diff options
Diffstat (limited to 'devtools')
179 files changed, 4393 insertions, 1081 deletions
diff --git a/devtools/bootstrap.js b/devtools/bootstrap.js index bedca0c78..3c154fef4 100644 --- a/devtools/bootstrap.js +++ b/devtools/bootstrap.js @@ -187,7 +187,7 @@ function reload(event) { // HUDService is going to close it on unload. // Instead we have to manually toggle it. if (reopenBrowserConsole) { - let HUDService = devtools.require("devtools/client/webconsole/hudservice"); + let {HUDService} = devtools.require("devtools/client/webconsole/hudservice"); HUDService.toggleBrowserConsole(); } diff --git a/devtools/client/canvasdebugger/test/browser_profiling-canvas.js b/devtools/client/canvasdebugger/test/browser_profiling-canvas.js index ede8a4dbf..75f8da4f3 100644..100755 --- a/devtools/client/canvasdebugger/test/browser_profiling-canvas.js +++ b/devtools/client/canvasdebugger/test/browser_profiling-canvas.js @@ -37,7 +37,7 @@ function* ifTestingSupported() { for (let i = 0; i < functionCalls.length - 1; i += 2) { ok(functionCalls[i].timestamp > 0, "The timestamp of the called function is larger than 0."); ok(functionCalls[i].timestamp < currentTime, "The timestamp has been minus the frame start time."); - ok(functionCalls[i + 1].timestamp > functionCalls[i].timestamp, "The timestamp of the called function is correct."); + ok(functionCalls[i + 1].timestamp >= functionCalls[i].timestamp, "The timestamp of the called function is correct."); } yield removeTab(target.tab); diff --git a/devtools/client/commandline/test/browser_cmd_commands.js b/devtools/client/commandline/test/browser_cmd_commands.js index 6c69034ec..78db77bfd 100644 --- a/devtools/client/commandline/test/browser_cmd_commands.js +++ b/devtools/client/commandline/test/browser_cmd_commands.js @@ -4,7 +4,7 @@ // Test various GCLI commands const TEST_URI = "data:text/html;charset=utf-8,gcli-commands"; -const HUDService = require("devtools/client/webconsole/hudservice"); +const {HUDService} = require("devtools/client/webconsole/hudservice"); // Use the old webconsole since pprint isn't working on new one (Bug 1304794) Services.prefs.setBoolPref("devtools.webconsole.new-frontend-enabled", false); diff --git a/devtools/client/commandline/test/browser_cmd_csscoverage_startstop.js b/devtools/client/commandline/test/browser_cmd_csscoverage_startstop.js index 2bdb86d86..c48136989 100644 --- a/devtools/client/commandline/test/browser_cmd_csscoverage_startstop.js +++ b/devtools/client/commandline/test/browser_cmd_csscoverage_startstop.js @@ -4,6 +4,7 @@ // Tests that the addon commands works as they should const csscoverage = require("devtools/shared/fronts/csscoverage"); +const {gDevTools} = require("devtools/client/framework/devtools"); const PAGE_1 = TEST_BASE_HTTPS + "browser_cmd_csscoverage_page1.html"; const PAGE_2 = TEST_BASE_HTTPS + "browser_cmd_csscoverage_page2.html"; diff --git a/devtools/client/debugger/test/mochitest/browser_dbg_closure-inspection.js b/devtools/client/debugger/test/mochitest/browser_dbg_closure-inspection.js index 739d3b2a7..b2fa66872 100644 --- a/devtools/client/debugger/test/mochitest/browser_dbg_closure-inspection.js +++ b/devtools/client/debugger/test/mochitest/browser_dbg_closure-inspection.js @@ -53,13 +53,13 @@ function test() { .getAttribute("value"), "getName", "Should have the right property name for 'getName' in person."); is(personNode.get("getName").target.querySelector(".value") - .getAttribute("value"), "_pfactory/<.getName()", + .getAttribute("value"), "getName()", "'getName' in person should have the right value."); is(personNode.get("getFoo").target.querySelector(".name") .getAttribute("value"), "getFoo", "Should have the right property name for 'getFoo' in person."); is(personNode.get("getFoo").target.querySelector(".value") - .getAttribute("value"), "_pfactory/<.getFoo()", + .getAttribute("value"), "getFoo()", "'getFoo' in person should have the right value."); // Expand the function nodes. This causes their properties to be diff --git a/devtools/client/devtools-startup.js b/devtools/client/devtools-startup.js index 2271dd790..4a385a9d5 100644 --- a/devtools/client/devtools-startup.js +++ b/devtools/client/devtools-startup.js @@ -25,7 +25,7 @@ function DevToolsStartup() {} DevToolsStartup.prototype = { handle: function (cmdLine) { - let consoleFlag = cmdLine.handleFlag("jsconsole", false); + let consoleFlag = cmdLine.handleFlag("browserconsole", false); let debuggerFlag = cmdLine.handleFlag("jsdebugger", false); let devtoolsFlag = cmdLine.handleFlag("devtools", false); @@ -75,9 +75,9 @@ DevToolsStartup.prototype = { this.initDevTools(); let { require } = Cu.import("resource://devtools/shared/Loader.jsm", {}); - let hudservice = require("devtools/client/webconsole/hudservice"); + let { HUDService } = require("devtools/client/webconsole/hudservice"); let { console } = Cu.import("resource://gre/modules/Console.jsm", {}); - hudservice.toggleBrowserConsole().then(null, console.error); + HUDService.toggleBrowserConsole().then(null, console.error); } else { // the Browser Console was already open window.focus(); @@ -104,12 +104,14 @@ DevToolsStartup.prototype = { return Services.prefs.getBoolPref(pref); }); } catch (ex) { + let { console } = Cu.import("resource://gre/modules/Console.jsm", {}); console.error(ex); return false; } if (!remoteDebuggingEnabled) { let errorMsg = "Could not run chrome debugger! You need the following " + "prefs to be set to true: " + kDebuggerPrefs.join(", "); + let { console } = Cu.import("resource://gre/modules/Console.jsm", {}); console.error(new Error(errorMsg)); // Dump as well, as we're doing this from a commandline, make sure people // don't miss it: @@ -190,7 +192,10 @@ DevToolsStartup.prototype = { listener.open(); dump("Started debugger server on " + portOrPath + "\n"); } catch (e) { - dump("Unable to start debugger server on " + portOrPath + ": " + e); + let _error = "Unable to start debugger server on " + portOrPath + ": " + + e; + Cu.reportError(_error); + dump(_error + "\n"); } if (cmdLine.state == Ci.nsICommandLine.STATE_REMOTE_AUTO) { @@ -199,12 +204,14 @@ DevToolsStartup.prototype = { }, /* eslint-disable max-len */ - helpInfo: " --jsconsole Open the Browser Console.\n" + - " --jsdebugger Open the Browser Toolbox.\n" + - " --devtools Open DevTools on initial load.\n" + - " --start-debugger-server [ws:][ <port> | <path> ] Start the debugger server on\n" + - " a TCP port or Unix domain socket path. Defaults to TCP port\n" + - " 6000. Use WebSocket protocol if ws: prefix is specified.\n", + helpInfo: " --browserconsole Open the Browser Console.\n" + + " --jsdebugger Open the Browser Toolbox.\n" + + " --devtools Open DevTools on initial load.\n" + + " --start-debugger-server [ws:][<port>|<path>] Start the debugger server on\n" + + " a TCP port or Unix domain socket path.\n" + + " Defaults to TCP port 6000.\n" + + " Use WebSocket protocol if ws: prefix\n" + + " is specified.\n", /* eslint-disable max-len */ classID: Components.ID("{9e9a9283-0ce9-4e4a-8f1c-ba129a032c32}"), diff --git a/devtools/client/framework/browser-menus.js b/devtools/client/framework/browser-menus.js index 3d6c4def6..e62afddac 100644 --- a/devtools/client/framework/browser-menus.js +++ b/devtools/client/framework/browser-menus.js @@ -133,10 +133,11 @@ function attachKeybindingsToBrowser(doc, keys) { */ function createToolMenuElements(toolDefinition, doc) { let id = toolDefinition.id; + let appmenuId = "appmenuitem_" + id; let menuId = "menuitem_" + id; // Prevent multiple entries for the same tool. - if (doc.getElementById(menuId)) { + if (doc.getElementById(appmenuId) || doc.getElementById(menuId)) { return; } @@ -156,6 +157,13 @@ function createToolMenuElements(toolDefinition, doc) { }); } + let appmenuitem = createMenuItem({ + doc, + id: "appmenuitem_" + id, + label: toolDefinition.menuLabel || toolDefinition.label, + accesskey: null + }); + let menuitem = createMenuItem({ doc, id: "menuitem_" + id, @@ -166,10 +174,12 @@ function createToolMenuElements(toolDefinition, doc) { // Refer to the key in order to display the key shortcut at menu ends menuitem.setAttribute("key", key.id); } + appmenuitem.addEventListener("command", oncommand); menuitem.addEventListener("command", oncommand); return { key, + appmenuitem, menuitem }; } @@ -186,22 +196,34 @@ function createToolMenuElements(toolDefinition, doc) { * The tool definition after which the tool menu item is to be added. */ function insertToolMenuElements(doc, toolDefinition, prevDef) { - let { key, menuitem } = createToolMenuElements(toolDefinition, doc); + let { key, appmenuitem, menuitem } = createToolMenuElements(toolDefinition, doc); if (key) { attachKeybindingsToBrowser(doc, key); } - let ref; + let amp; + if (prevDef) { + let appmenuitem = doc.getElementById("appmenuitem_" + prevDef.id); + amp = appmenuitem && appmenuitem.nextSibling ? appmenuitem.nextSibling : null; + } else { + amp = doc.getElementById("appmenu_devtools_separator"); + } + + if (amp) { + amp.parentNode.insertBefore(appmenuitem, amp); + } + + let mp; if (prevDef) { let menuitem = doc.getElementById("menuitem_" + prevDef.id); - ref = menuitem && menuitem.nextSibling ? menuitem.nextSibling : null; + mp = menuitem && menuitem.nextSibling ? menuitem.nextSibling : null; } else { - ref = doc.getElementById("menu_devtools_separator"); + mp = doc.getElementById("menu_devtools_separator"); } - if (ref) { - ref.parentNode.insertBefore(menuitem, ref); + if (mp) { + mp.parentNode.insertBefore(menuitem, mp); } } exports.insertToolMenuElements = insertToolMenuElements; @@ -220,6 +242,11 @@ function removeToolFromMenu(toolId, doc) { key.remove(); } + let appmenuitem = doc.getElementById("appmenuitem_" + toolId); + if (appmenuitem) { + appmenuitem.remove(); + } + let menuitem = doc.getElementById("menuitem_" + toolId); if (menuitem) { menuitem.remove(); @@ -235,6 +262,7 @@ exports.removeToolFromMenu = removeToolFromMenu; */ function addAllToolsToMenu(doc) { let fragKeys = doc.createDocumentFragment(); + let fragAppMenuItems = doc.createDocumentFragment(); let fragMenuItems = doc.createDocumentFragment(); for (let toolDefinition of gDevTools.getToolDefinitionArray()) { @@ -251,11 +279,17 @@ function addAllToolsToMenu(doc) { if (elements.key) { fragKeys.appendChild(elements.key); } + fragAppMenuItems.appendChild(elements.appmenuitem); fragMenuItems.appendChild(elements.menuitem); } attachKeybindingsToBrowser(doc, fragKeys); + let amps = doc.getElementById("appmenu_devtools_separator"); + if (amps) { + amps.parentNode.insertBefore(fragAppMenuItems, amps); + } + let mps = doc.getElementById("menu_devtools_separator"); if (mps) { mps.parentNode.insertBefore(fragMenuItems, mps); @@ -270,18 +304,29 @@ function addAllToolsToMenu(doc) { */ function addTopLevelItems(doc) { let keys = doc.createDocumentFragment(); + let appmenuItems = doc.createDocumentFragment(); let menuItems = doc.createDocumentFragment(); let { menuitems } = require("../menus"); for (let item of menuitems) { if (item.separator) { + let appseparator = doc.createElement("menuseparator"); + appseparator.id = "app" + item.id; let separator = doc.createElement("menuseparator"); separator.id = item.id; + appmenuItems.appendChild(appseparator); menuItems.appendChild(separator); } else { let { id, l10nKey } = item; // Create a <menuitem> + let appmenuitem = createMenuItem({ + doc, + id: "app" + id, + label: l10n(l10nKey + ".label"), + accesskey: null, + isCheckbox: item.checkbox + }); let menuitem = createMenuItem({ doc, id, @@ -289,7 +334,9 @@ function addTopLevelItems(doc) { accesskey: l10n(l10nKey + ".accesskey"), isCheckbox: item.checkbox }); + appmenuitem.addEventListener("command", item.oncommand); menuitem.addEventListener("command", item.oncommand); + appmenuItems.appendChild(appmenuitem); menuItems.appendChild(menuitem); if (item.key && l10nKey) { @@ -330,6 +377,9 @@ function addTopLevelItems(doc) { for (let node of keys.children) { nodes.push(node); } + for (let node of appmenuItems.children) { + nodes.push(node); + } for (let node of menuItems.children) { nodes.push(node); } @@ -337,15 +387,33 @@ function addTopLevelItems(doc) { attachKeybindingsToBrowser(doc, keys); + // There are hardcoded menu items in the Web Developer menus plus it is a + // location of menu items via overlays from extensions so we want to make + // sure the last seperator and the "Get More Tools..." items are last. + // This will emulate the behavior when devtools menu items were actually + // physically present in browser.xul + + // Tools > Web Developer let menu = doc.getElementById("menuWebDeveloperPopup"); - menu.appendChild(menuItems); - - // There is still "Page Source" menuitem hardcoded into browser.xul. Instead - // of manually inserting everything around it, move it to the expected - // position. - let pageSource = doc.getElementById("menu_pageSource"); - let endSeparator = doc.getElementById("devToolsEndSeparator"); - menu.insertBefore(pageSource, endSeparator); + // Insert the Devtools Menu Items before everything else + menu.insertBefore(menuItems, menu.firstChild); + // Move the devtools last seperator and Get More Tools menu items to the bottom + let menu_endSeparator = doc.getElementById("menu_devToolsEndSeparator"); + let menu_getMoreDevtools = doc.getElementById("menu_getMoreDevtools"); + menu.insertBefore(menu_getMoreDevtools, null); + menu.insertBefore(menu_endSeparator, menu_getMoreDevtools); + + // Application Menu > Web Developer (If existant) + let appmenu = doc.getElementById("appmenu_webDeveloper_popup"); + if (appmenu) { + // Insert the Devtools Menu Items after the hardcoded idless seperator + appmenu.insertBefore(appmenuItems, appmenu.childNodes[2].nextSibling); + // Move the devtools last seperator and Get More Tools menu items to the bottom + let appmenu_endSeparator = doc.getElementById("appmenu_devToolsEndSeparator"); + let appmenu_getMoreDevtools = doc.getElementById("appmenu_getMoreDevtools"); + appmenu.insertBefore(appmenu_getMoreDevtools, null); + appmenu.insertBefore(appmenu_endSeparator, appmenu_getMoreDevtools); + } } /** diff --git a/devtools/client/framework/devtools-browser.js b/devtools/client/framework/devtools-browser.js index b9f4d92ba..f032f82aa 100644 --- a/devtools/client/framework/devtools-browser.js +++ b/devtools/client/framework/devtools-browser.js @@ -8,7 +8,7 @@ * This is the main module loaded in Firefox desktop that handles browser * windows and coordinates devtools around each window. * - * This module is loaded lazily by devtools-clhandler.js, once the first + * This module is loaded lazily by devtools-startup.js, once the first * browser window is ready (i.e. fired browser-delayed-startup-finished event) **/ @@ -27,8 +27,10 @@ loader.lazyRequireGetter(this, "DebuggerServer", "devtools/server/main", true); loader.lazyRequireGetter(this, "DebuggerClient", "devtools/shared/client/main", true); loader.lazyRequireGetter(this, "BrowserMenus", "devtools/client/framework/browser-menus"); -loader.lazyImporter(this, "CustomizableUI", "resource:///modules/CustomizableUI.jsm"); loader.lazyImporter(this, "AppConstants", "resource://gre/modules/AppConstants.jsm"); +#ifdef MC_BASILISK +loader.lazyImporter(this, "CustomizableUI", "resource:///modules/CustomizableUI.jsm"); +#endif const {LocalizationHelper} = require("devtools/shared/l10n"); const L10N = new LocalizationHelper("devtools/client/locales/toolbox.properties"); @@ -85,6 +87,9 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { function toggleMenuItem(id, isEnabled) { let cmd = doc.getElementById(id); + if (!cmd) { + return; + } if (isEnabled) { cmd.removeAttribute("disabled"); cmd.removeAttribute("hidden"); @@ -94,22 +99,39 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { } } + let idEls = []; + // Enable developer toolbar? let devToolbarEnabled = Services.prefs.getBoolPref("devtools.toolbar.enabled"); - toggleMenuItem("menu_devToolbar", devToolbarEnabled); - let focusEl = doc.getElementById("menu_devToolbar"); - if (devToolbarEnabled) { - focusEl.removeAttribute("disabled"); - } else { - focusEl.setAttribute("disabled", "true"); - } + idEls = [ + "appmenu_devToolbar", + "menu_devToolbar" + ]; + idEls.forEach(function (idEl) { + toggleMenuItem(idEl, devToolbarEnabled); + let focusEl = doc.getElementById(idEl); + if (!focusEl) { + return; + } + if (devToolbarEnabled) { + focusEl.removeAttribute("disabled"); + } else { + focusEl.setAttribute("disabled", "true"); + } + }); if (devToolbarEnabled && Services.prefs.getBoolPref("devtools.toolbar.visible")) { win.DeveloperToolbar.show(false).catch(console.error); } // Enable WebIDE? let webIDEEnabled = Services.prefs.getBoolPref("devtools.webide.enabled"); - toggleMenuItem("menu_webide", webIDEEnabled); + idEls = [ + "appmenu_webide", + "menu_webide" + ]; + idEls.forEach(function (idEl) { + toggleMenuItem(idEl, webIDEEnabled); + }); let showWebIDEWidget = Services.prefs.getBoolPref("devtools.webide.widget.enabled"); if (webIDEEnabled && showWebIDEWidget) { @@ -122,11 +144,29 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { let chromeEnabled = Services.prefs.getBoolPref("devtools.chrome.enabled"); let devtoolsRemoteEnabled = Services.prefs.getBoolPref("devtools.debugger.remote-enabled"); let remoteEnabled = chromeEnabled && devtoolsRemoteEnabled; - toggleMenuItem("menu_browserToolbox", remoteEnabled); - toggleMenuItem("menu_browserContentToolbox", remoteEnabled && win.gMultiProcessBrowser); + idEls = [ + "appmenu_browserToolbox", + "menu_browserToolbox" + ]; + idEls.forEach(function (idEl) { + toggleMenuItem(idEl, remoteEnabled); + }); + idEls = [ + "appmenu_browserContentToolbox", + "menu_browserContentToolbox" + ]; + idEls.forEach(function (idEl) { + toggleMenuItem(idEl, remoteEnabled && win.gMultiProcessBrowser); + }); // Enable DevTools connection screen, if the preference allows this. - toggleMenuItem("menu_devtools_connect", devtoolsRemoteEnabled); + idEls = [ + "appmenu_devtools_connect", + "menu_devtools_connect" + ]; + idEls.forEach(function (idEl) { + toggleMenuItem(idEl, devtoolsRemoteEnabled); + }); }, observe: function (subject, topic, prefName) { @@ -295,6 +335,7 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { * Install Developer widget */ installDeveloperWidget: function () { +#ifdef MC_BASILISK let id = "developer-button"; let widget = CustomizableUI.getWidget(id); if (widget && widget.provider == CustomizableUI.PROVIDER_API) { @@ -343,6 +384,9 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { doc.getElementById("PanelUI-multiView").appendChild(view); } }); +#else + return; +#endif }, /** @@ -350,6 +394,7 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { */ // Used by itself installWebIDEWidget: function () { +#ifdef MC_BASILISK if (this.isWebIDEWidgetInstalled()) { return; } @@ -371,11 +416,18 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { gDevToolsBrowser.openWebIDE(); } }); +#else + return; +#endif }, isWebIDEWidgetInstalled: function () { +#ifdef MC_BASILISK let widgetWrapper = CustomizableUI.getWidget("webide-button"); return !!(widgetWrapper && widgetWrapper.provider == CustomizableUI.PROVIDER_API); +#else + return false; +#endif }, /** @@ -387,10 +439,14 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { * Uninstall WebIDE widget */ uninstallWebIDEWidget: function () { +#ifdef MC_BASILISK if (this.isWebIDEWidgetInstalled()) { CustomizableUI.removeWidgetFromArea("webide-button"); } CustomizableUI.destroyWidget("webide-button"); +#else + return; +#endif }, /** @@ -398,7 +454,11 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { */ // Used by webide.js moveWebIDEWidgetInNavbar: function () { +#ifdef MC_BASILISK CustomizableUI.addWidgetToArea("webide-button", CustomizableUI.AREA_NAVBAR); +#else + return; +#endif }, /** @@ -591,12 +651,23 @@ var gDevToolsBrowser = exports.gDevToolsBrowser = { let hasToolbox = gDevToolsBrowser.hasToolboxOpened(win); - let menu = win.document.getElementById("menu_devToolbox"); - if (hasToolbox) { - menu.setAttribute("checked", "true"); - } else { - menu.removeAttribute("checked"); - } + let idEls = []; + + idEls = [ + "appmenu_devToolbox", + "menu_devToolbox" + ]; + idEls.forEach(function (idEl) { + let menu = win.document.getElementById(idEl); + if (!menu) { + return; + } + if (hasToolbox) { + menu.setAttribute("checked", "true"); + } else { + menu.removeAttribute("checked"); + } + }); } }, diff --git a/devtools/client/framework/moz.build b/devtools/client/framework/moz.build index 7b28b4b9e..407e21f8b 100644 --- a/devtools/client/framework/moz.build +++ b/devtools/client/framework/moz.build @@ -13,7 +13,6 @@ DevToolsModules( 'about-devtools-toolbox.js', 'attach-thread.js', 'browser-menus.js', - 'devtools-browser.js', 'devtools.js', 'gDevTools.jsm', 'location-store.js', @@ -31,3 +30,7 @@ DevToolsModules( 'toolbox.js', 'ToolboxProcess.jsm', ) + +FINAL_TARGET_PP_FILES.chrome.devtools.modules.devtools.client.framework += [ + 'devtools-browser.js', +] diff --git a/devtools/client/framework/test/browser_keybindings_01.js b/devtools/client/framework/test/browser_keybindings_01.js index 4e4effb07..134fb127c 100644 --- a/devtools/client/framework/test/browser_keybindings_01.js +++ b/devtools/client/framework/test/browser_keybindings_01.js @@ -8,6 +8,9 @@ const TEST_URL = "data:text/html,<html><head><title>Test for the " + "highlighter keybindings</title></head><body>" + "<h1>Keybindings!</h1></body></html>" + +const {gDevToolsBrowser} = require("devtools/client/framework/devtools-browser"); + function test() { waitForExplicitFinish(); diff --git a/devtools/client/framework/toolbox.js b/devtools/client/framework/toolbox.js index 82d5d2915..926e30647 100644 --- a/devtools/client/framework/toolbox.js +++ b/devtools/client/framework/toolbox.js @@ -22,7 +22,7 @@ var {Task} = require("devtools/shared/task"); var {gDevTools} = require("devtools/client/framework/devtools"); var EventEmitter = require("devtools/shared/event-emitter"); var Telemetry = require("devtools/client/shared/telemetry"); -var HUDService = require("devtools/client/webconsole/hudservice"); +var { HUDService } = require("devtools/client/webconsole/hudservice"); var viewSource = require("devtools/client/shared/view-source"); var { attachThread, detachThread } = require("./attach-thread"); var Menu = require("devtools/client/framework/menu"); diff --git a/devtools/client/inspector/inspector.js b/devtools/client/inspector/inspector.js index c056c213f..d0458fc1f 100644 --- a/devtools/client/inspector/inspector.js +++ b/devtools/client/inspector/inspector.js @@ -169,6 +169,10 @@ Inspector.prototype = { return this._target.client.traits.getUniqueSelector; }, + get canGetCssPath() { + return this._target.client.traits.getCssPath; + }, + get canGetUsedFontFaces() { return this._target.client.traits.getUsedFontFaces; }, @@ -1074,6 +1078,15 @@ Inspector.prototype = { click: () => this.copyUniqueSelector(), })); copySubmenu.append(new MenuItem({ + id: "node-menu-copycsspath", + label: INSPECTOR_L10N.getStr("inspectorCopyCSSPath.label"), + accesskey: + INSPECTOR_L10N.getStr("inspectorCopyCSSPath.accesskey"), + disabled: !isSelectionElement, + hidden: !this.canGetCssPath, + click: () => this.copyCssPath(), + })); + copySubmenu.append(new MenuItem({ id: "node-menu-copyimagedatauri", label: INSPECTOR_L10N.getStr("inspectorImageDataUri.label"), disabled: !isSelectionElement || !markupContainer || @@ -1677,9 +1690,24 @@ Inspector.prototype = { return; } - this.selection.nodeFront.getUniqueSelector().then((selector) => { + this.telemetry.toolOpened("copyuniquecssselector"); + this.selection.nodeFront.getUniqueSelector().then(selector => { clipboardHelper.copyString(selector); - }).then(null, console.error); + }).catch(e => console.error); + }, + + /** + * Copy the full CSS Path of the selected Node to the clipboard. + */ + copyCssPath: function () { + if (!this.selection.isNode()) { + return; + } + + this.telemetry.toolOpened("copyfullcssselector"); + this.selection.nodeFront.getCssPath().then(path => { + clipboardHelper.copyString(path); + }).catch(e => console.error); }, /** diff --git a/devtools/client/inspector/markup/test/browser_markup_events3.js b/devtools/client/inspector/markup/test/browser_markup_events3.js index a9dc2a499..a38e9a011 100644 --- a/devtools/client/inspector/markup/test/browser_markup_events3.js +++ b/devtools/client/inspector/markup/test/browser_markup_events3.js @@ -115,7 +115,7 @@ const TEST_DATA = [ // eslint-disable-line expected: [ { type: "click", - filename: TEST_URL + ":1", + filename: TEST_URL + ":0", attributes: [ "Bubbling", "DOM2" @@ -129,7 +129,7 @@ const TEST_DATA = [ // eslint-disable-line expected: [ { type: "click", - filename: TEST_URL + ":1", + filename: TEST_URL + ":0", attributes: [ "Bubbling", "DOM2" diff --git a/devtools/client/inspector/markup/views/markup-container.js b/devtools/client/inspector/markup/views/markup-container.js index b54157242..44768b46c 100644 --- a/devtools/client/inspector/markup/views/markup-container.js +++ b/devtools/client/inspector/markup/views/markup-container.js @@ -211,10 +211,12 @@ MarkupContainer.prototype = { } if (this.showExpander) { + this.elt.classList.add("expandable"); this.expander.style.visibility = "visible"; // Update accessibility expanded state. this.tagLine.setAttribute("aria-expanded", this.expanded); } else { + this.elt.classList.remove("expandable"); this.expander.style.visibility = "hidden"; // No need for accessible expanded state indicator when expander is not // shown. diff --git a/devtools/client/inspector/rules/models/rule.js b/devtools/client/inspector/rules/models/rule.js index 1a3fa057a..4c978cb58 100644 --- a/devtools/client/inspector/rules/models/rule.js +++ b/devtools/client/inspector/rules/models/rule.js @@ -140,11 +140,18 @@ Rule.prototype = { line, mediaText}) => { let mediaString = mediaText ? " @" + mediaText : ""; let linePart = line > 0 ? (":" + line) : ""; + let decodedHref = href; + + if (decodedHref) { + try { + decodedHref = decodeURIComponent(href); + } catch (e) {} + } let sourceStrings = { - full: (href || CssLogic.l10n("rule.sourceInline")) + linePart + + full: (decodedHref || CssLogic.l10n("rule.sourceInline")) + linePart + mediaString, - short: CssLogic.shortSource({href: href}) + linePart + mediaString + short: CssLogic.shortSource({href: decodedHref}) + linePart + mediaString }; return sourceStrings; diff --git a/devtools/client/inspector/rules/test/browser_rules_style-editor-link.js b/devtools/client/inspector/rules/test/browser_rules_style-editor-link.js index 927deb8ce..6a4fd1d66 100644 --- a/devtools/client/inspector/rules/test/browser_rules_style-editor-link.js +++ b/devtools/client/inspector/rules/test/browser_rules_style-editor-link.js @@ -10,10 +10,12 @@ thisTestLeaksUncaughtRejectionsAndShouldBeFixed("Error: Unknown sheet source"); // Test the links from the rule-view to the styleeditor -const STYLESHEET_URL = "data:text/css," + encodeURIComponent( - ["#first {", - "color: blue", - "}"].join("\n")); +const STYLESHEET_DATA_URL_CONTENTS = ["#first {", + "color: blue", + "}"].join("\n"); +const STYLESHEET_DATA_URL = + `data:text/css,${encodeURIComponent(STYLESHEET_DATA_URL_CONTENTS)}`; +const STYLESHEET_DECODED_DATA_URL = `data:text/css,${STYLESHEET_DATA_URL_CONTENTS}`; const EXTERNAL_STYLESHEET_FILE_NAME = "doc_style_editor_link.css"; const EXTERNAL_STYLESHEET_URL = URL_ROOT + EXTERNAL_STYLESHEET_FILE_NAME; @@ -31,7 +33,7 @@ const DOCUMENT_URL = "data:text/html;charset=utf-8," + encodeURIComponent(` <style> div { font-weight: bold; } </style> - <link rel="stylesheet" type="text/css" href="${STYLESHEET_URL}"> + <link rel="stylesheet" type="text/css" href="${STYLESHEET_DATA_URL}"> <link rel="stylesheet" type="text/css" href="${EXTERNAL_STYLESHEET_URL}"> </head> <body> @@ -178,15 +180,28 @@ function* testDisabledStyleEditor(view, toolbox) { } function testRuleViewLinkLabel(view) { - let link = getRuleViewLinkByIndex(view, 2); + info("Checking the data URL link label"); + + let link = getRuleViewLinkByIndex(view, 1); let labelElem = link.querySelector(".ruleview-rule-source-label"); let value = labelElem.textContent; let tooltipText = labelElem.getAttribute("title"); - is(value, EXTERNAL_STYLESHEET_FILE_NAME + ":1", - "rule view stylesheet display value matches filename and line number"); - is(tooltipText, EXTERNAL_STYLESHEET_URL + ":1", - "rule view stylesheet tooltip text matches the full URI path"); + is(value, `${STYLESHEET_DATA_URL_CONTENTS}:1`, + "Rule view data URL stylesheet display value matches contents"); + is(tooltipText, `${STYLESHEET_DECODED_DATA_URL}:1`, + "Rule view data URL stylesheet tooltip text matches the full URI path"); + + info("Checking the external link label"); + link = getRuleViewLinkByIndex(view, 2); + labelElem = link.querySelector(".ruleview-rule-source-label"); + value = labelElem.textContent; + tooltipText = labelElem.getAttribute("title"); + + is(value, `${EXTERNAL_STYLESHEET_FILE_NAME}:1`, + "Rule view external stylesheet display value matches filename and line number"); + is(tooltipText, `${EXTERNAL_STYLESHEET_URL}:1`, + "Rule view external stylesheet tooltip text matches the full URI path"); } function testUnselectableRuleViewLink(view, index) { diff --git a/devtools/client/inspector/shared/tooltips-overlay.js b/devtools/client/inspector/shared/tooltips-overlay.js index 8a02d7e3d..336dae05b 100644 --- a/devtools/client/inspector/shared/tooltips-overlay.js +++ b/devtools/client/inspector/shared/tooltips-overlay.js @@ -88,7 +88,9 @@ TooltipsOverlay.prototype = { if (this.isRuleView) { // Color picker tooltip - this.colorPicker = new SwatchColorPickerTooltip(toolbox.doc, this.view.inspector); + this.colorPicker = new SwatchColorPickerTooltip(toolbox.doc, + this.view.inspector, + this._cssProperties); // Cubic bezier tooltip this.cubicBezier = new SwatchCubicBezierTooltip(toolbox.doc); // Filter editor tooltip diff --git a/devtools/client/inspector/test/browser.ini b/devtools/client/inspector/test/browser.ini index 65ad71c0c..499df25f0 100644 --- a/devtools/client/inspector/test/browser.ini +++ b/devtools/client/inspector/test/browser.ini @@ -113,6 +113,7 @@ subsuite = clipboard [browser_inspector_infobar_01.js] [browser_inspector_infobar_02.js] [browser_inspector_infobar_03.js] +[browser_inspector_infobar_04.js] [browser_inspector_infobar_textnode.js] [browser_inspector_initialization.js] skip-if = (e10s && debug) # Bug 1250058 - Docshell leak on debug e10s diff --git a/devtools/client/inspector/test/browser_inspector_infobar_04.js b/devtools/client/inspector/test/browser_inspector_infobar_04.js new file mode 100644 index 000000000..f1b9eca49 --- /dev/null +++ b/devtools/client/inspector/test/browser_inspector_infobar_04.js @@ -0,0 +1,38 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +"use strict"; + +// Check the position and text content of the highlighter nodeinfo bar under page zoom. + +const TEST_URI = URL_ROOT + "doc_inspector_infobar_01.html"; + +add_task(function* () { + let {inspector, testActor} = yield openInspectorForURL(TEST_URI); + let testData = { + selector: "#top", + dims: "500" + " \u00D7 " + "100" + }; + + yield testInfobar(testData, inspector, testActor); + info("Change zoom page to level 2."); + yield testActor.zoomPageTo(2); + info("Testing again the infobar after zoom."); + yield testInfobar(testData, inspector, testActor); +}); + +function* testInfobar(test, inspector, testActor) { + info(`Testing ${test.selector}`); + + yield selectAndHighlightNode(test.selector, inspector); + + // Ensure the node is the correct one. + let id = yield testActor.getHighlighterNodeTextContent( + "box-model-infobar-id"); + is(id, test.selector, `Node ${test.selector} selected.`); + + let dims = yield testActor.getHighlighterNodeTextContent( + "box-model-infobar-dimensions"); + is(dims, test.dims, "Node's infobar displays the right dimensions."); +} diff --git a/devtools/client/inspector/test/browser_inspector_menu-01-sensitivity.js b/devtools/client/inspector/test/browser_inspector_menu-01-sensitivity.js index 59dbbbcc0..052e9da68 100644 --- a/devtools/client/inspector/test/browser_inspector_menu-01-sensitivity.js +++ b/devtools/client/inspector/test/browser_inspector_menu-01-sensitivity.js @@ -26,6 +26,7 @@ const ALL_MENU_ITEMS = [ "node-menu-copyinner", "node-menu-copyouter", "node-menu-copyuniqueselector", + "node-menu-copycsspath", "node-menu-copyimagedatauri", "node-menu-delete", "node-menu-pseudo-hover", diff --git a/devtools/client/inspector/test/browser_inspector_menu-02-copy-items.js b/devtools/client/inspector/test/browser_inspector_menu-02-copy-items.js index 0c96e9bbe..57a5dbaa0 100644 --- a/devtools/client/inspector/test/browser_inspector_menu-02-copy-items.js +++ b/devtools/client/inspector/test/browser_inspector_menu-02-copy-items.js @@ -26,6 +26,12 @@ const COPY_ITEMS_TEST_DATA = [ text: "body > div:nth-child(1) > p:nth-child(2)", }, { + desc: "copy css path", + id: "node-menu-copycsspath", + selector: "[data-id=\"copy\"]", + text: "html body div p", + }, + { desc: "copy image data uri", id: "node-menu-copyimagedatauri", selector: "#copyimage", diff --git a/devtools/client/locales/en-US/inspector.properties b/devtools/client/locales/en-US/inspector.properties index 4f4829678..252d72bfa 100644 --- a/devtools/client/locales/en-US/inspector.properties +++ b/devtools/client/locales/en-US/inspector.properties @@ -66,7 +66,7 @@ inspector.collapsePane=Collapse pane # inspector UI. inspector.expandPane=Expand pane -# LOCALIZATION NOTE (inspector.searchResultsCount): This is the label that +# LOCALIZATION NOTE (inspector.searchResultsCount2): This is the label that # will show up next to the inspector search box. %1$S is the current result # index and %2$S is the total number of search results. For example: "3 of 9". # This won't be visible until the search box is updated in Bug 835896. @@ -154,6 +154,12 @@ inspectorCopyOuterHTML.accesskey=O inspectorCopyCSSSelector.label=CSS Selector inspectorCopyCSSSelector.accesskey=S +# LOCALIZATION NOTE (inspectorCopyCSSPath.label): This is the label +# shown in the inspector contextual-menu for the item that lets users copy +# the full CSS path of the current node +inspectorCopyCSSPath.label=CSS Path +inspectorCopyCSSPath.accesskey=P + # LOCALIZATION NOTE (inspectorPasteOuterHTML.label): This is the label shown # in the inspector contextual-menu for the item that lets users paste outer # HTML in the current node diff --git a/devtools/client/locales/en-US/netmonitor.properties b/devtools/client/locales/en-US/netmonitor.properties index e6118ca9f..4926c234b 100644 --- a/devtools/client/locales/en-US/netmonitor.properties +++ b/devtools/client/locales/en-US/netmonitor.properties @@ -143,12 +143,17 @@ networkMenu.sortedDesc=Sorted descending # in the network table footer when there are no requests available. networkMenu.empty=No requests -# LOCALIZATION NOTE (networkMenu.summary): Semi-colon list of plural forms. +# LOCALIZATION NOTE (networkMenu.summary2): Semi-colon list of plural forms. # See: http://developer.mozilla.org/en/docs/Localization_and_Plurals # This label is displayed in the network table footer providing concise # information about all requests. Parameters: #1 is the number of requests, -# #2 is the size, #3 is the number of seconds. -networkMenu.summary=One request, #2 KB, #3 s;#1 requests, #2 KB, #3 s +# #2 is the size, #3 is the transferred size, #4 is the number of seconds. +networkMenu.summary2=One request, #2 KB (transferred: #3 KB), #4 s;#1 requests, #2 KB (transferred: #3 KB), #4 s + +# LOCALIZATION NOTE (networkMenu.timeS): This is the label displayed +# in the network table footer providing concise information about all requests. +# Events DOMContentLoaded and load - specifying the number of seconds. +networkMenu.timeS=%S s # LOCALIZATION NOTE (networkMenu.sizeB): This is the label displayed # in the network menu specifying the size of a request (in bytes). @@ -221,10 +226,22 @@ tableChart.unavailable=No data available # in pie or table charts specifying the size of a request (in kilobytes). charts.sizeKB=%S KB +# LOCALIZATION NOTE (charts.transferredSizeKB): This is the label displayed +# in pie or table charts specifying the size of a transferred request (in kilobytes). +charts.transferredSizeKB=%S KB + # LOCALIZATION NOTE (charts.totalS): This is the label displayed # in pie or table charts specifying the time for a request to finish (in seconds). charts.totalS=%S s +# LOCALIZATION NOTE (charts.totalSize): This is the label displayed +# in the performance analysis view for total requests size, in kilobytes. +charts.totalSize=Size: %S KB + +# LOCALIZATION NOTE (charts.totalTranferredSize): This is the label displayed +# in the performance analysis view for total transferred size, in kilobytes. +charts.totalTransferredSize=Transferred Size: %S KB + # LOCALIZATION NOTE (charts.cacheEnabled): This is the label displayed # in the performance analysis view for "cache enabled" charts. charts.cacheEnabled=Primed cache @@ -233,10 +250,6 @@ charts.cacheEnabled=Primed cache # in the performance analysis view for "cache disabled" charts. charts.cacheDisabled=Empty cache -# LOCALIZATION NOTE (charts.totalSize): This is the label displayed -# in the performance analysis view for total requests size, in kilobytes. -charts.totalSize=Size: %S KB - # LOCALIZATION NOTE (charts.totalSeconds): Semi-colon list of plural forms. # See: http://developer.mozilla.org/en/docs/Localization_and_Plurals # This is the label displayed in the performance analysis view for the @@ -251,6 +264,23 @@ charts.totalCached=Cached responses: %S # in the performance analysis view for total requests. charts.totalCount=Total requests: %S +# LOCALIZATION NOTE (charts.size): This is the label displayed +# in the header column in the performance analysis view for size of the request. +charts.size=Size + +# LOCALIZATION NOTE (charts.type): This is the label displayed +# in the header column in the performance analysis view for type of request. +charts.type=Type + +# LOCALIZATION NOTE (charts.transferred): This is the label displayed +# in the header column in the performance analysis view for transferred +# size of the request. +charts.transferred=Transferred + +# LOCALIZATION NOTE (charts.time): This is the label displayed +# in the header column in the performance analysis view for time of request. +charts.time=Time + # LOCALIZATION NOTE (netRequest.headers): A label used for Headers tab # This tab displays list of HTTP headers netRequest.headers=Headers @@ -556,6 +586,11 @@ netmonitor.timings.blocked=Blocked: # in a "dns" state. netmonitor.timings.dns=DNS resolution: +# LOCALIZATION NOTE (netmonitor.timings.ssl): This is the label displayed +# in the network details timings tab identifying the amount of time spent +# in a "tls" handshake state. +netmonitor.timings.ssl=TLS setup: + # LOCALIZATION NOTE (netmonitor.timings.connect): This is the label displayed # in the network details timings tab identifying the amount of time spent # in a "connect" state. @@ -592,6 +627,37 @@ netmonitor.security.protocolVersion=Protocol version: # in the security tab describing the cipher suite used to secure this connection. netmonitor.security.cipherSuite=Cipher suite: +# LOCALIZATION NOTE (netmonitor.security.keaGroup): This is the label displayed +# in the security tab describing the key exchange group suite used to secure +# this connection. +netmonitor.security.keaGroup=Key Exchange Group: + +# LOCALIZATION NOTE (netmonitor.security.keaGroup.none): This is the label +# displayed in the security tab describing the case when no group was used. +netmonitor.security.keaGroup.none=none + +# LOCALIZATION NOTE (netmonitor.security.keaGroup.custom): This is the label +# displayed in the security tab describing the case when a custom group was used. +netmonitor.security.keaGroup.custom=custom + +# LOCALIZATION NOTE (netmonitor.security.keaGroup.unknown): This is the value +# displayed in the security tab describing an unknown group. +netmonitor.security.keaGroup.unknown=unknown group + +# LOCALIZATION NOTE (netmonitor.security.signatureScheme): This is the label +# displayed in the security tab describing the signature scheme used by for +# the server certificate in this connection. +netmonitor.security.signatureScheme=Signature Scheme: + +# LOCALIZATION NOTE (netmonitor.security.signatureScheme.none): This is the +# label displayed in the security tab describing the case when no signature +# was used. +netmonitor.security.signatureScheme.none=none + +# LOCALIZATION NOTE (netmonitor.security.signatureScheme.unknown): This is the +# value displayed in the security tab describing an unknown signature scheme. +netmonitor.security.signatureScheme.unknown=unknown signature scheme + # LOCALIZATION NOTE (netmonitor.security.hsts): This is the label displayed # in the security tab describing the usage of HTTP Strict Transport Security. netmonitor.security.hsts=HTTP Strict Transport Security: diff --git a/devtools/client/locales/en-US/storage.dtd b/devtools/client/locales/en-US/storage.dtd index 211c79436..adfc03183 100644 --- a/devtools/client/locales/en-US/storage.dtd +++ b/devtools/client/locales/en-US/storage.dtd @@ -9,3 +9,6 @@ <!-- LOCALIZATION NOTE : Label of popup menu action to delete all storage items. --> <!ENTITY storage.popupMenu.deleteAllLabel "Delete All"> + +<!-- LOCALIZATION NOTE : Label of popup menu action to delete all session cookies. --> +<!ENTITY storage.popupMenu.deleteAllSessionCookiesLabel "Delete All Session Cookies"> diff --git a/devtools/client/locales/en-US/storage.properties b/devtools/client/locales/en-US/storage.properties index 1eeb88ff9..4719520bd 100644 --- a/devtools/client/locales/en-US/storage.properties +++ b/devtools/client/locales/en-US/storage.properties @@ -35,6 +35,7 @@ tree.labels.Cache=Cache Storage # LOCALIZATION NOTE (table.headers.*.*): # These strings are the header names of the columns in the Storage Table for # each type of storage available through the Storage Tree to the side. +table.headers.cookies.uniqueKey=Unique key table.headers.cookies.name=Name table.headers.cookies.path=Path table.headers.cookies.host=Domain @@ -52,14 +53,16 @@ table.headers.sessionStorage.value=Value table.headers.Cache.url=URL table.headers.Cache.status=Status +table.headers.indexedDB.uniqueKey=Unique key table.headers.indexedDB.name=Key table.headers.indexedDB.db=Database Name +table.headers.indexedDB.storage=Storage table.headers.indexedDB.objectStore=Object Store Name table.headers.indexedDB.value=Value table.headers.indexedDB.origin=Origin table.headers.indexedDB.version=Version table.headers.indexedDB.objectStores=Object Stores -table.headers.indexedDB.keyPath=Key +table.headers.indexedDB.keyPath2=Key Path table.headers.indexedDB.autoIncrement=Auto Increment table.headers.indexedDB.indexes=Indexes @@ -84,7 +87,11 @@ storage.parsedValue.label=Parsed Value # Label of popup menu action to delete storage item. storage.popupMenu.deleteLabel=Delete “%S” -# LOCALIZATION NOTE (storage.popupMenu.deleteAllLabel): +# LOCALIZATION NOTE (storage.popupMenu.addItemLabel): +# Label of popup menu action to add an item. +storage.popupMenu.addItemLabel=Add Item + +# LOCALIZATION NOTE (storage.popupMenu.deleteAllFromLabel): # Label of popup menu action to delete all storage items. storage.popupMenu.deleteAllFromLabel=Delete All From “%S” diff --git a/devtools/client/menus.js b/devtools/client/menus.js index 1aee85095..1d2168967 100644 --- a/devtools/client/menus.js +++ b/devtools/client/menus.js @@ -120,7 +120,7 @@ exports.menuitems = [ { id: "menu_browserConsole", l10nKey: "browserConsoleCmd", oncommand() { - let HUDService = require("devtools/client/webconsole/hudservice"); + let {HUDService} = require("devtools/client/webconsole/hudservice"); HUDService.openBrowserConsoleOrFocus(); }, key: { @@ -183,9 +183,9 @@ exports.menuitems = [ } }, { separator: true, - id: "devToolsEndSeparator" + id: "menu_devToolsEndSeparator" }, - { id: "getMoreDevtools", + { id: "menu_getMoreDevtools", l10nKey: "getMoreDevtoolsCmd", oncommand(event) { let window = event.target.ownerDocument.defaultView; diff --git a/devtools/client/moz.build b/devtools/client/moz.build index b63de757c..b55aa5380 100644 --- a/devtools/client/moz.build +++ b/devtools/client/moz.build @@ -38,7 +38,7 @@ DIRS += [ ] # Shim old theme paths used by DevTools add-ons -if CONFIG['MOZ_BUILD_APP'] == 'browser': +if CONFIG['MOZ_PHOENIX']: DIRS += ['themes/shims'] EXTRA_COMPONENTS += [ diff --git a/devtools/client/netmonitor/actions/index.js b/devtools/client/netmonitor/actions/index.js index 3f7b0bd2f..de8f4ae1d 100644 --- a/devtools/client/netmonitor/actions/index.js +++ b/devtools/client/netmonitor/actions/index.js @@ -4,6 +4,8 @@ "use strict"; const filters = require("./filters"); -const sidebar = require("./sidebar"); +const requests = require("./requests"); +const timingMarkers = require("./timing-markers"); +const ui = require("./ui"); -module.exports = Object.assign({}, filters, sidebar); +module.exports = Object.assign({}, filters, requests, timingMarkers, ui); diff --git a/devtools/client/netmonitor/actions/moz.build b/devtools/client/netmonitor/actions/moz.build index 477cafb41..ce904cae8 100644 --- a/devtools/client/netmonitor/actions/moz.build +++ b/devtools/client/netmonitor/actions/moz.build @@ -6,5 +6,7 @@ DevToolsModules( 'filters.js', 'index.js', - 'sidebar.js', + 'requests.js', + 'timing-markers.js', + 'ui.js', ) diff --git a/devtools/client/netmonitor/actions/requests.js b/devtools/client/netmonitor/actions/requests.js new file mode 100644 index 000000000..ae794a437 --- /dev/null +++ b/devtools/client/netmonitor/actions/requests.js @@ -0,0 +1,25 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +"use strict"; + +const { + UPDATE_REQUESTS, +} = require("../constants"); + +/** + * Update request items + * + * @param {array} requests - visible request items + */ +function updateRequests(items) { + return { + type: UPDATE_REQUESTS, + items, + }; +} + +module.exports = { + updateRequests, +}; diff --git a/devtools/client/netmonitor/actions/sidebar.js b/devtools/client/netmonitor/actions/sidebar.js deleted file mode 100644 index 7e8dca5c1..000000000 --- a/devtools/client/netmonitor/actions/sidebar.js +++ /dev/null @@ -1,49 +0,0 @@ -/* This Source Code Form is subject to the terms of the Mozilla Public - * License, v. 2.0. If a copy of the MPL was not distributed with this - * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ -"use strict"; - -const { - DISABLE_TOGGLE_BUTTON, - SHOW_SIDEBAR, - TOGGLE_SIDEBAR, -} = require("../constants"); - -/** - * Change ToggleButton disabled state. - * - * @param {boolean} disabled - expected button disabled state - */ -function disableToggleButton(disabled) { - return { - type: DISABLE_TOGGLE_BUTTON, - disabled: disabled, - }; -} - -/** - * Change sidebar visible state. - * - * @param {boolean} visible - expected sidebar visible state - */ -function showSidebar(visible) { - return { - type: SHOW_SIDEBAR, - visible: visible, - }; -} - -/** - * Toggle to show/hide sidebar. - */ -function toggleSidebar() { - return { - type: TOGGLE_SIDEBAR, - }; -} - -module.exports = { - disableToggleButton, - showSidebar, - toggleSidebar, -}; diff --git a/devtools/client/netmonitor/actions/timing-markers.js b/devtools/client/netmonitor/actions/timing-markers.js new file mode 100644 index 000000000..4f1363a70 --- /dev/null +++ b/devtools/client/netmonitor/actions/timing-markers.js @@ -0,0 +1,19 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +"use strict"; + +const { ADD_TIMING_MARKER, CLEAR_TIMING_MARKERS } = require("../constants"); + +exports.addTimingMarker = (marker) => { + return { + type: ADD_TIMING_MARKER, + marker + }; +}; + +exports.clearTimingMarkers = () => { + return { + type: CLEAR_TIMING_MARKERS + }; +}; diff --git a/devtools/client/netmonitor/actions/ui.js b/devtools/client/netmonitor/actions/ui.js new file mode 100644 index 000000000..c6df307ed --- /dev/null +++ b/devtools/client/netmonitor/actions/ui.js @@ -0,0 +1,36 @@ ++/* This Source Code Form is subject to the terms of the Mozilla Public
++ * License, v. 2.0. If a copy of the MPL was not distributed with this
++ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+"use strict";
+
+const {
+ OPEN_SIDEBAR,
+ TOGGLE_SIDEBAR,
+} = require("../constants");
+
+/**
+ * Change sidebar open state.
+ *
+ * @param {boolean} open - open state
+ */
+function openSidebar(open) {
+ return {
+ type: OPEN_SIDEBAR,
+ open,
+ };
+}
+
+/**
+ * Toggle sidebar open state.
+ */
+function toggleSidebar() {
+ return {
+ type: TOGGLE_SIDEBAR,
+ };
+}
+
+module.exports = {
+ openSidebar,
+ toggleSidebar,
+};
diff --git a/devtools/client/netmonitor/components/moz.build b/devtools/client/netmonitor/components/moz.build index 47ef7f026..42459584d 100644 --- a/devtools/client/netmonitor/components/moz.build +++ b/devtools/client/netmonitor/components/moz.build @@ -6,5 +6,6 @@ DevToolsModules( 'filter-buttons.js', 'search-box.js', + 'summary-button.js', 'toggle-button.js', ) diff --git a/devtools/client/netmonitor/components/summary-button.js b/devtools/client/netmonitor/components/summary-button.js new file mode 100644 index 000000000..00595e5e6 --- /dev/null +++ b/devtools/client/netmonitor/components/summary-button.js @@ -0,0 +1,79 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* globals NetMonitorView */ + +"use strict"; + +const { + CONTENT_SIZE_DECIMALS, + REQUEST_TIME_DECIMALS, +} = require("../constants"); +const { DOM, PropTypes } = require("devtools/client/shared/vendor/react"); +const { connect } = require("devtools/client/shared/vendor/react-redux"); +const { PluralForm } = require("devtools/shared/plural-form"); +const { L10N } = require("../l10n"); +const { + getDisplayedRequestsSummary, + getDisplayedTimingMarker +} = require("../selectors/index"); + +const { button, span } = DOM; + +function SummaryButton({ + summary, + triggerSummary, + timingMarkers +}) { + let { count, contentSize, transferredSize, millis } = summary; + let { + DOMContentLoaded, + load, + } = timingMarkers; + const text = (count === 0) ? L10N.getStr("networkMenu.empty") : + PluralForm.get(count, L10N.getStr("networkMenu.summary2")) + .replace("#1", count) + .replace("#2", L10N.numberWithDecimals(contentSize / 1024, + CONTENT_SIZE_DECIMALS)) + .replace("#3", L10N.numberWithDecimals(transferredSize / 1024, + CONTENT_SIZE_DECIMALS)) + .replace("#4", L10N.numberWithDecimals(millis / 1000, + REQUEST_TIME_DECIMALS)) + + ((DOMContentLoaded > -1) + ? ", " + "DOMContentLoaded: " + L10N.getFormatStrWithNumbers("networkMenu.timeS", L10N.numberWithDecimals(DOMContentLoaded / 1000, REQUEST_TIME_DECIMALS)) + : "") + + ((load > -1) + ? ", " + "load: " + L10N.getFormatStrWithNumbers("networkMenu.timeS", L10N.numberWithDecimals(load / 1000, REQUEST_TIME_DECIMALS)) + : ""); + + return button({ + id: "requests-menu-network-summary-button", + className: "devtools-button", + title: count ? text : L10N.getStr("netmonitor.toolbar.perf"), + onClick: triggerSummary, + }, + span({ className: "summary-info-icon" }), + span({ className: "summary-info-text" }, text)); +} + +SummaryButton.propTypes = { + summary: PropTypes.object.isRequired, + timingMarkers: PropTypes.object.isRequired, +}; + +module.exports = connect( + (state) => ({ + summary: getDisplayedRequestsSummary(state), + timingMarkers: { + DOMContentLoaded: + getDisplayedTimingMarker(state, "firstDocumentDOMContentLoadedTimestamp"), + load: getDisplayedTimingMarker(state, "firstDocumentLoadTimestamp"), + }, + }), + (dispatch) => ({ + triggerSummary: () => { + NetMonitorView.toggleFrontendMode(); + }, + }) +)(SummaryButton); diff --git a/devtools/client/netmonitor/components/toggle-button.js b/devtools/client/netmonitor/components/toggle-button.js index db546c55d..c9a59a76b 100644 --- a/devtools/client/netmonitor/components/toggle-button.js +++ b/devtools/client/netmonitor/components/toggle-button.js @@ -1,5 +1,3 @@ -/* -*- indent-tabs-mode: nil; js-indent-level: 2 -*- */ -/* vim: set ft=javascript ts=2 et sw=2 tw=80: */ /* This Source Code Form is subject to the terms of the Mozilla Public * License, v. 2.0. If a copy of the MPL was not distributed with this * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ @@ -11,47 +9,43 @@ const { connect } = require("devtools/client/shared/vendor/react-redux"); const { L10N } = require("../l10n"); const Actions = require("../actions/index"); -// Shortcuts const { button } = DOM; -/** - * Button used to toggle sidebar - */ function ToggleButton({ disabled, - onToggle, - visible, + open, + triggerSidebar, }) { let className = ["devtools-button"]; - if (!visible) { + if (!open) { className.push("pane-collapsed"); } - let titleMsg = visible ? L10N.getStr("collapseDetailsPane") : - L10N.getStr("expandDetailsPane"); + + const title = open ? L10N.getStr("collapseDetailsPane") : + L10N.getStr("expandDetailsPane"); return button({ id: "details-pane-toggle", className: className.join(" "), - title: titleMsg, - disabled: disabled, + title, + disabled, tabIndex: "0", - onMouseDown: onToggle, + onMouseDown: triggerSidebar, }); } ToggleButton.propTypes = { disabled: PropTypes.bool.isRequired, - onToggle: PropTypes.func.isRequired, - visible: PropTypes.bool.isRequired, + triggerSidebar: PropTypes.func.isRequired, }; module.exports = connect( (state) => ({ - disabled: state.sidebar.toggleButtonDisabled, - visible: state.sidebar.visible, + disabled: state.requests.items.length === 0, + open: state.ui.sidebar.open, }), (dispatch) => ({ - onToggle: () => { + triggerSidebar: () => { dispatch(Actions.toggleSidebar()); let requestsMenu = NetMonitorView.RequestsMenu; diff --git a/devtools/client/netmonitor/constants.js b/devtools/client/netmonitor/constants.js index a540d74b2..1605496a5 100644 --- a/devtools/client/netmonitor/constants.js +++ b/devtools/client/netmonitor/constants.js @@ -5,15 +5,19 @@ const general = { FREETEXT_FILTER_SEARCH_DELAY: 200, + CONTENT_SIZE_DECIMALS: 2, + REQUEST_TIME_DECIMALS: 2, }; const actionTypes = { + ADD_TIMING_MARKER: "ADD_TIMING_MARKER", + CLEAR_TIMING_MARKERS: "CLEAR_TIMING_MARKERS", TOGGLE_FILTER_TYPE: "TOGGLE_FILTER_TYPE", ENABLE_FILTER_TYPE_ONLY: "ENABLE_FILTER_TYPE_ONLY", - TOGGLE_SIDEBAR: "TOGGLE_SIDEBAR", - SHOW_SIDEBAR: "SHOW_SIDEBAR", - DISABLE_TOGGLE_BUTTON: "DISABLE_TOGGLE_BUTTON", SET_FILTER_TEXT: "SET_FILTER_TEXT", + OPEN_SIDEBAR: "OPEN_SIDEBAR", + TOGGLE_SIDEBAR: "TOGGLE_SIDEBAR", + UPDATE_REQUESTS: "UPDATE_REQUESTS", }; module.exports = Object.assign({}, general, actionTypes); diff --git a/devtools/client/netmonitor/moz.build b/devtools/client/netmonitor/moz.build index 4b34b093b..2c9b32d3f 100644 --- a/devtools/client/netmonitor/moz.build +++ b/devtools/client/netmonitor/moz.build @@ -17,6 +17,7 @@ DevToolsModules( 'events.js', 'filter-predicates.js', 'l10n.js', + 'open-request-in-tab.js', 'panel.js', 'performance-statistics-view.js', 'prefs.js', diff --git a/devtools/client/netmonitor/netmonitor-controller.js b/devtools/client/netmonitor/netmonitor-controller.js index 739e174fb..39bee8570 100644 --- a/devtools/client/netmonitor/netmonitor-controller.js +++ b/devtools/client/netmonitor/netmonitor-controller.js @@ -407,6 +407,9 @@ TargetEventsHandler.prototype = { if (!Services.prefs.getBoolPref("devtools.webconsole.persistlog")) { NetMonitorView.RequestsMenu.reset(); NetMonitorView.Sidebar.toggle(false); + } else { + // If the log is persistent, just clear some informations. + NetMonitorView.RequestsMenu.resetNotPersistent(); } // Switch to the default network traffic inspector view. if (NetMonitorController.getCurrentActivity() == ACTIVITY_TYPE.NONE) { @@ -414,6 +417,7 @@ TargetEventsHandler.prototype = { } // Clear any accumulated markers. NetMonitorController.NetworkEventsHandler.clearMarkers(); + gStore.dispatch(Actions.clearTimingMarkers()); window.emit(EVENTS.TARGET_WILL_NAVIGATE); break; @@ -534,6 +538,7 @@ NetworkEventsHandler.prototype = { _onDocLoadingMarker: function (marker) { window.emit(EVENTS.TIMELINE_EVENT, marker); this._markers.push(marker); + gStore.dispatch(Actions.addTimingMarker(marker)); }, /** diff --git a/devtools/client/netmonitor/netmonitor-view.js b/devtools/client/netmonitor/netmonitor-view.js index 68470f7a9..414b9ab8f 100644 --- a/devtools/client/netmonitor/netmonitor-view.js +++ b/devtools/client/netmonitor/netmonitor-view.js @@ -125,7 +125,6 @@ var NetMonitorView = { if (!Prefs.statistics) { $("#request-menu-context-perf").hidden = true; $("#notice-perf-message").hidden = true; - $("#requests-menu-network-summary-button").hidden = true; } }, @@ -171,10 +170,10 @@ var NetMonitorView = { if (flags.visible) { this._body.classList.remove("pane-collapsed"); - gStore.dispatch(Actions.showSidebar(true)); + gStore.dispatch(Actions.openSidebar(true)); } else { this._body.classList.add("pane-collapsed"); - gStore.dispatch(Actions.showSidebar(false)); + gStore.dispatch(Actions.openSidebar(false)); } if (tabIndex !== undefined) { @@ -234,7 +233,7 @@ var NetMonitorView = { // populating the statistics view. // • The response mime type is used for categorization. yield whenDataAvailable(requestsView, [ - "responseHeaders", "status", "contentSize", "mimeType", "totalTime" + "responseHeaders", "status", "contentSize", "transferredSize", "mimeType", "totalTime" ]); } catch (ex) { // Timed out while waiting for data. Continue with what we have. @@ -964,7 +963,7 @@ NetworkDetailsView.prototype = { if (!response) { return; } - let { blocked, dns, connect, send, wait, receive } = response.timings; + let { blocked, dns, connect, ssl, send, wait, receive } = response.timings; let tabboxWidth = $("#details-pane").getAttribute("width"); @@ -989,6 +988,11 @@ NetworkDetailsView.prototype = { $("#timings-summary-connect .requests-menu-timings-total") .setAttribute("value", L10N.getFormatStr("networkMenu.totalMS", connect)); + $("#timings-summary-ssl .requests-menu-timings-box") + .setAttribute("width", ssl * scale); + $("#timings-summary-ssl .requests-menu-timings-total") + .setAttribute("value", L10N.getFormatStr("networkMenu.totalMS", ssl)); + $("#timings-summary-send .requests-menu-timings-box") .setAttribute("width", send * scale); $("#timings-summary-send .requests-menu-timings-total") @@ -1008,6 +1012,8 @@ NetworkDetailsView.prototype = { .style.transform = "translateX(" + (scale * blocked) + "px)"; $("#timings-summary-connect .requests-menu-timings-box") .style.transform = "translateX(" + (scale * (blocked + dns)) + "px)"; + $("#timings-summary-ssl .requests-menu-timings-box") + .style.transform = "translateX(" + (scale * blocked) + "px)"; $("#timings-summary-send .requests-menu-timings-box") .style.transform = "translateX(" + (scale * (blocked + dns + connect)) + "px)"; @@ -1023,6 +1029,8 @@ NetworkDetailsView.prototype = { .style.transform = "translateX(" + (scale * blocked) + "px)"; $("#timings-summary-connect .requests-menu-timings-total") .style.transform = "translateX(" + (scale * (blocked + dns)) + "px)"; + $("#timings-summary-ssl .requests-menu-timings-total") + .style.transform = "translateX(" + (scale * blocked) + "px)"; $("#timings-summary-send .requests-menu-timings-total") .style.transform = "translateX(" + (scale * (blocked + dns + connect)) + "px)"; @@ -1125,6 +1133,8 @@ NetworkDetailsView.prototype = { setValue("#security-protocol-version-value", securityInfo.protocolVersion); setValue("#security-ciphersuite-value", securityInfo.cipherSuite); + setValue("#security-keagroup-value", securityInfo.keaGroupName); + setValue("#security-signaturescheme-value", securityInfo.signatureSchemeName); // Host header let domain = getUriHostPort(url); diff --git a/devtools/client/netmonitor/netmonitor.xul b/devtools/client/netmonitor/netmonitor.xul index bb580f7ad..aa5c4d848 100644 --- a/devtools/client/netmonitor/netmonitor.xul +++ b/devtools/client/netmonitor/netmonitor.xul @@ -28,9 +28,8 @@ id="react-filter-buttons-hook"/> <spacer id="requests-menu-spacer" flex="1"/> - <toolbarbutton id="requests-menu-network-summary-button" - class="devtools-toolbarbutton icon-and-text" - data-localization="tooltiptext=netmonitor.toolbar.perf"/> + <html:div xmlns="http://www.w3.org/1999/xhtml" + id="react-summary-button-hook"/> <html:div xmlns="http://www.w3.org/1999/xhtml" id="react-search-box-hook"/> <html:div xmlns="http://www.w3.org/1999/xhtml" @@ -479,6 +478,14 @@ <hbox class="requests-menu-timings-box connect"/> <label class="plain requests-menu-timings-total"/> </hbox> + <hbox id="timings-summary-ssl" + class="tabpanel-summary-container" + align="center"> + <label class="plain tabpanel-summary-label" + data-localization="content=netmonitor.timings.ssl"/> + <hbox class="requests-menu-timings-box ssl"/> + <label class="plain requests-menu-timings-total"/> + </hbox> <hbox id="timings-summary-send" class="tabpanel-summary-container" align="center"> @@ -551,6 +558,26 @@ id="security-warning-cipher" data-localization="tooltiptext=netmonitor.security.warning.cipher" /> </hbox> + <hbox id="security-keagroup" + class="tabpanel-summary-container" + align="baseline"> + <label class="plain tabpanel-summary-label" + data-localization="content=netmonitor.security.keaGroup"/> + <textbox id="security-keagroup-value" + class="plain tabpanel-summary-value devtools-monospace cropped-textbox" + flex="1" + readonly="true"/> + </hbox> + <hbox id="security-signaturescheme" + class="tabpanel-summary-container" + align="baseline"> + <label class="plain tabpanel-summary-label" + data-localization="content=netmonitor.security.signatureScheme"/> + <textbox id="security-signaturescheme-value" + class="plain tabpanel-summary-value devtools-monospace cropped-textbox" + flex="1" + readonly="true"/> + </hbox> </vbox> </vbox> <vbox id="security-info-domain" diff --git a/devtools/client/netmonitor/open-request-in-tab.js b/devtools/client/netmonitor/open-request-in-tab.js new file mode 100644 index 000000000..aeb35dad0 --- /dev/null +++ b/devtools/client/netmonitor/open-request-in-tab.js @@ -0,0 +1,40 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+/* eslint-disable mozilla/reject-some-requires */
+
+"use strict";
+
+let { Cc, Ci } = require("chrome");
+const Services = require("Services");
+const { gDevTools } = require("devtools/client/framework/devtools");
+
+/**
+ * Opens given request in a new tab.
+ */
+function openRequestInTab(request) {
+ let win = Services.wm.getMostRecentWindow(gDevTools.chromeWindowType);
+ let rawData = request.requestPostData ? request.requestPostData.postData : null;
+ let postData;
+
+ if (rawData && rawData.text) {
+ let stringStream = getInputStreamFromString(rawData.text);
+ postData = Cc["@mozilla.org/network/mime-input-stream;1"]
+ .createInstance(Ci.nsIMIMEInputStream);
+ postData.addHeader("Content-Type", "application/x-www-form-urlencoded");
+ postData.setData(stringStream);
+ }
+
+ win.gBrowser.selectedTab = win.gBrowser.addTab(request.url, null, null, postData);
+}
+
+function getInputStreamFromString(data) {
+ let stringStream = Cc["@mozilla.org/io/string-input-stream;1"]
+ .createInstance(Ci.nsIStringInputStream);
+ stringStream.data = data;
+ return stringStream;
+}
+
+module.exports = {
+ openRequestInTab,
+};
diff --git a/devtools/client/netmonitor/performance-statistics-view.js b/devtools/client/netmonitor/performance-statistics-view.js index c712c083d..38b98fb68 100644 --- a/devtools/client/netmonitor/performance-statistics-view.js +++ b/devtools/client/netmonitor/performance-statistics-view.js @@ -92,27 +92,35 @@ PerformanceStatisticsView.prototype = { let string = L10N.numberWithDecimals(value / 1024, CONTENT_SIZE_DECIMALS); return L10N.getFormatStr("charts.sizeKB", string); }, + transferredSize: value => { + let string = L10N.numberWithDecimals(value / 1024, CONTENT_SIZE_DECIMALS); + return L10N.getFormatStr("charts.transferredSizeKB", string); + }, time: value => { let string = L10N.numberWithDecimals(value / 1000, REQUEST_TIME_DECIMALS); return L10N.getFormatStr("charts.totalS", string); } }, _commonChartTotals: { + cached: total => { + return L10N.getFormatStr("charts.totalCached", total); + }, + count: total => { + return L10N.getFormatStr("charts.totalCount", total); + }, size: total => { let string = L10N.numberWithDecimals(total / 1024, CONTENT_SIZE_DECIMALS); return L10N.getFormatStr("charts.totalSize", string); }, + transferredSize: total => { + let string = L10N.numberWithDecimals(total / 1024, CONTENT_SIZE_DECIMALS); + return L10N.getFormatStr("charts.totalTransferredSize", string); + }, time: total => { let seconds = total / 1000; let string = L10N.numberWithDecimals(seconds, REQUEST_TIME_DECIMALS); return PluralForm.get(seconds, L10N.getStr("charts.totalSeconds")).replace("#1", string); - }, - cached: total => { - return L10N.getFormatStr("charts.totalCached", total); - }, - count: total => { - return L10N.getFormatStr("charts.totalCount", total); } }, @@ -136,6 +144,14 @@ PerformanceStatisticsView.prototype = { let chart = Chart.PieTable(document, { diameter: NETWORK_ANALYSIS_PIE_CHART_DIAMETER, title: L10N.getStr(title), + header: { + cached: "", + count: "", + label: L10N.getStr("charts.type"), + size: L10N.getStr("charts.size"), + transferredSize: L10N.getStr("charts.transferred"), + time: L10N.getStr("charts.time") + }, data: data, strings: strings, totals: totals, @@ -161,13 +177,14 @@ PerformanceStatisticsView.prototype = { * True if the cache is considered enabled, false for disabled. */ _sanitizeChartDataSource: function (items, emptyCache) { - let data = [ + const data = [ "html", "css", "js", "xhr", "fonts", "images", "media", "flash", "ws", "other" - ].map(e => ({ + ].map((type) => ({ cached: 0, count: 0, - label: e, + label: type, size: 0, + transferredSize: 0, time: 0 })); @@ -211,6 +228,7 @@ PerformanceStatisticsView.prototype = { if (emptyCache || !responseIsFresh(details)) { data[type].time += details.totalTime || 0; data[type].size += details.contentSize || 0; + data[type].transferredSize += details.transferredSize || 0; } else { data[type].cached++; } diff --git a/devtools/client/netmonitor/reducers/index.js b/devtools/client/netmonitor/reducers/index.js index 58638a030..f003c7805 100644 --- a/devtools/client/netmonitor/reducers/index.js +++ b/devtools/client/netmonitor/reducers/index.js @@ -5,9 +5,13 @@ const { combineReducers } = require("devtools/client/shared/vendor/redux"); const filters = require("./filters"); -const sidebar = require("./sidebar"); +const requests = require("./requests"); +const timingMarkers = require("./timing-markers"); +const ui = require("./ui"); module.exports = combineReducers({ filters, - sidebar, + requests, + timingMarkers, + ui, }); diff --git a/devtools/client/netmonitor/reducers/moz.build b/devtools/client/netmonitor/reducers/moz.build index 477cafb41..ce904cae8 100644 --- a/devtools/client/netmonitor/reducers/moz.build +++ b/devtools/client/netmonitor/reducers/moz.build @@ -6,5 +6,7 @@ DevToolsModules( 'filters.js', 'index.js', - 'sidebar.js', + 'requests.js', + 'timing-markers.js', + 'ui.js', ) diff --git a/devtools/client/netmonitor/reducers/requests.js b/devtools/client/netmonitor/reducers/requests.js new file mode 100644 index 000000000..9ba888cad --- /dev/null +++ b/devtools/client/netmonitor/reducers/requests.js @@ -0,0 +1,28 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +"use strict"; + +const I = require("devtools/client/shared/vendor/immutable"); +const { + UPDATE_REQUESTS, +} = require("../constants"); + +const Requests = I.Record({ + items: [], +}); + +function updateRequests(state, action) { + return state.set("items", action.items || state.items); +} + +function requests(state = new Requests(), action) { + switch (action.type) { + case UPDATE_REQUESTS: + return updateRequests(state, action); + default: + return state; + } +} + +module.exports = requests; diff --git a/devtools/client/netmonitor/reducers/sidebar.js b/devtools/client/netmonitor/reducers/sidebar.js deleted file mode 100644 index eaa8b63df..000000000 --- a/devtools/client/netmonitor/reducers/sidebar.js +++ /dev/null @@ -1,43 +0,0 @@ -/* This Source Code Form is subject to the terms of the Mozilla Public - * License, v. 2.0. If a copy of the MPL was not distributed with this - * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ -"use strict"; - -const I = require("devtools/client/shared/vendor/immutable"); -const { - DISABLE_TOGGLE_BUTTON, - SHOW_SIDEBAR, - TOGGLE_SIDEBAR, -} = require("../constants"); - -const SidebarState = I.Record({ - toggleButtonDisabled: true, - visible: false, -}); - -function disableToggleButton(state, action) { - return state.set("toggleButtonDisabled", action.disabled); -} - -function showSidebar(state, action) { - return state.set("visible", action.visible); -} - -function toggleSidebar(state, action) { - return state.set("visible", !state.visible); -} - -function sidebar(state = new SidebarState(), action) { - switch (action.type) { - case DISABLE_TOGGLE_BUTTON: - return disableToggleButton(state, action); - case SHOW_SIDEBAR: - return showSidebar(state, action); - case TOGGLE_SIDEBAR: - return toggleSidebar(state, action); - default: - return state; - } -} - -module.exports = sidebar; diff --git a/devtools/client/netmonitor/reducers/timing-markers.js b/devtools/client/netmonitor/reducers/timing-markers.js new file mode 100644 index 000000000..cb500b2c4 --- /dev/null +++ b/devtools/client/netmonitor/reducers/timing-markers.js @@ -0,0 +1,52 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +"use strict"; + +const I = require("devtools/client/shared/vendor/immutable"); +const { ADD_TIMING_MARKER, + CLEAR_TIMING_MARKERS } = require("../constants"); + +const TimingMarkers = I.Record({ + firstDocumentDOMContentLoadedTimestamp: -1, + firstDocumentLoadTimestamp: -1, +}); + +function addTimingMarker(state, action) { + if (action.marker.name == "document::DOMContentLoaded" && + state.firstDocumentDOMContentLoadedTimestamp == -1) { + return state.set("firstDocumentDOMContentLoadedTimestamp", + action.marker.unixTime / 1000); + } + + if (action.marker.name == "document::Load" && + state.firstDocumentLoadTimestamp == -1) { + return state.set("firstDocumentLoadTimestamp", + action.marker.unixTime / 1000); + } + + return state; +} + +function clearTimingMarkers(state) { + return state.withMutations(st => { + st.remove("firstDocumentDOMContentLoadedTimestamp"); + st.remove("firstDocumentLoadTimestamp"); + }); +} + +function timingMarkers(state = new TimingMarkers(), action) { + switch (action.type) { + case ADD_TIMING_MARKER: + return addTimingMarker(state, action); + + case CLEAR_TIMING_MARKERS: + return clearTimingMarkers(state); + + default: + return state; + } +} + +module.exports = timingMarkers; diff --git a/devtools/client/netmonitor/reducers/ui.js b/devtools/client/netmonitor/reducers/ui.js new file mode 100644 index 000000000..033b944f3 --- /dev/null +++ b/devtools/client/netmonitor/reducers/ui.js @@ -0,0 +1,40 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +"use strict"; + +const I = require("devtools/client/shared/vendor/immutable"); +const { + OPEN_SIDEBAR, + TOGGLE_SIDEBAR, +} = require("../constants"); + +const Sidebar = I.Record({ + open: false, +}); + +const UI = I.Record({ + sidebar: new Sidebar(), +}); + +function openSidebar(state, action) { + return state.setIn(["sidebar", "open"], action.open); +} + +function toggleSidebar(state, action) { + return state.setIn(["sidebar", "open"], !state.sidebar.open); +} + +function ui(state = new UI(), action) { + switch (action.type) { + case OPEN_SIDEBAR: + return openSidebar(state, action); + case TOGGLE_SIDEBAR: + return toggleSidebar(state, action); + default: + return state; + } +} + +module.exports = ui; diff --git a/devtools/client/netmonitor/request-list-context-menu.js b/devtools/client/netmonitor/request-list-context-menu.js index 215296265..bacb7dc33 100644 --- a/devtools/client/netmonitor/request-list-context-menu.js +++ b/devtools/client/netmonitor/request-list-context-menu.js @@ -10,6 +10,7 @@ const Services = require("Services"); const { Task } = require("devtools/shared/task"); const { Curl } = require("devtools/client/shared/curl"); const { gDevTools } = require("devtools/client/framework/devtools"); +const { openRequestInTab } = require("devtools/client/netmonitor/open-request-in-tab"); const Menu = require("devtools/client/framework/menu"); const MenuItem = require("devtools/client/framework/menu-item"); const { L10N } = require("./l10n"); @@ -185,9 +186,7 @@ RequestListContextMenu.prototype = { * Opens selected item in a new tab. */ openRequestInTab() { - let win = Services.wm.getMostRecentWindow(gDevTools.chromeWindowType); - let { url } = this.selectedItem.attachment; - win.openUILinkIn(url, "tab", { relatedToCurrent: true }); + openRequestInTab(this.selectedItem.attachment); }, /** diff --git a/devtools/client/netmonitor/request-utils.js b/devtools/client/netmonitor/request-utils.js index ba54efb4f..647d71e7c 100644 --- a/devtools/client/netmonitor/request-utils.js +++ b/devtools/client/netmonitor/request-utils.js @@ -92,7 +92,7 @@ exports.getFormDataSections = Task.async(function* (headers, uploadHeaders, post exports.formDataURI = function (mimeType, encoding, text) { if (!encoding) { encoding = "base64"; - text = btoa(text); + text = btoa(unescape(encodeURIComponent(text))); } return "data:" + mimeType + ";" + encoding + "," + text; }; diff --git a/devtools/client/netmonitor/requests-menu-view.js b/devtools/client/netmonitor/requests-menu-view.js index 6ea6381ec..0c854d264 100644 --- a/devtools/client/netmonitor/requests-menu-view.js +++ b/devtools/client/netmonitor/requests-menu-view.js @@ -19,7 +19,6 @@ const {setImageTooltip, getImageDimensions} = const {Heritage, WidgetMethods, setNamedTimeout} = require("devtools/client/shared/widgets/view-helpers"); const {CurlUtils} = require("devtools/client/shared/curl"); -const {PluralForm} = require("devtools/shared/plural-form"); const {Filters, isFreetextMatch} = require("./filter-predicates"); const {Sorters} = require("./sort-predicates"); const {L10N, WEBCONSOLE_L10N} = require("./l10n"); @@ -90,10 +89,11 @@ function storeWatcher(initialValue, reduceValue, onChange) { let currentValue = initialValue; return () => { + const oldValue = currentValue; const newValue = reduceValue(currentValue); - if (newValue !== currentValue) { - onChange(newValue, currentValue); + if (newValue !== oldValue) { currentValue = newValue; + onChange(newValue, oldValue); } }; } @@ -129,8 +129,6 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { let widgetParentEl = $("#requests-menu-contents"); this.widget = new SideMenuWidget(widgetParentEl); this._splitter = $("#network-inspector-view-splitter"); - this._summary = $("#requests-menu-network-summary-button"); - this._summary.setAttribute("label", L10N.getStr("networkMenu.empty")); // Create a tooltip for the newly appended network request item. this.tooltip = new HTMLTooltip(NetMonitorController._toolbox.doc, { type: "arrow" }); @@ -211,13 +209,10 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { if (NetMonitorController.supportsPerfStats) { $("#requests-menu-perf-notice-button").addEventListener("command", this._onContextPerfCommand, false); - $("#requests-menu-network-summary-button").addEventListener("command", - this._onContextPerfCommand, false); $("#network-statistics-back-button").addEventListener("command", this._onContextPerfCommand, false); } else { $("#notice-perf-message").hidden = true; - $("#requests-menu-network-summary-button").hidden = true; } if (!NetMonitorController.supportsTransferredResponseSize) { @@ -257,8 +252,6 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { this._onReloadCommand, false); $("#requests-menu-perf-notice-button").removeEventListener("command", this._onContextPerfCommand, false); - $("#requests-menu-network-summary-button").removeEventListener("command", - this._onContextPerfCommand, false); $("#network-statistics-back-button").removeEventListener("command", this._onContextPerfCommand, false); @@ -283,6 +276,14 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { this._updateQueue = []; this._firstRequestStartedMillis = -1; this._lastRequestEndedMillis = -1; + this.resetNotPersistent(); + }, + + /** + * Reset informations that "devtools.webconsole.persistlog == true". + */ + resetNotPersistent: function () { + this._firstRequestStartedMillisNotPersistent = -1; }, /** @@ -406,9 +407,20 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { if (rawHeadersHidden) { let selected = this.selectedItem.attachment; let selectedRequestHeaders = selected.requestHeaders.headers; - let selectedResponseHeaders = selected.responseHeaders.headers; + // display Status-Line above other response headers + let selectedStatusLine = selected.httpVersion + + " " + selected.status + + " " + selected.statusText + + "\n"; requestTextarea.value = writeHeaderText(selectedRequestHeaders); - responseTextare.value = writeHeaderText(selectedResponseHeaders); + // sometimes it's empty + if (selected.responseHeaders) { + let selectedResponseHeaders = selected.responseHeaders.headers; + responseTextare.value = selectedStatusLine + + writeHeaderText(selectedResponseHeaders); + } else { + responseTextare.value = selectedStatusLine; + } $("#raw-headers").hidden = false; } else { requestTextarea.value = null; @@ -422,7 +434,7 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { */ reFilterRequests: function () { this.filterContents(this._filterPredicate); - this.refreshSummary(); + this.updateRequests(); this.refreshZebra(); }, @@ -541,7 +553,7 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { break; } - this.refreshSummary(); + this.updateRequests(); this.refreshZebra(); }, @@ -552,41 +564,17 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { NetMonitorController.NetworkEventsHandler.clearMarkers(); NetMonitorView.Sidebar.toggle(false); - this.store.dispatch(Actions.disableToggleButton(true)); $("#requests-menu-empty-notice").hidden = false; this.empty(); - this.refreshSummary(); + this.updateRequests(); }, /** - * Refreshes the status displayed in this container's footer, providing - * concise information about all requests. + * Update store request itmes and trigger related UI update */ - refreshSummary: function () { - let visibleItems = this.visibleItems; - let visibleRequestsCount = visibleItems.length; - if (!visibleRequestsCount) { - this._summary.setAttribute("label", L10N.getStr("networkMenu.empty")); - return; - } - - let totalBytes = this._getTotalBytesOfRequests(visibleItems); - let totalMillis = - this._getNewestRequest(visibleItems).attachment.endedMillis - - this._getOldestRequest(visibleItems).attachment.startedMillis; - - // https://developer.mozilla.org/en-US/docs/Localization_and_Plurals - let str = PluralForm.get(visibleRequestsCount, - L10N.getStr("networkMenu.summary")); - - this._summary.setAttribute("label", str - .replace("#1", visibleRequestsCount) - .replace("#2", L10N.numberWithDecimals((totalBytes || 0) / 1024, - CONTENT_SIZE_DECIMALS)) - .replace("#3", L10N.numberWithDecimals((totalMillis || 0) / 1000, - REQUEST_TIME_DECIMALS)) - ); + updateRequests: function () { + this.store.dispatch(Actions.updateRequests(this.visibleItems)); }, /** @@ -670,6 +658,7 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { // Append a network request item to this container. let requestItem = this.push([menuView, id], { attachment: { + firstRequestStartedMillisNotPersistent: this._firstRequestStartedMillisNotPersistent, startedDeltaMillis: unixTime - this._firstRequestStartedMillis, startedMillis: unixTime, method: method, @@ -865,7 +854,6 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { this._updateQueue = []; this._addQueue = []; - this.store.dispatch(Actions.disableToggleButton(!this.itemCount)); $("#requests-menu-empty-notice").hidden = !!this.itemCount; // Make sure all the requests are sorted and filtered. @@ -875,7 +863,7 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { // so this doesn't happen once per network event update). this.sortContents(); this.filterContents(); - this.refreshSummary(); + this.updateRequests(); this.refreshZebra(); // Rescale all the waterfalls so that everything is visible at once. @@ -1131,7 +1119,7 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { */ _createWaterfallView: function (item, timings, fromCache) { let { target } = item; - let sections = ["blocked", "dns", "connect", "send", "wait", "receive"]; + let sections = ["blocked", "dns", "connect", "ssl", "send", "wait", "receive"]; // Skipping "blocked" because it doesn't work yet. let timingsNode = $(".requests-menu-timings", target); @@ -1543,6 +1531,9 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { if (this._firstRequestStartedMillis == -1) { this._firstRequestStartedMillis = unixTime; } + if (this._firstRequestStartedMillisNotPersistent == -1) { + this._firstRequestStartedMillisNotPersistent = unixTime; + } }, /** @@ -1559,59 +1550,6 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { }, /** - * Gets the total number of bytes representing the cumulated content size of - * a set of requests. Returns 0 for an empty set. - * - * @param array itemsArray - * @return number - */ - _getTotalBytesOfRequests: function (itemsArray) { - if (!itemsArray.length) { - return 0; - } - - let result = 0; - itemsArray.forEach(item => { - let size = item.attachment.contentSize; - result += (typeof size == "number") ? size : 0; - }); - - return result; - }, - - /** - * Gets the oldest (first performed) request in a set. Returns null for an - * empty set. - * - * @param array itemsArray - * @return object - */ - _getOldestRequest: function (itemsArray) { - if (!itemsArray.length) { - return null; - } - return itemsArray.reduce((prev, curr) => - prev.attachment.startedMillis < curr.attachment.startedMillis ? - prev : curr); - }, - - /** - * Gets the newest (latest performed) request in a set. Returns null for an - * empty set. - * - * @param array itemsArray - * @return object - */ - _getNewestRequest: function (itemsArray) { - if (!itemsArray.length) { - return null; - } - return itemsArray.reduce((prev, curr) => - prev.attachment.startedMillis > curr.attachment.startedMillis ? - prev : curr); - }, - - /** * Gets the available waterfall width in this container. * @return number */ @@ -1637,6 +1575,7 @@ RequestsMenuView.prototype = Heritage.extend(WidgetMethods, { _ctx: null, _cachedWaterfallWidth: 0, _firstRequestStartedMillis: -1, + _firstRequestStartedMillisNotPersistent: -1, _lastRequestEndedMillis: -1, _updateQueue: [], _addQueue: [], diff --git a/devtools/client/netmonitor/selectors/index.js b/devtools/client/netmonitor/selectors/index.js index f473149b5..ba5c19094 100644 --- a/devtools/client/netmonitor/selectors/index.js +++ b/devtools/client/netmonitor/selectors/index.js @@ -1,8 +1,98 @@ /* This Source Code Form is subject to the terms of the Mozilla Public * License, v. 2.0. If a copy of the MPL was not distributed with this * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + "use strict"; +const { createSelector } = require("devtools/client/shared/vendor/reselect"); + +/** + * Gets the total number of bytes representing the cumulated content size of + * a set of requests. Returns 0 for an empty set. + * + * @param {array} items - an array of request items + * @return {number} total bytes of requests + */ +function getContentSizeOfRequests(items) { + if (!items.length) { + return 0; + } + + let result = 0; + items.forEach((item) => { + let size = item.attachment.contentSize; + result += (typeof size == "number") ? size : 0; + }); + + return result; +} + +function getTransferredSizeOfRequests(items) { + if (!items.length) { + return 0; + } + + let result = 0; + items.forEach((item) => { + let size = item.attachment.transferredSize; + result += (typeof size == "number") ? size : 0; + }); + + return result; +} + +/** + * Gets the total milliseconds for all requests. Returns null for an + * empty set. + * + * @param {array} items - an array of request items + * @return {object} total milliseconds for all requests + */ +function getMillisOfRequests(items) { + if (!items.length) { + return null; + } + + const oldest = items.reduce((prev, curr) => + prev.attachment.startedMillis < curr.attachment.startedMillis ? + prev : curr); + const newest = items.reduce((prev, curr) => + prev.attachment.startedMillis > curr.attachment.startedMillis ? + prev : curr); + + return newest.attachment.endedMillis - oldest.attachment.startedMillis; +} + +const getDisplayedRequestsSummary = createSelector( + (state) => state.requests.items, + (requests) => ({ + count: requests.length, + contentSize: getContentSizeOfRequests(requests), + transferredSize: getTransferredSizeOfRequests(requests), + millis: getMillisOfRequests(requests), + }) +); + +function getDisplayedTimingMarker(state, marker) { + let timingMarker = null; + if (state.timingMarkers) { + timingMarker = state.timingMarkers.get(marker); + } + let firstRequestStartedMillis = null; + if (state.requests.items.length) { + firstRequestStartedMillis = state.requests + .items[state.requests.items.length - 1] + .attachment + .firstRequestStartedMillisNotPersistent; + } + if (timingMarker && firstRequestStartedMillis) { + return timingMarker - firstRequestStartedMillis; + } else { + return -1; + } +} + module.exports = { - // selectors... + getDisplayedRequestsSummary, + getDisplayedTimingMarker, }; diff --git a/devtools/client/netmonitor/test/browser_net_charts-03.js b/devtools/client/netmonitor/test/browser_net_charts-03.js index c7d9b0c1a..4a655a8ca 100644 --- a/devtools/client/netmonitor/test/browser_net_charts-03.js +++ b/devtools/client/netmonitor/test/browser_net_charts-03.js @@ -33,6 +33,10 @@ add_task(function* () { totals: { label1: value => "Hello " + L10N.numberWithDecimals(value, 2), label2: value => "World " + L10N.numberWithDecimals(value, 2) + }, + header: { + label1: "label1header", + label2: "label2header", } }); @@ -51,39 +55,48 @@ add_task(function* () { is(title.getAttribute("value"), "Table title", "The title node displays the correct text."); - is(rows.length, 3, "There should be 3 table chart rows created."); + is(rows.length, 4, "There should be 3 table chart rows and a header created."); - ok(rows[0].querySelector(".table-chart-row-box.chart-colored-blob"), - "A colored blob exists for the firt row."); is(rows[0].querySelectorAll("label")[0].getAttribute("name"), "label1", - "The first column of the first row exists."); + "The first column of the header exists."); is(rows[0].querySelectorAll("label")[1].getAttribute("name"), "label2", + "The second column of the header exists."); + is(rows[0].querySelectorAll("span")[0].textContent, "label1header", + "The first column of the header displays the correct text."); + is(rows[0].querySelectorAll("span")[1].textContent, "label2header", + "The second column of the header displays the correct text."); + + ok(rows[1].querySelector(".table-chart-row-box.chart-colored-blob"), + "A colored blob exists for the firt row."); + is(rows[1].querySelectorAll("span")[0].getAttribute("name"), "label1", + "The first column of the first row exists."); + is(rows[1].querySelectorAll("span")[1].getAttribute("name"), "label2", "The second column of the first row exists."); - is(rows[0].querySelectorAll("label")[0].getAttribute("value"), "1", + is(rows[1].querySelectorAll("label")[0].getAttribute("value"), "1", "The first column of the first row displays the correct text."); - is(rows[0].querySelectorAll("label")[1].getAttribute("value"), "11.1foo", + is(rows[1].querySelectorAll("label")[1].getAttribute("value"), "11.1foo", "The second column of the first row displays the correct text."); - ok(rows[1].querySelector(".table-chart-row-box.chart-colored-blob"), + ok(rows[2].querySelector(".table-chart-row-box.chart-colored-blob"), "A colored blob exists for the second row."); - is(rows[1].querySelectorAll("label")[0].getAttribute("name"), "label1", + is(rows[2].querySelectorAll("label")[0].getAttribute("name"), "label1", "The first column of the second row exists."); - is(rows[1].querySelectorAll("label")[1].getAttribute("name"), "label2", + is(rows[2].querySelectorAll("label")[1].getAttribute("name"), "label2", "The second column of the second row exists."); - is(rows[1].querySelectorAll("label")[0].getAttribute("value"), "2", + is(rows[2].querySelectorAll("label")[0].getAttribute("value"), "2", "The first column of the second row displays the correct text."); - is(rows[1].querySelectorAll("label")[1].getAttribute("value"), "12.2bar", + is(rows[2].querySelectorAll("label")[1].getAttribute("value"), "12.2bar", "The second column of the first row displays the correct text."); - ok(rows[2].querySelector(".table-chart-row-box.chart-colored-blob"), + ok(rows[3].querySelector(".table-chart-row-box.chart-colored-blob"), "A colored blob exists for the third row."); - is(rows[2].querySelectorAll("label")[0].getAttribute("name"), "label1", + is(rows[3].querySelectorAll("label")[0].getAttribute("name"), "label1", "The first column of the third row exists."); - is(rows[2].querySelectorAll("label")[1].getAttribute("name"), "label2", + is(rows[3].querySelectorAll("label")[1].getAttribute("name"), "label2", "The second column of the third row exists."); - is(rows[2].querySelectorAll("label")[0].getAttribute("value"), "3", + is(rows[3].querySelectorAll("label")[0].getAttribute("value"), "3", "The first column of the third row displays the correct text."); - is(rows[2].querySelectorAll("label")[1].getAttribute("value"), "13.3baz", + is(rows[3].querySelectorAll("label")[1].getAttribute("value"), "13.3baz", "The second column of the third row displays the correct text."); is(sums.length, 2, "There should be 2 total summaries created."); diff --git a/devtools/client/netmonitor/test/browser_net_charts-04.js b/devtools/client/netmonitor/test/browser_net_charts-04.js index 0d150c409..921701ae5 100644 --- a/devtools/client/netmonitor/test/browser_net_charts-04.js +++ b/devtools/client/netmonitor/test/browser_net_charts-04.js @@ -22,6 +22,10 @@ add_task(function* () { totals: { label1: value => "Hello " + L10N.numberWithDecimals(value, 2), label2: value => "World " + L10N.numberWithDecimals(value, 2) + }, + header: { + label1: "", + label2: "" } }); @@ -40,17 +44,17 @@ add_task(function* () { is(title.getAttribute("value"), "Table title", "The title node displays the correct text."); - is(rows.length, 1, "There should be 1 table chart row created."); + is(rows.length, 2, "There should be 1 table chart row and a 1 header created."); - ok(rows[0].querySelector(".table-chart-row-box.chart-colored-blob"), + ok(rows[1].querySelector(".table-chart-row-box.chart-colored-blob"), "A colored blob exists for the firt row."); - is(rows[0].querySelectorAll("label")[0].getAttribute("name"), "size", + is(rows[1].querySelectorAll("label")[0].getAttribute("name"), "size", "The first column of the first row exists."); - is(rows[0].querySelectorAll("label")[1].getAttribute("name"), "label", + is(rows[1].querySelectorAll("label")[1].getAttribute("name"), "label", "The second column of the first row exists."); - is(rows[0].querySelectorAll("label")[0].getAttribute("value"), "", + is(rows[1].querySelectorAll("label")[0].getAttribute("value"), "", "The first column of the first row displays the correct text."); - is(rows[0].querySelectorAll("label")[1].getAttribute("value"), + is(rows[1].querySelectorAll("label")[1].getAttribute("value"), L10N.getStr("tableChart.loading"), "The second column of the first row displays the correct text."); diff --git a/devtools/client/netmonitor/test/browser_net_charts-05.js b/devtools/client/netmonitor/test/browser_net_charts-05.js index 00445b132..c444d2c65 100644 --- a/devtools/client/netmonitor/test/browser_net_charts-05.js +++ b/devtools/client/netmonitor/test/browser_net_charts-05.js @@ -33,6 +33,10 @@ add_task(function* () { totals: { size: value => "Hello " + L10N.numberWithDecimals(value, 2), label: value => "World " + L10N.numberWithDecimals(value, 2) + }, + header: { + label1: "", + label2: "" } }); @@ -53,9 +57,9 @@ add_task(function* () { ok(node.querySelector(".table-chart-container"), "A table chart was created successfully."); - is(rows.length, 3, "There should be 3 pie chart slices created."); - is(rows.length, 3, "There should be 3 table chart rows created."); - is(sums.length, 2, "There should be 2 total summaries created."); + is(rows.length, 4, "There should be 3 pie chart slices and 1 header created."); + is(rows.length, 4, "There should be 3 table chart rows and 1 header created."); + is(sums.length, 2, "There should be 2 total summaries and 1 header created."); yield teardown(monitor); }); diff --git a/devtools/client/netmonitor/test/browser_net_charts-07.js b/devtools/client/netmonitor/test/browser_net_charts-07.js index bb992e4eb..a655f258c 100644 --- a/devtools/client/netmonitor/test/browser_net_charts-07.js +++ b/devtools/client/netmonitor/test/browser_net_charts-07.js @@ -20,6 +20,10 @@ add_task(function* () { totals: { label1: value => "Hello " + L10N.numberWithDecimals(value, 2), label2: value => "World " + L10N.numberWithDecimals(value, 2) + }, + header: { + label1: "", + label2: "" } }); @@ -29,17 +33,17 @@ add_task(function* () { let rows = grid.querySelectorAll(".table-chart-row"); let sums = node.querySelectorAll(".table-chart-summary-label"); - is(rows.length, 1, "There should be 1 table chart row created."); + is(rows.length, 2, "There should be 1 table chart row and 1 header created."); - ok(rows[0].querySelector(".table-chart-row-box.chart-colored-blob"), + ok(rows[1].querySelector(".table-chart-row-box.chart-colored-blob"), "A colored blob exists for the firt row."); - is(rows[0].querySelectorAll("label")[0].getAttribute("name"), "size", + is(rows[1].querySelectorAll("label")[0].getAttribute("name"), "size", "The first column of the first row exists."); - is(rows[0].querySelectorAll("label")[1].getAttribute("name"), "label", + is(rows[1].querySelectorAll("label")[1].getAttribute("name"), "label", "The second column of the first row exists."); - is(rows[0].querySelectorAll("label")[0].getAttribute("value"), "", + is(rows[1].querySelectorAll("label")[0].getAttribute("value"), "", "The first column of the first row displays the correct text."); - is(rows[0].querySelectorAll("label")[1].getAttribute("value"), + is(rows[1].querySelectorAll("label")[1].getAttribute("value"), L10N.getStr("tableChart.unavailable"), "The second column of the first row displays the correct text."); diff --git a/devtools/client/netmonitor/test/browser_net_curl-utils.js b/devtools/client/netmonitor/test/browser_net_curl-utils.js index 7a5fc7926..afac78cfc 100644 --- a/devtools/client/netmonitor/test/browser_net_curl-utils.js +++ b/devtools/client/netmonitor/test/browser_net_curl-utils.js @@ -7,7 +7,7 @@ * Tests Curl Utils functionality. */ -const { CurlUtils } = require("devtools/client/shared/curl"); +const { Curl, CurlUtils } = require("devtools/client/shared/curl"); add_task(function* () { let { tab, monitor } = yield initNetMonitor(CURL_UTILS_URL); @@ -18,7 +18,7 @@ add_task(function* () { RequestsMenu.lazyUpdate = false; - let wait = waitForNetworkEvents(monitor, 1, 3); + let wait = waitForNetworkEvents(monitor, 1, 4); yield ContentTask.spawn(tab.linkedBrowser, SIMPLE_SJS, function* (url) { content.wrappedJSObject.performRequests(url); }); @@ -27,8 +27,9 @@ add_task(function* () { let requests = { get: RequestsMenu.getItemAtIndex(0), post: RequestsMenu.getItemAtIndex(1), - multipart: RequestsMenu.getItemAtIndex(2), - multipartForm: RequestsMenu.getItemAtIndex(3) + patch: RequestsMenu.getItemAtIndex(2), + multipart: RequestsMenu.getItemAtIndex(3), + multipartForm: RequestsMenu.getItemAtIndex(4) }; let data = yield createCurlData(requests.get.attachment, gNetwork); @@ -37,6 +38,12 @@ add_task(function* () { data = yield createCurlData(requests.post.attachment, gNetwork); testIsUrlEncodedRequest(data); testWritePostDataTextParams(data); + testWriteEmptyPostDataTextParams(data); + testDataArgumentOnGeneratedCommand(data); + + data = yield createCurlData(requests.patch.attachment, gNetwork); + testWritePostDataTextParams(data); + testDataArgumentOnGeneratedCommand(data); data = yield createCurlData(requests.multipart.attachment, gNetwork); testIsMultipartRequest(data); @@ -85,6 +92,18 @@ function testWritePostDataTextParams(data) { "Should return a serialized representation of the request parameters"); } +function testWriteEmptyPostDataTextParams(data) { + let params = CurlUtils.writePostDataTextParams(null); + is(params, "", + "Should return a empty string when no parameters provided"); +} + +function testDataArgumentOnGeneratedCommand(data) { + let curlCommand = Curl.generateCommand(data); + ok(curlCommand.includes("--data"), + "Should return a curl command with --data"); +} + function testGetMultipartBoundary(data) { let boundary = CurlUtils.getMultipartBoundary(data); ok(/-{3,}\w+/.test(boundary), diff --git a/devtools/client/netmonitor/test/browser_net_footer-summary.js b/devtools/client/netmonitor/test/browser_net_footer-summary.js index e484b2097..8faa8470b 100644 --- a/devtools/client/netmonitor/test/browser_net_footer-summary.js +++ b/devtools/client/netmonitor/test/browser_net_footer-summary.js @@ -10,13 +10,14 @@ add_task(function* () { requestLongerTimeout(2); + let { getSummary } = require("devtools/client/netmonitor/selectors/index"); let { L10N } = require("devtools/client/netmonitor/l10n"); let { PluralForm } = require("devtools/shared/plural-form"); let { tab, monitor } = yield initNetMonitor(FILTERING_URL); info("Starting test... "); - let { $, NetMonitorView } = monitor.panelWin; + let { $, NetMonitorView, gStore } = monitor.panelWin; let { RequestsMenu } = NetMonitorView; RequestsMenu.lazyUpdate = false; @@ -43,33 +44,27 @@ add_task(function* () { yield teardown(monitor); function testStatus() { - let summary = $("#requests-menu-network-summary-button"); - let value = summary.getAttribute("label"); + const { count, contentSize, transferredSize, millis } = getSummary(gStore.getState()); + let value = $("#requests-menu-network-summary-button").textContent; info("Current summary: " + value); - let visibleItems = RequestsMenu.visibleItems; - let visibleRequestsCount = visibleItems.length; let totalRequestsCount = RequestsMenu.itemCount; - info("Current requests: " + visibleRequestsCount + " of " + totalRequestsCount + "."); + info("Current requests: " + count + " of " + totalRequestsCount + "."); - if (!totalRequestsCount || !visibleRequestsCount) { + if (!totalRequestsCount || !count) { is(value, L10N.getStr("networkMenu.empty"), "The current summary text is incorrect, expected an 'empty' label."); return; } - let totalBytes = RequestsMenu._getTotalBytesOfRequests(visibleItems); - let totalMillis = - RequestsMenu._getNewestRequest(visibleItems).attachment.endedMillis - - RequestsMenu._getOldestRequest(visibleItems).attachment.startedMillis; + info("Computed total bytes: " + contentSize); + info("Computed total millis: " + millis); - info("Computed total bytes: " + totalBytes); - info("Computed total millis: " + totalMillis); - - is(value, PluralForm.get(visibleRequestsCount, L10N.getStr("networkMenu.summary")) - .replace("#1", visibleRequestsCount) - .replace("#2", L10N.numberWithDecimals((totalBytes || 0) / 1024, 2)) - .replace("#3", L10N.numberWithDecimals((totalMillis || 0) / 1000, 2)) + is(value, PluralForm.get(count, L10N.getStr("networkMenu.summary2")) + .replace("#1", count) + .replace("#2", L10N.numberWithDecimals((contentSize || 0) / 1024, 2)) + .replace("#3", L10N.numberWithDecimals((transferredSize || 0) / 1024, 2)) + .replace("#4", L10N.numberWithDecimals((millis || 0) / 1000, 2)) , "The current summary text is incorrect."); } }); diff --git a/devtools/client/netmonitor/test/browser_net_security-details.js b/devtools/client/netmonitor/test/browser_net_security-details.js index 0a83b3ed9..61f39a414 100644 --- a/devtools/client/netmonitor/test/browser_net_security-details.js +++ b/devtools/client/netmonitor/test/browser_net_security-details.js @@ -66,6 +66,10 @@ add_task(function* () { checkLabel("#security-cert-issuer-o", "Mozilla Testing"); checkLabel("#security-cert-issuer-ou", "<Not Available>"); + // These two values can change. So only check they're not empty. + checkLabelNotEmpty("#security-keagroup-value"); + checkLabelNotEmpty("#security-signaturescheme-value"); + // Locale sensitive and varies between timezones. Cant't compare equality or // the test fails depending on which part of the world the test is executed. checkLabelNotEmpty("#security-cert-validity-begins"); diff --git a/devtools/client/netmonitor/test/browser_net_simple-request-data.js b/devtools/client/netmonitor/test/browser_net_simple-request-data.js index 1b952bd71..f21318d7a 100644 --- a/devtools/client/netmonitor/test/browser_net_simple-request-data.js +++ b/devtools/client/netmonitor/test/browser_net_simple-request-data.js @@ -226,6 +226,8 @@ function test() { "The eventTimings attachment has an incorrect |timings.blocked| property."); is(typeof requestItem.attachment.eventTimings.timings.dns, "number", "The eventTimings attachment has an incorrect |timings.dns| property."); + is(typeof requestItem.attachment.eventTimings.timings.ssl, "number", + "The eventTimings attachment has an incorrect |timings.ssl| property."); is(typeof requestItem.attachment.eventTimings.timings.connect, "number", "The eventTimings attachment has an incorrect |timings.connect| property."); is(typeof requestItem.attachment.eventTimings.timings.send, "number", diff --git a/devtools/client/netmonitor/test/html_curl-utils.html b/devtools/client/netmonitor/test/html_curl-utils.html index 8ff7ecdf0..eb5c0c5b6 100644 --- a/devtools/client/netmonitor/test/html_curl-utils.html +++ b/devtools/client/netmonitor/test/html_curl-utils.html @@ -52,6 +52,17 @@ xhr.send(params); } + function ajaxPatch(aUrl, aCallback) { + let xhr = new XMLHttpRequest(); + xhr.open("PATCH", aUrl, true); + xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest"); + xhr.onload = function() { + aCallback(); + }; + var params = "param1=value1¶m2=value2¶m3=value3"; + xhr.send(params); + } + function ajaxMultipart(aUrl, aCallback) { var xhr = new XMLHttpRequest(); xhr.open("POST", aUrl, true); @@ -88,8 +99,10 @@ function performRequests(aUrl) { ajaxGet(aUrl, () => { ajaxPost(aUrl, () => { - ajaxMultipart(aUrl, () => { - submitForm(); + ajaxPatch(aUrl, () => { + ajaxMultipart(aUrl, () => { + submitForm(); + }); }); }); }); diff --git a/devtools/client/netmonitor/toolbar-view.js b/devtools/client/netmonitor/toolbar-view.js index 28c3cf99b..1834d3ee9 100644 --- a/devtools/client/netmonitor/toolbar-view.js +++ b/devtools/client/netmonitor/toolbar-view.js @@ -7,6 +7,7 @@ const Provider = createFactory(require("devtools/client/shared/vendor/react-redu const FilterButtons = createFactory(require("./components/filter-buttons")); const ToggleButton = createFactory(require("./components/toggle-button")); const SearchBox = createFactory(require("./components/search-box")); +const SummaryButton = createFactory(require("./components/summary-button")); const { L10N } = require("./l10n"); // Shortcuts @@ -28,8 +29,9 @@ ToolbarView.prototype = { this._clearContainerNode = $("#react-clear-button-hook"); this._filterContainerNode = $("#react-filter-buttons-hook"); - this._toggleContainerNode = $("#react-details-pane-toggle-hook"); + this._summaryContainerNode = $("#react-summary-button-hook"); this._searchContainerNode = $("#react-search-box-hook"); + this._toggleContainerNode = $("#react-details-pane-toggle-hook"); // clear button ReactDOM.render(button({ @@ -47,6 +49,12 @@ ToolbarView.prototype = { FilterButtons() ), this._filterContainerNode); + // summary button + ReactDOM.render(Provider( + { store }, + SummaryButton() + ), this._summaryContainerNode); + // search box ReactDOM.render(Provider( { store }, @@ -68,8 +76,9 @@ ToolbarView.prototype = { ReactDOM.unmountComponentAtNode(this._clearContainerNode); ReactDOM.unmountComponentAtNode(this._filterContainerNode); - ReactDOM.unmountComponentAtNode(this._toggleContainerNode); + ReactDOM.unmountComponentAtNode(this._summaryContainerNode); ReactDOM.unmountComponentAtNode(this._searchContainerNode); + ReactDOM.unmountComponentAtNode(this._toggleContainerNode); } }; diff --git a/devtools/client/performance/performance-controller.js b/devtools/client/performance/performance-controller.js index e47a0c401..4bd272f41 100644 --- a/devtools/client/performance/performance-controller.js +++ b/devtools/client/performance/performance-controller.js @@ -527,11 +527,10 @@ var PerformanceController = { if (flags.testing) { return { supported: true, enabled: true }; } - let supported = system.constants.E10S_TESTING_ONLY; // This is only checked on tool startup -- requires a restart if // e10s subsequently enabled. let enabled = this._e10s; - return { supported, enabled }; + return { supported: false, enabled }; }, /** diff --git a/devtools/client/performance/test/browser_perf-recording-notices-05.js b/devtools/client/performance/test/browser_perf-recording-notices-05.js index b6267470d..7a6b6b6b9 100644 --- a/devtools/client/performance/test/browser_perf-recording-notices-05.js +++ b/devtools/client/performance/test/browser_perf-recording-notices-05.js @@ -41,8 +41,8 @@ add_task(function* () { enabled = true; PerformanceController._setMultiprocessAttributes(); ok($("#performance-view").getAttribute("e10s"), "", - "When e10s is enabled, but not supported, this probably means we no longer have " + - "E10S_TESTING_ONLY, and we have no e10s attribute."); + "When e10s is enabled, but not supported, this probably means we " + + "have no e10s attribute."); supported = true; enabled = true; diff --git a/devtools/client/scratchpad/scratchpad.js b/devtools/client/scratchpad/scratchpad.js index 306b635df..60221f39d 100644 --- a/devtools/client/scratchpad/scratchpad.js +++ b/devtools/client/scratchpad/scratchpad.js @@ -81,7 +81,7 @@ loader.lazyRequireGetter(this, "DebuggerServer", "devtools/server/main", true); loader.lazyRequireGetter(this, "DebuggerClient", "devtools/shared/client/main", true); loader.lazyRequireGetter(this, "EnvironmentClient", "devtools/shared/client/main", true); loader.lazyRequireGetter(this, "ObjectClient", "devtools/shared/client/main", true); -loader.lazyRequireGetter(this, "HUDService", "devtools/client/webconsole/hudservice"); +loader.lazyRequireGetter(this, "HUDService", "devtools/client/webconsole/hudservice", true); XPCOMUtils.defineLazyGetter(this, "REMOTE_TIMEOUT", () => Services.prefs.getIntPref("devtools.debugger.remote-timeout")); @@ -1744,6 +1744,9 @@ var Scratchpad = { this.editor.focus(); this.editor.setCursor({ line: lines.length, ch: lines.pop().length }); + // Add the commands controller for the source-editor. + this.editor.insertCommandsController(); + if (state) this.dirty = !state.saved; diff --git a/devtools/client/scratchpad/scratchpad.xul b/devtools/client/scratchpad/scratchpad.xul index 0603fa95e..8694c1bb5 100644 --- a/devtools/client/scratchpad/scratchpad.xul +++ b/devtools/client/scratchpad/scratchpad.xul @@ -121,7 +121,7 @@ <key id="sp-key-reloadAndRun" key="&reloadAndRun.key;" command="sp-cmd-reloadAndRun" - modifiers="accel,shift"/> + modifiers="shift,alt"/> <key id="sp-key-evalFunction" key="&evalFunction.key;" command="sp-cmd-evalFunction" diff --git a/devtools/client/scratchpad/test/browser_scratchpad_open_error_console.js b/devtools/client/scratchpad/test/browser_scratchpad_open_error_console.js index 4da2a2daf..418bdfb56 100644 --- a/devtools/client/scratchpad/test/browser_scratchpad_open_error_console.js +++ b/devtools/client/scratchpad/test/browser_scratchpad_open_error_console.js @@ -2,7 +2,7 @@ /* Any copyright is dedicated to the Public Domain. http://creativecommons.org/publicdomain/zero/1.0/ */ -const HUDService = require("devtools/client/webconsole/hudservice"); +const {HUDService} = require("devtools/client/webconsole/hudservice"); function test() { diff --git a/devtools/client/scratchpad/test/head.js b/devtools/client/scratchpad/test/head.js index 15619a169..955c037d7 100644 --- a/devtools/client/scratchpad/test/head.js +++ b/devtools/client/scratchpad/test/head.js @@ -9,6 +9,7 @@ const {FileUtils} = Cu.import("resource://gre/modules/FileUtils.jsm", {}); const {console} = Cu.import("resource://gre/modules/Console.jsm", {}); const {ScratchpadManager} = Cu.import("resource://devtools/client/scratchpad/scratchpad-manager.jsm", {}); const {require} = Cu.import("resource://devtools/shared/Loader.jsm", {}); +const {gDevTools} = require("devtools/client/framework/devtools"); const Services = require("Services"); const DevToolsUtils = require("devtools/shared/DevToolsUtils"); const flags = require("devtools/shared/flags"); diff --git a/devtools/client/shared/curl.js b/devtools/client/shared/curl.js index 978cbad9c..420fe6aa5 100644 --- a/devtools/client/shared/curl.js +++ b/devtools/client/shared/curl.js @@ -76,7 +76,8 @@ const Curl = { // Create post data. let postData = []; - if (utils.isUrlEncodedRequest(data) || data.method == "PUT") { + if (utils.isUrlEncodedRequest(data) || + ["PUT", "POST", "PATCH"].includes(data.method)) { postDataText = data.postDataText; postData.push("--data"); postData.push(escapeString(utils.writePostDataTextParams(postDataText))); @@ -107,7 +108,13 @@ const Curl = { // Add http version. if (data.httpVersion && data.httpVersion != DEFAULT_HTTP_VERSION) { - command.push("--" + data.httpVersion.split("/")[1]); + let version = data.httpVersion.split("/")[1]; + // curl accepts --http1.0, --http1.1 and --http2 for HTTP/1.0, HTTP/1.1 + // and HTTP/2 protocols respectively. But the corresponding values in + // data.httpVersion are HTTP/1.0, HTTP/1.1 and HTTP/2.0 + // So in case of HTTP/2.0 (which should ideally be HTTP/2) we are using + // only major version, and full version in other cases + command.push("--http" + (version == "2.0" ? version.split(".")[0] : version)); } // Add request headers. @@ -201,6 +208,9 @@ const CurlUtils = { * Post data parameters. */ writePostDataTextParams: function (postDataText) { + if (!postDataText) { + return ""; + } let lines = postDataText.split("\r\n"); return lines[lines.length - 1]; }, diff --git a/devtools/client/shared/developer-toolbar.js b/devtools/client/shared/developer-toolbar.js index 2528591a6..d84402418 100644 --- a/devtools/client/shared/developer-toolbar.js +++ b/devtools/client/shared/developer-toolbar.js @@ -449,7 +449,15 @@ DeveloperToolbar.prototype.show = function (focus) { [ this.tooltipPanel, this.outputPanel ] = panels; - this._doc.getElementById("menu_devToolbar").setAttribute("checked", "true"); + let checkboxValue = "true"; + let appmenuEl = this._doc.getElementById("appmenu_devToolbar"); + let menuEl = this._doc.getElementById("menu_devToolbar"); + if (appmenuEl) { + appmenuEl.setAttribute("checked", checkboxValue); + } + if (menuEl) { + menuEl.setAttribute("checked", checkboxValue); + } this.target = TargetFactory.forTab(this._chromeWindow.gBrowser.selectedTab); const options = { @@ -569,7 +577,15 @@ DeveloperToolbar.prototype.hide = function () { Services.prefs.setBoolPref("devtools.toolbar.visible", false); - this._doc.getElementById("menu_devToolbar").setAttribute("checked", "false"); + let checkboxValue = "false"; + let appmenuEl = this._doc.getElementById("appmenu_devToolbar"); + let menuEl = this._doc.getElementById("menu_devToolbar"); + if (appmenuEl) { + appmenuEl.setAttribute("checked", checkboxValue); + } + if (menuEl) { + menuEl.setAttribute("checked", checkboxValue); + } this.destroy(); this._telemetry.toolClosed("developertoolbar"); diff --git a/devtools/client/shared/moz.build b/devtools/client/shared/moz.build index 1c61970c0..7be4a0088 100644 --- a/devtools/client/shared/moz.build +++ b/devtools/client/shared/moz.build @@ -35,6 +35,7 @@ DevToolsModules( 'Jsbeautify.jsm', 'key-shortcuts.js', 'keycodes.js', + 'natural-sort.js', 'network-throttling-profiles.js', 'node-attribute-parser.js', 'options-view.js', diff --git a/devtools/client/shared/natural-sort.js b/devtools/client/shared/natural-sort.js new file mode 100644 index 000000000..904d76431 --- /dev/null +++ b/devtools/client/shared/natural-sort.js @@ -0,0 +1,106 @@ +/* + * Natural Sort algorithm for Javascript - Version 0.8.1 - Released under MIT license + * Author: Jim Palmer (based on chunking idea from Dave Koelle) + * + * Includes pull request to move regexes out of main function for performance + * increases. + * + * Repository: + * https://github.com/overset/javascript-natural-sort/ + */ + +"use strict"; + +var re = /(^([+\-]?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?(?=\D|\s|$))|^0x[\da-fA-F]+$|\d+)/g; +var sre = /^\s+|\s+$/g; // trim pre-post whitespace +var snre = /\s+/g; // normalize all whitespace to single ' ' character + +// eslint-disable-next-line +var dre = /(^([\w ]+,?[\w ]+)?[\w ]+,?[\w ]+\d+:\d+(:\d+)?[\w ]?|^\d{1,4}[\/\-]\d{1,4}[\/\-]\d{1,4}|^\w+, \w+ \d+, \d{4})/; +var hre = /^0x[0-9a-f]+$/i; +var ore = /^0/; +var b0re = /^\0/; +var e0re = /\0$/; + +exports.naturalSortCaseSensitive = +function naturalSortCaseSensitive(a, b) { + return naturalSort(a, b, false); +}; + +exports.naturalSortCaseInsensitive = +function naturalSortCaseInsensitive(a, b) { + return naturalSort(a, b, true); +}; + +/** + * Sort numbers, strings, IP Addresses, Dates, Filenames, version numbers etc. + * "the way humans do." + * + * This function should only be called via naturalSortCaseSensitive and + * naturalSortCaseInsensitive. + * + * e.g. [3, 2, 1, 10].sort(naturalSort) + * + * @param {Object} a + * Passed in by Array.sort(a, b) + * @param {Object} b + * Passed in by Array.sort(a, b) + * @param {Boolean} insensitive + * Should the search be case insensitive? + */ +function naturalSort(a, b, insensitive) { + // convert all to strings strip whitespace + let i = function (s) { + return (insensitive && ("" + s).toLowerCase() || "" + s) + .replace(sre, ""); + }; + let x = i(a) || ""; + let y = i(b) || ""; + // chunk/tokenize + let xN = x.replace(re, "\0$1\0").replace(e0re, "").replace(b0re, "").split("\0"); + let yN = y.replace(re, "\0$1\0").replace(e0re, "").replace(b0re, "").split("\0"); + // numeric, hex or date detection + let xD = parseInt(x.match(hre), 16) || (xN.length !== 1 && Date.parse(x)); + let yD = parseInt(y.match(hre), 16) || xD && y.match(dre) && Date.parse(y) || null; + let normChunk = function (s, l) { + // normalize spaces; find floats not starting with '0', string or 0 if + // not defined (Clint Priest) + return (!s.match(ore) || l == 1) && + parseFloat(s) || s.replace(snre, " ").replace(sre, "") || 0; + }; + let oFxNcL; + let oFyNcL; + + // first try and sort Hex codes or Dates + if (yD) { + if (xD < yD) { + return -1; + } else if (xD > yD) { + return 1; + } + } + + // natural sorting through split numeric strings and default strings + // eslint-disable-next-line + for (let cLoc = 0, xNl = xN.length, yNl = yN.length, numS = Math.max(xNl, yNl); cLoc < numS; cLoc++) { + oFxNcL = normChunk(xN[cLoc] || "", xNl); + oFyNcL = normChunk(yN[cLoc] || "", yNl); + + // handle numeric vs string comparison - number < string - (Kyle Adams) + if (isNaN(oFxNcL) !== isNaN(oFyNcL)) { + return isNaN(oFxNcL) ? 1 : -1; + } + // if unicode use locale comparison + // eslint-disable-next-line + if (/[^\x00-\x80]/.test(oFxNcL + oFyNcL) && oFxNcL.localeCompare) { + let comp = oFxNcL.localeCompare(oFyNcL); + return comp / Math.abs(comp); + } + if (oFxNcL < oFyNcL) { + return -1; + } else if (oFxNcL > oFyNcL) { + return 1; + } + } + return null; +} diff --git a/devtools/client/shared/output-parser.js b/devtools/client/shared/output-parser.js index 726c93b8b..b4fb1c6aa 100644 --- a/devtools/client/shared/output-parser.js +++ b/devtools/client/shared/output-parser.js @@ -40,8 +40,11 @@ const CSS_GRID_ENABLED_PREF = "layout.css.grid.enabled"; * where CSS_TYPES is defined in devtools/shared/css/properties-db.js * @param {Function} isValidOnClient - A function that checks if a css property * name/value combo is valid. + * @param {Function} supportsCssColor4ColorFunction - A function for checking + * the supporting of css-color-4 color function. */ -function OutputParser(document, {supportsType, isValidOnClient}) { +function OutputParser(document, + {supportsType, isValidOnClient, supportsCssColor4ColorFunction}) { this.parsed = []; this.doc = document; this.supportsType = supportsType; @@ -50,6 +53,8 @@ function OutputParser(document, {supportsType, isValidOnClient}) { this.angleSwatches = new WeakMap(); this._onColorSwatchMouseDown = this._onColorSwatchMouseDown.bind(this); this._onAngleSwatchMouseDown = this._onAngleSwatchMouseDown.bind(this); + + this.cssColor4 = supportsCssColor4ColorFunction(); } exports.OutputParser = OutputParser; @@ -188,7 +193,8 @@ OutputParser.prototype = { if (options.expectCubicBezier && token.text === "cubic-bezier") { this._appendCubicBezier(functionText, options); - } else if (colorOK() && colorUtils.isValidCSSColor(functionText)) { + } else if (colorOK() && + colorUtils.isValidCSSColor(functionText, this.cssColor4)) { this._appendColor(functionText, options); } else { this._appendTextNode(functionText); @@ -205,7 +211,8 @@ OutputParser.prototype = { options.expectDisplay && token.text === "grid" && text === token.text) { this._appendGrid(token.text, options); - } else if (colorOK() && colorUtils.isValidCSSColor(token.text)) { + } else if (colorOK() && + colorUtils.isValidCSSColor(token.text, this.cssColor4)) { this._appendColor(token.text, options); } else if (angleOK(token.text)) { this._appendAngle(token.text, options); @@ -218,7 +225,7 @@ OutputParser.prototype = { case "id": case "hash": { let original = text.substring(token.startOffset, token.endOffset); - if (colorOK() && colorUtils.isValidCSSColor(original)) { + if (colorOK() && colorUtils.isValidCSSColor(original, this.cssColor4)) { this._appendColor(original, options); } else { this._appendTextNode(original); @@ -394,7 +401,7 @@ OutputParser.prototype = { * _mergeOptions(). */ _appendColor: function (color, options = {}) { - let colorObj = new colorUtils.CssColor(color); + let colorObj = new colorUtils.CssColor(color, this.cssColor4); if (this._isValidColor(colorObj)) { let container = this._createNode("span", { diff --git a/devtools/client/shared/telemetry.js b/devtools/client/shared/telemetry.js index 64a299581..38a21cef6 100644 --- a/devtools/client/shared/telemetry.js +++ b/devtools/client/shared/telemetry.js @@ -163,6 +163,12 @@ Telemetry.prototype = { toolbareyedropper: { histogram: "DEVTOOLS_TOOLBAR_EYEDROPPER_OPENED_COUNT", }, + copyuniquecssselector: { + histogram: "DEVTOOLS_COPY_UNIQUE_CSS_SELECTOR_OPENED_COUNT", + }, + copyfullcssselector: { + histogram: "DEVTOOLS_COPY_FULL_CSS_SELECTOR_OPENED_COUNT", + }, developertoolbar: { histogram: "DEVTOOLS_DEVELOPERTOOLBAR_OPENED_COUNT", timerHistogram: "DEVTOOLS_DEVELOPERTOOLBAR_TIME_ACTIVE_SECONDS" diff --git a/devtools/client/shared/test/unit/test_cssColor-03.js b/devtools/client/shared/test/unit/test_cssColor-03.js index c3ef5a5c2..a081f7698 100644 --- a/devtools/client/shared/test/unit/test_cssColor-03.js +++ b/devtools/client/shared/test/unit/test_cssColor-03.js @@ -42,15 +42,15 @@ const CSS_COLOR_4_TESTS = [ function run_test() { for (let test of OLD_STYLE_TESTS) { - let ours = colorUtils.colorToRGBA(test, true); + let ours = colorUtils.colorToRGBA(test, false); let platform = DOMUtils.colorToRGBA(test); deepEqual(ours, platform, "color " + test + " matches DOMUtils"); ok(ours !== null, "'" + test + "' is a color"); } for (let test of CSS_COLOR_4_TESTS) { - let oursOld = colorUtils.colorToRGBA(test, true); - let oursNew = colorUtils.colorToRGBA(test, false); + let oursOld = colorUtils.colorToRGBA(test, false); + let oursNew = colorUtils.colorToRGBA(test, true); let platform = DOMUtils.colorToRGBA(test); notEqual(oursOld, platform, "old style parser for color " + test + " should not match DOMUtils"); diff --git a/devtools/client/shared/widgets/Chart.jsm b/devtools/client/shared/widgets/Chart.jsm index 0894a62ca..0b7cb71fb 100644 --- a/devtools/client/shared/widgets/Chart.jsm +++ b/devtools/client/shared/widgets/Chart.jsm @@ -105,7 +105,7 @@ function PieTableChart(node, pie, table) { * - "mouseout", when the mouse leaves a slice or a row * - "click", when the mouse enters a slice or a row */ -function createPieTableChart(document, { title, diameter, data, strings, totals, sorted }) { +function createPieTableChart(document, { title, diameter, data, strings, totals, sorted, header }) { if (data && sorted) { data = data.slice().sort((a, b) => +(a.size < b.size)); } @@ -119,7 +119,8 @@ function createPieTableChart(document, { title, diameter, data, strings, totals, title: title, data: data, strings: strings, - totals: totals + totals: totals, + header: header, }); let container = document.createElement("hbox"); @@ -338,7 +339,7 @@ function createPieChart(document, { data, width, height, centerX, centerY, radiu * - "mouseout", when the mouse leaves a row * - "click", when the mouse clicks a row */ -function createTableChart(document, { title, data, strings, totals }) { +function createTableChart(document, { title, data, strings, totals, header }) { strings = strings || {}; totals = totals || {}; let isPlaceholder = false; @@ -371,6 +372,24 @@ function createTableChart(document, { title, data, strings, totals }) { tableNode.className = "plain table-chart-grid"; container.appendChild(tableNode); + const headerNode = document.createElement("div"); + headerNode.className = "table-chart-row"; + + const headerBoxNode = document.createElement("div"); + headerBoxNode.className = "table-chart-row-box"; + headerNode.appendChild(headerBoxNode); + + for (let [key, value] of Object.entries(header)) { + let headerLabelNode = document.createElement("span"); + headerLabelNode.className = "plain table-chart-row-label"; + headerLabelNode.setAttribute("name", key); + headerLabelNode.textContent = value; + + headerNode.appendChild(headerLabelNode); + } + + tableNode.appendChild(headerNode); + for (let rowInfo of data) { let rowNode = document.createElement("hbox"); rowNode.className = "table-chart-row"; diff --git a/devtools/client/shared/widgets/TableWidget.js b/devtools/client/shared/widgets/TableWidget.js index 5dacd1b67..a0f0dfc11 100644 --- a/devtools/client/shared/widgets/TableWidget.js +++ b/devtools/client/shared/widgets/TableWidget.js @@ -8,6 +8,8 @@ loader.lazyRequireGetter(this, "setNamedTimeout", "devtools/client/shared/widgets/view-helpers", true); loader.lazyRequireGetter(this, "clearNamedTimeout", "devtools/client/shared/widgets/view-helpers", true); +loader.lazyRequireGetter(this, "naturalSortCaseInsensitive", + "devtools/client/shared/natural-sort", true); const {KeyCodes} = require("devtools/client/shared/keycodes"); const XUL_NS = "http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"; @@ -123,6 +125,8 @@ function TableWidget(node, options = {}) { TableWidget.prototype = { items: null, + editBookmark: null, + scrollIntoViewOnUpdate: null, /** * Getter for the headers context menu popup id. @@ -139,7 +143,12 @@ TableWidget.prototype = { */ set selectedRow(id) { for (let column of this.columns.values()) { - column.selectRow(id[this.uniqueId] || id); + if (id) { + column.selectRow(id[this.uniqueId] || id); + } else { + column.selectedRow = null; + column.selectRow(null); + } } }, @@ -615,8 +624,13 @@ TableWidget.prototype = { /** * Populates the header context menu with the names of the columns along with * displaying which columns are hidden or visible. + * + * @param {Array} privateColumns=[] + * An array of column names that should never appear in the table. This + * allows us to e.g. have an invisible compound primary key for a + * table's rows. */ - populateMenuPopup: function () { + populateMenuPopup: function (privateColumns = []) { if (!this.menupopup) { return; } @@ -626,6 +640,10 @@ TableWidget.prototype = { } for (let column of this.columns.values()) { + if (privateColumns.includes(column.id)) { + continue; + } + let menuitem = this.document.createElementNS(XUL_NS, "menuitem"); menuitem.setAttribute("label", column.header.getAttribute("value")); menuitem.setAttribute("data-id", column.id); @@ -663,16 +681,21 @@ TableWidget.prototype = { * Creates the columns in the table. Without calling this method, data cannot * be inserted into the table unless `initialColumns` was supplied. * - * @param {object} columns + * @param {Object} columns * A key value pair representing the columns of the table. Where the * key represents the id of the column and the value is the displayed * label in the header of the column. - * @param {string} sortOn + * @param {String} sortOn * The id of the column on which the table will be initially sorted on. - * @param {array} hiddenColumns + * @param {Array} hiddenColumns * Ids of all the columns that are hidden by default. + * @param {Array} privateColumns=[] + * An array of column names that should never appear in the table. This + * allows us to e.g. have an invisible compound primary key for a + * table's rows. */ - setColumns: function (columns, sortOn = this.sortedOn, hiddenColumns = []) { + setColumns: function (columns, sortOn = this.sortedOn, hiddenColumns = [], + privateColumns = []) { for (let column of this.columns.values()) { column.destroy(); } @@ -702,13 +725,18 @@ TableWidget.prototype = { } this.columns.set(id, new Column(this, id, columns[id])); - if (hiddenColumns.indexOf(id) > -1) { + if (hiddenColumns.includes(id) || privateColumns.includes(id)) { + // Hide the column. this.columns.get(id).toggleColumn(); + + if (privateColumns.includes(id)) { + this.columns.get(id).private = true; + } } } this.sortedOn = sortOn; this.sortBy(this.sortedOn); - this.populateMenuPopup(); + this.populateMenuPopup(privateColumns); }, /** @@ -778,6 +806,11 @@ TableWidget.prototype = { return; } + if (this.editBookmark && !this.items.has(this.editBookmark)) { + // Key has been updated... update bookmark. + this.editBookmark = item[this.uniqueId]; + } + let index = this.columns.get(this.sortedOn).push(item); for (let [key, column] of this.columns) { if (key != this.sortedOn) { @@ -814,7 +847,8 @@ TableWidget.prototype = { column.remove(item); column.updateZebra(); } - if (this.items.size == 0) { + if (this.items.size === 0) { + this.selectedRow = null; this.tbody.setAttribute("empty", "empty"); } @@ -857,6 +891,8 @@ TableWidget.prototype = { this.tbody.setAttribute("empty", "empty"); this.setPlaceholderText(this.emptyText); + this.selectedRow = null; + this.emit(EVENTS.TABLE_CLEARED, this); }, @@ -958,6 +994,9 @@ module.exports.TableWidget = TableWidget; * The displayed string on the column's header. */ function Column(table, id, header) { + // By default cells are visible in the UI. + this._private = false; + this.tbody = table.tbody; this.document = table.document; this.window = table.window; @@ -1041,6 +1080,23 @@ Column.prototype = { }, /** + * Get the private state of the column (visibility in the UI). + */ + get private() { + return this._private; + }, + + /** + * Set the private state of the column (visibility in the UI). + * + * @param {Boolean} state + * Private (true or false) + */ + set private(state) { + this._private = state; + }, + + /** * Sets the sorted value */ set sorted(value) { @@ -1115,7 +1171,9 @@ Column.prototype = { }, /** - * Called when a row is updated. + * Called when a row is updated e.g. a cell is changed. This means that + * for a new row this method will be called once for each column. If a single + * cell is changed this method will be called just once. * * @param {string} event * The event name of the event. i.e. EVENTS.ROW_UPDATED @@ -1124,7 +1182,23 @@ Column.prototype = { */ onRowUpdated: function (event, id) { this._updateItems(); + if (this.highlightUpdated && this.items[id] != null) { + if (this.table.scrollIntoViewOnUpdate) { + let cell = this.cells[this.items[id]]; + + // When a new row is created this method is called once for each column + // as each cell is updated. We can only scroll to cells if they are + // visible. We check for visibility and once we find the first visible + // cell in a row we scroll it into view and reset the + // scrollIntoViewOnUpdate flag. + if (cell.label.clientHeight > 0) { + cell.scrollIntoView(); + + this.table.scrollIntoViewOnUpdate = null; + } + } + if (this.table.editBookmark) { // A rows position in the table can change as the result of an edit. In // order to ensure that the correct row is highlighted after an edit we @@ -1136,6 +1210,7 @@ Column.prototype = { this.cells[this.items[id]].flash(); } + this.updateZebra(); }, @@ -1160,15 +1235,16 @@ Column.prototype = { */ selectRowAt: function (index) { if (this.selectedRow != null) { - this.cells[this.items[this.selectedRow]].toggleClass("theme-selected"); + this.cells[this.items[this.selectedRow]].classList.remove("theme-selected"); } - if (index < 0) { + + let cell = this.cells[index]; + if (cell) { + cell.classList.add("theme-selected"); + this.selectedRow = cell.id; + } else { this.selectedRow = null; - return; } - let cell = this.cells[index]; - cell.toggleClass("theme-selected"); - this.selectedRow = cell.id; }, /** @@ -1218,11 +1294,11 @@ Column.prototype = { let index; if (this.sorted == 1) { index = this.cells.findIndex(element => { - return value < element.value; + return naturalSortCaseInsensitive(value, element.value) === -1; }); } else { index = this.cells.findIndex(element => { - return value > element.value; + return naturalSortCaseInsensitive(value, element.value) === 1; }); } index = index >= 0 ? index : this.cells.length; @@ -1332,7 +1408,6 @@ Column.prototype = { this.cells = []; this.items = {}; this._itemsDirty = false; - this.selectedRow = null; while (this.header.nextSibling) { this.header.nextSibling.remove(); } @@ -1350,7 +1425,7 @@ Column.prototype = { a[this.id].textContent : a[this.id]; let val2 = (b[this.id] instanceof Node) ? b[this.id].textContent : b[this.id]; - return val1 > val2; + return naturalSortCaseInsensitive(val1, val2); }); } else if (this.sorted > 1) { items.sort((a, b) => { @@ -1358,12 +1433,12 @@ Column.prototype = { a[this.id].textContent : a[this.id]; let val2 = (b[this.id] instanceof Node) ? b[this.id].textContent : b[this.id]; - return val2 > val1; + return naturalSortCaseInsensitive(val2, val1); }); } if (this.selectedRow) { - this.cells[this.items[this.selectedRow]].toggleClass("theme-selected"); + this.cells[this.items[this.selectedRow]].classList.remove("theme-selected"); } this.items = {}; // Otherwise, just use the sorted array passed to update the cells value. @@ -1373,7 +1448,7 @@ Column.prototype = { this.cells[i].id = item[this.uniqueId]; }); if (this.selectedRow) { - this.cells[this.items[this.selectedRow]].toggleClass("theme-selected"); + this.cells[this.items[this.selectedRow]].classList.add("theme-selected"); } this._itemsDirty = false; this.updateZebra(); @@ -1387,7 +1462,9 @@ Column.prototype = { if (!cell.hidden) { i++; } - cell.toggleClass("even", !(i % 2)); + + let even = !(i % 2); + cell.classList.toggle("even", even); } }, @@ -1523,8 +1600,8 @@ Cell.prototype = { return this._value; }, - toggleClass: function (className, condition) { - this.label.classList.toggle(className, condition); + get classList() { + return this.label.classList; }, /** @@ -1550,6 +1627,10 @@ Cell.prototype = { this.label.focus(); }, + scrollIntoView: function () { + this.label.scrollIntoView(false); + }, + destroy: function () { this.label.remove(); this.label = null; diff --git a/devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js b/devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js index bf211b8b9..6a18ec12c 100644 --- a/devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js +++ b/devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js @@ -28,8 +28,12 @@ const XHTML_NS = "http://www.w3.org/1999/xhtml"; * inline editor. * @param {InspectorPanel} inspector * The inspector panel, needed for the eyedropper. + * @param {Function} supportsCssColor4ColorFunction + * A function for checking the supporting of css-color-4 color function. */ -function SwatchColorPickerTooltip(document, inspector) { +function SwatchColorPickerTooltip(document, + inspector, + {supportsCssColor4ColorFunction}) { let stylesheet = "chrome://devtools/content/shared/widgets/spectrum.css"; SwatchBasedEditorTooltip.call(this, document, stylesheet); @@ -40,6 +44,7 @@ function SwatchColorPickerTooltip(document, inspector) { this.spectrum = this.setColorPickerContent([0, 0, 0, 1]); this._onSpectrumColorChange = this._onSpectrumColorChange.bind(this); this._openEyeDropper = this._openEyeDropper.bind(this); + this.cssColor4 = supportsCssColor4ColorFunction(); } SwatchColorPickerTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, { @@ -159,14 +164,14 @@ SwatchColorPickerTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.pr }, _colorToRgba: function (color) { - color = new colorUtils.CssColor(color); + color = new colorUtils.CssColor(color, this.cssColor4); let rgba = color._getRGBATuple(); return [rgba.r, rgba.g, rgba.b, rgba.a]; }, _toDefaultType: function (color) { let colorObj = new colorUtils.CssColor(color); - colorObj.setAuthoredUnitFromColor(this._originalColor); + colorObj.setAuthoredUnitFromColor(this._originalColor, this.cssColor4); return colorObj.toString(); }, diff --git a/devtools/client/sourceeditor/editor-commands-controller.js b/devtools/client/sourceeditor/editor-commands-controller.js new file mode 100644 index 000000000..2587f9a1f --- /dev/null +++ b/devtools/client/sourceeditor/editor-commands-controller.js @@ -0,0 +1,97 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +"use strict"; + +/** + * The source editor exposes XUL commands that can be used when embedded in a XUL + * document. This controller drives the availability and behavior of the commands. When + * the editor input field is focused, this controller will update the matching menu item + * entries found in application menus or context menus. + */ + +/** + * Returns a controller object that can be used for editor-specific commands: + * - find + * - find again + * - go to line + * - undo + * - redo + * - delete + * - select all + */ +function createController(ed) { + return { + supportsCommand: function (cmd) { + switch (cmd) { + case "cmd_find": + case "cmd_findAgain": + case "cmd_gotoLine": + case "cmd_undo": + case "cmd_redo": + case "cmd_delete": + case "cmd_selectAll": + return true; + } + + return false; + }, + + isCommandEnabled: function (cmd) { + let cm = ed.codeMirror; + + switch (cmd) { + case "cmd_find": + case "cmd_gotoLine": + case "cmd_selectAll": + return true; + case "cmd_findAgain": + return cm.state.search != null && cm.state.search.query != null; + case "cmd_undo": + return ed.canUndo(); + case "cmd_redo": + return ed.canRedo(); + case "cmd_delete": + return ed.somethingSelected(); + } + + return false; + }, + + doCommand: function (cmd) { + let cm = ed.codeMirror; + + let map = { + "cmd_selectAll": "selectAll", + "cmd_find": "find", + "cmd_undo": "undo", + "cmd_redo": "redo", + "cmd_delete": "delCharAfter", + "cmd_findAgain": "findNext" + }; + + if (map[cmd]) { + cm.execCommand(map[cmd]); + return; + } + + if (cmd == "cmd_gotoLine") { + ed.jumpToLine(); + } + }, + + onEvent: function () {} + }; +} + +/** + * Create and insert a commands controller for the provided SourceEditor instance. + */ +function insertCommandsController(sourceEditor) { + let input = sourceEditor.codeMirror.getInputField(); + let controller = createController(sourceEditor); + input.controllers.insertControllerAt(0, controller); +} + +module.exports = { insertCommandsController }; diff --git a/devtools/client/sourceeditor/editor.js b/devtools/client/sourceeditor/editor.js index ce2136afc..1b3c1d31a 100644 --- a/devtools/client/sourceeditor/editor.js +++ b/devtools/client/sourceeditor/editor.js @@ -489,6 +489,16 @@ Editor.prototype = { }, /** + * The source editor can expose several commands linked from system and context menus. + * Kept for backward compatibility with scratchpad and styleeditor. + */ + insertCommandsController: function () { + const { insertCommandsController } = + require("devtools/client/sourceeditor/editor-commands-controller"); + insertCommandsController(this); + }, + + /** * Returns text from the text area. If line argument is provided * the method returns only that line. */ diff --git a/devtools/client/sourceeditor/moz.build b/devtools/client/sourceeditor/moz.build index 5081325c5..765accb14 100644 --- a/devtools/client/sourceeditor/moz.build +++ b/devtools/client/sourceeditor/moz.build @@ -12,6 +12,7 @@ DevToolsModules( 'autocomplete.js', 'css-autocompleter.js', 'debugger.js', + 'editor-commands-controller.js', 'editor.js' ) diff --git a/devtools/client/storage/storage.xul b/devtools/client/storage/storage.xul index 9fbef5199..fa006ac7c 100644 --- a/devtools/client/storage/storage.xul +++ b/devtools/client/storage/storage.xul @@ -26,13 +26,18 @@ <menupopup id="storage-tree-popup"> <menuitem id="storage-tree-popup-delete-all" label="&storage.popupMenu.deleteAllLabel;"/> + <menuitem id="storage-tree-popup-delete-all-session-cookies" + label="&storage.popupMenu.deleteAllSessionCookiesLabel;"/> <menuitem id="storage-tree-popup-delete"/> </menupopup> <menupopup id="storage-table-popup"> + <menuitem id="storage-table-popup-add"/> <menuitem id="storage-table-popup-delete"/> <menuitem id="storage-table-popup-delete-all-from"/> <menuitem id="storage-table-popup-delete-all" label="&storage.popupMenu.deleteAllLabel;"/> + <menuitem id="storage-table-popup-delete-all-session-cookies" + label="&storage.popupMenu.deleteAllSessionCookiesLabel;"/> </menupopup> </popupset> @@ -41,6 +46,11 @@ <splitter class="devtools-side-splitter"/> <vbox flex="1"> <hbox id="storage-toolbar" class="devtools-toolbar"> + <button id="add-button" + class="devtools-button add-button"></button> + <button id="refresh-button" + class="devtools-button refresh-button"></button> + <spacer flex="1"/> <textbox id="storage-searchbox" class="devtools-filterinput" type="search" diff --git a/devtools/client/storage/test/browser.ini b/devtools/client/storage/test/browser.ini index dd7f48bd7..0290aaa5e 100644 --- a/devtools/client/storage/test/browser.ini +++ b/devtools/client/storage/test/browser.ini @@ -7,7 +7,9 @@ support-files = storage-cookies.html storage-empty-objectstores.html storage-idb-delete-blocked.html + storage-indexeddb-duplicate-names.html storage-listings.html + storage-listings-with-fragment.html storage-localstorage.html storage-overflow.html storage-search.html @@ -19,25 +21,34 @@ support-files = !/devtools/client/framework/test/shared-head.js [browser_storage_basic.js] +[browser_storage_basic_with_fragment.js] [browser_storage_cache_delete.js] [browser_storage_cache_error.js] +[browser_storage_cookies_add.js] [browser_storage_cookies_delete_all.js] [browser_storage_cookies_domain.js] +[browser_storage_cookies_domain_port.js] [browser_storage_cookies_edit.js] [browser_storage_cookies_edit_keyboard.js] [browser_storage_cookies_tab_navigation.js] [browser_storage_delete.js] [browser_storage_delete_all.js] [browser_storage_delete_tree.js] -[browser_storage_dynamic_updates.js] +[browser_storage_dom_cache_disabled.js] +[browser_storage_dynamic_updates_cookies.js] +[browser_storage_dynamic_updates_localStorage.js] +[browser_storage_dynamic_updates_sessionStorage.js] [browser_storage_empty_objectstores.js] [browser_storage_indexeddb_delete.js] [browser_storage_indexeddb_delete_blocked.js] +[browser_storage_indexeddb_duplicate_names.js] +[browser_storage_localstorage_add.js] [browser_storage_localstorage_edit.js] [browser_storage_localstorage_error.js] [browser_storage_overflow.js] [browser_storage_search.js] [browser_storage_search_keyboard_trap.js] +[browser_storage_sessionstorage_add.js] [browser_storage_sessionstorage_edit.js] [browser_storage_sidebar.js] [browser_storage_sidebar_update.js] diff --git a/devtools/client/storage/test/browser_storage_basic.js b/devtools/client/storage/test/browser_storage_basic.js index 343d46170..35d08afce 100644 --- a/devtools/client/storage/test/browser_storage_basic.js +++ b/devtools/client/storage/test/browser_storage_basic.js @@ -2,6 +2,8 @@ * License, v. 2.0. If a copy of the MPL was not distributed with this * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +/* import-globals-from head.js */ + // Basic test to assert that the storage tree and table corresponding to each // item in the storage tree is correctly displayed @@ -21,10 +23,30 @@ "use strict"; const testCases = [ - [["cookies", "test1.example.org"], - ["c1", "cs2", "c3", "uc1"]], - [["cookies", "sectest1.example.org"], - ["uc1", "cs2", "sc1"]], + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c1", "test1.example.org", "/browser"), + getCookieId("cs2", ".example.org", "/"), + getCookieId("c3", "test1.example.org", "/"), + getCookieId("c4", ".example.org", "/"), + getCookieId("uc1", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/") + ] + ], + [ + ["cookies", "https://sectest1.example.org"], + [ + getCookieId("uc1", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/"), + getCookieId("cs2", ".example.org", "/"), + getCookieId("c4", ".example.org", "/"), + getCookieId("sc1", "sectest1.example.org", + "/browser/devtools/client/storage/test/"), + getCookieId("sc2", "sectest1.example.org", + "/browser/devtools/client/storage/test/") + ] + ], [["localStorage", "http://test1.example.org"], ["ls1", "ls2"]], [["localStorage", "http://sectest1.example.org"], @@ -38,28 +60,28 @@ const testCases = [ [["sessionStorage", "https://sectest1.example.org"], ["iframe-s-ss1"]], [["indexedDB", "http://test1.example.org"], - ["idb1", "idb2"]], - [["indexedDB", "http://test1.example.org", "idb1"], + ["idb1 (default)", "idb2 (default)"]], + [["indexedDB", "http://test1.example.org", "idb1 (default)"], ["obj1", "obj2"]], - [["indexedDB", "http://test1.example.org", "idb2"], + [["indexedDB", "http://test1.example.org", "idb2 (default)"], ["obj3"]], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], [1, 2, 3]], - [["indexedDB", "http://test1.example.org", "idb1", "obj2"], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj2"], [1]], - [["indexedDB", "http://test1.example.org", "idb2", "obj3"], + [["indexedDB", "http://test1.example.org", "idb2 (default)", "obj3"], []], [["indexedDB", "http://sectest1.example.org"], []], [["indexedDB", "https://sectest1.example.org"], - ["idb-s1", "idb-s2"]], - [["indexedDB", "https://sectest1.example.org", "idb-s1"], + ["idb-s1 (default)", "idb-s2 (default)"]], + [["indexedDB", "https://sectest1.example.org", "idb-s1 (default)"], ["obj-s1"]], - [["indexedDB", "https://sectest1.example.org", "idb-s2"], + [["indexedDB", "https://sectest1.example.org", "idb-s2 (default)"], ["obj-s2"]], - [["indexedDB", "https://sectest1.example.org", "idb-s1", "obj-s1"], + [["indexedDB", "https://sectest1.example.org", "idb-s1 (default)", "obj-s1"], [6, 7]], - [["indexedDB", "https://sectest1.example.org", "idb-s2", "obj-s2"], + [["indexedDB", "https://sectest1.example.org", "idb-s2 (default)", "obj-s2"], [16]], [["Cache", "http://test1.example.org", "plop"], [MAIN_DOMAIN + "404_cached_file.js", @@ -71,8 +93,8 @@ const testCases = [ */ function testTree() { let doc = gPanelWindow.document; - for (let item of testCases) { - ok(doc.querySelector("[data-id='" + JSON.stringify(item[0]) + "']"), + for (let [item] of testCases) { + ok(doc.querySelector("[data-id='" + JSON.stringify(item) + "']"), "Tree item " + item[0] + " should be present in the storage tree"); } } @@ -86,8 +108,8 @@ function* testTables() { gUI.tree.expandAll(); // First tree item is already selected so no clicking and waiting for update - for (let id of testCases[0][1]) { - ok(doc.querySelector(".table-widget-cell[data-id='" + id + "']"), + for (let [treeItem, items] of testCases.slice(1)) { + yield selectTreeItem(treeItem); "Table item " + id + " should be present"); } @@ -98,10 +120,10 @@ function* testTables() { // Check whether correct number of items are present in the table is(doc.querySelectorAll( ".table-widget-wrapper:first-of-type .table-widget-cell" - ).length, item[1].length, "Number of items in table is correct"); + ).length, items.length, "Number of items in table is correct"); // Check if all the desired items are present in the table - for (let id of item[1]) { + for (let id of items) { ok(doc.querySelector(".table-widget-cell[data-id='" + id + "']"), "Table item " + id + " should be present"); } diff --git a/devtools/client/storage/test/browser_storage_basic_with_fragment.js b/devtools/client/storage/test/browser_storage_basic_with_fragment.js new file mode 100644 index 000000000..7769781c0 --- /dev/null +++ b/devtools/client/storage/test/browser_storage_basic_with_fragment.js @@ -0,0 +1,139 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* import-globals-from head.js */ + +// A second basic test to assert that the storage tree and table corresponding +// to each item in the storage tree is correctly displayed. + +// This test differs from browser_storage_basic.js because the URLs we load +// include fragments e.g. http://example.com/test.js#abcdefg +// ^^^^^^^^ +// fragment + +// Entries that should be present in the tree for this test +// Format for each entry in the array : +// [ +// ["path", "to", "tree", "item"], - The path to the tree item to click formed +// by id of each item +// ["key_value1", "key_value2", ...] - The value of the first (unique) column +// for each row in the table corresponding +// to the tree item selected. +// ] +// These entries are formed by the cookies, local storage, session storage and +// indexedDB entries created in storage-listings.html, +// storage-secured-iframe.html and storage-unsecured-iframe.html + +"use strict"; + +const testCases = [ + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c1", "test1.example.org", "/browser"), + getCookieId("cs2", ".example.org", "/"), + getCookieId("c3", "test1.example.org", "/"), + getCookieId("uc1", ".example.org", "/") + ] + ], + [ + ["cookies", "https://sectest1.example.org"], + [ + getCookieId("uc1", ".example.org", "/"), + getCookieId("cs2", ".example.org", "/"), + getCookieId("sc1", "sectest1.example.org", "/browser/devtools/client/storage/test/") + ] + ], + [["localStorage", "http://test1.example.org"], + ["ls1", "ls2"]], + [["localStorage", "http://sectest1.example.org"], + ["iframe-u-ls1"]], + [["localStorage", "https://sectest1.example.org"], + ["iframe-s-ls1"]], + [["sessionStorage", "http://test1.example.org"], + ["ss1"]], + [["sessionStorage", "http://sectest1.example.org"], + ["iframe-u-ss1", "iframe-u-ss2"]], + [["sessionStorage", "https://sectest1.example.org"], + ["iframe-s-ss1"]], + [["indexedDB", "http://test1.example.org"], + ["idb1 (default)", "idb2 (default)"]], + [["indexedDB", "http://test1.example.org", "idb1 (default)"], + ["obj1", "obj2"]], + [["indexedDB", "http://test1.example.org", "idb2 (default)"], + ["obj3"]], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], + [1, 2, 3]], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj2"], + [1]], + [["indexedDB", "http://test1.example.org", "idb2 (default)", "obj3"], + []], + [["indexedDB", "http://sectest1.example.org"], + []], + [["indexedDB", "https://sectest1.example.org"], + ["idb-s1 (default)", "idb-s2 (default)"]], + [["indexedDB", "https://sectest1.example.org", "idb-s1 (default)"], + ["obj-s1"]], + [["indexedDB", "https://sectest1.example.org", "idb-s2 (default)"], + ["obj-s2"]], + [["indexedDB", "https://sectest1.example.org", "idb-s1 (default)", "obj-s1"], + [6, 7]], + [["indexedDB", "https://sectest1.example.org", "idb-s2 (default)", "obj-s2"], + [16]], + [["Cache", "http://test1.example.org", "plop"], + [MAIN_DOMAIN + "404_cached_file.js", + MAIN_DOMAIN + "browser_storage_basic.js"]], +]; + +/** + * Test that the desired number of tree items are present + */ +function testTree() { + let doc = gPanelWindow.document; + for (let [item] of testCases) { + ok(doc.querySelector("[data-id='" + JSON.stringify(item) + "']"), + "Tree item " + item[0] + " should be present in the storage tree"); + } +} + +/** + * Test that correct table entries are shown for each of the tree item + */ +function* testTables() { + let doc = gPanelWindow.document; + // Expand all nodes so that the synthesized click event actually works + gUI.tree.expandAll(); + + // First tree item is already selected so no clicking and waiting for update + for (let id of testCases[0][1]) { + ok(doc.querySelector(".table-widget-cell[data-id='" + id + "']"), + "Table item " + id + " should be present"); + } + + // Click rest of the tree items and wait for the table to be updated + for (let [treeItem, items] of testCases.slice(1)) { + yield selectTreeItem(treeItem); + + // Check whether correct number of items are present in the table + is(doc.querySelectorAll( + ".table-widget-wrapper:first-of-type .table-widget-cell" + ).length, items.length, "Number of items in table is correct"); + + // Check if all the desired items are present in the table + for (let id of items) { + ok(doc.querySelector(".table-widget-cell[data-id='" + id + "']"), + "Table item " + id + " should be present"); + } + } +} + +add_task(function* () { + yield openTabAndSetupStorage( + MAIN_DOMAIN + "storage-listings-with-fragment.html#abc"); + + testTree(); + yield testTables(); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_cookies_add.js b/devtools/client/storage/test/browser_storage_cookies_add.js new file mode 100644 index 000000000..ac66eb92c --- /dev/null +++ b/devtools/client/storage/test/browser_storage_cookies_add.js @@ -0,0 +1,20 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +// Basic test to check the adding of cookies. + +"use strict"; + +add_task(function* () { + yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-cookies.html"); + showAllColumns(true); + + yield performAdd(["cookies", "http://test1.example.org"]); + yield performAdd(["cookies", "http://test1.example.org"]); + yield performAdd(["cookies", "http://test1.example.org"]); + yield performAdd(["cookies", "http://test1.example.org"]); + yield performAdd(["cookies", "http://test1.example.org"]); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_cookies_delete_all.js b/devtools/client/storage/test/browser_storage_cookies_delete_all.js index 6e6008e66..f8e9bb288 100644 --- a/devtools/client/storage/test/browser_storage_cookies_delete_all.js +++ b/devtools/client/storage/test/browser_storage_cookies_delete_all.js @@ -8,11 +8,13 @@ // Test deleting all cookies -function* performDelete(store, rowName, deleteAll) { +function* performDelete(store, rowName, action) { let contextMenu = gPanelWindow.document.getElementById( "storage-table-popup"); let menuDeleteAllItem = contextMenu.querySelector( "#storage-table-popup-delete-all"); + let menuDeleteAllSessionCookiesItem = contextMenu.querySelector( + "#storage-table-popup-delete-all-session-cookies"); let menuDeleteAllFromItem = contextMenu.querySelector( "#storage-table-popup-delete-all-from"); @@ -21,17 +23,23 @@ function* performDelete(store, rowName, deleteAll) { yield selectTreeItem(store); let eventWait = gUI.once("store-objects-updated"); + let cells = getRowCells(rowName, true); - let cells = getRowCells(rowName); yield waitForContextMenu(contextMenu, cells.name, () => { info(`Opened context menu in ${storeName}, row '${rowName}'`); - if (deleteAll) { - menuDeleteAllItem.click(); - } else { - menuDeleteAllFromItem.click(); - let hostName = cells.host.value; - ok(menuDeleteAllFromItem.getAttribute("label").includes(hostName), + switch (action) { + case "deleteAll": + menuDeleteAllItem.click(); + break; + case "deleteAllSessionCookies": + menuDeleteAllSessionCookiesItem.click(); + break; + case "deleteAllFrom": + menuDeleteAllFromItem.click(); + let hostName = cells.host.value; + ok(menuDeleteAllFromItem.getAttribute("label").includes(hostName), `Context menu item label contains '${hostName}'`); + break; } }); @@ -43,31 +51,101 @@ add_task(function* () { info("test state before delete"); yield checkState([ - [["cookies", "test1.example.org"], ["c1", "c3", "cs2", "uc1"]], - [["cookies", "sectest1.example.org"], ["cs2", "sc1", "uc1"]], + [ + ["cookies", "http://test1.example.org"], [ + getCookieId("c1", "test1.example.org", "/browser"), + getCookieId("c3", "test1.example.org", "/"), + getCookieId("cs2", ".example.org", "/"), + getCookieId("c4", ".example.org", "/"), + getCookieId("uc1", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/") + ] + ], + [ + ["cookies", "https://sectest1.example.org"], [ + getCookieId("cs2", ".example.org", "/"), + getCookieId("c4", ".example.org", "/"), + getCookieId("sc1", "sectest1.example.org", + "/browser/devtools/client/storage/test/"), + getCookieId("sc2", "sectest1.example.org", + "/browser/devtools/client/storage/test/"), + getCookieId("uc1", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/") + ] + ], ]); info("delete all from domain"); // delete only cookies that match the host exactly - yield performDelete(["cookies", "test1.example.org"], "c1", false); + let id = getCookieId("c1", "test1.example.org", "/browser"); + yield performDelete(["cookies", "http://test1.example.org"], id, "deleteAllFrom"); info("test state after delete all from domain"); yield checkState([ // Domain cookies (.example.org) must not be deleted. - [["cookies", "test1.example.org"], ["cs2", "uc1"]], - [["cookies", "sectest1.example.org"], ["cs2", "sc1", "uc1"]], + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("cs2", ".example.org", "/"), + getCookieId("c4", ".example.org", "/"), + getCookieId("uc1", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/") + ] + ], + [ + ["cookies", "https://sectest1.example.org"], + [ + getCookieId("cs2", ".example.org", "/"), + getCookieId("c4", ".example.org", "/"), + getCookieId("uc1", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/"), + getCookieId("sc1", "sectest1.example.org", + "/browser/devtools/client/storage/test/"), + getCookieId("sc2", "sectest1.example.org", + "/browser/devtools/client/storage/test/") + ] + ], + ]); + + info("delete all session cookies"); + // delete only session cookies + id = getCookieId("cs2", ".example.org", "/"); + yield performDelete(["cookies", "sectest1.example.org"], id, + "deleteAllSessionCookies"); + + info("test state after delete all session cookies"); + yield checkState([ + // Cookies with expiry date must not be deleted. + [ + ["cookies", "test1.example.org"], + [ + getCookieId("c4", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/") + ] + ], + [ + ["cookies", "sectest1.example.org"], + [ + getCookieId("c4", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/"), + getCookieId("sc2", "sectest1.example.org", + "/browser/devtools/client/storage/test/") + ] + ], ]); info("delete all"); // delete all cookies for host, including domain cookies - yield performDelete(["cookies", "sectest1.example.org"], "uc1", true); + id = getCookieId("uc2", ".example.org", "/"); + yield performDelete(["cookies", "http://sectest1.example.org"], id, + "deleteAll"); info("test state after delete all"); yield checkState([ // Domain cookies (.example.org) are deleted too, so deleting in sectest1 // also removes stuff from test1. - [["cookies", "test1.example.org"], []], - [["cookies", "sectest1.example.org"], []], + [["cookies", "http://test1.example.org"], []], + [["cookies", "https://sectest1.example.org"], []], ]); yield finishTests(); diff --git a/devtools/client/storage/test/browser_storage_cookies_domain.js b/devtools/client/storage/test/browser_storage_cookies_domain.js index dc93d6e67..06f0a464d 100644 --- a/devtools/client/storage/test/browser_storage_cookies_domain.js +++ b/devtools/client/storage/test/browser_storage_cookies_domain.js @@ -13,8 +13,16 @@ add_task(function* () { yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-cookies.html"); yield checkState([ - [["cookies", "test1.example.org"], - ["test1", "test2", "test3", "test4", "test5"]], + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("test1", ".test1.example.org", "/browser"), + getCookieId("test2", "test1.example.org", "/browser"), + getCookieId("test3", ".test1.example.org", "/browser"), + getCookieId("test4", "test1.example.org", "/browser"), + getCookieId("test5", ".test1.example.org", "/browser") + ] + ], ]); yield finishTests(); diff --git a/devtools/client/storage/test/browser_storage_cookies_domain_port.js b/devtools/client/storage/test/browser_storage_cookies_domain_port.js new file mode 100644 index 000000000..a5bc2e5be --- /dev/null +++ b/devtools/client/storage/test/browser_storage_cookies_domain_port.js @@ -0,0 +1,29 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* import-globals-from ../../framework/test/shared-head.js */ + +"use strict"; + +// Test that cookies with domain equal to full host name and port are listed. +// E.g., ".example.org:8000" vs. example.org:8000). + +add_task(function* () { + yield openTabAndSetupStorage(MAIN_DOMAIN_WITH_PORT + "storage-cookies.html"); + + yield checkState([ + [ + ["cookies", "http://test1.example.org:8000"], + [ + getCookieId("test1", ".test1.example.org", "/browser"), + getCookieId("test2", "test1.example.org", "/browser"), + getCookieId("test3", ".test1.example.org", "/browser"), + getCookieId("test4", "test1.example.org", "/browser"), + getCookieId("test5", ".test1.example.org", "/browser") + ] + ], + ]); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_cookies_edit.js b/devtools/client/storage/test/browser_storage_cookies_edit.js index 5818e4864..14944b398 100644 --- a/devtools/client/storage/test/browser_storage_cookies_edit.js +++ b/devtools/client/storage/test/browser_storage_cookies_edit.js @@ -10,13 +10,20 @@ add_task(function* () { yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-cookies.html"); showAllColumns(true); - yield editCell("test3", "name", "newTest3"); - yield editCell("newTest3", "path", "/"); - yield editCell("newTest3", "host", "test1.example.org"); - yield editCell("newTest3", "expires", "Tue, 14 Feb 2040 17:41:14 GMT"); - yield editCell("newTest3", "value", "newValue3"); - yield editCell("newTest3", "isSecure", "true"); - yield editCell("newTest3", "isHttpOnly", "true"); + let id = getCookieId("test3", ".test1.example.org", "/browser"); + yield editCell(id, "name", "newTest3"); + + id = getCookieId("newTest3", ".test1.example.org", "/browser"); + yield editCell(id, "host", "test1.example.org"); + + id = getCookieId("newTest3", "test1.example.org", "/browser"); + yield editCell(id, "path", "/"); + + id = getCookieId("newTest3", "test1.example.org", "/"); + yield editCell(id, "expires", "Tue, 14 Feb 2040 17:41:14 GMT"); + yield editCell(id, "value", "newValue3"); + yield editCell(id, "isSecure", "true"); + yield editCell(id, "isHttpOnly", "true"); yield finishTests(); }); diff --git a/devtools/client/storage/test/browser_storage_cookies_edit_keyboard.js b/devtools/client/storage/test/browser_storage_cookies_edit_keyboard.js index 1208c4376..4bbb63fbe 100644 --- a/devtools/client/storage/test/browser_storage_cookies_edit_keyboard.js +++ b/devtools/client/storage/test/browser_storage_cookies_edit_keyboard.js @@ -10,10 +10,11 @@ add_task(function* () { yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-cookies.html"); showAllColumns(true); - yield startCellEdit("test4", "name"); + let id = getCookieId("test4", "test1.example.org", "/browser"); + yield startCellEdit(id, "name"); yield typeWithTerminator("test6", "VK_TAB"); - yield typeWithTerminator("/", "VK_TAB"); yield typeWithTerminator(".example.org", "VK_TAB"); + yield typeWithTerminator("/", "VK_TAB"); yield typeWithTerminator("Tue, 25 Dec 2040 12:00:00 GMT", "VK_TAB"); yield typeWithTerminator("test6value", "VK_TAB"); yield typeWithTerminator("false", "VK_TAB"); diff --git a/devtools/client/storage/test/browser_storage_cookies_tab_navigation.js b/devtools/client/storage/test/browser_storage_cookies_tab_navigation.js index 783a0c844..5da359b8d 100644 --- a/devtools/client/storage/test/browser_storage_cookies_tab_navigation.js +++ b/devtools/client/storage/test/browser_storage_cookies_tab_navigation.js @@ -10,7 +10,8 @@ add_task(function* () { yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-cookies.html"); showAllColumns(true); - yield startCellEdit("test1", "name"); + let id = getCookieId("test1", ".test1.example.org", "/browser"); + yield startCellEdit(id, "name"); PressKeyXTimes("VK_TAB", 18); is(getCurrentEditorValue(), "value3", diff --git a/devtools/client/storage/test/browser_storage_delete.js b/devtools/client/storage/test/browser_storage_delete.js index c0e2b0ad7..306c33d24 100644 --- a/devtools/client/storage/test/browser_storage_delete.js +++ b/devtools/client/storage/test/browser_storage_delete.js @@ -13,9 +13,11 @@ const TEST_CASES = [ "ls1", "name"], [["sessionStorage", "http://test1.example.org"], "ss1", "name"], - [["cookies", "test1.example.org"], - "c1", "name"], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"], + [ + ["cookies", "http://test1.example.org"], + getCookieId("c1", "test1.example.org", "/browser"), "name" + ], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], 1, "name"], [["Cache", "http://test1.example.org", "plop"], MAIN_DOMAIN + "404_cached_file.js", "url"], @@ -41,7 +43,7 @@ add_task(function* () { yield waitForContextMenu(contextMenu, row[cellToClick], () => { info(`Opened context menu in ${treeItemName}, row '${rowName}'`); menuDeleteItem.click(); - let truncatedRowName = String(rowName).substr(0, 16); + let truncatedRowName = String(rowName).replace(SEPARATOR_GUID, "-").substr(0, 16); ok(menuDeleteItem.getAttribute("label").includes(truncatedRowName), `Context menu item label contains '${rowName}' (maybe truncated)`); }); diff --git a/devtools/client/storage/test/browser_storage_delete_all.js b/devtools/client/storage/test/browser_storage_delete_all.js index c4b6048fb..60b417bdb 100644 --- a/devtools/client/storage/test/browser_storage_delete_all.js +++ b/devtools/client/storage/test/browser_storage_delete_all.js @@ -29,7 +29,7 @@ add_task(function* () { ["iframe-u-ss1", "iframe-u-ss2"]], [["sessionStorage", "https://sectest1.example.org"], ["iframe-s-ss1"]], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], [1, 2, 3]], [["Cache", "http://test1.example.org", "plop"], [MAIN_DOMAIN + "404_cached_file.js", MAIN_DOMAIN + "browser_storage_basic.js"]], @@ -41,7 +41,7 @@ add_task(function* () { const deleteHosts = [ [["localStorage", "https://sectest1.example.org"], "iframe-s-ls1", "name"], [["sessionStorage", "https://sectest1.example.org"], "iframe-s-ss1", "name"], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"], 1, "name"], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], 1, "name"], [["Cache", "http://test1.example.org", "plop"], MAIN_DOMAIN + "404_cached_file.js", "url"], ]; @@ -78,7 +78,7 @@ add_task(function* () { ["iframe-u-ss1", "iframe-u-ss2"]], [["sessionStorage", "https://sectest1.example.org"], []], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], []], [["Cache", "http://test1.example.org", "plop"], []], diff --git a/devtools/client/storage/test/browser_storage_delete_tree.js b/devtools/client/storage/test/browser_storage_delete_tree.js index 867a1c8b6..6705dba8a 100644 --- a/devtools/client/storage/test/browser_storage_delete_tree.js +++ b/devtools/client/storage/test/browser_storage_delete_tree.js @@ -17,20 +17,30 @@ add_task(function* () { info("test state before delete"); yield checkState([ - [["cookies", "test1.example.org"], ["c1", "c3", "cs2", "uc1"]], + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c1", "test1.example.org", "/browser"), + getCookieId("cs2", ".example.org", "/"), + getCookieId("c3", "test1.example.org", "/"), + getCookieId("c4", ".example.org", "/"), + getCookieId("uc1", ".example.org", "/"), + getCookieId("uc2", ".example.org", "/") + ] + ], [["localStorage", "http://test1.example.org"], ["ls1", "ls2"]], [["sessionStorage", "http://test1.example.org"], ["ss1"]], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"], [1, 2, 3]], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], [1, 2, 3]], [["Cache", "http://test1.example.org", "plop"], [MAIN_DOMAIN + "404_cached_file.js", MAIN_DOMAIN + "browser_storage_basic.js"]], ]); info("do the delete"); const deleteHosts = [ - ["cookies", "test1.example.org"], + ["cookies", "http://test1.example.org"], ["localStorage", "http://test1.example.org"], ["sessionStorage", "http://test1.example.org"], - ["indexedDB", "http://test1.example.org", "idb1", "obj1"], + ["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], ["Cache", "http://test1.example.org", "plop"], ]; @@ -56,10 +66,10 @@ add_task(function* () { info("test state after delete"); yield checkState([ - [["cookies", "test1.example.org"], []], + [["cookies", "http://test1.example.org"], []], [["localStorage", "http://test1.example.org"], []], [["sessionStorage", "http://test1.example.org"], []], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"], []], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], []], [["Cache", "http://test1.example.org", "plop"], []], ]); diff --git a/devtools/client/storage/test/browser_storage_dom_cache_disabled.js b/devtools/client/storage/test/browser_storage_dom_cache_disabled.js new file mode 100644 index 000000000..db0aca392 --- /dev/null +++ b/devtools/client/storage/test/browser_storage_dom_cache_disabled.js @@ -0,0 +1,37 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* import-globals-from ../../framework/test/shared-head.js */ + +"use strict"; + +// Test the storage inspector when dom.caches.enabled=false. + +add_task(function* () { + // Disable the DOM cache + Services.prefs.setBoolPref(DOM_CACHE, false); + + yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-listings.html"); + + const state = [ + [["localStorage", "http://test1.example.org"], + ["ls1", "ls2"]], + [["localStorage", "http://sectest1.example.org"], + ["iframe-u-ls1"]], + [["localStorage", "https://sectest1.example.org"], + ["iframe-s-ls1"]], + [["sessionStorage", "http://test1.example.org"], + ["ss1"]], + [["sessionStorage", "http://sectest1.example.org"], + ["iframe-u-ss1", "iframe-u-ss2"]], + [["sessionStorage", "https://sectest1.example.org"], + ["iframe-s-ss1"]], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], + [1, 2, 3]], + ]; + + yield checkState(state); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_dynamic_updates_cookies.js b/devtools/client/storage/test/browser_storage_dynamic_updates_cookies.js new file mode 100644 index 000000000..032e7b7b9 --- /dev/null +++ b/devtools/client/storage/test/browser_storage_dynamic_updates_cookies.js @@ -0,0 +1,188 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +"use strict"; + +// Test dynamic updates in the storage inspector for cookies. + +add_task(function* () { + yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-updates.html"); + + gUI.tree.expandAll(); + + ok(gUI.sidebar.hidden, "Sidebar is initially hidden"); + let c1id = getCookieId("c1", "test1.example.org", "/browser"); + yield selectTableItem(c1id); + + // test that value is something initially + let initialValue = [[ + {name: "c1", value: "1.2.3.4.5.6.7"}, + {name: "c1.Path", value: "/browser"} + ], [ + {name: "c1", value: "Array"}, + {name: "c1.0", value: "1"}, + {name: "c1.6", value: "7"} + ]]; + + // test that value is something initially + let finalValue = [[ + {name: "c1", value: '{"foo": 4,"bar":6}'}, + {name: "c1.Path", value: "/browser"} + ], [ + {name: "c1", value: "Object"}, + {name: "c1.foo", value: "4"}, + {name: "c1.bar", value: "6"} + ]]; + + // Check that sidebar shows correct initial value + yield findVariableViewProperties(initialValue[0], false); + + yield findVariableViewProperties(initialValue[1], true); + // Check if table shows correct initial value + + yield checkState([ + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c1", "test1.example.org", "/browser"), + getCookieId("c2", "test1.example.org", "/browser") + ] + ], + ]); + checkCell(c1id, "value", "1.2.3.4.5.6.7"); + + gWindow.addCookie("c1", '{"foo": 4,"bar":6}', "/browser"); + yield gUI.once("sidebar-updated"); + + yield findVariableViewProperties(finalValue[0], false); + yield findVariableViewProperties(finalValue[1], true); + + yield checkState([ + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c1", "test1.example.org", "/browser"), + getCookieId("c2", "test1.example.org", "/browser") + ] + ], + ]); + checkCell(c1id, "value", '{"foo": 4,"bar":6}'); + + // Add a new entry + gWindow.addCookie("c3", "booyeah"); + + // Wait once for update and another time for value fetching + yield gUI.once("store-objects-updated"); + yield gUI.once("store-objects-updated"); + + yield checkState([ + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c1", "test1.example.org", "/browser"), + getCookieId("c2", "test1.example.org", "/browser"), + getCookieId("c3", "test1.example.org", + "/browser/devtools/client/storage/test/") + ] + ], + ]); + let c3id = getCookieId("c3", "test1.example.org", + "/browser/devtools/client/storage/test/"); + checkCell(c3id, "value", "booyeah"); + + // Add another + gWindow.addCookie("c4", "booyeah"); + + // Wait once for update and another time for value fetching + yield gUI.once("store-objects-updated"); + yield gUI.once("store-objects-updated"); + + yield checkState([ + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c1", "test1.example.org", "/browser"), + getCookieId("c2", "test1.example.org", "/browser"), + getCookieId("c3", "test1.example.org", + "/browser/devtools/client/storage/test/"), + getCookieId("c4", "test1.example.org", + "/browser/devtools/client/storage/test/") + ] + ], + ]); + let c4id = getCookieId("c4", "test1.example.org", + "/browser/devtools/client/storage/test/"); + checkCell(c4id, "value", "booyeah"); + + // Removing cookies + gWindow.removeCookie("c1", "/browser"); + + yield gUI.once("sidebar-updated"); + + yield checkState([ + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c2", "test1.example.org", "/browser"), + getCookieId("c3", "test1.example.org", + "/browser/devtools/client/storage/test/"), + getCookieId("c4", "test1.example.org", + "/browser/devtools/client/storage/test/") + ] + ], + ]); + + ok(!gUI.sidebar.hidden, "Sidebar still visible for next row"); + + // Check if next element's value is visible in sidebar + yield findVariableViewProperties([{name: "c2", value: "foobar"}]); + + // Keep deleting till no rows + gWindow.removeCookie("c3"); + + yield gUI.once("store-objects-updated"); + + yield checkState([ + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c2", "test1.example.org", "/browser"), + getCookieId("c4", "test1.example.org", + "/browser/devtools/client/storage/test/") + ] + ], + ]); + + // Check if next element's value is visible in sidebar + yield findVariableViewProperties([{name: "c2", value: "foobar"}]); + + gWindow.removeCookie("c2", "/browser"); + + yield gUI.once("sidebar-updated"); + + yield checkState([ + [ + ["cookies", "http://test1.example.org"], + [ + getCookieId("c4", "test1.example.org", + "/browser/devtools/client/storage/test/") + ] + ], + ]); + + // Check if next element's value is visible in sidebar + yield findVariableViewProperties([{name: "c4", value: "booyeah"}]); + + gWindow.removeCookie("c4"); + + yield gUI.once("store-objects-updated"); + + yield checkState([ + [["cookies", "http://test1.example.org"], [ ]], + ]); + + ok(gUI.sidebar.hidden, "Sidebar is hidden when no rows"); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_dynamic_updates_localStorage.js b/devtools/client/storage/test/browser_storage_dynamic_updates_localStorage.js new file mode 100644 index 000000000..35912ce3a --- /dev/null +++ b/devtools/client/storage/test/browser_storage_dynamic_updates_localStorage.js @@ -0,0 +1,70 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +"use strict"; + +// Test dynamic updates in the storage inspector for localStorage. + +add_task(function* () { + yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-updates.html"); + + gUI.tree.expandAll(); + + ok(gUI.sidebar.hidden, "Sidebar is initially hidden"); + + yield checkState([ + [ + ["localStorage", "http://test1.example.org"], + ["ls1", "ls2", "ls3", "ls4", "ls5", "ls6", "ls7"] + ], + ]); + + gWindow.localStorage.removeItem("ls4"); + + yield gUI.once("store-objects-updated"); + + yield checkState([ + [ + ["localStorage", "http://test1.example.org"], + ["ls1", "ls2", "ls3", "ls5", "ls6", "ls7"] + ], + ]); + + gWindow.localStorage.setItem("ls4", "again"); + + yield gUI.once("store-objects-updated"); + yield gUI.once("store-objects-updated"); + + yield checkState([ + [ + ["localStorage", "http://test1.example.org"], + ["ls1", "ls2", "ls3", "ls4", "ls5", "ls6", "ls7"] + ], + ]); + // Updating a row + gWindow.localStorage.setItem("ls2", "ls2-changed"); + + yield gUI.once("store-objects-updated"); + yield gUI.once("store-objects-updated"); + + checkCell("ls2", "value", "ls2-changed"); + + // Clearing items. Bug 1233497 makes it so that we can no longer yield + // CPOWs from Tasks. We work around this by calling clear via a ContentTask + // instead. + yield ContentTask.spawn(gBrowser.selectedBrowser, null, function* () { + return Task.spawn(content.wrappedJSObject.clear); + }); + + yield gUI.once("store-objects-cleared"); + + yield checkState([ + [ + ["localStorage", "http://test1.example.org"], + [ ] + ], + ]); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_dynamic_updates_sessionStorage.js b/devtools/client/storage/test/browser_storage_dynamic_updates_sessionStorage.js new file mode 100644 index 000000000..8c2f2537e --- /dev/null +++ b/devtools/client/storage/test/browser_storage_dynamic_updates_sessionStorage.js @@ -0,0 +1,83 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +"use strict"; + +// Test dynamic updates in the storage inspector for sessionStorage. + +add_task(function* () { + yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-updates.html"); + + gUI.tree.expandAll(); + + ok(gUI.sidebar.hidden, "Sidebar is initially hidden"); + yield checkState([ + [ + ["sessionStorage", "http://test1.example.org"], + ["ss1", "ss2", "ss3"] + ], + ]); + + gWindow.sessionStorage.setItem("ss4", "new-item"); + + yield gUI.once("store-objects-updated"); + yield gUI.once("store-objects-updated"); + + yield checkState([ + [ + ["sessionStorage", "http://test1.example.org"], + ["ss1", "ss2", "ss3", "ss4"] + ], + ]); + + // deleting item + + gWindow.sessionStorage.removeItem("ss3"); + + yield gUI.once("store-objects-updated"); + + gWindow.sessionStorage.removeItem("ss1"); + + yield gUI.once("store-objects-updated"); + + yield checkState([ + [ + ["sessionStorage", "http://test1.example.org"], + ["ss2", "ss4"] + ], + ]); + + yield selectTableItem("ss2"); + + ok(!gUI.sidebar.hidden, "sidebar is visible"); + + // Checking for correct value in sidebar before update + yield findVariableViewProperties([{name: "ss2", value: "foobar"}]); + + gWindow.sessionStorage.setItem("ss2", "changed=ss2"); + + yield gUI.once("sidebar-updated"); + + checkCell("ss2", "value", "changed=ss2"); + + yield findVariableViewProperties([{name: "ss2", value: "changed=ss2"}]); + + // Clearing items. Bug 1233497 makes it so that we can no longer yield + // CPOWs from Tasks. We work around this by calling clear via a ContentTask + // instead. + yield ContentTask.spawn(gBrowser.selectedBrowser, null, function* () { + return Task.spawn(content.wrappedJSObject.clear); + }); + + yield gUI.once("store-objects-cleared"); + + yield checkState([ + [ + ["sessionStorage", "http://test1.example.org"], + [ ] + ], + ]); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_empty_objectstores.js b/devtools/client/storage/test/browser_storage_empty_objectstores.js index 1749c91b8..e6f259742 100644 --- a/devtools/client/storage/test/browser_storage_empty_objectstores.js +++ b/devtools/client/storage/test/browser_storage_empty_objectstores.js @@ -21,14 +21,14 @@ // storage-secured-iframe.html and storage-unsecured-iframe.html const storeItems = [ [["indexedDB", "http://test1.example.org"], - ["idb1", "idb2"]], - [["indexedDB", "http://test1.example.org", "idb1"], + ["idb1 (default)", "idb2 (default)"]], + [["indexedDB", "http://test1.example.org", "idb1 (default)"], ["obj1", "obj2"]], - [["indexedDB", "http://test1.example.org", "idb2"], + [["indexedDB", "http://test1.example.org", "idb2 (default)"], []], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"], [1, 2, 3]], - [["indexedDB", "http://test1.example.org", "idb1", "obj2"], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj2"], [1]] ]; diff --git a/devtools/client/storage/test/browser_storage_indexeddb_delete.js b/devtools/client/storage/test/browser_storage_indexeddb_delete.js index 18a0daf69..5c499c9e9 100644 --- a/devtools/client/storage/test/browser_storage_indexeddb_delete.js +++ b/devtools/client/storage/test/browser_storage_indexeddb_delete.js @@ -16,11 +16,11 @@ add_task(function* () { info("test state before delete"); yield checkState([ - [["indexedDB", "http://test1.example.org"], ["idb1", "idb2"]], + [["indexedDB", "http://test1.example.org"], ["idb1 (default)", "idb2 (default)"]], ]); info("do the delete"); - const deletedDb = ["indexedDB", "http://test1.example.org", "idb1"]; + const deletedDb = ["indexedDB", "http://test1.example.org", "idb1 (default)"]; yield selectTreeItem(deletedDb); @@ -40,7 +40,7 @@ add_task(function* () { info("test state after delete"); yield checkState([ - [["indexedDB", "http://test1.example.org"], ["idb2"]], + [["indexedDB", "http://test1.example.org"], ["idb2 (default)"]], ]); yield finishTests(); diff --git a/devtools/client/storage/test/browser_storage_indexeddb_delete_blocked.js b/devtools/client/storage/test/browser_storage_indexeddb_delete_blocked.js index 6e89c4f28..2d77896f3 100644 --- a/devtools/client/storage/test/browser_storage_indexeddb_delete_blocked.js +++ b/devtools/client/storage/test/browser_storage_indexeddb_delete_blocked.js @@ -13,19 +13,19 @@ add_task(function* () { info("test state before delete"); yield checkState([ - [["indexedDB", "http://test1.example.org"], ["idb"]] + [["indexedDB", "http://test1.example.org"], ["idb (default)"]] ]); info("do the delete"); yield selectTreeItem(["indexedDB", "http://test1.example.org"]); - let actor = gUI.getCurrentActor(); - let result = yield actor.removeDatabase("http://test1.example.org", "idb"); + let front = gUI.getCurrentFront(); + let result = yield front.removeDatabase("http://test1.example.org", "idb (default)"); ok(result.blocked, "removeDatabase attempt is blocked"); info("test state after blocked delete"); yield checkState([ - [["indexedDB", "http://test1.example.org"], ["idb"]] + [["indexedDB", "http://test1.example.org"], ["idb (default)"]] ]); let eventWait = gUI.once("store-objects-updated"); @@ -47,7 +47,7 @@ add_task(function* () { info("try to delete database from nonexistent host"); let errorThrown = false; try { - result = yield actor.removeDatabase("http://test2.example.org", "idb"); + result = yield front.removeDatabase("http://test2.example.org", "idb (default)"); } catch (ex) { errorThrown = true; } diff --git a/devtools/client/storage/test/browser_storage_indexeddb_duplicate_names.js b/devtools/client/storage/test/browser_storage_indexeddb_duplicate_names.js new file mode 100644 index 000000000..8316d22c5 --- /dev/null +++ b/devtools/client/storage/test/browser_storage_indexeddb_duplicate_names.js @@ -0,0 +1,31 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +// Test to verify that indexedDBs with duplicate names (different types / paths) +// work as expected. + +"use strict"; + +add_task(function* () { + const TESTPAGE = MAIN_DOMAIN + "storage-indexeddb-duplicate-names.html"; + + setPermission(TESTPAGE, "indexedDB"); + + yield openTabAndSetupStorage(TESTPAGE); + + yield checkState([ + [ + ["indexedDB", "http://test1.example.org"], [ + "idb1 (default)", + "idb1 (temporary)", + "idb1 (persistent)", + "idb2 (default)", + "idb2 (temporary)", + "idb2 (persistent)" + ] + ] + ]); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_localstorage_add.js b/devtools/client/storage/test/browser_storage_localstorage_add.js new file mode 100644 index 000000000..de40957b8 --- /dev/null +++ b/devtools/client/storage/test/browser_storage_localstorage_add.js @@ -0,0 +1,20 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +// Basic test to check the adding of localStorage entries. + +"use strict"; + +add_task(function* () { + yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-localstorage.html"); + showAllColumns(true); + + yield performAdd(["localStorage", "http://test1.example.org"]); + yield performAdd(["localStorage", "http://test1.example.org"]); + yield performAdd(["localStorage", "http://test1.example.org"]); + yield performAdd(["localStorage", "http://test1.example.org"]); + yield performAdd(["localStorage", "http://test1.example.org"]); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_overflow.js b/devtools/client/storage/test/browser_storage_overflow.js index 88181ca05..21b931c8e 100644 --- a/devtools/client/storage/test/browser_storage_overflow.js +++ b/devtools/client/storage/test/browser_storage_overflow.js @@ -2,40 +2,58 @@ // inspector table. "use strict"; +const ITEMS_PER_PAGE = 50; + add_task(function* () { yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-overflow.html"); - let $ = id => gPanelWindow.document.querySelector(id); - let $$ = sel => gPanelWindow.document.querySelectorAll(sel); - gUI.tree.expandAll(); yield selectTreeItem(["localStorage", "http://test1.example.org"]); + checkCellLength(ITEMS_PER_PAGE); + + yield scroll(); + checkCellLength(ITEMS_PER_PAGE * 2); - let table = $("#storage-table .table-widget-body"); - let cellHeight = $(".table-widget-cell").getBoundingClientRect().height; + yield scroll(); + checkCellLength(ITEMS_PER_PAGE * 3); - is($$("#value .table-widget-cell").length, 50, - "Table should initially display 50 items"); + // Check that the columns are sorted in a human readable way (ascending). + checkCellValues("ASC"); - let onStoresUpdate = gUI.once("store-objects-updated"); - table.scrollTop += cellHeight * 50; - yield onStoresUpdate; + // Sort descending. + clickColumnHeader("name"); - is($$("#value .table-widget-cell").length, 100, - "Table should display 100 items after scrolling"); + // Check that the columns are sorted in a human readable way (descending). + checkCellValues("DEC"); - onStoresUpdate = gUI.once("store-objects-updated"); - table.scrollTop += cellHeight * 50; - yield onStoresUpdate; + yield finishTests(); +}); - is($$("#value .table-widget-cell").length, 150, - "Table should display 150 items after scrolling"); +function checkCellLength(len) { + let cells = gPanelWindow.document + .querySelectorAll("#name .table-widget-cell"); + let msg = `Table should initially display ${len} items`; - onStoresUpdate = gUI.once("store-objects-updated"); + is(cells.length, len, msg); +} + +function checkCellValues(order) { + let cells = [...gPanelWindow.document + .querySelectorAll("#name .table-widget-cell")]; + cells.forEach(function (cell, index, arr) { + let i = order === "ASC" ? index + 1 : arr.length - index; + is(cell.value, `item-${i}`, `Cell value is correct (${order}).`); + }); +} + +function* scroll() { + let $ = id => gPanelWindow.document.querySelector(id); + + let table = $("#storage-table .table-widget-body"); + let cell = $("#name .table-widget-cell"); + let cellHeight = cell.getBoundingClientRect().height; + + let onStoresUpdate = gUI.once("store-objects-updated"); table.scrollTop += cellHeight * 50; yield onStoresUpdate; - - is($$("#value .table-widget-cell").length, 160, - "Table should display all 160 items after scrolling"); - yield finishTests(); -}); +} diff --git a/devtools/client/storage/test/browser_storage_sessionstorage_add.js b/devtools/client/storage/test/browser_storage_sessionstorage_add.js new file mode 100644 index 000000000..8f220bc81 --- /dev/null +++ b/devtools/client/storage/test/browser_storage_sessionstorage_add.js @@ -0,0 +1,20 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +// Basic test to check the adding of sessionStorage entries. + +"use strict"; + +add_task(function* () { + yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-sessionstorage.html"); + showAllColumns(true); + + yield performAdd(["sessionStorage", "http://test1.example.org"]); + yield performAdd(["sessionStorage", "http://test1.example.org"]); + yield performAdd(["sessionStorage", "http://test1.example.org"]); + yield performAdd(["sessionStorage", "http://test1.example.org"]); + yield performAdd(["sessionStorage", "http://test1.example.org"]); + + yield finishTests(); +}); diff --git a/devtools/client/storage/test/browser_storage_sidebar.js b/devtools/client/storage/test/browser_storage_sidebar.js index 9b60026a0..ed8a333e2 100644 --- a/devtools/client/storage/test/browser_storage_sidebar.js +++ b/devtools/client/storage/test/browser_storage_sidebar.js @@ -16,26 +16,26 @@ const testCases = [ { - location: ["cookies", "sectest1.example.org"], + location: ["cookies", "https://sectest1.example.org"], sidebarHidden: true }, { - location: "cs2", + location: getCookieId("cs2", ".example.org", "/"), sidebarHidden: false }, { sendEscape: true }, { - location: "cs2", + location: getCookieId("cs2", ".example.org", "/"), sidebarHidden: false }, { - location: "uc1", + location: getCookieId("uc1", ".example.org", "/"), sidebarHidden: false }, { - location: "uc1", + location: getCookieId("uc1", ".example.org", "/"), sidebarHidden: false }, @@ -72,17 +72,17 @@ const testCases = [ sidebarHidden: true }, { - location: "idb2", + location: "idb2 (default)", sidebarHidden: false }, { - location: ["indexedDB", "http://test1.example.org", "idb2", "obj3"], + location: ["indexedDB", "http://test1.example.org", "idb2 (default)", "obj3"], sidebarHidden: true }, { - location: ["indexedDB", "https://sectest1.example.org", "idb-s2"], + location: ["indexedDB", "https://sectest1.example.org", "idb-s2 (default)"], sidebarHidden: true }, { diff --git a/devtools/client/storage/test/browser_storage_sidebar_update.js b/devtools/client/storage/test/browser_storage_sidebar_update.js index 419d63020..92547815a 100644 --- a/devtools/client/storage/test/browser_storage_sidebar_update.js +++ b/devtools/client/storage/test/browser_storage_sidebar_update.js @@ -26,7 +26,7 @@ add_task(function* () { for (let i = 0; i < UPDATE_COUNT; i++) { info(`Performing update #${i}`); updates.push(gUI.once("sidebar-updated")); - gUI.displayObjectSidebar(); + gUI.updateObjectSidebar(); } yield promise.all(updates); diff --git a/devtools/client/storage/test/browser_storage_values.js b/devtools/client/storage/test/browser_storage_values.js index 920ce350e..1d3e9ff76 100644 --- a/devtools/client/storage/test/browser_storage_values.js +++ b/devtools/client/storage/test/browser_storage_values.js @@ -17,7 +17,7 @@ const LONG_WORD = "a".repeat(1000); const testCases = [ - ["cs2", [ + [getCookieId("cs2", ".example.org", "/"), [ {name: "cs2", value: "sessionCookie"}, {name: "cs2.Path", value: "/"}, {name: "cs2.HostOnly", value: "false"}, @@ -26,7 +26,7 @@ const testCases = [ {name: "cs2.Expires", value: "Session"}, {name: "cs2.Secure", value: "false"}, ]], - ["c1", [ + [getCookieId("c1", "test1.example.org", "/browser"), [ {name: "c1", value: JSON.stringify(["foo", "Bar", {foo: "Bar"}])}, {name: "c1.Path", value: "/browser"}, {name: "c1.HostOnly", value: "true"}, @@ -42,9 +42,13 @@ const testCases = [ {name: "c1.2", value: "Object"}, {name: "c1.2.foo", value: "Bar"}, ], true], - ["c_encoded", [ - {name: "c_encoded", value: encodeURIComponent(JSON.stringify({foo: {foo1: "bar"}}))} - ]], + [ + getCookieId("c_encoded", "test1.example.org", + "/browser/devtools/client/storage/test/"), + [ + {name: "c_encoded", value: encodeURIComponent(JSON.stringify({foo: {foo1: "bar"}}))} + ] + ], [null, [ {name: "c_encoded", value: "Object"}, {name: "c_encoded.foo", value: "Object"}, @@ -120,7 +124,7 @@ const testCases = [ {name: "ss5.3", value: `${LONG_WORD}&${LONG_WORD}`}, {name: "ss5.4", value: `${LONG_WORD}&${LONG_WORD}`}, ], true], - [["indexedDB", "http://test1.example.org", "idb1", "obj1"]], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj1"]], [1, [ {name: 1, value: JSON.stringify({id: 1, name: "foo", email: "foo@bar.com"})} ]], @@ -129,7 +133,7 @@ const testCases = [ {name: "1.name", value: "foo"}, {name: "1.email", value: "foo@bar.com"}, ], true], - [["indexedDB", "http://test1.example.org", "idb1", "obj2"]], + [["indexedDB", "http://test1.example.org", "idb1 (default)", "obj2"]], [1, [ {name: 1, value: JSON.stringify({ id2: 1, name: "foo", email: "foo@bar.com", extra: "baz" diff --git a/devtools/client/storage/test/head.js b/devtools/client/storage/test/head.js index 9662393cf..c734f7b8f 100644 --- a/devtools/client/storage/test/head.js +++ b/devtools/client/storage/test/head.js @@ -15,15 +15,22 @@ Services.scriptloader.loadSubScript( const {TableWidget} = require("devtools/client/shared/widgets/TableWidget"); const SPLIT_CONSOLE_PREF = "devtools.toolbox.splitconsoleEnabled"; const STORAGE_PREF = "devtools.storage.enabled"; +const DOM_CACHE = "dom.caches.enabled"; const DUMPEMIT_PREF = "devtools.dump.emit"; const DEBUGGERLOG_PREF = "devtools.debugger.log"; // Allows Cache API to be working on usage `http` test page const CACHES_ON_HTTP_PREF = "dom.caches.testing.enabled"; const PATH = "browser/devtools/client/storage/test/"; const MAIN_DOMAIN = "http://test1.example.org/" + PATH; +const MAIN_DOMAIN_WITH_PORT = "http://test1.example.org:8000/" + PATH; const ALT_DOMAIN = "http://sectest1.example.org/" + PATH; const ALT_DOMAIN_SECURED = "https://sectest1.example.org:443/" + PATH; +// GUID to be used as a separator in compound keys. This must match the same +// constant in devtools/server/actors/storage.js, +// devtools/client/storage/ui.js and devtools/server/tests/browser/head.js +const SEPARATOR_GUID = "{9d414cc5-8319-0a04-0586-c0a6ae01670a}"; + var gToolbox, gPanelWindow, gWindow, gUI; // Services.prefs.setBoolPref(DUMPEMIT_PREF, true); @@ -33,11 +40,12 @@ Services.prefs.setBoolPref(STORAGE_PREF, true); Services.prefs.setBoolPref(CACHES_ON_HTTP_PREF, true); registerCleanupFunction(() => { gToolbox = gPanelWindow = gWindow = gUI = null; - Services.prefs.clearUserPref(STORAGE_PREF); - Services.prefs.clearUserPref(SPLIT_CONSOLE_PREF); - Services.prefs.clearUserPref(DUMPEMIT_PREF); - Services.prefs.clearUserPref(DEBUGGERLOG_PREF); Services.prefs.clearUserPref(CACHES_ON_HTTP_PREF); + Services.prefs.clearUserPref(DEBUGGERLOG_PREF); + Services.prefs.clearUserPref(DOM_CACHE); + Services.prefs.clearUserPref(DUMPEMIT_PREF); + Services.prefs.clearUserPref(SPLIT_CONSOLE_PREF); + Services.prefs.clearUserPref(STORAGE_PREF); }); /** @@ -505,10 +513,16 @@ function* selectTreeItem(ids) { * The id of the row in the table widget */ function* selectTableItem(id) { - let selector = ".table-widget-cell[data-id='" + id + "']"; + let table = gUI.table; + let selector = ".table-widget-column#" + table.uniqueId + + " .table-widget-cell[value='" + id + "']"; let target = gPanelWindow.document.querySelector(selector); ok(target, "table item found with ids " + id); + if (!target) { + showAvailableIds(); + } + yield click(target); yield gUI.once("sidebar-updated"); } @@ -586,22 +600,39 @@ function getRowCells(id, includeHidden = false) { if (!item) { ok(false, "Row id '" + id + "' exists"); + + showAvailableIds(); } - let index = table.columns.get(table.uniqueId).visibleCellNodes.indexOf(item); + let index = table.columns.get(table.uniqueId).cellNodes.indexOf(item); let cells = {}; for (let [name, column] of [...table.columns]) { if (!includeHidden && column.column.parentNode.hidden) { continue; } - cells[name] = column.visibleCellNodes[index]; + cells[name] = column.cellNodes[index]; } return cells; } /** + * Show available ids. + */ +function showAvailableIds() { + let doc = gPanelWindow.document; + let table = gUI.table; + + info("Available ids:"); + let cells = doc.querySelectorAll(".table-widget-column#" + table.uniqueId + + " .table-widget-cell"); + for (let cell of cells) { + info(" - " + cell.getAttribute("value")); + } +} + +/** * Get a cell value. * * @param {String} id @@ -704,6 +735,20 @@ function showColumn(id, state) { } /** + * Toggle sort direction on a column by clicking on the column header. + * + * @param {String} id + * The uniqueId of the given column. + */ +function clickColumnHeader(id) { + let columns = gUI.table.columns; + let column = columns.get(id); + let header = column.header; + + header.click(); +} + +/** * Show or hide all columns. * * @param {Boolean} state @@ -798,9 +843,18 @@ function* checkState(state) { is(items.size, names.length, `There is correct number of rows in ${storeName}`); + + if (names.length === 0) { + showAvailableIds(); + } + for (let name of names) { ok(items.has(name), `There is item with name '${name}' in ${storeName}`); + + if (!items.has(name)) { + showAvailableIds(); + } } } } @@ -838,3 +892,59 @@ var focusSearchBoxUsingShortcut = Task.async(function* (panelWin, callback) { callback(); } }); + +function getCookieId(name, domain, path) { + return `${name}${SEPARATOR_GUID}${domain}${SEPARATOR_GUID}${path}`; +} + +function setPermission(url, permission) { + const nsIPermissionManager = Components.interfaces.nsIPermissionManager; + + let uri = Components.classes["@mozilla.org/network/io-service;1"] + .getService(Components.interfaces.nsIIOService) + .newURI(url, null, null); + let ssm = Components.classes["@mozilla.org/scriptsecuritymanager;1"] + .getService(Ci.nsIScriptSecurityManager); + let principal = ssm.createCodebasePrincipal(uri, {}); + + Components.classes["@mozilla.org/permissionmanager;1"] + .getService(nsIPermissionManager) + .addFromPrincipal(principal, permission, + nsIPermissionManager.ALLOW_ACTION); +} + +/** + * Add an item. + * @param {Array} store + * An array containing the path to the store to which we wish to add an + * item. + */ +function* performAdd(store) { + let storeName = store.join(" > "); + let toolbar = gPanelWindow.document.getElementById("storage-toolbar"); + let type = store[0]; + + yield selectTreeItem(store); + + let menuAdd = toolbar.querySelector( + "#add-button"); + + if (menuAdd.hidden) { + is(menuAdd.hidden, false, + `performAdd called for ${storeName} but it is not supported`); + return; + } + + let eventEdit = gUI.table.once("row-edit"); + let eventWait = gUI.once("store-objects-updated"); + + menuAdd.click(); + + let rowId = yield eventEdit; + yield eventWait; + + let key = type === "cookies" ? "uniqueKey" : "name"; + let value = getCellValue(rowId, key); + + is(rowId, value, `Row '${rowId}' was successfully added.`); +} diff --git a/devtools/client/storage/test/storage-indexeddb-duplicate-names.html b/devtools/client/storage/test/storage-indexeddb-duplicate-names.html new file mode 100644 index 000000000..d8c76dc2a --- /dev/null +++ b/devtools/client/storage/test/storage-indexeddb-duplicate-names.html @@ -0,0 +1,50 @@ +<!DOCTYPE html> +<html><head> +<meta http-equiv="content-type" content="text/html; charset=UTF-8"> + <meta charset="utf-8"> + <title>Storage inspector IndexedDBs with duplicate names</title> + + <script type="application/javascript;version=1.7"> + "use strict"; + + function createIndexedDBs() { + createIndexedDB("idb1", "temporary"); + createIndexedDB("idb1", "default"); + createIndexedDB("idb1", "persistent"); + createIndexedDB("idb2", "temporary"); + createIndexedDB("idb2", "default"); + createIndexedDB("idb2", "persistent"); + } + + function createIndexedDB(name, storage) { + let open = indexedDB.open(name, {storage: storage}); + + open.onsuccess = function () { + let db = open.result; + db.close(); + }; + } + + function deleteDB(dbName, storage) { + return new Promise(resolve => { + dump(`removing database ${dbName} (${storage}) from ${document.location}\n`); + indexedDB.deleteDatabase(dbName, { storage: storage }).onsuccess = resolve; + }); + } + + window.clear = function* () { + yield deleteDB("idb1", "temporary"); + yield deleteDB("idb1", "default"); + yield deleteDB("idb1", "persistent"); + yield deleteDB("idb2", "temporary"); + yield deleteDB("idb2", "default"); + yield deleteDB("idb2", "persistent"); + + dump(`removed indexedDB data from ${document.location}\n`); + }; + </script> +</head> +<body onload="createIndexedDBs()"> + <h1>storage-indexeddb-duplicate-names.html</h1> +</body> +</html> diff --git a/devtools/client/storage/test/storage-listings-with-fragment.html b/devtools/client/storage/test/storage-listings-with-fragment.html new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/devtools/client/storage/test/storage-listings-with-fragment.html diff --git a/devtools/client/storage/test/storage-listings.html b/devtools/client/storage/test/storage-listings.html index de3054d3a..385d33193 100644 --- a/devtools/client/storage/test/storage-listings.html +++ b/devtools/client/storage/test/storage-listings.html @@ -1,7 +1,7 @@ -<!DOCTYPE HTML> +<!DOCTYPE HTML> <html> <!-- -Bug 970517 - Storage inspector front end - tests +Storage inspector front end - tests --> <head> <meta charset="utf-8"> @@ -20,7 +20,10 @@ document.cookie = "c1=foobar; expires=" + new Date(cookieExpiresTime1).toGMTString() + "; path=/browser"; document.cookie = "cs2=sessionCookie; path=/; domain=" + partialHostname; document.cookie = "c3=foobar-2; expires=" + - new Date(cookieExpiresTime2).toGMTString() + "; path=/"; + new Date(cookieExpiresTime1).toGMTString() + "; path=/"; +document.cookie = "c4=foobar-3; expires=" + + new Date(cookieExpiresTime2).toGMTString() + "; path=/; domain=" + + partialHostname; // ... and some local storage items .. localStorage.setItem("ls1", "foobar"); localStorage.setItem("ls2", "foobar-2"); @@ -110,14 +113,19 @@ let cacheGenerator = function*() { window.setup = function*() { yield idbGenerator(); - yield cacheGenerator(); + + if (window.caches) { + yield cacheGenerator(); + } }; window.clear = function*() { yield deleteDB("idb1"); yield deleteDB("idb2"); - yield caches.delete("plop"); + if (window.caches) { + yield caches.delete("plop"); + } dump("removed indexedDB and cache data from " + document.location + "\n"); }; diff --git a/devtools/client/storage/test/storage-overflow.html b/devtools/client/storage/test/storage-overflow.html index ee8db36e6..6309046b3 100644 --- a/devtools/client/storage/test/storage-overflow.html +++ b/devtools/client/storage/test/storage-overflow.html @@ -11,7 +11,7 @@ Bug 1171903 - Storage Inspector endless scrolling <script type="text/javascript;version=1.8"> "use strict"; -for (let i = 0; i < 160; i++) { +for (let i = 1; i < 151; i++) { localStorage.setItem(`item-${i}`, `value-${i}`); } </script> diff --git a/devtools/client/storage/test/storage-secured-iframe.html b/devtools/client/storage/test/storage-secured-iframe.html index 8424fd4cd..9e1ef60a0 100644 --- a/devtools/client/storage/test/storage-secured-iframe.html +++ b/devtools/client/storage/test/storage-secured-iframe.html @@ -1,4 +1,4 @@ -<!DOCTYPE HTML> +<!DOCTYPE HTML> <html> <!-- Iframe for testing multiple host detetion in storage actor @@ -9,7 +9,10 @@ Iframe for testing multiple host detetion in storage actor <body> <script type="application/javascript;version=1.7"> "use strict"; +let cookieExpiresTime = 2000000000000; document.cookie = "sc1=foobar;"; +document.cookie = "sc2=foobar-2; expires=" + + new Date(cookieExpiresTime).toGMTString() + ";"; localStorage.setItem("iframe-s-ls1", "foobar"); sessionStorage.setItem("iframe-s-ss1", "foobar-2"); dump("added cookies and storage from secured iframe\n"); diff --git a/devtools/client/storage/test/storage-unsecured-iframe.html b/devtools/client/storage/test/storage-unsecured-iframe.html index a69ffdfd1..cd08a6164 100644 --- a/devtools/client/storage/test/storage-unsecured-iframe.html +++ b/devtools/client/storage/test/storage-unsecured-iframe.html @@ -9,7 +9,10 @@ Iframe for testing multiple host detetion in storage actor <body> <script> "use strict"; +let cookieExpiresTime = 2000000000000; document.cookie = "uc1=foobar; domain=.example.org; path=/"; +document.cookie = "uc2=foobar-2; expires=" + + new Date(cookieExpiresTime).toGMTString() + "; path=/; domain=.example.org"; localStorage.setItem("iframe-u-ls1", "foobar"); sessionStorage.setItem("iframe-u-ss1", "foobar1"); sessionStorage.setItem("iframe-u-ss2", "foobar2"); diff --git a/devtools/client/storage/test/storage-updates.html b/devtools/client/storage/test/storage-updates.html index a009814b2..341992f61 100644 --- a/devtools/client/storage/test/storage-updates.html +++ b/devtools/client/storage/test/storage-updates.html @@ -38,8 +38,10 @@ window.removeCookie = function(name, path) { * can be tested. */ window.clear = function*() { - sessionStorage.clear(); + localStorage.clear(); + dump("removed localStorage from " + document.location + "\n"); + sessionStorage.clear(); dump("removed sessionStorage from " + document.location + "\n"); }; diff --git a/devtools/client/storage/ui.js b/devtools/client/storage/ui.js index 6af493e44..7745c8da9 100644 --- a/devtools/client/storage/ui.js +++ b/devtools/client/storage/ui.js @@ -12,6 +12,12 @@ const {KeyShortcuts} = require("devtools/client/shared/key-shortcuts"); const JSOL = require("devtools/client/shared/vendor/jsol"); const {KeyCodes} = require("devtools/client/shared/keycodes"); +// GUID to be used as a separator in compound keys. This must match the same +// constant in devtools/server/actors/storage.js, +// devtools/client/storage/test/head.js and +// devtools/server/tests/browser/head.js +const SEPARATOR_GUID = "{9d414cc5-8319-0a04-0586-c0a6ae01670a}"; + loader.lazyRequireGetter(this, "TreeWidget", "devtools/client/shared/widgets/TreeWidget", true); loader.lazyRequireGetter(this, "TableWidget", @@ -36,13 +42,6 @@ const GENERIC_VARIABLES_VIEW_SETTINGS = { preventDescriptorModifiers: true }; -// Columns which are hidden by default in the storage table -const HIDDEN_COLUMNS = [ - "creationTime", - "isDomain", - "isSecure" -]; - const REASON = { NEW_ROW: "new-row", NEXT_50_ITEMS: "next-50-items", @@ -114,8 +113,8 @@ function StorageUI(front, target, panelWin, toolbox) { cellContextMenuId: "storage-table-popup" }); - this.displayObjectSidebar = this.displayObjectSidebar.bind(this); - this.table.on(TableWidget.EVENTS.ROW_SELECTED, this.displayObjectSidebar); + this.updateObjectSidebar = this.updateObjectSidebar.bind(this); + this.table.on(TableWidget.EVENTS.ROW_SELECTED, this.updateObjectSidebar); this.handleScrollEnd = this.handleScrollEnd.bind(this); this.table.on(TableWidget.EVENTS.SCROLL_END, this.handleScrollEnd); @@ -161,11 +160,24 @@ function StorageUI(front, target, panelWin, toolbox) { this._tablePopup = this._panelDoc.getElementById("storage-table-popup"); this._tablePopup.addEventListener("popupshowing", this.onTablePopupShowing); + this.onRefreshTable = this.onRefreshTable.bind(this); + this.onAddItem = this.onAddItem.bind(this); this.onRemoveItem = this.onRemoveItem.bind(this); this.onRemoveAllFrom = this.onRemoveAllFrom.bind(this); this.onRemoveAll = this.onRemoveAll.bind(this); + this.onRemoveAllSessionCookies = this.onRemoveAllSessionCookies.bind(this); this.onRemoveTreeItem = this.onRemoveTreeItem.bind(this); + this._refreshButton = this._panelDoc.getElementById("refresh-button"); + this._refreshButton.addEventListener("command", this.onRefreshTable); + + this._addButton = this._panelDoc.getElementById("add-button"); + this._addButton.addEventListener("command", this.onAddItem); + + this._tablePopupAddItem = this._panelDoc.getElementById( + "storage-table-popup-add"); + this._tablePopupAddItem.addEventListener("command", this.onAddItem); + this._tablePopupDelete = this._panelDoc.getElementById( "storage-table-popup-delete"); this._tablePopupDelete.addEventListener("command", this.onRemoveItem); @@ -179,10 +191,20 @@ function StorageUI(front, target, panelWin, toolbox) { "storage-table-popup-delete-all"); this._tablePopupDeleteAll.addEventListener("command", this.onRemoveAll); + this._tablePopupDeleteAllSessionCookies = this._panelDoc.getElementById( + "storage-table-popup-delete-all-session-cookies"); + this._tablePopupDeleteAllSessionCookies.addEventListener("command", + this.onRemoveAllSessionCookies); + this._treePopupDeleteAll = this._panelDoc.getElementById( "storage-tree-popup-delete-all"); this._treePopupDeleteAll.addEventListener("command", this.onRemoveAll); + this._treePopupDeleteAllSessionCookies = this._panelDoc.getElementById( + "storage-tree-popup-delete-all-session-cookies"); + this._treePopupDeleteAllSessionCookies.addEventListener("command", + this.onRemoveAllSessionCookies); + this._treePopupDelete = this._panelDoc.getElementById("storage-tree-popup-delete"); this._treePopupDelete.addEventListener("command", this.onRemoveTreeItem); } @@ -199,7 +221,7 @@ StorageUI.prototype = { }, destroy: function () { - this.table.off(TableWidget.EVENTS.ROW_SELECTED, this.displayObjectSidebar); + this.table.off(TableWidget.EVENTS.ROW_SELECTED, this.updateObjectSidebar); this.table.off(TableWidget.EVENTS.SCROLL_END, this.handleScrollEnd); this.table.off(TableWidget.EVENTS.CELL_EDIT, this.editItem); this.table.destroy(); @@ -211,13 +233,20 @@ StorageUI.prototype = { this.searchBox = null; this._treePopup.removeEventListener("popupshowing", this.onTreePopupShowing); + this._refreshButton.removeEventListener("command", this.onRefreshTable); + this._addButton.removeEventListener("command", this.onAddItem); + this._tablePopupAddItem.removeEventListener("command", this.onAddItem); this._treePopupDeleteAll.removeEventListener("command", this.onRemoveAll); + this._treePopupDeleteAllSessionCookies.removeEventListener("command", + this.onRemoveAllSessionCookies); this._treePopupDelete.removeEventListener("command", this.onRemoveTreeItem); this._tablePopup.removeEventListener("popupshowing", this.onTablePopupShowing); this._tablePopupDelete.removeEventListener("command", this.onRemoveItem); this._tablePopupDeleteAllFrom.removeEventListener("command", this.onRemoveAllFrom); this._tablePopupDeleteAll.removeEventListener("command", this.onRemoveAll); + this._tablePopupDeleteAllSessionCookies.removeEventListener("command", + this.onRemoveAllSessionCookies); }, /** @@ -229,7 +258,7 @@ StorageUI.prototype = { this.table.clearSelection(); }, - getCurrentActor: function () { + getCurrentFront: function () { let type = this.table.datatype; return this.storageTypes[type]; @@ -250,9 +279,9 @@ StorageUI.prototype = { }, editItem: function (eventType, data) { - let actor = this.getCurrentActor(); + let front = this.getCurrentFront(); - actor.editItem(data); + front.editItem(data); }, /** @@ -261,17 +290,16 @@ StorageUI.prototype = { * being removed was selected. */ removeItemFromTable: function (name) { - if (this.table.isSelected(name)) { + if (this.table.isSelected(name) && this.table.items.size > 1) { if (this.table.selectedIndex == 0) { this.table.selectNextRow(); } else { this.table.selectPreviousRow(); } - this.table.remove(name); - this.displayObjectSidebar(); - } else { - this.table.remove(name); } + + this.table.remove(name); + this.updateObjectSidebar(); }, /** @@ -454,22 +482,24 @@ StorageUI.prototype = { * @param {object} See onUpdate docs */ handleChangedItems: function (changed) { - let [type, host, db, objectStore] = this.tree.selectedItem; - if (!changed[type] || !changed[type][host] || - changed[type][host].length == 0) { - return; - } - try { - let toUpdate = []; - for (let name of changed[type][host]) { - let names = JSON.parse(name); - if (names[0] == db && names[1] == objectStore && names[2]) { - toUpdate.push(name); + if (this.tree.selectedItem) { + let [type, host, db, objectStore] = this.tree.selectedItem; + if (!changed[type] || !changed[type][host] || + changed[type][host].length == 0) { + return; + } + try { + let toUpdate = []; + for (let name of changed[type][host]) { + let names = JSON.parse(name); + if (names[0] == db && names[1] == objectStore && names[2]) { + toUpdate.push(name); + } } + this.fetchStorageObjects(type, host, toUpdate, REASON.UPDATE); + } catch (ex) { + this.fetchStorageObjects(type, host, changed[type][host], REASON.UPDATE); } - this.fetchStorageObjects(type, host, toUpdate, REASON.UPDATE); - } catch (ex) { - this.fetchStorageObjects(type, host, changed[type][host], REASON.UPDATE); } }, @@ -504,7 +534,7 @@ StorageUI.prototype = { // The indexedDB type could have sub-type data to fetch. // If having names specified, then it means // we are fetching details of specific database or of object store. - if (type == "indexedDB" && names) { + if (type === "indexedDB" && names) { let [ dbName, objectStoreName ] = JSON.parse(names[0]); if (dbName) { subType = "database"; @@ -513,6 +543,15 @@ StorageUI.prototype = { subType = "object store"; } } + + this.actorSupportsAddItem = yield this._target.actorHasMethod(type, "addItem"); + this.actorSupportsRemoveItem = + yield this._target.actorHasMethod(type, "removeItem"); + this.actorSupportsRemoveAll = + yield this._target.actorHasMethod(type, "removeAll"); + this.actorSupportsRemoveAllSessionCookies = + yield this._target.actorHasMethod(type, "removeAllSessionCookies"); + yield this.resetColumns(type, host, subType); } @@ -520,6 +559,7 @@ StorageUI.prototype = { if (data.length) { this.populateTable(data, reason); } + yield this.updateToolbar(); this.emit("store-objects-updated"); } catch (ex) { console.error(ex); @@ -527,6 +567,27 @@ StorageUI.prototype = { }), /** + * Updates the toolbar hiding and showing buttons as appropriate. + */ + updateToolbar: Task.async(function* () { + let item = this.tree.selectedItem; + let howManyNodesIn = item ? item.length : 0; + + // The first node is just a title e.g. "Cookies" so we need to be at least + // 2 nodes in to show the add button. + let canAdd = this.actorSupportsAddItem && howManyNodesIn > 1; + + if (canAdd) { + this._addButton.hidden = false; + this._addButton.setAttribute("tooltiptext", + L10N.getFormatStr("storage.popupMenu.addItemLabel")); + } else { + this._addButton.hidden = true; + this._addButton.removeAttribute("tooltiptext"); + } + }), + + /** * Populates the storage tree which displays the list of storages present for * the page. * @@ -574,23 +635,28 @@ StorageUI.prototype = { }, /** - * Populates the selected entry from teh table in the sidebar for a more + * Populates the selected entry from the table in the sidebar for a more * detailed view. */ - displayObjectSidebar: Task.async(function* () { + updateObjectSidebar: Task.async(function* () { let item = this.table.selectedRow; - if (!item) { - // Make sure that sidebar is hidden and return - this.sidebar.hidden = true; - return; - } + let value; // Get the string value (async action) and the update the UI synchronously. - let value; - if (item.name && item.valueActor) { + if (item && item.name && item.valueActor) { value = yield item.valueActor.string(); } + // Bail if the selectedRow is no longer selected, the item doesn't exist or the state + // changed in another way during the above yield. + if (this.table.items.size === 0 || + !item || + !this.table.selectedRow || + item.uniqueKey !== this.table.selectedRow.uniqueKey) { + this.hideSidebar(); + return; + } + // Start updating the UI. Everything is sync beyond this point. this.sidebar.hidden = false; this.view.empty(); @@ -616,6 +682,11 @@ StorageUI.prototype = { let otherProps = itemProps.filter( e => !["name", "value", "valueActor"].includes(e)); for (let prop of otherProps) { + let column = this.table.columns.get(prop); + if (column && column.private) { + continue; + } + let cookieProp = COOKIE_KEY_MAP[prop] || prop; // The pseduo property of HostOnly refers to converse of isDomain property rawObject[cookieProp] = (prop === "isDomain") ? !item[prop] : item[prop]; @@ -627,6 +698,11 @@ StorageUI.prototype = { } else { // Case when displaying IndexedDB db/object store properties. for (let key in item) { + let column = this.table.columns.get(key); + if (column && column.private) { + continue; + } + mainScope.addItem(key, {}, true).setGrip(item[key]); this.parseItemValue(key, item[key]); } @@ -751,11 +827,19 @@ StorageUI.prototype = { * the storage tree */ onHostSelect: function (event, item) { + if (!item) { + return; + } this.table.clear(); this.hideSidebar(); this.searchBox.value = ""; let [type, host] = item; + this.table.host = host; + this.table.datatype = type; + + this.updateToolbar(); + let names = null; if (!host) { return; @@ -786,7 +870,9 @@ StorageUI.prototype = { let uniqueKey = null; let columns = {}; let editableFields = []; - let fields = yield this.getCurrentActor().getFields(subtype); + let hiddenFields = []; + let privateFields = []; + let fields = yield this.getCurrentFront().getFields(subtype); fields.forEach(f => { if (!uniqueKey) { @@ -797,10 +883,21 @@ StorageUI.prototype = { editableFields.push(f.name); } + if (f.hidden) { + hiddenFields.push(f.name); + } + + if (f.private) { + privateFields.push(f.name); + } + columns[f.name] = f.name; let columnName; try { - columnName = L10N.getStr("table.headers." + type + "." + f.name); + // Path key names for l10n in the case of a string change. + let name = f.name === "keyPath" ? "keyPath2" : f.name; + + columnName = L10N.getStr("table.headers." + type + "." + name); } catch (e) { columnName = COOKIE_KEY_MAP[f.name]; } @@ -812,7 +909,7 @@ StorageUI.prototype = { } }); - this.table.setColumns(columns, null, HIDDEN_COLUMNS); + this.table.setColumns(columns, null, hiddenFields, privateFields); this.hideSidebar(); yield this.makeFieldsEditable(editableFields); @@ -857,7 +954,7 @@ StorageUI.prototype = { case REASON.UPDATE: this.table.update(item); if (item == this.table.selectedRow && !this.sidebar.hidden) { - this.displayObjectSidebar(); + this.updateObjectSidebar(); } break; } @@ -910,27 +1007,53 @@ StorageUI.prototype = { }, /** - * Fires before a cell context menu with the "Delete" action is shown. - * If the currently selected storage object doesn't support removing items, prevent - * showing the menu. + * Fires before a cell context menu with the "Add" or "Delete" action is + * shown. If the currently selected storage object doesn't support adding or + * removing items, prevent showing the menu. */ onTablePopupShowing: function (event) { let selectedItem = this.tree.selectedItem; let type = selectedItem[0]; - let actor = this.getCurrentActor(); // IndexedDB only supports removing items from object stores (level 4 of the tree) - if (!actor.removeItem || (type === "indexedDB" && selectedItem.length !== 4)) { + if ((!this.actorSupportsAddItem && !this.actorSupportsRemoveItem && + type !== "cookies") || + (type === "indexedDB" && selectedItem.length !== 4)) { event.preventDefault(); return; } let rowId = this.table.contextMenuRowId; let data = this.table.items.get(rowId); - let name = addEllipsis(data[this.table.uniqueId]); - this._tablePopupDelete.setAttribute("label", - L10N.getFormatStr("storage.popupMenu.deleteLabel", name)); + if (this.actorSupportsRemoveItem) { + let name = data[this.table.uniqueId]; + let separatorRegex = new RegExp(SEPARATOR_GUID, "g"); + let label = addEllipsis((name + "").replace(separatorRegex, "-")); + + this._tablePopupDelete.hidden = false; + this._tablePopupDelete.setAttribute("label", + L10N.getFormatStr("storage.popupMenu.deleteLabel", label)); + } else { + this._tablePopupDelete.hidden = true; + } + + if (this.actorSupportsAddItem) { + this._tablePopupAddItem.hidden = false; + this._tablePopupAddItem.setAttribute("label", + L10N.getFormatStr("storage.popupMenu.addItemLabel")); + } else { + this._tablePopupAddItem.hidden = true; + } + + let showDeleteAllSessionCookies = false; + if (this.actorSupportsRemoveAllSessionCookies) { + if (type === "cookies" && selectedItem.length === 2) { + showDeleteAllSessionCookies = true; + } + } + + this._tablePopupDeleteAllSessionCookies.hidden = !showDeleteAllSessionCookies; if (type === "cookies") { let host = addEllipsis(data.host); @@ -949,13 +1072,12 @@ StorageUI.prototype = { if (selectedItem) { let type = selectedItem[0]; - let actor = this.storageTypes[type]; // The delete all (aka clear) action is displayed for IndexedDB object stores // (level 4 of tree), for Cache objects (level 3) and for the whole host (level 2) // for other storage types (cookies, localStorage, ...). let showDeleteAll = false; - if (actor.removeAll) { + if (this.actorSupportsRemoveAll) { let level; if (type == "indexedDB") { level = 4; @@ -972,6 +1094,17 @@ StorageUI.prototype = { this._treePopupDeleteAll.hidden = !showDeleteAll; + // The delete all session cookies action is displayed for cookie object stores + // (level 2 of tree) + let showDeleteAllSessionCookies = false; + if (this.actorSupportsRemoveAllSessionCookies) { + if (type === "cookies" && selectedItem.length === 2) { + showDeleteAllSessionCookies = true; + } + } + + this._treePopupDeleteAllSessionCookies.hidden = !showDeleteAllSessionCookies; + // The delete action is displayed for: // - IndexedDB databases (level 3 of the tree) // - Cache objects (level 3 of the tree) @@ -993,31 +1126,61 @@ StorageUI.prototype = { }, /** + * Handles refreshing the selected storage + */ + onRefreshTable: function (event) { + this.onHostSelect(event, this.tree.selectedItem); + }, + + /** + * Handles adding an item from the storage + */ + onAddItem: function () { + if (!this.tree.selectedItem) { + return; + } + let front = this.getCurrentFront(); + let [, host] = this.tree.selectedItem; + + // Prepare to scroll into view. + this.table.scrollIntoViewOnUpdate = true; + this.table.editBookmark = createGUID(); + front.addItem(this.table.editBookmark, host); + }, + + /** * Handles removing an item from the storage */ onRemoveItem: function () { let [, host, ...path] = this.tree.selectedItem; - let actor = this.getCurrentActor(); + let front = this.getCurrentFront(); let rowId = this.table.contextMenuRowId; let data = this.table.items.get(rowId); let name = data[this.table.uniqueId]; if (path.length > 0) { name = JSON.stringify([...path, name]); } - actor.removeItem(host, name); + front.removeItem(host, name); }, /** * Handles removing all items from the storage */ onRemoveAll: function () { - // Cannot use this.currentActor() if the handler is called from the - // tree context menu: it returns correct value only after the table - // data from server are successfully fetched (and that's async). - let [type, host, ...path] = this.tree.selectedItem; - let actor = this.storageTypes[type]; + let [, host, ...path] = this.tree.selectedItem; + let front = this.getCurrentFront(); let name = path.length > 0 ? JSON.stringify(path) : undefined; - actor.removeAll(host, name); + front.removeAll(host, name); + }, + + /** + * Handles removing all session cookies from the storage + */ + onRemoveAllSessionCookies: function () { + let [, host, ...path] = this.tree.selectedItem; + let front = this.getCurrentFront(); + let name = path.length > 0 ? JSON.stringify(path) : undefined; + front.removeAllSessionCookies(host, name); }, /** @@ -1026,11 +1189,11 @@ StorageUI.prototype = { */ onRemoveAllFrom: function () { let [, host] = this.tree.selectedItem; - let actor = this.getCurrentActor(); + let front = this.getCurrentFront(); let rowId = this.table.contextMenuRowId; let data = this.table.items.get(rowId); - actor.removeAll(host, data.host); + front.removeAll(host, data.host); }, onRemoveTreeItem: function () { @@ -1044,9 +1207,9 @@ StorageUI.prototype = { }, removeDatabase: function (host, dbName) { - let actor = this.storageTypes.indexedDB; + let front = this.getCurrentFront(); - actor.removeDatabase(host, dbName).then(result => { + front.removeDatabase(host, dbName).then(result => { if (result.blocked) { let notificationBox = this._toolbox.getNotificationBox(); notificationBox.appendNotification( @@ -1066,8 +1229,17 @@ StorageUI.prototype = { }, removeCache: function (host, cacheName) { - let actor = this.storageTypes.Cache; + let front = this.getCurrentFront(); - actor.removeItem(host, JSON.stringify([ cacheName ])); + front.removeItem(host, JSON.stringify([ cacheName ])); }, }; + +// Helper Functions + +function createGUID() { + return "{cccccccc-cccc-4ccc-yccc-cccccccccccc}".replace(/[cy]/g, c => { + let r = Math.random() * 16 | 0, v = c == "c" ? r : (r & 0x3 | 0x8); + return v.toString(16); + }); +} diff --git a/devtools/client/styleeditor/StyleEditorUI.jsm b/devtools/client/styleeditor/StyleEditorUI.jsm index cdb267669..b2735b3fc 100644 --- a/devtools/client/styleeditor/StyleEditorUI.jsm +++ b/devtools/client/styleeditor/StyleEditorUI.jsm @@ -72,10 +72,18 @@ function StyleEditorUI(debuggee, target, panelDoc, cssProperties) { this.editors = []; this.selectedEditor = null; this.savedLocations = {}; + this._seenSheets = new Map(); + + // Don't add any style sheets that might arrive via events, until + // the call to initialize. Style sheets can arrive from the server + // at any time, for example if a new style sheet was added, or if + // the style sheet actor was just created and is walking the style + // sheets for the first time. In any case, in |initialize| we're + // going to fetch the list of sheets anyway. + this._suppressAdd = true; this._onOptionsPopupShowing = this._onOptionsPopupShowing.bind(this); this._onOptionsPopupHiding = this._onOptionsPopupHiding.bind(this); - this._onStyleSheetCreated = this._onStyleSheetCreated.bind(this); this._onNewDocument = this._onNewDocument.bind(this); this._onMediaPrefChanged = this._onMediaPrefChanged.bind(this); this._updateMediaList = this._updateMediaList.bind(this); @@ -83,10 +91,13 @@ function StyleEditorUI(debuggee, target, panelDoc, cssProperties) { this._onError = this._onError.bind(this); this._updateOpenLinkItem = this._updateOpenLinkItem.bind(this); this._openLinkNewTab = this._openLinkNewTab.bind(this); + this._addStyleSheet = this._addStyleSheet.bind(this); this._prefObserver = new PrefObserver("devtools.styleeditor."); this._prefObserver.on(PREF_ORIG_SOURCES, this._onNewDocument); this._prefObserver.on(PREF_MEDIA_SIDEBAR, this._onMediaPrefChanged); + + this._debuggee.on("stylesheet-added", this._addStyleSheet); } this.StyleEditorUI = StyleEditorUI; @@ -165,7 +176,7 @@ StyleEditorUI.prototype = { this._view = new SplitView(viewRoot); wire(this._view.rootElement, ".style-editor-newButton", () =>{ - this._debuggee.addStyleSheet(null).then(this._onStyleSheetCreated); + this._debuggee.addStyleSheet(null); }); wire(this._view.rootElement, ".style-editor-importButton", ()=> { @@ -233,6 +244,7 @@ StyleEditorUI.prototype = { * StyleSheet object for new sheet */ _onNewDocument: function () { + this._suppressAdd = true; this._debuggee.getStyleSheets().then((styleSheets) => { return this._resetStyleSheetList(styleSheets); }).then(null, e => console.error(e)); @@ -246,6 +258,7 @@ StyleEditorUI.prototype = { */ _resetStyleSheetList: Task.async(function* (styleSheets) { this._clear(); + this._suppressAdd = false; for (let sheet of styleSheets) { try { @@ -288,6 +301,10 @@ StyleEditorUI.prototype = { this._view.removeAll(); this.selectedEditor = null; + // Here the keys are style sheet actors, and the values are + // promises that resolve to the sheet's editor. See |_addStyleSheet|. + this._seenSheets = new Map(); + this._suppressAdd = true; this._root.classList.add("loading"); }, @@ -298,46 +315,67 @@ StyleEditorUI.prototype = { * * @param {StyleSheetFront} styleSheet * Style sheet to add to style editor + * @param {Boolean} isNew + * True if this style sheet was created by a call to the + * style sheets actor's @see addStyleSheet method. + * @return {Promise} + * A promise that resolves to the style sheet's editor when the style sheet has + * been fully loaded. If the style sheet has a source map, and source mapping + * is enabled, then the promise resolves to null. */ - _addStyleSheet: Task.async(function* (styleSheet) { - let editor = yield this._addStyleSheetEditor(styleSheet); - - if (!Services.prefs.getBoolPref(PREF_ORIG_SOURCES)) { - return; + _addStyleSheet: function (styleSheet, isNew) { + if (this._suppressAdd) { + return null; } - let sources = yield styleSheet.getOriginalSources(); - if (sources && sources.length) { - let parentEditorName = editor.friendlyName; - this._removeStyleSheetEditor(editor); - - for (let source of sources) { - // set so the first sheet will be selected, even if it's a source - source.styleSheetIndex = styleSheet.styleSheetIndex; - source.relatedStyleSheet = styleSheet; - source.relatedEditorName = parentEditorName; - yield this._addStyleSheetEditor(source); - } + if (!this._seenSheets.has(styleSheet)) { + let promise = (async () => { + let editor = await this._addStyleSheetEditor(styleSheet, isNew); + + if (!Services.prefs.getBoolPref(PREF_ORIG_SOURCES)) { + return editor; + } + + let sources = await styleSheet.getOriginalSources(); + // A single generated sheet might map to multiple original + // sheets, so make editors for each of them. + if (sources && sources.length) { + let parentEditorName = editor.friendlyName; + this._removeStyleSheetEditor(editor); + editor = null; + + for (let source of sources) { + // set so the first sheet will be selected, even if it's a source + source.styleSheetIndex = styleSheet.styleSheetIndex; + source.relatedStyleSheet = styleSheet; + source.relatedEditorName = parentEditorName; + await this._addStyleSheetEditor(source); + } + } + + return editor; + })(); + this._seenSheets.set(styleSheet, promise); } - }), + return this._seenSheets.get(styleSheet); + }, /** * Add a new editor to the UI for a source. * * @param {StyleSheet} styleSheet * Object representing stylesheet - * @param {nsIfile} file - * Optional file object that sheet was imported from * @param {Boolean} isNew * Optional if stylesheet is a new sheet created by user * @return {Promise} that is resolved with the created StyleSheetEditor when * the editor is fully initialized or rejected on error. */ - _addStyleSheetEditor: Task.async(function* (styleSheet, file, isNew) { + _addStyleSheetEditor: Task.async(function* (styleSheet, isNew) { // recall location of saved file for this sheet after page reload + let file = null; let identifier = this.getStyleSheetIdentifier(styleSheet); let savedFile = this.savedLocations[identifier]; - if (savedFile && !file) { + if (savedFile) { file = savedFile; } @@ -388,8 +426,16 @@ StyleEditorUI.prototype = { NetUtil.readInputStreamToString(stream, stream.available()); stream.close(); + this._suppressAdd = true; this._debuggee.addStyleSheet(source).then((styleSheet) => { - this._onStyleSheetCreated(styleSheet, selectedFile); + this._suppressAdd = false; + this._addStyleSheet(styleSheet, true).then(editor => { + if (editor) { + editor.savedFile = selectedFile; + } + // Just for testing purposes. + this.emit("test:editor-updated", editor); + }); }); }); }; @@ -398,14 +444,6 @@ StyleEditorUI.prototype = { }, /** - * When a new or imported stylesheet has been added to the document. - * Add an editor for it. - */ - _onStyleSheetCreated: function (styleSheet, file) { - this._addStyleSheetEditor(styleSheet, file, true); - }, - - /** * Forward any error from a stylesheet. * * @param {string} event @@ -1013,6 +1051,9 @@ StyleEditorUI.prototype = { this._clearStyleSheetEditors(); + this._seenSheets = null; + this._suppressAdd = false; + let sidebar = this._panelDoc.querySelector(".splitview-controller"); let sidebarWidth = sidebar.getAttribute("width"); Services.prefs.setIntPref(PREF_NAV_WIDTH, sidebarWidth); @@ -1025,5 +1066,7 @@ StyleEditorUI.prototype = { this._prefObserver.off(PREF_ORIG_SOURCES, this._onNewDocument); this._prefObserver.off(PREF_MEDIA_SIDEBAR, this._onMediaPrefChanged); this._prefObserver.destroy(); + + this._debuggee.off("stylesheet-added", this._addStyleSheet); } }; diff --git a/devtools/client/styleeditor/StyleSheetEditor.jsm b/devtools/client/styleeditor/StyleSheetEditor.jsm index 980e51974..832fcacde 100644 --- a/devtools/client/styleeditor/StyleSheetEditor.jsm +++ b/devtools/client/styleeditor/StyleSheetEditor.jsm @@ -468,6 +468,9 @@ StyleSheetEditor.prototype = { sourceEditor.container.addEventListener("mousemove", this._onMouseMove); } + // Add the commands controller for the source-editor. + sourceEditor.insertCommandsController(); + this.emit("source-editor-load"); }); }, diff --git a/devtools/client/styleeditor/test/browser.ini b/devtools/client/styleeditor/test/browser.ini index 1a85546af..4a84d45e6 100644 --- a/devtools/client/styleeditor/test/browser.ini +++ b/devtools/client/styleeditor/test/browser.ini @@ -60,6 +60,7 @@ support-files = !/devtools/client/shared/test/test-actor-registry.js !/devtools/client/shared/test/test-actor.js +[browser_styleeditor_add_stylesheet.js] [browser_styleeditor_autocomplete.js] [browser_styleeditor_autocomplete-disabled.js] [browser_styleeditor_bom.js] diff --git a/devtools/client/styleeditor/test/browser_styleeditor_add_stylesheet.js b/devtools/client/styleeditor/test/browser_styleeditor_add_stylesheet.js new file mode 100644 index 000000000..d8315d212 --- /dev/null +++ b/devtools/client/styleeditor/test/browser_styleeditor_add_stylesheet.js @@ -0,0 +1,37 @@ +/* vim: set ts=2 et sw=2 tw=80: */ +/* Any copyright is dedicated to the Public Domain. + http://creativecommons.org/publicdomain/zero/1.0/ */ +"use strict"; + +// Test that a newly-added style sheet shows up in the style editor. + +const TESTCASE_URI = TEST_BASE_HTTPS + "simple.html"; + +add_task(function* () { + let { ui } = yield openStyleEditorForURL(TESTCASE_URI); + + is(ui.editors.length, 2, "Two sheets present after load."); + + // We have to wait for the length to change, because we might still + // be seeing events from the initial open. + let added = new Promise(resolve => { + let handler = () => { + if (ui.editors.length === 3) { + ui.off("editor-added", handler); + resolve(); + } + }; + ui.on("editor-added", handler); + }); + + info("Adding a style sheet"); + yield ContentTask.spawn(gBrowser.selectedBrowser, null, () => { + let document = content.document; + const style = document.createElement("style"); + style.appendChild(document.createTextNode("div { background: #f06; }")); + document.head.appendChild(style); + }); + yield added; + + is(ui.editors.length, 3, "Three sheets present after new style sheet"); +}); diff --git a/devtools/client/styleeditor/test/browser_styleeditor_import.js b/devtools/client/styleeditor/test/browser_styleeditor_import.js index f31f72ce7..2f42317b9 100644 --- a/devtools/client/styleeditor/test/browser_styleeditor_import.js +++ b/devtools/client/styleeditor/test/browser_styleeditor_import.js @@ -18,7 +18,7 @@ const SOURCE = "body{background:red;}"; add_task(function* () { let { panel, ui } = yield openStyleEditorForURL(TESTCASE_URI); - let added = ui.once("editor-added"); + let added = ui.once("test:editor-updated"); importSheet(ui, panel.panelWindow); info("Waiting for editor to be added for the imported sheet."); diff --git a/devtools/client/themes/common.css b/devtools/client/themes/common.css index 3d713ada7..133770150 100644 --- a/devtools/client/themes/common.css +++ b/devtools/client/themes/common.css @@ -2,7 +2,9 @@ * License, v. 2.0. If a copy of the MPL was not distributed with this * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + @import url("resource://devtools/client/themes/splitters.css"); +@namespace html url("http://www.w3.org/1999/xhtml"); :root { font: message-box; @@ -33,6 +35,10 @@ font-size: 80%; } +/* Override wrong system font from forms.css */ +html|button, html|select { + font: message-box; +} /* Autocomplete Popup */ diff --git a/devtools/client/themes/images/reload.svg b/devtools/client/themes/images/reload.svg index b04262784..c5d9bf991 100644 --- a/devtools/client/themes/images/reload.svg +++ b/devtools/client/themes/images/reload.svg @@ -1,6 +1,7 @@ <!-- This Source Code Form is subject to the terms of the Mozilla Public - License, v. 2.0. If a copy of the MPL was not distributed with this - file, You can obtain one at http://mozilla.org/MPL/2.0/. --> -<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 14 14" width="14" height="14"> - <path d="M12,7H6l2.4-2.4C7.6,4,6.6,3.8,5.5,4.1C4.3,4.5,3.3,5.5,3,6.8 C2.6,9,4.3,11,6.5,11c1,0,2-0.5,2.6-1.2l1.7,1c-1.3,1.6-3.3,2.5-5.6,2c-2-0.5-3.6-2.1-4-4.1C0.4,5.1,3.1,2,6.5,2 c1.3,0,2.4,0.4,3.3,1.2L12,1V7z"/> +<svg width="16" height="16" viewBox="0 0 16 16" xmlns="http://www.w3.org/2000/svg"> + <path d="M13.917 7C13.44 4.162 10.973 2 8 2 4.686 2 2 4.686 2 8s2.686 6 6 6c2.22 0 4.16-1.207 5.197-3H12c-.912 1.214-2.364 2-4 2-2.76 0-5-2.24-5-5s2.24-5 5-5c2.42 0 4.437 1.718 4.9 4h1.017z"/> + <path d="M14 1L8 7h6V1zm-1 1L9 6h4V2z" fill-rule="evenodd"/> </svg> diff --git a/devtools/client/themes/markup.css b/devtools/client/themes/markup.css index 4b4cfd031..0569b7ce7 100644 --- a/devtools/client/themes/markup.css +++ b/devtools/client/themes/markup.css @@ -197,6 +197,22 @@ ul.children + .tag-line::before { display: inline; } +.expandable.collapsed .close::before { + /* Display an ellipsis character in collapsed nodes that can be expanded. */ + content: "\2026"; + display: inline-block; + width: 12px; + height: 8px; + margin: 0 2px; + line-height: 3px; + color: var(--theme-body-color-inactive); + border-radius: 3px; + border-style: solid; + border-width: 1px; + text-align: center; + vertical-align: middle; +} + /* Hide HTML void elements (img, hr, br, …) closing tag when the element is not * expanded (it can be if it has pseudo-elements attached) */ .child.collapsed > .tag-line .void-element .close { @@ -318,7 +334,8 @@ ul.children + .tag-line::before { .theme-selected ~ .editor .theme-fg-color4, .theme-selected ~ .editor .theme-fg-color5, .theme-selected ~ .editor .theme-fg-color6, -.theme-selected ~ .editor .theme-fg-color7 { +.theme-selected ~ .editor .theme-fg-color7, +.theme-selected ~ .editor .close::before { color: var(--theme-selection-color); } diff --git a/devtools/client/themes/netmonitor.css b/devtools/client/themes/netmonitor.css index fea634a0e..ccffb2acc 100644 --- a/devtools/client/themes/netmonitor.css +++ b/devtools/client/themes/netmonitor.css @@ -8,6 +8,7 @@ } #react-clear-button-hook, +#react-summary-button-hook, #react-details-pane-toggle-hook { display: flex; } @@ -47,7 +48,7 @@ #details-pane-toggle, #details-pane.pane-collapsed, .requests-menu-waterfall, - #requests-menu-network-summary-button > .toolbarbutton-text { + #requests-menu-network-summary-button > .summary-info-text { display: none; } } @@ -58,6 +59,7 @@ --timing-blocked-color: rgba(235, 83, 104, 0.8); --timing-dns-color: rgba(223, 128, 255, 0.8); /* pink */ + --timing-ssl-color: rgba(217, 102, 41, 0.8); /* orange */ --timing-connect-color: rgba(217, 102, 41, 0.8); /* orange */ --timing-send-color: rgba(70, 175, 227, 0.8); /* light blue */ --timing-wait-color: rgba(94, 136, 176, 0.8); /* blue grey */ @@ -73,6 +75,7 @@ --timing-blocked-color: rgba(235, 83, 104, 0.8); --timing-dns-color: rgba(223, 128, 255, 0.8); /* pink */ + --timing-ssl-color: rgba(217, 102, 41, 0.8); /* orange */ --timing-connect-color: rgba(217, 102, 41, 0.8); /* orange */ --timing-send-color: rgba(0, 136, 204, 0.8); /* blue */ --timing-wait-color: rgba(95, 136, 176, 0.8); /* blue grey */ @@ -504,6 +507,10 @@ background-color: var(--timing-connect-color); } +.requests-menu-timings-box.ssl { + background-color: var(--timing-ssl-color); +} + .requests-menu-timings-box.send { background-color: var(--timing-send-color); } @@ -744,16 +751,35 @@ /* Performance analysis buttons */ #requests-menu-network-summary-button { + display: flex; + align-items: center; background: none; box-shadow: none; border-color: transparent; - list-style-image: url(images/profiler-stopwatch.svg); padding-inline-end: 0; cursor: pointer; margin-inline-end: 1em; min-width: 0; } +#requests-menu-network-summary-button > .summary-info-icon { + background-image: url(images/profiler-stopwatch.svg); + filter: var(--icon-filter); + width: 16px; + height: 16px; + opacity: 0.8; +} + +#requests-menu-network-summary-button > .summary-info-text { + opacity: 0.8; + margin-inline-start: 0.5em; +} + +#requests-menu-network-summary-button:hover > .summary-info-icon, +#requests-menu-network-summary-button:hover > .summary-info-text { + opacity: 1; +} + /* Performance analysis view */ #network-statistics-toolbar { diff --git a/devtools/client/themes/storage.css b/devtools/client/themes/storage.css index 1e611f842..314b6b7fe 100644 --- a/devtools/client/themes/storage.css +++ b/devtools/client/themes/storage.css @@ -32,6 +32,26 @@ min-width: 250px; } +#storage-toolbar .add-button::before { + margin: 0; + background-image: url("chrome://devtools/skin/images/add.svg"); + -moz-user-focus: normal; +} + +#storage-toolbar .refresh-button::before { + margin: 0; + background-image: url("chrome://devtools/skin/images/reload.svg"); + -moz-user-focus: normal; +} + +#storage-toolbar .devtools-button { + min-width: unset; +} + +#storage-toolbar .devtools-button hbox { + display: none; +} + /* Responsive sidebar */ @media (max-width: 700px) { #storage-tree, diff --git a/devtools/client/webconsole/hudservice.js b/devtools/client/webconsole/hudservice.js index 46b4f2a13..3023b7bb3 100644 --- a/devtools/client/webconsole/hudservice.js +++ b/devtools/client/webconsole/hudservice.js @@ -51,6 +51,23 @@ HUD_SERVICE.prototype = */ consoles: null, + _browerConsoleSessionState: false, + storeBrowserConsoleSessionState() { + this._browerConsoleSessionState = !!this.getBrowserConsole(); + }, + getBrowserConsoleSessionState() { + return this._browerConsoleSessionState; + }, + + /** + * Restore the Browser Console as provided by SessionStore. + */ + restoreBrowserConsoleSession: function HS_restoreBrowserConsoleSession() { + if (!HUDService.getBrowserConsole()) { + HUDService.toggleBrowserConsole(); + } + }, + /** * Assign a function to this property to listen for every request that * completes. Used by unit tests. The callback takes one argument: the HTTP @@ -647,6 +664,9 @@ BrowserConsole.prototype = extend(WebConsole.prototype, { return this._bc_init; } + // Only add the shutdown observer if we've opened a Browser Console window. + ShutdownObserver.init(); + this.ui._filterPrefsPrefix = BROWSER_CONSOLE_FILTER_PREFS_PREFIX; let window = this.iframeWindow; @@ -703,16 +723,32 @@ BrowserConsole.prototype = extend(WebConsole.prototype, { }); const HUDService = new HUD_SERVICE(); +exports.HUDService = HUDService; -(() => { - let methods = ["openWebConsole", "openBrowserConsole", - "toggleBrowserConsole", "getOpenWebConsole", - "getBrowserConsole", "getHudByWindow", - "openBrowserConsoleOrFocus", "getHudReferenceById"]; - for (let method of methods) { - exports[method] = HUDService[method].bind(HUDService); - } +/** + * The ShutdownObserver listens for app shutdown and saves the current state + * of the Browser Console for session restore. + */ +var ShutdownObserver = { + _initialized: false, + init() { + if (this._initialized) { + return; + } + + Services.obs.addObserver(this, "quit-application-granted", false); + + this._initialized = true; + }, - exports.consoles = HUDService.consoles; - exports.lastFinishedRequest = HUDService.lastFinishedRequest; -})(); + observe(message, topic) { + if (topic == "quit-application-granted") { + HUDService.storeBrowserConsoleSessionState(); + this.uninit(); + } + }, + + uninit() { + Services.obs.removeObserver(this, "quit-application-granted"); + } +}; diff --git a/devtools/client/webconsole/new-console-output/test/mochitest/head.js b/devtools/client/webconsole/new-console-output/test/mochitest/head.js index b71eaec4f..049f3d1ce 100644 --- a/devtools/client/webconsole/new-console-output/test/mochitest/head.js +++ b/devtools/client/webconsole/new-console-output/test/mochitest/head.js @@ -14,6 +14,7 @@ Services.scriptloader.loadSubScript( var {Utils: WebConsoleUtils} = require("devtools/client/webconsole/utils"); const WEBCONSOLE_STRINGS_URI = "devtools/client/locales/webconsole.properties"; +var {HUDService} = require("devtools/client/webconsole/hudservice"); var WCUL10n = new WebConsoleUtils.L10n(WEBCONSOLE_STRINGS_URI); Services.prefs.setBoolPref("devtools.webconsole.new-frontend-enabled", true); diff --git a/devtools/client/webconsole/panel.js b/devtools/client/webconsole/panel.js index 3e3a4f4b9..b692de681 100644 --- a/devtools/client/webconsole/panel.js +++ b/devtools/client/webconsole/panel.js @@ -8,7 +8,7 @@ const promise = require("promise"); -loader.lazyGetter(this, "HUDService", () => require("devtools/client/webconsole/hudservice")); +loader.lazyRequireGetter(this, "HUDService", "devtools/client/webconsole/hudservice", true); loader.lazyGetter(this, "EventEmitter", () => require("devtools/shared/event-emitter")); /** diff --git a/devtools/client/webconsole/test/browser.ini b/devtools/client/webconsole/test/browser.ini index 918411182..1c7913835 100644 --- a/devtools/client/webconsole/test/browser.ini +++ b/devtools/client/webconsole/test/browser.ini @@ -182,6 +182,7 @@ subsuite = clipboard [browser_console_optimized_out_vars.js] [browser_console_private_browsing.js] skip-if = e10s # Bug 1042253 - webconsole e10s tests +[browser_console_restore.js] [browser_console_server_logging.js] [browser_console_variables_view.js] [browser_console_variables_view_filter.js] diff --git a/devtools/client/webconsole/test/browser_console.js b/devtools/client/webconsole/test/browser_console.js index 7bd1ffdc2..4358ac0f1 100644 --- a/devtools/client/webconsole/test/browser_console.js +++ b/devtools/client/webconsole/test/browser_console.js @@ -22,7 +22,7 @@ const TEST_IMAGE = "http://example.com/browser/devtools/client/webconsole/" + add_task(function* () { yield loadTab(TEST_URI); - let opened = waitForConsole(); + let opened = waitForBrowserConsole(); let hud = HUDService.getBrowserConsole(); ok(!hud, "browser console is not open"); @@ -141,20 +141,3 @@ function consoleOpened(hud) { ], }); } - -function waitForConsole() { - let deferred = promise.defer(); - - Services.obs.addObserver(function observer(aSubject) { - Services.obs.removeObserver(observer, "web-console-created"); - aSubject.QueryInterface(Ci.nsISupportsString); - - let hud = HUDService.getBrowserConsole(); - ok(hud, "browser console is open"); - is(aSubject.data, hud.hudId, "notification hudId is correct"); - - executeSoon(() => deferred.resolve(hud)); - }, "web-console-created", false); - - return deferred.promise; -} diff --git a/devtools/client/webconsole/test/browser_console_restore.js b/devtools/client/webconsole/test/browser_console_restore.js new file mode 100644 index 000000000..fb08d9c70 --- /dev/null +++ b/devtools/client/webconsole/test/browser_console_restore.js @@ -0,0 +1,30 @@ +/* -*- indent-tabs-mode: nil; js-indent-level: 2 -*- */ +/* vim: set ft=javascript ts=2 et sw=2 tw=80: */ +/* Any copyright is dedicated to the Public Domain. + * http://creativecommons.org/publicdomain/zero/1.0/ */ + +// Check that the browser console gets session state is set correctly, and that +// it re-opens when restore is requested. + +"use strict"; + +add_task(function* () { + is(HUDService.getBrowserConsoleSessionState(), false, "Session state false by default"); + HUDService.storeBrowserConsoleSessionState(); + is(HUDService.getBrowserConsoleSessionState(), false, + "Session state still not true even after setting (since Browser Console is closed)"); + + yield HUDService.toggleBrowserConsole(); + HUDService.storeBrowserConsoleSessionState(); + is(HUDService.getBrowserConsoleSessionState(), true, + "Session state true (since Browser Console is opened)"); + + info("Closing the browser console and waiting for the session restore to reopen it") + yield HUDService.toggleBrowserConsole(); + + let opened = waitForBrowserConsole(); + HUDService.restoreBrowserConsoleSession(); + + info("Waiting for the console to open after session restore") + yield opened; +}); diff --git a/devtools/client/webconsole/test/browser_webconsole_closure_inspection.js b/devtools/client/webconsole/test/browser_webconsole_closure_inspection.js index 6a29d61aa..769fc0fe5 100644 --- a/devtools/client/webconsole/test/browser_webconsole_closure_inspection.js +++ b/devtools/client/webconsole/test/browser_webconsole_closure_inspection.js @@ -58,7 +58,7 @@ function consoleOpened(hud) { waitForMessages({ webconsole: gWebConsole, messages: [{ - text: "function _pfactory/<.getName()", + text: "getName()", category: CATEGORY_OUTPUT, objects: true, }], diff --git a/devtools/client/webconsole/test/browser_webconsole_jsterm.js b/devtools/client/webconsole/test/browser_webconsole_jsterm.js index 221c96fa6..ae5dc71fe 100644 --- a/devtools/client/webconsole/test/browser_webconsole_jsterm.js +++ b/devtools/client/webconsole/test/browser_webconsole_jsterm.js @@ -175,7 +175,6 @@ function* testJSTerm(hud) { "JSMSG_BAD_RADIX": "(42).toString(0);", "JSMSG_BAD_ARRAY_LENGTH": "([]).length = -1", "JSMSG_NEGATIVE_REPETITION_COUNT": "'abc'.repeat(-1);", - "JSMSG_BAD_FORMAL": "var f = Function('x y', 'return x + y;');", "JSMSG_PRECISION_RANGE": "77.1234.toExponential(-1);", }; diff --git a/devtools/client/webconsole/test/browser_webconsole_output_02.js b/devtools/client/webconsole/test/browser_webconsole_output_02.js index 8018669a9..4c61cf041 100644 --- a/devtools/client/webconsole/test/browser_webconsole_output_02.js +++ b/devtools/client/webconsole/test/browser_webconsole_output_02.js @@ -36,10 +36,10 @@ var inputTests = [ suppressClick: true }, - // 3 - anonymous function, but spidermonkey gives us an inferred name. + // 3 - anonymous function, but gets name. { input: "testobj1.testfn2", - output: "function testobj1.testfn2()", + output: "function testfn2()", printOutput: "function () { return 42; }", suppressClick: true }, diff --git a/devtools/client/webconsole/test/browser_webconsole_strict_mode_errors.js b/devtools/client/webconsole/test/browser_webconsole_strict_mode_errors.js index c8f2200f9..cdaf2764e 100644 --- a/devtools/client/webconsole/test/browser_webconsole_strict_mode_errors.js +++ b/devtools/client/webconsole/test/browser_webconsole_strict_mode_errors.js @@ -55,7 +55,7 @@ add_task(function* () { webconsole: hud, messages: [ { - text: "TypeError: setting a property that has only a getter", + text: 'TypeError: setting getter-only property "p"', category: CATEGORY_JS, severity: SEVERITY_ERROR, }, diff --git a/devtools/client/webconsole/test/head.js b/devtools/client/webconsole/test/head.js index 519cb78b0..2787933c4 100644 --- a/devtools/client/webconsole/test/head.js +++ b/devtools/client/webconsole/test/head.js @@ -12,7 +12,7 @@ Services.scriptloader.loadSubScript("chrome://mochitests/content/browser/devtool var {Utils: WebConsoleUtils} = require("devtools/client/webconsole/utils"); var {Messages} = require("devtools/client/webconsole/console-output"); const asyncStorage = require("devtools/shared/async-storage"); -const HUDService = require("devtools/client/webconsole/hudservice"); +const {HUDService} = require("devtools/client/webconsole/hudservice"); // Services.prefs.setBoolPref("devtools.debugger.log", true); @@ -1842,3 +1842,18 @@ function getRenderedSource(root) { column: location.getAttribute("data-column"), } : null; } + +function waitForBrowserConsole() { + return new Promise(resolve => { + Services.obs.addObserver(function observer(subject) { + Services.obs.removeObserver(observer, "web-console-created"); + subject.QueryInterface(Ci.nsISupportsString); + + let hud = HUDService.getBrowserConsole(); + ok(hud, "browser console is open"); + is(subject.data, hud.hudId, "notification hudId is correct"); + + executeSoon(() => resolve(hud)); + }, "web-console-created"); + }); +} diff --git a/devtools/moz.build b/devtools/moz.build index b11c4a510..8e368facb 100644 --- a/devtools/moz.build +++ b/devtools/moz.build @@ -4,13 +4,9 @@ # License, v. 2.0. If a copy of the MPL was not distributed with this # file, You can obtain one at http://mozilla.org/MPL/2.0/. -if CONFIG['MOZ_DEVTOOLS'] and CONFIG['MOZ_DEVTOOLS'] not in ('all', 'server'): - error('Unsupported MOZ_DEVTOOLS value: %s' % (CONFIG['MOZ_DEVTOOLS'])) +if CONFIG['MOZ_DEVTOOLS']: + DIRS += ['client'] -if CONFIG['MOZ_DEVTOOLS'] == 'all': - DIRS += [ - 'client', - ] DIRS += [ 'server', @@ -20,6 +16,6 @@ DIRS += [ # /browser uses DIST_SUBDIR. We opt-in to this treatment when building # DevTools for the browser to keep the root omni.ja slim for use by external XUL # apps. Mulet also uses this since it includes /browser. -if CONFIG['MOZ_BUILD_APP'] in ('browser', 'b2g/dev'): +if CONFIG['MOZ_BUILD_APP'] == 'b2g/dev' or CONFIG['MOZ_PHOENIX']: DIST_SUBDIR = 'browser' export('DIST_SUBDIR') diff --git a/devtools/server/actors/css-properties.js b/devtools/server/actors/css-properties.js index d24c133d4..b22d8005f 100644 --- a/devtools/server/actors/css-properties.js +++ b/devtools/server/actors/css-properties.js @@ -31,8 +31,12 @@ exports.CssPropertiesActor = ActorClassWithSpec(cssPropertiesSpec, { getCSSDatabase() { const properties = generateCssProperties(); const pseudoElements = DOMUtils.getCSSPseudoElementNames(); + const supportedFeature = { + // checking for css-color-4 color function support. + "css-color-4-color-function": DOMUtils.isValidCSSColor("rgb(1 1 1 / 100%)"), + }; - return { properties, pseudoElements }; + return { properties, pseudoElements, supportedFeature }; } }); diff --git a/devtools/server/actors/errordocs.js b/devtools/server/actors/errordocs.js index 27f687dc7..7c4b3acff 100644 --- a/devtools/server/actors/errordocs.js +++ b/devtools/server/actors/errordocs.js @@ -18,7 +18,6 @@ const ErrorDocs = { JSMSG_RESULTING_STRING_TOO_LARGE: "Resulting_string_too_large", JSMSG_BAD_RADIX: "Bad_radix", JSMSG_PRECISION_RANGE: "Precision_range", - JSMSG_BAD_FORMAL: "Malformed_formal_parameter", JSMSG_STMT_AFTER_RETURN: "Stmt_after_return", JSMSG_NOT_A_CODEPOINT: "Not_a_codepoint", JSMSG_BAD_SORT_ARG: "Array_sort_argument", diff --git a/devtools/server/actors/highlighters/box-model.js b/devtools/server/actors/highlighters/box-model.js index 35f201a04..ae4284424 100644 --- a/devtools/server/actors/highlighters/box-model.js +++ b/devtools/server/actors/highlighters/box-model.js @@ -15,7 +15,10 @@ const { isNodeValid, moveInfobar, } = require("./utils/markup"); -const { setIgnoreLayoutChanges } = require("devtools/shared/layout/utils"); +const { + setIgnoreLayoutChanges, + getCurrentZoom, + } = require("devtools/shared/layout/utils"); const inspector = require("devtools/server/actors/inspector"); const nodeConstants = require("devtools/shared/dom-node-constants"); @@ -670,10 +673,14 @@ BoxModelHighlighter.prototype = extend(AutoRefreshHighlighter.prototype, { pseudos += ":" + pseudo; } - let rect = this._getOuterQuad("border").bounds; - let dim = parseFloat(rect.width.toPrecision(6)) + + // We want to display the original `width` and `height`, instead of the ones affected + // by any zoom. Since the infobar can be displayed also for text nodes, we can't + // access the computed style for that, and this is why we recalculate them here. + let zoom = getCurrentZoom(this.win); + let { width, height } = this._getOuterQuad("border").bounds; + let dim = parseFloat((width / zoom).toPrecision(6)) + " \u00D7 " + - parseFloat(rect.height.toPrecision(6)); + parseFloat((height / zoom).toPrecision(6)); this.getElement("infobar-tagname").setTextContent(displayName); this.getElement("infobar-id").setTextContent(id); diff --git a/devtools/server/actors/inspector.js b/devtools/server/actors/inspector.js index 20a227a40..883809b6c 100644 --- a/devtools/server/actors/inspector.js +++ b/devtools/server/actors/inspector.js @@ -626,6 +626,18 @@ var NodeActor = exports.NodeActor = protocol.ActorClassWithSpec(nodeSpec, { }, /** + * Get the full CSS path for this node. + * + * @return {String} A CSS selector with a part for the node and each of its ancestors. + */ + getCssPath: function () { + if (Cu.isDeadWrapper(this.rawNode)) { + return ""; + } + return CssLogic.getCssPath(this.rawNode); + }, + + /** * Scroll the selected node into view. */ scrollIntoView: function () { diff --git a/devtools/server/actors/moz.build b/devtools/server/actors/moz.build index 5980876e2..ddefc3e9e 100644 --- a/devtools/server/actors/moz.build +++ b/devtools/server/actors/moz.build @@ -61,9 +61,12 @@ DevToolsModules( 'stylesheets.js', 'timeline.js', 'webaudio.js', - 'webbrowser.js', 'webconsole.js', 'webextension.js', 'webgl.js', 'worker.js', ) + +FINAL_TARGET_PP_FILES.chrome.devtools.modules.devtools.server.actors += [ + 'webbrowser.js', +]
\ No newline at end of file diff --git a/devtools/server/actors/object.js b/devtools/server/actors/object.js index 1f417b951..06e95a5f0 100644 --- a/devtools/server/actors/object.js +++ b/devtools/server/actors/object.js @@ -1158,11 +1158,6 @@ DebuggerServer.ObjectActorPreviewers = { }], RegExp: [function ({obj, hooks}, grip) { - // Avoid having any special preview for the RegExp.prototype itself. - if (!obj.proto || obj.proto.class != "RegExp") { - return false; - } - let str = RegExp.prototype.toString.call(obj.unsafeDereference()); grip.displayString = hooks.createValueGrip(str); return true; diff --git a/devtools/server/actors/root.js b/devtools/server/actors/root.js index b6f8c0ee4..a5df148c2 100644 --- a/devtools/server/actors/root.js +++ b/devtools/server/actors/root.js @@ -145,6 +145,8 @@ RootActor.prototype = { addNewRule: true, // Whether the dom node actor implements the getUniqueSelector method getUniqueSelector: true, + // Whether the dom node actor implements the getCssPath method + getCssPath: true, // Whether the director scripts are supported directorScripts: true, // Whether the debugger server supports diff --git a/devtools/server/actors/storage.js b/devtools/server/actors/storage.js index 572cd6b68..c702e8145 100644 --- a/devtools/server/actors/storage.js +++ b/devtools/server/actors/storage.js @@ -15,6 +15,17 @@ const {isWindowIncluded} = require("devtools/shared/layout/utils"); const specs = require("devtools/shared/specs/storage"); const { Task } = require("devtools/shared/task"); +const DEFAULT_VALUE = "value"; + +loader.lazyRequireGetter(this, "naturalSortCaseInsensitive", + "devtools/client/shared/natural-sort", true); + +// GUID to be used as a separator in compound keys. This must match the same +// constant in devtools/client/storage/ui.js, +// devtools/client/storage/test/head.js and +// devtools/server/tests/browser/head.js +const SEPARATOR_GUID = "{9d414cc5-8319-0a04-0586-c0a6ae01670a}"; + loader.lazyImporter(this, "OS", "resource://gre/modules/osfile.jsm"); loader.lazyImporter(this, "Sqlite", "resource://gre/modules/Sqlite.jsm"); @@ -87,7 +98,7 @@ var StorageActors = {}; * - observe : Method which gets triggered on the notificaiton of the watched * topic. * - getNamesForHost : Given a host, get list of all known store names. - * - getValuesForHost : Given a host (and optianally a name) get all known + * - getValuesForHost : Given a host (and optionally a name) get all known * store objects. * - toStoreObject : Given a store object, convert it to the required format * so that it can be transferred over wire. @@ -118,7 +129,11 @@ StorageActors.defaults = function (typeName, observationTopic) { get hosts() { let hosts = new Set(); for (let {location} of this.storageActor.windows) { - hosts.add(this.getHostName(location)); + let host = this.getHostName(location); + + if (host) { + hosts.add(host); + } } return hosts; }, @@ -132,10 +147,35 @@ StorageActors.defaults = function (typeName, observationTopic) { }, /** - * Converts the window.location object into host. + * Converts the window.location object into a URL (e.g. http://domain.com). */ getHostName(location) { - return location.hostname || location.href; + if (!location) { + // Debugging a legacy Firefox extension... no hostname available and no + // storage possible. + return null; + } + + switch (location.protocol) { + case "data:": + // data: URLs do not support storage of any type. + return null; + case "about:": + // Fallthrough. + case "chrome:": + // Fallthrough. + case "file:": + return location.protocol + location.pathname; + case "resource:": + return location.origin + location.pathname; + case "moz-extension:": + return location.origin; + case "javascript:": + return location.href; + default: + // http: or unknown protocol. + return `${location.protocol}//${location.host}`; + } }, initialize(storageActor) { @@ -188,7 +228,7 @@ StorageActors.defaults = function (typeName, observationTopic) { */ onWindowReady: Task.async(function* (window) { let host = this.getHostName(window.location); - if (!this.hostVsStores.has(host)) { + if (host && !this.hostVsStores.has(host)) { yield this.populateStoresForHost(host, window); let data = {}; data[host] = this.getNamesForHost(host); @@ -209,7 +249,7 @@ StorageActors.defaults = function (typeName, observationTopic) { return; } let host = this.getHostName(window.location); - if (!this.hosts.has(host)) { + if (host && !this.hosts.has(host)) { this.hostVsStores.delete(host); let data = {}; data[host] = []; @@ -315,15 +355,20 @@ StorageActors.defaults = function (typeName, observationTopic) { toReturn.data.push(...values); } } + toReturn.total = this.getObjectsSize(host, names, options); + if (offset > toReturn.total) { // In this case, toReturn.data is an empty array. toReturn.offset = toReturn.total; toReturn.data = []; } else { - toReturn.data = toReturn.data.sort((a, b) => { - return a[sortOn] - b[sortOn]; - }).slice(offset, offset + size).map(a => this.toStoreObject(a)); + // We need to use natural sort before slicing. + let sorted = toReturn.data.sort((a, b) => { + return naturalSortCaseInsensitive(a[sortOn], b[sortOn]); + }); + let sliced = sorted.slice(offset, offset + size); + toReturn.data = sliced.map(a => this.toStoreObject(a)); } } else { let obj = yield this.getValuesForHost(host, undefined, undefined, @@ -333,15 +378,18 @@ StorageActors.defaults = function (typeName, observationTopic) { } toReturn.total = obj.length; + if (offset > toReturn.total) { // In this case, toReturn.data is an empty array. toReturn.offset = offset = toReturn.total; toReturn.data = []; } else { - toReturn.data = obj.sort((a, b) => { - return a[sortOn] - b[sortOn]; - }).slice(offset, offset + size) - .map(object => this.toStoreObject(object)); + // We need to use natural sort before slicing. + let sorted = obj.sort((a, b) => { + return naturalSortCaseInsensitive(a[sortOn], b[sortOn]); + }); + let sliced = sorted.slice(offset, offset + size); + toReturn.data = sliced.map(object => this.toStoreObject(object)); } } @@ -445,6 +493,9 @@ StorageActors.createActor({ if (cookie.host == null) { return host == null; } + + host = trimHttpHttpsPort(host); + if (cookie.host.startsWith(".")) { return ("." + host).endsWith(cookie.host); } @@ -460,11 +511,13 @@ StorageActors.createActor({ } return { + uniqueKey: `${cookie.name}${SEPARATOR_GUID}${cookie.host}` + + `${SEPARATOR_GUID}${cookie.path}`, name: cookie.name, - path: cookie.path || "", host: cookie.host || "", + path: cookie.path || "", - // because expires is in seconds + // because creationTime is in micro seconds expires: (cookie.expires || 0) * 1000, // because it is in micro seconds @@ -488,7 +541,10 @@ StorageActors.createActor({ for (let cookie of cookies) { if (this.isCookieAtHost(cookie, host)) { - this.hostVsStores.get(host).set(cookie.name, cookie); + let uniqueKey = `${cookie.name}${SEPARATOR_GUID}${cookie.host}` + + `${SEPARATOR_GUID}${cookie.path}`; + + this.hostVsStores.get(host).set(uniqueKey, cookie); } } }, @@ -521,8 +577,11 @@ StorageActors.createActor({ case "changed": if (hosts.length) { for (let host of hosts) { - this.hostVsStores.get(host).set(subject.name, subject); - data[host] = [subject.name]; + let uniqueKey = `${subject.name}${SEPARATOR_GUID}${subject.host}` + + `${SEPARATOR_GUID}${subject.path}`; + + this.hostVsStores.get(host).set(uniqueKey, subject); + data[host] = [uniqueKey]; } this.storageActor.update(action, "cookies", data); } @@ -531,8 +590,11 @@ StorageActors.createActor({ case "deleted": if (hosts.length) { for (let host of hosts) { - this.hostVsStores.get(host).delete(subject.name); - data[host] = [subject.name]; + let uniqueKey = `${subject.name}${SEPARATOR_GUID}${subject.host}` + + `${SEPARATOR_GUID}${subject.path}`; + + this.hostVsStores.get(host).delete(uniqueKey); + data[host] = [uniqueKey]; } this.storageActor.update("deleted", "cookies", data); } @@ -543,8 +605,11 @@ StorageActors.createActor({ for (let host of hosts) { let stores = []; for (let cookie of subject) { - this.hostVsStores.get(host).delete(cookie.name); - stores.push(cookie.name); + let uniqueKey = `${cookie.name}${SEPARATOR_GUID}${cookie.host}` + + `${SEPARATOR_GUID}${cookie.path}`; + + this.hostVsStores.get(host).delete(uniqueKey); + stores.push(uniqueKey); } data[host] = stores; } @@ -566,15 +631,17 @@ StorageActors.createActor({ getFields: Task.async(function* () { return [ - { name: "name", editable: 1}, - { name: "path", editable: 1}, - { name: "host", editable: 1}, - { name: "expires", editable: 1}, - { name: "lastAccessed", editable: 0}, - { name: "value", editable: 1}, - { name: "isDomain", editable: 0}, - { name: "isSecure", editable: 1}, - { name: "isHttpOnly", editable: 1} + { name: "uniqueKey", editable: false, private: true }, + { name: "name", editable: true, hidden: false }, + { name: "host", editable: true, hidden: false }, + { name: "path", editable: true, hidden: false }, + { name: "expires", editable: true, hidden: false }, + { name: "lastAccessed", editable: false, hidden: false }, + { name: "creationTime", editable: false, hidden: true }, + { name: "value", editable: true, hidden: false }, + { name: "isDomain", editable: false, hidden: true }, + { name: "isSecure", editable: true, hidden: true }, + { name: "isHttpOnly", editable: true, hidden: false } ]; }), @@ -591,6 +658,14 @@ StorageActors.createActor({ this.editCookie(data); }), + addItem: Task.async(function* (guid) { + let doc = this.storageActor.document; + let time = new Date().getTime(); + let expiry = new Date(time + 3600 * 24 * 1000).toGMTString(); + + doc.cookie = `${guid}=${DEFAULT_VALUE};expires=${expiry}`; + }), + removeItem: Task.async(function* (host, name) { let doc = this.storageActor.document; this.removeCookie(host, name, doc.nodePrincipal @@ -603,6 +678,12 @@ StorageActors.createActor({ .originAttributes); }), + removeAllSessionCookies: Task.async(function* (host, domain) { + let doc = this.storageActor.document; + this.removeAllSessionCookies(host, domain, doc.nodePrincipal + .originAttributes); + }), + maybeSetupChildProcess() { cookieHelpers.onCookieChanged = this.onCookieChanged.bind(this); @@ -619,6 +700,8 @@ StorageActors.createActor({ cookieHelpers.removeCookie.bind(cookieHelpers); this.removeAllCookies = cookieHelpers.removeAllCookies.bind(cookieHelpers); + this.removeAllSessionCookies = + cookieHelpers.removeAllSessionCookies.bind(cookieHelpers); return; } @@ -642,6 +725,8 @@ StorageActors.createActor({ callParentProcess.bind(null, "removeCookie"); this.removeAllCookies = callParentProcess.bind(null, "removeAllCookies"); + this.removeAllSessionCookies = + callParentProcess.bind(null, "removeAllSessionCookies"); addMessageListener("debug:storage-cookie-request-child", cookieHelpers.handleParentRequest); @@ -676,6 +761,8 @@ var cookieHelpers = { host = ""; } + host = trimHttpHttpsPort(host); + let cookies = Services.cookies.getCookiesFromHost(host, originAttributes); let store = []; @@ -696,7 +783,7 @@ var cookieHelpers = { * { * host: "http://www.mozilla.org", * field: "value", - * key: "name", + * editCookie: "name", * oldValue: "%7BHello%7D", * newValue: "%7BHelloo%7D", * items: { @@ -720,10 +807,14 @@ var cookieHelpers = { let origPath = field === "path" ? oldValue : data.items.path; let cookie = null; - let enumerator = Services.cookies.getCookiesFromHost(origHost, data.originAttributes || {}); + let enumerator = + Services.cookies.getCookiesFromHost(origHost, data.originAttributes || {}); + while (enumerator.hasMoreElements()) { let nsiCookie = enumerator.getNext().QueryInterface(Ci.nsICookie2); - if (nsiCookie.name === origName && nsiCookie.host === origHost) { + if (nsiCookie.name === origName && + nsiCookie.host === origHost && + nsiCookie.path === origPath) { cookie = { host: nsiCookie.host, path: nsiCookie.path, @@ -743,7 +834,7 @@ var cookieHelpers = { return; } - // If the date is expired set it for 1 minute in the future. + // If the date is expired set it for 10 seconds in the future. let now = new Date(); if (!cookie.isSession && (cookie.expires * 1000) <= now) { let tenSecondsFromNow = (now.getTime() + 10 * 1000) / 1000; @@ -797,6 +888,17 @@ var cookieHelpers = { }, _removeCookies(host, opts = {}) { + // We use a uniqueId to emulate compound keys for cookies. We need to + // extract the cookie name to remove the correct cookie. + if (opts.name) { + let split = opts.name.split(SEPARATOR_GUID); + + opts.name = split[0]; + opts.path = split[2]; + } + + host = trimHttpHttpsPort(host); + function hostMatches(cookieHost, matchHost) { if (cookieHost == null) { return matchHost == null; @@ -807,12 +909,16 @@ var cookieHelpers = { return cookieHost == host; } - let enumerator = Services.cookies.getCookiesFromHost(host, opts.originAttributes || {}); + let enumerator = + Services.cookies.getCookiesFromHost(host, opts.originAttributes || {}); + while (enumerator.hasMoreElements()) { let cookie = enumerator.getNext().QueryInterface(Ci.nsICookie2); if (hostMatches(cookie.host, host) && (!opts.name || cookie.name === opts.name) && - (!opts.domain || cookie.host === opts.domain)) { + (!opts.domain || cookie.host === opts.domain) && + (!opts.path || cookie.path === opts.path) && + (!opts.session || (!cookie.expires && !cookie.maxAge))) { Services.cookies.remove( cookie.host, cookie.name, @@ -834,6 +940,10 @@ var cookieHelpers = { this._removeCookies(host, { domain, originAttributes }); }, + removeAllSessionCookies(host, domain, originAttributes) { + this._removeCookies(host, { domain, originAttributes, session: true }); + }, + addCookieObservers() { Services.obs.addObserver(cookieHelpers, "cookie-changed", false); return null; @@ -898,6 +1008,12 @@ var cookieHelpers = { let rowdata = msg.data.args[0]; return cookieHelpers.editCookie(rowdata); } + case "createNewCookie": { + let host = msg.data.args[0]; + let guid = msg.data.args[1]; + let originAttributes = msg.data.args[2]; + return cookieHelpers.createNewCookie(host, guid, originAttributes); + } case "removeCookie": { let host = msg.data.args[0]; let name = msg.data.args[1]; @@ -910,6 +1026,12 @@ var cookieHelpers = { let originAttributes = msg.data.args[2]; return cookieHelpers.removeAllCookies(host, domain, originAttributes); } + case "removeAllSessionCookies": { + let host = msg.data.args[0]; + let domain = msg.data.args[1]; + let originAttributes = msg.data.args[2]; + return cookieHelpers.removeAllSessionCookies(host, domain, originAttributes); + } default: console.error("ERR_DIRECTOR_PARENT_UNKNOWN_METHOD", msg.json.method); throw new Error("ERR_DIRECTOR_PARENT_UNKNOWN_METHOD"); @@ -1000,13 +1122,6 @@ function getObjectForLocalOrSessionStorage(type) { })); }, - getHostName(location) { - if (!location.host) { - return location.href; - } - return location.protocol + "//" + location.host; - }, - populateStoresForHost(host, window) { try { this.hostVsStores.set(host, window[type]); @@ -1018,17 +1133,28 @@ function getObjectForLocalOrSessionStorage(type) { populateStoresForHosts() { this.hostVsStores = new Map(); for (let window of this.windows) { - this.populateStoresForHost(this.getHostName(window.location), window); + let host = this.getHostName(window.location); + if (host) { + this.populateStoresForHost(host, window); + } } }, getFields: Task.async(function* () { return [ - { name: "name", editable: 1}, - { name: "value", editable: 1} + { name: "name", editable: true }, + { name: "value", editable: true } ]; }), + addItem: Task.async(function* (guid, host) { + let storage = this.hostVsStores.get(host); + if (!storage) { + return; + } + storage.setItem(guid, DEFAULT_VALUE); + }), + /** * Edit localStorage or sessionStorage fields. * @@ -1143,6 +1269,11 @@ StorageActors.createActor({ // The |chrome| cache is the cache implicitely cached by the platform, // hosting the source file of the service worker. let { CacheStorage } = this.storageActor.window; + + if (!CacheStorage) { + return []; + } + let cache = new CacheStorage("content", principal); return cache; }), @@ -1205,18 +1336,11 @@ StorageActors.createActor({ getFields: Task.async(function* () { return [ - { name: "url", editable: 0 }, - { name: "status", editable: 0 } + { name: "url", editable: false }, + { name: "status", editable: false } ]; }), - getHostName(location) { - if (!location.host) { - return location.href; - } - return location.protocol + "//" + location.host; - }, - populateStoresForHost: Task.async(function* (host) { let storeMap = new Map(); let caches = yield this.getCachesForHost(host); @@ -1386,12 +1510,15 @@ ObjectStoreMetadata.prototype = { * The host associated with this indexed db. * @param {IDBDatabase} db * The particular indexed db. + * @param {String} storage + * Storage type, either "temporary", "default" or "persistent". */ -function DatabaseMetadata(origin, db) { +function DatabaseMetadata(origin, db, storage) { this._origin = origin; this._name = db.name; this._version = db.version; this._objectStores = []; + this.storage = storage; if (db.objectStoreNames.length) { let transaction = db.transaction(db.objectStoreNames, "readonly"); @@ -1411,7 +1538,9 @@ DatabaseMetadata.prototype = { toObject() { return { + uniqueKey: `${this._name}${SEPARATOR_GUID}${this.storage}`, name: this._name, + storage: this.storage, origin: this._origin, version: this._version, objectStores: this._objectStores.size @@ -1483,13 +1612,6 @@ StorageActors.createActor({ this.removeDBRecord(host, principal, db, store, id); }), - getHostName(location) { - if (!location.host) { - return location.href; - } - return location.protocol + "//" + location.host; - }, - /** * This method is overriden and left blank as for indexedDB, this operation * cannot be performed synchronously. Thus, the preListStores method exists to @@ -1579,15 +1701,17 @@ StorageActors.createActor({ populateStoresForHost: Task.async(function* (host) { let storeMap = new Map(); let {names} = yield this.getDBNamesForHost(host); + let win = this.storageActor.getWindowFromHost(host); if (win) { let principal = win.document.nodePrincipal; - for (let name of names) { - let metadata = yield this.getDBMetaData(host, principal, name); + for (let {name, storage} of names) { + let metadata = yield this.getDBMetaData(host, principal, name, storage); metadata = indexedDBHelpers.patchMetadataMapsAndProtos(metadata); - storeMap.set(name, metadata); + + storeMap.set(`${name} (${storage})`, metadata); } } @@ -1614,16 +1738,30 @@ StorageActors.createActor({ if ("objectStores" in item) { // DB meta data return { + uniqueKey: `${item.name} (${item.storage})`, db: item.name, + storage: item.storage, origin: item.origin, version: item.version, objectStores: item.objectStores }; } + + let value = JSON.stringify(item.value); + + // FIXME: Bug 1318029 - Due to a bug that is thrown whenever a + // LongStringActor string reaches DebuggerServer.LONG_STRING_LENGTH we need + // to trim the value. When the bug is fixed we should stop trimming the + // string here. + let maxLength = DebuggerServer.LONG_STRING_LENGTH - 1; + if (value.length > maxLength) { + value = value.substr(0, maxLength); + } + // Indexed db entry return { name: item.name, - value: new LongStringActor(this.conn, JSON.stringify(item.value)) + value: new LongStringActor(this.conn, value) }; }, @@ -1659,16 +1797,20 @@ StorageActors.createActor({ maybeSetupChildProcess() { if (!DebuggerServer.isInChildProcess) { this.backToChild = (func, rv) => rv; + this.clearDBStore = indexedDBHelpers.clearDBStore; + this.findIDBPathsForHost = indexedDBHelpers.findIDBPathsForHost; + this.findSqlitePathsForHost = indexedDBHelpers.findSqlitePathsForHost; + this.findStorageTypePaths = indexedDBHelpers.findStorageTypePaths; this.getDBMetaData = indexedDBHelpers.getDBMetaData; - this.openWithPrincipal = indexedDBHelpers.openWithPrincipal; this.getDBNamesForHost = indexedDBHelpers.getDBNamesForHost; - this.getSanitizedHost = indexedDBHelpers.getSanitizedHost; this.getNameFromDatabaseFile = indexedDBHelpers.getNameFromDatabaseFile; - this.getValuesForHost = indexedDBHelpers.getValuesForHost; this.getObjectStoreData = indexedDBHelpers.getObjectStoreData; + this.getSanitizedHost = indexedDBHelpers.getSanitizedHost; + this.getValuesForHost = indexedDBHelpers.getValuesForHost; + this.openWithPrincipal = indexedDBHelpers.openWithPrincipal; this.removeDB = indexedDBHelpers.removeDB; this.removeDBRecord = indexedDBHelpers.removeDBRecord; - this.clearDBStore = indexedDBHelpers.clearDBStore; + this.splitNameAndStorage = indexedDBHelpers.splitNameAndStorage; return; } @@ -1681,6 +1823,7 @@ StorageActors.createActor({ }); this.getDBMetaData = callParentProcessAsync.bind(null, "getDBMetaData"); + this.splitNameAndStorage = callParentProcessAsync.bind(null, "splitNameAndStorage"); this.getDBNamesForHost = callParentProcessAsync.bind(null, "getDBNamesForHost"); this.getValuesForHost = callParentProcessAsync.bind(null, "getValuesForHost"); this.removeDB = callParentProcessAsync.bind(null, "removeDB"); @@ -1725,26 +1868,28 @@ StorageActors.createActor({ // Detail of database case "database": return [ - { name: "objectStore", editable: 0 }, - { name: "keyPath", editable: 0 }, - { name: "autoIncrement", editable: 0 }, - { name: "indexes", editable: 0 }, + { name: "objectStore", editable: false }, + { name: "keyPath", editable: false }, + { name: "autoIncrement", editable: false }, + { name: "indexes", editable: false }, ]; // Detail of object store case "object store": return [ - { name: "name", editable: 0 }, - { name: "value", editable: 0 } + { name: "name", editable: false }, + { name: "value", editable: false } ]; // Detail of indexedDB for one origin default: return [ - { name: "db", editable: 0 }, - { name: "origin", editable: 0 }, - { name: "version", editable: 0 }, - { name: "objectStores", editable: 0 }, + { name: "uniqueKey", editable: false, private: true }, + { name: "db", editable: false }, + { name: "storage", editable: false }, + { name: "origin", editable: false }, + { name: "version", editable: false }, + { name: "objectStores", editable: false }, ]; } }) @@ -1776,14 +1921,14 @@ var indexedDBHelpers = { * `name` for the given `host` with its `principal`. The stored metadata * information is of `DatabaseMetadata` type. */ - getDBMetaData: Task.async(function* (host, principal, name) { - let request = this.openWithPrincipal(principal, name); + getDBMetaData: Task.async(function* (host, principal, name, storage) { + let request = this.openWithPrincipal(principal, name, storage); let success = promise.defer(); request.onsuccess = event => { let db = event.target.result; - let dbData = new DatabaseMetadata(host, db); + let dbData = new DatabaseMetadata(host, db, storage); db.close(); success.resolve(this.backToChild("getDBMetaData", dbData)); @@ -1796,21 +1941,37 @@ var indexedDBHelpers = { return success.promise; }), + splitNameAndStorage: function (name) { + let lastOpenBracketIndex = name.lastIndexOf("("); + let lastCloseBracketIndex = name.lastIndexOf(")"); + let delta = lastCloseBracketIndex - lastOpenBracketIndex - 1; + + let storage = name.substr(lastOpenBracketIndex + 1, delta); + + name = name.substr(0, lastOpenBracketIndex - 1); + + return { storage, name }; + }, + /** * Opens an indexed db connection for the given `principal` and * database `name`. */ - openWithPrincipal(principal, name) { - return indexedDBForStorage.openForPrincipal(principal, name); + openWithPrincipal: function (principal, name, storage) { + return indexedDBForStorage.openForPrincipal(principal, name, + { storage: storage }); }, - removeDB: Task.async(function* (host, principal, name) { + removeDB: Task.async(function* (host, principal, dbName) { let result = new promise(resolve => { - let request = indexedDBForStorage.deleteForPrincipal(principal, name); + let {name, storage} = this.splitNameAndStorage(dbName); + let request = + indexedDBForStorage.deleteForPrincipal(principal, name, + { storage: storage }); request.onsuccess = () => { resolve({}); - this.onItemUpdated("deleted", host, [name]); + this.onItemUpdated("deleted", host, [dbName]); }; request.onblocked = () => { @@ -1836,10 +1997,11 @@ var indexedDBHelpers = { removeDBRecord: Task.async(function* (host, principal, dbName, storeName, id) { let db; + let {name, storage} = this.splitNameAndStorage(dbName); try { db = yield new promise((resolve, reject) => { - let request = this.openWithPrincipal(principal, dbName); + let request = this.openWithPrincipal(principal, name, storage); request.onsuccess = ev => resolve(ev.target.result); request.onerror = ev => reject(ev.target.error); }); @@ -1868,10 +2030,11 @@ var indexedDBHelpers = { clearDBStore: Task.async(function* (host, principal, dbName, storeName) { let db; + let {name, storage} = this.splitNameAndStorage(dbName); try { db = yield new promise((resolve, reject) => { - let request = this.openWithPrincipal(principal, dbName); + let request = this.openWithPrincipal(principal, name, storage); request.onsuccess = ev => resolve(ev.target.result); request.onerror = ev => reject(ev.target.error); }); @@ -1903,46 +2066,101 @@ var indexedDBHelpers = { */ getDBNamesForHost: Task.async(function* (host) { let sanitizedHost = this.getSanitizedHost(host); - let directory = OS.Path.join(OS.Constants.Path.profileDir, "storage", - "default", sanitizedHost, "idb"); - - let exists = yield OS.File.exists(directory); - if (!exists && host.startsWith("about:")) { - // try for moz-safe-about directory - sanitizedHost = this.getSanitizedHost("moz-safe-" + host); - directory = OS.Path.join(OS.Constants.Path.profileDir, "storage", - "permanent", sanitizedHost, "idb"); - exists = yield OS.File.exists(directory); - } - if (!exists) { - return this.backToChild("getDBNamesForHost", {names: []}); + let profileDir = OS.Constants.Path.profileDir; + let files = []; + let names = []; + let storagePath = OS.Path.join(profileDir, "storage"); + + // We expect sqlite DB paths to look something like this: + // - PathToProfileDir/storage/default/http+++www.example.com/ + // idb/1556056096MeysDaabta.sqlite + // - PathToProfileDir/storage/permanent/http+++www.example.com/ + // idb/1556056096MeysDaabta.sqlite + // - PathToProfileDir/storage/temporary/http+++www.example.com/ + // idb/1556056096MeysDaabta.sqlite + // The subdirectory inside the storage folder is determined by the storage + // type: + // - default: { storage: "default" } or not specified. + // - permanent: { storage: "persistent" }. + // - temporary: { storage: "temporary" }. + let sqliteFiles = yield this.findSqlitePathsForHost(storagePath, sanitizedHost); + + for (let file of sqliteFiles) { + let splitPath = OS.Path.split(file).components; + let idbIndex = splitPath.indexOf("idb"); + let storage = splitPath[idbIndex - 2]; + let relative = file.substr(profileDir.length + 1); + + files.push({ + file: relative, + storage: storage === "permanent" ? "persistent" : storage + }); } - let names = []; - let dirIterator = new OS.File.DirectoryIterator(directory); - try { - yield dirIterator.forEach(file => { - // Skip directories. - if (file.isDir) { - return null; + if (files.length > 0) { + for (let {file, storage} of files) { + let name = yield this.getNameFromDatabaseFile(file); + if (name) { + names.push({ + name, + storage + }); } + } + } + return this.backToChild("getDBNamesForHost", {names}); + }), - // Skip any non-sqlite files. - if (!file.name.endsWith(".sqlite")) { - return null; + /** + * Find all SQLite files that hold IndexedDB data for a host, such as: + * storage/temporary/http+++www.example.com/idb/1556056096MeysDaabta.sqlite + */ + findSqlitePathsForHost: Task.async(function* (storagePath, sanitizedHost) { + let sqlitePaths = []; + let idbPaths = yield this.findIDBPathsForHost(storagePath, sanitizedHost); + for (let idbPath of idbPaths) { + let iterator = new OS.File.DirectoryIterator(idbPath); + yield iterator.forEach(entry => { + if (!entry.isDir && entry.path.endsWith(".sqlite")) { + sqlitePaths.push(entry.path); } - - return this.getNameFromDatabaseFile(file.path).then(name => { - if (name) { - names.push(name); - } - return null; - }); }); - } finally { - dirIterator.close(); + iterator.close(); + } + return sqlitePaths; + }), + + /** + * Find all paths that hold IndexedDB data for a host, such as: + * storage/temporary/http+++www.example.com/idb + */ + findIDBPathsForHost: Task.async(function* (storagePath, sanitizedHost) { + let idbPaths = []; + let typePaths = yield this.findStorageTypePaths(storagePath); + for (let typePath of typePaths) { + let idbPath = OS.Path.join(typePath, sanitizedHost, "idb"); + if (yield OS.File.exists(idbPath)) { + idbPaths.push(idbPath); + } } - return this.backToChild("getDBNamesForHost", {names: names}); + return idbPaths; + }), + + /** + * Find all the storage types, such as "default", "permanent", or "temporary". + * These names have changed over time, so it seems simpler to look through all types + * that currently exist in the profile. + */ + findStorageTypePaths: Task.async(function* (storagePath) { + let iterator = new OS.File.DirectoryIterator(storagePath); + let typePaths = []; + yield iterator.forEach(entry => { + if (entry.isDir) { + typePaths.push(entry.path); + } + }); + iterator.close(); + return typePaths; }), /** @@ -1950,6 +2168,9 @@ var indexedDBHelpers = { * name. */ getSanitizedHost(host) { + if (host.startsWith("about:")) { + host = "moz-safe-" + host; + } return host.replace(ILLEGAL_CHAR_REGEX, "+"); }, @@ -1963,7 +2184,7 @@ var indexedDBHelpers = { // Content pages might be having an open transaction for the same indexed db // which this sqlite file belongs to. In that case, sqlite.openConnection - // will throw. Thus we retey for some time to see if lock is removed. + // will throw. Thus we retry for some time to see if lock is removed. while (!connection && retryCount++ < 25) { try { connection = yield Sqlite.openConnection({ path: path }); @@ -2024,8 +2245,14 @@ var indexedDBHelpers = { return this.backToChild("getValuesForHost", {objectStores: objectStores}); } // Get either all entries from the object store, or a particular id - let result = yield this.getObjectStoreData(host, principal, db2, - objectStore, id, options.index, options.size); + let storage = hostVsStores.get(host).get(db2).storage; + let result = yield this.getObjectStoreData(host, principal, db2, storage, { + objectStore: objectStore, + id: id, + index: options.index, + offset: 0, + size: options.size + }); return this.backToChild("getValuesForHost", {result: result}); }), @@ -2039,23 +2266,27 @@ var indexedDBHelpers = { * The principal of the given document. * @param {string} dbName * The name of the indexed db from the above host. - * @param {string} objectStore - * The name of the object store from the above db. - * @param {string} id - * id of the requested entry from the above object store. - * null if all entries from the above object store are requested. - * @param {string} index - * name of the IDBIndex to be iterated on while fetching entries. - * null or "name" if no index is to be iterated. - * @param {number} offset - * ofsset of the entries to be fetched. - * @param {number} size - * The intended size of the entries to be fetched. + * @param {String} storage + * Storage type, either "temporary", "default" or "persistent". + * @param {Object} requestOptions + * An object in the following format: + * { + * objectStore: The name of the object store from the above db, + * id: Id of the requested entry from the above object + * store. null if all entries from the above object + * store are requested, + * index: Name of the IDBIndex to be iterated on while fetching + * entries. null or "name" if no index is to be + * iterated, + * offset: offset of the entries to be fetched, + * size: The intended size of the entries to be fetched + * } */ - getObjectStoreData(host, principal, dbName, objectStore, id, index, - offset, size) { - let request = this.openWithPrincipal(principal, dbName); + getObjectStoreData(host, principal, dbName, storage, requestOptions) { + let {name} = this.splitNameAndStorage(dbName); + let request = this.openWithPrincipal(principal, name, storage); let success = promise.defer(); + let {objectStore, id, index, offset, size} = requestOptions; let data = []; let db; @@ -2157,8 +2388,12 @@ var indexedDBHelpers = { switch (msg.json.method) { case "getDBMetaData": { - let [host, principal, name] = args; - return indexedDBHelpers.getDBMetaData(host, principal, name); + let [host, principal, name, storage] = args; + return indexedDBHelpers.getDBMetaData(host, principal, name, storage); + } + case "splitNameAndStorage": { + let [name] = args; + return indexedDBHelpers.splitNameAndStorage(name); } case "getDBNamesForHost": { let [host] = args; @@ -2170,8 +2405,8 @@ var indexedDBHelpers = { hostVsStores, principal); } case "removeDB": { - let [host, principal, name] = args; - return indexedDBHelpers.removeDB(host, principal, name); + let [host, principal, dbName] = args; + return indexedDBHelpers.removeDB(host, principal, dbName); } case "removeDBRecord": { let [host, principal, db, store, id] = args; @@ -2215,6 +2450,24 @@ exports.setupParentProcessForIndexedDB = function ({ mm, prefix }) { }; /** + * General helpers + */ +function trimHttpHttpsPort(url) { + let match = url.match(/(.+):\d+$/); + + if (match) { + url = match[1]; + } + if (url.startsWith("http://")) { + return url.substr(7); + } + if (url.startsWith("https://")) { + return url.substr(8); + } + return url; +} + +/** * The main Storage Actor. */ let StorageActor = protocol.ActorClassWithSpec(specs.storageSpec, { @@ -2480,6 +2733,7 @@ let StorageActor = protocol.ActorClassWithSpec(specs.storageSpec, { // added or changed update this.removeNamesFromUpdateList("added", storeType, data); this.removeNamesFromUpdateList("changed", storeType, data); + for (let host in data) { if (data[host].length == 0 && this.boundUpdate.added && this.boundUpdate.added[storeType] && diff --git a/devtools/server/actors/stylesheets.js b/devtools/server/actors/stylesheets.js index f20634e6c..7fcbca8c4 100644 --- a/devtools/server/actors/stylesheets.js +++ b/devtools/server/actors/stylesheets.js @@ -13,7 +13,6 @@ const events = require("sdk/event/core"); const protocol = require("devtools/shared/protocol"); const {LongStringActor} = require("devtools/server/actors/string"); const {fetch} = require("devtools/shared/DevToolsUtils"); -const {listenOnce} = require("devtools/shared/async-utils"); const {originalSourceSpec, mediaRuleSpec, styleSheetSpec, styleSheetsSpec} = require("devtools/shared/specs/stylesheets"); const {SourceMapConsumer} = require("source-map"); @@ -251,7 +250,7 @@ var StyleSheetActor = protocol.ActorClassWithSpec(styleSheetSpec, { }, destroy: function () { - if (this._transitionTimeout) { + if (this._transitionTimeout && this.window) { this.window.clearTimeout(this._transitionTimeout); removePseudoClassLock( this.document.documentElement, TRANSITION_PSEUDO_CLASS); @@ -801,6 +800,64 @@ var StyleSheetsActor = protocol.ActorClassWithSpec(styleSheetsSpec, { protocol.Actor.prototype.initialize.call(this, null); this.parentActor = tabActor; + + this._onNewStyleSheetActor = this._onNewStyleSheetActor.bind(this); + this._onSheetAdded = this._onSheetAdded.bind(this); + this._onWindowReady = this._onWindowReady.bind(this); + + events.on(this.parentActor, "stylesheet-added", this._onNewStyleSheetActor); + events.on(this.parentActor, "window-ready", this._onWindowReady); + + // We listen for StyleSheetApplicableStateChanged rather than + // StyleSheetAdded, because the latter will be sent before the + // rules are ready. Using the former (with a check to ensure that + // the sheet is enabled) ensures that the sheet is ready before we + // try to make an actor for it. + this.parentActor.chromeEventHandler + .addEventListener("StyleSheetApplicableStateChanged", this._onSheetAdded, true); + + // This is used when creating a new style sheet, so that we can + // pass the correct flag when emitting our stylesheet-added event. + // See addStyleSheet and _onNewStyleSheetActor for more details. + this._nextStyleSheetIsNew = false; + }, + + destroy: function () { + for (let win of this.parentActor.windows) { + // This flag only exists for devtools, so we are free to clear + // it when we're done. + win.document.styleSheetChangeEventsEnabled = false; + } + + events.off(this.parentActor, "stylesheet-added", this._onNewStyleSheetActor); + events.off(this.parentActor, "window-ready", this._onWindowReady); + + this.parentActor.chromeEventHandler.removeEventListener("StyleSheetAdded", + this._onSheetAdded, true); + + protocol.Actor.prototype.destroy.call(this); + }, + + /** + * Event handler that is called when a the tab actor emits window-ready. + * + * @param {Event} evt + * The triggering event. + */ + _onWindowReady: function (evt) { + this._addStyleSheets(evt.window); + }, + + /** + * Event handler that is called when a the tab actor emits stylesheet-added. + * + * @param {StyleSheetActor} actor + * The new style sheet actor. + */ + _onNewStyleSheetActor: function (actor) { + // Forward it to the client side. + events.emit(this, "stylesheet-added", actor, this._nextStyleSheetIsNew); + this._nextStyleSheetIsNew = false; }, /** @@ -808,23 +865,11 @@ var StyleSheetsActor = protocol.ActorClassWithSpec(styleSheetsSpec, { * all the style sheets in this document. */ getStyleSheets: Task.async(function* () { - // Iframe document can change during load (bug 1171919). Track their windows - // instead. - let windows = [this.window]; let actors = []; - for (let win of windows) { + for (let win of this.parentActor.windows) { let sheets = yield this._addStyleSheets(win); actors = actors.concat(sheets); - - // Recursively handle style sheets of the documents in iframes. - for (let iframe of win.document.querySelectorAll("iframe, browser, frame")) { - if (iframe.contentDocument && iframe.contentWindow) { - // Sometimes, iframes don't have any document, like the - // one that are over deeply nested (bug 285395) - windows.push(iframe.contentWindow); - } - } } return actors; }), @@ -832,15 +877,13 @@ var StyleSheetsActor = protocol.ActorClassWithSpec(styleSheetsSpec, { /** * Check if we should be showing this stylesheet. * - * @param {Document} doc - * Document for which we're checking * @param {DOMCSSStyleSheet} sheet * Stylesheet we're interested in * * @return boolean * Whether the stylesheet should be listed. */ - _shouldListSheet: function (doc, sheet) { + _shouldListSheet: function (sheet) { // Special case about:PreferenceStyleSheet, as it is generated on the // fly and the URI is not registered with the about: handler. // https://bugzilla.mozilla.org/show_bug.cgi?id=935803#c37 @@ -852,6 +895,22 @@ var StyleSheetsActor = protocol.ActorClassWithSpec(styleSheetsSpec, { }, /** + * Event handler that is called when a new style sheet is added to + * a document. In particular, StyleSheetApplicableStateChanged is + * listened for, because StyleSheetAdded is sent too early, before + * the rules are ready. + * + * @param {Event} evt + * The triggering event. + */ + _onSheetAdded: function (evt) { + let sheet = evt.stylesheet; + if (this._shouldListSheet(sheet)) { + this.parentActor.createStyleSheetActor(sheet); + } + }, + + /** * Add all the stylesheets for the document in this window to the map and * create an actor for each one if not already created. * @@ -865,24 +924,16 @@ var StyleSheetsActor = protocol.ActorClassWithSpec(styleSheetsSpec, { { return Task.spawn(function* () { let doc = win.document; - // readyState can be uninitialized if an iframe has just been created but - // it has not started to load yet. - if (doc.readyState === "loading" || doc.readyState === "uninitialized") { - // Wait for the document to load first. - yield listenOnce(win, "DOMContentLoaded", true); - - // Make sure we have the actual document for this window. If the - // readyState was initially uninitialized, the initial dummy document - // was replaced with the actual document (bug 1171919). - doc = win.document; - } + // We have to set this flag in order to get the + // StyleSheetApplicableStateChanged events. See Document.webidl. + doc.styleSheetChangeEventsEnabled = true; let isChrome = Services.scriptSecurityManager.isSystemPrincipal(doc.nodePrincipal); let styleSheets = isChrome ? DOMUtils.getAllStyleSheets(doc) : doc.styleSheets; let actors = []; for (let i = 0; i < styleSheets.length; i++) { let sheet = styleSheets[i]; - if (!this._shouldListSheet(doc, sheet)) { + if (!this._shouldListSheet(sheet)) { continue; } @@ -917,7 +968,7 @@ var StyleSheetsActor = protocol.ActorClassWithSpec(styleSheetsSpec, { if (rule.type == Ci.nsIDOMCSSRule.IMPORT_RULE) { // Associated styleSheet may be null if it has already been seen due // to duplicate @imports for the same URL. - if (!rule.styleSheet || !this._shouldListSheet(doc, rule.styleSheet)) { + if (!rule.styleSheet || !this._shouldListSheet(rule.styleSheet)) { continue; } let actor = this.parentActor.createStyleSheetActor(rule.styleSheet); @@ -948,6 +999,13 @@ var StyleSheetsActor = protocol.ActorClassWithSpec(styleSheetsSpec, { * Object with 'styelSheet' property for form on new actor. */ addStyleSheet: function (text) { + // This is a bit convoluted. The style sheet actor may be created + // by a notification from platform. In this case, we can't easily + // pass the "new" flag through to createStyleSheetActor, so we set + // a flag locally and check it before sending an event to the + // client. See |_onNewStyleSheetActor|. + this._nextStyleSheetIsNew = true; + let parent = this.document.documentElement; let style = this.document.createElementNS("http://www.w3.org/1999/xhtml", "style"); style.setAttribute("type", "text/css"); diff --git a/devtools/server/actors/webbrowser.js b/devtools/server/actors/webbrowser.js index 0edcdc187..dffe49b91 100644 --- a/devtools/server/actors/webbrowser.js +++ b/devtools/server/actors/webbrowser.js @@ -30,7 +30,9 @@ loader.lazyRequireGetter(this, "WorkerActorList", "devtools/server/actors/worker loader.lazyRequireGetter(this, "ServiceWorkerRegistrationActorList", "devtools/server/actors/worker", true); loader.lazyRequireGetter(this, "ProcessActorList", "devtools/server/actors/process", true); loader.lazyImporter(this, "AddonManager", "resource://gre/modules/AddonManager.jsm"); +#ifdef MOZ_WEBEXTENSIONS loader.lazyImporter(this, "ExtensionContent", "resource://gre/modules/ExtensionContent.jsm"); +#endif // Assumptions on events module: // events needs to be dispatched synchronously, @@ -982,6 +984,7 @@ TabActor.prototype = { return null; }, +#ifdef MOZ_WEBEXTENSIONS /** * Getter for the WebExtensions ContentScript globals related to the * current tab content's DOM window. @@ -994,6 +997,7 @@ TabActor.prototype = { return []; }, +#endif /** * Getter for the list of all content DOM windows in this tabActor @@ -2497,7 +2501,11 @@ DebuggerProgressListener.prototype = { if (isWindow && isStop) { // Don't dispatch "navigate" event just yet when there is a redirect to // about:neterror page. - if (request.status != Cr.NS_OK) { + // Navigating to about:neterror will make `status` be something else than NS_OK. + // But for some error like NS_BINDING_ABORTED we don't want to emit any `navigate` + // event as the page load has been cancelled and the related page document is going + // to be a dead wrapper. + if (request.status != Cr.NS_OK && request.status != Cr.NS_BINDING_ABORTED) { // Instead, listen for DOMContentLoaded as about:neterror is loaded // with LOAD_BACKGROUND flags and never dispatches load event. // That may be the same reason why there is no onStateChange event diff --git a/devtools/server/css-logic.js b/devtools/server/css-logic.js index f632871e1..c4a073635 100644 --- a/devtools/server/css-logic.js +++ b/devtools/server/css-logic.js @@ -793,6 +793,55 @@ CssLogic.findCssSelector = function (ele) { }; /** + * Get the full CSS path for a given element. + * @returns a string that can be used as a CSS selector for the element. It might not + * match the element uniquely. It does however, represent the full path from the root + * node to the element. + */ +CssLogic.getCssPath = function (ele) { + ele = getRootBindingParent(ele); + const document = ele.ownerDocument; + if (!document || !document.contains(ele)) { + throw new Error("getCssPath received element not inside document"); + } + + const getElementSelector = element => { + if (!element.localName) { + return ""; + } + + let label = element.nodeName == element.nodeName.toUpperCase() + ? element.localName.toLowerCase() + : element.localName; + + if (element.id) { + label += "#" + element.id; + } + + if (element.classList) { + for (let cl of element.classList) { + label += "." + cl; + } + } + + return label; + }; + + let paths = []; + + while (ele) { + if (!ele || ele.nodeType !== Node.ELEMENT_NODE) { + break; + } + + paths.splice(0, 0, getElementSelector(ele)); + ele = ele.parentNode; + } + + return paths.length ? paths.join(" ") : ""; +} + +/** * A safe way to access cached bits of information about a stylesheet. * * @constructor diff --git a/devtools/server/event-parsers.js b/devtools/server/event-parsers.js index a813d8e9b..6245af190 100644 --- a/devtools/server/event-parsers.js +++ b/devtools/server/event-parsers.js @@ -91,44 +91,58 @@ var parsers = [ return jQueryLiveGetListeners(node, false); }, normalizeHandler: function (handlerDO) { - let paths = [ - [".event.proxy/", ".event.proxy/", "*"], - [".proxy/", "*"] - ]; - - let name = handlerDO.displayName; + function isFunctionInProxy(funcDO) { + // If the anonymous function is inside the |proxy| function and the + // function only has guessed atom, the guessed atom should starts with + // "proxy/". + let displayName = funcDO.displayName; + if (displayName && displayName.startsWith("proxy/")) { + return true; + } - if (!name) { - return handlerDO; + // If the anonymous function is inside the |proxy| function and the + // function gets name at compile time by SetFunctionName, its guessed + // atom doesn't contain "proxy/". In that case, check if the caller is + // "proxy" function, as a fallback. + let calleeDO = funcDO.environment.callee; + if (!calleeDO) { + return false; + } + let calleeName = calleeDO.displayName; + return calleeName == "proxy"; } - for (let path of paths) { - if (name.includes(path[0])) { - path.splice(0, 1); - - for (let point of path) { - let names = handlerDO.environment.names(); + function getFirstFunctionVariable(funcDO) { + // The handler function inside the |proxy| function should point the + // unwrapped function via environment variable. + let names = funcDO.environment.names(); + for (let varName of names) { + let varDO = handlerDO.environment.getVariable(varName); + if (!varDO) { + continue; + } + if (varDO.class == "Function") { + return varDO; + } + } + return null; + } - for (let varName of names) { - let temp = handlerDO.environment.getVariable(varName); - if (!temp) { - continue; - } + if (!isFunctionInProxy(handlerDO)) { + return handlerDO; + } - let displayName = temp.displayName; - if (!displayName) { - continue; - } + const MAX_NESTED_HANDLER_COUNT = 2; + for (let i = 0; i < MAX_NESTED_HANDLER_COUNT; i++) { + let funcDO = getFirstFunctionVariable(handlerDO); + if (!funcDO) + return handlerDO; - if (temp.class === "Function" && - (displayName.includes(point) || point === "*")) { - handlerDO = temp; - break; - } - } - } - break; + handlerDO = funcDO; + if (isFunctionInProxy(handlerDO)) { + continue; } + break; } return handlerDO; diff --git a/devtools/server/tests/browser/browser.ini b/devtools/server/tests/browser/browser.ini index c05933230..b7929e2b0 100644 --- a/devtools/server/tests/browser/browser.ini +++ b/devtools/server/tests/browser/browser.ini @@ -11,6 +11,7 @@ support-files = doc_perf.html navigate-first.html navigate-second.html + storage-cookies-same-name.html storage-dynamic-windows.html storage-listings.html storage-unsecured-iframe.html @@ -80,6 +81,7 @@ skip-if = e10s # Bug 1183605 - devtools/server/tests/browser/ tests are still di #[browser_perf-front-profiler-01.js] bug 1077464 #[browser_perf-front-profiler-05.js] bug 1077464 #[browser_perf-front-profiler-06.js] +[browser_storage_cookies-duplicate-names.js] [browser_storage_dynamic_windows.js] [browser_storage_listings.js] [browser_storage_updates.js] diff --git a/devtools/server/tests/browser/browser_storage_cookies-duplicate-names.js b/devtools/server/tests/browser/browser_storage_cookies-duplicate-names.js new file mode 100644 index 000000000..1cdc8b490 --- /dev/null +++ b/devtools/server/tests/browser/browser_storage_cookies-duplicate-names.js @@ -0,0 +1,105 @@ +/* vim: set ft=javascript ts=2 et sw=2 tw=80: */ +/* Any copyright is dedicated to the Public Domain. + http://creativecommons.org/publicdomain/zero/1.0/ */ + +"use strict"; + +// Test that the storage panel is able to display multiple cookies with the same +// name (and different paths). + +const {StorageFront} = require("devtools/shared/fronts/storage"); +Services.scriptloader.loadSubScript("chrome://mochitests/content/browser/devtools/server/tests/browser/storage-helpers.js", this); + +const TESTDATA = { + "http://test1.example.org": [ + { + name: "name", + value: "value1", + expires: 0, + path: "/", + host: "test1.example.org", + isDomain: false, + isSecure: false, + }, + { + name: "name", + value: "value2", + expires: 0, + path: "/path2/", + host: "test1.example.org", + isDomain: false, + isSecure: false, + }, + { + name: "name", + value: "value3", + expires: 0, + path: "/path3/", + host: "test1.example.org", + isDomain: false, + isSecure: false, + } + ] +}; + +add_task(function* () { + yield openTabAndSetupStorage(MAIN_DOMAIN + "storage-cookies-same-name.html"); + + initDebuggerServer(); + let client = new DebuggerClient(DebuggerServer.connectPipe()); + let form = yield connectDebuggerClient(client); + let front = StorageFront(client, form); + let data = yield front.listStores(); + + ok(data.cookies, "Cookies storage actor is present"); + + yield testCookies(data.cookies); + yield clearStorage(); + + // Forcing GC/CC to get rid of docshells and windows created by this test. + forceCollections(); + yield client.close(); + forceCollections(); + DebuggerServer.destroy(); + forceCollections(); +}); + +function testCookies(cookiesActor) { + let numHosts = Object.keys(cookiesActor.hosts).length; + is(numHosts, 1, "Correct number of host entries for cookies"); + return testCookiesObjects(0, cookiesActor.hosts, cookiesActor); +} + +var testCookiesObjects = Task.async(function* (index, hosts, cookiesActor) { + let host = Object.keys(hosts)[index]; + let matchItems = data => { + is(data.total, TESTDATA[host].length, + "Number of cookies in host " + host + " matches"); + for (let item of data.data) { + let found = false; + for (let toMatch of TESTDATA[host]) { + if (item.name === toMatch.name && + item.host === toMatch.host && + item.path === toMatch.path) { + found = true; + ok(true, "Found cookie " + item.name + " in response"); + is(item.value.str, toMatch.value, "The value matches."); + is(item.expires, toMatch.expires, "The expiry time matches."); + is(item.path, toMatch.path, "The path matches."); + is(item.host, toMatch.host, "The host matches."); + is(item.isSecure, toMatch.isSecure, "The isSecure value matches."); + is(item.isDomain, toMatch.isDomain, "The isDomain value matches."); + break; + } + } + ok(found, "cookie " + item.name + " should exist in response"); + } + }; + + ok(!!TESTDATA[host], "Host is present in the list : " + host); + matchItems(yield cookiesActor.getStoreObjects(host)); + if (index == Object.keys(hosts).length - 1) { + return; + } + yield testCookiesObjects(++index, hosts, cookiesActor); +}); diff --git a/devtools/server/tests/browser/browser_storage_dynamic_windows.js b/devtools/server/tests/browser/browser_storage_dynamic_windows.js index 440c91222..a8f791f15 100644 --- a/devtools/server/tests/browser/browser_storage_dynamic_windows.js +++ b/devtools/server/tests/browser/browser_storage_dynamic_windows.js @@ -9,8 +9,8 @@ Services.scriptloader.loadSubScript("chrome://mochitests/content/browser/devtool const beforeReload = { cookies: { - "test1.example.org": ["c1", "cs2", "c3", "uc1"], - "sectest1.example.org": ["uc1", "cs2"] + "http://test1.example.org": ["c1", "cs2", "c3", "uc1"], + "http://sectest1.example.org": ["uc1", "cs2"] }, localStorage: { "http://test1.example.org": ["ls1", "ls2"], @@ -66,6 +66,7 @@ function markOutMatched(toBeEmptied, data, deleted) { info("Testing for " + storageType); for (let host in data[storageType]) { ok(toBeEmptied[storageType][host], "Host " + host + " found"); + if (!deleted) { for (let item of data[storageType][host]) { let index = toBeEmptied[storageType][host].indexOf(item); @@ -87,50 +88,6 @@ function markOutMatched(toBeEmptied, data, deleted) { } } -// function testReload(front) { -// info("Testing if reload works properly"); - -// let shouldBeEmptyFirst = Cu.cloneInto(beforeReload, {}); -// let shouldBeEmptyLast = Cu.cloneInto(beforeReload, {}); -// return new Promise(resolve => { - -// let onStoresUpdate = data => { -// info("in stores update of testReload"); -// // This might be second time stores update is happening, in which case, -// // data.deleted will be null. -// // OR.. This might be the first time on a super slow machine where both -// // data.deleted and data.added is missing in the first update. -// if (data.deleted) { -// markOutMatched(shouldBeEmptyFirst, data.deleted, true); -// } - -// if (!Object.keys(shouldBeEmptyFirst).length) { -// info("shouldBeEmptyFirst is empty now"); -// } - -// // stores-update call might not have data.added for the first time on -// // slow machines, in which case, data.added will be null -// if (data.added) { -// markOutMatched(shouldBeEmptyLast, data.added); -// } - -// if (!Object.keys(shouldBeEmptyLast).length) { -// info("Everything to be received is received."); -// endTestReloaded(); -// } -// }; - -// let endTestReloaded = () => { -// front.off("stores-update", onStoresUpdate); -// resolve(); -// }; - -// front.on("stores-update", onStoresUpdate); - -// content.location.reload(); -// }); -// } - function testAddIframe(front) { info("Testing if new iframe addition works properly"); return new Promise(resolve => { @@ -142,7 +99,15 @@ function testAddIframe(front) { "https://sectest1.example.org": ["iframe-s-ss1"] }, cookies: { - "sectest1.example.org": ["sc1"] + "https://sectest1.example.org": [ + getCookieId("cs2", ".example.org", "/"), + getCookieId("sc1", "sectest1.example.org", + "/browser/devtools/server/tests/browser/") + ], + "http://sectest1.example.org": [ + getCookieId("sc1", "sectest1.example.org", + "/browser/devtools/server/tests/browser/") + ] }, indexedDB: { // empty because indexed db creation happens after the page load, so at @@ -150,7 +115,7 @@ function testAddIframe(front) { "https://sectest1.example.org": [] }, Cache: { - "https://sectest1.example.org":[] + "https://sectest1.example.org": [] } }; diff --git a/devtools/server/tests/browser/browser_storage_listings.js b/devtools/server/tests/browser/browser_storage_listings.js index 4ff3c3fc1..6c1668321 100644 --- a/devtools/server/tests/browser/browser_storage_listings.js +++ b/devtools/server/tests/browser/browser_storage_listings.js @@ -9,7 +9,7 @@ Services.scriptloader.loadSubScript("chrome://mochitests/content/browser/devtool const storeMap = { cookies: { - "test1.example.org": [ + "http://test1.example.org": [ { name: "c1", value: "foobar", @@ -20,15 +20,6 @@ const storeMap = { isSecure: false, }, { - name: "cs2", - value: "sessionCookie", - path: "/", - host: ".example.org", - expires: 0, - isDomain: true, - isSecure: false, - }, - { name: "c3", value: "foobar-2", expires: 2000000001000, @@ -47,7 +38,29 @@ const storeMap = { isSecure: true, } ], - "sectest1.example.org": [ + + "http://sectest1.example.org": [ + { + name: "cs2", + value: "sessionCookie", + path: "/", + host: ".example.org", + expires: 0, + isDomain: true, + isSecure: false, + }, + { + name: "sc1", + value: "foobar", + path: "/browser/devtools/server/tests/browser/", + host: "sectest1.example.org", + expires: 0, + isDomain: false, + isSecure: false, + } + ], + + "https://sectest1.example.org": [ { name: "uc1", value: "foobar", @@ -130,24 +143,24 @@ const storeMap = { const IDBValues = { listStoresResponse: { "http://test1.example.org": [ - ["idb1", "obj1"], ["idb1", "obj2"], ["idb2", "obj3"] + ["idb1 (default)", "obj1"], ["idb1 (default)", "obj2"], ["idb2 (default)", "obj3"] ], "http://sectest1.example.org": [ ], "https://sectest1.example.org": [ - ["idb-s1", "obj-s1"], ["idb-s2", "obj-s2"] + ["idb-s1 (default)", "obj-s1"], ["idb-s2 (default)", "obj-s2"] ] }, - dbDetails : { + dbDetails: { "http://test1.example.org": [ { - db: "idb1", + db: "idb1 (default)", origin: "http://test1.example.org", version: 1, objectStores: 2 }, { - db: "idb2", + db: "idb2 (default)", origin: "http://test1.example.org", version: 1, objectStores: 1 @@ -157,13 +170,13 @@ const IDBValues = { ], "https://sectest1.example.org": [ { - db: "idb-s1", + db: "idb-s1 (default)", origin: "https://sectest1.example.org", version: 1, objectStores: 1 }, { - db: "idb-s2", + db: "idb-s2 (default)", origin: "https://sectest1.example.org", version: 1, objectStores: 1 @@ -172,7 +185,7 @@ const IDBValues = { }, objectStoreDetails: { "http://test1.example.org": { - idb1: [ + "idb1 (default)": [ { objectStore: "obj1", keyPath: "id", @@ -199,7 +212,7 @@ const IDBValues = { indexes: [] } ], - idb2: [ + "idb2 (default)": [ { objectStore: "obj3", keyPath: "id3", @@ -217,7 +230,7 @@ const IDBValues = { }, "http://sectest1.example.org" : {}, "https://sectest1.example.org": { - "idb-s1": [ + "idb-s1 (default)": [ { objectStore: "obj-s1", keyPath: "id", @@ -225,7 +238,7 @@ const IDBValues = { indexes: [] }, ], - "idb-s2": [ + "idb-s2 (default)": [ { objectStore: "obj-s2", keyPath: "id3", @@ -245,7 +258,7 @@ const IDBValues = { }, entries: { "http://test1.example.org": { - "idb1#obj1": [ + "idb1 (default)#obj1": [ { name: 1, value: { @@ -271,7 +284,7 @@ const IDBValues = { } } ], - "idb1#obj2": [ + "idb1 (default)#obj2": [ { name: 1, value: { @@ -282,11 +295,11 @@ const IDBValues = { } } ], - "idb2#obj3": [] + "idb2 (default)#obj3": [] }, "http://sectest1.example.org" : {}, "https://sectest1.example.org": { - "idb-s1#obj-s1": [ + "idb-s1 (default)#obj-s1": [ { name: 6, value: { @@ -304,7 +317,7 @@ const IDBValues = { } } ], - "idb-s2#obj-s2": [ + "idb-s2 (default)#obj-s2": [ { name: 13, value: { @@ -337,7 +350,8 @@ function* testStores(data) { } function testCookies(cookiesActor) { - is(Object.keys(cookiesActor.hosts).length, 2, "Correct number of host entries for cookies"); + is(Object.keys(cookiesActor.hosts).length, 3, + "Correct number of host entries for cookies"); return testCookiesObjects(0, cookiesActor.hosts, cookiesActor); } @@ -346,9 +360,9 @@ var testCookiesObjects = Task.async(function* (index, hosts, cookiesActor) { let matchItems = data => { let cookiesLength = 0; for (let secureCookie of storeMap.cookies[host]) { - if (secureCookie.isSecure) { - ++cookiesLength; - } + if (secureCookie.isSecure) { + ++cookiesLength; + } } // Any secure cookies did not get stored in the database. is(data.total, storeMap.cookies[host].length - cookiesLength, @@ -478,17 +492,17 @@ var testIndexedDBs = Task.async(function* (index, hosts, indexedDBActor) { for (let item of data.data) { let found = false; for (let toMatch of IDBValues.dbDetails[host]) { - if (item.db == toMatch.db) { + if (item.uniqueKey == toMatch.db) { found = true; - ok(true, "Found indexed db " + item.db + " in response"); + ok(true, "Found indexed db " + item.uniqueKey + " in response"); is(item.origin, toMatch.origin, "The origin matches."); is(item.version, toMatch.version, "The version matches."); is(item.objectStores, toMatch.objectStores, - "The numebr of object stores matches."); + "The number of object stores matches."); break; } } - ok(found, "indexed db " + item.name + " should exist in response"); + ok(found, "indexed db " + item.uniqueKey + " should exist in response"); } }; diff --git a/devtools/server/tests/browser/browser_storage_updates.js b/devtools/server/tests/browser/browser_storage_updates.js index 28b2e509f..4a1604787 100644 --- a/devtools/server/tests/browser/browser_storage_updates.js +++ b/devtools/server/tests/browser/browser_storage_updates.js @@ -6,7 +6,7 @@ const {StorageFront} = require("devtools/shared/fronts/storage"); const beforeReload = { - cookies: ["test1.example.org", "sectest1.example.org"], + cookies: ["http://test1.example.org", "https://sectest1.example.org"], localStorage: ["http://test1.example.org", "http://sectest1.example.org"], sessionStorage: ["http://test1.example.org", "http://sectest1.example.org"], }; @@ -27,7 +27,12 @@ const TESTS = [ expected: { added: { cookies: { - "test1.example.org": ["c1", "c2"] + "http://test1.example.org": [ + getCookieId("c1", "test1.example.org", + "/browser/devtools/server/tests/browser/"), + getCookieId("c2", "test1.example.org", + "/browser/devtools/server/tests/browser/") + ] }, localStorage: { "http://test1.example.org": ["l1"] @@ -48,7 +53,10 @@ const TESTS = [ expected: { changed: { cookies: { - "test1.example.org": ["c1"] + "http://test1.example.org": [ + getCookieId("c1", "test1.example.org", + "/browser/devtools/server/tests/browser/"), + ] } }, added: { @@ -74,7 +82,10 @@ const TESTS = [ expected: { deleted: { cookies: { - "test1.example.org": ["c2"] + "http://test1.example.org": [ + getCookieId("c2", "test1.example.org", + "/browser/devtools/server/tests/browser/"), + ] }, localStorage: { "http://test1.example.org": ["l1"] @@ -112,7 +123,10 @@ const TESTS = [ expected: { added: { cookies: { - "test1.example.org": ["c3"] + "http://test1.example.org": [ + getCookieId("c3", "test1.example.org", + "/browser/devtools/server/tests/browser/"), + ] }, sessionStorage: { "http://test1.example.org": ["s1", "s2"] @@ -125,7 +139,10 @@ const TESTS = [ }, deleted: { cookies: { - "test1.example.org": ["c1"] + "http://test1.example.org": [ + getCookieId("c1", "test1.example.org", + "/browser/devtools/server/tests/browser/"), + ] }, localStorage: { "http://test1.example.org": ["l2"] @@ -158,7 +175,10 @@ const TESTS = [ expected: { deleted: { cookies: { - "test1.example.org": ["c3"] + "http://test1.example.org": [ + getCookieId("c3", "test1.example.org", + "/browser/devtools/server/tests/browser/"), + ] } } } diff --git a/devtools/server/tests/browser/head.js b/devtools/server/tests/browser/head.js index 1e7f09d95..5cf98c2b0 100644 --- a/devtools/server/tests/browser/head.js +++ b/devtools/server/tests/browser/head.js @@ -2,6 +2,10 @@ * License, v. 2.0. If a copy of the MPL was not distributed with this * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +"use strict"; + +/* eslint no-unused-vars: [2, {"vars": "local"}] */ + var Cc = Components.classes; var Ci = Components.interfaces; var Cu = Components.utils; @@ -19,6 +23,11 @@ const MAIN_DOMAIN = "http://test1.example.org/" + PATH; const ALT_DOMAIN = "http://sectest1.example.org/" + PATH; const ALT_DOMAIN_SECURED = "https://sectest1.example.org:443/" + PATH; +// GUID to be used as a separator in compound keys. This must match the same +// constant in devtools/server/actors/storage.js, +// devtools/client/storage/ui.js and devtools/client/storage/test/head.js +const SEPARATOR_GUID = "{9d414cc5-8319-0a04-0586-c0a6ae01670a}"; + // All tests are asynchronous. waitForExplicitFinish(); @@ -94,7 +103,6 @@ function once(target, eventName, useCapture = false) { info("Waiting for event: '" + eventName + "' on " + target + "."); return new Promise(resolve => { - for (let [add, remove] of [ ["addEventListener", "removeEventListener"], ["addListener", "removeListener"], @@ -137,6 +145,8 @@ function getMockTabActor(win) { } registerCleanupFunction(function tearDown() { + Services.cookies.removeAll(); + while (gBrowser.tabs.length > 1) { gBrowser.removeCurrentTab(); } @@ -148,8 +158,11 @@ function idleWait(time) { function busyWait(time) { let start = Date.now(); + // eslint-disable-next-line let stack; - while (Date.now() - start < time) { stack = Components.stack; } + while (Date.now() - start < time) { + stack = Components.stack; + } } /** @@ -172,11 +185,12 @@ function waitUntil(predicate, interval = 10) { } function waitForMarkerType(front, types, predicate, - unpackFun = (name, data) => data.markers, - eventName = "timeline-data") -{ + unpackFun = (name, data) => data.markers, + eventName = "timeline-data") { types = [].concat(types); - predicate = predicate || function () { return true; }; + predicate = predicate || function () { + return true; + }; let filteredMarkers = []; let { promise, resolve } = defer(); @@ -190,9 +204,11 @@ function waitForMarkerType(front, types, predicate, let markers = unpackFun(name, data); info("Got markers: " + JSON.stringify(markers, null, 2)); - filteredMarkers = filteredMarkers.concat(markers.filter(m => types.indexOf(m.name) !== -1)); + filteredMarkers = filteredMarkers.concat( + markers.filter(m => types.indexOf(m.name) !== -1)); - if (types.every(t => filteredMarkers.some(m => m.name === t)) && predicate(filteredMarkers)) { + if (types.every(t => filteredMarkers.some(m => m.name === t)) && + predicate(filteredMarkers)) { front.off(eventName, handler); resolve(filteredMarkers); } @@ -201,3 +217,7 @@ function waitForMarkerType(front, types, predicate, return promise; } + +function getCookieId(name, domain, path) { + return `${name}${SEPARATOR_GUID}${domain}${SEPARATOR_GUID}${path}`; +} diff --git a/devtools/server/tests/browser/storage-cookies-same-name.html b/devtools/server/tests/browser/storage-cookies-same-name.html new file mode 100644 index 000000000..e3e092ec3 --- /dev/null +++ b/devtools/server/tests/browser/storage-cookies-same-name.html @@ -0,0 +1,28 @@ +<!DOCTYPE HTML> +<html> +<head> + <meta charset="utf-8"> + <title>Storage inspector cookies with duplicate names</title> +</head> +<body onload="createCookies()"> +<script type="application/javascript;version=1.7"> +"use strict"; +function createCookies() { + document.cookie = "name=value1;path=/;"; + document.cookie = "name=value2;path=/path2/;"; + document.cookie = "name=value3;path=/path3/;"; +} + +window.removeCookie = function (name) { + document.cookie = name + "=;expires=Thu, 01 Jan 1970 00:00:00 GMT"; +}; + +window.clearCookies = function () { + let cookies = document.cookie; + for (let cookie of cookies.split(";")) { + removeCookie(cookie.split("=")[0]); + } +}; +</script> +</body> +</html> diff --git a/devtools/server/tests/mochitest/test_memory_allocations_05.html b/devtools/server/tests/mochitest/test_memory_allocations_05.html index 0eeb7bd16..4b6b4f0ea 100644..100755 --- a/devtools/server/tests/mochitest/test_memory_allocations_05.html +++ b/devtools/server/tests/mochitest/test_memory_allocations_05.html @@ -70,8 +70,9 @@ window.onload = function() { if (lastTimestamp) { var delta = timestamp - lastTimestamp; info("delta since last timestamp", delta); - ok(delta >= 1 /* ms */, - "The timestamp should be about 1 ms after the last timestamp."); + // If we're unlucky, we might have rounded down to 0ms + // ok(delta >= 1 /* ms */, + // "The timestamp should be about 1 ms after the last timestamp."); } lastTimestamp = timestamp; diff --git a/devtools/server/tests/unit/test_functiongrips-01.js b/devtools/server/tests/unit/test_functiongrips-01.js index c41a7cad5..81b1b7767 100644 --- a/devtools/server/tests/unit/test_functiongrips-01.js +++ b/devtools/server/tests/unit/test_functiongrips-01.js @@ -52,7 +52,7 @@ function test_inferred_name_function() { do_check_eq(args[0].class, "Function"); // No name for an anonymous function, but it should have an inferred name. do_check_eq(args[0].name, undefined); - do_check_eq(args[0].displayName, "o.m"); + do_check_eq(args[0].displayName, "m"); let objClient = gThreadClient.pauseGrip(args[0]); objClient.getParameterNames(function (aResponse) { diff --git a/devtools/shared/css/color.js b/devtools/shared/css/color.js index b354043d7..98ddeff19 100644 --- a/devtools/shared/css/color.js +++ b/devtools/shared/css/color.js @@ -28,6 +28,10 @@ const SPECIALVALUES = new Set([ * Usage: * let {colorUtils} = require("devtools/shared/css/color"); * let color = new colorUtils.CssColor("red"); + * // In order to support css-color-4 color function, pass true to the + * // second argument. + * // e.g. + * // let color = new colorUtils.CssColor("red", true); * * color.authored === "red" * color.hasAlpha === false @@ -58,8 +62,9 @@ const SPECIALVALUES = new Set([ * Valid values for COLOR_UNIT_PREF are contained in CssColor.COLORUNIT. */ -function CssColor(colorValue) { +function CssColor(colorValue, supportsCssColor4ColorFunction = false) { this.newColor(colorValue); + this.cssColor4 = supportsCssColor4ColorFunction; } module.exports.colorUtils = { @@ -92,6 +97,9 @@ CssColor.prototype = { // A lower-cased copy of |authored|. lowerCased: null, + // Whether the value should be parsed using css-color-4 rules. + cssColor4: false, + _setColorUnitUppercase: function (color) { // Specifically exclude the case where the color is // case-insensitive. This makes it so that "#000" isn't @@ -136,7 +144,7 @@ CssColor.prototype = { }, get valid() { - return isValidCSSColor(this.authored); + return isValidCSSColor(this.authored, this.cssColor4); }, /** @@ -393,7 +401,7 @@ CssColor.prototype = { * appropriate. */ _getRGBATuple: function () { - let tuple = colorToRGBA(this.authored); + let tuple = colorToRGBA(this.authored, this.cssColor4); tuple.a = parseFloat(tuple.a.toFixed(1)); @@ -481,11 +489,13 @@ function roundTo(number, digits) { * Color in the form of hex, hsl, hsla, rgb, rgba. * @param {Number} alpha * Alpha value for the color, between 0 and 1. + * @param {Boolean} useCssColor4ColorFunction + * use css-color-4 color function or not. * @return {String} * Converted color with `alpha` value in rgba form. */ -function setAlpha(colorValue, alpha) { - let color = new CssColor(colorValue); +function setAlpha(colorValue, alpha, useCssColor4ColorFunction = false) { + let color = new CssColor(colorValue, useCssColor4ColorFunction); // Throw if the color supplied is not valid. if (!color.valid) { @@ -1049,12 +1059,11 @@ function parseOldStyleRgb(lexer, hasAlpha) { * color's components. Any valid CSS color form can be passed in. * * @param {String} name the color - * @param {Boolean} oldColorFunctionSyntax use old color function syntax or the - * css-color-4 syntax + * @param {Boolean} useCssColor4ColorFunction use css-color-4 color function or not. * @return {Object} an object of the form {r, g, b, a}; or null if the * name was not a valid color */ -function colorToRGBA(name, oldColorFunctionSyntax = true) { +function colorToRGBA(name, useCssColor4ColorFunction = false) { name = name.trim().toLowerCase(); if (name in cssColors) { @@ -1089,7 +1098,7 @@ function colorToRGBA(name, oldColorFunctionSyntax = true) { let hsl = func.text === "hsl" || func.text === "hsla"; let vals; - if (oldColorFunctionSyntax) { + if (!useCssColor4ColorFunction) { let hasAlpha = (func.text === "rgba" || func.text === "hsla"); vals = hsl ? parseOldStyleHsl(lexer, hasAlpha) : parseOldStyleRgb(lexer, hasAlpha); } else { @@ -1110,8 +1119,9 @@ function colorToRGBA(name, oldColorFunctionSyntax = true) { * Check whether a string names a valid CSS color. * * @param {String} name The string to check + * @param {Boolean} useCssColor4ColorFunction use css-color-4 color function or not. * @return {Boolean} True if the string is a CSS color name. */ -function isValidCSSColor(name) { - return colorToRGBA(name) !== null; +function isValidCSSColor(name, useCssColor4ColorFunction = false) { + return colorToRGBA(name, useCssColor4ColorFunction) !== null; } diff --git a/devtools/shared/fronts/css-properties.js b/devtools/shared/fronts/css-properties.js index 9b3172a22..d61bb4b07 100644 --- a/devtools/shared/fronts/css-properties.js +++ b/devtools/shared/fronts/css-properties.js @@ -47,6 +47,20 @@ const CssPropertiesFront = FrontClassWithSpec(cssPropertiesSpec, { }); /** + * Query the feature supporting status in the featureSet. + * + * @param {Hashmap} featureSet the feature set hashmap + * @param {String} feature the feature name string + * @return {Boolean} has the feature or not + */ +function hasFeature(featureSet, feature) { + if (feature in featureSet) { + return featureSet[feature]; + } + return false; +} + +/** * Ask questions to a CSS database. This class does not care how the database * gets loaded in, only the questions that you can ask to it. * Prototype functions are bound to 'this' so they can be passed around as helper @@ -62,10 +76,16 @@ function CssProperties(db) { this.properties = db.properties; this.pseudoElements = db.pseudoElements; + // supported feature + this.cssColor4ColorFunction = hasFeature(db.supportedFeature, + "css-color-4-color-function"); + this.isKnown = this.isKnown.bind(this); this.isInherited = this.isInherited.bind(this); this.supportsType = this.supportsType.bind(this); this.isValidOnClient = this.isValidOnClient.bind(this); + this.supportsCssColor4ColorFunction = + this.supportsCssColor4ColorFunction.bind(this); // A weakly held dummy HTMLDivElement to test CSS properties on the client. this._dummyElements = new WeakMap(); @@ -181,6 +201,15 @@ CssProperties.prototype = { } return []; }, + + /** + * Checking for the css-color-4 color function support. + * + * @return {Boolean} Return true if the server supports css-color-4 color function. + */ + supportsCssColor4ColorFunction() { + return this.cssColor4ColorFunction; + }, }; /** @@ -292,6 +321,11 @@ function normalizeCssData(db) { reattachCssColorValues(db); + // If there is no supportedFeature in db, create an empty one. + if (!db.supportedFeature) { + db.supportedFeature = {}; + } + return db; } diff --git a/devtools/shared/gcli/commands/cmd.js b/devtools/shared/gcli/commands/cmd.js index 1777ed960..1b3cb2ecb 100644 --- a/devtools/shared/gcli/commands/cmd.js +++ b/devtools/shared/gcli/commands/cmd.js @@ -137,8 +137,6 @@ exports.items = [ return !prefBranch.prefHasUserValue(PREF_DIR); }, exec: function(args, context) { - gcli.load(); - let dirName = prefBranch.getComplexValue(PREF_DIR, Ci.nsISupportsString).data.trim(); return l10n.lookupFormat("cmdStatus3", [ dirName ]); @@ -170,8 +168,6 @@ exports.items = [ supportsString.data = args.directory; prefBranch.setComplexValue(PREF_DIR, Ci.nsISupportsString, supportsString); - gcli.load(); - return l10n.lookupFormat("cmdStatus3", [ args.directory ]); } } diff --git a/devtools/shared/gcli/commands/cookie.js b/devtools/shared/gcli/commands/cookie.js index f1680042f..203ac738c 100644 --- a/devtools/shared/gcli/commands/cookie.js +++ b/devtools/shared/gcli/commands/cookie.js @@ -100,7 +100,7 @@ exports.items = [ let cookies = []; while (enm.hasMoreElements()) { - let cookie = enm.getNext().QueryInterface(Ci.nsICookie); + let cookie = enm.getNext().QueryInterface(Ci.nsICookie2); if (isCookieAtHost(cookie, host)) { cookies.push({ host: cookie.host, @@ -108,9 +108,10 @@ exports.items = [ value: cookie.value, path: cookie.path, expires: cookie.expires, - secure: cookie.secure, - httpOnly: cookie.httpOnly, - sameDomain: cookie.sameDomain + isDomain: cookie.isDomain, + isHttpOnly: cookie.isHttpOnly, + isSecure: cookie.isSecure, + isSession: cookie.isSession, }); } } @@ -169,11 +170,14 @@ exports.items = [ for (let cookie of cookies) { cookie.expires = translateExpires(cookie.expires); - let noAttrs = !cookie.secure && !cookie.httpOnly && !cookie.sameDomain; - cookie.attrs = (cookie.secure ? "secure" : " ") + - (cookie.httpOnly ? "httpOnly" : " ") + - (cookie.sameDomain ? "sameDomain" : " ") + - (noAttrs ? l10n.lookup("cookieListOutNone") : " "); + let noAttrs = !cookie.isDomain && !cookie.isHttpOnly && + !cookie.isSecure && !cookie.isSession; + cookie.attrs = ((cookie.isDomain ? "isDomain " : "") + + (cookie.isHttpOnly ? "isHttpOnly " : "") + + (cookie.isSecure ? "isSecure " : "") + + (cookie.isSession ? "isSession " : "") + + (noAttrs ? l10n.lookup("cookieListOutNone") : "")) + .trim(); } return context.createView({ diff --git a/devtools/shared/gcli/commands/screenshot.js b/devtools/shared/gcli/commands/screenshot.js index e2f38b6d9..11bafcab9 100644 --- a/devtools/shared/gcli/commands/screenshot.js +++ b/devtools/shared/gcli/commands/screenshot.js @@ -277,6 +277,12 @@ function createScreenshotData(document, args) { window.scrollTo(0,0); width = window.innerWidth + window.scrollMaxX - window.scrollMinX; height = window.innerHeight + window.scrollMaxY - window.scrollMinY; + let writingMode = "horizontal-tb"; + if (window.getComputedStyle(document.documentElement)) { + writingMode = window.getComputedStyle(document.documentElement).writingMode; + } + let orientation = writingMode.substring(0, writingMode.indexOf("-")).toLowerCase(); + left = ((orientation != "vertical") ? left : (-width + window.innerWidth)); filename = filename.replace(".png", "-fullpage.png"); } else if (args.selector) { diff --git a/devtools/shared/gcli/source/lib/gcli/commands/help.js b/devtools/shared/gcli/source/lib/gcli/commands/help.js index 7d1cc9087..365c53380 100644 --- a/devtools/shared/gcli/source/lib/gcli/commands/help.js +++ b/devtools/shared/gcli/source/lib/gcli/commands/help.js @@ -275,7 +275,7 @@ exports.items = [ ' <div if="${command.isParent}">\n' + ' <p class="gcli-help-header">${l10n.subCommands}:</p>\n' + ' <ul class="gcli-help-${subcommands}">\n' + - ' <li if="${subcommands.length === 0}">${l10n.subcommandsNone}</li>\n' + + ' <li if="${subcommands.length === 0}">${l10n.subCommandsNone}</li>\n' + ' <li foreach="subcommand in ${subcommands}">\n' + ' ${subcommand.name}: ${subcommand.description}\n' + ' <span class="gcli-out-shortcut" data-command="help ${subcommand.name}"\n' + @@ -321,7 +321,7 @@ exports.items = [ '\n' + '<span if="${command.isParent}"># ${l10n.subCommands}:</span>\n' + '\n' + - '<span if="${subcommands.length === 0}">${l10n.subcommandsNone}</span>\n' + + '<span if="${subcommands.length === 0}">${l10n.subCommandsNone}</span>\n' + '<loop foreach="subcommand in ${subcommands}">* ${subcommand.name}: ${subcommand.description}\n' + '</loop>\n' + '</div>\n', diff --git a/devtools/shared/inspector/css-logic.js b/devtools/shared/inspector/css-logic.js index c8cdd2fdb..901b7a189 100644 --- a/devtools/shared/inspector/css-logic.js +++ b/devtools/shared/inspector/css-logic.js @@ -30,6 +30,8 @@ "use strict"; +const MAX_DATA_URL_LENGTH = 40; + /** * Provide access to the style information in a page. * CssLogic uses the standard DOM API, and the Gecko inIDOMUtils API to access @@ -103,6 +105,13 @@ exports.shortSource = function (sheet) { return exports.l10n("rule.sourceInline"); } + // If the sheet is a data URL, return a trimmed version of it. + let dataUrl = sheet.href.trim().match(/^data:.*?,((?:.|\r|\n)*)$/); + if (dataUrl) { + return dataUrl[1].length > MAX_DATA_URL_LENGTH ? + `${dataUrl[1].substr(0, MAX_DATA_URL_LENGTH - 1)}…` : dataUrl[1]; + } + // We try, in turn, the filename, filePath, query string, whole thing let url = {}; try { @@ -123,8 +132,7 @@ exports.shortSource = function (sheet) { return url.query; } - let dataUrl = sheet.href.match(/^(data:[^,]*),/); - return dataUrl ? dataUrl[1] : sheet.href; + return sheet.href; }; const TAB_CHARS = "\t"; diff --git a/devtools/shared/locales/en-US/gcli.properties b/devtools/shared/locales/en-US/gcli.properties index e5231e44a..59c344832 100644 --- a/devtools/shared/locales/en-US/gcli.properties +++ b/devtools/shared/locales/en-US/gcli.properties @@ -141,9 +141,10 @@ helpManual=Provide help either on a specific command (if a search string is prov helpSearchDesc=Search string helpSearchManual3=search string to use in narrowing down the displayed commands. Regular expressions not supported. -# LOCALIZATION NOTE: These strings are displayed in the help page for a -# command in the console. +# LOCALIZATION NOTE (helpManSynopsis, helpManDescription): These strings are +# displayed in the help page for a command in the console. helpManSynopsis=Synopsis +helpManDescription=Description # LOCALIZATION NOTE: This message is displayed in the help page if the command # has no parameters. @@ -177,6 +178,10 @@ helpIntro=GCLI is an experiment to create a highly usable command line for web d # sub-commands. subCommands=Sub-Commands +# LOCALIZATION NOTE: Text shown as part of the output of the 'help' command +# when the command in question should have sub-commands but in fact has none. +subCommandsNone=None + # LOCALIZATION NOTE: This error message is displayed when the command line is # cannot find a match for the parse types. commandParseError=Command line parsing error diff --git a/devtools/shared/qrcode/moz.build b/devtools/shared/qrcode/moz.build index 68a093b1c..c9493a538 100644 --- a/devtools/shared/qrcode/moz.build +++ b/devtools/shared/qrcode/moz.build @@ -9,7 +9,7 @@ DIRS += [ ] # Save file size on Fennec until there are active plans to use the decoder there -if CONFIG['MOZ_BUILD_APP'] != 'mobile/android': +if not CONFIG['MOZ_FENNEC']: DIRS += [ 'decoder' ] diff --git a/devtools/shared/specs/node.js b/devtools/shared/specs/node.js index ea3d1b264..022d7f1ac 100644 --- a/devtools/shared/specs/node.js +++ b/devtools/shared/specs/node.js @@ -37,6 +37,12 @@ const nodeSpec = generateActorSpec({ value: RetVal("string") } }, + getCssPath: { + request: {}, + response: { + value: RetVal("string") + } + }, scrollIntoView: { request: {}, response: {} diff --git a/devtools/shared/specs/storage.js b/devtools/shared/specs/storage.js index d6ddaefe5..42a35073a 100644 --- a/devtools/shared/specs/storage.js +++ b/devtools/shared/specs/storage.js @@ -40,6 +40,7 @@ function createStorageSpec(options) { // Cookies store object types.addDictType("cookieobject", { + uniqueKey: "string", name: "string", value: "longstring", path: "nullable:string", @@ -61,7 +62,7 @@ types.addDictType("cookiestoreobject", { // Common methods for edit/remove const editRemoveMethods = { - getEditableFields: { + getFields: { request: {}, response: { value: RetVal("json") @@ -89,6 +90,13 @@ createStorageSpec({ methods: Object.assign({}, editRemoveMethods, { + addItem: { + request: { + guid: Arg(0, "string"), + }, + response: {} + } + }, { removeAll: { request: { host: Arg(0, "string"), @@ -96,6 +104,14 @@ createStorageSpec({ }, response: {} } + }, { + removeAllSessionCookies: { + request: { + host: Arg(0, "string"), + domain: Arg(1, "nullable:string") + }, + response: {} + } } ) }); @@ -110,6 +126,14 @@ types.addDictType("storageobject", { const storageMethods = Object.assign({}, editRemoveMethods, { + addItem: { + request: { + guid: Arg(0, "string"), + host: Arg(1, "nullable:string") + }, + response: {} + } + }, { removeAll: { request: { host: Arg(0, "string") @@ -176,11 +200,13 @@ createStorageSpec({ // This is a union on idb object, db metadata object and object store metadata // object types.addDictType("idbobject", { + uniqueKey: "string", name: "nullable:string", db: "nullable:string", objectStore: "nullable:string", origin: "nullable:string", version: "nullable:number", + storage: "nullable:string", objectStores: "nullable:number", keyPath: "nullable:string", autoIncrement: "nullable:boolean", diff --git a/devtools/shared/specs/stylesheets.js b/devtools/shared/specs/stylesheets.js index c89a7c088..fc75281f8 100644 --- a/devtools/shared/specs/stylesheets.js +++ b/devtools/shared/specs/stylesheets.js @@ -105,6 +105,14 @@ exports.styleSheetSpec = styleSheetSpec; const styleSheetsSpec = generateActorSpec({ typeName: "stylesheets", + events: { + "stylesheet-added": { + type: "stylesheetAdded", + sheet: Arg(0, "stylesheet"), + isNew: Arg(1, "boolean") + }, + }, + methods: { getStyleSheets: { request: {}, diff --git a/devtools/shared/tests/mochitest/chrome.ini b/devtools/shared/tests/mochitest/chrome.ini index 85ece7c48..3e4e028d1 100644 --- a/devtools/shared/tests/mochitest/chrome.ini +++ b/devtools/shared/tests/mochitest/chrome.ini @@ -2,6 +2,7 @@ tags = devtools skip-if = os == 'android' -[test_eventemitter_basic.html] +[test_css-logic-getCssPath.html] [test_devtools_extensions.html] +[test_eventemitter_basic.html] skip-if = os == 'linux' && debug # Bug 1205739 diff --git a/devtools/shared/tests/mochitest/test_css-logic-getCssPath.html b/devtools/shared/tests/mochitest/test_css-logic-getCssPath.html new file mode 100644 index 000000000..2c444308a --- /dev/null +++ b/devtools/shared/tests/mochitest/test_css-logic-getCssPath.html @@ -0,0 +1,121 @@ +<!DOCTYPE HTML> +<html> +<!-- +https://bugzilla.mozilla.org/show_bug.cgi?id=1323700 +--> +<head> + <meta charset="utf-8"> + <title>Test for Bug 1323700</title> + + <script type="application/javascript" src="chrome://mochikit/content/tests/SimpleTest/SimpleTest.js"></script> + <link rel="stylesheet" type="text/css" href="chrome://mochikit/content/tests/SimpleTest/test.css"> + <script type="application/javascript;version=1.8"> +const { classes: Cc, interfaces: Ci, utils: Cu } = Components; + +let { require } = Cu.import("resource://devtools/shared/Loader.jsm", {}); +const CssLogic = require("devtools/shared/inspector/css-logic"); + +var _tests = []; +function addTest(test) { + _tests.push(test); +} + +function runNextTest() { + if (_tests.length == 0) { + SimpleTest.finish() + return; + } + _tests.shift()(); +} + +window.onload = function() { + SimpleTest.waitForExplicitFinish(); + runNextTest(); +} + +addTest(function getCssPathForUnattachedElement() { + var unattached = document.createElement("div"); + unattached.id = "unattached"; + try { + CssLogic.getCssPath(unattached); + ok(false, "Unattached node did not throw") + } catch(e) { + ok(e, "Unattached node throws an exception"); + } + + var unattachedChild = document.createElement("div"); + unattached.appendChild(unattachedChild); + try { + CssLogic.getCssPath(unattachedChild); + ok(false, "Unattached child node did not throw") + } catch(e) { + ok(e, "Unattached child node throws an exception"); + } + + var unattachedBody = document.createElement("body"); + try { + CssLogic.getCssPath(unattachedBody); + ok(false, "Unattached body node did not throw") + } catch(e) { + ok(e, "Unattached body node throws an exception"); + } + + runNextTest(); +}); + +addTest(function cssPathHasOneStepForEachAncestor() { + for (let el of [...document.querySelectorAll('*')]) { + let splitPath = CssLogic.getCssPath(el).split(" "); + + let expectedNbOfParts = 0; + var parent = el.parentNode; + while (parent) { + expectedNbOfParts ++; + parent = parent.parentNode; + } + + is(splitPath.length, expectedNbOfParts, "There are enough parts in the full path"); + } + + runNextTest(); +}); + +addTest(function getCssPath() { + let data = [{ + selector: "#id", + path: "html body div div div.class div#id" + }, { + selector: "html", + path: "html" + }, { + selector: "body", + path: "html body" + }, { + selector: ".c1.c2.c3", + path: "html body span.c1.c2.c3" + }, { + selector: "#i", + path: "html body span#i.c1.c2" + }]; + + for (let {selector, path} of data) { + let node = document.querySelector(selector); + is (CssLogic.getCssPath(node), path, `Full css path is correct for ${selector}`); + } + + runNextTest(); +}); + </script> +</head> +<body> + <div> + <div> + <div class="class"> + <div id="id"></div> + </div> + </div> + </div> + <span class="c1 c2 c3"></span> + <span id="i" class="c1 c2"></span> +</body> +</html> diff --git a/devtools/shared/webconsole/network-helper.js b/devtools/shared/webconsole/network-helper.js index af6a2e55b..4e25fac26 100644 --- a/devtools/shared/webconsole/network-helper.js +++ b/devtools/shared/webconsole/network-helper.js @@ -63,6 +63,8 @@ const {components, Cc, Ci} = require("chrome"); loader.lazyImporter(this, "NetUtil", "resource://gre/modules/NetUtil.jsm"); const DevToolsUtils = require("devtools/shared/DevToolsUtils"); const Services = require("Services"); +const { LocalizationHelper } = require("devtools/shared/l10n"); +const L10N = new LocalizationHelper("devtools/client/locales/netmonitor.properties"); // The cache used in the `nsIURL` function. const gNSURLStore = new Map(); @@ -620,6 +622,31 @@ var NetworkHelper = { // Cipher suite. info.cipherSuite = SSLStatus.cipherName; + // Key exchange group name. + info.keaGroupName = SSLStatus.keaGroupName; + // Localise two special values. + if (info.keaGroupName == "none") { + info.keaGroupName = L10N.getStr("netmonitor.security.keaGroup.none"); + } + if (info.keaGroupName == "custom") { + info.keaGroupName = L10N.getStr("netmonitor.security.keaGroup.custom"); + } + if (info.keaGroupName == "unknown group") { + info.keaGroupName = L10N.getStr("netmonitor.security.keaGroup.unknown"); + } + + // Certificate signature scheme. + info.signatureSchemeName = SSLStatus.signatureSchemeName; + // Localise two special values. + if (info.signatureSchemeName == "none") { + info.signatureSchemeName = + L10N.getStr("netmonitor.security.signatureScheme.none"); + } + if (info.signatureSchemeName == "unknown signature") { + info.signatureSchemeName = + L10N.getStr("netmonitor.security.signatureScheme.unknown"); + } + // Protocol version. info.protocolVersion = this.formatSecurityProtocol(SSLStatus.protocolVersion); diff --git a/devtools/shared/webconsole/network-monitor.js b/devtools/shared/webconsole/network-monitor.js index 084493432..a55162f52 100644 --- a/devtools/shared/webconsole/network-monitor.js +++ b/devtools/shared/webconsole/network-monitor.js @@ -732,7 +732,9 @@ NetworkMonitor.prototype = { 0x804b0004: "STATUS_CONNECTED_TO", 0x804b0005: "STATUS_SENDING_TO", 0x804b000a: "STATUS_WAITING_FOR", - 0x804b0006: "STATUS_RECEIVING_FROM" + 0x804b0006: "STATUS_RECEIVING_FROM", + 0x804b000c: "STATUS_TLS_STARTING", + 0x804b000d: "STATUS_TLS_ENDING" }, httpDownloadActivities: [ @@ -1327,8 +1329,24 @@ NetworkMonitor.prototype = { let response = {}; response.httpVersion = statusLineArray.shift(); - response.remoteAddress = httpActivity.channel.remoteAddress; - response.remotePort = httpActivity.channel.remotePort; + // XXX: + // Sometimes, when using a proxy server (manual proxy configuration), + // throws an error: + // 0x80040111 (NS_ERROR_NOT_AVAILABLE) + // [nsIHttpChannelInternal.remoteAddress] + // Bug 1337791 is the suspect. + response.remoteAddress = null; + try { + response.remoteAddress = httpActivity.channel.remoteAddress; + } catch (e) { + Cu.reportError(e); + } + response.remotePort = null; + try { + response.remotePort = httpActivity.channel.remotePort; + } catch (e) { + Cu.reportError(e); + } response.status = statusLineArray.shift(); response.statusText = statusLineArray.join(" "); response.headersSize = extraStringData.length; @@ -1390,6 +1408,7 @@ NetworkMonitor.prototype = { timings: { blocked: 0, dns: 0, + ssl: 0, connect: 0, send: 0, wait: 0, @@ -1424,6 +1443,36 @@ NetworkMonitor.prototype = { harTimings.connect = -1; } + if (timings.STATUS_TLS_STARTING && timings.STATUS_TLS_ENDING) { + harTimings.ssl = timings.STATUS_TLS_ENDING.last - + timings.STATUS_TLS_STARTING.first; + } else { + harTimings.ssl = -1; + } + + // sometimes the connection information events are attached to a speculative + // channel instead of this one, but necko might glue them back together in the + // nsITimedChannel interface used by Resource and Navigation Timing + let timedChannel = httpActivity.channel.QueryInterface(Ci.nsITimedChannel); + + if ((harTimings.connect <= 0) && timedChannel) { + if (timedChannel.secureConnectionStartTime > timedChannel.connectStartTime) { + harTimings.connect = + timedChannel.secureConnectionStartTime - timedChannel.connectStartTime; + harTimings.ssl = + timedChannel.connectEndTime - timedChannel.secureConnectionStartTime; + } else { + harTimings.connect = + timedChannel.connectEndTime - timedChannel.connectStartTime; + harTimings.ssl = -1; + } + } + + if ((harTimings.dns <= 0) && timedChannel) { + harTimings.dns = + timedChannel.domainLookupEndTime - timedChannel.domainLookupStartTime; + } + if (timings.STATUS_SENDING_TO) { harTimings.send = timings.STATUS_SENDING_TO.last - timings.STATUS_SENDING_TO.first; } else if (timings.REQUEST_HEADER && timings.REQUEST_BODY_SENT) { diff --git a/devtools/shared/webconsole/test/test_page_errors.html b/devtools/shared/webconsole/test/test_page_errors.html index 19e5ba4b4..78138856e 100644 --- a/devtools/shared/webconsole/test/test_page_errors.html +++ b/devtools/shared/webconsole/test/test_page_errors.html @@ -102,16 +102,6 @@ function doPageErrors() warning: false, exception: true, }, - "var f = Function('x y', 'return x + y;');": { - errorMessage: /malformed formal/, - errorMessageName: "JSMSG_BAD_FORMAL", - sourceName: /test_page_errors/, - category: "chrome javascript", - timeStamp: /^\d+$/, - error: false, - warning: false, - exception: true, - }, "function a() { return; 1 + 1; }": { errorMessage: /unreachable code/, errorMessageName: "JSMSG_STMT_AFTER_RETURN", |