summaryrefslogtreecommitdiffstats
path: root/devtools/client/shared/widgets
diff options
context:
space:
mode:
Diffstat (limited to 'devtools/client/shared/widgets')
-rw-r--r--devtools/client/shared/widgets/Chart.jsm25
-rw-r--r--devtools/client/shared/widgets/TableWidget.js142
-rw-r--r--devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js11
3 files changed, 145 insertions, 33 deletions
diff --git a/devtools/client/shared/widgets/Chart.jsm b/devtools/client/shared/widgets/Chart.jsm
index 0894a62ca..0b7cb71fb 100644
--- a/devtools/client/shared/widgets/Chart.jsm
+++ b/devtools/client/shared/widgets/Chart.jsm
@@ -105,7 +105,7 @@ function PieTableChart(node, pie, table) {
* - "mouseout", when the mouse leaves a slice or a row
* - "click", when the mouse enters a slice or a row
*/
-function createPieTableChart(document, { title, diameter, data, strings, totals, sorted }) {
+function createPieTableChart(document, { title, diameter, data, strings, totals, sorted, header }) {
if (data && sorted) {
data = data.slice().sort((a, b) => +(a.size < b.size));
}
@@ -119,7 +119,8 @@ function createPieTableChart(document, { title, diameter, data, strings, totals,
title: title,
data: data,
strings: strings,
- totals: totals
+ totals: totals,
+ header: header,
});
let container = document.createElement("hbox");
@@ -338,7 +339,7 @@ function createPieChart(document, { data, width, height, centerX, centerY, radiu
* - "mouseout", when the mouse leaves a row
* - "click", when the mouse clicks a row
*/
-function createTableChart(document, { title, data, strings, totals }) {
+function createTableChart(document, { title, data, strings, totals, header }) {
strings = strings || {};
totals = totals || {};
let isPlaceholder = false;
@@ -371,6 +372,24 @@ function createTableChart(document, { title, data, strings, totals }) {
tableNode.className = "plain table-chart-grid";
container.appendChild(tableNode);
+ const headerNode = document.createElement("div");
+ headerNode.className = "table-chart-row";
+
+ const headerBoxNode = document.createElement("div");
+ headerBoxNode.className = "table-chart-row-box";
+ headerNode.appendChild(headerBoxNode);
+
+ for (let [key, value] of Object.entries(header)) {
+ let headerLabelNode = document.createElement("span");
+ headerLabelNode.className = "plain table-chart-row-label";
+ headerLabelNode.setAttribute("name", key);
+ headerLabelNode.textContent = value;
+
+ headerNode.appendChild(headerLabelNode);
+ }
+
+ tableNode.appendChild(headerNode);
+
for (let rowInfo of data) {
let rowNode = document.createElement("hbox");
rowNode.className = "table-chart-row";
diff --git a/devtools/client/shared/widgets/TableWidget.js b/devtools/client/shared/widgets/TableWidget.js
index 5dacd1b67..57d2914d5 100644
--- a/devtools/client/shared/widgets/TableWidget.js
+++ b/devtools/client/shared/widgets/TableWidget.js
@@ -8,6 +8,8 @@ loader.lazyRequireGetter(this, "setNamedTimeout",
"devtools/client/shared/widgets/view-helpers", true);
loader.lazyRequireGetter(this, "clearNamedTimeout",
"devtools/client/shared/widgets/view-helpers", true);
+loader.lazyRequireGetter(this, "naturalSortCaseInsensitive",
+ "devtools/client/shared/natural-sort", true);
const {KeyCodes} = require("devtools/client/shared/keycodes");
const XUL_NS = "http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul";
@@ -123,6 +125,8 @@ function TableWidget(node, options = {}) {
TableWidget.prototype = {
items: null,
+ editBookmark: null,
+ scrollIntoViewOnUpdate: null,
/**
* Getter for the headers context menu popup id.
@@ -139,7 +143,12 @@ TableWidget.prototype = {
*/
set selectedRow(id) {
for (let column of this.columns.values()) {
- column.selectRow(id[this.uniqueId] || id);
+ if (id) {
+ column.selectRow(id[this.uniqueId] || id);
+ } else {
+ column.selectedRow = null;
+ column.selectRow(null);
+ }
}
},
@@ -454,7 +463,14 @@ TableWidget.prototype = {
return;
}
- let selectedCell = this.tbody.querySelector(".theme-selected");
+ // We need to get the first *visible* selected cell. Some columns are hidden
+ // e.g. because they contain a unique compound key for cookies that is never
+ // displayed in the UI. To do this we get all selected cells and filter out
+ // any that are hidden.
+ let selectedCells = [...this.tbody.querySelectorAll(".theme-selected")]
+ .filter(cell => cell.clientWidth > 0);
+ // Select the first visible selected cell.
+ let selectedCell = selectedCells[0];
if (!selectedCell) {
return;
}
@@ -615,8 +631,13 @@ TableWidget.prototype = {
/**
* Populates the header context menu with the names of the columns along with
* displaying which columns are hidden or visible.
+ *
+ * @param {Array} privateColumns=[]
+ * An array of column names that should never appear in the table. This
+ * allows us to e.g. have an invisible compound primary key for a
+ * table's rows.
*/
- populateMenuPopup: function () {
+ populateMenuPopup: function (privateColumns = []) {
if (!this.menupopup) {
return;
}
@@ -626,6 +647,10 @@ TableWidget.prototype = {
}
for (let column of this.columns.values()) {
+ if (privateColumns.includes(column.id)) {
+ continue;
+ }
+
let menuitem = this.document.createElementNS(XUL_NS, "menuitem");
menuitem.setAttribute("label", column.header.getAttribute("value"));
menuitem.setAttribute("data-id", column.id);
@@ -663,16 +688,21 @@ TableWidget.prototype = {
* Creates the columns in the table. Without calling this method, data cannot
* be inserted into the table unless `initialColumns` was supplied.
*
- * @param {object} columns
+ * @param {Object} columns
* A key value pair representing the columns of the table. Where the
* key represents the id of the column and the value is the displayed
* label in the header of the column.
- * @param {string} sortOn
+ * @param {String} sortOn
* The id of the column on which the table will be initially sorted on.
- * @param {array} hiddenColumns
+ * @param {Array} hiddenColumns
* Ids of all the columns that are hidden by default.
+ * @param {Array} privateColumns=[]
+ * An array of column names that should never appear in the table. This
+ * allows us to e.g. have an invisible compound primary key for a
+ * table's rows.
*/
- setColumns: function (columns, sortOn = this.sortedOn, hiddenColumns = []) {
+ setColumns: function (columns, sortOn = this.sortedOn, hiddenColumns = [],
+ privateColumns = []) {
for (let column of this.columns.values()) {
column.destroy();
}
@@ -702,13 +732,18 @@ TableWidget.prototype = {
}
this.columns.set(id, new Column(this, id, columns[id]));
- if (hiddenColumns.indexOf(id) > -1) {
+ if (hiddenColumns.includes(id) || privateColumns.includes(id)) {
+ // Hide the column.
this.columns.get(id).toggleColumn();
+
+ if (privateColumns.includes(id)) {
+ this.columns.get(id).private = true;
+ }
}
}
this.sortedOn = sortOn;
this.sortBy(this.sortedOn);
- this.populateMenuPopup();
+ this.populateMenuPopup(privateColumns);
},
/**
@@ -778,6 +813,11 @@ TableWidget.prototype = {
return;
}
+ if (this.editBookmark && !this.items.has(this.editBookmark)) {
+ // Key has been updated... update bookmark.
+ this.editBookmark = item[this.uniqueId];
+ }
+
let index = this.columns.get(this.sortedOn).push(item);
for (let [key, column] of this.columns) {
if (key != this.sortedOn) {
@@ -814,7 +854,8 @@ TableWidget.prototype = {
column.remove(item);
column.updateZebra();
}
- if (this.items.size == 0) {
+ if (this.items.size === 0) {
+ this.selectedRow = null;
this.tbody.setAttribute("empty", "empty");
}
@@ -857,6 +898,8 @@ TableWidget.prototype = {
this.tbody.setAttribute("empty", "empty");
this.setPlaceholderText(this.emptyText);
+ this.selectedRow = null;
+
this.emit(EVENTS.TABLE_CLEARED, this);
},
@@ -958,6 +1001,9 @@ module.exports.TableWidget = TableWidget;
* The displayed string on the column's header.
*/
function Column(table, id, header) {
+ // By default cells are visible in the UI.
+ this._private = false;
+
this.tbody = table.tbody;
this.document = table.document;
this.window = table.window;
@@ -1041,6 +1087,23 @@ Column.prototype = {
},
/**
+ * Get the private state of the column (visibility in the UI).
+ */
+ get private() {
+ return this._private;
+ },
+
+ /**
+ * Set the private state of the column (visibility in the UI).
+ *
+ * @param {Boolean} state
+ * Private (true or false)
+ */
+ set private(state) {
+ this._private = state;
+ },
+
+ /**
* Sets the sorted value
*/
set sorted(value) {
@@ -1115,7 +1178,9 @@ Column.prototype = {
},
/**
- * Called when a row is updated.
+ * Called when a row is updated e.g. a cell is changed. This means that
+ * for a new row this method will be called once for each column. If a single
+ * cell is changed this method will be called just once.
*
* @param {string} event
* The event name of the event. i.e. EVENTS.ROW_UPDATED
@@ -1124,7 +1189,23 @@ Column.prototype = {
*/
onRowUpdated: function (event, id) {
this._updateItems();
+
if (this.highlightUpdated && this.items[id] != null) {
+ if (this.table.scrollIntoViewOnUpdate) {
+ let cell = this.cells[this.items[id]];
+
+ // When a new row is created this method is called once for each column
+ // as each cell is updated. We can only scroll to cells if they are
+ // visible. We check for visibility and once we find the first visible
+ // cell in a row we scroll it into view and reset the
+ // scrollIntoViewOnUpdate flag.
+ if (cell.label.clientHeight > 0) {
+ cell.scrollIntoView();
+
+ this.table.scrollIntoViewOnUpdate = null;
+ }
+ }
+
if (this.table.editBookmark) {
// A rows position in the table can change as the result of an edit. In
// order to ensure that the correct row is highlighted after an edit we
@@ -1136,6 +1217,7 @@ Column.prototype = {
this.cells[this.items[id]].flash();
}
+
this.updateZebra();
},
@@ -1160,15 +1242,16 @@ Column.prototype = {
*/
selectRowAt: function (index) {
if (this.selectedRow != null) {
- this.cells[this.items[this.selectedRow]].toggleClass("theme-selected");
+ this.cells[this.items[this.selectedRow]].classList.remove("theme-selected");
}
- if (index < 0) {
+
+ let cell = this.cells[index];
+ if (cell) {
+ cell.classList.add("theme-selected");
+ this.selectedRow = cell.id;
+ } else {
this.selectedRow = null;
- return;
}
- let cell = this.cells[index];
- cell.toggleClass("theme-selected");
- this.selectedRow = cell.id;
},
/**
@@ -1218,11 +1301,11 @@ Column.prototype = {
let index;
if (this.sorted == 1) {
index = this.cells.findIndex(element => {
- return value < element.value;
+ return naturalSortCaseInsensitive(value, element.value) === -1;
});
} else {
index = this.cells.findIndex(element => {
- return value > element.value;
+ return naturalSortCaseInsensitive(value, element.value) === 1;
});
}
index = index >= 0 ? index : this.cells.length;
@@ -1332,7 +1415,6 @@ Column.prototype = {
this.cells = [];
this.items = {};
this._itemsDirty = false;
- this.selectedRow = null;
while (this.header.nextSibling) {
this.header.nextSibling.remove();
}
@@ -1350,7 +1432,7 @@ Column.prototype = {
a[this.id].textContent : a[this.id];
let val2 = (b[this.id] instanceof Node) ?
b[this.id].textContent : b[this.id];
- return val1 > val2;
+ return naturalSortCaseInsensitive(val1, val2);
});
} else if (this.sorted > 1) {
items.sort((a, b) => {
@@ -1358,12 +1440,12 @@ Column.prototype = {
a[this.id].textContent : a[this.id];
let val2 = (b[this.id] instanceof Node) ?
b[this.id].textContent : b[this.id];
- return val2 > val1;
+ return naturalSortCaseInsensitive(val2, val1);
});
}
if (this.selectedRow) {
- this.cells[this.items[this.selectedRow]].toggleClass("theme-selected");
+ this.cells[this.items[this.selectedRow]].classList.remove("theme-selected");
}
this.items = {};
// Otherwise, just use the sorted array passed to update the cells value.
@@ -1373,7 +1455,7 @@ Column.prototype = {
this.cells[i].id = item[this.uniqueId];
});
if (this.selectedRow) {
- this.cells[this.items[this.selectedRow]].toggleClass("theme-selected");
+ this.cells[this.items[this.selectedRow]].classList.add("theme-selected");
}
this._itemsDirty = false;
this.updateZebra();
@@ -1387,7 +1469,9 @@ Column.prototype = {
if (!cell.hidden) {
i++;
}
- cell.toggleClass("even", !(i % 2));
+
+ let even = !(i % 2);
+ cell.classList.toggle("even", even);
}
},
@@ -1523,8 +1607,8 @@ Cell.prototype = {
return this._value;
},
- toggleClass: function (className, condition) {
- this.label.classList.toggle(className, condition);
+ get classList() {
+ return this.label.classList;
},
/**
@@ -1550,6 +1634,10 @@ Cell.prototype = {
this.label.focus();
},
+ scrollIntoView: function () {
+ this.label.scrollIntoView(false);
+ },
+
destroy: function () {
this.label.remove();
this.label = null;
diff --git a/devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js b/devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js
index bf211b8b9..6a18ec12c 100644
--- a/devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js
+++ b/devtools/client/shared/widgets/tooltip/SwatchColorPickerTooltip.js
@@ -28,8 +28,12 @@ const XHTML_NS = "http://www.w3.org/1999/xhtml";
* inline editor.
* @param {InspectorPanel} inspector
* The inspector panel, needed for the eyedropper.
+ * @param {Function} supportsCssColor4ColorFunction
+ * A function for checking the supporting of css-color-4 color function.
*/
-function SwatchColorPickerTooltip(document, inspector) {
+function SwatchColorPickerTooltip(document,
+ inspector,
+ {supportsCssColor4ColorFunction}) {
let stylesheet = "chrome://devtools/content/shared/widgets/spectrum.css";
SwatchBasedEditorTooltip.call(this, document, stylesheet);
@@ -40,6 +44,7 @@ function SwatchColorPickerTooltip(document, inspector) {
this.spectrum = this.setColorPickerContent([0, 0, 0, 1]);
this._onSpectrumColorChange = this._onSpectrumColorChange.bind(this);
this._openEyeDropper = this._openEyeDropper.bind(this);
+ this.cssColor4 = supportsCssColor4ColorFunction();
}
SwatchColorPickerTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, {
@@ -159,14 +164,14 @@ SwatchColorPickerTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.pr
},
_colorToRgba: function (color) {
- color = new colorUtils.CssColor(color);
+ color = new colorUtils.CssColor(color, this.cssColor4);
let rgba = color._getRGBATuple();
return [rgba.r, rgba.g, rgba.b, rgba.a];
},
_toDefaultType: function (color) {
let colorObj = new colorUtils.CssColor(color);
- colorObj.setAuthoredUnitFromColor(this._originalColor);
+ colorObj.setAuthoredUnitFromColor(this._originalColor, this.cssColor4);
return colorObj.toString();
},