diff options
315 files changed, 9229 insertions, 3953 deletions
@@ -22,4 +22,4 @@ # changes to stick? As of bug 928195, this shouldn't be necessary! Please # don't change CLOBBER for WebIDL changes any more. -Clobber for NSS Update +Clobber for SpiderMonkey Update diff --git a/application/basilisk/installer/package-manifest.in b/application/basilisk/installer/package-manifest.in index f9ca0d727..bffab0f6e 100644 --- a/application/basilisk/installer/package-manifest.in +++ b/application/basilisk/installer/package-manifest.in @@ -183,6 +183,7 @@ @RESPATH@/components/dom.xpt @RESPATH@/components/dom_apps.xpt @RESPATH@/components/dom_base.xpt +@RESPATH@/components/dom_bindings.xpt @RESPATH@/components/dom_system.xpt @RESPATH@/components/dom_canvas.xpt @RESPATH@/components/dom_core.xpt diff --git a/config/check_spidermonkey_style.py b/config/check_spidermonkey_style.py index 647f403c4..3b5f20037 100644 --- a/config/check_spidermonkey_style.py +++ b/config/check_spidermonkey_style.py @@ -63,7 +63,7 @@ included_inclnames_to_ignore = set([ 'devtools/Instruments.h', # we ignore devtools/ in general 'double-conversion.h', # strange MFBT case 'javascript-trace.h', # generated in $OBJDIR if HAVE_DTRACE is defined - 'jsautokw.h', # generated in $OBJDIR + 'frontend/ReservedWordsGenerated.h', # generated in $OBJDIR 'jscustomallocator.h', # provided by embedders; allowed to be missing 'js-config.h', # generated in $OBJDIR 'fdlibm.h', # fdlibm @@ -99,7 +99,7 @@ included_inclnames_to_ignore = set([ # ignore #includes of them when checking #include ordering. oddly_ordered_inclnames = set([ 'ctypes/typedefs.h', # Included multiple times in the body of ctypes/CTypes.h - 'jsautokw.h', # Included in the body of frontend/TokenStream.h + 'frontend/ReservedWordsGenerated.h', # Included in the body of frontend/TokenStream.h 'jswin.h', # Must be #included before <psapi.h> 'machine/endian.h', # Must be included after <sys/types.h> on BSD 'winbase.h', # Must precede other system headers(?) diff --git a/config/milestone.txt b/config/milestone.txt index 493ad3bbd..3c80f8bb5 100644 --- a/config/milestone.txt +++ b/config/milestone.txt @@ -10,4 +10,4 @@ # hardcoded milestones in the tree from these two files. #-------------------------------------------------------- -4.3.0 +4.4.0
\ No newline at end of file diff --git a/devtools/client/webconsole/new-console-output/components/message-types/evaluation-result.js b/devtools/client/webconsole/new-console-output/components/message-types/evaluation-result.js index 992dc62cf..824bdb3fb 100644 --- a/devtools/client/webconsole/new-console-output/components/message-types/evaluation-result.js +++ b/devtools/client/webconsole/new-console-output/components/message-types/evaluation-result.js @@ -34,6 +34,7 @@ function EvaluationResult(props) { id: messageId, exceptionDocURL, frame, + notes, } = message; let messageBody; @@ -57,6 +58,7 @@ function EvaluationResult(props) { serviceContainer, exceptionDocURL, frame, + notes, }; return Message(childProps); } diff --git a/devtools/client/webconsole/new-console-output/components/message-types/page-error.js b/devtools/client/webconsole/new-console-output/components/message-types/page-error.js index 77ea75ff7..c68b850bd 100644 --- a/devtools/client/webconsole/new-console-output/components/message-types/page-error.js +++ b/devtools/client/webconsole/new-console-output/components/message-types/page-error.js @@ -44,6 +44,7 @@ function PageError(props) { stacktrace, frame, exceptionDocURL, + notes, } = message; const childProps = { @@ -62,6 +63,7 @@ function PageError(props) { stacktrace, serviceContainer, exceptionDocURL, + notes, }; return Message(childProps); } diff --git a/devtools/client/webconsole/new-console-output/components/message.js b/devtools/client/webconsole/new-console-output/components/message.js index f36bff7e4..1ffa4e12d 100644 --- a/devtools/client/webconsole/new-console-output/components/message.js +++ b/devtools/client/webconsole/new-console-output/components/message.js @@ -47,6 +47,10 @@ const Message = createClass({ onViewSourceInDebugger: PropTypes.func.isRequired, sourceMapService: PropTypes.any, }), + notes: PropTypes.arrayOf(PropTypes.shape({ + messageBody: PropTypes.string.isRequired, + frame: PropTypes.any, + })), }, getDefaultProps: function () { @@ -90,6 +94,7 @@ const Message = createClass({ serviceContainer, dispatch, exceptionDocURL, + notes, } = this.props; topLevelClasses.push("message", source, type, level); @@ -127,6 +132,29 @@ const Message = createClass({ }); } + let notesNodes; + if (notes) { + notesNodes = notes.map(note => dom.span( + { className: "message-flex-body error-note" }, + dom.span({ className: "message-body devtools-monospace" }, + "note: " + note.messageBody + ), + dom.span({ className: "message-location devtools-monospace" }, + note.frame ? FrameView({ + frame: note.frame, + onClick: serviceContainer + ? serviceContainer.onViewSourceInDebugger + : undefined, + showEmptyPathAsHost: true, + sourceMapService: serviceContainer + ? serviceContainer.sourceMapService + : undefined + }) : null + ))); + } else { + notesNodes = []; + } + const repeat = this.props.repeat ? MessageRepeat({repeat: this.props.repeat}) : null; // Configure the location. @@ -167,7 +195,8 @@ const Message = createClass({ repeat, location ), - attachment + attachment, + ...notesNodes ) ); } diff --git a/devtools/client/webconsole/new-console-output/selectors/messages.js b/devtools/client/webconsole/new-console-output/selectors/messages.js index c4b1aee28..e405be2f8 100644 --- a/devtools/client/webconsole/new-console-output/selectors/messages.js +++ b/devtools/client/webconsole/new-console-output/selectors/messages.js @@ -126,6 +126,15 @@ function matchSearchFilters(message, filters) { || (message.parameters !== null && message.parameters.join("").toLocaleLowerCase() .includes(text.toLocaleLowerCase())) + // Look for a match in notes. + || (Array.isArray(message.notes) && message.notes.some(note => + // Look for a match in location. + isTextInFrame(text, note.frame) + // Look for a match in messageBody. + || (note.messageBody !== null + && note.messageBody.toLocaleLowerCase() + .includes(text.toLocaleLowerCase())) + )) ); } diff --git a/devtools/client/webconsole/new-console-output/test/components/page-error.test.js b/devtools/client/webconsole/new-console-output/test/components/page-error.test.js index 93f3a9ea5..5bc5fe0f0 100644 --- a/devtools/client/webconsole/new-console-output/test/components/page-error.test.js +++ b/devtools/client/webconsole/new-console-output/test/components/page-error.test.js @@ -123,4 +123,118 @@ describe("PageError component:", () => { wrapper = render(PageError({ message, serviceContainer})); expect(wrapper.find(".indent").prop("style").width).toBe(`0`); }); + + it("has empty error notes", () => { + const message = stubPreparedMessages.get("ReferenceError: asdf is not defined"); + let wrapper = render(PageError({ message, serviceContainer })); + + const notes = wrapper.find(".error-note"); + + expect(notes.length).toBe(0); + }); + + it("can show an error note", () => { + const origMessage = stubPreparedMessages.get("ReferenceError: asdf is not defined"); + const message = origMessage.set("notes", [ + { + "messageBody": "test note", + "frame": { + "source": "http://example.com/test.js", + "line": 2, + "column": 6 + } + } + ]); + + let wrapper = render(PageError({ message, serviceContainer })); + + const notes = wrapper.find(".error-note"); + expect(notes.length).toBe(1); + + const note = notes.eq(0); + expect(note.find(".message-body").text()) + .toBe("note: test note"); + + // There should be the location. + const locationLink = note.find(`.message-location`); + expect(locationLink.length).toBe(1); + expect(locationLink.text()).toBe("test.js:2:6"); + }); + + it("can show multiple error notes", () => { + const origMessage = stubPreparedMessages.get("ReferenceError: asdf is not defined"); + const message = origMessage.set("notes", [ + { + "messageBody": "test note 1", + "frame": { + "source": "http://example.com/test1.js", + "line": 2, + "column": 6 + } + }, + { + "messageBody": "test note 2", + "frame": { + "source": "http://example.com/test2.js", + "line": 10, + "column": 18 + } + }, + { + "messageBody": "test note 3", + "frame": { + "source": "http://example.com/test3.js", + "line": 9, + "column": 4 + } + } + ]); + + let wrapper = render(PageError({ message, serviceContainer })); + + const notes = wrapper.find(".error-note"); + expect(notes.length).toBe(3); + + const note1 = notes.eq(0); + expect(note1.find(".message-body").text()) + .toBe("note: test note 1"); + + const locationLink1 = note1.find(`.message-location`); + expect(locationLink1.length).toBe(1); + expect(locationLink1.text()).toBe("test1.js:2:6"); + + const note2 = notes.eq(1); + expect(note2.find(".message-body").text()) + .toBe("note: test note 2"); + + const locationLink2 = note2.find(`.message-location`); + expect(locationLink2.length).toBe(1); + expect(locationLink2.text()).toBe("test2.js:10:18"); + + const note3 = notes.eq(2); + expect(note3.find(".message-body").text()) + .toBe("note: test note 3"); + + const locationLink3 = note3.find(`.message-location`); + expect(locationLink3.length).toBe(1); + expect(locationLink3.text()).toBe("test3.js:9:4"); + }); + + it("displays error notes", () => { + const message = stubPreparedMessages.get("SyntaxError: redeclaration of let a"); + + let wrapper = render(PageError({ message, serviceContainer })); + + const notes = wrapper.find(".error-note"); + expect(notes.length).toBe(1); + + const note = notes.eq(0); + expect(note.find(".message-body").text()) + .toBe("note: Previously declared at line 2, column 6"); + + // There should be the location. + const locationLink = note.find(`.message-location`); + expect(locationLink.length).toBe(1); + expect(locationLink.text()).toBe("test-console-api.html:2:6"); + }); }); diff --git a/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/stub-snippets.js b/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/stub-snippets.js index f79548e7b..f0f01a561 100644 --- a/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/stub-snippets.js +++ b/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/stub-snippets.js @@ -140,6 +140,10 @@ pageError.set("Reference Error", ` foo() `); +pageError.set("Redeclaration Error", ` + let a, a; +`); + module.exports = { consoleApi, evaluationResult, diff --git a/devtools/client/webconsole/new-console-output/test/fixtures/stubs/consoleApi.js b/devtools/client/webconsole/new-console-output/test/fixtures/stubs/consoleApi.js index d9662c4fd..bec3abd70 100644 --- a/devtools/client/webconsole/new-console-output/test/fixtures/stubs/consoleApi.js +++ b/devtools/client/webconsole/new-console-output/test/fixtures/stubs/consoleApi.js @@ -11,8 +11,6 @@ const { ConsoleMessage, NetworkEventMessage } = require("devtools/client/webcons let stubPreparedMessages = new Map(); let stubPackets = new Map(); - - stubPreparedMessages.set("console.log('foobar', 'test')", new ConsoleMessage({ "id": "1", "allowRepeating": true, @@ -34,7 +32,8 @@ stubPreparedMessages.set("console.log('foobar', 'test')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.log(undefined)", new ConsoleMessage({ @@ -50,7 +49,7 @@ stubPreparedMessages.set("console.log(undefined)", new ConsoleMessage({ } ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"undefined\"}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(undefined)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"undefined\"}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(undefined)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(undefined)", @@ -59,7 +58,8 @@ stubPreparedMessages.set("console.log(undefined)", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.warn('danger, will robinson!')", new ConsoleMessage({ @@ -73,7 +73,7 @@ stubPreparedMessages.set("console.warn('danger, will robinson!')", new ConsoleMe "danger, will robinson!" ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"warn\",\"level\":\"warn\",\"messageText\":null,\"parameters\":[\"danger, will robinson!\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.warn(%27danger%2C%20will%20robinson!%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"warn\",\"level\":\"warn\",\"messageText\":null,\"parameters\":[\"danger, will robinson!\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.warn(%27danger%2C%20will%20robinson!%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.warn(%27danger%2C%20will%20robinson!%27)", @@ -82,7 +82,8 @@ stubPreparedMessages.set("console.warn('danger, will robinson!')", new ConsoleMe }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.log(NaN)", new ConsoleMessage({ @@ -98,7 +99,7 @@ stubPreparedMessages.set("console.log(NaN)", new ConsoleMessage({ } ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"NaN\"}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(NaN)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"NaN\"}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(NaN)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(NaN)", @@ -107,7 +108,8 @@ stubPreparedMessages.set("console.log(NaN)", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.log(null)", new ConsoleMessage({ @@ -123,7 +125,7 @@ stubPreparedMessages.set("console.log(null)", new ConsoleMessage({ } ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"null\"}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(null)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"null\"}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(null)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(null)", @@ -132,7 +134,8 @@ stubPreparedMessages.set("console.log(null)", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.log('鼬')", new ConsoleMessage({ @@ -146,7 +149,7 @@ stubPreparedMessages.set("console.log('鼬')", new ConsoleMessage({ "鼬" ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"鼬\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27%E9%BC%AC%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"鼬\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27%E9%BC%AC%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27%E9%BC%AC%27)", @@ -155,7 +158,8 @@ stubPreparedMessages.set("console.log('鼬')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.clear()", new ConsoleMessage({ @@ -169,8 +173,7 @@ stubPreparedMessages.set("console.clear()", new ConsoleMessage({ "Console was cleared." ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"clear\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"Console was cleared.\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.clear()\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", - "stacktrace": null, + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"clear\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"Console was cleared.\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.clear()\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.clear()", "line": 1, @@ -178,7 +181,8 @@ stubPreparedMessages.set("console.clear()", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.count('bar')", new ConsoleMessage({ @@ -190,7 +194,7 @@ stubPreparedMessages.set("console.count('bar')", new ConsoleMessage({ "messageText": "bar: 1", "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"debug\",\"messageText\":\"bar: 1\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.count(%27bar%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"debug\",\"messageText\":\"bar: 1\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.count(%27bar%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.count(%27bar%27)", @@ -199,7 +203,8 @@ stubPreparedMessages.set("console.count('bar')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.assert(false, {message: 'foobar'})", new ConsoleMessage({ @@ -234,7 +239,7 @@ stubPreparedMessages.set("console.assert(false, {message: 'foobar'})", new Conso } ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"assert\",\"level\":\"error\",\"messageText\":null,\"parameters\":[{\"type\":\"object\",\"actor\":\"server1.conn8.child1/obj31\",\"class\":\"Object\",\"extensible\":true,\"frozen\":false,\"sealed\":false,\"ownPropertyLength\":1,\"preview\":{\"kind\":\"Object\",\"ownProperties\":{\"message\":{\"configurable\":true,\"enumerable\":true,\"writable\":true,\"value\":\"foobar\"}},\"ownPropertiesLength\":1,\"safeGetterValues\":{}}}],\"repeatId\":null,\"stacktrace\":[{\"columnNumber\":27,\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.assert(false%2C%20%7Bmessage%3A%20%27foobar%27%7D)\",\"functionName\":\"triggerPacket\",\"language\":2,\"lineNumber\":1}],\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.assert(false%2C%20%7Bmessage%3A%20%27foobar%27%7D)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"assert\",\"level\":\"error\",\"messageText\":null,\"parameters\":[{\"type\":\"object\",\"actor\":\"server1.conn8.child1/obj31\",\"class\":\"Object\",\"extensible\":true,\"frozen\":false,\"sealed\":false,\"ownPropertyLength\":1,\"preview\":{\"kind\":\"Object\",\"ownProperties\":{\"message\":{\"configurable\":true,\"enumerable\":true,\"writable\":true,\"value\":\"foobar\"}},\"ownPropertiesLength\":1,\"safeGetterValues\":{}}}],\"repeatId\":null,\"stacktrace\":[{\"columnNumber\":27,\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.assert(false%2C%20%7Bmessage%3A%20%27foobar%27%7D)\",\"functionName\":\"triggerPacket\",\"language\":2,\"lineNumber\":1}],\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.assert(false%2C%20%7Bmessage%3A%20%27foobar%27%7D)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": [ { "columnNumber": 27, @@ -251,7 +256,8 @@ stubPreparedMessages.set("console.assert(false, {message: 'foobar'})", new Conso }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.log('hello \nfrom \rthe \"string world!')", new ConsoleMessage({ @@ -265,7 +271,7 @@ stubPreparedMessages.set("console.log('hello \nfrom \rthe \"string world!')", ne "hello \nfrom \rthe \"string world!" ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"hello \\nfrom \\rthe \\\"string world!\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27hello%20%5Cnfrom%20%5Crthe%20%5C%22string%20world!%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"hello \\nfrom \\rthe \\\"string world!\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27hello%20%5Cnfrom%20%5Crthe%20%5C%22string%20world!%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27hello%20%5Cnfrom%20%5Crthe%20%5C%22string%20world!%27)", @@ -274,7 +280,8 @@ stubPreparedMessages.set("console.log('hello \nfrom \rthe \"string world!')", ne }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.log('úṇĩçödê țĕșť')", new ConsoleMessage({ @@ -288,7 +295,7 @@ stubPreparedMessages.set("console.log('úṇĩçödê țĕșť')", new ConsoleMe "úṇĩçödê țĕșť" ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"úṇĩçödê țĕșť\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27%C3%BA%E1%B9%87%C4%A9%C3%A7%C3%B6d%C3%AA%20%C8%9B%C4%95%C8%99%C5%A5%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"úṇĩçödê țĕșť\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27%C3%BA%E1%B9%87%C4%A9%C3%A7%C3%B6d%C3%AA%20%C8%9B%C4%95%C8%99%C5%A5%27)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%27%C3%BA%E1%B9%87%C4%A9%C3%A7%C3%B6d%C3%AA%20%C8%9B%C4%95%C8%99%C5%A5%27)", @@ -297,7 +304,8 @@ stubPreparedMessages.set("console.log('úṇĩçödê țĕșť')", new ConsoleMe }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.dirxml(window)", new ConsoleMessage({ @@ -315,7 +323,7 @@ stubPreparedMessages.set("console.dirxml(window)", new ConsoleMessage({ "extensible": true, "frozen": false, "sealed": false, - "ownPropertyLength": 804, + "ownPropertyLength": 815, "preview": { "kind": "ObjectWithURL", "url": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html" @@ -323,7 +331,7 @@ stubPreparedMessages.set("console.dirxml(window)", new ConsoleMessage({ } ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"object\",\"actor\":\"server1.conn11.child1/obj31\",\"class\":\"Window\",\"extensible\":true,\"frozen\":false,\"sealed\":false,\"ownPropertyLength\":804,\"preview\":{\"kind\":\"ObjectWithURL\",\"url\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html\"}}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.dirxml(window)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"object\",\"actor\":\"server1.conn11.child1/obj31\",\"class\":\"Window\",\"extensible\":true,\"frozen\":false,\"sealed\":false,\"ownPropertyLength\":804,\"preview\":{\"kind\":\"ObjectWithURL\",\"url\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html\"}}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.dirxml(window)\",\"line\":1,\"column\":27},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.dirxml(window)", @@ -332,7 +340,8 @@ stubPreparedMessages.set("console.dirxml(window)", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.trace()", new ConsoleMessage({ @@ -344,7 +353,7 @@ stubPreparedMessages.set("console.trace()", new ConsoleMessage({ "messageText": null, "parameters": [], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"trace\",\"level\":\"log\",\"messageText\":null,\"parameters\":[],\"repeatId\":null,\"stacktrace\":[{\"columnNumber\":3,\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.trace()\",\"functionName\":\"testStacktraceFiltering\",\"language\":2,\"lineNumber\":3},{\"columnNumber\":3,\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.trace()\",\"functionName\":\"foo\",\"language\":2,\"lineNumber\":6},{\"columnNumber\":1,\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.trace()\",\"functionName\":\"triggerPacket\",\"language\":2,\"lineNumber\":9}],\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.trace()\",\"line\":3,\"column\":3},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"trace\",\"level\":\"log\",\"messageText\":null,\"parameters\":[],\"repeatId\":null,\"stacktrace\":[{\"columnNumber\":3,\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.trace()\",\"functionName\":\"testStacktraceFiltering\",\"language\":2,\"lineNumber\":3},{\"columnNumber\":3,\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.trace()\",\"functionName\":\"foo\",\"language\":2,\"lineNumber\":6},{\"columnNumber\":1,\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.trace()\",\"functionName\":\"triggerPacket\",\"language\":2,\"lineNumber\":9}],\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.trace()\",\"line\":3,\"column\":3},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": [ { "columnNumber": 3, @@ -375,7 +384,8 @@ stubPreparedMessages.set("console.trace()", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.time('bar')", new ConsoleMessage({ @@ -387,7 +397,7 @@ stubPreparedMessages.set("console.time('bar')", new ConsoleMessage({ "messageText": null, "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"nullMessage\",\"level\":\"log\",\"messageText\":null,\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.time(%27bar%27)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"nullMessage\",\"level\":\"log\",\"messageText\":null,\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.time(%27bar%27)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.time(%27bar%27)", @@ -396,7 +406,8 @@ stubPreparedMessages.set("console.time('bar')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.timeEnd('bar')", new ConsoleMessage({ @@ -408,7 +419,7 @@ stubPreparedMessages.set("console.timeEnd('bar')", new ConsoleMessage({ "messageText": "bar: 1.36ms", "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"timeEnd\",\"level\":\"log\",\"messageText\":\"bar: 1.36ms\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.time(%27bar%27)\",\"line\":3,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"timeEnd\",\"level\":\"log\",\"messageText\":\"bar: 1.36ms\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.time(%27bar%27)\",\"line\":3,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.time(%27bar%27)", @@ -417,7 +428,8 @@ stubPreparedMessages.set("console.timeEnd('bar')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.table('bar')", new ConsoleMessage({ @@ -431,7 +443,7 @@ stubPreparedMessages.set("console.table('bar')", new ConsoleMessage({ "bar" ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"bar\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.table(%27bar%27)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"bar\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.table(%27bar%27)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.table(%27bar%27)", @@ -440,7 +452,8 @@ stubPreparedMessages.set("console.table('bar')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.table(['a', 'b', 'c'])", new ConsoleMessage({ @@ -471,7 +484,7 @@ stubPreparedMessages.set("console.table(['a', 'b', 'c'])", new ConsoleMessage({ } ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"table\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"object\",\"actor\":\"server1.conn15.child1/obj31\",\"class\":\"Array\",\"extensible\":true,\"frozen\":false,\"sealed\":false,\"ownPropertyLength\":4,\"preview\":{\"kind\":\"ArrayLike\",\"length\":3,\"items\":[\"a\",\"b\",\"c\"]}}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.table(%5B%27a%27%2C%20%27b%27%2C%20%27c%27%5D)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"table\",\"level\":\"log\",\"messageText\":null,\"parameters\":[{\"type\":\"object\",\"actor\":\"server1.conn15.child1/obj31\",\"class\":\"Array\",\"extensible\":true,\"frozen\":false,\"sealed\":false,\"ownPropertyLength\":4,\"preview\":{\"kind\":\"ArrayLike\",\"length\":3,\"items\":[\"a\",\"b\",\"c\"]}}],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.table(%5B%27a%27%2C%20%27b%27%2C%20%27c%27%5D)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.table(%5B%27a%27%2C%20%27b%27%2C%20%27c%27%5D)", @@ -480,7 +493,8 @@ stubPreparedMessages.set("console.table(['a', 'b', 'c'])", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.group('bar')", new ConsoleMessage({ @@ -492,7 +506,7 @@ stubPreparedMessages.set("console.group('bar')", new ConsoleMessage({ "messageText": "bar", "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"startGroup\",\"level\":\"log\",\"messageText\":\"bar\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group(%27bar%27)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"startGroup\",\"level\":\"log\",\"messageText\":\"bar\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group(%27bar%27)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group(%27bar%27)", @@ -501,7 +515,8 @@ stubPreparedMessages.set("console.group('bar')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.groupEnd('bar')", new ConsoleMessage({ @@ -513,7 +528,7 @@ stubPreparedMessages.set("console.groupEnd('bar')", new ConsoleMessage({ "messageText": null, "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"endGroup\",\"level\":\"log\",\"messageText\":null,\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group(%27bar%27)\",\"line\":3,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"endGroup\",\"level\":\"log\",\"messageText\":null,\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group(%27bar%27)\",\"line\":3,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group(%27bar%27)", @@ -522,7 +537,8 @@ stubPreparedMessages.set("console.groupEnd('bar')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.groupCollapsed('foo')", new ConsoleMessage({ @@ -534,7 +550,7 @@ stubPreparedMessages.set("console.groupCollapsed('foo')", new ConsoleMessage({ "messageText": "foo", "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"startGroupCollapsed\",\"level\":\"log\",\"messageText\":\"foo\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.groupCollapsed(%27foo%27)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"startGroupCollapsed\",\"level\":\"log\",\"messageText\":\"foo\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.groupCollapsed(%27foo%27)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.groupCollapsed(%27foo%27)", @@ -543,7 +559,8 @@ stubPreparedMessages.set("console.groupCollapsed('foo')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.groupEnd('foo')", new ConsoleMessage({ @@ -555,7 +572,7 @@ stubPreparedMessages.set("console.groupEnd('foo')", new ConsoleMessage({ "messageText": null, "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"endGroup\",\"level\":\"log\",\"messageText\":null,\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.groupCollapsed(%27foo%27)\",\"line\":3,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"endGroup\",\"level\":\"log\",\"messageText\":null,\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.groupCollapsed(%27foo%27)\",\"line\":3,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.groupCollapsed(%27foo%27)", @@ -564,7 +581,8 @@ stubPreparedMessages.set("console.groupEnd('foo')", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.group()", new ConsoleMessage({ @@ -576,7 +594,7 @@ stubPreparedMessages.set("console.group()", new ConsoleMessage({ "messageText": "<no group label>", "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"startGroup\",\"level\":\"log\",\"messageText\":\"<no group label>\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group()\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"startGroup\",\"level\":\"log\",\"messageText\":\"<no group label>\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group()\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group()", @@ -585,7 +603,8 @@ stubPreparedMessages.set("console.group()", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.groupEnd()", new ConsoleMessage({ @@ -597,7 +616,7 @@ stubPreparedMessages.set("console.groupEnd()", new ConsoleMessage({ "messageText": null, "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"endGroup\",\"level\":\"log\",\"messageText\":null,\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group()\",\"line\":3,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"endGroup\",\"level\":\"log\",\"messageText\":null,\"parameters\":null,\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group()\",\"line\":3,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.group()", @@ -606,7 +625,8 @@ stubPreparedMessages.set("console.groupEnd()", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": null, - "userProvidedStyles": [] + "userProvidedStyles": [], + "notes": null })); stubPreparedMessages.set("console.log(%cfoobar)", new ConsoleMessage({ @@ -621,7 +641,7 @@ stubPreparedMessages.set("console.log(%cfoobar)", new ConsoleMessage({ "bar" ], "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"foo\",\"bar\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%25cfoobar)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[\"color:blue;font-size:1.3em;background:url('http://example.com/test');position:absolute;top:10px\",\"color:red;background:url('http://example.com/test')\"]}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"console-api\",\"type\":\"log\",\"level\":\"log\",\"messageText\":null,\"parameters\":[\"foo\",\"bar\"],\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%25cfoobar)\",\"line\":2,\"column\":1},\"groupId\":null,\"exceptionDocURL\":null,\"userProvidedStyles\":[\"color:blue;font-size:1.3em;background:url('http://example.com/test');position:absolute;top:10px\",\"color:red;background:url('http://example.com/test')\"],\"notes\":null}", "stacktrace": null, "frame": { "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=console.log(%25cfoobar)", @@ -633,10 +653,10 @@ stubPreparedMessages.set("console.log(%cfoobar)", new ConsoleMessage({ "userProvidedStyles": [ "color:blue;font-size:1.3em;background:url('http://example.com/test');position:absolute;top:10px", "color:red;background:url('http://example.com/test')" - ] + ], + "notes": null })); - stubPackets.set("console.log('foobar', 'test')", { "from": "server1.conn0.child1/consoleActor2", "type": "consoleAPICall", @@ -1017,7 +1037,7 @@ stubPackets.set("console.dirxml(window)", { "extensible": true, "frozen": false, "sealed": false, - "ownPropertyLength": 804, + "ownPropertyLength": 815, "preview": { "kind": "ObjectWithURL", "url": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html" @@ -1451,8 +1471,7 @@ stubPackets.set("console.log(%cfoobar)", { } }); - module.exports = { stubPreparedMessages, stubPackets, -}
\ No newline at end of file +}; diff --git a/devtools/client/webconsole/new-console-output/test/fixtures/stubs/evaluationResult.js b/devtools/client/webconsole/new-console-output/test/fixtures/stubs/evaluationResult.js index 098086044..0682d9134 100644 --- a/devtools/client/webconsole/new-console-output/test/fixtures/stubs/evaluationResult.js +++ b/devtools/client/webconsole/new-console-output/test/fixtures/stubs/evaluationResult.js @@ -11,8 +11,6 @@ const { ConsoleMessage, NetworkEventMessage } = require("devtools/client/webcons let stubPreparedMessages = new Map(); let stubPackets = new Map(); - - stubPreparedMessages.set("new Date(0)", new ConsoleMessage({ "id": "1", "allowRepeating": true, @@ -32,11 +30,12 @@ stubPreparedMessages.set("new Date(0)", new ConsoleMessage({ } }, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"result\",\"level\":\"log\",\"parameters\":{\"type\":\"object\",\"actor\":\"server1.conn0.child1/obj30\",\"class\":\"Date\",\"extensible\":true,\"frozen\":false,\"sealed\":false,\"ownPropertyLength\":0,\"preview\":{\"timestamp\":0}},\"repeatId\":null,\"stacktrace\":null,\"frame\":null,\"groupId\":null,\"userProvidedStyles\":null}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"result\",\"level\":\"log\",\"parameters\":{\"type\":\"object\",\"actor\":\"server1.conn0.child1/obj30\",\"class\":\"Date\",\"extensible\":true,\"frozen\":false,\"sealed\":false,\"ownPropertyLength\":0,\"preview\":{\"timestamp\":0}},\"repeatId\":null,\"stacktrace\":null,\"frame\":null,\"groupId\":null,\"userProvidedStyles\":null,\"notes\":null}", "stacktrace": null, "frame": null, "groupId": null, - "userProvidedStyles": null + "userProvidedStyles": null, + "notes": null })); stubPreparedMessages.set("asdf()", new ConsoleMessage({ @@ -50,7 +49,7 @@ stubPreparedMessages.set("asdf()", new ConsoleMessage({ "type": "undefined" }, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"result\",\"level\":\"error\",\"messageText\":\"ReferenceError: asdf is not defined\",\"parameters\":{\"type\":\"undefined\"},\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"debugger eval code\",\"line\":1,\"column\":1},\"groupId\":null,\"exceptionDocURL\":\"https://developer.mozilla.org/docs/Web/JavaScript/Reference/Errors/Not_defined?utm_source=mozilla&utm_medium=firefox-console-errors&utm_campaign=default\",\"userProvidedStyles\":null}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"result\",\"level\":\"error\",\"messageText\":\"ReferenceError: asdf is not defined\",\"parameters\":{\"type\":\"undefined\"},\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"debugger eval code\",\"line\":1,\"column\":1},\"groupId\":null,\"exceptionDocURL\":\"https://developer.mozilla.org/docs/Web/JavaScript/Reference/Errors/Not_defined?utm_source=mozilla&utm_medium=firefox-console-errors&utm_campaign=default\",\"userProvidedStyles\":null,\"notes\":null}", "stacktrace": null, "frame": { "source": "debugger eval code", @@ -59,7 +58,8 @@ stubPreparedMessages.set("asdf()", new ConsoleMessage({ }, "groupId": null, "exceptionDocURL": "https://developer.mozilla.org/docs/Web/JavaScript/Reference/Errors/Not_defined?utm_source=mozilla&utm_medium=firefox-console-errors&utm_campaign=default", - "userProvidedStyles": null + "userProvidedStyles": null, + "notes": null })); stubPreparedMessages.set("1 + @", new ConsoleMessage({ @@ -73,7 +73,7 @@ stubPreparedMessages.set("1 + @", new ConsoleMessage({ "type": "undefined" }, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"result\",\"level\":\"error\",\"messageText\":\"SyntaxError: illegal character\",\"parameters\":{\"type\":\"undefined\"},\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"debugger eval code\",\"line\":1,\"column\":4},\"groupId\":null,\"userProvidedStyles\":null}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"result\",\"level\":\"error\",\"messageText\":\"SyntaxError: illegal character\",\"parameters\":{\"type\":\"undefined\"},\"repeatId\":null,\"stacktrace\":null,\"frame\":{\"source\":\"debugger eval code\",\"line\":1,\"column\":4},\"groupId\":null,\"userProvidedStyles\":null,\"notes\":null}", "stacktrace": null, "frame": { "source": "debugger eval code", @@ -81,10 +81,10 @@ stubPreparedMessages.set("1 + @", new ConsoleMessage({ "column": 4 }, "groupId": null, - "userProvidedStyles": null + "userProvidedStyles": null, + "notes": null })); - stubPackets.set("new Date(0)", { "from": "server1.conn0.child1/consoleActor2", "input": "new Date(0)", @@ -103,7 +103,8 @@ stubPackets.set("new Date(0)", { "timestamp": 1476573073424, "exception": null, "frame": null, - "helperResult": null + "helperResult": null, + "notes": null }); stubPackets.set("asdf()", { @@ -138,7 +139,8 @@ stubPackets.set("asdf()", { "line": 1, "column": 1 }, - "helperResult": null + "helperResult": null, + "notes": null }); stubPackets.set("1 + @", { @@ -172,11 +174,11 @@ stubPackets.set("1 + @", { "line": 1, "column": 4 }, - "helperResult": null + "helperResult": null, + "notes": null }); - module.exports = { stubPreparedMessages, stubPackets, -}
\ No newline at end of file +}; diff --git a/devtools/client/webconsole/new-console-output/test/fixtures/stubs/pageError.js b/devtools/client/webconsole/new-console-output/test/fixtures/stubs/pageError.js index eda8e8b83..80147e7dd 100644 --- a/devtools/client/webconsole/new-console-output/test/fixtures/stubs/pageError.js +++ b/devtools/client/webconsole/new-console-output/test/fixtures/stubs/pageError.js @@ -11,8 +11,6 @@ const { ConsoleMessage, NetworkEventMessage } = require("devtools/client/webcons let stubPreparedMessages = new Map(); let stubPackets = new Map(); - - stubPreparedMessages.set("ReferenceError: asdf is not defined", new ConsoleMessage({ "id": "1", "allowRepeating": true, @@ -22,7 +20,7 @@ stubPreparedMessages.set("ReferenceError: asdf is not defined", new ConsoleMessa "messageText": "ReferenceError: asdf is not defined", "parameters": null, "repeat": 1, - "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"log\",\"level\":\"error\",\"messageText\":\"ReferenceError: asdf is not defined\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":[{\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error\",\"lineNumber\":3,\"columnNumber\":5,\"functionName\":\"bar\"},{\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error\",\"lineNumber\":6,\"columnNumber\":5,\"functionName\":\"foo\"},{\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error\",\"lineNumber\":9,\"columnNumber\":3,\"functionName\":null}],\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error\",\"line\":3,\"column\":5},\"groupId\":null,\"exceptionDocURL\":\"https://developer.mozilla.org/docs/Web/JavaScript/Reference/Errors/Not_defined?utm_source=mozilla&utm_medium=firefox-console-errors&utm_campaign=default\"}", + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"log\",\"level\":\"error\",\"messageText\":\"ReferenceError: asdf is not defined\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":[{\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error\",\"lineNumber\":3,\"columnNumber\":5,\"functionName\":\"bar\"},{\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error\",\"lineNumber\":6,\"columnNumber\":5,\"functionName\":\"foo\"},{\"filename\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error\",\"lineNumber\":9,\"columnNumber\":3,\"functionName\":null}],\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error\",\"line\":3,\"column\":5},\"groupId\":null,\"exceptionDocURL\":\"https://developer.mozilla.org/docs/Web/JavaScript/Reference/Errors/Not_defined?utm_source=mozilla&utm_medium=firefox-console-errors&utm_campaign=default\",\"userProvidedStyles\":null,\"notes\":null}", "stacktrace": [ { "filename": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-tempfile.js?key=Reference%20Error", @@ -49,9 +47,53 @@ stubPreparedMessages.set("ReferenceError: asdf is not defined", new ConsoleMessa "column": 5 }, "groupId": null, - "exceptionDocURL": "https://developer.mozilla.org/docs/Web/JavaScript/Reference/Errors/Not_defined?utm_source=mozilla&utm_medium=firefox-console-errors&utm_campaign=default" + "exceptionDocURL": "https://developer.mozilla.org/docs/Web/JavaScript/Reference/Errors/Not_defined?utm_source=mozilla&utm_medium=firefox-console-errors&utm_campaign=default", + "userProvidedStyles": null, + "notes": null })); +stubPreparedMessages.set("SyntaxError: redeclaration of let a", new ConsoleMessage({ + "id": "1", + "allowRepeating": true, + "source": "javascript", + "type": "log", + "level": "error", + "messageText": "SyntaxError: redeclaration of let a", + "parameters": null, + "repeat": 1, + "repeatId": "{\"id\":null,\"allowRepeating\":true,\"source\":\"javascript\",\"type\":\"log\",\"level\":\"error\",\"messageText\":\"SyntaxError: redeclaration of let a\",\"parameters\":null,\"repeatId\":null,\"stacktrace\":[{\"filename\":\"chrome://mochikit/content/tests/BrowserTestUtils/content-task.js line 52 > eval\",\"lineNumber\":6,\"columnNumber\":9,\"functionName\":null},{\"filename\":\"chrome://mochikit/content/tests/BrowserTestUtils/content-task.js\",\"lineNumber\":53,\"columnNumber\":20,\"functionName\":null}],\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html\",\"line\":2,\"column\":9},\"groupId\":null,\"userProvidedStyles\":null,\"notes\":[{\"messageBody\":\"Previously declared at line 2, column 6\",\"frame\":{\"source\":\"http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html\",\"line\":2,\"column\":6}}]}", + "stacktrace": [ + { + "filename": "chrome://mochikit/content/tests/BrowserTestUtils/content-task.js line 52 > eval", + "lineNumber": 6, + "columnNumber": 9, + "functionName": null + }, + { + "filename": "chrome://mochikit/content/tests/BrowserTestUtils/content-task.js", + "lineNumber": 53, + "columnNumber": 20, + "functionName": null + } + ], + "frame": { + "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html", + "line": 2, + "column": 9 + }, + "groupId": null, + "userProvidedStyles": null, + "notes": [ + { + "messageBody": "Previously declared at line 2, column 6", + "frame": { + "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html", + "line": 2, + "column": 6 + } + } + ] +})); stubPackets.set("ReferenceError: asdf is not defined", { "from": "server1.conn0.child1/consoleActor2", @@ -91,12 +133,56 @@ stubPackets.set("ReferenceError: asdf is not defined", { "columnNumber": 3, "functionName": null } - ] + ], + "notes": null } }); +stubPackets.set("SyntaxError: redeclaration of let a", { + "from": "server1.conn0.child1/consoleActor2", + "type": "pageError", + "pageError": { + "errorMessage": "SyntaxError: redeclaration of let a", + "errorMessageName": "JSMSG_REDECLARED_VAR", + "sourceName": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html", + "lineText": " let a, a;\n", + "lineNumber": 2, + "columnNumber": 9, + "category": "content javascript", + "warning": false, + "error": false, + "exception": true, + "strict": false, + "info": false, + "private": false, + "stacktrace": [ + { + "filename": "chrome://mochikit/content/tests/BrowserTestUtils/content-task.js line 52 > eval", + "lineNumber": 6, + "columnNumber": 9, + "functionName": null + }, + { + "filename": "chrome://mochikit/content/tests/BrowserTestUtils/content-task.js", + "lineNumber": 53, + "columnNumber": 20, + "functionName": null + } + ], + "notes": [ + { + "messageBody": "Previously declared at line 2, column 6", + "frame": { + "source": "http://example.com/browser/devtools/client/webconsole/new-console-output/test/fixtures/stub-generators/test-console-api.html", + "line": 2, + "column": 6 + } + } + ] + } +}); module.exports = { stubPreparedMessages, stubPackets, -}
\ No newline at end of file +}; diff --git a/devtools/client/webconsole/new-console-output/types.js b/devtools/client/webconsole/new-console-output/types.js index 897ae5d3a..cb27aedab 100644 --- a/devtools/client/webconsole/new-console-output/types.js +++ b/devtools/client/webconsole/new-console-output/types.js @@ -38,6 +38,7 @@ exports.ConsoleMessage = Immutable.Record({ groupId: null, exceptionDocURL: null, userProvidedStyles: null, + notes: null, }); exports.NetworkEventMessage = Immutable.Record({ diff --git a/devtools/client/webconsole/new-console-output/utils/messages.js b/devtools/client/webconsole/new-console-output/utils/messages.js index f91209e9d..119bc7fba 100644 --- a/devtools/client/webconsole/new-console-output/utils/messages.js +++ b/devtools/client/webconsole/new-console-output/utils/messages.js @@ -165,6 +165,7 @@ function transformPacket(packet) { stacktrace: pageError.stacktrace ? pageError.stacktrace : null, frame, exceptionDocURL: pageError.exceptionDocURL, + notes: pageError.notes, }); } @@ -185,7 +186,8 @@ function transformPacket(packet) { exceptionMessage: messageText, exceptionDocURL, frame, - result: parameters + result: parameters, + notes, } = packet; const level = messageText ? MESSAGE_LEVEL.ERROR : MESSAGE_LEVEL.LOG; @@ -197,6 +199,7 @@ function transformPacket(packet) { parameters, exceptionDocURL, frame, + notes, }); } } diff --git a/devtools/server/actors/webconsole.js b/devtools/server/actors/webconsole.js index a1eba84ed..66715bd34 100644 --- a/devtools/server/actors/webconsole.js +++ b/devtools/server/actors/webconsole.js @@ -888,7 +888,8 @@ WebConsoleActor.prototype = let evalResult = evalInfo.result; let helperResult = evalInfo.helperResult; - let result, errorDocURL, errorMessage, errorGrip = null, frame = null; + let result, errorDocURL, errorMessage, errorNotes = null, errorGrip = null, + frame = null; if (evalResult) { if ("return" in evalResult) { result = evalResult.return; @@ -943,6 +944,23 @@ WebConsoleActor.prototype = }; } } catch (ex) {} + + try { + let notes = error.errorNotes; + if (notes && notes.length) { + errorNotes = []; + for (let note of notes) { + errorNotes.push({ + messageBody: this._createStringGrip(note.message), + frame: { + source: note.fileName, + line: note.lineNumber, + column: note.columnNumber, + } + }); + } + } + } catch (ex) {} } } @@ -967,6 +985,7 @@ WebConsoleActor.prototype = exceptionDocURL: errorDocURL, frame, helperResult: helperResult, + notes: errorNotes, }; }, @@ -1500,6 +1519,23 @@ WebConsoleActor.prototype = lineText = lineText.substr(0, DebuggerServer.LONG_STRING_INITIAL_LENGTH); } + let notesArray = null; + let notes = aPageError.notes; + if (notes && notes.length) { + notesArray = []; + for (let i = 0, len = notes.length; i < len; i++) { + let note = notes.queryElementAt(i, Ci.nsIScriptErrorNote); + notesArray.push({ + messageBody: this._createStringGrip(note.errorMessage), + frame: { + source: note.sourceName, + line: note.lineNumber, + column: note.columnNumber, + } + }); + } + } + return { errorMessage: this._createStringGrip(aPageError.errorMessage), errorMessageName: aPageError.errorMessageName, @@ -1516,7 +1552,8 @@ WebConsoleActor.prototype = strict: !!(aPageError.flags & aPageError.strictFlag), info: !!(aPageError.flags & aPageError.infoFlag), private: aPageError.isFromPrivateWindow, - stacktrace: stack + stacktrace: stack, + notes: notesArray, }; }, diff --git a/devtools/shared/webconsole/test/test_page_errors.html b/devtools/shared/webconsole/test/test_page_errors.html index 78138856e..b4c0fe885 100644 --- a/devtools/shared/webconsole/test/test_page_errors.html +++ b/devtools/shared/webconsole/test/test_page_errors.html @@ -112,6 +112,24 @@ function doPageErrors() warning: true, exception: false, }, + "let a, a;": { + errorMessage: /redeclaration of/, + errorMessageName: "JSMSG_REDECLARED_VAR", + sourceName: /test_page_errors/, + category: "chrome javascript", + timeStamp: /^\d+$/, + error: false, + warning: false, + exception: true, + notes: [ + { + messageBody: /Previously declared at line/, + frame: { + source: /test_page_errors/, + } + } + ] + }, }; let container = document.createElement("script"); diff --git a/dom/base/nsGlobalWindow.cpp b/dom/base/nsGlobalWindow.cpp index f9126f4da..afaa24f09 100644 --- a/dom/base/nsGlobalWindow.cpp +++ b/dom/base/nsGlobalWindow.cpp @@ -2504,8 +2504,7 @@ nsGlobalWindow::WouldReuseInnerWindow(nsIDocument* aNewDocument) } bool equal; - if (NS_SUCCEEDED(mDoc->NodePrincipal()->Equals(aNewDocument->NodePrincipal(), - &equal)) && + if (NS_SUCCEEDED(mDoc->NodePrincipal()->EqualsConsideringDomain(aNewDocument->NodePrincipal(), &equal)) && equal) { // The origin is the same. return true; @@ -9335,7 +9334,7 @@ nsGlobalWindow::EnterModalState() topWin->mSuspendedDoc = topDoc; if (topDoc) { - topDoc->SuppressEventHandling(nsIDocument::eEvents); + topDoc->SuppressEventHandling(nsIDocument::eAnimationsOnly); } nsGlobalWindow* inner = topWin->GetCurrentInnerWindowInternal(); @@ -9372,7 +9371,7 @@ nsGlobalWindow::LeaveModalState() if (topWin->mSuspendedDoc) { nsCOMPtr<nsIDocument> currentDoc = topWin->GetExtantDoc(); - topWin->mSuspendedDoc->UnsuppressEventHandlingAndFireEvents(nsIDocument::eEvents, + topWin->mSuspendedDoc->UnsuppressEventHandlingAndFireEvents(nsIDocument::eAnimationsOnly, currentDoc == topWin->mSuspendedDoc); topWin->mSuspendedDoc = nullptr; } diff --git a/dom/bindings/BindingUtils.cpp b/dom/bindings/BindingUtils.cpp index 8d2bdaac6..a26fc4422 100644 --- a/dom/bindings/BindingUtils.cpp +++ b/dom/bindings/BindingUtils.cpp @@ -1184,14 +1184,6 @@ GetInterfaceImpl(JSContext* aCx, nsIInterfaceRequestor* aRequestor, } bool -UnforgeableValueOf(JSContext* cx, unsigned argc, JS::Value* vp) -{ - JS::CallArgs args = JS::CallArgsFromVp(argc, vp); - args.rval().set(args.thisv()); - return true; -} - -bool ThrowingConstructor(JSContext* cx, unsigned argc, JS::Value* vp) { return ThrowErrorMessage(cx, MSG_ILLEGAL_CONSTRUCTOR); diff --git a/dom/bindings/BindingUtils.h b/dom/bindings/BindingUtils.h index a3ec70f47..5cab835b3 100644 --- a/dom/bindings/BindingUtils.h +++ b/dom/bindings/BindingUtils.h @@ -2045,9 +2045,6 @@ GetInterface(JSContext* aCx, T* aThis, nsIJSID* aIID, } bool -UnforgeableValueOf(JSContext* cx, unsigned argc, JS::Value* vp); - -bool ThrowingConstructor(JSContext* cx, unsigned argc, JS::Value* vp); bool diff --git a/dom/bindings/Codegen.py b/dom/bindings/Codegen.py index 74acb5918..d7d700a96 100644 --- a/dom/bindings/Codegen.py +++ b/dom/bindings/Codegen.py @@ -2390,11 +2390,10 @@ class MethodDefiner(PropertyDefiner): # Synthesize our valueOf method self.regular.append({ "name": 'valueOf', - "nativeName": "UnforgeableValueOf", + "selfHostedName": "Object_valueOf", "methodInfo": False, "length": 0, - "flags": "JSPROP_ENUMERATE", # readonly/permanent added - # automatically. + "flags": "0", # readonly/permanent added automatically. "condition": MemberCondition() }) @@ -3456,19 +3455,15 @@ def InitUnforgeablePropertiesOnHolder(descriptor, properties, failureCode, "nsContentUtils::ThreadsafeIsCallerChrome()")) if descriptor.interface.getExtendedAttribute("Unforgeable"): - # We do our undefined toJSON and toPrimitive here, not as a regular - # property because we don't have a concept of value props anywhere in - # IDL. + # We do our undefined toPrimitive here, not as a regular property + # because we don't have a concept of value props anywhere in IDL. unforgeables.append(CGGeneric(fill( """ JS::RootedId toPrimitive(aCx, SYMBOL_TO_JSID(JS::GetWellKnownSymbol(aCx, JS::SymbolCode::toPrimitive))); if (!JS_DefinePropertyById(aCx, ${holderName}, toPrimitive, JS::UndefinedHandleValue, - JSPROP_READONLY | JSPROP_PERMANENT) || - !JS_DefineProperty(aCx, ${holderName}, "toJSON", - JS::UndefinedHandleValue, - JSPROP_READONLY | JSPROP_ENUMERATE | JSPROP_PERMANENT)) { + JSPROP_READONLY | JSPROP_PERMANENT)) { $*{failureCode} } """, diff --git a/dom/bindings/moz.build b/dom/bindings/moz.build index 043b3c494..ed8a4d37e 100644 --- a/dom/bindings/moz.build +++ b/dom/bindings/moz.build @@ -6,6 +6,12 @@ TEST_DIRS += ['test'] +XPIDL_SOURCES += [ + 'nsIScriptError.idl' +] + +XPIDL_MODULE = 'dom_bindings' + EXPORTS.ipc += [ 'ErrorIPCUtils.h', ] @@ -91,6 +97,8 @@ UNIFIED_SOURCES += [ 'DOMJSProxyHandler.cpp', 'Exceptions.cpp', 'IterableIterator.cpp', + 'nsScriptError.cpp', + 'nsScriptErrorWithStack.cpp', 'SimpleGlobalObject.cpp', 'ToJSValue.cpp', 'WebIDLGlobalNameHash.cpp', diff --git a/js/xpconnect/idl/nsIScriptError.idl b/dom/bindings/nsIScriptError.idl index 468ca682f..8436361a8 100644 --- a/js/xpconnect/idl/nsIScriptError.idl +++ b/dom/bindings/nsIScriptError.idl @@ -9,13 +9,25 @@ #include "nsISupports.idl" +#include "nsIArray.idl" #include "nsIConsoleMessage.idl" %{C++ #include "nsStringGlue.h" // for nsDependentCString %} -[scriptable, uuid(361be358-76f0-47aa-b37b-6ad833599e8d)] +[scriptable, uuid(e8933fc9-c302-4e12-a55b-4f88611d9c6c)] +interface nsIScriptErrorNote : nsISupports +{ + readonly attribute AString errorMessage; + readonly attribute AString sourceName; + readonly attribute uint32_t lineNumber; + readonly attribute uint32_t columnNumber; + + AUTF8String toString(); +}; + +[scriptable, uuid(63eb4d3e-7d99-4150-b4f3-11314f9d82a9)] interface nsIScriptError : nsIConsoleMessage { /** pseudo-flag for default case */ @@ -74,6 +86,7 @@ interface nsIScriptError : nsIConsoleMessage */ attribute AString errorMessageName; + readonly attribute nsIArray notes; void init(in AString message, in AString sourceName, diff --git a/js/xpconnect/src/nsScriptError.cpp b/dom/bindings/nsScriptError.cpp index ff687bc44..9248d1a31 100644 --- a/js/xpconnect/src/nsScriptError.cpp +++ b/dom/bindings/nsScriptError.cpp @@ -5,18 +5,19 @@ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ /* - * nsIScriptError implementation. Defined here, lacking a JS-specific - * place to put XPCOM things. + * nsIScriptError implementation. */ -#include "xpcprivate.h" +#include "nsScriptError.h" #include "jsprf.h" #include "MainThreadUtils.h" #include "mozilla/Assertions.h" #include "nsGlobalWindow.h" +#include "nsNetUtil.h" #include "nsPIDOMWindow.h" #include "nsILoadContext.h" #include "nsIDocShell.h" +#include "nsIMutableArray.h" #include "nsIScriptError.h" #include "nsISensitiveInfoHiddenURI.h" @@ -47,6 +48,12 @@ nsScriptErrorBase::nsScriptErrorBase() nsScriptErrorBase::~nsScriptErrorBase() {} void +nsScriptErrorBase::AddNote(nsIScriptErrorNote* note) +{ + mNotes.AppendObject(note); +} + +void nsScriptErrorBase::InitializeOnMainThread() { MOZ_ASSERT(NS_IsMainThread()); @@ -189,6 +196,28 @@ nsScriptErrorBase::Init(const nsAString& message, 0); } +static void +AssignSourceNameHelper(nsString& aSourceNameDest, const nsAString& aSourceNameSrc) +{ + if (aSourceNameSrc.IsEmpty()) + return; + + aSourceNameDest.Assign(aSourceNameSrc); + + nsCOMPtr<nsIURI> uri; + nsAutoCString pass; + if (NS_SUCCEEDED(NS_NewURI(getter_AddRefs(uri), aSourceNameSrc)) && + NS_SUCCEEDED(uri->GetPassword(pass)) && + !pass.IsEmpty()) + { + nsCOMPtr<nsISensitiveInfoHiddenURI> safeUri = do_QueryInterface(uri); + + nsAutoCString loc; + if (safeUri && NS_SUCCEEDED(safeUri->GetSensitiveInfoHiddenSpec(loc))) + aSourceNameDest.Assign(NS_ConvertUTF8toUTF16(loc)); + } +} + NS_IMETHODIMP nsScriptErrorBase::InitWithWindowID(const nsAString& message, const nsAString& sourceName, @@ -200,26 +229,7 @@ nsScriptErrorBase::InitWithWindowID(const nsAString& message, uint64_t aInnerWindowID) { mMessage.Assign(message); - - if (!sourceName.IsEmpty()) { - mSourceName.Assign(sourceName); - - nsCOMPtr<nsIURI> uri; - nsAutoCString pass; - if (NS_SUCCEEDED(NS_NewURI(getter_AddRefs(uri), sourceName)) && - NS_SUCCEEDED(uri->GetPassword(pass)) && - !pass.IsEmpty()) { - nsCOMPtr<nsISensitiveInfoHiddenURI> safeUri = - do_QueryInterface(uri); - - nsAutoCString loc; - if (safeUri && - NS_SUCCEEDED(safeUri->GetSensitiveInfoHiddenSpec(loc))) { - mSourceName.Assign(NS_ConvertUTF8toUTF16(loc)); - } - } - } - + AssignSourceNameHelper(mSourceName, sourceName); mLineNumber = lineNumber; mSourceLine.Assign(sourceLine); mColumnNumber = columnNumber; @@ -235,8 +245,11 @@ nsScriptErrorBase::InitWithWindowID(const nsAString& message, return NS_OK; } -NS_IMETHODIMP -nsScriptErrorBase::ToString(nsACString& /*UTF8*/ aResult) +static nsresult +ToStringHelper(const char* aSeverity, const nsString& aMessage, + const nsString& aSourceName, const nsString* aSourceLine, + uint32_t aLineNumber, uint32_t aColumnNumber, + nsACString& /*UTF8*/ aResult) { static const char format0[] = "[%s: \"%s\" {file: \"%s\" line: %d column: %d source: \"%s\"}]"; @@ -245,43 +258,39 @@ nsScriptErrorBase::ToString(nsACString& /*UTF8*/ aResult) static const char format2[] = "[%s: \"%s\"]"; - static const char error[] = "JavaScript Error"; - static const char warning[] = "JavaScript Warning"; - - const char* severity = !(mFlags & JSREPORT_WARNING) ? error : warning; - char* temp; char* tempMessage = nullptr; char* tempSourceName = nullptr; char* tempSourceLine = nullptr; - if (!mMessage.IsEmpty()) - tempMessage = ToNewUTF8String(mMessage); - if (!mSourceName.IsEmpty()) + if (!aMessage.IsEmpty()) + tempMessage = ToNewUTF8String(aMessage); + if (!aSourceName.IsEmpty()) // Use at most 512 characters from mSourceName. - tempSourceName = ToNewUTF8String(StringHead(mSourceName, 512)); - if (!mSourceLine.IsEmpty()) + tempSourceName = ToNewUTF8String(StringHead(aSourceName, 512)); + if (aSourceLine && !aSourceLine->IsEmpty()) // Use at most 512 characters from mSourceLine. - tempSourceLine = ToNewUTF8String(StringHead(mSourceLine, 512)); + tempSourceLine = ToNewUTF8String(StringHead(*aSourceLine, 512)); - if (nullptr != tempSourceName && nullptr != tempSourceLine) + if (nullptr != tempSourceName && nullptr != tempSourceLine) { temp = JS_smprintf(format0, - severity, + aSeverity, tempMessage, tempSourceName, - mLineNumber, - mColumnNumber, + aLineNumber, + aColumnNumber, tempSourceLine); - else if (!mSourceName.IsEmpty()) + } else if (!aSourceName.IsEmpty()) { temp = JS_smprintf(format1, - severity, + aSeverity, tempMessage, tempSourceName, - mLineNumber); - else + aLineNumber); + } else { temp = JS_smprintf(format2, - severity, + aSeverity, tempMessage); + } if (nullptr != tempMessage) free(tempMessage); @@ -299,6 +308,18 @@ nsScriptErrorBase::ToString(nsACString& /*UTF8*/ aResult) } NS_IMETHODIMP +nsScriptErrorBase::ToString(nsACString& /*UTF8*/ aResult) +{ + static const char error[] = "JavaScript Error"; + static const char warning[] = "JavaScript Warning"; + + const char* severity = !(mFlags & JSREPORT_WARNING) ? error : warning; + + return ToStringHelper(severity, mMessage, mSourceName, &mSourceLine, + mLineNumber, mColumnNumber, aResult); +} + +NS_IMETHODIMP nsScriptErrorBase::GetOuterWindowID(uint64_t* aOuterWindowID) { NS_WARNING_ASSERTION(NS_IsMainThread() || mInitializedOnMainThread, @@ -342,4 +363,76 @@ nsScriptErrorBase::GetIsFromPrivateWindow(bool* aIsFromPrivateWindow) return NS_OK; } +NS_IMETHODIMP +nsScriptErrorBase::GetNotes(nsIArray** aNotes) +{ + nsresult rv = NS_OK; + nsCOMPtr<nsIMutableArray> array = + do_CreateInstance(NS_ARRAY_CONTRACTID, &rv); + NS_ENSURE_SUCCESS(rv, rv); + + uint32_t len = mNotes.Length(); + for (uint32_t i = 0; i < len; i++) + array->AppendElement(mNotes[i], false); + array.forget(aNotes); + + return NS_OK; +} + NS_IMPL_ISUPPORTS(nsScriptError, nsIConsoleMessage, nsIScriptError) + +nsScriptErrorNote::nsScriptErrorNote() + : mMessage(), + mSourceName(), + mLineNumber(0), + mColumnNumber(0) +{ +} + +nsScriptErrorNote::~nsScriptErrorNote() {} + +void +nsScriptErrorNote::Init(const nsAString& message, + const nsAString& sourceName, + uint32_t lineNumber, + uint32_t columnNumber) +{ + mMessage.Assign(message); + AssignSourceNameHelper(mSourceName, sourceName); + mLineNumber = lineNumber; + mColumnNumber = columnNumber; +} + +// nsIScriptErrorNote methods +NS_IMETHODIMP +nsScriptErrorNote::GetErrorMessage(nsAString& aResult) { + aResult.Assign(mMessage); + return NS_OK; +} + +NS_IMETHODIMP +nsScriptErrorNote::GetSourceName(nsAString& aResult) { + aResult.Assign(mSourceName); + return NS_OK; +} + +NS_IMETHODIMP +nsScriptErrorNote::GetLineNumber(uint32_t* result) { + *result = mLineNumber; + return NS_OK; +} + +NS_IMETHODIMP +nsScriptErrorNote::GetColumnNumber(uint32_t* result) { + *result = mColumnNumber; + return NS_OK; +} + +NS_IMETHODIMP +nsScriptErrorNote::ToString(nsACString& /*UTF8*/ aResult) +{ + return ToStringHelper("JavaScript Note", mMessage, mSourceName, nullptr, + mLineNumber, mColumnNumber, aResult); +} + +NS_IMPL_ISUPPORTS(nsScriptErrorNote, nsIScriptErrorNote) diff --git a/dom/bindings/nsScriptError.h b/dom/bindings/nsScriptError.h new file mode 100644 index 000000000..b8049d0a0 --- /dev/null +++ b/dom/bindings/nsScriptError.h @@ -0,0 +1,109 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_nsScriptError_h +#define mozilla_dom_nsScriptError_h + +#include "mozilla/Atomics.h" + +#include <stdint.h> + +#include "jsapi.h" +#include "js/RootingAPI.h" + +#include "nsIScriptError.h" +#include "nsString.h" + +class nsScriptErrorNote final : public nsIScriptErrorNote { + public: + nsScriptErrorNote(); + + NS_DECL_THREADSAFE_ISUPPORTS + NS_DECL_NSISCRIPTERRORNOTE + + void Init(const nsAString& message, const nsAString& sourceName, + uint32_t lineNumber, uint32_t columnNumber); + + private: + virtual ~nsScriptErrorNote(); + + nsString mMessage; + nsString mSourceName; + nsString mSourceLine; + uint32_t mLineNumber; + uint32_t mColumnNumber; +}; + +// Definition of nsScriptError.. +class nsScriptErrorBase : public nsIScriptError { +public: + nsScriptErrorBase(); + + NS_DECL_NSICONSOLEMESSAGE + NS_DECL_NSISCRIPTERROR + + void AddNote(nsIScriptErrorNote* note); + +protected: + virtual ~nsScriptErrorBase(); + + void + InitializeOnMainThread(); + + nsCOMArray<nsIScriptErrorNote> mNotes; + nsString mMessage; + nsString mMessageName; + nsString mSourceName; + uint32_t mLineNumber; + nsString mSourceLine; + uint32_t mColumnNumber; + uint32_t mFlags; + nsCString mCategory; + // mOuterWindowID is set on the main thread from InitializeOnMainThread(). + uint64_t mOuterWindowID; + uint64_t mInnerWindowID; + int64_t mTimeStamp; + // mInitializedOnMainThread and mIsFromPrivateWindow are set on the main + // thread from InitializeOnMainThread(). + mozilla::Atomic<bool> mInitializedOnMainThread; + bool mIsFromPrivateWindow; +}; + +class nsScriptError final : public nsScriptErrorBase { +public: + nsScriptError() {} + NS_DECL_THREADSAFE_ISUPPORTS + +private: + virtual ~nsScriptError() {} +}; + +class nsScriptErrorWithStack : public nsScriptErrorBase { +public: + explicit nsScriptErrorWithStack(JS::HandleObject); + + NS_DECL_CYCLE_COLLECTING_ISUPPORTS + NS_DECL_CYCLE_COLLECTION_SCRIPT_HOLDER_CLASS(nsScriptErrorWithStack) + + NS_IMETHOD Init(const nsAString& message, + const nsAString& sourceName, + const nsAString& sourceLine, + uint32_t lineNumber, + uint32_t columnNumber, + uint32_t flags, + const char* category) override; + + NS_IMETHOD GetStack(JS::MutableHandleValue) override; + NS_IMETHOD ToString(nsACString& aResult) override; + +private: + virtual ~nsScriptErrorWithStack(); + // Complete stackframe where the error happened. + // Must be SavedFrame object. + JS::Heap<JSObject*> mStack; +}; + +#endif /* mozilla_dom_nsScriptError_h */ diff --git a/js/xpconnect/src/nsScriptErrorWithStack.cpp b/dom/bindings/nsScriptErrorWithStack.cpp index 50407da23..74c00999f 100644 --- a/js/xpconnect/src/nsScriptErrorWithStack.cpp +++ b/dom/bindings/nsScriptErrorWithStack.cpp @@ -10,12 +10,14 @@ * that can store a SavedFrame stack trace object. */ -#include "xpcprivate.h" +#include "nsScriptError.h" #include "MainThreadUtils.h" #include "mozilla/Assertions.h" +#include "mozilla/dom/ScriptSettings.h" #include "nsGlobalWindow.h" #include "nsCycleCollectionParticipant.h" +using namespace mozilla::dom; namespace { diff --git a/dom/canvas/WebGLBuffer.cpp b/dom/canvas/WebGLBuffer.cpp index 1eaf37ac4..02a8f649f 100644 --- a/dom/canvas/WebGLBuffer.cpp +++ b/dom/canvas/WebGLBuffer.cpp @@ -134,6 +134,7 @@ WebGLBuffer::BufferData(GLenum target, size_t size, const void* data, GLenum usa if (error) { MOZ_ASSERT(error == LOCAL_GL_OUT_OF_MEMORY); mContext->ErrorOutOfMemory("%s: Error from driver: 0x%04x", funcName, error); + mByteLength = 0; return; } } else { diff --git a/dom/canvas/WebGLContext.h b/dom/canvas/WebGLContext.h index 8a20237ff..0510e6898 100644 --- a/dom/canvas/WebGLContext.h +++ b/dom/canvas/WebGLContext.h @@ -20,6 +20,7 @@ #include "mozilla/gfx/2D.h" #include "mozilla/LinkedList.h" #include "mozilla/UniquePtr.h" +#include "mozilla/WeakPtr.h" #include "nsCycleCollectionNoteChild.h" #include "nsICanvasRenderingContextInternal.h" #include "nsLayoutUtils.h" @@ -299,6 +300,7 @@ class WebGLContext , public WebGLContextUnchecked , public WebGLRectangleObject , public nsWrapperCache + , public SupportsWeakPtr<WebGLContext> { friend class ScopedDrawHelper; friend class ScopedDrawWithTransformFeedback; @@ -342,6 +344,7 @@ public: NS_DECL_CYCLE_COLLECTION_SCRIPT_HOLDER_CLASS_AMBIGUOUS(WebGLContext, nsIDOMWebGLRenderingContext) + MOZ_DECLARE_WEAKREFERENCE_TYPENAME(WebGLContext) virtual JSObject* WrapObject(JSContext* cx, JS::Handle<JSObject*> givenProto) override = 0; diff --git a/dom/canvas/WebGLExtensionDebugShaders.cpp b/dom/canvas/WebGLExtensionDebugShaders.cpp index 75880465e..8399aeb95 100644 --- a/dom/canvas/WebGLExtensionDebugShaders.cpp +++ b/dom/canvas/WebGLExtensionDebugShaders.cpp @@ -29,15 +29,10 @@ WebGLExtensionDebugShaders::GetTranslatedShaderSource(const WebGLShader& shader, { retval.SetIsVoid(true); - if (mIsLost) { - mContext->ErrorInvalidOperation("%s: Extension is lost.", - "getTranslatedShaderSource"); + if (mIsLost || !mContext) { return; } - if (mContext->IsContextLost()) - return; - if (!mContext->ValidateObject("getShaderTranslatedSource: shader", shader)) return; diff --git a/dom/canvas/WebGLExtensionDisjointTimerQuery.cpp b/dom/canvas/WebGLExtensionDisjointTimerQuery.cpp index e2e34f14e..da76eeb2d 100644 --- a/dom/canvas/WebGLExtensionDisjointTimerQuery.cpp +++ b/dom/canvas/WebGLExtensionDisjointTimerQuery.cpp @@ -40,8 +40,10 @@ void WebGLExtensionDisjointTimerQuery::DeleteQueryEXT(WebGLQuery* query) const { const char funcName[] = "deleteQueryEXT"; - if (mIsLost) - return; + + if (mIsLost || !mContext) { + return; + } mContext->DeleteQuery(query, funcName); } @@ -50,8 +52,10 @@ bool WebGLExtensionDisjointTimerQuery::IsQueryEXT(const WebGLQuery* query) const { const char funcName[] = "isQueryEXT"; - if (mIsLost) - return false; + + if (mIsLost || !mContext) { + return false; + } return mContext->IsQuery(query, funcName); } @@ -60,8 +64,10 @@ void WebGLExtensionDisjointTimerQuery::BeginQueryEXT(GLenum target, WebGLQuery& query) const { const char funcName[] = "beginQueryEXT"; - if (mIsLost) - return; + + if (mIsLost || !mContext) { + return; + } mContext->BeginQuery(target, query, funcName); } @@ -70,8 +76,10 @@ void WebGLExtensionDisjointTimerQuery::EndQueryEXT(GLenum target) const { const char funcName[] = "endQueryEXT"; - if (mIsLost) - return; + + if (mIsLost || !mContext) { + return; + } mContext->EndQuery(target, funcName); } @@ -80,8 +88,10 @@ void WebGLExtensionDisjointTimerQuery::QueryCounterEXT(WebGLQuery& query, GLenum target) const { const char funcName[] = "queryCounterEXT"; - if (mIsLost) - return; + + if (mIsLost || !mContext) { + return; + } if (!mContext->ValidateObject(funcName, query)) return; @@ -95,8 +105,10 @@ WebGLExtensionDisjointTimerQuery::GetQueryEXT(JSContext* cx, GLenum target, GLen { const char funcName[] = "getQueryEXT"; retval.setNull(); - if (mIsLost) - return; + + if (mIsLost || !mContext) { + return; + } mContext->GetQuery(cx, target, pname, retval, funcName); } @@ -108,8 +120,10 @@ WebGLExtensionDisjointTimerQuery::GetQueryObjectEXT(JSContext* cx, { const char funcName[] = "getQueryObjectEXT"; retval.setNull(); - if (mIsLost) - return; + + if (mIsLost || !mContext) { + return; + } mContext->GetQueryParameter(cx, query, pname, retval, funcName); } diff --git a/dom/canvas/WebGLExtensionDrawBuffers.cpp b/dom/canvas/WebGLExtensionDrawBuffers.cpp index 27aa76cc7..6f386621f 100644 --- a/dom/canvas/WebGLExtensionDrawBuffers.cpp +++ b/dom/canvas/WebGLExtensionDrawBuffers.cpp @@ -36,7 +36,9 @@ void WebGLExtensionDrawBuffers::DrawBuffersWEBGL(const dom::Sequence<GLenum>& buffers) { if (mIsLost) { - mContext->ErrorInvalidOperation("drawBuffersWEBGL: Extension is lost."); + if (mContext) { + mContext->ErrorInvalidOperation("drawBuffersWEBGL: Extension is lost."); + } return; } diff --git a/dom/canvas/WebGLExtensionInstancedArrays.cpp b/dom/canvas/WebGLExtensionInstancedArrays.cpp index 10d0533fe..22b3ec12c 100644 --- a/dom/canvas/WebGLExtensionInstancedArrays.cpp +++ b/dom/canvas/WebGLExtensionInstancedArrays.cpp @@ -28,8 +28,10 @@ WebGLExtensionInstancedArrays::DrawArraysInstancedANGLE(GLenum mode, GLsizei primcount) { if (mIsLost) { - mContext->ErrorInvalidOperation("%s: Extension is lost.", - "drawArraysInstancedANGLE"); + if (mContext) { + mContext->ErrorInvalidOperation("%s: Extension is lost.", + "drawArraysInstancedANGLE"); + } return; } @@ -44,8 +46,10 @@ WebGLExtensionInstancedArrays::DrawElementsInstancedANGLE(GLenum mode, GLsizei primcount) { if (mIsLost) { - mContext->ErrorInvalidOperation("%s: Extension is lost.", - "drawElementsInstancedANGLE"); + if (mContext) { + mContext->ErrorInvalidOperation("%s: Extension is lost.", + "drawElementsInstancedANGLE"); + } return; } @@ -57,8 +61,10 @@ WebGLExtensionInstancedArrays::VertexAttribDivisorANGLE(GLuint index, GLuint divisor) { if (mIsLost) { - mContext->ErrorInvalidOperation("%s: Extension is lost.", - "vertexAttribDivisorANGLE"); + if (mContext) { + mContext->ErrorInvalidOperation("%s: Extension is lost.", + "vertexAttribDivisorANGLE"); + } return; } diff --git a/dom/canvas/WebGLExtensionLoseContext.cpp b/dom/canvas/WebGLExtensionLoseContext.cpp index 020731e63..41f1633d8 100644 --- a/dom/canvas/WebGLExtensionLoseContext.cpp +++ b/dom/canvas/WebGLExtensionLoseContext.cpp @@ -22,12 +22,14 @@ WebGLExtensionLoseContext::~WebGLExtensionLoseContext() void WebGLExtensionLoseContext::LoseContext() { + if (!mContext) return; mContext->LoseContext(); } void WebGLExtensionLoseContext::RestoreContext() { + if (!mContext) return; mContext->RestoreContext(); } diff --git a/dom/canvas/WebGLExtensionVertexArray.cpp b/dom/canvas/WebGLExtensionVertexArray.cpp index 0984582f5..39aa96801 100644 --- a/dom/canvas/WebGLExtensionVertexArray.cpp +++ b/dom/canvas/WebGLExtensionVertexArray.cpp @@ -25,7 +25,7 @@ WebGLExtensionVertexArray::~WebGLExtensionVertexArray() already_AddRefed<WebGLVertexArray> WebGLExtensionVertexArray::CreateVertexArrayOES() { - if (mIsLost) + if (mIsLost || !mContext) return nullptr; return mContext->CreateVertexArray(); @@ -34,7 +34,7 @@ WebGLExtensionVertexArray::CreateVertexArrayOES() void WebGLExtensionVertexArray::DeleteVertexArrayOES(WebGLVertexArray* array) { - if (mIsLost) + if (mIsLost || !mContext) return; mContext->DeleteVertexArray(array); @@ -43,7 +43,7 @@ WebGLExtensionVertexArray::DeleteVertexArrayOES(WebGLVertexArray* array) bool WebGLExtensionVertexArray::IsVertexArrayOES(const WebGLVertexArray* array) { - if (mIsLost) + if (mIsLost || !mContext) return false; return mContext->IsVertexArray(array); @@ -52,7 +52,7 @@ WebGLExtensionVertexArray::IsVertexArrayOES(const WebGLVertexArray* array) void WebGLExtensionVertexArray::BindVertexArrayOES(WebGLVertexArray* array) { - if (mIsLost) + if (mIsLost || !mContext) return; mContext->BindVertexArray(array); diff --git a/dom/canvas/WebGLObjectModel.h b/dom/canvas/WebGLObjectModel.h index b18b790c0..6371c7b03 100644 --- a/dom/canvas/WebGLObjectModel.h +++ b/dom/canvas/WebGLObjectModel.h @@ -6,8 +6,8 @@ #ifndef WEBGLOBJECTMODEL_H_ #define WEBGLOBJECTMODEL_H_ +#include "mozilla/WeakPtr.h" #include "nsCycleCollectionNoteChild.h" - #include "WebGLTypes.h" namespace mozilla { @@ -24,7 +24,7 @@ class WebGLContext; class WebGLContextBoundObject { public: - WebGLContext* const mContext; + const WeakPtr<WebGLContext> mContext; private: const uint32_t mContextGeneration; diff --git a/dom/canvas/WebGLRenderbuffer.cpp b/dom/canvas/WebGLRenderbuffer.cpp index ec076fdbb..32397dd1a 100644 --- a/dom/canvas/WebGLRenderbuffer.cpp +++ b/dom/canvas/WebGLRenderbuffer.cpp @@ -215,6 +215,16 @@ WebGLRenderbuffer::RenderbufferStorage(const char* funcName, uint32_t samples, if (error) { const char* errorName = mContext->ErrorName(error); mContext->GenerateWarning("%s generated error %s", funcName, errorName); + if (error == LOCAL_GL_OUT_OF_MEMORY) { + // Truncate. + mSamples = 0; + mFormat = nullptr; + mWidth = 0; + mHeight = 0; + mImageDataStatus = WebGLImageDataStatus::NoImageData; + + InvalidateStatusOfAttachedFBs(); + } return; } diff --git a/dom/canvas/WebGLTexture.cpp b/dom/canvas/WebGLTexture.cpp index 767ff610a..65bb71153 100644 --- a/dom/canvas/WebGLTexture.cpp +++ b/dom/canvas/WebGLTexture.cpp @@ -51,8 +51,6 @@ WebGLTexture::ImageInfo::Clear() WebGLTexture::ImageInfo& WebGLTexture::ImageInfo::operator =(const ImageInfo& a) { - MOZ_ASSERT(a.IsDefined()); - Mutable(mFormat) = a.mFormat; Mutable(mWidth) = a.mWidth; Mutable(mHeight) = a.mHeight; @@ -1216,6 +1214,12 @@ WebGLTexture::TexParameter(TexTarget texTarget, GLenum pname, const FloatOrInt& mContext->gl->fTexParameterf(texTarget.get(), pname, clamped.f); } +void WebGLTexture::Truncate() { + for (auto& cur : mImageInfoArr) { + SetImageInfo(&cur, ImageInfo()); + } +} + //////////////////////////////////////////////////////////////////////////////// NS_IMPL_CYCLE_COLLECTION_WRAPPERCACHE_0(WebGLTexture) diff --git a/dom/canvas/WebGLTexture.h b/dom/canvas/WebGLTexture.h index 66e781f23..8d3024590 100644 --- a/dom/canvas/WebGLTexture.h +++ b/dom/canvas/WebGLTexture.h @@ -386,6 +386,7 @@ public: bool* const out_initFailed); bool IsMipmapCubeComplete() const; + void Truncate(); bool IsCubeMap() const { return (mTarget == LOCAL_GL_TEXTURE_CUBE_MAP); } diff --git a/dom/canvas/WebGLTextureUpload.cpp b/dom/canvas/WebGLTextureUpload.cpp index 3839b5d5e..ae60d2a2b 100644 --- a/dom/canvas/WebGLTextureUpload.cpp +++ b/dom/canvas/WebGLTextureUpload.cpp @@ -1178,6 +1178,7 @@ WebGLTexture::TexStorage(const char* funcName, TexTarget target, GLsizei levels, if (error == LOCAL_GL_OUT_OF_MEMORY) { mContext->ErrorOutOfMemory("%s: Ran out of memory during texture allocation.", funcName); + Truncate(); return; } if (error) { @@ -1310,6 +1311,7 @@ WebGLTexture::TexImage(const char* funcName, TexImageTarget target, GLint level, if (glError == LOCAL_GL_OUT_OF_MEMORY) { mContext->ErrorOutOfMemory("%s: Driver ran out of memory during upload.", funcName); + Truncate(); return; } @@ -1398,6 +1400,7 @@ WebGLTexture::TexSubImage(const char* funcName, TexImageTarget target, GLint lev if (glError == LOCAL_GL_OUT_OF_MEMORY) { mContext->ErrorOutOfMemory("%s: Driver ran out of memory during upload.", funcName); + Truncate(); return; } @@ -1514,6 +1517,7 @@ WebGLTexture::CompressedTexImage(const char* funcName, TexImageTarget target, GL blob->mAvailBytes, blob->mPtr); if (error == LOCAL_GL_OUT_OF_MEMORY) { mContext->ErrorOutOfMemory("%s: Ran out of memory during upload.", funcName); + Truncate(); return; } if (error) { @@ -1664,6 +1668,7 @@ WebGLTexture::CompressedTexSubImage(const char* funcName, TexImageTarget target, blob->mAvailBytes, blob->mPtr); if (error == LOCAL_GL_OUT_OF_MEMORY) { mContext->ErrorOutOfMemory("%s: Ran out of memory during upload.", funcName); + Truncate(); return; } if (error) { @@ -1992,7 +1997,7 @@ WebGLTexture::ValidateCopyTexImageForFeedback(const char* funcName, uint32_t lev static bool DoCopyTexOrSubImage(WebGLContext* webgl, const char* funcName, bool isSubImage, - const WebGLTexture* tex, TexImageTarget target, GLint level, + WebGLTexture* tex, TexImageTarget target, GLint level, GLint xWithinSrc, GLint yWithinSrc, uint32_t srcTotalWidth, uint32_t srcTotalHeight, const webgl::FormatUsageInfo* srcUsage, @@ -2069,6 +2074,7 @@ DoCopyTexOrSubImage(WebGLContext* webgl, const char* funcName, bool isSubImage, if (error == LOCAL_GL_OUT_OF_MEMORY) { webgl->ErrorOutOfMemory("%s: Ran out of memory during texture copy.", funcName); + tex->Truncate(); return false; } diff --git a/dom/indexedDB/ActorsChild.cpp b/dom/indexedDB/ActorsChild.cpp index c4fcceb90..30dc9b6da 100644 --- a/dom/indexedDB/ActorsChild.cpp +++ b/dom/indexedDB/ActorsChild.cpp @@ -2385,9 +2385,14 @@ BackgroundVersionChangeTransactionChild::RecvComplete(const nsresult& aResult) database->Close(); } + RefPtr<IDBOpenDBRequest> request = mOpenDBRequest; + MOZ_ASSERT(request); + mTransaction->FireCompleteOrAbortEvents(aResult); - mOpenDBRequest->SetTransaction(nullptr); + request->SetTransaction(nullptr); + request = nullptr; + mOpenDBRequest = nullptr; NoteComplete(); diff --git a/dom/media/MediaResource.cpp b/dom/media/MediaResource.cpp index d36783be7..84a8d67fd 100644 --- a/dom/media/MediaResource.cpp +++ b/dom/media/MediaResource.cpp @@ -1525,7 +1525,7 @@ void BaseMediaResource::SetLoadInBackground(bool aLoadInBackground) { NS_WARNING("Null owner in MediaResource::SetLoadInBackground()"); return; } - dom::HTMLMediaElement* element = owner->GetMediaElement(); + RefPtr<dom::HTMLMediaElement> element = owner->GetMediaElement(); if (!element) { NS_WARNING("Null element in MediaResource::SetLoadInBackground()"); return; diff --git a/dom/media/webm/WebMDecoder.cpp b/dom/media/webm/WebMDecoder.cpp index 5cb943742..cbe9ffdb7 100644 --- a/dom/media/webm/WebMDecoder.cpp +++ b/dom/media/webm/WebMDecoder.cpp @@ -82,6 +82,10 @@ WebMDecoder::CanHandleMediaType(const nsACString& aMIMETypeExcludingCodecs, continue; } + if (IsAACCodecString(codec)) { + continue; + } + // Some unsupported codec. return false; } diff --git a/dom/media/webm/WebMDemuxer.cpp b/dom/media/webm/WebMDemuxer.cpp index 2b6d46186..84b4b506e 100644 --- a/dom/media/webm/WebMDemuxer.cpp +++ b/dom/media/webm/WebMDemuxer.cpp @@ -422,6 +422,8 @@ WebMDemuxer::ReadMetadata() mInfo.mAudio.mMimeType = "audio/opus"; OpusDataDecoder::AppendCodecDelay(mInfo.mAudio.mCodecSpecificConfig, media::TimeUnit::FromNanoseconds(params.codec_delay).ToMicroseconds()); + } else if (mAudioCodec == NESTEGG_CODEC_AAC) { + mInfo.mAudio.mMimeType = "audio/mp4a-latm"; } mSeekPreroll = params.seek_preroll; mInfo.mAudio.mRate = params.rate; diff --git a/dom/network/UDPSocketChild.cpp b/dom/network/UDPSocketChild.cpp index 6e374ce31..d205e7e8a 100644 --- a/dom/network/UDPSocketChild.cpp +++ b/dom/network/UDPSocketChild.cpp @@ -172,19 +172,28 @@ UDPSocketChild::Bind(nsIUDPSocketInternal* aSocket, NS_ENSURE_ARG(aSocket); - mSocket = aSocket; - AddIPDLReference(); + if (NS_IsMainThread()) { + if (!gNeckoChild->SendPUDPSocketConstructor( + this, IPC::Principal(aPrincipal), mFilterName)) { + return NS_ERROR_FAILURE; + } + } else { + if (!mBackgroundManager) { + return NS_ERROR_NOT_AVAILABLE; + } - if (mBackgroundManager) { // If we want to support a passed-in principal here we'd need to // convert it to a PrincipalInfo MOZ_ASSERT(!aPrincipal); - mBackgroundManager->SendPUDPSocketConstructor(this, void_t(), mFilterName); - } else { - gNeckoChild->SendPUDPSocketConstructor(this, IPC::Principal(aPrincipal), - mFilterName); + if (!mBackgroundManager->SendPUDPSocketConstructor( + this, void_t(), mFilterName)) { + return NS_ERROR_FAILURE; + } } + mSocket = aSocket; + AddIPDLReference(); + SendBind(UDPAddressInfo(nsCString(aHost), aPort), aAddressReuse, aLoopback, recvBufferSize, sendBufferSize); return NS_OK; diff --git a/dom/plugins/base/nsPluginStreamListenerPeer.cpp b/dom/plugins/base/nsPluginStreamListenerPeer.cpp index 665e11ec1..0476315d5 100644 --- a/dom/plugins/base/nsPluginStreamListenerPeer.cpp +++ b/dom/plugins/base/nsPluginStreamListenerPeer.cpp @@ -1381,7 +1381,7 @@ nsPluginStreamListenerPeer::AsyncOnChannelRedirect(nsIChannel *oldChannel, nsICh return NS_ERROR_FAILURE; } - // Don't allow cross-origin 307 POST redirects. + // Don't allow cross-origin 307/308 POST redirects. nsCOMPtr<nsIHttpChannel> oldHttpChannel(do_QueryInterface(oldChannel)); if (oldHttpChannel) { uint32_t responseStatus; @@ -1389,7 +1389,7 @@ nsPluginStreamListenerPeer::AsyncOnChannelRedirect(nsIChannel *oldChannel, nsICh if (NS_FAILED(rv)) { return rv; } - if (responseStatus == 307) { + if (responseStatus == 307 || responseStatus == 308) { nsAutoCString method; rv = oldHttpChannel->GetRequestMethod(method); if (NS_FAILED(rv)) { diff --git a/dom/workers/RuntimeService.cpp b/dom/workers/RuntimeService.cpp index 21f6d8ddf..19c4ded2a 100644 --- a/dom/workers/RuntimeService.cpp +++ b/dom/workers/RuntimeService.cpp @@ -988,7 +988,7 @@ Wrap(JSContext *cx, JS::HandleObject existing, JS::HandleObject obj) } if (existing) { - js::Wrapper::Renew(cx, existing, obj, wrapper); + js::Wrapper::Renew(existing, obj, wrapper); } return js::Wrapper::New(cx, obj, wrapper); } diff --git a/dom/workers/WorkerPrivate.cpp b/dom/workers/WorkerPrivate.cpp index 6bc5c4f96..27eb570e9 100644 --- a/dom/workers/WorkerPrivate.cpp +++ b/dom/workers/WorkerPrivate.cpp @@ -87,6 +87,7 @@ #include "nsProxyRelease.h" #include "nsQueryObject.h" #include "nsSandboxFlags.h" +#include "nsScriptError.h" #include "nsUTF8Utils.h" #include "prthread.h" #include "xpcpublic.h" @@ -281,27 +282,34 @@ struct WindowAction }; void -LogErrorToConsole(const nsAString& aMessage, - const nsAString& aFilename, - const nsAString& aLine, - uint32_t aLineNumber, - uint32_t aColumnNumber, - uint32_t aFlags, - uint64_t aInnerWindowId) +LogErrorToConsole(const WorkerErrorReport& aReport, uint64_t aInnerWindowId) { AssertIsOnMainThread(); - nsCOMPtr<nsIScriptError> scriptError = - do_CreateInstance(NS_SCRIPTERROR_CONTRACTID); + RefPtr<nsScriptErrorBase> scriptError = new nsScriptError(); NS_WARNING_ASSERTION(scriptError, "Failed to create script error!"); if (scriptError) { - if (NS_FAILED(scriptError->InitWithWindowID(aMessage, aFilename, aLine, - aLineNumber, aColumnNumber, - aFlags, "Web Worker", + nsAutoCString category("Web Worker"); + if (NS_FAILED(scriptError->InitWithWindowID(aReport.mMessage, + aReport.mFilename, + aReport.mLine, + aReport.mLineNumber, + aReport.mColumnNumber, + aReport.mFlags, + category, aInnerWindowId))) { NS_WARNING("Failed to init script error!"); scriptError = nullptr; + + for (size_t i = 0, len = aReport.mNotes.Length(); i < len; i++) { + const WorkerErrorNote& note = aReport.mNotes.ElementAt(i); + + nsScriptErrorNote* noteObject = new nsScriptErrorNote(); + noteObject->Init(note.mMessage, note.mFilename, + note.mLineNumber, note.mColumnNumber); + scriptError->AddNote(noteObject); + } } } @@ -316,23 +324,23 @@ LogErrorToConsole(const nsAString& aMessage, } NS_WARNING("LogMessage failed!"); } else if (NS_SUCCEEDED(consoleService->LogStringMessage( - aMessage.BeginReading()))) { + aReport.mMessage.BeginReading()))) { return; } NS_WARNING("LogStringMessage failed!"); } - NS_ConvertUTF16toUTF8 msg(aMessage); - NS_ConvertUTF16toUTF8 filename(aFilename); + NS_ConvertUTF16toUTF8 msg(aReport.mMessage); + NS_ConvertUTF16toUTF8 filename(aReport.mFilename); static const char kErrorString[] = "JS error in Web Worker: %s [%s:%u]"; #ifdef ANDROID __android_log_print(ANDROID_LOG_INFO, "Gecko", kErrorString, msg.get(), - filename.get(), aLineNumber); + filename.get(), aReport.mLineNumber); #endif - fprintf(stderr, kErrorString, msg.get(), filename.get(), aLineNumber); + fprintf(stderr, kErrorString, msg.get(), filename.get(), aReport.mLineNumber); fflush(stderr); } @@ -536,10 +544,7 @@ private: } if (aWorkerPrivate->IsSharedWorker()) { - aWorkerPrivate->BroadcastErrorToSharedWorkers(aCx, EmptyString(), - EmptyString(), - EmptyString(), 0, 0, - JSREPORT_ERROR, + aWorkerPrivate->BroadcastErrorToSharedWorkers(aCx, nullptr, /* isErrorEvent */ false); return true; } @@ -1060,15 +1065,7 @@ private: class ReportErrorRunnable final : public WorkerRunnable { - nsString mMessage; - nsString mFilename; - nsString mLine; - uint32_t mLineNumber; - uint32_t mColumnNumber; - uint32_t mFlags; - uint32_t mErrorNumber; - JSExnType mExnType; - bool mMutedError; + WorkerErrorReport mReport; public: // aWorkerPrivate is the worker thread we're on (or the main thread, if null) @@ -1077,11 +1074,7 @@ public: static void ReportError(JSContext* aCx, WorkerPrivate* aWorkerPrivate, bool aFireAtScope, WorkerPrivate* aTarget, - const nsString& aMessage, const nsString& aFilename, - const nsString& aLine, uint32_t aLineNumber, - uint32_t aColumnNumber, uint32_t aFlags, - uint32_t aErrorNumber, JSExnType aExnType, - bool aMutedError, uint64_t aInnerWindowId, + const WorkerErrorReport& aReport, uint64_t aInnerWindowId, JS::Handle<JS::Value> aException = JS::NullHandleValue) { if (aWorkerPrivate) { @@ -1092,16 +1085,16 @@ public: // We should not fire error events for warnings but instead make sure that // they show up in the error console. - if (!JSREPORT_IS_WARNING(aFlags)) { + if (!JSREPORT_IS_WARNING(aReport.mFlags)) { // First fire an ErrorEvent at the worker. RootedDictionary<ErrorEventInit> init(aCx); - if (aMutedError) { + if (aReport.mMutedError) { init.mMessage.AssignLiteral("Script error."); } else { - init.mMessage = aMessage; - init.mFilename = aFilename; - init.mLineno = aLineNumber; + init.mMessage = aReport.mMessage; + init.mFilename = aReport.mFilename; + init.mLineno = aReport.mLineNumber; init.mError = aException; } @@ -1128,7 +1121,8 @@ public: // into an error event on our parent worker! // https://bugzilla.mozilla.org/show_bug.cgi?id=1271441 tracks making this // better. - if (aFireAtScope && (aTarget || aErrorNumber != JSMSG_OVER_RECURSED)) { + if (aFireAtScope && + (aTarget || aReport.mErrorNumber != JSMSG_OVER_RECURSED)) { JS::Rooted<JSObject*> global(aCx, JS::CurrentGlobalOrNull(aCx)); NS_ASSERTION(global, "This should never be null!"); @@ -1145,8 +1139,8 @@ public: MOZ_ASSERT_IF(globalScope, globalScope->GetWrapperPreserveColor() == global); if (globalScope || IsDebuggerSandbox(global)) { - aWorkerPrivate->ReportErrorToDebugger(aFilename, aLineNumber, - aMessage); + aWorkerPrivate->ReportErrorToDebugger(aReport.mFilename, aReport.mLineNumber, + aReport.mMessage); return; } @@ -1193,28 +1187,20 @@ public: // Now fire a runnable to do the same on the parent's thread if we can. if (aWorkerPrivate) { RefPtr<ReportErrorRunnable> runnable = - new ReportErrorRunnable(aWorkerPrivate, aMessage, aFilename, aLine, - aLineNumber, aColumnNumber, aFlags, - aErrorNumber, aExnType, aMutedError); + new ReportErrorRunnable(aWorkerPrivate, aReport); runnable->Dispatch(); return; } // Otherwise log an error to the error console. - LogErrorToConsole(aMessage, aFilename, aLine, aLineNumber, aColumnNumber, - aFlags, aInnerWindowId); + LogErrorToConsole(aReport, aInnerWindowId); } private: - ReportErrorRunnable(WorkerPrivate* aWorkerPrivate, const nsString& aMessage, - const nsString& aFilename, const nsString& aLine, - uint32_t aLineNumber, uint32_t aColumnNumber, - uint32_t aFlags, uint32_t aErrorNumber, - JSExnType aExnType, bool aMutedError) + ReportErrorRunnable(WorkerPrivate* aWorkerPrivate, + const WorkerErrorReport& aReport) : WorkerRunnable(aWorkerPrivate, ParentThreadUnchangedBusyCount), - mMessage(aMessage), mFilename(aFilename), mLine(aLine), - mLineNumber(aLineNumber), mColumnNumber(aColumnNumber), mFlags(aFlags), - mErrorNumber(aErrorNumber), mExnType(aExnType), mMutedError(aMutedError) + mReport(aReport) { } virtual void @@ -1251,9 +1237,7 @@ private: } if (aWorkerPrivate->IsSharedWorker()) { - aWorkerPrivate->BroadcastErrorToSharedWorkers(aCx, mMessage, mFilename, - mLine, mLineNumber, - mColumnNumber, mFlags, + aWorkerPrivate->BroadcastErrorToSharedWorkers(aCx, &mReport, /* isErrorEvent */ true); return true; } @@ -1267,9 +1251,10 @@ private: swm->HandleError(aCx, aWorkerPrivate->GetPrincipal(), aWorkerPrivate->WorkerName(), aWorkerPrivate->ScriptURL(), - mMessage, - mFilename, mLine, mLineNumber, - mColumnNumber, mFlags, mExnType); + mReport.mMessage, + mReport.mFilename, mReport.mLine, mReport.mLineNumber, + mReport.mColumnNumber, mReport.mFlags, + mReport.mExnType); } return true; } @@ -1289,9 +1274,8 @@ private: return true; } - ReportError(aCx, parent, fireAtScope, aWorkerPrivate, mMessage, - mFilename, mLine, mLineNumber, mColumnNumber, mFlags, - mErrorNumber, mExnType, mMutedError, innerWindowId); + ReportError(aCx, parent, fireAtScope, aWorkerPrivate, mReport, + innerWindowId); return true; } }; @@ -3314,21 +3298,16 @@ template <class Derived> void WorkerPrivateParent<Derived>::BroadcastErrorToSharedWorkers( JSContext* aCx, - const nsAString& aMessage, - const nsAString& aFilename, - const nsAString& aLine, - uint32_t aLineNumber, - uint32_t aColumnNumber, - uint32_t aFlags, + const WorkerErrorReport* aReport, bool aIsErrorEvent) { AssertIsOnMainThread(); - if (JSREPORT_IS_WARNING(aFlags)) { + if (aIsErrorEvent && JSREPORT_IS_WARNING(aReport->mFlags)) { // Don't fire any events anywhere. Just log to console. // XXXbz should we log to all the consoles of all the relevant windows? - LogErrorToConsole(aMessage, aFilename, aLine, aLineNumber, aColumnNumber, - aFlags, 0); + MOZ_ASSERT(aReport); + LogErrorToConsole(*aReport, 0); return; } @@ -3357,10 +3336,10 @@ WorkerPrivateParent<Derived>::BroadcastErrorToSharedWorkers( RootedDictionary<ErrorEventInit> errorInit(aCx); errorInit.mBubbles = false; errorInit.mCancelable = true; - errorInit.mMessage = aMessage; - errorInit.mFilename = aFilename; - errorInit.mLineno = aLineNumber; - errorInit.mColno = aColumnNumber; + errorInit.mMessage = aReport->mMessage; + errorInit.mFilename = aReport->mFilename; + errorInit.mLineno = aReport->mLineNumber; + errorInit.mColno = aReport->mColumnNumber; event = ErrorEvent::Constructor(sharedWorker, NS_LITERAL_STRING("error"), errorInit); @@ -3426,9 +3405,9 @@ WorkerPrivateParent<Derived>::BroadcastErrorToSharedWorkers( MOZ_ASSERT(NS_IsMainThread()); RootedDictionary<ErrorEventInit> init(aCx); - init.mLineno = aLineNumber; - init.mFilename = aFilename; - init.mMessage = aMessage; + init.mLineno = aReport->mLineNumber; + init.mFilename = aReport->mFilename; + init.mMessage = aReport->mMessage; init.mCancelable = true; init.mBubbles = true; @@ -3446,8 +3425,8 @@ WorkerPrivateParent<Derived>::BroadcastErrorToSharedWorkers( // Finally log a warning in the console if no window tried to prevent it. if (shouldLogErrorToConsole) { - LogErrorToConsole(aMessage, aFilename, aLine, aLineNumber, aColumnNumber, - aFlags, 0); + MOZ_ASSERT(aReport); + LogErrorToConsole(*aReport, 0); } } @@ -4120,7 +4099,10 @@ WorkerDebugger::ReportErrorToDebuggerOnMainThread(const nsAString& aFilename, listeners[index]->OnError(aFilename, aLineno, aMessage); } - LogErrorToConsole(aMessage, aFilename, nsString(), aLineno, 0, 0, 0); + WorkerErrorReport report; + report.mMessage = aMessage; + report.mFilename = aFilename; + LogErrorToConsole(report, 0); } WorkerPrivate::WorkerPrivate(WorkerPrivate* aParent, @@ -5926,6 +5908,47 @@ WorkerPrivate::NotifyInternal(JSContext* aCx, Status aStatus) } void +WorkerErrorBase::AssignErrorBase(JSErrorBase* aReport) +{ + mFilename = NS_ConvertUTF8toUTF16(aReport->filename); + mLineNumber = aReport->lineno; + mColumnNumber = aReport->column; + mErrorNumber = aReport->errorNumber; +} + +void +WorkerErrorNote::AssignErrorNote(JSErrorNotes::Note* aNote) +{ + WorkerErrorBase::AssignErrorBase(aNote); + xpc::ErrorNote::ErrorNoteToMessageString(aNote, mMessage); +} + +void +WorkerErrorReport::AssignErrorReport(JSErrorReport* aReport) +{ + WorkerErrorBase::AssignErrorBase(aReport); + xpc::ErrorReport::ErrorReportToMessageString(aReport, mMessage); + + mLine.Assign(aReport->linebuf(), aReport->linebufLength()); + mFlags = aReport->flags; + MOZ_ASSERT(aReport->exnType >= JSEXN_FIRST && aReport->exnType < JSEXN_LIMIT); + mExnType = JSExnType(aReport->exnType); + mMutedError = aReport->isMuted; + + if (aReport->notes) { + if (!mNotes.SetLength(aReport->notes->length(), fallible)) { + return; + } + + size_t i = 0; + for (auto&& note : *aReport->notes) { + mNotes.ElementAt(i).AssignErrorNote(note.get()); + i++; + } + } +} + +void WorkerPrivate::ReportError(JSContext* aCx, JS::ConstUTF8CharsZ aToStringResult, JSErrorReport* aReport) { @@ -5947,32 +5970,17 @@ WorkerPrivate::ReportError(JSContext* aCx, JS::ConstUTF8CharsZ aToStringResult, } JS_ClearPendingException(aCx); - nsString message, filename, line; - uint32_t lineNumber, columnNumber, flags, errorNumber; - JSExnType exnType = JSEXN_ERR; - bool mutedError = aReport && aReport->isMuted; - + WorkerErrorReport report; if (aReport) { - // We want the same behavior here as xpc::ErrorReport::init here. - xpc::ErrorReport::ErrorReportToMessageString(aReport, message); - - filename = NS_ConvertUTF8toUTF16(aReport->filename); - line.Assign(aReport->linebuf(), aReport->linebufLength()); - lineNumber = aReport->lineno; - columnNumber = aReport->tokenOffset(); - flags = aReport->flags; - errorNumber = aReport->errorNumber; - MOZ_ASSERT(aReport->exnType >= JSEXN_FIRST && aReport->exnType < JSEXN_LIMIT); - exnType = JSExnType(aReport->exnType); + report.AssignErrorReport(aReport); } else { - lineNumber = columnNumber = errorNumber = 0; - flags = nsIScriptError::errorFlag | nsIScriptError::exceptionFlag; + report.mFlags = nsIScriptError::errorFlag | nsIScriptError::exceptionFlag; } - if (message.IsEmpty() && aToStringResult) { + if (report.mMessage.IsEmpty() && aToStringResult) { nsDependentCString toStringResult(aToStringResult.c_str()); - if (!AppendUTF8toUTF16(toStringResult, message, mozilla::fallible)) { + if (!AppendUTF8toUTF16(toStringResult, report.mMessage, mozilla::fallible)) { // Try again, with only a 1 KB string. Do this infallibly this time. // If the user doesn't have 1 KB to spare we're done anyways. uint32_t index = std::min(uint32_t(1024), toStringResult.Length()); @@ -5982,7 +5990,7 @@ WorkerPrivate::ReportError(JSContext* aCx, JS::ConstUTF8CharsZ aToStringResult, nsDependentCString truncatedToStringResult(aToStringResult.c_str(), index); - AppendUTF8toUTF16(truncatedToStringResult, message); + AppendUTF8toUTF16(truncatedToStringResult, report.mMessage); } } @@ -5991,13 +5999,11 @@ WorkerPrivate::ReportError(JSContext* aCx, JS::ConstUTF8CharsZ aToStringResult, // Don't want to run the scope's error handler if this is a recursive error or // if we ran out of memory. bool fireAtScope = mErrorHandlerRecursionCount == 1 && - errorNumber != JSMSG_OUT_OF_MEMORY && + report.mErrorNumber != JSMSG_OUT_OF_MEMORY && JS::CurrentGlobalOrNull(aCx); - ReportErrorRunnable::ReportError(aCx, this, fireAtScope, nullptr, message, - filename, line, lineNumber, - columnNumber, flags, errorNumber, exnType, - mutedError, 0, exn); + ReportErrorRunnable::ReportError(aCx, this, fireAtScope, nullptr, report, 0, + exn); mErrorHandlerRecursionCount--; } diff --git a/dom/workers/WorkerPrivate.h b/dom/workers/WorkerPrivate.h index 20a530205..885abccd5 100644 --- a/dom/workers/WorkerPrivate.h +++ b/dom/workers/WorkerPrivate.h @@ -140,6 +140,45 @@ public: } }; +class WorkerErrorBase { +public: + nsString mMessage; + nsString mFilename; + uint32_t mLineNumber; + uint32_t mColumnNumber; + uint32_t mErrorNumber; + + WorkerErrorBase() + : mLineNumber(0), + mColumnNumber(0), + mErrorNumber(0) + { } + + void AssignErrorBase(JSErrorBase* aReport); +}; + +class WorkerErrorNote : public WorkerErrorBase { +public: + void AssignErrorNote(JSErrorNotes::Note* aNote); +}; + +class WorkerErrorReport : public WorkerErrorBase { +public: + nsString mLine; + uint32_t mFlags; + JSExnType mExnType; + bool mMutedError; + nsTArray<WorkerErrorNote> mNotes; + + WorkerErrorReport() + : mFlags(0), + mExnType(JSEXN_ERR), + mMutedError(false) + { } + + void AssignErrorReport(JSErrorReport* aReport); +}; + template <class Derived> class WorkerPrivateParent : public DOMEventTargetHelper { @@ -401,12 +440,7 @@ public: void BroadcastErrorToSharedWorkers(JSContext* aCx, - const nsAString& aMessage, - const nsAString& aFilename, - const nsAString& aLine, - uint32_t aLineNumber, - uint32_t aColumnNumber, - uint32_t aFlags, + const WorkerErrorReport* aReport, bool aIsErrorEvent); void diff --git a/dom/workers/moz.build b/dom/workers/moz.build index 4f4b52e4a..9fea84193 100644 --- a/dom/workers/moz.build +++ b/dom/workers/moz.build @@ -94,6 +94,7 @@ LOCAL_INCLUDES += [ '../base', '../system', '/dom/base', + '/dom/bindings', '/xpcom/build', '/xpcom/threads', ] diff --git a/dom/workers/test/test_sharedWorker.html b/dom/workers/test/test_sharedWorker.html index 3d3d4e2c6..c00c4e586 100644 --- a/dom/workers/test/test_sharedWorker.html +++ b/dom/workers/test/test_sharedWorker.html @@ -23,7 +23,7 @@ const errorFilename = href.substring(0, href.lastIndexOf("/") + 1) + filename; const errorLine = 91; - const errorColumn = 0; + const errorColumn = 11; var worker = new SharedWorker(filename); diff --git a/js/ipc/JavaScriptParent.cpp b/js/ipc/JavaScriptParent.cpp index 6cf9e0591..aafd7f565 100644 --- a/js/ipc/JavaScriptParent.cpp +++ b/js/ipc/JavaScriptParent.cpp @@ -9,6 +9,7 @@ #include "mozilla/dom/ContentParent.h" #include "mozilla/dom/ScriptSettings.h" #include "nsJSUtils.h" +#include "nsIScriptError.h" #include "jsfriendapi.h" #include "jswrapper.h" #include "js/Proxy.h" diff --git a/js/public/CallArgs.h b/js/public/CallArgs.h index a7774309a..aae7121ad 100644 --- a/js/public/CallArgs.h +++ b/js/public/CallArgs.h @@ -128,7 +128,10 @@ class MOZ_STACK_CLASS CallArgsBase : public WantUsedRval protected: Value* argv_; unsigned argc_; - bool constructing_; + bool constructing_:1; + + // True if the caller does not use the return value. + bool ignoresReturnValue_:1; public: // CALLEE ACCESS @@ -164,6 +167,10 @@ class MOZ_STACK_CLASS CallArgsBase : public WantUsedRval return true; } + bool ignoresReturnValue() const { + return ignoresReturnValue_; + } + MutableHandleValue newTarget() const { MOZ_ASSERT(constructing_); return MutableHandleValue::fromMarkedLocation(&this->argv_[argc_]); @@ -280,14 +287,17 @@ class MOZ_STACK_CLASS CallArgs : public detail::CallArgsBase<detail::IncludeUsed { private: friend CallArgs CallArgsFromVp(unsigned argc, Value* vp); - friend CallArgs CallArgsFromSp(unsigned stackSlots, Value* sp, bool constructing); + friend CallArgs CallArgsFromSp(unsigned stackSlots, Value* sp, bool constructing, + bool ignoresReturnValue); - static CallArgs create(unsigned argc, Value* argv, bool constructing) { + static CallArgs create(unsigned argc, Value* argv, bool constructing, + bool ignoresReturnValue = false) { CallArgs args; args.clearUsedRval(); args.argv_ = argv; args.argc_ = argc; args.constructing_ = constructing; + args.ignoresReturnValue_ = ignoresReturnValue; #ifdef DEBUG for (unsigned i = 0; i < argc; ++i) MOZ_ASSERT_IF(argv[i].isGCThing(), !GCThingIsMarkedGray(GCCellPtr(argv[i]))); @@ -314,9 +324,11 @@ CallArgsFromVp(unsigned argc, Value* vp) // eventually move it to an internal header. Embedders should use // JS::CallArgsFromVp! MOZ_ALWAYS_INLINE CallArgs -CallArgsFromSp(unsigned stackSlots, Value* sp, bool constructing = false) +CallArgsFromSp(unsigned stackSlots, Value* sp, bool constructing = false, + bool ignoresReturnValue = false) { - return CallArgs::create(stackSlots - constructing, sp - stackSlots, constructing); + return CallArgs::create(stackSlots - constructing, sp - stackSlots, constructing, + ignoresReturnValue); } } // namespace JS diff --git a/js/src/builtin/AtomicsObject.cpp b/js/src/builtin/AtomicsObject.cpp index 3de3f5f4c..ceee83349 100644 --- a/js/src/builtin/AtomicsObject.cpp +++ b/js/src/builtin/AtomicsObject.cpp @@ -1117,7 +1117,7 @@ JSObject* AtomicsObject::initClass(JSContext* cx, Handle<GlobalObject*> global) { // Create Atomics Object. - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!objProto) return nullptr; RootedObject Atomics(cx, NewObjectWithGivenProto(cx, &AtomicsObject::class_, objProto, diff --git a/js/src/builtin/Intl.cpp b/js/src/builtin/Intl.cpp index 71f7b58d4..0cd0c62dd 100644 --- a/js/src/builtin/Intl.cpp +++ b/js/src/builtin/Intl.cpp @@ -270,7 +270,7 @@ Collator(JSContext* cx, const CallArgs& args, bool construct) // See https://github.com/tc39/ecma402/issues/57 if (!construct) { // ES Intl 1st ed., 10.1.2.1 step 3 - JSObject* intl = cx->global()->getOrCreateIntlObject(cx); + JSObject* intl = GlobalObject::getOrCreateIntlObject(cx, cx->global()); if (!intl) return false; RootedValue self(cx, args.thisv()); @@ -298,7 +298,7 @@ Collator(JSContext* cx, const CallArgs& args, bool construct) return false; if (!proto) { - proto = cx->global()->getOrCreateCollatorPrototype(cx); + proto = GlobalObject::getOrCreateCollatorPrototype(cx, cx->global()); if (!proto) return false; } @@ -358,11 +358,12 @@ collator_finalize(FreeOp* fop, JSObject* obj) static JSObject* CreateCollatorPrototype(JSContext* cx, HandleObject Intl, Handle<GlobalObject*> global) { - RootedFunction ctor(cx, global->createConstructor(cx, &Collator, cx->names().Collator, 0)); + RootedFunction ctor(cx, GlobalObject::createConstructor(cx, &Collator, cx->names().Collator, + 0)); if (!ctor) return nullptr; - RootedNativeObject proto(cx, global->createBlankPrototype(cx, &CollatorClass)); + RootedNativeObject proto(cx, GlobalObject::createBlankPrototype(cx, global, &CollatorClass)); if (!proto) return nullptr; proto->setReservedSlot(UCOLLATOR_SLOT, PrivateValue(nullptr)); @@ -772,7 +773,7 @@ NumberFormat(JSContext* cx, const CallArgs& args, bool construct) // See https://github.com/tc39/ecma402/issues/57 if (!construct) { // ES Intl 1st ed., 11.1.2.1 step 3 - JSObject* intl = cx->global()->getOrCreateIntlObject(cx); + JSObject* intl = GlobalObject::getOrCreateIntlObject(cx, cx->global()); if (!intl) return false; RootedValue self(cx, args.thisv()); @@ -800,7 +801,7 @@ NumberFormat(JSContext* cx, const CallArgs& args, bool construct) return false; if (!proto) { - proto = cx->global()->getOrCreateNumberFormatPrototype(cx); + proto = GlobalObject::getOrCreateNumberFormatPrototype(cx, cx->global()); if (!proto) return false; } @@ -862,11 +863,12 @@ static JSObject* CreateNumberFormatPrototype(JSContext* cx, HandleObject Intl, Handle<GlobalObject*> global) { RootedFunction ctor(cx); - ctor = global->createConstructor(cx, &NumberFormat, cx->names().NumberFormat, 0); + ctor = GlobalObject::createConstructor(cx, &NumberFormat, cx->names().NumberFormat, 0); if (!ctor) return nullptr; - RootedNativeObject proto(cx, global->createBlankPrototype(cx, &NumberFormatClass)); + RootedNativeObject proto(cx, GlobalObject::createBlankPrototype(cx, global, + &NumberFormatClass)); if (!proto) return nullptr; proto->setReservedSlot(UNUMBER_FORMAT_SLOT, PrivateValue(nullptr)); @@ -1250,7 +1252,7 @@ DateTimeFormat(JSContext* cx, const CallArgs& args, bool construct) // See https://github.com/tc39/ecma402/issues/57 if (!construct) { // ES Intl 1st ed., 12.1.2.1 step 3 - JSObject* intl = cx->global()->getOrCreateIntlObject(cx); + JSObject* intl = GlobalObject::getOrCreateIntlObject(cx, cx->global()); if (!intl) return false; RootedValue self(cx, args.thisv()); @@ -1278,7 +1280,7 @@ DateTimeFormat(JSContext* cx, const CallArgs& args, bool construct) return false; if (!proto) { - proto = cx->global()->getOrCreateDateTimeFormatPrototype(cx); + proto = GlobalObject::getOrCreateDateTimeFormatPrototype(cx, cx->global()); if (!proto) return false; } @@ -1340,11 +1342,12 @@ static JSObject* CreateDateTimeFormatPrototype(JSContext* cx, HandleObject Intl, Handle<GlobalObject*> global) { RootedFunction ctor(cx); - ctor = global->createConstructor(cx, &DateTimeFormat, cx->names().DateTimeFormat, 0); + ctor = GlobalObject::createConstructor(cx, &DateTimeFormat, cx->names().DateTimeFormat, 0); if (!ctor) return nullptr; - RootedNativeObject proto(cx, global->createBlankPrototype(cx, &DateTimeFormatClass)); + RootedNativeObject proto(cx, GlobalObject::createBlankPrototype(cx, global, + &DateTimeFormatClass)); if (!proto) return nullptr; proto->setReservedSlot(UDATE_FORMAT_SLOT, PrivateValue(nullptr)); @@ -2731,10 +2734,10 @@ static const JSFunctionSpec intl_static_methods[] = { * Initializes the Intl Object and its standard built-in properties. * Spec: ECMAScript Internationalization API Specification, 8.0, 8.1 */ -bool +/* static */ bool GlobalObject::initIntlObject(JSContext* cx, Handle<GlobalObject*> global) { - RootedObject proto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!proto) return false; diff --git a/js/src/builtin/MapObject.cpp b/js/src/builtin/MapObject.cpp index c496cfb77..34e2e566d 100644 --- a/js/src/builtin/MapObject.cpp +++ b/js/src/builtin/MapObject.cpp @@ -164,7 +164,7 @@ MapIteratorObject::kind() const return MapObject::IteratorKind(i); } -bool +/* static */ bool GlobalObject::initMapIteratorProto(JSContext* cx, Handle<GlobalObject*> global) { Rooted<JSObject*> base(cx, GlobalObject::getOrCreateIteratorPrototype(cx, global)); @@ -924,7 +924,7 @@ SetIteratorObject::kind() const return SetObject::IteratorKind(i); } -bool +/* static */ bool GlobalObject::initSetIteratorProto(JSContext* cx, Handle<GlobalObject*> global) { Rooted<JSObject*> base(cx, GlobalObject::getOrCreateIteratorPrototype(cx, global)); diff --git a/js/src/builtin/ModuleObject.cpp b/js/src/builtin/ModuleObject.cpp index c6bd2d300..798ef46e1 100644 --- a/js/src/builtin/ModuleObject.cpp +++ b/js/src/builtin/ModuleObject.cpp @@ -103,7 +103,7 @@ GlobalObject::initImportEntryProto(JSContext* cx, Handle<GlobalObject*> global) JS_PS_END }; - RootedObject proto(cx, global->createBlankPrototype<PlainObject>(cx)); + RootedObject proto(cx, GlobalObject::createBlankPrototype<PlainObject>(cx, global)); if (!proto) return false; @@ -169,7 +169,7 @@ GlobalObject::initExportEntryProto(JSContext* cx, Handle<GlobalObject*> global) JS_PS_END }; - RootedObject proto(cx, global->createBlankPrototype<PlainObject>(cx)); + RootedObject proto(cx, GlobalObject::createBlankPrototype<PlainObject>(cx, global)); if (!proto) return false; @@ -788,7 +788,7 @@ AssertModuleScopesMatch(ModuleObject* module) } void -ModuleObject::fixEnvironmentsAfterCompartmentMerge(JSContext* cx) +ModuleObject::fixEnvironmentsAfterCompartmentMerge() { AssertModuleScopesMatch(this); initialEnvironment().fixEnclosingEnvironmentAfterCompartmentMerge(script()->global()); @@ -1020,7 +1020,7 @@ GlobalObject::initModuleProto(JSContext* cx, Handle<GlobalObject*> global) JS_FS_END }; - RootedObject proto(cx, global->createBlankPrototype<PlainObject>(cx)); + RootedObject proto(cx, GlobalObject::createBlankPrototype<PlainObject>(cx, global)); if (!proto) return false; diff --git a/js/src/builtin/ModuleObject.h b/js/src/builtin/ModuleObject.h index d0ed8ed08..e83520ebe 100644 --- a/js/src/builtin/ModuleObject.h +++ b/js/src/builtin/ModuleObject.h @@ -244,7 +244,7 @@ class ModuleObject : public NativeObject #ifdef DEBUG static bool IsFrozen(JSContext* cx, HandleModuleObject self); #endif - void fixEnvironmentsAfterCompartmentMerge(JSContext* cx); + void fixEnvironmentsAfterCompartmentMerge(); JSScript* script() const; Scope* enclosingScope() const; diff --git a/js/src/builtin/Object.cpp b/js/src/builtin/Object.cpp index 389bb57db..56c77f304 100644 --- a/js/src/builtin/Object.cpp +++ b/js/src/builtin/Object.cpp @@ -525,18 +525,6 @@ js::obj_toString(JSContext* cx, unsigned argc, Value* vp) return true; } - -bool -js::obj_valueOf(JSContext* cx, unsigned argc, Value* vp) -{ - CallArgs args = CallArgsFromVp(argc, vp); - RootedObject obj(cx, ToObject(cx, args.thisv())); - if (!obj) - return false; - args.rval().setObject(*obj); - return true; -} - static bool obj_setPrototypeOf(JSContext* cx, unsigned argc, Value* vp) { @@ -1301,7 +1289,7 @@ static const JSFunctionSpec object_methods[] = { #endif JS_FN(js_toString_str, obj_toString, 0,0), JS_SELF_HOSTED_FN(js_toLocaleString_str, "Object_toLocaleString", 0, 0), - JS_FN(js_valueOf_str, obj_valueOf, 0,0), + JS_SELF_HOSTED_FN(js_valueOf_str, "Object_valueOf", 0,0), #if JS_HAS_OBJ_WATCHPOINT JS_FN(js_watch_str, obj_watch, 2,0), JS_FN(js_unwatch_str, obj_unwatch, 1,0), @@ -1420,8 +1408,8 @@ FinishObjectClassInit(JSContext* cx, JS::HandleObject ctor, JS::HandleObject pro * only set the [[Prototype]] if it hasn't already been set. */ Rooted<TaggedProto> tagged(cx, TaggedProto(proto)); - if (global->shouldSplicePrototype(cx)) { - if (!global->splicePrototype(cx, global->getClass(), tagged)) + if (global->shouldSplicePrototype()) { + if (!JSObject::splicePrototype(cx, global, global->getClass(), tagged)) return false; } return true; diff --git a/js/src/builtin/Object.h b/js/src/builtin/Object.h index 09512be36..8231888b1 100644 --- a/js/src/builtin/Object.h +++ b/js/src/builtin/Object.h @@ -25,9 +25,6 @@ obj_construct(JSContext* cx, unsigned argc, JS::Value* vp); MOZ_MUST_USE bool obj_propertyIsEnumerable(JSContext* cx, unsigned argc, Value* vp); -MOZ_MUST_USE bool -obj_valueOf(JSContext* cx, unsigned argc, JS::Value* vp); - PlainObject* ObjectCreateImpl(JSContext* cx, HandleObject proto, NewObjectKind newKind = GenericObject, HandleObjectGroup group = nullptr); diff --git a/js/src/builtin/Object.js b/js/src/builtin/Object.js index a7440aec7..9ed1be0e1 100644 --- a/js/src/builtin/Object.js +++ b/js/src/builtin/Object.js @@ -87,6 +87,12 @@ function Object_toLocaleString() { return callContentFunction(O.toString, O); } +// ES 2017 draft bb96899bb0d9ef9be08164a26efae2ee5f25e875 19.1.3.7 +function Object_valueOf() { + // Step 1. + return ToObject(this); +} + // ES7 draft (2016 March 8) B.2.2.3 function ObjectDefineSetter(name, setter) { // Step 1. diff --git a/js/src/builtin/Promise.cpp b/js/src/builtin/Promise.cpp index c781a336d..ec7845e89 100644 --- a/js/src/builtin/Promise.cpp +++ b/js/src/builtin/Promise.cpp @@ -603,7 +603,7 @@ ResolvePromise(JSContext* cx, Handle<PromiseObject*> promise, HandleValue valueO // Now that everything else is done, do the things the debugger needs. // Step 7 of RejectPromise implemented in onSettled. - promise->onSettled(cx); + PromiseObject::onSettled(cx, promise); // Step 7 of FulfillPromise. // Step 8 of RejectPromise. @@ -1947,26 +1947,23 @@ PerformPromiseRace(JSContext *cx, JS::ForOfIterator& iterator, HandleObject C, } // ES2016, Sub-steps of 25.4.4.4 and 25.4.4.5. -static MOZ_MUST_USE bool -CommonStaticResolveRejectImpl(JSContext* cx, unsigned argc, Value* vp, ResolutionMode mode) +static MOZ_MUST_USE JSObject* +CommonStaticResolveRejectImpl(JSContext* cx, HandleValue thisVal, HandleValue argVal, + ResolutionMode mode) { - CallArgs args = CallArgsFromVp(argc, vp); - RootedValue x(cx, args.get(0)); - // Steps 1-2. - if (!args.thisv().isObject()) { + if (!thisVal.isObject()) { const char* msg = mode == ResolveMode ? "Receiver of Promise.resolve call" : "Receiver of Promise.reject call"; JS_ReportErrorNumberASCII(cx, GetErrorMessage, nullptr, JSMSG_NOT_NONNULL_OBJECT, msg); - return false; + return nullptr; } - RootedValue cVal(cx, args.thisv()); - RootedObject C(cx, &cVal.toObject()); + RootedObject C(cx, &thisVal.toObject()); // Step 3 of Resolve. - if (mode == ResolveMode && x.isObject()) { - RootedObject xObj(cx, &x.toObject()); + if (mode == ResolveMode && argVal.isObject()) { + RootedObject xObj(cx, &argVal.toObject()); bool isPromise = false; if (xObj->is<PromiseObject>()) { isPromise = true; @@ -1985,11 +1982,9 @@ CommonStaticResolveRejectImpl(JSContext* cx, unsigned argc, Value* vp, Resolutio if (isPromise) { RootedValue ctorVal(cx); if (!GetProperty(cx, xObj, xObj, cx->names().constructor, &ctorVal)) - return false; - if (ctorVal == cVal) { - args.rval().set(x); - return true; - } + return nullptr; + if (ctorVal == thisVal) + return xObj; } } @@ -1998,15 +1993,17 @@ CommonStaticResolveRejectImpl(JSContext* cx, unsigned argc, Value* vp, Resolutio RootedObject resolveFun(cx); RootedObject rejectFun(cx); if (!NewPromiseCapability(cx, C, &promise, &resolveFun, &rejectFun, true)) - return false; + return nullptr; // Step 5 of Resolve, 4 of Reject. - if (!RunResolutionFunction(cx, mode == ResolveMode ? resolveFun : rejectFun, x, mode, promise)) - return false; + if (!RunResolutionFunction(cx, mode == ResolveMode ? resolveFun : rejectFun, argVal, mode, + promise)) + { + return nullptr; + } // Step 6 of Resolve, 4 of Reject. - args.rval().setObject(*promise); - return true; + return promise; } /** @@ -2015,7 +2012,14 @@ CommonStaticResolveRejectImpl(JSContext* cx, unsigned argc, Value* vp, Resolutio bool js::Promise_reject(JSContext* cx, unsigned argc, Value* vp) { - return CommonStaticResolveRejectImpl(cx, argc, vp, RejectMode); + CallArgs args = CallArgsFromVp(argc, vp); + RootedValue thisVal(cx, args.thisv()); + RootedValue argVal(cx, args.get(0)); + JSObject* result = CommonStaticResolveRejectImpl(cx, thisVal, argVal, RejectMode); + if (!result) + return false; + args.rval().setObject(*result); + return true; } /** @@ -2024,19 +2028,11 @@ js::Promise_reject(JSContext* cx, unsigned argc, Value* vp) /* static */ JSObject* PromiseObject::unforgeableReject(JSContext* cx, HandleValue value) { - // Steps 1-2 (omitted). - - // Roughly step 3. - Rooted<PromiseObject*> promise(cx, CreatePromiseObjectInternal(cx)); - if (!promise) + RootedObject promiseCtor(cx, JS::GetPromiseConstructor(cx)); + if (!promiseCtor) return nullptr; - - // Roughly step 4. - if (!ResolvePromise(cx, promise, value, JS::PromiseState::Rejected)) - return nullptr; - - // Step 5. - return promise; + RootedValue cVal(cx, ObjectValue(*promiseCtor)); + return CommonStaticResolveRejectImpl(cx, cVal, value, RejectMode); } /** @@ -2045,7 +2041,14 @@ PromiseObject::unforgeableReject(JSContext* cx, HandleValue value) bool js::Promise_static_resolve(JSContext* cx, unsigned argc, Value* vp) { - return CommonStaticResolveRejectImpl(cx, argc, vp, ResolveMode); + CallArgs args = CallArgsFromVp(argc, vp); + RootedValue thisVal(cx, args.thisv()); + RootedValue argVal(cx, args.get(0)); + JSObject* result = CommonStaticResolveRejectImpl(cx, thisVal, argVal, ResolveMode); + if (!result) + return false; + args.rval().setObject(*result); + return true; } /** @@ -2054,30 +2057,11 @@ js::Promise_static_resolve(JSContext* cx, unsigned argc, Value* vp) /* static */ JSObject* PromiseObject::unforgeableResolve(JSContext* cx, HandleValue value) { - // Steps 1-2 (omitted). - - // Step 3. - if (value.isObject()) { - JSObject* obj = &value.toObject(); - if (IsWrapper(obj)) - obj = CheckedUnwrap(obj); - // Instead of getting the `constructor` property, do an unforgeable - // check. - if (obj && obj->is<PromiseObject>()) - return obj; - } - - // Step 4. - Rooted<PromiseObject*> promise(cx, CreatePromiseObjectInternal(cx)); - if (!promise) + RootedObject promiseCtor(cx, JS::GetPromiseConstructor(cx)); + if (!promiseCtor) return nullptr; - - // Steps 5. - if (!ResolvePromiseInternal(cx, promise, value)) - return nullptr; - - // Step 6. - return promise; + RootedValue cVal(cx, ObjectValue(*promiseCtor)); + return CommonStaticResolveRejectImpl(cx, cVal, value, ResolveMode); } // ES2016, 25.4.4.6, implemented in Promise.js. @@ -2647,14 +2631,14 @@ PromiseObject::dependentPromises(JSContext* cx, MutableHandle<GCVector<Value>> v return true; } -bool -PromiseObject::resolve(JSContext* cx, HandleValue resolutionValue) +/* static */ bool +PromiseObject::resolve(JSContext* cx, Handle<PromiseObject*> promise, HandleValue resolutionValue) { - MOZ_ASSERT(!PromiseHasAnyFlag(*this, PROMISE_FLAG_ASYNC)); - if (state() != JS::PromiseState::Pending) + MOZ_ASSERT(!PromiseHasAnyFlag(*promise, PROMISE_FLAG_ASYNC)); + if (promise->state() != JS::PromiseState::Pending) return true; - RootedObject resolveFun(cx, GetResolveFunctionFromPromise(this)); + RootedObject resolveFun(cx, GetResolveFunctionFromPromise(promise)); RootedValue funVal(cx, ObjectValue(*resolveFun)); // For xray'd Promises, the resolve fun may have been created in another @@ -2670,14 +2654,14 @@ PromiseObject::resolve(JSContext* cx, HandleValue resolutionValue) return Call(cx, funVal, UndefinedHandleValue, args, &dummy); } -bool -PromiseObject::reject(JSContext* cx, HandleValue rejectionValue) +/* static */ bool +PromiseObject::reject(JSContext* cx, Handle<PromiseObject*> promise, HandleValue rejectionValue) { - MOZ_ASSERT(!PromiseHasAnyFlag(*this, PROMISE_FLAG_ASYNC)); - if (state() != JS::PromiseState::Pending) + MOZ_ASSERT(!PromiseHasAnyFlag(*promise, PROMISE_FLAG_ASYNC)); + if (promise->state() != JS::PromiseState::Pending) return true; - RootedValue funVal(cx, this->getFixedSlot(PromiseSlot_RejectFunction)); + RootedValue funVal(cx, promise->getFixedSlot(PromiseSlot_RejectFunction)); MOZ_ASSERT(IsCallable(funVal)); FixedInvokeArgs<1> args(cx); @@ -2687,10 +2671,9 @@ PromiseObject::reject(JSContext* cx, HandleValue rejectionValue) return Call(cx, funVal, UndefinedHandleValue, args, &dummy); } -void -PromiseObject::onSettled(JSContext* cx) +/* static */ void +PromiseObject::onSettled(JSContext* cx, Handle<PromiseObject*> promise) { - Rooted<PromiseObject*> promise(cx, this); RootedObject stack(cx); if (cx->options().asyncStack() || cx->compartment()->isDebuggee()) { if (!JS::CaptureCurrentStack(cx, &stack, JS::StackCapture(JS::AllFrames()))) { @@ -2750,7 +2733,7 @@ PromiseTask::executeAndFinish(JSContext* cx) static JSObject* CreatePromisePrototype(JSContext* cx, JSProtoKey key) { - return cx->global()->createBlankPrototype(cx, &PromiseObject::protoClass_); + return GlobalObject::createBlankPrototype(cx, cx->global(), &PromiseObject::protoClass_); } static const JSFunctionSpec promise_methods[] = { diff --git a/js/src/builtin/Promise.h b/js/src/builtin/Promise.h index bb4778631..c76dc358c 100644 --- a/js/src/builtin/Promise.h +++ b/js/src/builtin/Promise.h @@ -66,10 +66,12 @@ class PromiseObject : public NativeObject return getFixedSlot(PromiseSlot_ReactionsOrResult); } - MOZ_MUST_USE bool resolve(JSContext* cx, HandleValue resolutionValue); - MOZ_MUST_USE bool reject(JSContext* cx, HandleValue rejectionValue); + static MOZ_MUST_USE bool resolve(JSContext* cx, Handle<PromiseObject*> promise, + HandleValue resolutionValue); + static MOZ_MUST_USE bool reject(JSContext* cx, Handle<PromiseObject*> promise, + HandleValue rejectionValue); - void onSettled(JSContext* cx); + static void onSettled(JSContext* cx, Handle<PromiseObject*> promise); double allocationTime() { return getFixedSlot(PromiseSlot_AllocationTime).toNumber(); } double resolutionTime() { return getFixedSlot(PromiseSlot_ResolutionTime).toNumber(); } diff --git a/js/src/builtin/Reflect.cpp b/js/src/builtin/Reflect.cpp index 2f509a226..4e7fae78c 100644 --- a/js/src/builtin/Reflect.cpp +++ b/js/src/builtin/Reflect.cpp @@ -268,7 +268,8 @@ static const JSFunctionSpec methods[] = { JSObject* js::InitReflect(JSContext* cx, HandleObject obj) { - RootedObject proto(cx, obj->as<GlobalObject>().getOrCreateObjectPrototype(cx)); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!proto) return nullptr; diff --git a/js/src/builtin/ReflectParse.cpp b/js/src/builtin/ReflectParse.cpp index beff58e13..8e8bb2417 100644 --- a/js/src/builtin/ReflectParse.cpp +++ b/js/src/builtin/ReflectParse.cpp @@ -3044,7 +3044,12 @@ ASTSerializer::expression(ParseNode* pn, MutableHandleValue dst) MOZ_ASSERT(pn->pn_pos.encloses(next->pn_pos)); RootedValue expr(cx); - expr.setString(next->pn_atom); + if (next->isKind(PNK_RAW_UNDEFINED)) { + expr.setUndefined(); + } else { + MOZ_ASSERT(next->isKind(PNK_TEMPLATE_STRING)); + expr.setString(next->pn_atom); + } cooked.infallibleAppend(expr); } @@ -3136,6 +3141,7 @@ ASTSerializer::expression(ParseNode* pn, MutableHandleValue dst) case PNK_TRUE: case PNK_FALSE: case PNK_NULL: + case PNK_RAW_UNDEFINED: return literal(pn, dst); case PNK_YIELD_STAR: @@ -3216,6 +3222,8 @@ ASTSerializer::property(ParseNode* pn, MutableHandleValue dst) return expression(pn->pn_kid, &val) && builder.prototypeMutation(val, &pn->pn_pos, dst); } + if (pn->isKind(PNK_SPREAD)) + return expression(pn, dst); PropKind kind; switch (pn->getOp()) { @@ -3276,6 +3284,10 @@ ASTSerializer::literal(ParseNode* pn, MutableHandleValue dst) val.setNull(); break; + case PNK_RAW_UNDEFINED: + val.setUndefined(); + break; + case PNK_TRUE: val.setBoolean(true); break; @@ -3332,6 +3344,16 @@ ASTSerializer::objectPattern(ParseNode* pn, MutableHandleValue dst) return false; for (ParseNode* propdef = pn->pn_head; propdef; propdef = propdef->pn_next) { + if (propdef->isKind(PNK_SPREAD)) { + RootedValue target(cx); + RootedValue spread(cx); + if (!pattern(propdef->pn_kid, &target)) + return false; + if(!builder.spreadExpression(target, &propdef->pn_pos, &spread)) + return false; + elts.infallibleAppend(spread); + continue; + } LOCAL_ASSERT(propdef->isKind(PNK_MUTATEPROTO) != propdef->isOp(JSOP_INITPROP)); RootedValue key(cx); @@ -3407,12 +3429,7 @@ ASTSerializer::function(ParseNode* pn, ASTType type, MutableHandleValue dst) : GeneratorStyle::None; bool isAsync = pn->pn_funbox->isAsync(); - bool isExpression = -#if JS_HAS_EXPR_CLOSURES - func->isExprBody(); -#else - false; -#endif + bool isExpression = pn->pn_funbox->isExprBody(); RootedValue id(cx); RootedAtom funcAtom(cx, func->explicitName()); diff --git a/js/src/builtin/RegExp.cpp b/js/src/builtin/RegExp.cpp index b20f41c53..7cf20d23c 100644 --- a/js/src/builtin/RegExp.cpp +++ b/js/src/builtin/RegExp.cpp @@ -140,12 +140,12 @@ ExecuteRegExpImpl(JSContext* cx, RegExpStatics* res, RegExpShared& re, HandleLin /* Legacy ExecuteRegExp behavior is baked into the JSAPI. */ bool -js::ExecuteRegExpLegacy(JSContext* cx, RegExpStatics* res, RegExpObject& reobj, +js::ExecuteRegExpLegacy(JSContext* cx, RegExpStatics* res, Handle<RegExpObject*> reobj, HandleLinearString input, size_t* lastIndex, bool test, MutableHandleValue rval) { RegExpGuard shared(cx); - if (!reobj.getShared(cx, &shared)) + if (!RegExpObject::getShared(cx, reobj, &shared)) return false; ScopedMatchPairs matches(&cx->tempLifoAlloc()); @@ -801,7 +801,7 @@ const JSFunctionSpec js::regexp_methods[] = { name(JSContext* cx, unsigned argc, Value* vp) \ { \ CallArgs args = CallArgsFromVp(argc, vp); \ - RegExpStatics* res = cx->global()->getRegExpStatics(cx); \ + RegExpStatics* res = GlobalObject::getRegExpStatics(cx, cx->global()); \ if (!res) \ return false; \ code; \ @@ -827,7 +827,7 @@ DEFINE_STATIC_GETTER(static_paren9_getter, STATIC_PAREN_GETTER_CODE(9)) static bool \ name(JSContext* cx, unsigned argc, Value* vp) \ { \ - RegExpStatics* res = cx->global()->getRegExpStatics(cx); \ + RegExpStatics* res = GlobalObject::getRegExpStatics(cx, cx->global()); \ if (!res) \ return false; \ code; \ @@ -838,7 +838,7 @@ static bool static_input_setter(JSContext* cx, unsigned argc, Value* vp) { CallArgs args = CallArgsFromVp(argc, vp); - RegExpStatics* res = cx->global()->getRegExpStatics(cx); + RegExpStatics* res = GlobalObject::getRegExpStatics(cx, cx->global()); if (!res) return false; @@ -918,12 +918,12 @@ ExecuteRegExp(JSContext* cx, HandleObject regexp, HandleString string, Rooted<RegExpObject*> reobj(cx, ®exp->as<RegExpObject>()); RegExpGuard re(cx); - if (!reobj->getShared(cx, &re)) + if (!RegExpObject::getShared(cx, reobj, &re)) return RegExpRunStatus_Error; RegExpStatics* res; if (staticsUpdate == UpdateRegExpStatics) { - res = cx->global()->getRegExpStatics(cx); + res = GlobalObject::getRegExpStatics(cx, cx->global()); if (!res) return RegExpRunStatus_Error; } else { @@ -1725,7 +1725,7 @@ js::intrinsic_GetElemBaseForLambda(JSContext* cx, unsigned argc, Value* vp) if (!fun->isInterpreted() || fun->isClassConstructor()) return true; - JSScript* script = fun->getOrCreateScript(cx); + JSScript* script = JSFunction::getOrCreateScript(cx, fun); if (!script) return false; @@ -1800,7 +1800,7 @@ js::intrinsic_GetStringDataProperty(JSContext* cx, unsigned argc, Value* vp) return false; RootedValue v(cx); - if (HasDataProperty(cx, nobj, AtomToId(atom), v.address()) && v.isString()) + if (GetPropertyPure(cx, nobj, AtomToId(atom), v.address()) && v.isString()) args.rval().set(v); else args.rval().setUndefined(); diff --git a/js/src/builtin/RegExp.h b/js/src/builtin/RegExp.h index 715656f40..4e0ff6948 100644 --- a/js/src/builtin/RegExp.h +++ b/js/src/builtin/RegExp.h @@ -31,7 +31,7 @@ enum RegExpStaticsUpdate { UpdateRegExpStatics, DontUpdateRegExpStatics }; * |chars| and |length|. */ MOZ_MUST_USE bool -ExecuteRegExpLegacy(JSContext* cx, RegExpStatics* res, RegExpObject& reobj, +ExecuteRegExpLegacy(JSContext* cx, RegExpStatics* res, Handle<RegExpObject*> reobj, HandleLinearString input, size_t* lastIndex, bool test, MutableHandleValue rval); diff --git a/js/src/builtin/SIMD.cpp b/js/src/builtin/SIMD.cpp index 2383922db..5fe691152 100644 --- a/js/src/builtin/SIMD.cpp +++ b/js/src/builtin/SIMD.cpp @@ -475,7 +475,7 @@ const Class SimdObject::class_ = { &SimdObjectClassOps }; -bool +/* static */ bool GlobalObject::initSimdObject(JSContext* cx, Handle<GlobalObject*> global) { // SIMD relies on the TypedObject module being initialized. @@ -483,11 +483,11 @@ GlobalObject::initSimdObject(JSContext* cx, Handle<GlobalObject*> global) // to be able to call GetTypedObjectModule(). It is NOT necessary // to install the TypedObjectModule global, but at the moment // those two things are not separable. - if (!global->getOrCreateTypedObjectModule(cx)) + if (!GlobalObject::getOrCreateTypedObjectModule(cx, global)) return false; RootedObject globalSimdObject(cx); - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!objProto) return false; @@ -510,7 +510,7 @@ static bool CreateSimdType(JSContext* cx, Handle<GlobalObject*> global, HandlePropertyName stringRepr, SimdType simdType, const JSFunctionSpec* methods) { - RootedObject funcProto(cx, global->getOrCreateFunctionPrototype(cx)); + RootedObject funcProto(cx, GlobalObject::getOrCreateFunctionPrototype(cx, global)); if (!funcProto) return false; @@ -531,7 +531,7 @@ CreateSimdType(JSContext* cx, Handle<GlobalObject*> global, HandlePropertyName s return false; // Create prototype property, which inherits from Object.prototype. - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!objProto) return false; Rooted<TypedProto*> proto(cx); @@ -551,7 +551,7 @@ CreateSimdType(JSContext* cx, Handle<GlobalObject*> global, HandlePropertyName s } // Bind type descriptor to the global SIMD object - RootedObject globalSimdObject(cx, global->getOrCreateSimdGlobalObject(cx)); + RootedObject globalSimdObject(cx, GlobalObject::getOrCreateSimdGlobalObject(cx, global)); MOZ_ASSERT(globalSimdObject); RootedValue typeValue(cx, ObjectValue(*typeDescr)); @@ -568,7 +568,7 @@ CreateSimdType(JSContext* cx, Handle<GlobalObject*> global, HandlePropertyName s return !!typeDescr; } -bool +/* static */ bool GlobalObject::initSimdType(JSContext* cx, Handle<GlobalObject*> global, SimdType simdType) { #define CREATE_(Type) \ @@ -584,13 +584,13 @@ GlobalObject::initSimdType(JSContext* cx, Handle<GlobalObject*> global, SimdType #undef CREATE_ } -SimdTypeDescr* +/* static */ SimdTypeDescr* GlobalObject::getOrCreateSimdTypeDescr(JSContext* cx, Handle<GlobalObject*> global, SimdType simdType) { MOZ_ASSERT(unsigned(simdType) < unsigned(SimdType::Count), "Invalid SIMD type"); - RootedObject globalSimdObject(cx, global->getOrCreateSimdGlobalObject(cx)); + RootedObject globalSimdObject(cx, GlobalObject::getOrCreateSimdGlobalObject(cx, global)); if (!globalSimdObject) return nullptr; @@ -628,8 +628,8 @@ SimdObject::resolve(JSContext* cx, JS::HandleObject obj, JS::HandleId id, bool* JSObject* js::InitSimdClass(JSContext* cx, HandleObject obj) { - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); - return global->getOrCreateSimdGlobalObject(cx); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + return GlobalObject::getOrCreateSimdGlobalObject(cx, global); } template<typename V> diff --git a/js/src/builtin/SymbolObject.cpp b/js/src/builtin/SymbolObject.cpp index ae38d5371..8fa860ef3 100644 --- a/js/src/builtin/SymbolObject.cpp +++ b/js/src/builtin/SymbolObject.cpp @@ -53,17 +53,17 @@ const JSFunctionSpec SymbolObject::staticMethods[] = { JSObject* SymbolObject::initClass(JSContext* cx, HandleObject obj) { - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); // This uses &JSObject::class_ because: "The Symbol prototype object is an // ordinary object. It is not a Symbol instance and does not have a // [[SymbolData]] internal slot." (ES6 rev 24, 19.4.3) - RootedObject proto(cx, global->createBlankPrototype<PlainObject>(cx)); + RootedObject proto(cx, GlobalObject::createBlankPrototype<PlainObject>(cx, global)); if (!proto) return nullptr; - RootedFunction ctor(cx, global->createConstructor(cx, construct, - ClassName(JSProto_Symbol, cx), 0)); + RootedFunction ctor(cx, GlobalObject::createConstructor(cx, construct, + ClassName(JSProto_Symbol, cx), 0)); if (!ctor) return nullptr; diff --git a/js/src/builtin/TestingFunctions.cpp b/js/src/builtin/TestingFunctions.cpp index c896ce5d1..992fe2c97 100644 --- a/js/src/builtin/TestingFunctions.cpp +++ b/js/src/builtin/TestingFunctions.cpp @@ -3218,13 +3218,13 @@ ByteSizeOfScript(JSContext*cx, unsigned argc, Value* vp) return false; } - JSFunction* fun = &args[0].toObject().as<JSFunction>(); + RootedFunction fun(cx, &args[0].toObject().as<JSFunction>()); if (fun->isNative()) { JS_ReportErrorASCII(cx, "Argument must be a scripted function"); return false; } - RootedScript script(cx, fun->getOrCreateScript(cx)); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, fun)); if (!script) return false; @@ -3319,7 +3319,8 @@ GetConstructorName(JSContext* cx, unsigned argc, Value* vp) } RootedAtom name(cx); - if (!args[0].toObject().constructorDisplayAtom(cx, &name)) + RootedObject obj(cx, &args[0].toObject()); + if (!JSObject::constructorDisplayAtom(cx, obj, &name)) return false; if (name) { @@ -4023,7 +4024,7 @@ DisRegExp(JSContext* cx, unsigned argc, Value* vp) return false; } - if (!reobj->dumpBytecode(cx, match_only, input)) + if (!RegExpObject::dumpBytecode(cx, reobj, match_only, input)) return false; args.rval().setUndefined(); @@ -4042,6 +4043,32 @@ IsConstructor(JSContext* cx, unsigned argc, Value* vp) return true; } +static bool +GetErrorNotes(JSContext* cx, unsigned argc, Value* vp) +{ + CallArgs args = CallArgsFromVp(argc, vp); + if (!args.requireAtLeast(cx, "getErrorNotes", 1)) + return false; + + if (!args[0].isObject() || !args[0].toObject().is<ErrorObject>()) { + args.rval().setNull(); + return true; + } + + JSErrorReport* report = args[0].toObject().as<ErrorObject>().getErrorReport(); + if (!report) { + args.rval().setNull(); + return true; + } + + RootedObject notesArray(cx, CreateErrorNotesArray(cx, report)); + if (!notesArray) + return false; + + args.rval().setObject(*notesArray); + return true; +} + static const JSFunctionSpecWithHelp TestingFunctions[] = { JS_FN_HELP("gc", ::GC, 0, 0, "gc([obj] | 'zone' [, 'shrinking'])", @@ -4576,6 +4603,10 @@ static const JSFunctionSpecWithHelp FuzzingUnsafeTestingFunctions[] = { " Dumps RegExp bytecode."), #endif + JS_FN_HELP("getErrorNotes", GetErrorNotes, 1, 0, +"getErrorNotes(error)", +" Returns an array of error notes."), + JS_FS_HELP_END }; diff --git a/js/src/builtin/TypedObject.cpp b/js/src/builtin/TypedObject.cpp index 0dfc1123a..ff3680774 100644 --- a/js/src/builtin/TypedObject.cpp +++ b/js/src/builtin/TypedObject.cpp @@ -1124,11 +1124,11 @@ DefineSimpleTypeDescr(JSContext* cx, typename T::Type type, HandlePropertyName className) { - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!objProto) return false; - RootedObject funcProto(cx, global->getOrCreateFunctionPrototype(cx)); + RootedObject funcProto(cx, GlobalObject::getOrCreateFunctionPrototype(cx, global)); if (!funcProto) return false; @@ -1185,7 +1185,7 @@ DefineMetaTypeDescr(JSContext* cx, if (!className) return nullptr; - RootedObject funcProto(cx, global->getOrCreateFunctionPrototype(cx)); + RootedObject funcProto(cx, GlobalObject::getOrCreateFunctionPrototype(cx, global)); if (!funcProto) return nullptr; @@ -1197,7 +1197,7 @@ DefineMetaTypeDescr(JSContext* cx, // Create ctor.prototype.prototype, which inherits from Object.__proto__ - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!objProto) return nullptr; RootedObject protoProto(cx); @@ -1216,7 +1216,7 @@ DefineMetaTypeDescr(JSContext* cx, const int constructorLength = 2; RootedFunction ctor(cx); - ctor = global->createConstructor(cx, T::construct, className, constructorLength); + ctor = GlobalObject::createConstructor(cx, T::construct, className, constructorLength); if (!ctor || !LinkConstructorAndPrototype(cx, ctor, proto) || !DefinePropertiesAndFunctions(cx, proto, @@ -1240,10 +1240,10 @@ DefineMetaTypeDescr(JSContext* cx, * initializer for the `TypedObject` class populate the * `TypedObject` global (which is referred to as "module" herein). */ -bool +/* static */ bool GlobalObject::initTypedObjectModule(JSContext* cx, Handle<GlobalObject*> global) { - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!objProto) return false; @@ -1317,9 +1317,8 @@ GlobalObject::initTypedObjectModule(JSContext* cx, Handle<GlobalObject*> global) JSObject* js::InitTypedObjectModuleObject(JSContext* cx, HandleObject obj) { - MOZ_ASSERT(obj->is<GlobalObject>()); - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); - return global->getOrCreateTypedObjectModule(cx); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + return GlobalObject::getOrCreateTypedObjectModule(cx, global); } /****************************************************************************** diff --git a/js/src/builtin/Utilities.js b/js/src/builtin/Utilities.js index c73bc5e7f..d5f233d05 100644 --- a/js/src/builtin/Utilities.js +++ b/js/src/builtin/Utilities.js @@ -229,6 +229,69 @@ function GetInternalError(msg) { // To be used when a function is required but calling it shouldn't do anything. function NullFunction() {} +// Object Rest/Spread Properties proposal +// Abstract operation: CopyDataProperties (target, source, excluded) +function CopyDataProperties(target, source, excluded) { + // Step 1. + assert(IsObject(target), "target is an object"); + + // Step 2. + assert(IsObject(excluded), "excluded is an object"); + + // Steps 3, 6. + if (source === undefined || source === null) + return; + + // Step 4.a. + source = ToObject(source); + + // Step 4.b. + var keys = OwnPropertyKeys(source, JSITER_OWNONLY | JSITER_HIDDEN | JSITER_SYMBOLS); + + // Step 5. + for (var index = 0; index < keys.length; index++) { + var key = keys[index]; + + // We abbreviate this by calling propertyIsEnumerable which is faster + // and returns false for not defined properties. + if (!callFunction(std_Object_hasOwnProperty, excluded, key) && callFunction(std_Object_propertyIsEnumerable, source, key)) + _DefineDataProperty(target, key, source[key]); + } + + // Step 6 (Return). +} + +// Object Rest/Spread Properties proposal +// Abstract operation: CopyDataProperties (target, source, excluded) +function CopyDataPropertiesUnfiltered(target, source) { + // Step 1. + assert(IsObject(target), "target is an object"); + + // Step 2 (Not applicable). + + // Steps 3, 6. + if (source === undefined || source === null) + return; + + // Step 4.a. + source = ToObject(source); + + // Step 4.b. + var keys = OwnPropertyKeys(source, JSITER_OWNONLY | JSITER_HIDDEN | JSITER_SYMBOLS); + + // Step 5. + for (var index = 0; index < keys.length; index++) { + var key = keys[index]; + + // We abbreviate this by calling propertyIsEnumerable which is faster + // and returns false for not defined properties. + if (callFunction(std_Object_propertyIsEnumerable, source, key)) + _DefineDataProperty(target, key, source[key]); + } + + // Step 6 (Return). +} + /*************************************** Testing functions ***************************************/ function outer() { return function inner() { diff --git a/js/src/builtin/WeakMapObject.cpp b/js/src/builtin/WeakMapObject.cpp index 555b9e03a..dcfa19776 100644 --- a/js/src/builtin/WeakMapObject.cpp +++ b/js/src/builtin/WeakMapObject.cpp @@ -350,14 +350,14 @@ InitWeakMapClass(JSContext* cx, HandleObject obj, bool defineMembers) { MOZ_ASSERT(obj->isNative()); - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); RootedPlainObject proto(cx, NewBuiltinClassInstance<PlainObject>(cx)); if (!proto) return nullptr; - RootedFunction ctor(cx, global->createConstructor(cx, WeakMap_construct, - cx->names().WeakMap, 0)); + RootedFunction ctor(cx, GlobalObject::createConstructor(cx, WeakMap_construct, + cx->names().WeakMap, 0)); if (!ctor) return nullptr; diff --git a/js/src/builtin/WeakSetObject.cpp b/js/src/builtin/WeakSetObject.cpp index 7ea3f2fef..fbe5e418c 100644 --- a/js/src/builtin/WeakSetObject.cpp +++ b/js/src/builtin/WeakSetObject.cpp @@ -41,14 +41,15 @@ const JSFunctionSpec WeakSetObject::methods[] = { }; JSObject* -WeakSetObject::initClass(JSContext* cx, JSObject* obj) +WeakSetObject::initClass(JSContext* cx, HandleObject obj) { - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); RootedPlainObject proto(cx, NewBuiltinClassInstance<PlainObject>(cx)); if (!proto) return nullptr; - Rooted<JSFunction*> ctor(cx, global->createConstructor(cx, construct, ClassName(JSProto_WeakSet, cx), 0)); + Rooted<JSFunction*> ctor(cx, GlobalObject::createConstructor(cx, construct, + ClassName(JSProto_WeakSet, cx), 0)); if (!ctor || !LinkConstructorAndPrototype(cx, ctor, proto) || !DefinePropertiesAndFunctions(cx, proto, properties, methods) || diff --git a/js/src/builtin/WeakSetObject.h b/js/src/builtin/WeakSetObject.h index 0a6ff33f3..50e54c182 100644 --- a/js/src/builtin/WeakSetObject.h +++ b/js/src/builtin/WeakSetObject.h @@ -16,7 +16,7 @@ class WeakSetObject : public NativeObject public: static const unsigned RESERVED_SLOTS = 1; - static JSObject* initClass(JSContext* cx, JSObject* obj); + static JSObject* initClass(JSContext* cx, HandleObject obj); static const Class class_; private: diff --git a/js/src/frontend/BytecodeCompiler.cpp b/js/src/frontend/BytecodeCompiler.cpp index b5be5f5ac..a1abbfeda 100644 --- a/js/src/frontend/BytecodeCompiler.cpp +++ b/js/src/frontend/BytecodeCompiler.cpp @@ -77,7 +77,13 @@ class MOZ_STACK_CLASS BytecodeCompiler bool canLazilyParse(); bool createParser(); bool createSourceAndParser(Maybe<uint32_t> parameterListEnd = Nothing()); - bool createScript(uint32_t preludeStart = 0); + + // If toString{Start,End} are not explicitly passed, assume the script's + // offsets in the source used to parse it are the same as what should be + // used to compute its Function.prototype.toString() value. + bool createScript(); + bool createScript(uint32_t toStringStart, uint32_t toStringEnd); + bool emplaceEmitter(Maybe<BytecodeEmitter>& emitter, SharedContext* sharedContext); bool handleParseFailure(const Directives& newDirectives); bool deoptimizeArgumentsInEnclosingScripts(JSContext* cx, HandleObject environment); @@ -242,11 +248,17 @@ BytecodeCompiler::createSourceAndParser(Maybe<uint32_t> parameterListEnd /* = No } bool -BytecodeCompiler::createScript(uint32_t preludeStart /* = 0 */) +BytecodeCompiler::createScript() +{ + return createScript(0, sourceBuffer.length()); +} + +bool +BytecodeCompiler::createScript(uint32_t toStringStart, uint32_t toStringEnd) { script = JSScript::Create(cx, options, sourceObject, /* sourceStart = */ 0, sourceBuffer.length(), - preludeStart); + toStringStart, toStringEnd); return script != nullptr; } @@ -287,7 +299,8 @@ BytecodeCompiler::deoptimizeArgumentsInEnclosingScripts(JSContext* cx, HandleObj RootedObject env(cx, environment); while (env->is<EnvironmentObject>() || env->is<DebugEnvironmentProxy>()) { if (env->is<CallObject>()) { - RootedScript script(cx, env->as<CallObject>().callee().getOrCreateScript(cx)); + RootedFunction fun(cx, &env->as<CallObject>().callee()); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, fun)); if (!script) return false; if (script->argumentsHasVarBinding()) { @@ -457,7 +470,7 @@ BytecodeCompiler::compileStandaloneFunction(MutableHandleFunction fun, if (fn->pn_funbox->function()->isInterpreted()) { MOZ_ASSERT(fun == fn->pn_funbox->function()); - if (!createScript(fn->pn_funbox->preludeStart)) + if (!createScript(fn->pn_funbox->toStringStart, fn->pn_funbox->toStringEnd)) return false; Maybe<BytecodeEmitter> emitter; @@ -652,7 +665,7 @@ frontend::CompileLazyFunction(JSContext* cx, Handle<LazyScript*> lazy, const cha Rooted<JSScript*> script(cx, JSScript::Create(cx, options, sourceObject, lazy->begin(), lazy->end(), - lazy->preludeStart())); + lazy->toStringStart(), lazy->toStringEnd())); if (!script) return false; diff --git a/js/src/frontend/BytecodeEmitter.cpp b/js/src/frontend/BytecodeEmitter.cpp index 7f9fa8a5d..309d6c290 100644 --- a/js/src/frontend/BytecodeEmitter.cpp +++ b/js/src/frontend/BytecodeEmitter.cpp @@ -3069,6 +3069,7 @@ BytecodeEmitter::checkSideEffects(ParseNode* pn, bool* answer) case PNK_TRUE: case PNK_FALSE: case PNK_NULL: + case PNK_RAW_UNDEFINED: case PNK_ELISION: case PNK_GENERATOR: case PNK_NUMBER: @@ -3538,9 +3539,10 @@ BytecodeEmitter::needsImplicitThis() bool BytecodeEmitter::maybeSetDisplayURL() { - if (tokenStream()->hasDisplayURL()) { - if (!parser->ss->setDisplayURL(cx, tokenStream()->displayURL())) + if (tokenStream().hasDisplayURL()) { + if (!parser->ss->setDisplayURL(cx, tokenStream().displayURL())) { return false; + } } return true; } @@ -3548,10 +3550,11 @@ BytecodeEmitter::maybeSetDisplayURL() bool BytecodeEmitter::maybeSetSourceMap() { - if (tokenStream()->hasSourceMapURL()) { + if (tokenStream().hasSourceMapURL()) { MOZ_ASSERT(!parser->ss->hasSourceMapURL()); - if (!parser->ss->setSourceMapURL(cx, tokenStream()->sourceMapURL())) + if (!parser->ss->setSourceMapURL(cx, tokenStream().sourceMapURL())) { return false; + } } /* @@ -3590,21 +3593,21 @@ BytecodeEmitter::tellDebuggerAboutCompiledScript(ExclusiveContext* cx) } } -inline TokenStream* +inline TokenStream& BytecodeEmitter::tokenStream() { - return &parser->tokenStream; + return parser->tokenStream; } bool BytecodeEmitter::reportError(ParseNode* pn, unsigned errorNumber, ...) { - TokenPos pos = pn ? pn->pn_pos : tokenStream()->currentToken().pos; + TokenPos pos = pn ? pn->pn_pos : tokenStream().currentToken().pos; va_list args; va_start(args, errorNumber); - bool result = tokenStream()->reportCompileErrorNumberVA(pos.begin, JSREPORT_ERROR, - errorNumber, args); + bool result = tokenStream().reportCompileErrorNumberVA(nullptr, pos.begin, JSREPORT_ERROR, + errorNumber, args); va_end(args); return result; } @@ -3612,11 +3615,12 @@ BytecodeEmitter::reportError(ParseNode* pn, unsigned errorNumber, ...) bool BytecodeEmitter::reportExtraWarning(ParseNode* pn, unsigned errorNumber, ...) { - TokenPos pos = pn ? pn->pn_pos : tokenStream()->currentToken().pos; + TokenPos pos = pn ? pn->pn_pos : tokenStream().currentToken().pos; va_list args; va_start(args, errorNumber); - bool result = tokenStream()->reportExtraWarningErrorNumberVA(pos.begin, errorNumber, args); + bool result = tokenStream().reportExtraWarningErrorNumberVA(nullptr, pos.begin, + errorNumber, args); va_end(args); return result; } @@ -3624,12 +3628,12 @@ BytecodeEmitter::reportExtraWarning(ParseNode* pn, unsigned errorNumber, ...) bool BytecodeEmitter::reportStrictModeError(ParseNode* pn, unsigned errorNumber, ...) { - TokenPos pos = pn ? pn->pn_pos : tokenStream()->currentToken().pos; + TokenPos pos = pn ? pn->pn_pos : tokenStream().currentToken().pos; va_list args; va_start(args, errorNumber); - bool result = tokenStream()->reportStrictModeErrorNumberVA(pos.begin, sc->strict(), - errorNumber, args); + bool result = tokenStream().reportStrictModeErrorNumberVA(nullptr, pos.begin, sc->strict(), + errorNumber, args); va_end(args); return result; } @@ -4599,7 +4603,7 @@ BytecodeEmitter::emitSwitch(ParseNode* pn) // If the expression is a literal, suppress line number emission so // that debugging works more naturally. if (caseValue) { - if (!emitTree(caseValue, + if (!emitTree(caseValue, ValueUsage::WantValue, caseValue->isLiteral() ? SUPPRESS_LINENOTE : EMIT_LINENOTE)) { return false; @@ -5810,36 +5814,78 @@ BytecodeEmitter::emitDestructuringOpsObject(ParseNode* pattern, DestructuringFla if (!emitRequireObjectCoercible()) // ... RHS return false; + bool needsRestPropertyExcludedSet = pattern->pn_count > 1 && + pattern->last()->isKind(PNK_SPREAD); + if (needsRestPropertyExcludedSet) { + if (!emitDestructuringObjRestExclusionSet(pattern)) // ... RHS SET + return false; + + if (!emit1(JSOP_SWAP)) // ... SET RHS + return false; + } + for (ParseNode* member = pattern->pn_head; member; member = member->pn_next) { ParseNode* subpattern; - if (member->isKind(PNK_MUTATEPROTO)) + if (member->isKind(PNK_MUTATEPROTO) || member->isKind(PNK_SPREAD)) subpattern = member->pn_kid; else subpattern = member->pn_right; + ParseNode* lhs = subpattern; + MOZ_ASSERT_IF(member->isKind(PNK_SPREAD), !lhs->isKind(PNK_ASSIGN)); if (lhs->isKind(PNK_ASSIGN)) lhs = lhs->pn_left; size_t emitted; - if (!emitDestructuringLHSRef(lhs, &emitted)) // ... RHS *LREF + if (!emitDestructuringLHSRef(lhs, &emitted)) // ... *SET RHS *LREF return false; // Duplicate the value being destructured to use as a reference base. if (emitted) { - if (!emitDupAt(emitted)) // ... RHS *LREF RHS + if (!emitDupAt(emitted)) // ... *SET RHS *LREF RHS return false; } else { - if (!emit1(JSOP_DUP)) // ... RHS RHS + if (!emit1(JSOP_DUP)) // ... *SET RHS RHS return false; } + if (member->isKind(PNK_SPREAD)) { + if (!updateSourceCoordNotes(member->pn_pos.begin)) + return false; + + if (!emitNewInit(JSProto_Object)) // ... *SET RHS *LREF RHS TARGET + return false; + if (!emit1(JSOP_DUP)) // ... *SET RHS *LREF RHS TARGET TARGET + return false; + if (!emit2(JSOP_PICK, 2)) // ... *SET RHS *LREF TARGET TARGET RHS + return false; + + if (needsRestPropertyExcludedSet) { + if (!emit2(JSOP_PICK, emitted + 4)) // ... RHS *LREF TARGET TARGET RHS SET + return false; + } + + CopyOption option = needsRestPropertyExcludedSet + ? CopyOption::Filtered + : CopyOption::Unfiltered; + if (!emitCopyDataProperties(option)) // ... RHS *LREF TARGET + return false; + + // Destructure TARGET per this member's lhs. + if (!emitSetOrInitializeDestructuring(lhs, flav)) // ... RHS + return false; + + MOZ_ASSERT(member == pattern->last(), "Rest property is always last"); + break; + } + // Now push the property name currently being matched, which is the // current property name "label" on the left of a colon in the object // initialiser. bool needsGetElem = true; if (member->isKind(PNK_MUTATEPROTO)) { - if (!emitAtomOp(cx->names().proto, JSOP_GETPROP)) // ... RHS *LREF PROP + if (!emitAtomOp(cx->names().proto, JSOP_GETPROP)) // ... *SET RHS *LREF PROP return false; needsGetElem = false; } else { @@ -5847,40 +5893,131 @@ BytecodeEmitter::emitDestructuringOpsObject(ParseNode* pattern, DestructuringFla ParseNode* key = member->pn_left; if (key->isKind(PNK_NUMBER)) { - if (!emitNumberOp(key->pn_dval)) // ... RHS *LREF RHS KEY + if (!emitNumberOp(key->pn_dval)) // ... *SET RHS *LREF RHS KEY return false; } else if (key->isKind(PNK_OBJECT_PROPERTY_NAME) || key->isKind(PNK_STRING)) { - PropertyName* name = key->pn_atom->asPropertyName(); - - // The parser already checked for atoms representing indexes and - // used PNK_NUMBER instead, but also watch for ids which TI treats - // as indexes for simplification of downstream analysis. - jsid id = NameToId(name); - if (id != IdToTypeId(id)) { - if (!emitTree(key)) // ... RHS *LREF RHS KEY + if (!emitAtomOp(key->pn_atom, JSOP_GETPROP)) // ... *SET RHS *LREF PROP + return false; + needsGetElem = false; + } else { + if (!emitComputedPropertyName(key)) // ... *SET RHS *LREF RHS KEY + return false; + + // Add the computed property key to the exclusion set. + if (needsRestPropertyExcludedSet) { + if (!emitDupAt(emitted + 3)) // ... SET RHS *LREF RHS KEY SET return false; - } else { - if (!emitAtomOp(name, JSOP_GETPROP)) // ... RHS *LREF PROP + if (!emitDupAt(1)) // ... SET RHS *LREF RHS KEY SET KEY + return false; + if (!emit1(JSOP_UNDEFINED)) // ... SET RHS *LREF RHS KEY SET KEY UNDEFINED + return false; + if (!emit1(JSOP_INITELEM)) // ... SET RHS *LREF RHS KEY SET + return false; + if (!emit1(JSOP_POP)) // ... SET RHS *LREF RHS KEY return false; - needsGetElem = false; } - } else { - if (!emitComputedPropertyName(key)) // ... RHS *LREF RHS KEY - return false; } } // Get the property value if not done already. - if (needsGetElem && !emitElemOpBase(JSOP_GETELEM)) // ... RHS *LREF PROP + if (needsGetElem && !emitElemOpBase(JSOP_GETELEM)) // ... *SET RHS *LREF PROP return false; if (subpattern->isKind(PNK_ASSIGN)) { - if (!emitDefault(subpattern->pn_right, lhs)) // ... RHS *LREF VALUE + if (!emitDefault(subpattern->pn_right, lhs)) // ... *SET RHS *LREF VALUE return false; } // Destructure PROP per this member's lhs. - if (!emitSetOrInitializeDestructuring(subpattern, flav)) // ... RHS + if (!emitSetOrInitializeDestructuring(subpattern, flav)) // ... *SET RHS + return false; + } + + return true; +} + +bool +BytecodeEmitter::emitDestructuringObjRestExclusionSet(ParseNode* pattern) +{ + MOZ_ASSERT(pattern->isKind(PNK_OBJECT)); + MOZ_ASSERT(pattern->isArity(PN_LIST)); + MOZ_ASSERT(pattern->last()->isKind(PNK_SPREAD)); + + ptrdiff_t offset = this->offset(); + if (!emitNewInit(JSProto_Object)) + return false; + + // Try to construct the shape of the object as we go, so we can emit a + // JSOP_NEWOBJECT with the final shape instead. + // In the case of computed property names and indices, we cannot fix the + // shape at bytecode compile time. When the shape cannot be determined, + // |obj| is nulled out. + + // No need to do any guessing for the object kind, since we know the upper + // bound of how many properties we plan to have. + gc::AllocKind kind = gc::GetGCObjectKind(pattern->pn_count - 1); + RootedPlainObject obj(cx, NewBuiltinClassInstance<PlainObject>(cx, kind, TenuredObject)); + if (!obj) + return false; + + RootedAtom pnatom(cx); + for (ParseNode* member = pattern->pn_head; member; member = member->pn_next) { + if (member->isKind(PNK_SPREAD)) + break; + + bool isIndex = false; + if (member->isKind(PNK_MUTATEPROTO)) { + pnatom.set(cx->names().proto); + } else { + ParseNode* key = member->pn_left; + if (key->isKind(PNK_NUMBER)) { + if (!emitNumberOp(key->pn_dval)) + return false; + isIndex = true; + } else if (key->isKind(PNK_OBJECT_PROPERTY_NAME) || key->isKind(PNK_STRING)) { + pnatom.set(key->pn_atom); + } else { + // Otherwise this is a computed property name which needs to + // be added dynamically. + obj.set(nullptr); + continue; + } + } + + // Initialize elements with |undefined|. + if (!emit1(JSOP_UNDEFINED)) + return false; + + if (isIndex) { + obj.set(nullptr); + if (!emit1(JSOP_INITELEM)) + return false; + } else { + uint32_t index; + if (!makeAtomIndex(pnatom, &index)) + return false; + + if (obj) { + MOZ_ASSERT(!obj->inDictionaryMode()); + Rooted<jsid> id(cx, AtomToId(pnatom)); + if (!NativeDefineProperty(cx, obj, id, UndefinedHandleValue, nullptr, nullptr, + JSPROP_ENUMERATE)) + { + return false; + } + if (obj->inDictionaryMode()) + obj.set(nullptr); + } + + if (!emitIndex32(JSOP_INITPROP, index)) + return false; + } + } + + if (obj) { + // The object survived and has a predictable shape: update the + // original bytecode. + if (!replaceNewInitWithNewObject(obj, offset)) return false; } @@ -6242,6 +6379,9 @@ ParseNode::getConstantValue(ExclusiveContext* cx, AllowConstantObjects allowObje case PNK_NULL: vp.setNull(); return true; + case PNK_RAW_UNDEFINED: + vp.setUndefined(); + return true; case PNK_CALLSITEOBJ: case PNK_ARRAY: { unsigned count; @@ -6645,7 +6785,7 @@ BytecodeEmitter::emitLexicalScopeBody(ParseNode* body, EmitLineNumberNote emitLi } // Line notes were updated by emitLexicalScope. - return emitTree(body, emitLineNote); + return emitTree(body, ValueUsage::WantValue, emitLineNote); } // Using MOZ_NEVER_INLINE in here is a workaround for llvm.org/pr14047. See @@ -6747,9 +6887,9 @@ BytecodeEmitter::emitRequireObjectCoercible() return false; if (!emit2(JSOP_PICK, 2)) // VAL REQUIREOBJECTCOERCIBLE UNDEFINED VAL return false; - if (!emitCall(JSOP_CALL, 1)) // VAL IGNORED + if (!emitCall(JSOP_CALL_IGNORES_RV, 1))// VAL IGNORED return false; - checkTypeSet(JSOP_CALL); + checkTypeSet(JSOP_CALL_IGNORES_RV); if (!emit1(JSOP_POP)) // VAL return false; @@ -6759,6 +6899,53 @@ BytecodeEmitter::emitRequireObjectCoercible() } bool +BytecodeEmitter::emitCopyDataProperties(CopyOption option) +{ + DebugOnly<int32_t> depth = this->stackDepth; + + uint32_t argc; + if (option == CopyOption::Filtered) { + MOZ_ASSERT(depth > 2); // TARGET SOURCE SET + argc = 3; + + if (!emitAtomOp(cx->names().CopyDataProperties, + JSOP_GETINTRINSIC)) // TARGET SOURCE SET COPYDATAPROPERTIES + { + return false; + } + } else { + MOZ_ASSERT(depth > 1); // TARGET SOURCE + argc = 2; + + if (!emitAtomOp(cx->names().CopyDataPropertiesUnfiltered, + JSOP_GETINTRINSIC)) // TARGET SOURCE COPYDATAPROPERTIES + { + return false; + } + } + + if (!emit1(JSOP_UNDEFINED)) // TARGET SOURCE *SET COPYDATAPROPERTIES UNDEFINED + return false; + if (!emit2(JSOP_PICK, argc + 1)) // SOURCE *SET COPYDATAPROPERTIES UNDEFINED TARGET + return false; + if (!emit2(JSOP_PICK, argc + 1)) // *SET COPYDATAPROPERTIES UNDEFINED TARGET SOURCE + return false; + if (option == CopyOption::Filtered) { + if (!emit2(JSOP_PICK, argc + 1)) // COPYDATAPROPERTIES UNDEFINED TARGET SOURCE SET + return false; + } + if (!emitCall(JSOP_CALL_IGNORES_RV, argc)) // IGNORED + return false; + checkTypeSet(JSOP_CALL_IGNORES_RV); + + if (!emit1(JSOP_POP)) // - + return false; + + MOZ_ASSERT(depth - int(argc) == this->stackDepth); + return true; +} + +bool BytecodeEmitter::emitIterator() { // Convert iterable to iterator. @@ -7269,12 +7456,14 @@ BytecodeEmitter::emitCStyleFor(ParseNode* pn, EmitterScope* headLexicalEmitterSc // scope, but we still need to emit code for the initializers.) if (!updateSourceCoordNotes(init->pn_pos.begin)) return false; - if (!emitTree(init)) - return false; - - if (!init->isForLoopDeclaration()) { + if (init->isForLoopDeclaration()) { + if (!emitTree(init)) + return false; + } else { // 'init' is an expression, not a declaration. emitTree left its // value on the stack. + if (!emitTree(init, ValueUsage::IgnoreValue)) + return false; if (!emit1(JSOP_POP)) return false; } @@ -7356,7 +7545,7 @@ BytecodeEmitter::emitCStyleFor(ParseNode* pn, EmitterScope* headLexicalEmitterSc if (!updateSourceCoordNotes(update->pn_pos.begin)) return false; - if (!emitTree(update)) + if (!emitTree(update, ValueUsage::IgnoreValue)) return false; if (!emit1(JSOP_POP)) return false; @@ -7839,7 +8028,8 @@ BytecodeEmitter::emitFunction(ParseNode* pn, bool needsProto) Rooted<JSObject*> sourceObject(cx, script->sourceObject()); Rooted<JSScript*> script(cx, JSScript::Create(cx, options, sourceObject, funbox->bufStart, funbox->bufEnd, - funbox->preludeStart)); + funbox->toStringStart, + funbox->toStringEnd)); if (!script) return false; @@ -8682,8 +8872,9 @@ BytecodeEmitter::emitStatement(ParseNode* pn) if (useful) { JSOp op = wantval ? JSOP_SETRVAL : JSOP_POP; + ValueUsage valueUsage = wantval ? ValueUsage::WantValue : ValueUsage::IgnoreValue; MOZ_ASSERT_IF(pn2->isKind(PNK_ASSIGN), pn2->isOp(JSOP_NOP)); - if (!emitTree(pn2)) + if (!emitTree(pn2, valueUsage)) return false; if (!emit1(op)) return false; @@ -9033,7 +9224,7 @@ BytecodeEmitter::emitOptimizeSpread(ParseNode* arg0, JumpList* jmp, bool* emitte } bool -BytecodeEmitter::emitCallOrNew(ParseNode* pn) +BytecodeEmitter::emitCallOrNew(ParseNode* pn, ValueUsage valueUsage /* = ValueUsage::WantValue */) { bool callop = pn->isKind(PNK_CALL) || pn->isKind(PNK_TAGGED_TEMPLATE); /* @@ -9212,13 +9403,20 @@ BytecodeEmitter::emitCallOrNew(ParseNode* pn) } if (!spread) { - if (!emitCall(pn->getOp(), argc, pn)) - return false; + if (pn->getOp() == JSOP_CALL && valueUsage == ValueUsage::IgnoreValue) { + if (!emitCall(JSOP_CALL_IGNORES_RV, argc, pn)) + return false; + checkTypeSet(JSOP_CALL_IGNORES_RV); + } else { + if (!emitCall(pn->getOp(), argc, pn)) + return false; + checkTypeSet(pn->getOp()); + } } else { if (!emit1(pn->getOp())) return false; + checkTypeSet(pn->getOp()); } - checkTypeSet(pn->getOp()); if (pn->isOp(JSOP_EVAL) || pn->isOp(JSOP_STRICTEVAL) || pn->isOp(JSOP_SPREADEVAL) || @@ -9316,12 +9514,13 @@ BytecodeEmitter::emitLogical(ParseNode* pn) } bool -BytecodeEmitter::emitSequenceExpr(ParseNode* pn) +BytecodeEmitter::emitSequenceExpr(ParseNode* pn, + ValueUsage valueUsage /* = ValueUsage::WantValue */) { for (ParseNode* child = pn->pn_head; ; child = child->pn_next) { if (!updateSourceCoordNotes(child->pn_pos.begin)) return false; - if (!emitTree(child)) + if (!emitTree(child, child->pn_next ? ValueUsage::IgnoreValue : valueUsage)) return false; if (!child->pn_next) break; @@ -9384,7 +9583,8 @@ BytecodeEmitter::emitLabeledStatement(const LabeledStatement* pn) } bool -BytecodeEmitter::emitConditionalExpression(ConditionalExpression& conditional) +BytecodeEmitter::emitConditionalExpression(ConditionalExpression& conditional, + ValueUsage valueUsage /* = ValueUsage::WantValue */) { /* Emit the condition, then branch if false to the else part. */ if (!emitTree(&conditional.condition())) @@ -9394,13 +9594,13 @@ BytecodeEmitter::emitConditionalExpression(ConditionalExpression& conditional) if (!ifThenElse.emitCond()) return false; - if (!emitTreeInBranch(&conditional.thenExpression())) + if (!emitTreeInBranch(&conditional.thenExpression(), valueUsage)) return false; if (!ifThenElse.emitElse()) return false; - if (!emitTreeInBranch(&conditional.elseExpression())) + if (!emitTreeInBranch(&conditional.elseExpression(), valueUsage)) return false; if (!ifThenElse.emitEnd()) @@ -9429,6 +9629,22 @@ BytecodeEmitter::emitPropertyList(ParseNode* pn, MutableHandlePlainObject objp, continue; } + if (propdef->isKind(PNK_SPREAD)) { + MOZ_ASSERT(type == ObjectLiteral); + + if (!emit1(JSOP_DUP)) + return false; + + if (!emitTree(propdef->pn_kid)) + return false; + + if (!emitCopyDataProperties(CopyOption::Unfiltered)) + return false; + + objp.set(nullptr); + continue; + } + bool extraPop = false; if (type == ClassBody && propdef->as<ClassMethod>().isStatic()) { extraPop = true; @@ -9452,16 +9668,6 @@ BytecodeEmitter::emitPropertyList(ParseNode* pn, MutableHandlePlainObject objp, { continue; } - - // The parser already checked for atoms representing indexes and - // used PNK_NUMBER instead, but also watch for ids which TI treats - // as indexes for simpliciation of downstream analysis. - jsid id = NameToId(key->pn_atom->asPropertyName()); - if (id != IdToTypeId(id)) { - if (!emitTree(key)) - return false; - isIndex = true; - } } else { if (!emitComputedPropertyName(key)) return false; @@ -9542,8 +9748,7 @@ BytecodeEmitter::emitPropertyList(ParseNode* pn, MutableHandlePlainObject objp, MOZ_ASSERT(!IsHiddenInitOp(op)); MOZ_ASSERT(!objp->inDictionaryMode()); Rooted<jsid> id(cx, AtomToId(key->pn_atom)); - RootedValue undefinedValue(cx, UndefinedValue()); - if (!NativeDefineProperty(cx, objp, id, undefinedValue, nullptr, nullptr, + if (!NativeDefineProperty(cx, objp, id, UndefinedHandleValue, nullptr, nullptr, JSPROP_ENUMERATE)) { return false; @@ -9586,15 +9791,16 @@ BytecodeEmitter::emitObject(ParseNode* pn) if (!emitNewInit(JSProto_Object)) return false; - /* - * Try to construct the shape of the object as we go, so we can emit a - * JSOP_NEWOBJECT with the final shape instead. - */ - RootedPlainObject obj(cx); - // No need to do any guessing for the object kind, since we know exactly - // how many properties we plan to have. + // Try to construct the shape of the object as we go, so we can emit a + // JSOP_NEWOBJECT with the final shape instead. + // In the case of computed property names and indices, we cannot fix the + // shape at bytecode compile time. When the shape cannot be determined, + // |obj| is nulled out. + + // No need to do any guessing for the object kind, since we know the upper + // bound of how many properties we plan to have. gc::AllocKind kind = gc::GetGCObjectKind(pn->pn_count); - obj = NewBuiltinClassInstance<PlainObject>(cx, kind, TenuredObject); + RootedPlainObject obj(cx, NewBuiltinClassInstance<PlainObject>(cx, kind, TenuredObject)); if (!obj) return false; @@ -9602,25 +9808,34 @@ BytecodeEmitter::emitObject(ParseNode* pn) return false; if (obj) { - /* - * The object survived and has a predictable shape: update the original - * bytecode. - */ - ObjectBox* objbox = parser->newObjectBox(obj); - if (!objbox) + // The object survived and has a predictable shape: update the original + // bytecode. + if (!replaceNewInitWithNewObject(obj, offset)) return false; + } - static_assert(JSOP_NEWINIT_LENGTH == JSOP_NEWOBJECT_LENGTH, - "newinit and newobject must have equal length to edit in-place"); + return true; +} - uint32_t index = objectList.add(objbox); - jsbytecode* code = this->code(offset); - code[0] = JSOP_NEWOBJECT; - code[1] = jsbytecode(index >> 24); - code[2] = jsbytecode(index >> 16); - code[3] = jsbytecode(index >> 8); - code[4] = jsbytecode(index); - } +bool +BytecodeEmitter::replaceNewInitWithNewObject(JSObject* obj, ptrdiff_t offset) +{ + ObjectBox* objbox = parser->newObjectBox(obj); + if (!objbox) + return false; + + static_assert(JSOP_NEWINIT_LENGTH == JSOP_NEWOBJECT_LENGTH, + "newinit and newobject must have equal length to edit in-place"); + + uint32_t index = objectList.add(objbox); + jsbytecode* code = this->code(offset); + + MOZ_ASSERT(code[0] == JSOP_NEWINIT); + code[0] = JSOP_NEWOBJECT; + code[1] = jsbytecode(index >> 24); + code[2] = jsbytecode(index >> 16); + code[3] = jsbytecode(index >> 8); + code[4] = jsbytecode(index); return true; } @@ -10219,6 +10434,13 @@ BytecodeEmitter::emitClass(ParseNode* pn) return false; } } else { + // In the case of default class constructors, emit the start and end + // offsets in the source buffer as source notes so that when we + // actually make the constructor during execution, we can give it the + // correct toString output. + if (!newSrcNote3(SRC_CLASS_SPAN, ptrdiff_t(pn->pn_pos.begin), ptrdiff_t(pn->pn_pos.end))) + return false; + JSAtom *name = names ? names->innerBinding()->pn_atom : cx->names().empty; if (heritageExpression) { if (!emitAtomOp(name, JSOP_DERIVEDCONSTRUCTOR)) @@ -10273,7 +10495,8 @@ BytecodeEmitter::emitClass(ParseNode* pn) } bool -BytecodeEmitter::emitTree(ParseNode* pn, EmitLineNumberNote emitLineNote) +BytecodeEmitter::emitTree(ParseNode* pn, ValueUsage valueUsage /* = ValueUsage::WantValue */, + EmitLineNumberNote emitLineNote /* = EMIT_LINENOTE */) { JS_CHECK_RECURSION(cx, return false); @@ -10395,7 +10618,7 @@ BytecodeEmitter::emitTree(ParseNode* pn, EmitLineNumberNote emitLineNote) break; case PNK_COMMA: - if (!emitSequenceExpr(pn)) + if (!emitSequenceExpr(pn, valueUsage)) return false; break; @@ -10417,7 +10640,7 @@ BytecodeEmitter::emitTree(ParseNode* pn, EmitLineNumberNote emitLineNote) break; case PNK_CONDITIONAL: - if (!emitConditionalExpression(pn->as<ConditionalExpression>())) + if (!emitConditionalExpression(pn->as<ConditionalExpression>(), valueUsage)) return false; break; @@ -10530,7 +10753,7 @@ BytecodeEmitter::emitTree(ParseNode* pn, EmitLineNumberNote emitLineNote) case PNK_CALL: case PNK_GENEXP: case PNK_SUPERCALL: - if (!emitCallOrNew(pn)) + if (!emitCallOrNew(pn, valueUsage)) return false; break; @@ -10636,6 +10859,7 @@ BytecodeEmitter::emitTree(ParseNode* pn, EmitLineNumberNote emitLineNote) case PNK_TRUE: case PNK_FALSE: case PNK_NULL: + case PNK_RAW_UNDEFINED: if (!emit1(pn->getOp())) return false; break; @@ -10687,12 +10911,13 @@ BytecodeEmitter::emitTree(ParseNode* pn, EmitLineNumberNote emitLineNote) } bool -BytecodeEmitter::emitTreeInBranch(ParseNode* pn) +BytecodeEmitter::emitTreeInBranch(ParseNode* pn, + ValueUsage valueUsage /* = ValueUsage::WantValue */) { // Code that may be conditionally executed always need their own TDZ // cache. TDZCheckCache tdzCache(this); - return emitTree(pn); + return emitTree(pn, valueUsage); } static bool diff --git a/js/src/frontend/BytecodeEmitter.h b/js/src/frontend/BytecodeEmitter.h index 29050c846..595ee6405 100644 --- a/js/src/frontend/BytecodeEmitter.h +++ b/js/src/frontend/BytecodeEmitter.h @@ -171,6 +171,11 @@ struct JumpList { void patchAll(jsbytecode* code, JumpTarget target); }; +enum class ValueUsage { + WantValue, + IgnoreValue +}; + struct MOZ_STACK_CLASS BytecodeEmitter { class TDZCheckCache; @@ -356,7 +361,7 @@ struct MOZ_STACK_CLASS BytecodeEmitter MOZ_MUST_USE bool maybeSetSourceMap(); void tellDebuggerAboutCompiledScript(ExclusiveContext* cx); - inline TokenStream* tokenStream(); + inline TokenStream& tokenStream(); BytecodeVector& code() const { return current->code; } jsbytecode* code(ptrdiff_t offset) const { return current->code.begin() + offset; } @@ -434,10 +439,12 @@ struct MOZ_STACK_CLASS BytecodeEmitter }; // Emit code for the tree rooted at pn. - MOZ_MUST_USE bool emitTree(ParseNode* pn, EmitLineNumberNote emitLineNote = EMIT_LINENOTE); + MOZ_MUST_USE bool emitTree(ParseNode* pn, ValueUsage valueUsage = ValueUsage::WantValue, + EmitLineNumberNote emitLineNote = EMIT_LINENOTE); // Emit code for the tree rooted at pn with its own TDZ cache. - MOZ_MUST_USE bool emitTreeInBranch(ParseNode* pn); + MOZ_MUST_USE bool emitTreeInBranch(ParseNode* pn, + ValueUsage valueUsage = ValueUsage::WantValue); // Emit global, eval, or module code for tree rooted at body. Always // encompasses the entire source. @@ -533,6 +540,8 @@ struct MOZ_STACK_CLASS BytecodeEmitter MOZ_NEVER_INLINE MOZ_MUST_USE bool emitFunction(ParseNode* pn, bool needsProto = false); MOZ_NEVER_INLINE MOZ_MUST_USE bool emitObject(ParseNode* pn); + MOZ_MUST_USE bool replaceNewInitWithNewObject(JSObject* obj, ptrdiff_t offset); + MOZ_MUST_USE bool emitHoistedFunctionsInList(ParseNode* pn); MOZ_MUST_USE bool emitPropertyList(ParseNode* pn, MutableHandlePlainObject objp, @@ -660,6 +669,10 @@ struct MOZ_STACK_CLASS BytecodeEmitter // []/{} expression). MOZ_MUST_USE bool emitSetOrInitializeDestructuring(ParseNode* target, DestructuringFlavor flav); + // emitDestructuringObjRestExclusionSet emits the property exclusion set + // for the rest-property in an object pattern. + MOZ_MUST_USE bool emitDestructuringObjRestExclusionSet(ParseNode* pattern); + // emitDestructuringOps assumes the to-be-destructured value has been // pushed on the stack and emits code to destructure each part of a [] or // {} lhs expression. @@ -677,6 +690,15 @@ struct MOZ_STACK_CLASS BytecodeEmitter // object, with no overall effect on the stack. MOZ_MUST_USE bool emitRequireObjectCoercible(); + enum class CopyOption { + Filtered, Unfiltered + }; + + // Calls either the |CopyDataProperties| or the + // |CopyDataPropertiesUnfiltered| intrinsic function, consumes three (or + // two in the latter case) elements from the stack. + MOZ_MUST_USE bool emitCopyDataProperties(CopyOption option); + // emitIterator expects the iterable to already be on the stack. // It will replace that stack value with the corresponding iterator MOZ_MUST_USE bool emitIterator(); @@ -724,16 +746,18 @@ struct MOZ_STACK_CLASS BytecodeEmitter MOZ_MUST_USE bool emitRightAssociative(ParseNode* pn); MOZ_MUST_USE bool emitLeftAssociative(ParseNode* pn); MOZ_MUST_USE bool emitLogical(ParseNode* pn); - MOZ_MUST_USE bool emitSequenceExpr(ParseNode* pn); + MOZ_MUST_USE bool emitSequenceExpr(ParseNode* pn, + ValueUsage valueUsage = ValueUsage::WantValue); MOZ_NEVER_INLINE MOZ_MUST_USE bool emitIncOrDec(ParseNode* pn); - MOZ_MUST_USE bool emitConditionalExpression(ConditionalExpression& conditional); + MOZ_MUST_USE bool emitConditionalExpression(ConditionalExpression& conditional, + ValueUsage valueUsage = ValueUsage::WantValue); MOZ_MUST_USE bool isRestParameter(ParseNode* pn, bool* result); MOZ_MUST_USE bool emitOptimizeSpread(ParseNode* arg0, JumpList* jmp, bool* emitted); - MOZ_MUST_USE bool emitCallOrNew(ParseNode* pn); + MOZ_MUST_USE bool emitCallOrNew(ParseNode* pn, ValueUsage valueUsage = ValueUsage::WantValue); MOZ_MUST_USE bool emitSelfHostedCallFunction(ParseNode* pn); MOZ_MUST_USE bool emitSelfHostedResumeGenerator(ParseNode* pn); MOZ_MUST_USE bool emitSelfHostedForceInterpreter(ParseNode* pn); diff --git a/js/src/frontend/FoldConstants.cpp b/js/src/frontend/FoldConstants.cpp index 6f62ffac6..689fa02b4 100644 --- a/js/src/frontend/FoldConstants.cpp +++ b/js/src/frontend/FoldConstants.cpp @@ -378,6 +378,7 @@ ContainsHoistedDeclaration(ExclusiveContext* cx, ParseNode* node, bool* result) case PNK_TRUE: case PNK_FALSE: case PNK_NULL: + case PNK_RAW_UNDEFINED: case PNK_THIS: case PNK_ELISION: case PNK_NUMBER: @@ -468,6 +469,7 @@ IsEffectless(ParseNode* node) node->isKind(PNK_TEMPLATE_STRING) || node->isKind(PNK_NUMBER) || node->isKind(PNK_NULL) || + node->isKind(PNK_RAW_UNDEFINED) || node->isKind(PNK_FUNCTION) || node->isKind(PNK_GENEXP); } @@ -492,6 +494,7 @@ Boolish(ParseNode* pn) case PNK_FALSE: case PNK_NULL: + case PNK_RAW_UNDEFINED: return Falsy; case PNK_VOID: { @@ -1342,15 +1345,8 @@ FoldElement(ExclusiveContext* cx, ParseNode** nodePtr, Parser<FullParseHandler>& if (!name) return true; - // Also don't optimize if the name doesn't map directly to its id for TI's - // purposes. - if (NameToId(name) != IdToTypeId(NameToId(name))) - return true; - // Optimization 3: We have expr["foo"] where foo is not an index. Convert // to a property access (like expr.foo) that optimizes better downstream. - // Don't bother with this for names that TI considers to be indexes, to - // simplify downstream analysis. ParseNode* dottedAccess = parser.handler.newPropertyAccess(expr, name, node->pn_pos.end); if (!dottedAccess) return false; @@ -1643,6 +1639,7 @@ Fold(ExclusiveContext* cx, ParseNode** pnp, Parser<FullParseHandler>& parser, bo case PNK_TRUE: case PNK_FALSE: case PNK_NULL: + case PNK_RAW_UNDEFINED: case PNK_ELISION: case PNK_NUMBER: case PNK_DEBUGGER: diff --git a/js/src/frontend/FullParseHandler.h b/js/src/frontend/FullParseHandler.h index b619cf24c..2d7f57e1e 100644 --- a/js/src/frontend/FullParseHandler.h +++ b/js/src/frontend/FullParseHandler.h @@ -10,6 +10,8 @@ #include "mozilla/Attributes.h" #include "mozilla/PodOperations.h" +#include <string.h> + #include "frontend/ParseNode.h" #include "frontend/SharedContext.h" @@ -181,6 +183,10 @@ class FullParseHandler return new_<NullLiteral>(pos); } + ParseNode* newRawUndefinedLiteral(const TokenPos& pos) { + return new_<RawUndefinedLiteral>(pos); + } + // The Boxer object here is any object that can allocate ObjectBoxes. // Specifically, a Boxer has a .newObjectBox(T) method that accepts a // Rooted<RegExpObject*> argument and returns an ObjectBox*. @@ -296,10 +302,9 @@ class FullParseHandler } MOZ_MUST_USE bool addSpreadElement(ParseNode* literal, uint32_t begin, ParseNode* inner) { - TokenPos pos(begin, inner->pn_pos.end); - ParseNode* spread = new_<UnaryNode>(PNK_SPREAD, JSOP_NOP, pos, inner); + ParseNode* spread = newSpread(begin, inner); if (!spread) - return null(); + return false; literal->append(spread); literal->pn_xflags |= PNX_ARRAYHOLESPREAD | PNX_NONCONST; return true; @@ -327,8 +332,10 @@ class FullParseHandler return literal; } - ParseNode* newClass(ParseNode* name, ParseNode* heritage, ParseNode* methodBlock) { - return new_<ClassNode>(name, heritage, methodBlock); + ParseNode* newClass(ParseNode* name, ParseNode* heritage, ParseNode* methodBlock, + const TokenPos& pos) + { + return new_<ClassNode>(name, heritage, methodBlock, pos); } ParseNode* newClassMethodList(uint32_t begin) { return new_<ListNode>(PNK_CLASSMETHODLIST, TokenPos(begin, begin + 1)); @@ -388,6 +395,18 @@ class FullParseHandler return true; } + MOZ_MUST_USE bool addSpreadProperty(ParseNode* literal, uint32_t begin, ParseNode* inner) { + MOZ_ASSERT(literal->isKind(PNK_OBJECT)); + MOZ_ASSERT(literal->isArity(PN_LIST)); + + setListFlag(literal, PNX_NONCONST); + ParseNode* spread = newSpread(begin, inner); + if (!spread) + return false; + literal->append(spread); + return true; + } + MOZ_MUST_USE bool addObjectMethodDefinition(ParseNode* literal, ParseNode* key, ParseNode* fn, JSOp op) { @@ -870,29 +889,29 @@ class FullParseHandler return node->isKind(PNK_NAME); } - bool nameIsEvalAnyParentheses(ParseNode* node, ExclusiveContext* cx) { - MOZ_ASSERT(isNameAnyParentheses(node), - "must only call this function on known names"); + bool isArgumentsAnyParentheses(ParseNode* node, ExclusiveContext* cx) { + return node->isKind(PNK_NAME) && node->pn_atom == cx->names().arguments; + } - return node->pn_atom == cx->names().eval; + bool isEvalAnyParentheses(ParseNode* node, ExclusiveContext* cx) { + return node->isKind(PNK_NAME) && node->pn_atom == cx->names().eval; } const char* nameIsArgumentsEvalAnyParentheses(ParseNode* node, ExclusiveContext* cx) { MOZ_ASSERT(isNameAnyParentheses(node), "must only call this function on known names"); - if (nameIsEvalAnyParentheses(node, cx)) + if (isEvalAnyParentheses(node, cx)) return js_eval_str; - if (node->pn_atom == cx->names().arguments) + if (isArgumentsAnyParentheses(node, cx)) return js_arguments_str; return nullptr; } - bool nameIsUnparenthesizedAsync(ParseNode* node, ExclusiveContext* cx) { - MOZ_ASSERT(isNameAnyParentheses(node), - "must only call this function on known names"); - - return node->pn_atom == cx->names().async; + bool isAsyncKeyword(ParseNode* node, ExclusiveContext* cx) { + return node->isKind(PNK_NAME) && + node->pn_pos.begin + strlen("async") == node->pn_pos.end && + node->pn_atom == cx->names().async; } bool isCall(ParseNode* pn) { diff --git a/js/src/frontend/GenerateReservedWords.py b/js/src/frontend/GenerateReservedWords.py new file mode 100644 index 000000000..bd698cc5f --- /dev/null +++ b/js/src/frontend/GenerateReservedWords.py @@ -0,0 +1,213 @@ +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +import re +import sys + +def read_reserved_word_list(filename): + macro_pat = re.compile(r"^\s*macro\(([^,]+), *[^,]+, *[^\)]+\)\s*\\?$") + + reserved_word_list = [] + index = 0 + with open(filename, 'r') as f: + for line in f: + m = macro_pat.search(line) + if m: + reserved_word_list.append((index, m.group(1))) + index += 1 + + assert(len(reserved_word_list) != 0) + + return reserved_word_list + +def line(opt, s): + opt['output'].write('{}{}\n'.format(' ' * opt['indent_level'], s)) + +def indent(opt): + opt['indent_level'] += 1 + +def dedent(opt): + opt['indent_level'] -= 1 + +def span_and_count_at(reserved_word_list, column): + assert(len(reserved_word_list) != 0); + + chars_dict = {} + for index, word in reserved_word_list: + chars_dict[ord(word[column])] = True + + chars = sorted(chars_dict.keys()) + return chars[-1] - chars[0] + 1, len(chars) + +def optimal_switch_column(opt, reserved_word_list, columns, unprocessed_columns): + assert(len(reserved_word_list) != 0); + assert(unprocessed_columns != 0); + + min_count = 0 + min_span = 0 + min_count_index = 0 + min_span_index = 0 + + for index in range(0, unprocessed_columns): + span, count = span_and_count_at(reserved_word_list, columns[index]) + assert(span != 0) + + if span == 1: + assert(count == 1) + return 1, True + + assert(count != 1) + if index == 0 or min_span > span: + min_span = span + min_span_index = index + + if index == 0 or min_count > count: + min_count = count + min_count_index = index + + if min_count <= opt['use_if_threshold']: + return min_count_index, True + + return min_span_index, False + +def split_list_per_column(reserved_word_list, column): + assert(len(reserved_word_list) != 0); + + column_dict = {} + for item in reserved_word_list: + index, word = item + per_column = column_dict.setdefault(word[column], []) + per_column.append(item) + + return sorted(column_dict.items(), key=lambda (char, word): ord(char)) + +def generate_letter_switch(opt, unprocessed_columns, reserved_word_list, + columns=None): + assert(len(reserved_word_list) != 0); + + if not columns: + columns = range(0, unprocessed_columns) + + if len(reserved_word_list) == 1: + index, word = reserved_word_list[0] + + if unprocessed_columns == 0: + line(opt, 'JSRW_GOT_MATCH({}) /* {} */'.format(index, word)) + return + + if unprocessed_columns > opt['char_tail_test_threshold']: + line(opt, 'JSRW_TEST_GUESS({}) /* {} */'.format(index, word)) + return + + conds = [] + for column in columns[0:unprocessed_columns]: + quoted = repr(word[column]) + conds.append('JSRW_AT({})=={}'.format(column, quoted)) + + line(opt, 'if ({}) {{'.format(' && '.join(conds))) + + indent(opt) + line(opt, 'JSRW_GOT_MATCH({}) /* {} */'.format(index, word)) + dedent(opt) + + line(opt, '}') + line(opt, 'JSRW_NO_MATCH()') + return + + assert(unprocessed_columns != 0); + + optimal_column_index, use_if = optimal_switch_column(opt, reserved_word_list, + columns, + unprocessed_columns) + optimal_column = columns[optimal_column_index] + + # Make a copy to avoid breaking passed list. + columns = columns[:] + columns[optimal_column_index] = columns[unprocessed_columns - 1] + + list_per_column = split_list_per_column(reserved_word_list, optimal_column) + + if not use_if: + line(opt, 'switch (JSRW_AT({})) {{'.format(optimal_column)) + + for char, reserved_word_list_per_column in list_per_column: + quoted = repr(char) + if use_if: + line(opt, 'if (JSRW_AT({}) == {}) {{'.format(optimal_column, + quoted)) + else: + line(opt, ' case {}:'.format(quoted)) + + indent(opt) + generate_letter_switch(opt, unprocessed_columns - 1, + reserved_word_list_per_column, columns) + dedent(opt) + + if use_if: + line(opt, '}') + + if not use_if: + line(opt, '}') + + line(opt, 'JSRW_NO_MATCH()') + +def split_list_per_length(reserved_word_list): + assert(len(reserved_word_list) != 0); + + length_dict = {} + for item in reserved_word_list: + index, word = item + per_length = length_dict.setdefault(len(word), []) + per_length.append(item) + + return sorted(length_dict.items(), key=lambda (length, word): length) + +def generate_switch(opt, reserved_word_list): + assert(len(reserved_word_list) != 0); + + line(opt, '/*') + line(opt, ' * Generating switch for the list of {} entries:'.format(len(reserved_word_list))) + for index, word in reserved_word_list: + line(opt, ' * {}'.format(word)) + line(opt, ' */') + + list_per_length = split_list_per_length(reserved_word_list) + + use_if = False + if len(list_per_length) < opt['use_if_threshold']: + use_if = True + + if not use_if: + line(opt, 'switch (JSRW_LENGTH()) {') + + for length, reserved_word_list_per_length in list_per_length: + if use_if: + line(opt, 'if (JSRW_LENGTH() == {}) {{'.format(length)) + else: + line(opt, ' case {}:'.format(length)) + + indent(opt) + generate_letter_switch(opt, length, reserved_word_list_per_length) + dedent(opt) + + if use_if: + line(opt, '}') + + if not use_if: + line(opt, '}') + line(opt, 'JSRW_NO_MATCH()') + +def main(output, reserved_words_h): + reserved_word_list = read_reserved_word_list(reserved_words_h) + + opt = { + 'indent_level': 1, + 'use_if_threshold': 3, + 'char_tail_test_threshold': 4, + 'output': output + } + generate_switch(opt, reserved_word_list) + +if __name__ == '__main__': + main(sys.stdout, *sys.argv[1:]) diff --git a/js/src/frontend/NameAnalysisTypes.h b/js/src/frontend/NameAnalysisTypes.h index d39e177fb..2d327c827 100644 --- a/js/src/frontend/NameAnalysisTypes.h +++ b/js/src/frontend/NameAnalysisTypes.h @@ -78,6 +78,7 @@ enum class DeclarationKind : uint8_t Const, Import, BodyLevelFunction, + ModuleBodyLevelFunction, LexicalFunction, VarForAnnexBLexicalFunction, SimpleCatchParameter, @@ -95,6 +96,7 @@ DeclarationKindToBindingKind(DeclarationKind kind) case DeclarationKind::Var: case DeclarationKind::BodyLevelFunction: + case DeclarationKind::ModuleBodyLevelFunction: case DeclarationKind::VarForAnnexBLexicalFunction: case DeclarationKind::ForOfVar: return BindingKind::Var; @@ -124,6 +126,7 @@ DeclarationKindIsLexical(DeclarationKind kind) // Used in Parser to track declared names. class DeclaredNameInfo { + uint32_t pos_; DeclarationKind kind_; // If the declared name is a binding, whether the binding is closed @@ -132,8 +135,9 @@ class DeclaredNameInfo bool closedOver_; public: - explicit DeclaredNameInfo(DeclarationKind kind) - : kind_(kind), + explicit DeclaredNameInfo(DeclarationKind kind, uint32_t pos) + : pos_(pos), + kind_(kind), closedOver_(false) { } @@ -144,6 +148,12 @@ class DeclaredNameInfo return kind_; } + static const uint32_t npos = uint32_t(-1); + + uint32_t pos() const { + return pos_; + } + void alterKind(DeclarationKind kind) { kind_ = kind; } diff --git a/js/src/frontend/NameFunctions.cpp b/js/src/frontend/NameFunctions.cpp index ce1318f0b..dc54d0a88 100644 --- a/js/src/frontend/NameFunctions.cpp +++ b/js/src/frontend/NameFunctions.cpp @@ -316,7 +316,8 @@ class NameResolver return false; // Next is the callsite object node. This node only contains - // internal strings and an array -- no user-controlled expressions. + // internal strings or undefined and an array -- no user-controlled + // expressions. element = element->pn_next; #ifdef DEBUG { @@ -326,7 +327,7 @@ class NameResolver for (ParseNode* kid = array->pn_head; kid; kid = kid->pn_next) MOZ_ASSERT(kid->isKind(PNK_TEMPLATE_STRING)); for (ParseNode* next = array->pn_next; next; next = next->pn_next) - MOZ_ASSERT(next->isKind(PNK_TEMPLATE_STRING)); + MOZ_ASSERT(next->isKind(PNK_TEMPLATE_STRING) || next->isKind(PNK_RAW_UNDEFINED)); } #endif @@ -382,6 +383,7 @@ class NameResolver case PNK_TRUE: case PNK_FALSE: case PNK_NULL: + case PNK_RAW_UNDEFINED: case PNK_ELISION: case PNK_GENERATOR: case PNK_NUMBER: diff --git a/js/src/frontend/ParseNode.cpp b/js/src/frontend/ParseNode.cpp index 91f17625c..5fe64e3d3 100644 --- a/js/src/frontend/ParseNode.cpp +++ b/js/src/frontend/ParseNode.cpp @@ -190,6 +190,7 @@ PushNodeChildren(ParseNode* pn, NodeStack* stack) case PNK_TRUE: case PNK_FALSE: case PNK_NULL: + case PNK_RAW_UNDEFINED: case PNK_ELISION: case PNK_GENERATOR: case PNK_NUMBER: @@ -685,6 +686,7 @@ NullaryNode::dump() case PNK_TRUE: fprintf(stderr, "#true"); break; case PNK_FALSE: fprintf(stderr, "#false"); break; case PNK_NULL: fprintf(stderr, "#null"); break; + case PNK_RAW_UNDEFINED: fprintf(stderr, "#undefined"); break; case PNK_NUMBER: { ToCStringBuf cbuf; diff --git a/js/src/frontend/ParseNode.h b/js/src/frontend/ParseNode.h index c3523afe4..1f20f3988 100644 --- a/js/src/frontend/ParseNode.h +++ b/js/src/frontend/ParseNode.h @@ -54,6 +54,7 @@ class ObjectBox; F(TRUE) \ F(FALSE) \ F(NULL) \ + F(RAW_UNDEFINED) \ F(THIS) \ F(FUNCTION) \ F(MODULE) \ @@ -406,7 +407,8 @@ IsTypeofKind(ParseNodeKind kind) * PNK_NUMBER dval pn_dval: double value of numeric literal * PNK_TRUE, nullary pn_op: JSOp bytecode * PNK_FALSE, - * PNK_NULL + * PNK_NULL, + * PNK_RAW_UNDEFINED * * PNK_THIS, unary pn_kid: '.this' Name if function `this`, else nullptr * PNK_SUPERBASE unary pn_kid: '.this' Name @@ -686,7 +688,8 @@ class ParseNode isKind(PNK_STRING) || isKind(PNK_TRUE) || isKind(PNK_FALSE) || - isKind(PNK_NULL); + isKind(PNK_NULL) || + isKind(PNK_RAW_UNDEFINED); } /* Return true if this node appears in a Directive Prologue. */ @@ -1141,6 +1144,16 @@ class NullLiteral : public ParseNode explicit NullLiteral(const TokenPos& pos) : ParseNode(PNK_NULL, JSOP_NULL, PN_NULLARY, pos) { } }; +// This is only used internally, currently just for tagged templates. +// It represents the value 'undefined' (aka `void 0`), like NullLiteral +// represents the value 'null'. +class RawUndefinedLiteral : public ParseNode +{ + public: + explicit RawUndefinedLiteral(const TokenPos& pos) + : ParseNode(PNK_RAW_UNDEFINED, JSOP_UNDEFINED, PN_NULLARY, pos) { } +}; + class BooleanLiteral : public ParseNode { public: @@ -1296,8 +1309,9 @@ struct ClassNames : public BinaryNode { }; struct ClassNode : public TernaryNode { - ClassNode(ParseNode* names, ParseNode* heritage, ParseNode* methodsOrBlock) - : TernaryNode(PNK_CLASS, JSOP_NOP, names, heritage, methodsOrBlock) + ClassNode(ParseNode* names, ParseNode* heritage, ParseNode* methodsOrBlock, + const TokenPos& pos) + : TernaryNode(PNK_CLASS, JSOP_NOP, names, heritage, methodsOrBlock, pos) { MOZ_ASSERT_IF(names, names->is<ClassNames>()); MOZ_ASSERT(methodsOrBlock->is<LexicalScopeNode>() || @@ -1361,6 +1375,7 @@ ParseNode::isConstant() case PNK_STRING: case PNK_TEMPLATE_STRING: case PNK_NULL: + case PNK_RAW_UNDEFINED: case PNK_FALSE: case PNK_TRUE: return true; diff --git a/js/src/frontend/Parser.cpp b/js/src/frontend/Parser.cpp index 3b7a0e612..0c279591f 100644 --- a/js/src/frontend/Parser.cpp +++ b/js/src/frontend/Parser.cpp @@ -19,6 +19,8 @@ #include "frontend/Parser.h" +#include "mozilla/Sprintf.h" + #include <new> #include "jsapi.h" @@ -62,19 +64,33 @@ using AddDeclaredNamePtr = ParseContext::Scope::AddDeclaredNamePtr; using BindingIter = ParseContext::Scope::BindingIter; using UsedNamePtr = UsedNameTracker::UsedNameMap::Ptr; -/* Read a token. Report an error and return null() if that token isn't of type tt. */ -#define MUST_MATCH_TOKEN_MOD(tt, modifier, errorNumber) \ +// Read a token. Report an error and return null() if that token doesn't match +// to the condition. Do not use MUST_MATCH_TOKEN_INTERNAL directly. +#define MUST_MATCH_TOKEN_INTERNAL(cond, modifier, errorReport) \ JS_BEGIN_MACRO \ TokenKind token; \ if (!tokenStream.getToken(&token, modifier)) \ return null(); \ - if (token != tt) { \ - error(errorNumber); \ + if (!(cond)) { \ + errorReport; \ return null(); \ } \ JS_END_MACRO -#define MUST_MATCH_TOKEN(tt, errno) MUST_MATCH_TOKEN_MOD(tt, TokenStream::None, errno) +#define MUST_MATCH_TOKEN_MOD(tt, modifier, errorNumber) \ + MUST_MATCH_TOKEN_INTERNAL(token == tt, modifier, error(errorNumber)) + +#define MUST_MATCH_TOKEN(tt, errorNumber) \ + MUST_MATCH_TOKEN_MOD(tt, TokenStream::None, errorNumber) + +#define MUST_MATCH_TOKEN_FUNC_MOD(func, modifier, errorNumber) \ + MUST_MATCH_TOKEN_INTERNAL((func)(token), modifier, error(errorNumber)) + +#define MUST_MATCH_TOKEN_FUNC(func, errorNumber) \ + MUST_MATCH_TOKEN_FUNC_MOD(func, TokenStream::None, errorNumber) + +#define MUST_MATCH_TOKEN_MOD_WITH_REPORT(tt, modifier, errorReport) \ + MUST_MATCH_TOKEN_INTERNAL(token == tt, modifier, errorReport) template <class T, class U> static inline void @@ -106,6 +122,7 @@ DeclarationKindString(DeclarationKind kind) case DeclarationKind::Import: return "import"; case DeclarationKind::BodyLevelFunction: + case DeclarationKind::ModuleBodyLevelFunction: case DeclarationKind::LexicalFunction: return "function"; case DeclarationKind::VarForAnnexBLexicalFunction: @@ -127,7 +144,8 @@ StatementKindIsBraced(StatementKind kind) kind == StatementKind::Switch || kind == StatementKind::Try || kind == StatementKind::Catch || - kind == StatementKind::Finally; + kind == StatementKind::Finally || + kind == StatementKind::Class; } void @@ -189,11 +207,12 @@ ParseContext::Scope::addCatchParameters(ParseContext* pc, Scope& catchParamScope for (DeclaredNameMap::Range r = catchParamScope.declared_->all(); !r.empty(); r.popFront()) { DeclarationKind kind = r.front().value()->kind(); + uint32_t pos = r.front().value()->pos(); MOZ_ASSERT(DeclarationKindIsCatchParameter(kind)); JSAtom* name = r.front().key(); AddDeclaredNamePtr p = lookupDeclaredNameForAdd(name); MOZ_ASSERT(!p); - if (!addDeclaredName(pc, p, name, kind)) + if (!addDeclaredName(pc, p, name, kind, pos)) return false; } @@ -332,7 +351,8 @@ ParseContext::init() namedLambdaScope_->lookupDeclaredNameForAdd(fun->explicitName()); MOZ_ASSERT(!p); if (!namedLambdaScope_->addDeclaredName(this, p, fun->explicitName(), - DeclarationKind::Const)) + DeclarationKind::Const, + DeclaredNameInfo::npos)) { return false; } @@ -441,7 +461,7 @@ UsedNameTracker::rewind(RewindToken token) } FunctionBox::FunctionBox(ExclusiveContext* cx, LifoAlloc& alloc, ObjectBox* traceListHead, - JSFunction* fun, uint32_t preludeStart, + JSFunction* fun, uint32_t toStringStart, Directives directives, bool extraWarnings, GeneratorKind generatorKind, FunctionAsyncKind asyncKind) : ObjectBox(fun, traceListHead), @@ -455,7 +475,8 @@ FunctionBox::FunctionBox(ExclusiveContext* cx, LifoAlloc& alloc, ObjectBox* trac bufEnd(0), startLine(1), startColumn(0), - preludeStart(preludeStart), + toStringStart(toStringStart), + toStringEnd(0), length(0), generatorKindBits_(GeneratorKindAsBits(generatorKind)), asyncKindBits_(AsyncKindAsBits(asyncKind)), @@ -474,6 +495,7 @@ FunctionBox::FunctionBox(ExclusiveContext* cx, LifoAlloc& alloc, ObjectBox* trac usesThis(false), usesReturn(false), hasRest_(false), + isExprBody_(false), funCxFlags() { // Functions created at parse time may be set singleton after parsing and @@ -525,10 +547,16 @@ FunctionBox::initWithEnclosingParseContext(ParseContext* enclosing, FunctionSynt allowNewTarget_ = true; allowSuperProperty_ = fun->allowSuperProperty(); - if (kind == DerivedClassConstructor) { - setDerivedClassConstructor(); - allowSuperCall_ = true; - needsThisTDZChecks_ = true; + if (kind == ClassConstructor || kind == DerivedClassConstructor) { + auto stmt = enclosing->findInnermostStatement<ParseContext::ClassStatement>(); + MOZ_ASSERT(stmt); + stmt->constructorBox = this; + + if (kind == DerivedClassConstructor) { + setDerivedClassConstructor(); + allowSuperCall_ = true; + needsThisTDZChecks_ = true; + } } if (isGenexpLambda) @@ -570,97 +598,136 @@ FunctionBox::initWithEnclosingScope(Scope* enclosingScope) computeInWith(enclosingScope); } -template <typename ParseHandler> void -Parser<ParseHandler>::error(unsigned errorNumber, ...) +ParserBase::error(unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); #ifdef DEBUG bool result = #endif - tokenStream.reportCompileErrorNumberVA(pos().begin, JSREPORT_ERROR, errorNumber, args); + tokenStream.reportCompileErrorNumberVA(nullptr, pos().begin, JSREPORT_ERROR, + errorNumber, args); MOZ_ASSERT(!result, "reporting an error returned true?"); va_end(args); } -template <typename ParseHandler> void -Parser<ParseHandler>::errorAt(uint32_t offset, unsigned errorNumber, ...) +ParserBase::errorWithNotes(UniquePtr<JSErrorNotes> notes, unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); #ifdef DEBUG bool result = #endif - tokenStream.reportCompileErrorNumberVA(offset, JSREPORT_ERROR, errorNumber, args); + tokenStream.reportCompileErrorNumberVA(Move(notes), pos().begin, JSREPORT_ERROR, + errorNumber, args); + MOZ_ASSERT(!result, "reporting an error returned true?"); + va_end(args); +} + +void +ParserBase::errorAt(uint32_t offset, unsigned errorNumber, ...) +{ + va_list args; + va_start(args, errorNumber); +#ifdef DEBUG + bool result = +#endif + tokenStream.reportCompileErrorNumberVA(nullptr, offset, JSREPORT_ERROR, errorNumber, args); + MOZ_ASSERT(!result, "reporting an error returned true?"); + va_end(args); +} + +void +ParserBase::errorWithNotesAt(UniquePtr<JSErrorNotes> notes, uint32_t offset, + unsigned errorNumber, ...) +{ + va_list args; + va_start(args, errorNumber); +#ifdef DEBUG + bool result = +#endif + tokenStream.reportCompileErrorNumberVA(Move(notes), offset, JSREPORT_ERROR, + errorNumber, args); MOZ_ASSERT(!result, "reporting an error returned true?"); va_end(args); } -template <typename ParseHandler> bool -Parser<ParseHandler>::warning(unsigned errorNumber, ...) +ParserBase::warning(unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); bool result = - tokenStream.reportCompileErrorNumberVA(pos().begin, JSREPORT_WARNING, errorNumber, args); + tokenStream.reportCompileErrorNumberVA(nullptr, pos().begin, JSREPORT_WARNING, + errorNumber, args); va_end(args); return result; } -template <typename ParseHandler> bool -Parser<ParseHandler>::warningAt(uint32_t offset, unsigned errorNumber, ...) +ParserBase::warningAt(uint32_t offset, unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); bool result = - tokenStream.reportCompileErrorNumberVA(offset, JSREPORT_WARNING, errorNumber, args); + tokenStream.reportCompileErrorNumberVA(nullptr, offset, JSREPORT_WARNING, + errorNumber, args); va_end(args); return result; } -template <typename ParseHandler> bool -Parser<ParseHandler>::extraWarning(unsigned errorNumber, ...) +ParserBase::extraWarning(unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); - bool result = tokenStream.reportExtraWarningErrorNumberVA(pos().begin, errorNumber, args); + bool result = tokenStream.reportExtraWarningErrorNumberVA(nullptr, pos().begin, + errorNumber, args); va_end(args); return result; } -template <typename ParseHandler> bool -Parser<ParseHandler>::strictModeError(unsigned errorNumber, ...) +ParserBase::extraWarningAt(uint32_t offset, unsigned errorNumber, ...) +{ + va_list args; + va_start(args, errorNumber); + + bool result = + tokenStream.reportExtraWarningErrorNumberVA(nullptr, offset, errorNumber, args); + + va_end(args); + return result; +} + +bool +ParserBase::strictModeError(unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); bool res = - tokenStream.reportStrictModeErrorNumberVA(pos().begin, pc->sc()->strict(), + tokenStream.reportStrictModeErrorNumberVA(nullptr, pos().begin, pc->sc()->strict(), errorNumber, args); va_end(args); return res; } -template <typename ParseHandler> bool -Parser<ParseHandler>::strictModeErrorAt(uint32_t offset, unsigned errorNumber, ...) +ParserBase::strictModeErrorAt(uint32_t offset, unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); bool res = - tokenStream.reportStrictModeErrorNumberVA(offset, pc->sc()->strict(), errorNumber, args); + tokenStream.reportStrictModeErrorNumberVA(nullptr, offset, pc->sc()->strict(), + errorNumber, args); va_end(args); return res; } -template <typename ParseHandler> bool -Parser<ParseHandler>::reportNoOffset(ParseReportKind kind, bool strict, unsigned errorNumber, ...) +ParserBase::reportNoOffset(ParseReportKind kind, bool strict, unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); @@ -668,17 +735,21 @@ Parser<ParseHandler>::reportNoOffset(ParseReportKind kind, bool strict, unsigned uint32_t offset = TokenStream::NoOffset; switch (kind) { case ParseError: - result = tokenStream.reportCompileErrorNumberVA(offset, JSREPORT_ERROR, errorNumber, args); + result = tokenStream.reportCompileErrorNumberVA(nullptr, offset, JSREPORT_ERROR, + errorNumber, args); break; case ParseWarning: result = - tokenStream.reportCompileErrorNumberVA(offset, JSREPORT_WARNING, errorNumber, args); + tokenStream.reportCompileErrorNumberVA(nullptr, offset, JSREPORT_WARNING, + errorNumber, args); break; case ParseExtraWarning: - result = tokenStream.reportExtraWarningErrorNumberVA(offset, errorNumber, args); + result = tokenStream.reportExtraWarningErrorNumberVA(nullptr, offset, + errorNumber, args); break; case ParseStrictError: - result = tokenStream.reportStrictModeErrorNumberVA(offset, strict, errorNumber, args); + result = tokenStream.reportStrictModeErrorNumberVA(nullptr, offset, strict, + errorNumber, args); break; } va_end(args); @@ -686,7 +757,7 @@ Parser<ParseHandler>::reportNoOffset(ParseReportKind kind, bool strict, unsigned } template <> -bool +inline bool Parser<FullParseHandler>::abortIfSyntaxParser() { handler.disableSyntaxParser(); @@ -694,23 +765,21 @@ Parser<FullParseHandler>::abortIfSyntaxParser() } template <> -bool +inline bool Parser<SyntaxParseHandler>::abortIfSyntaxParser() { abortedSyntaxParse = true; return false; } -template <typename ParseHandler> -Parser<ParseHandler>::Parser(ExclusiveContext* cx, LifoAlloc& alloc, - const ReadOnlyCompileOptions& options, - const char16_t* chars, size_t length, - bool foldConstants, - UsedNameTracker& usedNames, - Parser<SyntaxParseHandler>* syntaxParser, - LazyScript* lazyOuterFunction) - : AutoGCRooter(cx, PARSER), - context(cx), +ParserBase::ParserBase(ExclusiveContext* cx, LifoAlloc& alloc, + const ReadOnlyCompileOptions& options, + const char16_t* chars, size_t length, + bool foldConstants, + UsedNameTracker& usedNames, + Parser<SyntaxParseHandler>* syntaxParser, + LazyScript* lazyOuterFunction) + : context(cx), alloc(alloc), tokenStream(cx, options, chars, length, thisForCtor()), traceListHead(nullptr), @@ -725,17 +794,44 @@ Parser<ParseHandler>::Parser(ExclusiveContext* cx, LifoAlloc& alloc, #endif abortedSyntaxParse(false), isUnexpectedEOF_(false), - handler(cx, alloc, tokenStream, syntaxParser, lazyOuterFunction) + awaitIsKeyword_(false) { cx->perThreadData->frontendCollectionPool.addActiveCompilation(); + tempPoolMark = alloc.mark(); +} + +ParserBase::~ParserBase() +{ + alloc.release(tempPoolMark); + + /* + * The parser can allocate enormous amounts of memory for large functions. + * Eagerly free the memory now (which otherwise won't be freed until the + * next GC) to avoid unnecessary OOMs. + */ + alloc.freeAllIfHugeAndUnused(); + + context->perThreadData->frontendCollectionPool.removeActiveCompilation(); +} +template <typename ParseHandler> +Parser<ParseHandler>::Parser(ExclusiveContext* cx, LifoAlloc& alloc, + const ReadOnlyCompileOptions& options, + const char16_t* chars, size_t length, + bool foldConstants, + UsedNameTracker& usedNames, + Parser<SyntaxParseHandler>* syntaxParser, + LazyScript* lazyOuterFunction) + : ParserBase(cx, alloc, options, chars, length, foldConstants, usedNames, syntaxParser, + lazyOuterFunction), + AutoGCRooter(cx, PARSER), + handler(cx, alloc, tokenStream, syntaxParser, lazyOuterFunction) +{ // The Mozilla specific JSOPTION_EXTRA_WARNINGS option adds extra warnings // which are not generated if functions are parsed lazily. Note that the // standard "use strict" does not inhibit lazy parsing. if (options.extraWarningsOption) handler.disableSyntaxParser(); - - tempPoolMark = alloc.mark(); } template<typename ParseHandler> @@ -746,26 +842,29 @@ Parser<ParseHandler>::checkOptions() checkOptionsCalled = true; #endif - if (!tokenStream.checkOptions()) - return false; - - return true; + return tokenStream.checkOptions(); } template <typename ParseHandler> Parser<ParseHandler>::~Parser() { MOZ_ASSERT(checkOptionsCalled); - alloc.release(tempPoolMark); +} - /* - * The parser can allocate enormous amounts of memory for large functions. - * Eagerly free the memory now (which otherwise won't be freed until the - * next GC) to avoid unnecessary OOMs. - */ - alloc.freeAllIfHugeAndUnused(); +template <> +void +Parser<SyntaxParseHandler>::setAwaitIsKeyword(bool isKeyword) +{ + awaitIsKeyword_ = isKeyword; +} - context->perThreadData->frontendCollectionPool.removeActiveCompilation(); +template <> +void +Parser<FullParseHandler>::setAwaitIsKeyword(bool isKeyword) +{ + awaitIsKeyword_ = isKeyword; + if (Parser<SyntaxParseHandler>* parser = handler.syntaxParser) + parser->setAwaitIsKeyword(isKeyword); } template <typename ParseHandler> @@ -795,7 +894,7 @@ Parser<ParseHandler>::newObjectBox(JSObject* obj) template <typename ParseHandler> FunctionBox* -Parser<ParseHandler>::newFunctionBox(Node fn, JSFunction* fun, uint32_t preludeStart, +Parser<ParseHandler>::newFunctionBox(Node fn, JSFunction* fun, uint32_t toStringStart, Directives inheritedDirectives, GeneratorKind generatorKind, FunctionAsyncKind asyncKind, bool tryAnnexB) @@ -811,7 +910,7 @@ Parser<ParseHandler>::newFunctionBox(Node fn, JSFunction* fun, uint32_t preludeS * function. */ FunctionBox* funbox = - alloc.new_<FunctionBox>(context, alloc, traceListHead, fun, preludeStart, + alloc.new_<FunctionBox>(context, alloc, traceListHead, fun, toStringStart, inheritedDirectives, options().extraWarningsOption, generatorKind, asyncKind); if (!funbox) { @@ -894,38 +993,17 @@ Parser<ParseHandler>::parse() /* * Strict mode forbids introducing new definitions for 'eval', 'arguments', or - * for any strict mode reserved keyword. + * for any strict mode reserved word. */ -template <typename ParseHandler> bool -Parser<ParseHandler>::isValidStrictBinding(PropertyName* name) +ParserBase::isValidStrictBinding(PropertyName* name) { return name != context->names().eval && name != context->names().arguments && name != context->names().let && name != context->names().static_ && - !(IsKeyword(name) && name != context->names().await); -} - -/* - * Check that it is permitted to introduce a binding for |name|. Use |pos| for - * reporting error locations. - */ -template <typename ParseHandler> -bool -Parser<ParseHandler>::checkStrictBinding(PropertyName* name, TokenPos pos) -{ - if (!pc->sc()->needStrictChecks()) - return true; - - if (!isValidStrictBinding(name)) { - JSAutoByteString bytes; - if (!AtomToPrintableString(context, name, &bytes)) - return false; - return strictModeErrorAt(pos.begin, JSMSG_BAD_BINDING, bytes.ptr()); - } - - return true; + name != context->names().yield && + !IsStrictReservedWord(name); } /* @@ -952,13 +1030,71 @@ Parser<ParseHandler>::hasValidSimpleStrictParameterNames() template <typename ParseHandler> void -Parser<ParseHandler>::reportRedeclaration(HandlePropertyName name, DeclarationKind kind, - TokenPos pos) +Parser<ParseHandler>::reportMissingClosing(unsigned errorNumber, unsigned noteNumber, + uint32_t openedPos) +{ + auto notes = MakeUnique<JSErrorNotes>(); + if (!notes) + return; + + uint32_t line, column; + tokenStream.srcCoords.lineNumAndColumnIndex(openedPos, &line, &column); + + const size_t MaxWidth = sizeof("4294967295"); + char columnNumber[MaxWidth]; + SprintfLiteral(columnNumber, "%" PRIu32, column); + char lineNumber[MaxWidth]; + SprintfLiteral(lineNumber, "%" PRIu32, line); + + if (!notes->addNoteASCII(pc->sc()->context, + getFilename(), line, column, + GetErrorMessage, nullptr, + noteNumber, lineNumber, columnNumber)) + { + return; + } + + errorWithNotes(Move(notes), errorNumber); +} + +template <typename ParseHandler> +void +Parser<ParseHandler>::reportRedeclaration(HandlePropertyName name, DeclarationKind prevKind, + TokenPos pos, uint32_t prevPos) { JSAutoByteString bytes; if (!AtomToPrintableString(context, name, &bytes)) return; - errorAt(pos.begin, JSMSG_REDECLARED_VAR, DeclarationKindString(kind), bytes.ptr()); + + if (prevPos == DeclaredNameInfo::npos) { + errorAt(pos.begin, JSMSG_REDECLARED_VAR, DeclarationKindString(prevKind), bytes.ptr()); + return; + } + + auto notes = MakeUnique<JSErrorNotes>(); + if (!notes) + return; + + uint32_t line, column; + tokenStream.srcCoords.lineNumAndColumnIndex(prevPos, &line, &column); + + const size_t MaxWidth = sizeof("4294967295"); + char columnNumber[MaxWidth]; + SprintfLiteral(columnNumber, "%" PRIu32, column); + char lineNumber[MaxWidth]; + SprintfLiteral(lineNumber, "%" PRIu32, line); + + if (!notes->addNoteASCII(pc->sc()->context, + getFilename(), line, column, + GetErrorMessage, nullptr, + JSMSG_REDECLARED_PREV, + lineNumber, columnNumber)) + { + return; + } + + errorWithNotesAt(Move(notes), pos.begin, JSMSG_REDECLARED_VAR, + DeclarationKindString(prevKind), bytes.ptr()); } // notePositionalFormalParameter is called for both the arguments of a regular @@ -973,6 +1109,7 @@ Parser<ParseHandler>::reportRedeclaration(HandlePropertyName name, DeclarationKi template <typename ParseHandler> bool Parser<ParseHandler>::notePositionalFormalParameter(Node fn, HandlePropertyName name, + uint32_t beginPos, bool disallowDuplicateParams, bool* duplicatedParam) { @@ -997,7 +1134,7 @@ Parser<ParseHandler>::notePositionalFormalParameter(Node fn, HandlePropertyName *duplicatedParam = true; } else { DeclarationKind kind = DeclarationKind::PositionalFormalParameter; - if (!pc->functionScope().addDeclaredName(pc, p, name, kind)) + if (!pc->functionScope().addDeclaredName(pc, p, name, kind, beginPos)) return false; } @@ -1010,9 +1147,6 @@ Parser<ParseHandler>::notePositionalFormalParameter(Node fn, HandlePropertyName if (!paramNode) return false; - if (!checkStrictBinding(name, pos())) - return false; - handler.addFunctionFormalParameter(fn, paramNode); return true; } @@ -1104,8 +1238,8 @@ DeclarationKindIsParameter(DeclarationKind kind) template <typename ParseHandler> bool -Parser<ParseHandler>::tryDeclareVar(HandlePropertyName name, DeclarationKind kind, - Maybe<DeclarationKind>* redeclaredKind) +Parser<ParseHandler>::tryDeclareVar(HandlePropertyName name, DeclarationKind kind, uint32_t beginPos, + Maybe<DeclarationKind>* redeclaredKind, uint32_t* prevPos) { MOZ_ASSERT(DeclarationKindIsVar(kind)); @@ -1178,17 +1312,29 @@ Parser<ParseHandler>::tryDeclareVar(HandlePropertyName name, DeclarationKind kin if (!annexB35Allowance && !annexB33Allowance) { *redeclaredKind = Some(declaredKind); + *prevPos = p->value()->pos(); return true; } + } else if (kind == DeclarationKind::VarForAnnexBLexicalFunction) { + MOZ_ASSERT(DeclarationKindIsParameter(declaredKind)); + + // Annex B.3.3.1 disallows redeclaring parameter names. + // We don't need to set *prevPos here since this case is not + // an error. + *redeclaredKind = Some(declaredKind); + return true; } } else { - if (!scope->addDeclaredName(pc, p, name, kind)) + if (!scope->addDeclaredName(pc, p, name, kind, beginPos)) return false; } } - if (!pc->sc()->strict() && pc->sc()->isEvalContext()) + if (!pc->sc()->strict() && pc->sc()->isEvalContext()) { *redeclaredKind = isVarRedeclaredInEval(name, kind); + // We don't have position information at runtime. + *prevPos = DeclaredNameInfo::npos; + } return true; } @@ -1196,11 +1342,34 @@ Parser<ParseHandler>::tryDeclareVar(HandlePropertyName name, DeclarationKind kin template <typename ParseHandler> bool Parser<ParseHandler>::tryDeclareVarForAnnexBLexicalFunction(HandlePropertyName name, - bool* tryAnnexB) + uint32_t beginPos, bool* tryAnnexB) { Maybe<DeclarationKind> redeclaredKind; - if (!tryDeclareVar(name, DeclarationKind::VarForAnnexBLexicalFunction, &redeclaredKind)) + uint32_t unused; + if (!tryDeclareVar(name, DeclarationKind::VarForAnnexBLexicalFunction, beginPos, + &redeclaredKind, &unused)) + { return false; + } + + if (!redeclaredKind && pc->isFunctionBox()) { + ParseContext::Scope& funScope = pc->functionScope(); + ParseContext::Scope& varScope = pc->varScope(); + if (&funScope != &varScope) { + // Annex B.3.3.1 disallows redeclaring parameter names. In the + // presence of parameter expressions, parameter names are on the + // function scope, which encloses the var scope. This means + // tryDeclareVar call above would not catch this case, so test it + // manually. + if (AddDeclaredNamePtr p = funScope.lookupDeclaredNameForAdd(name)) { + DeclarationKind declaredKind = p->value()->kind(); + if (DeclarationKindIsParameter(declaredKind)) + redeclaredKind = Some(declaredKind); + else + MOZ_ASSERT(FunctionScope::isSpecialName(context, name)); + } + } + } if (redeclaredKind) { // If an early error would have occurred, undo all the @@ -1248,25 +1417,41 @@ Parser<ParseHandler>::noteDeclaredName(HandlePropertyName name, DeclarationKind if (pc->useAsmOrInsideUseAsm()) return true; - if (!checkStrictBinding(name, pos)) - return false; - switch (kind) { case DeclarationKind::Var: case DeclarationKind::BodyLevelFunction: case DeclarationKind::ForOfVar: { Maybe<DeclarationKind> redeclaredKind; - if (!tryDeclareVar(name, kind, &redeclaredKind)) + uint32_t prevPos; + if (!tryDeclareVar(name, kind, pos.begin, &redeclaredKind, &prevPos)) return false; if (redeclaredKind) { - reportRedeclaration(name, *redeclaredKind, pos); + reportRedeclaration(name, *redeclaredKind, pos, prevPos); return false; } break; } + case DeclarationKind::ModuleBodyLevelFunction: { + MOZ_ASSERT(pc->atModuleLevel()); + + AddDeclaredNamePtr p = pc->varScope().lookupDeclaredNameForAdd(name); + if (p) { + reportRedeclaration(name, p->value()->kind(), pos, p->value()->pos()); + return false; + } + + if (!pc->varScope().addDeclaredName(pc, p, name, kind, pos.begin)) + return false; + + // Body-level functions in modules are always closed over. + pc->varScope().lookupDeclaredName(name)->value()->setClosedOver(); + + break; + } + case DeclarationKind::FormalParameter: { // It is an early error if any non-positional formal parameter name // (e.g., destructuring formal parameter) is duplicated. @@ -1277,7 +1462,7 @@ Parser<ParseHandler>::noteDeclaredName(HandlePropertyName name, DeclarationKind return false; } - if (!pc->functionScope().addDeclaredName(pc, p, name, kind)) + if (!pc->functionScope().addDeclaredName(pc, p, name, kind, pos.begin)) return false; break; @@ -1300,7 +1485,7 @@ Parser<ParseHandler>::noteDeclaredName(HandlePropertyName name, DeclarationKind (p->value()->kind() != DeclarationKind::LexicalFunction && p->value()->kind() != DeclarationKind::VarForAnnexBLexicalFunction)) { - reportRedeclaration(name, p->value()->kind(), pos); + reportRedeclaration(name, p->value()->kind(), pos, p->value()->pos()); return false; } @@ -1308,7 +1493,7 @@ Parser<ParseHandler>::noteDeclaredName(HandlePropertyName name, DeclarationKind // declaration that shadows the VarForAnnexBLexicalFunction. p->value()->alterKind(kind); } else { - if (!scope->addDeclaredName(pc, p, name, kind)) + if (!scope->addDeclaredName(pc, p, name, kind, pos.begin)) return false; } @@ -1348,7 +1533,7 @@ Parser<ParseHandler>::noteDeclaredName(HandlePropertyName name, DeclarationKind if (pc->isFunctionExtraBodyVarScopeInnermost()) { DeclaredNamePtr p = pc->functionScope().lookupDeclaredName(name); if (p && DeclarationKindIsParameter(p->value()->kind())) { - reportRedeclaration(name, p->value()->kind(), pos); + reportRedeclaration(name, p->value()->kind(), pos, p->value()->pos()); return false; } } @@ -1365,12 +1550,12 @@ Parser<ParseHandler>::noteDeclaredName(HandlePropertyName name, DeclarationKind p = scope->lookupDeclaredNameForAdd(name); MOZ_ASSERT(!p); } else { - reportRedeclaration(name, p->value()->kind(), pos); + reportRedeclaration(name, p->value()->kind(), pos, p->value()->pos()); return false; } } - if (!p && !scope->addDeclaredName(pc, p, name, kind)) + if (!p && !scope->addDeclaredName(pc, p, name, kind, pos.begin)) return false; break; @@ -1742,11 +1927,8 @@ Parser<FullParseHandler>::newFunctionScopeData(ParseContext::Scope& scope, bool case BindingKind::Var: // The only vars in the function scope when there are parameter // exprs, which induces a separate var environment, should be the - // special internal bindings. - MOZ_ASSERT_IF(hasParameterExprs, - bi.name() == context->names().arguments || - bi.name() == context->names().dotThis || - bi.name() == context->names().dotGenerator); + // special bindings. + MOZ_ASSERT_IF(hasParameterExprs, FunctionScope::isSpecialName(context, bi.name())); if (!vars.append(binding)) return Nothing(); break; @@ -2031,7 +2213,7 @@ Parser<FullParseHandler>::moduleBody(ModuleSharedContext* modulesc) if (!mn) return null(); - AutoAwaitIsKeyword awaitIsKeyword(&tokenStream, true); + AutoAwaitIsKeyword<FullParseHandler> awaitIsKeyword(this, true); ParseNode* pn = statementList(YieldIsKeyword); if (!pn) return null(); @@ -2123,8 +2305,11 @@ Parser<ParseHandler>::declareFunctionThis() ParseContext::Scope& funScope = pc->functionScope(); AddDeclaredNamePtr p = funScope.lookupDeclaredNameForAdd(dotThis); MOZ_ASSERT(!p); - if (!funScope.addDeclaredName(pc, p, dotThis, DeclarationKind::Var)) + if (!funScope.addDeclaredName(pc, p, dotThis, DeclarationKind::Var, + DeclaredNameInfo::npos)) + { return false; + } funbox->setHasThisBinding(); } @@ -2166,14 +2351,17 @@ Parser<ParseHandler>::declareDotGeneratorName() ParseContext::Scope& funScope = pc->functionScope(); HandlePropertyName dotGenerator = context->names().dotGenerator; AddDeclaredNamePtr p = funScope.lookupDeclaredNameForAdd(dotGenerator); - if (!p && !funScope.addDeclaredName(pc, p, dotGenerator, DeclarationKind::Var)) + if (!p && !funScope.addDeclaredName(pc, p, dotGenerator, DeclarationKind::Var, + DeclaredNameInfo::npos)) + { return false; + } return true; } template <typename ParseHandler> bool -Parser<ParseHandler>::finishFunctionScopes() +Parser<ParseHandler>::finishFunctionScopes(bool isStandaloneFunction) { FunctionBox* funbox = pc->functionBox(); @@ -2182,7 +2370,7 @@ Parser<ParseHandler>::finishFunctionScopes() return false; } - if (funbox->function()->isNamedLambda()) { + if (funbox->function()->isNamedLambda() && !isStandaloneFunction) { if (!propagateFreeNamesAndMarkClosedOverBindings(pc->namedLambdaScope())) return false; } @@ -2192,9 +2380,9 @@ Parser<ParseHandler>::finishFunctionScopes() template <> bool -Parser<FullParseHandler>::finishFunction() +Parser<FullParseHandler>::finishFunction(bool isStandaloneFunction /* = false */) { - if (!finishFunctionScopes()) + if (!finishFunctionScopes(isStandaloneFunction)) return false; FunctionBox* funbox = pc->functionBox(); @@ -2215,7 +2403,7 @@ Parser<FullParseHandler>::finishFunction() funbox->functionScopeBindings().set(*bindings); } - if (funbox->function()->isNamedLambda()) { + if (funbox->function()->isNamedLambda() && !isStandaloneFunction) { Maybe<LexicalScope::Data*> bindings = newLexicalScopeData(pc->namedLambdaScope()); if (!bindings) return false; @@ -2227,14 +2415,14 @@ Parser<FullParseHandler>::finishFunction() template <> bool -Parser<SyntaxParseHandler>::finishFunction() +Parser<SyntaxParseHandler>::finishFunction(bool isStandaloneFunction /* = false */) { // The LazyScript for a lazily parsed function needs to know its set of // free variables and inner functions so that when it is fully parsed, we // can skip over any already syntax parsed inner functions and still // retain correct scope information. - if (!finishFunctionScopes()) + if (!finishFunctionScopes(isStandaloneFunction)) return false; // There are too many bindings or inner functions to be saved into the @@ -2251,7 +2439,7 @@ Parser<SyntaxParseHandler>::finishFunction() LazyScript* lazy = LazyScript::Create(context, fun, pc->closedOverBindingsForLazy(), pc->innerFunctionsForLazy, versionNumber(), funbox->bufStart, funbox->bufEnd, - funbox->preludeStart, + funbox->toStringStart, funbox->startLine, funbox->startColumn); if (!lazy) return false; @@ -2264,6 +2452,8 @@ Parser<SyntaxParseHandler>::finishFunction() lazy->setAsyncKind(funbox->asyncKind()); if (funbox->hasRest()) lazy->setHasRest(); + if (funbox->isExprBody()) + lazy->setIsExprBody(); if (funbox->isLikelyConstructorWrapper()) lazy->setLikelyConstructorWrapper(); if (funbox->isDerivedClassConstructor()) @@ -2340,7 +2530,7 @@ Parser<FullParseHandler>::standaloneFunction(HandleFunction fun, return null(); fn->pn_body = argsbody; - FunctionBox* funbox = newFunctionBox(fn, fun, /* preludeStart = */ 0, inheritedDirectives, + FunctionBox* funbox = newFunctionBox(fn, fun, /* toStringStart = */ 0, inheritedDirectives, generatorKind, asyncKind, /* tryAnnexB = */ false); if (!funbox) return null(); @@ -2352,9 +2542,9 @@ Parser<FullParseHandler>::standaloneFunction(HandleFunction fun, funpc.setIsStandaloneFunctionBody(); YieldHandling yieldHandling = GetYieldHandling(generatorKind, asyncKind); - AutoAwaitIsKeyword awaitIsKeyword(&tokenStream, asyncKind == AsyncFunction); + AutoAwaitIsKeyword<FullParseHandler> awaitIsKeyword(this, asyncKind == AsyncFunction); if (!functionFormalParametersAndBody(InAllowed, yieldHandling, fn, Statement, - parameterListEnd)) + parameterListEnd, /* isStandaloneFunction = */ true)) { return null(); } @@ -2414,8 +2604,11 @@ Parser<ParseHandler>::declareFunctionArgumentsObject() if (tryDeclareArguments) { AddDeclaredNamePtr p = funScope.lookupDeclaredNameForAdd(argumentsName); if (!p) { - if (!funScope.addDeclaredName(pc, p, argumentsName, DeclarationKind::Var)) + if (!funScope.addDeclaredName(pc, p, argumentsName, DeclarationKind::Var, + DeclaredNameInfo::npos)) + { return false; + } funbox->declaredArguments = true; funbox->usesArguments = true; } else if (hasExtraBodyVarScope) { @@ -2631,39 +2824,59 @@ Parser<ParseHandler>::newFunction(HandleAtom atom, FunctionSyntaxKind kind, /* * WARNING: Do not call this function directly. - * Call either MatchOrInsertSemicolonAfterExpression or - * MatchOrInsertSemicolonAfterNonExpression instead, depending on context. + * Call either matchOrInsertSemicolonAfterExpression or + * matchOrInsertSemicolonAfterNonExpression instead, depending on context. */ -static bool -MatchOrInsertSemicolonHelper(TokenStream& ts, TokenStream::Modifier modifier) +template <typename ParseHandler> +bool +Parser<ParseHandler>::matchOrInsertSemicolonHelper(TokenStream::Modifier modifier) { TokenKind tt = TOK_EOF; - if (!ts.peekTokenSameLine(&tt, modifier)) + if (!tokenStream.peekTokenSameLine(&tt, modifier)) return false; if (tt != TOK_EOF && tt != TOK_EOL && tt != TOK_SEMI && tt != TOK_RC) { + /* + * When current token is `await` and it's outside of async function, + * it's possibly intended to be an await expression. + * + * await f(); + * ^ + * | + * tried to insert semicolon here + * + * Detect this situation and throw an understandable error. Otherwise + * we'd throw a confusing "missing ; before statement" error. + */ + if (!pc->isAsync() && tokenStream.currentToken().type == TOK_AWAIT) { + error(JSMSG_AWAIT_OUTSIDE_ASYNC); + return false; + } + /* Advance the scanner for proper error location reporting. */ - ts.consumeKnownToken(tt, modifier); - ts.reportError(JSMSG_SEMI_BEFORE_STMNT); + tokenStream.consumeKnownToken(tt, modifier); + error(JSMSG_SEMI_BEFORE_STMNT); return false; } bool matched; - if (!ts.matchToken(&matched, TOK_SEMI, modifier)) + if (!tokenStream.matchToken(&matched, TOK_SEMI, modifier)) return false; if (!matched && modifier == TokenStream::None) - ts.addModifierException(TokenStream::OperandIsNone); + tokenStream.addModifierException(TokenStream::OperandIsNone); return true; } -static bool -MatchOrInsertSemicolonAfterExpression(TokenStream& ts) +template <typename ParseHandler> +bool +Parser<ParseHandler>::matchOrInsertSemicolonAfterExpression() { - return MatchOrInsertSemicolonHelper(ts, TokenStream::None); + return matchOrInsertSemicolonHelper(TokenStream::None); } -static bool -MatchOrInsertSemicolonAfterNonExpression(TokenStream& ts) +template <typename ParseHandler> +bool +Parser<ParseHandler>::matchOrInsertSemicolonAfterNonExpression() { - return MatchOrInsertSemicolonHelper(ts, TokenStream::Operand); + return matchOrInsertSemicolonHelper(TokenStream::Operand); } template <typename ParseHandler> @@ -2757,7 +2970,7 @@ Parser<ParseHandler>::functionArguments(YieldHandling yieldHandling, FunctionSyn firstTokenModifier = funbox->isAsync() ? TokenStream::None : TokenStream::Operand; if (!tokenStream.peekToken(&tt, firstTokenModifier)) return false; - if (tt == TOK_NAME || tt == TOK_YIELD) { + if (TokenKindIsPossibleIdentifier(tt)) { parenFreeArrow = true; argModifier = firstTokenModifier; } @@ -2813,7 +3026,7 @@ Parser<ParseHandler>::functionArguments(YieldHandling yieldHandling, FunctionSyn if (!tokenStream.getToken(&tt, argModifier)) return false; argModifier = TokenStream::Operand; - MOZ_ASSERT_IF(parenFreeArrow, tt == TOK_NAME || tt == TOK_YIELD); + MOZ_ASSERT_IF(parenFreeArrow, TokenKindIsPossibleIdentifier(tt)); if (tt == TOK_TRIPLEDOT) { if (IsSetterKind(kind)) { @@ -2834,7 +3047,7 @@ Parser<ParseHandler>::functionArguments(YieldHandling yieldHandling, FunctionSyn if (!tokenStream.getToken(&tt)) return false; - if (tt != TOK_NAME && tt != TOK_YIELD && tt != TOK_LB && tt != TOK_LC) { + if (!TokenKindIsPossibleIdentifier(tt) && tt != TOK_LB && tt != TOK_LC) { error(JSMSG_NO_REST_NAME); return false; } @@ -2864,26 +3077,21 @@ Parser<ParseHandler>::functionArguments(YieldHandling yieldHandling, FunctionSyn break; } - case TOK_NAME: - case TOK_YIELD: { - if (parenFreeArrow) - funbox->setStart(tokenStream); - - if (funbox->isAsync() && tokenStream.currentName() == context->names().await) { - // `await` is already gotten as TOK_NAME for the following - // case: - // - // async await => 1 - error(JSMSG_RESERVED_ID, "await"); + default: { + if (!TokenKindIsPossibleIdentifier(tt)) { + error(JSMSG_MISSING_FORMAL); return false; } + if (parenFreeArrow) + funbox->setStart(tokenStream); + RootedPropertyName name(context, bindingIdentifier(yieldHandling)); if (!name) return false; - if (!notePositionalFormalParameter(funcpn, name, disallowDuplicateParams, - &duplicatedParam)) + if (!notePositionalFormalParameter(funcpn, name, pos().begin, + disallowDuplicateParams, &duplicatedParam)) { return false; } @@ -2892,10 +3100,6 @@ Parser<ParseHandler>::functionArguments(YieldHandling yieldHandling, FunctionSyn break; } - - default: - error(JSMSG_MISSING_FORMAL); - return false; } if (positionalFormals.length() >= ARGNO_LIMIT) { @@ -2989,7 +3193,7 @@ Parser<ParseHandler>::functionArguments(YieldHandling yieldHandling, FunctionSyn template <> bool -Parser<FullParseHandler>::skipLazyInnerFunction(ParseNode* pn, uint32_t preludeStart, +Parser<FullParseHandler>::skipLazyInnerFunction(ParseNode* pn, uint32_t toStringStart, FunctionSyntaxKind kind, bool tryAnnexB) { // When a lazily-parsed function is called, we only fully parse (and emit) @@ -2999,7 +3203,7 @@ Parser<FullParseHandler>::skipLazyInnerFunction(ParseNode* pn, uint32_t preludeS RootedFunction fun(context, handler.nextLazyInnerFunction()); MOZ_ASSERT(!fun->isLegacyGenerator()); - FunctionBox* funbox = newFunctionBox(pn, fun, preludeStart, Directives(/* strict = */ false), + FunctionBox* funbox = newFunctionBox(pn, fun, toStringStart, Directives(/* strict = */ false), fun->generatorKind(), fun->asyncKind(), tryAnnexB); if (!funbox) return false; @@ -3007,6 +3211,8 @@ Parser<FullParseHandler>::skipLazyInnerFunction(ParseNode* pn, uint32_t preludeS LazyScript* lazy = fun->lazyScript(); if (lazy->needsHomeObject()) funbox->setNeedsHomeObject(); + if (lazy->isExprBody()) + funbox->setIsExprBody(); PropagateTransitiveParseFlags(lazy, pc->sc()); @@ -3019,17 +3225,22 @@ Parser<FullParseHandler>::skipLazyInnerFunction(ParseNode* pn, uint32_t preludeS if (!tokenStream.advance(fun->lazyScript()->end() - userbufBase)) return false; - if (kind == Statement && fun->isExprBody()) { - if (!MatchOrInsertSemicolonAfterExpression(tokenStream)) +#if JS_HAS_EXPR_CLOSURES + // Only expression closure can be Statement kind. + // If we remove expression closure, we can remove isExprBody flag from + // LazyScript and JSScript. + if (kind == Statement && funbox->isExprBody()) { + if (!matchOrInsertSemicolonAfterExpression()) return false; } +#endif return true; } template <> bool -Parser<SyntaxParseHandler>::skipLazyInnerFunction(Node pn, uint32_t preludeStart, +Parser<SyntaxParseHandler>::skipLazyInnerFunction(Node pn, uint32_t toStringStart, FunctionSyntaxKind kind, bool tryAnnexB) { MOZ_CRASH("Cannot skip lazy inner functions when syntax parsing"); @@ -3082,7 +3293,7 @@ template <typename ParseHandler> typename ParseHandler::Node Parser<ParseHandler>::templateLiteral(YieldHandling yieldHandling) { - Node pn = noSubstitutionTemplate(); + Node pn = noSubstitutionUntaggedTemplate(); if (!pn) return null(); @@ -3095,7 +3306,7 @@ Parser<ParseHandler>::templateLiteral(YieldHandling yieldHandling) if (!addExprAndGetNextTemplStrToken(yieldHandling, nodeList, &tt)) return null(); - pn = noSubstitutionTemplate(); + pn = noSubstitutionUntaggedTemplate(); if (!pn) return null(); @@ -3106,7 +3317,7 @@ Parser<ParseHandler>::templateLiteral(YieldHandling yieldHandling) template <typename ParseHandler> typename ParseHandler::Node -Parser<ParseHandler>::functionDefinition(uint32_t preludeStart, Node pn, InHandling inHandling, +Parser<ParseHandler>::functionDefinition(uint32_t toStringStart, Node pn, InHandling inHandling, YieldHandling yieldHandling, HandleAtom funName, FunctionSyntaxKind kind, GeneratorKind generatorKind, FunctionAsyncKind asyncKind, @@ -3119,7 +3330,7 @@ Parser<ParseHandler>::functionDefinition(uint32_t preludeStart, Node pn, InHandl // functions, which are also lazy. Instead, their free variables and // source extents are recorded and may be skipped. if (handler.canSkipLazyInnerFunctions()) { - if (!skipLazyInnerFunction(pn, preludeStart, kind, tryAnnexB)) + if (!skipLazyInnerFunction(pn, toStringStart, kind, tryAnnexB)) return null(); return pn; } @@ -3152,7 +3363,7 @@ Parser<ParseHandler>::functionDefinition(uint32_t preludeStart, Node pn, InHandl // reparse a function due to failed syntax parsing and encountering new // "use foo" directives. while (true) { - if (trySyntaxParseInnerFunction(pn, fun, preludeStart, inHandling, yieldHandling, kind, + if (trySyntaxParseInnerFunction(pn, fun, toStringStart, inHandling, yieldHandling, kind, generatorKind, asyncKind, tryAnnexB, directives, &newDirectives)) { @@ -3181,7 +3392,7 @@ Parser<ParseHandler>::functionDefinition(uint32_t preludeStart, Node pn, InHandl template <> bool Parser<FullParseHandler>::trySyntaxParseInnerFunction(ParseNode* pn, HandleFunction fun, - uint32_t preludeStart, + uint32_t toStringStart, InHandling inHandling, YieldHandling yieldHandling, FunctionSyntaxKind kind, @@ -3215,13 +3426,13 @@ Parser<FullParseHandler>::trySyntaxParseInnerFunction(ParseNode* pn, HandleFunct // Make a FunctionBox before we enter the syntax parser, because |pn| // still expects a FunctionBox to be attached to it during BCE, and // the syntax parser cannot attach one to it. - FunctionBox* funbox = newFunctionBox(pn, fun, preludeStart, inheritedDirectives, + FunctionBox* funbox = newFunctionBox(pn, fun, toStringStart, inheritedDirectives, generatorKind, asyncKind, tryAnnexB); if (!funbox) return false; funbox->initWithEnclosingParseContext(pc, kind); - if (!parser->innerFunction(SyntaxParseHandler::NodeGeneric, pc, funbox, preludeStart, + if (!parser->innerFunction(SyntaxParseHandler::NodeGeneric, pc, funbox, toStringStart, inHandling, yieldHandling, kind, inheritedDirectives, newDirectives)) { @@ -3249,14 +3460,14 @@ Parser<FullParseHandler>::trySyntaxParseInnerFunction(ParseNode* pn, HandleFunct } while (false); // We failed to do a syntax parse above, so do the full parse. - return innerFunction(pn, pc, fun, preludeStart, inHandling, yieldHandling, kind, + return innerFunction(pn, pc, fun, toStringStart, inHandling, yieldHandling, kind, generatorKind, asyncKind, tryAnnexB, inheritedDirectives, newDirectives); } template <> bool Parser<SyntaxParseHandler>::trySyntaxParseInnerFunction(Node pn, HandleFunction fun, - uint32_t preludeStart, + uint32_t toStringStart, InHandling inHandling, YieldHandling yieldHandling, FunctionSyntaxKind kind, @@ -3267,14 +3478,14 @@ Parser<SyntaxParseHandler>::trySyntaxParseInnerFunction(Node pn, HandleFunction Directives* newDirectives) { // This is already a syntax parser, so just parse the inner function. - return innerFunction(pn, pc, fun, preludeStart, inHandling, yieldHandling, kind, + return innerFunction(pn, pc, fun, toStringStart, inHandling, yieldHandling, kind, generatorKind, asyncKind, tryAnnexB, inheritedDirectives, newDirectives); } template <typename ParseHandler> bool Parser<ParseHandler>::innerFunction(Node pn, ParseContext* outerpc, FunctionBox* funbox, - uint32_t preludeStart, + uint32_t toStringStart, InHandling inHandling, YieldHandling yieldHandling, FunctionSyntaxKind kind, Directives inheritedDirectives, Directives* newDirectives) @@ -3298,7 +3509,7 @@ Parser<ParseHandler>::innerFunction(Node pn, ParseContext* outerpc, FunctionBox* template <typename ParseHandler> bool Parser<ParseHandler>::innerFunction(Node pn, ParseContext* outerpc, HandleFunction fun, - uint32_t preludeStart, + uint32_t toStringStart, InHandling inHandling, YieldHandling yieldHandling, FunctionSyntaxKind kind, GeneratorKind generatorKind, FunctionAsyncKind asyncKind, @@ -3310,13 +3521,13 @@ Parser<ParseHandler>::innerFunction(Node pn, ParseContext* outerpc, HandleFuncti // parser. In that case, outerpc is a ParseContext from the full parser // instead of the current top of the stack of the syntax parser. - FunctionBox* funbox = newFunctionBox(pn, fun, preludeStart, inheritedDirectives, + FunctionBox* funbox = newFunctionBox(pn, fun, toStringStart, inheritedDirectives, generatorKind, asyncKind, tryAnnexB); if (!funbox) return false; funbox->initWithEnclosingParseContext(outerpc, kind); - return innerFunction(pn, outerpc, funbox, preludeStart, inHandling, yieldHandling, kind, + return innerFunction(pn, outerpc, funbox, toStringStart, inHandling, yieldHandling, kind, inheritedDirectives, newDirectives); } @@ -3324,7 +3535,7 @@ template <typename ParseHandler> bool Parser<ParseHandler>::appendToCallSiteObj(Node callSiteObj) { - Node cookedNode = noSubstitutionTemplate(); + Node cookedNode = noSubstitutionTaggedTemplate(); if (!cookedNode) return false; @@ -3352,7 +3563,7 @@ Parser<FullParseHandler>::standaloneLazyFunction(HandleFunction fun, bool strict return null(); Directives directives(strict); - FunctionBox* funbox = newFunctionBox(pn, fun, /* preludeStart = */ 0, directives, + FunctionBox* funbox = newFunctionBox(pn, fun, /* toStringStart = */ 0, directives, generatorKind, asyncKind, /* tryAnnexB = */ false); if (!funbox) return null(); @@ -3402,7 +3613,8 @@ bool Parser<ParseHandler>::functionFormalParametersAndBody(InHandling inHandling, YieldHandling yieldHandling, Node pn, FunctionSyntaxKind kind, - Maybe<uint32_t> parameterListEnd /* = Nothing() */) + Maybe<uint32_t> parameterListEnd /* = Nothing() */, + bool isStandaloneFunction /* = false */) { // Given a properly initialized parse context, try to parse an actual // function without concern for conversion to strict mode, use of lazy @@ -3411,9 +3623,14 @@ Parser<ParseHandler>::functionFormalParametersAndBody(InHandling inHandling, FunctionBox* funbox = pc->functionBox(); RootedFunction fun(context, funbox->function()); - AutoAwaitIsKeyword awaitIsKeyword(&tokenStream, funbox->isAsync()); - if (!functionArguments(yieldHandling, kind, pn)) - return false; + // See below for an explanation why arrow function parameters and arrow + // function bodies are parsed with different yield/await settings. + { + bool asyncOrArrowInAsync = funbox->isAsync() || (kind == Arrow && awaitIsKeyword()); + AutoAwaitIsKeyword<ParseHandler> awaitIsKeyword(this, asyncOrArrowInAsync); + if (!functionArguments(yieldHandling, kind, pn)) + return false; + } Maybe<ParseContext::VarScope> varScope; if (funbox->hasParameterExprs) { @@ -3446,6 +3663,7 @@ Parser<ParseHandler>::functionFormalParametersAndBody(InHandling inHandling, TokenKind tt; if (!tokenStream.getToken(&tt, TokenStream::Operand)) return false; + uint32_t openedPos = 0; if (tt != TOK_LC) { if ((funbox->isStarGenerator() && !funbox->isAsync()) || kind == Method || kind == GetterNoExpressionClosure || kind == SetterNoExpressionClosure || @@ -3466,9 +3684,9 @@ Parser<ParseHandler>::functionFormalParametersAndBody(InHandling inHandling, tokenStream.ungetToken(); bodyType = ExpressionBody; -#if JS_HAS_EXPR_CLOSURES - fun->setIsExprBody(); -#endif + funbox->setIsExprBody(); + } else { + openedPos = pos().begin; } // Arrow function parameters inherit yieldHandling from the enclosing @@ -3476,41 +3694,59 @@ Parser<ParseHandler>::functionFormalParametersAndBody(InHandling inHandling, // |yield| in the parameters is either a name or keyword, depending on // whether the arrow function is enclosed in a generator function or not. // Whereas the |yield| in the function body is always parsed as a name. + // The same goes when parsing |await| in arrow functions. YieldHandling bodyYieldHandling = GetYieldHandling(pc->generatorKind(), pc->asyncKind()); - Node body = functionBody(inHandling, bodyYieldHandling, kind, bodyType); - if (!body) - return false; + Node body; + { + AutoAwaitIsKeyword<ParseHandler> awaitIsKeyword(this, funbox->isAsync()); + body = functionBody(inHandling, bodyYieldHandling, kind, bodyType); + if (!body) + return false; + } - if ((kind != Method && !IsConstructorKind(kind)) && fun->explicitName()) { + if ((kind == Statement || kind == Expression) && fun->explicitName()) { RootedPropertyName propertyName(context, fun->explicitName()->asPropertyName()); - if (!checkStrictBinding(propertyName, handler.getPosition(pn))) + YieldHandling nameYieldHandling; + if (kind == Expression) { + // Named lambda has binding inside it. + nameYieldHandling = bodyYieldHandling; + } else { + // Otherwise YieldHandling cannot be checked at this point + // because of different context. + // It should already be checked before this point. + nameYieldHandling = YieldIsName; + } + + // We already use the correct await-handling at this point, therefore + // we don't need call AutoAwaitIsKeyword here. + + if (!checkBindingIdentifier(propertyName, handler.getPosition(pn).begin, + nameYieldHandling)) + { return false; + } } if (bodyType == StatementListBody) { - bool matched; - if (!tokenStream.matchToken(&matched, TOK_RC, TokenStream::Operand)) - return false; - if (!matched) { - error(JSMSG_CURLY_AFTER_BODY); - return false; - } - funbox->bufEnd = pos().end; + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RC, TokenStream::Operand, + reportMissingClosing(JSMSG_CURLY_AFTER_BODY, + JSMSG_CURLY_OPENED, openedPos)); + funbox->setEnd(pos().end); } else { #if !JS_HAS_EXPR_CLOSURES MOZ_ASSERT(kind == Arrow); #endif if (tokenStream.hadError()) return false; - funbox->bufEnd = pos().end; - if (kind == Statement && !MatchOrInsertSemicolonAfterExpression(tokenStream)) + funbox->setEnd(pos().end); + if (kind == Statement && !matchOrInsertSemicolonAfterExpression()) return false; } if (IsMethodDefinitionKind(kind) && pc->superScopeNeedsHomeObject()) funbox->setNeedsHomeObject(); - if (!finishFunction()) + if (!finishFunction(isStandaloneFunction)) return false; handler.setEndPosition(body, pos().begin); @@ -3522,26 +3758,11 @@ Parser<ParseHandler>::functionFormalParametersAndBody(InHandling inHandling, template <typename ParseHandler> typename ParseHandler::Node -Parser<ParseHandler>::functionStmt(uint32_t preludeStart, YieldHandling yieldHandling, +Parser<ParseHandler>::functionStmt(uint32_t toStringStart, YieldHandling yieldHandling, DefaultHandling defaultHandling, FunctionAsyncKind asyncKind) { MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_FUNCTION)); - // Annex B.3.4 says we can parse function declarations unbraced under if - // or else as if it were braced. That is, |if (x) function f() {}| is - // parsed as |if (x) { function f() {} }|. - Maybe<ParseContext::Statement> synthesizedStmtForAnnexB; - Maybe<ParseContext::Scope> synthesizedScopeForAnnexB; - if (!pc->sc()->strict()) { - ParseContext::Statement* stmt = pc->innermostStatement(); - if (stmt && stmt->kind() == StatementKind::If) { - synthesizedStmtForAnnexB.emplace(pc, StatementKind::Block); - synthesizedScopeForAnnexB.emplace(this); - if (!synthesizedScopeForAnnexB->init(pc)) - return null(); - } - } - // In sloppy mode, Annex B.3.2 allows labelled function declarations. // Otherwise it's a parse error. ParseContext::Statement* declaredInStmt = pc->innermostStatement(); @@ -3577,7 +3798,7 @@ Parser<ParseHandler>::functionStmt(uint32_t preludeStart, YieldHandling yieldHan } RootedPropertyName name(context); - if (tt == TOK_NAME || tt == TOK_YIELD) { + if (TokenKindIsPossibleIdentifier(tt)) { name = bindingIdentifier(yieldHandling); if (!name) return null(); @@ -3602,19 +3823,18 @@ Parser<ParseHandler>::functionStmt(uint32_t preludeStart, YieldHandling yieldHan // early error, do so. This 'var' binding would be assigned // the function object when its declaration is reached, not at // the start of the block. - if (!tryDeclareVarForAnnexBLexicalFunction(name, &tryAnnexB)) + if (!tryDeclareVarForAnnexBLexicalFunction(name, pos().begin, &tryAnnexB)) return null(); } if (!noteDeclaredName(name, DeclarationKind::LexicalFunction, pos())) return null(); } else { - if (!noteDeclaredName(name, DeclarationKind::BodyLevelFunction, pos())) + DeclarationKind kind = pc->atModuleLevel() + ? DeclarationKind::ModuleBodyLevelFunction + : DeclarationKind::BodyLevelFunction; + if (!noteDeclaredName(name, kind, pos())) return null(); - - // Body-level functions in modules are always closed over. - if (pc->atModuleLevel()) - pc->varScope().lookupDeclaredName(name)->value()->setClosedOver(); } Node pn = handler.newFunctionStatement(); @@ -3622,30 +3842,18 @@ Parser<ParseHandler>::functionStmt(uint32_t preludeStart, YieldHandling yieldHan return null(); YieldHandling newYieldHandling = GetYieldHandling(generatorKind, asyncKind); - Node fun = functionDefinition(preludeStart, pn, InAllowed, newYieldHandling, + return functionDefinition(toStringStart, pn, InAllowed, newYieldHandling, name, Statement, generatorKind, asyncKind, tryAnnexB); - if (!fun) - return null(); - - if (synthesizedStmtForAnnexB) { - Node synthesizedStmtList = handler.newStatementList(handler.getPosition(fun)); - if (!synthesizedStmtList) - return null(); - handler.addStatementToList(synthesizedStmtList, fun); - return finishLexicalScope(*synthesizedScopeForAnnexB, synthesizedStmtList); - } - - return fun; } template <typename ParseHandler> typename ParseHandler::Node -Parser<ParseHandler>::functionExpr(uint32_t preludeStart, InvokedPrediction invoked, +Parser<ParseHandler>::functionExpr(uint32_t toStringStart, InvokedPrediction invoked, FunctionAsyncKind asyncKind) { MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_FUNCTION)); - AutoAwaitIsKeyword awaitIsKeyword(&tokenStream, asyncKind == AsyncFunction); + AutoAwaitIsKeyword<ParseHandler> awaitIsKeyword(this, asyncKind == AsyncFunction); GeneratorKind generatorKind = asyncKind == AsyncFunction ? StarGenerator : NotGenerator; TokenKind tt; if (!tokenStream.getToken(&tt)) @@ -3664,7 +3872,7 @@ Parser<ParseHandler>::functionExpr(uint32_t preludeStart, InvokedPrediction invo YieldHandling yieldHandling = GetYieldHandling(generatorKind, asyncKind); RootedPropertyName name(context); - if (tt == TOK_NAME || tt == TOK_YIELD) { + if (TokenKindIsPossibleIdentifier(tt)) { name = bindingIdentifier(yieldHandling); if (!name) return null(); @@ -3679,7 +3887,7 @@ Parser<ParseHandler>::functionExpr(uint32_t preludeStart, InvokedPrediction invo if (invoked) pn = handler.setLikelyIIFE(pn); - return functionDefinition(preludeStart, pn, InAllowed, yieldHandling, name, Expression, + return functionDefinition(toStringStart, pn, InAllowed, yieldHandling, name, Expression, generatorKind, asyncKind); } @@ -3701,18 +3909,6 @@ IsEscapeFreeStringLiteral(const TokenPos& pos, JSAtom* str) return pos.begin + str->length() + 2 == pos.end; } -template <typename ParseHandler> -bool -Parser<ParseHandler>::checkUnescapedName() -{ - const Token& token = tokenStream.currentToken(); - if (!token.nameContainsEscape()) - return true; - - errorAt(token.pos.begin, JSMSG_ESCAPED_KEYWORD); - return false; -} - template <> bool Parser<SyntaxParseHandler>::asmJS(Node list) @@ -3931,7 +4127,7 @@ Parser<ParseHandler>::matchLabel(YieldHandling yieldHandling, MutableHandle<Prop if (!tokenStream.peekTokenSameLine(&tt, TokenStream::Operand)) return false; - if (tt == TOK_NAME || tt == TOK_YIELD) { + if (TokenKindIsPossibleIdentifier(tt)) { tokenStream.consumeKnownToken(tt, TokenStream::Operand); label.set(labelIdentifier(yieldHandling)); @@ -3954,8 +4150,17 @@ Parser<ParseHandler>::PossibleError::error(ErrorKind kind) { if (kind == ErrorKind::Expression) return exprError_; - MOZ_ASSERT(kind == ErrorKind::Destructuring); - return destructuringError_; + if (kind == ErrorKind::Destructuring) + return destructuringError_; + MOZ_ASSERT(kind == ErrorKind::DestructuringWarning); + return destructuringWarning_; +} + +template <typename ParseHandler> +bool +Parser<ParseHandler>::PossibleError::hasPendingDestructuringError() +{ + return hasError(ErrorKind::Destructuring); } template <typename ParseHandler> @@ -3999,6 +4204,14 @@ Parser<ParseHandler>::PossibleError::setPendingDestructuringErrorAt(const TokenP template <typename ParseHandler> void +Parser<ParseHandler>::PossibleError::setPendingDestructuringWarningAt(const TokenPos& pos, + unsigned errorNumber) +{ + setPending(ErrorKind::DestructuringWarning, pos, errorNumber); +} + +template <typename ParseHandler> +void Parser<ParseHandler>::PossibleError::setPendingExpressionErrorAt(const TokenPos& pos, unsigned errorNumber) { @@ -4019,23 +4232,36 @@ Parser<ParseHandler>::PossibleError::checkForError(ErrorKind kind) template <typename ParseHandler> bool -Parser<ParseHandler>::PossibleError::checkForDestructuringError() +Parser<ParseHandler>::PossibleError::checkForWarning(ErrorKind kind) +{ + if (!hasError(kind)) + return true; + + Error& err = error(kind); + return parser_.extraWarningAt(err.offset_, err.errorNumber_); +} + +template <typename ParseHandler> +bool +Parser<ParseHandler>::PossibleError::checkForDestructuringErrorOrWarning() { // Clear pending expression error, because we're definitely not in an // expression context. setResolved(ErrorKind::Expression); - // Report any pending destructuring error. - return checkForError(ErrorKind::Destructuring); + // Report any pending destructuring error or warning. + return checkForError(ErrorKind::Destructuring) && + checkForWarning(ErrorKind::DestructuringWarning); } template <typename ParseHandler> bool Parser<ParseHandler>::PossibleError::checkForExpressionError() { - // Clear pending destructuring error, because we're definitely not in a - // destructuring context. + // Clear pending destructuring error or warning, because we're definitely + // not in a destructuring context. setResolved(ErrorKind::Destructuring); + setResolved(ErrorKind::DestructuringWarning); // Report any pending expression error. return checkForError(ErrorKind::Expression); @@ -4067,191 +4293,272 @@ Parser<ParseHandler>::PossibleError::transferErrorsTo(PossibleError* other) transferErrorTo(ErrorKind::Expression, other); } -template <> -bool -Parser<FullParseHandler>::checkDestructuringName(ParseNode* expr, Maybe<DeclarationKind> maybeDecl) +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::bindingInitializer(Node lhs, DeclarationKind kind, + YieldHandling yieldHandling) { - MOZ_ASSERT(!handler.isUnparenthesizedDestructuringPattern(expr)); - - // Parentheses are forbidden around destructuring *patterns* (but allowed - // around names). Use our nicer error message for parenthesized, nested - // patterns. - if (handler.isParenthesizedDestructuringPattern(expr)) { - errorAt(expr->pn_pos.begin, JSMSG_BAD_DESTRUCT_PARENS); - return false; - } + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_ASSIGN)); - // This expression might be in a variable-binding pattern where only plain, - // unparenthesized names are permitted. - if (maybeDecl) { - // Destructuring patterns in declarations must only contain - // unparenthesized names. - if (!handler.isUnparenthesizedName(expr)) { - errorAt(expr->pn_pos.begin, JSMSG_NO_VARIABLE_NAME); - return false; - } + if (kind == DeclarationKind::FormalParameter) + pc->functionBox()->hasParameterExprs = true; - RootedPropertyName name(context, expr->name()); - return noteDeclaredName(name, *maybeDecl, expr->pn_pos); - } + Node rhs = assignExpr(InAllowed, yieldHandling, TripledotProhibited); + if (!rhs) + return null(); - // Otherwise this is an expression in destructuring outside a declaration. - if (handler.isNameAnyParentheses(expr)) { - if (const char* chars = handler.nameIsArgumentsEvalAnyParentheses(expr, context)) { - if (!strictModeErrorAt(expr->pn_pos.begin, JSMSG_BAD_STRICT_ASSIGN, chars)) - return false; - } + handler.checkAndSetIsDirectRHSAnonFunction(rhs); - return true; - } + Node assign = handler.newAssignment(PNK_ASSIGN, lhs, rhs, JSOP_NOP); + if (!assign) + return null(); - if (handler.isPropertyAccess(expr)) - return true; + if (foldConstants && !FoldConstants(context, &assign, this)) + return null(); - errorAt(expr->pn_pos.begin, JSMSG_BAD_DESTRUCT_TARGET); - return false; + return assign; } -template <> -bool -Parser<FullParseHandler>::checkDestructuringPattern(ParseNode* pattern, - Maybe<DeclarationKind> maybeDecl, - PossibleError* possibleError /* = nullptr */); - -template <> -bool -Parser<FullParseHandler>::checkDestructuringObject(ParseNode* objectPattern, - Maybe<DeclarationKind> maybeDecl) +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::bindingIdentifier(DeclarationKind kind, YieldHandling yieldHandling) { - MOZ_ASSERT(objectPattern->isKind(PNK_OBJECT)); + RootedPropertyName name(context, bindingIdentifier(yieldHandling)); + if (!name) + return null(); - for (ParseNode* member = objectPattern->pn_head; member; member = member->pn_next) { - ParseNode* target; - if (member->isKind(PNK_MUTATEPROTO)) { - target = member->pn_kid; - } else { - MOZ_ASSERT(member->isKind(PNK_COLON) || member->isKind(PNK_SHORTHAND)); - MOZ_ASSERT_IF(member->isKind(PNK_SHORTHAND), - member->pn_left->isKind(PNK_OBJECT_PROPERTY_NAME) && - member->pn_right->isKind(PNK_NAME) && - member->pn_left->pn_atom == member->pn_right->pn_atom); + Node binding = newName(name); + if (!binding || !noteDeclaredName(name, kind, pos())) + return null(); - target = member->pn_right; - } - if (handler.isUnparenthesizedAssignment(target)) - target = target->pn_left; + return binding; +} - if (handler.isUnparenthesizedDestructuringPattern(target)) { - if (!checkDestructuringPattern(target, maybeDecl)) - return false; - } else { - if (!checkDestructuringName(target, maybeDecl)) - return false; - } +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::bindingIdentifierOrPattern(DeclarationKind kind, YieldHandling yieldHandling, + TokenKind tt) +{ + if (tt == TOK_LB) + return arrayBindingPattern(kind, yieldHandling); + + if (tt == TOK_LC) + return objectBindingPattern(kind, yieldHandling); + + if (!TokenKindIsPossibleIdentifierName(tt)) { + error(JSMSG_NO_VARIABLE_NAME); + return null(); } - return true; + return bindingIdentifier(kind, yieldHandling); } -template <> -bool -Parser<FullParseHandler>::checkDestructuringArray(ParseNode* arrayPattern, - Maybe<DeclarationKind> maybeDecl) +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::objectBindingPattern(DeclarationKind kind, YieldHandling yieldHandling) { - MOZ_ASSERT(arrayPattern->isKind(PNK_ARRAY)); + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_LC)); - for (ParseNode* element = arrayPattern->pn_head; element; element = element->pn_next) { - if (element->isKind(PNK_ELISION)) - continue; + JS_CHECK_RECURSION(context, return null()); - ParseNode* target; - if (element->isKind(PNK_SPREAD)) { - if (element->pn_next) { - errorAt(element->pn_next->pn_pos.begin, JSMSG_PARAMETER_AFTER_REST); - return false; - } - target = element->pn_kid; - } else if (handler.isUnparenthesizedAssignment(element)) { - target = element->pn_left; + uint32_t begin = pos().begin; + Node literal = handler.newObjectLiteral(begin); + if (!literal) + return null(); + + Maybe<DeclarationKind> declKind = Some(kind); + RootedAtom propAtom(context); + for (;;) { + TokenKind tt; + if (!tokenStream.peekToken(&tt)) + return null(); + if (tt == TOK_RC) + break; + + if (tt == TOK_TRIPLEDOT) { + // rest-binding property + tokenStream.consumeKnownToken(TOK_TRIPLEDOT); + uint32_t begin = pos().begin; + + TokenKind tt; + if (!tokenStream.getToken(&tt)) + return null(); + + Node inner = bindingIdentifierOrPattern(kind, yieldHandling, tt); + if (!inner) + return null(); + + if (!handler.addSpreadProperty(literal, begin, inner)) + return null(); } else { - target = element; + TokenPos namePos = tokenStream.nextToken().pos; + + PropertyType propType; + Node propName = propertyName(yieldHandling, declKind, literal, &propType, &propAtom); + if (!propName) + return null(); + if (propType == PropertyType::Normal) { + // Handle e.g., |var {p: x} = o| and |var {p: x=0} = o|. + + if (!tokenStream.getToken(&tt, TokenStream::Operand)) + return null(); + + Node binding = bindingIdentifierOrPattern(kind, yieldHandling, tt); + if (!binding) + return null(); + + bool hasInitializer; + if (!tokenStream.matchToken(&hasInitializer, TOK_ASSIGN)) + return null(); + + Node bindingExpr = hasInitializer + ? bindingInitializer(binding, kind, yieldHandling) + : binding; + if (!bindingExpr) + return null(); + + if (!handler.addPropertyDefinition(literal, propName, bindingExpr)) + return null(); + } else if (propType == PropertyType::Shorthand) { + // Handle e.g., |var {x, y} = o| as destructuring shorthand + // for |var {x: x, y: y} = o|. + MOZ_ASSERT(TokenKindIsPossibleIdentifierName(tt)); + + Node binding = bindingIdentifier(kind, yieldHandling); + if (!binding) + return null(); + + if (!handler.addShorthand(literal, propName, binding)) + return null(); + } else if (propType == PropertyType::CoverInitializedName) { + // Handle e.g., |var {x=1, y=2} = o| as destructuring + // shorthand with default values. + MOZ_ASSERT(TokenKindIsPossibleIdentifierName(tt)); + + Node binding = bindingIdentifier(kind, yieldHandling); + if (!binding) + return null(); + + tokenStream.consumeKnownToken(TOK_ASSIGN); + + Node bindingExpr = bindingInitializer(binding, kind, yieldHandling); + if (!bindingExpr) + return null(); + + if (!handler.addPropertyDefinition(literal, propName, bindingExpr)) + return null(); + } else { + errorAt(namePos.begin, JSMSG_NO_VARIABLE_NAME); + return null(); + + } } - if (handler.isUnparenthesizedDestructuringPattern(target)) { - if (!checkDestructuringPattern(target, maybeDecl)) - return false; - } else { - if (!checkDestructuringName(target, maybeDecl)) - return false; + bool matched; + if (!tokenStream.matchToken(&matched, TOK_COMMA)) + return null(); + if (!matched) + break; + if (tt == TOK_TRIPLEDOT) { + error(JSMSG_REST_WITH_COMMA); + return null(); } } - return true; + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RC, TokenStream::None, + reportMissingClosing(JSMSG_CURLY_AFTER_LIST, + JSMSG_CURLY_OPENED, begin)); + + handler.setEndPosition(literal, pos().end); + return literal; } -/* - * Destructuring patterns can appear in two kinds of contexts: - * - * - assignment-like: assignment expressions and |for| loop heads. In - * these cases, the patterns' property value positions can be - * arbitrary lvalue expressions; the destructuring is just a fancy - * assignment. - * - * - binding-like: |var| and |let| declarations, functions' formal - * parameter lists, |catch| clauses, and comprehension tails. In - * these cases, the patterns' property value positions must be - * simple names; the destructuring defines them as new variables. - * - * In both cases, other code parses the pattern as an arbitrary - * primaryExpr, and then, here in checkDestructuringPattern, verify - * that the tree is a valid AssignmentPattern or BindingPattern. - * - * In assignment-like contexts, we parse the pattern with - * pc->inDestructuringDecl clear, so the lvalue expressions in the - * pattern are parsed normally. primaryExpr links variable references - * into the appropriate use chains; creates placeholder definitions; - * and so on. checkDestructuringPattern won't bind any new names and - * we specialize lvalues as appropriate. - * - * In declaration-like contexts, the normal variable reference - * processing would just be an obstruction, because we're going to - * define the names that appear in the property value positions as new - * variables anyway. In this case, we parse the pattern with - * pc->inDestructuringDecl set, which directs primaryExpr to leave - * whatever name nodes it creates unconnected. Then, here in - * checkDestructuringPattern, we require the pattern's property value - * positions to be simple names, and define them as appropriate to the - * context. - */ -template <> -bool -Parser<FullParseHandler>::checkDestructuringPattern(ParseNode* pattern, - Maybe<DeclarationKind> maybeDecl, - PossibleError* possibleError /* = nullptr */) +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::arrayBindingPattern(DeclarationKind kind, YieldHandling yieldHandling) { - if (pattern->isKind(PNK_ARRAYCOMP)) { - errorAt(pattern->pn_pos.begin, JSMSG_ARRAY_COMP_LEFTSIDE); - return false; - } + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_LB)); - bool isDestructuring = pattern->isKind(PNK_ARRAY) - ? checkDestructuringArray(pattern, maybeDecl) - : checkDestructuringObject(pattern, maybeDecl); + JS_CHECK_RECURSION(context, return null()); - // Report any pending destructuring error. - if (isDestructuring && possibleError && !possibleError->checkForDestructuringError()) - return false; + uint32_t begin = pos().begin; + Node literal = handler.newArrayLiteral(begin); + if (!literal) + return null(); - return isDestructuring; -} + uint32_t index = 0; + TokenStream::Modifier modifier = TokenStream::Operand; + for (; ; index++) { + if (index >= NativeObject::MAX_DENSE_ELEMENTS_COUNT) { + error(JSMSG_ARRAY_INIT_TOO_BIG); + return null(); + } + + TokenKind tt; + if (!tokenStream.getToken(&tt, TokenStream::Operand)) + return null(); + + if (tt == TOK_RB) { + tokenStream.ungetToken(); + break; + } + + if (tt == TOK_COMMA) { + if (!handler.addElision(literal, pos())) + return null(); + } else if (tt == TOK_TRIPLEDOT) { + uint32_t begin = pos().begin; + + TokenKind tt; + if (!tokenStream.getToken(&tt, TokenStream::Operand)) + return null(); + + Node inner = bindingIdentifierOrPattern(kind, yieldHandling, tt); + if (!inner) + return null(); + + if (!handler.addSpreadElement(literal, begin, inner)) + return null(); + } else { + Node binding = bindingIdentifierOrPattern(kind, yieldHandling, tt); + if (!binding) + return null(); + + bool hasInitializer; + if (!tokenStream.matchToken(&hasInitializer, TOK_ASSIGN)) + return null(); + + Node element = hasInitializer + ? bindingInitializer(binding, kind, yieldHandling) + : binding; + if (!element) + return null(); + + handler.addArrayElement(literal, element); + } + + if (tt != TOK_COMMA) { + // If we didn't already match TOK_COMMA in above case. + bool matched; + if (!tokenStream.matchToken(&matched, TOK_COMMA)) + return null(); + if (!matched) { + modifier = TokenStream::None; + break; + } + if (tt == TOK_TRIPLEDOT) { + error(JSMSG_REST_WITH_COMMA); + return null(); + } + } + } + + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RB, modifier, + reportMissingClosing(JSMSG_BRACKET_AFTER_LIST, + JSMSG_BRACKET_OPENED, begin)); -template <> -bool -Parser<SyntaxParseHandler>::checkDestructuringPattern(Node pattern, - Maybe<DeclarationKind> maybeDecl, - PossibleError* possibleError /* = nullptr */) -{ - return abortIfSyntaxParser(); + handler.setEndPosition(literal, pos().end); + return literal; } template <typename ParseHandler> @@ -4262,18 +4569,9 @@ Parser<ParseHandler>::destructuringDeclaration(DeclarationKind kind, YieldHandli MOZ_ASSERT(tokenStream.isCurrentTokenType(tt)); MOZ_ASSERT(tt == TOK_LB || tt == TOK_LC); - PossibleError possibleError(*this); - Node pattern; - { - pc->inDestructuringDecl = Some(kind); - pattern = primaryExpr(yieldHandling, TripledotProhibited, tt, &possibleError); - pc->inDestructuringDecl = Nothing(); - } - - if (!pattern || !checkDestructuringPattern(pattern, Some(kind), &possibleError)) - return null(); - - return pattern; + return tt == TOK_LB + ? arrayBindingPattern(kind, yieldHandling) + : objectBindingPattern(kind, yieldHandling); } template <typename ParseHandler> @@ -4303,6 +4601,7 @@ typename ParseHandler::Node Parser<ParseHandler>::blockStatement(YieldHandling yieldHandling, unsigned errorNumber) { MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_LC)); + uint32_t openedPos = pos().begin; ParseContext::Statement stmt(pc, StatementKind::Block); ParseContext::Scope scope(this); @@ -4313,7 +4612,9 @@ Parser<ParseHandler>::blockStatement(YieldHandling yieldHandling, unsigned error if (!list) return null(); - MUST_MATCH_TOKEN_MOD(TOK_RC, TokenStream::Operand, errorNumber); + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RC, TokenStream::Operand, + reportMissingClosing(errorNumber, JSMSG_CURLY_OPENED, + openedPos)); return finishLexicalScope(scope, list); } @@ -4384,6 +4685,12 @@ Parser<ParseHandler>::declarationPattern(Node decl, DeclarationKind declKind, To // binary operator (examined with modifier None) terminated |init|. // For all other declarations, through ASI's infinite majesty, a next // token on a new line would begin an expression. + // Similar to the case in initializerInNameDeclaration(), we need to + // peek at the next token when assignExpr() is a lazily parsed arrow + // function. + TokenKind ignored; + if (!tokenStream.peekToken(&ignored)) + return null(); tokenStream.addModifierException(TokenStream::OperandIsNone); } @@ -4484,7 +4791,8 @@ Parser<ParseHandler>::declarationName(Node decl, DeclarationKind declKind, Token ParseNodeKind* forHeadKind, Node* forInOrOfExpression) { // Anything other than TOK_YIELD or TOK_NAME is an error. - if (tt != TOK_NAME && tt != TOK_YIELD) { + // Anything other than possible identifier is an error. + if (!TokenKindIsPossibleIdentifier(tt)) { error(JSMSG_NO_VARIABLE_NAME); return null(); } @@ -4625,8 +4933,10 @@ Parser<ParseHandler>::declarationList(YieldHandling yieldHandling, template <typename ParseHandler> typename ParseHandler::Node -Parser<ParseHandler>::lexicalDeclaration(YieldHandling yieldHandling, bool isConst) +Parser<ParseHandler>::lexicalDeclaration(YieldHandling yieldHandling, DeclarationKind kind) { + MOZ_ASSERT(kind == DeclarationKind::Const || kind == DeclarationKind::Let); + /* * Parse body-level lets without a new block object. ES6 specs * that an execution environment's initial lexical environment @@ -4638,8 +4948,9 @@ Parser<ParseHandler>::lexicalDeclaration(YieldHandling yieldHandling, bool isCon * * See 8.1.1.1.6 and the note in 13.2.1. */ - Node decl = declarationList(yieldHandling, isConst ? PNK_CONST : PNK_LET); - if (!decl || !MatchOrInsertSemicolonAfterExpression(tokenStream)) + Node decl = declarationList(yieldHandling, + kind == DeclarationKind::Const ? PNK_CONST : PNK_LET); + if (!decl || !matchOrInsertSemicolonAfterExpression()) return null(); return decl; @@ -4650,41 +4961,34 @@ bool Parser<FullParseHandler>::namedImportsOrNamespaceImport(TokenKind tt, Node importSpecSet) { if (tt == TOK_LC) { - TokenStream::Modifier modifier = TokenStream::KeywordIsName; while (true) { // Handle the forms |import {} from 'a'| and // |import { ..., } from 'a'| (where ... is non empty), by // escaping the loop early if the next token is }. - if (!tokenStream.peekToken(&tt, TokenStream::KeywordIsName)) + if (!tokenStream.getToken(&tt)) return false; if (tt == TOK_RC) break; - // If the next token is a keyword, the previous call to - // peekToken matched it as a TOK_NAME, and put it in the - // lookahead buffer, so this call will match keywords as well. - MUST_MATCH_TOKEN_MOD(TOK_NAME, TokenStream::KeywordIsName, JSMSG_NO_IMPORT_NAME); + if (!TokenKindIsPossibleIdentifierName(tt)) { + error(JSMSG_NO_IMPORT_NAME); + return false; + } + Rooted<PropertyName*> importName(context, tokenStream.currentName()); TokenPos importNamePos = pos(); - TokenKind maybeAs; - if (!tokenStream.peekToken(&maybeAs)) + bool matched; + if (!tokenStream.matchToken(&matched, TOK_AS)) return null(); - if (maybeAs == TOK_NAME && - tokenStream.nextName() == context->names().as) - { - tokenStream.consumeKnownToken(TOK_NAME); - - if (!checkUnescapedName()) - return false; - + if (matched) { TokenKind afterAs; if (!tokenStream.getToken(&afterAs)) return false; - if (afterAs != TOK_NAME && afterAs != TOK_YIELD) { + if (!TokenKindIsPossibleIdentifierName(afterAs)) { error(JSMSG_NO_BINDING_NAME); return false; } @@ -4694,10 +4998,7 @@ Parser<FullParseHandler>::namedImportsOrNamespaceImport(TokenKind tt, Node impor // by the keyword 'as'. // See the ImportSpecifier production in ES6 section 15.2.2. if (IsKeyword(importName)) { - JSAutoByteString bytes; - if (!AtomToPrintableString(context, importName, &bytes)) - return false; - error(JSMSG_AS_AFTER_RESERVED_WORD, bytes.ptr()); + error(JSMSG_AS_AFTER_RESERVED_WORD, ReservedWordToCharZ(importName)); return false; } } @@ -4722,31 +5023,24 @@ Parser<FullParseHandler>::namedImportsOrNamespaceImport(TokenKind tt, Node impor handler.addList(importSpecSet, importSpec); - bool matched; - if (!tokenStream.matchToken(&matched, TOK_COMMA)) + TokenKind next; + if (!tokenStream.getToken(&next)) return false; - if (!matched) { - modifier = TokenStream::None; + if (next == TOK_RC) break; + + if (next != TOK_COMMA) { + error(JSMSG_RC_AFTER_IMPORT_SPEC_LIST); + return false; } } - - MUST_MATCH_TOKEN_MOD(TOK_RC, modifier, JSMSG_RC_AFTER_IMPORT_SPEC_LIST); } else { MOZ_ASSERT(tt == TOK_MUL); - if (!tokenStream.getToken(&tt)) - return false; - if (tt != TOK_NAME || tokenStream.currentName() != context->names().as) { - error(JSMSG_AS_AFTER_IMPORT_STAR); - return false; - } - - if (!checkUnescapedName()) - return false; + MUST_MATCH_TOKEN(TOK_AS, JSMSG_AS_AFTER_IMPORT_STAR); - MUST_MATCH_TOKEN(TOK_NAME, JSMSG_NO_BINDING_NAME); + MUST_MATCH_TOKEN_FUNC(TokenKindIsPossibleIdentifierName, JSMSG_NO_BINDING_NAME); Node importName = newName(context->names().star); if (!importName) @@ -4780,14 +5074,6 @@ Parser<FullParseHandler>::namedImportsOrNamespaceImport(TokenKind tt, Node impor } template<> -bool -Parser<SyntaxParseHandler>::namedImportsOrNamespaceImport(TokenKind tt, Node importSpecSet) -{ - MOZ_ALWAYS_FALSE(abortIfSyntaxParser()); - return false; -} - -template<> ParseNode* Parser<FullParseHandler>::importDeclaration() { @@ -4807,8 +5093,15 @@ Parser<FullParseHandler>::importDeclaration() if (!importSpecSet) return null(); - if (tt == TOK_NAME || tt == TOK_LC || tt == TOK_MUL) { - if (tt == TOK_NAME) { + if (tt == TOK_STRING) { + // Handle the form |import 'a'| by leaving the list empty. This is + // equivalent to |import {} from 'a'|. + importSpecSet->pn_pos.end = importSpecSet->pn_pos.begin; + } else { + if (tt == TOK_LC || tt == TOK_MUL) { + if (!namedImportsOrNamespaceImport(tt, importSpecSet)) + return null(); + } else if (TokenKindIsPossibleIdentifierName(tt)) { // Handle the form |import a from 'b'|, by adding a single import // specifier to the list, with 'default' as the import name and // 'a' as the binding name. This is equivalent to @@ -4851,36 +5144,20 @@ Parser<FullParseHandler>::importDeclaration() return null(); } } else { - if (!namedImportsOrNamespaceImport(tt, importSpecSet)) - return null(); - } - - if (!tokenStream.getToken(&tt)) - return null(); - - if (tt != TOK_NAME || tokenStream.currentName() != context->names().from) { - error(JSMSG_FROM_AFTER_IMPORT_CLAUSE); + error(JSMSG_DECLARATION_AFTER_IMPORT); return null(); } - if (!checkUnescapedName()) - return null(); + MUST_MATCH_TOKEN(TOK_FROM, JSMSG_FROM_AFTER_IMPORT_CLAUSE); MUST_MATCH_TOKEN(TOK_STRING, JSMSG_MODULE_SPEC_AFTER_FROM); - } else if (tt == TOK_STRING) { - // Handle the form |import 'a'| by leaving the list empty. This is - // equivalent to |import {} from 'a'|. - importSpecSet->pn_pos.end = importSpecSet->pn_pos.begin; - } else { - error(JSMSG_DECLARATION_AFTER_IMPORT); - return null(); } Node moduleSpec = stringLiteral(); if (!moduleSpec) return null(); - if (!MatchOrInsertSemicolonAfterNonExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterNonExpression()) return null(); ParseNode* node = @@ -4947,284 +5224,539 @@ Parser<SyntaxParseHandler>::checkExportedNamesForDeclaration(Node node) } template<> -ParseNode* -Parser<FullParseHandler>::exportDeclaration() +bool +Parser<FullParseHandler>::checkExportedNameForClause(ParseNode* node) { - MOZ_ASSERT(tokenStream.currentToken().type == TOK_EXPORT); + return checkExportedName(node->pn_atom); +} - if (!pc->atModuleLevel()) { - error(JSMSG_EXPORT_DECL_AT_TOP_LEVEL); +template<> +bool +Parser<SyntaxParseHandler>::checkExportedNameForClause(Node node) +{ + MOZ_ALWAYS_FALSE(abortIfSyntaxParser()); + return false; +} + +template<> +bool +Parser<FullParseHandler>::checkExportedNameForFunction(ParseNode* node) +{ + return checkExportedName(node->pn_funbox->function()->explicitName()); +} + +template<> +bool +Parser<SyntaxParseHandler>::checkExportedNameForFunction(Node node) +{ + MOZ_ALWAYS_FALSE(abortIfSyntaxParser()); + return false; +} + +template<> +bool +Parser<FullParseHandler>::checkExportedNameForClass(ParseNode* node) +{ + const ClassNode& cls = node->as<ClassNode>(); + MOZ_ASSERT(cls.names()); + return checkExportedName(cls.names()->innerBinding()->pn_atom); +} + +template<> +bool +Parser<SyntaxParseHandler>::checkExportedNameForClass(Node node) +{ + MOZ_ALWAYS_FALSE(abortIfSyntaxParser()); + return false; +} + +template<> +bool +Parser<FullParseHandler>::processExport(ParseNode* node) +{ + return pc->sc()->asModuleContext()->builder.processExport(node); +} + +template<> +bool +Parser<SyntaxParseHandler>::processExport(Node node) +{ + MOZ_ALWAYS_FALSE(abortIfSyntaxParser()); + return false; +} + +template<> +bool +Parser<FullParseHandler>::processExportFrom(ParseNode* node) +{ + return pc->sc()->asModuleContext()->builder.processExportFrom(node); +} + +template<> +bool +Parser<SyntaxParseHandler>::processExportFrom(Node node) +{ + MOZ_ALWAYS_FALSE(abortIfSyntaxParser()); + return false; +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportFrom(uint32_t begin, Node specList) +{ + if (!abortIfSyntaxParser()) return null(); - } - uint32_t begin = pos().begin; + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_FROM)); - Node kid; - TokenKind tt; - if (!tokenStream.getToken(&tt)) + if (!abortIfSyntaxParser()) return null(); - switch (tt) { - case TOK_LC: { - kid = handler.newList(PNK_EXPORT_SPEC_LIST); - if (!kid) - return null(); - while (true) { - // Handle the forms |export {}| and |export { ..., }| (where ... - // is non empty), by escaping the loop early if the next token - // is }. - if (!tokenStream.peekToken(&tt)) - return null(); - if (tt == TOK_RC) - break; + MUST_MATCH_TOKEN(TOK_STRING, JSMSG_MODULE_SPEC_AFTER_FROM); - MUST_MATCH_TOKEN(TOK_NAME, JSMSG_NO_BINDING_NAME); - Node bindingName = newName(tokenStream.currentName()); - if (!bindingName) - return null(); + Node moduleSpec = stringLiteral(); + if (!moduleSpec) + return null(); - bool foundAs; - if (!tokenStream.matchContextualKeyword(&foundAs, context->names().as)) - return null(); - if (foundAs) - MUST_MATCH_TOKEN_MOD(TOK_NAME, TokenStream::KeywordIsName, JSMSG_NO_EXPORT_NAME); + if (!matchOrInsertSemicolonAfterNonExpression()) + return null(); - Node exportName = newName(tokenStream.currentName()); - if (!exportName) - return null(); + Node node = handler.newExportFromDeclaration(begin, specList, moduleSpec); + if (!node) + return null(); - if (!checkExportedName(exportName->pn_atom)) - return null(); + if (!processExportFrom(node)) + return null(); - Node exportSpec = handler.newBinary(PNK_EXPORT_SPEC, bindingName, exportName); - if (!exportSpec) - return null(); + return node; +} - handler.addList(kid, exportSpec); +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportBatch(uint32_t begin) +{ + if (!abortIfSyntaxParser()) + return null(); - bool matched; - if (!tokenStream.matchToken(&matched, TOK_COMMA)) - return null(); - if (!matched) - break; - } + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_MUL)); - MUST_MATCH_TOKEN(TOK_RC, JSMSG_RC_AFTER_EXPORT_SPEC_LIST); + Node kid = handler.newList(PNK_EXPORT_SPEC_LIST); + if (!kid) + return null(); - // Careful! If |from| follows, even on a new line, it must start a - // FromClause: - // - // export { x } - // from "foo"; // a single ExportDeclaration - // - // But if it doesn't, we might have an ASI opportunity in Operand - // context, so simply matching a contextual keyword won't work: - // - // export { x } // ExportDeclaration, terminated by ASI - // fro\u006D // ExpressionStatement, the name "from" - // - // In that case let MatchOrInsertSemicolonAfterNonExpression sort out - // ASI or any necessary error. - TokenKind tt; - if (!tokenStream.getToken(&tt, TokenStream::Operand)) - return null(); + // Handle the form |export *| by adding a special export batch + // specifier to the list. + Node exportSpec = handler.newNullary(PNK_EXPORT_BATCH_SPEC, JSOP_NOP, pos()); + if (!exportSpec) + return null(); - if (tt == TOK_NAME && - tokenStream.currentToken().name() == context->names().from && - !tokenStream.currentToken().nameContainsEscape()) - { - MUST_MATCH_TOKEN(TOK_STRING, JSMSG_MODULE_SPEC_AFTER_FROM); + handler.addList(kid, exportSpec); - Node moduleSpec = stringLiteral(); - if (!moduleSpec) - return null(); + MUST_MATCH_TOKEN(TOK_FROM, JSMSG_FROM_AFTER_EXPORT_STAR); - if (!MatchOrInsertSemicolonAfterNonExpression(tokenStream)) - return null(); + return exportFrom(begin, kid); +} - ParseNode* node = handler.newExportFromDeclaration(begin, kid, moduleSpec); - if (!node || !pc->sc()->asModuleContext()->builder.processExportFrom(node)) - return null(); +template<> +bool +Parser<FullParseHandler>::checkLocalExportNames(ParseNode* node) +{ + // ES 2017 draft 15.2.3.1. + for (ParseNode* next = node->pn_head; next; next = next->pn_next) { + ParseNode* name = next->pn_left; + MOZ_ASSERT(name->isKind(PNK_NAME)); - return node; - } + RootedPropertyName ident(context, name->pn_atom->asPropertyName()); + if (!checkLocalExportName(ident, name->pn_pos.begin)) + return false; + } - tokenStream.ungetToken(); + return true; +} - if (!MatchOrInsertSemicolonAfterNonExpression(tokenStream)) - return null(); - break; - } +template<> +bool +Parser<SyntaxParseHandler>::checkLocalExportNames(Node node) +{ + MOZ_ALWAYS_FALSE(abortIfSyntaxParser()); + return false; +} - case TOK_MUL: { - kid = handler.newList(PNK_EXPORT_SPEC_LIST); - if (!kid) - return null(); +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportClause(uint32_t begin) +{ + if (!abortIfSyntaxParser()) + return null(); - // Handle the form |export *| by adding a special export batch - // specifier to the list. - Node exportSpec = handler.newNullary(PNK_EXPORT_BATCH_SPEC, JSOP_NOP, pos()); - if (!exportSpec) - return null(); + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_LC)); - handler.addList(kid, exportSpec); + Node kid = handler.newList(PNK_EXPORT_SPEC_LIST); + if (!kid) + return null(); + TokenKind tt; + while (true) { + // Handle the forms |export {}| and |export { ..., }| (where ... is non + // empty), by escaping the loop early if the next token is }. if (!tokenStream.getToken(&tt)) return null(); - if (tt != TOK_NAME || tokenStream.currentName() != context->names().from) { - error(JSMSG_FROM_AFTER_EXPORT_STAR); + + if (tt == TOK_RC) + break; + + if (!TokenKindIsPossibleIdentifierName(tt)) { + error(JSMSG_NO_BINDING_NAME); return null(); } - if (!checkUnescapedName()) + Node bindingName = newName(tokenStream.currentName()); + if (!bindingName) return null(); - MUST_MATCH_TOKEN(TOK_STRING, JSMSG_MODULE_SPEC_AFTER_FROM); - - Node moduleSpec = stringLiteral(); - if (!moduleSpec) + bool foundAs; + if (!tokenStream.matchToken(&foundAs, TOK_AS)) return null(); + if (foundAs) + MUST_MATCH_TOKEN_FUNC(TokenKindIsPossibleIdentifierName, JSMSG_NO_EXPORT_NAME); - if (!MatchOrInsertSemicolonAfterNonExpression(tokenStream)) + Node exportName = newName(tokenStream.currentName()); + if (!exportName) return null(); - ParseNode* node = handler.newExportFromDeclaration(begin, kid, moduleSpec); - if (!node || !pc->sc()->asModuleContext()->builder.processExportFrom(node)) + if (!checkExportedNameForClause(exportName)) return null(); - return node; + Node exportSpec = handler.newBinary(PNK_EXPORT_SPEC, bindingName, exportName); + if (!exportSpec) + return null(); - } + handler.addList(kid, exportSpec); - case TOK_FUNCTION: - kid = functionStmt(pos().begin, YieldIsKeyword, NameRequired); - if (!kid) + TokenKind next; + if (!tokenStream.getToken(&next)) return null(); - if (!checkExportedName(kid->pn_funbox->function()->explicitName())) - return null(); - break; + if (next == TOK_RC) + break; - case TOK_CLASS: { - kid = classDefinition(YieldIsKeyword, ClassStatement, NameRequired); - if (!kid) + if (next != TOK_COMMA) { + error(JSMSG_RC_AFTER_EXPORT_SPEC_LIST); return null(); + } + } - const ClassNode& cls = kid->as<ClassNode>(); - MOZ_ASSERT(cls.names()); - if (!checkExportedName(cls.names()->innerBinding()->pn_atom)) - return null(); - break; - } + // Careful! If |from| follows, even on a new line, it must start a + // FromClause: + // + // export { x } + // from "foo"; // a single ExportDeclaration + // + // But if it doesn't, we might have an ASI opportunity in Operand context: + // + // export { x } // ExportDeclaration, terminated by ASI + // fro\u006D // ExpressionStatement, the name "from" + // + // In that case let matchOrInsertSemicolonAfterNonExpression sort out ASI + // or any necessary error. + bool matched; + if (!tokenStream.matchToken(&matched, TOK_FROM, TokenStream::Operand)) + return null(); - case TOK_VAR: - kid = declarationList(YieldIsName, PNK_VAR); - if (!kid) - return null(); - if (!MatchOrInsertSemicolonAfterExpression(tokenStream)) - return null(); - if (!checkExportedNamesForDeclaration(kid)) - return null(); - break; + if (matched) + return exportFrom(begin, kid); - case TOK_DEFAULT: { - if (!tokenStream.getToken(&tt, TokenStream::Operand)) - return null(); + if (!matchOrInsertSemicolonAfterNonExpression()) + return null(); - if (!checkExportedName(context->names().default_)) - return null(); + if (!checkLocalExportNames(kid)) + return null(); - ParseNode* nameNode = nullptr; - switch (tt) { - case TOK_FUNCTION: - kid = functionStmt(pos().begin, YieldIsKeyword, AllowDefaultName); - if (!kid) - return null(); - break; - case TOK_CLASS: - kid = classDefinition(YieldIsKeyword, ClassStatement, AllowDefaultName); - if (!kid) - return null(); - break; - default: { - if (tt == TOK_NAME && tokenStream.currentName() == context->names().async) { - TokenKind nextSameLine = TOK_EOF; - if (!tokenStream.peekTokenSameLine(&nextSameLine)) - return null(); + Node node = handler.newExportDeclaration(kid, TokenPos(begin, pos().end)); + if (!node) + return null(); - if (nextSameLine == TOK_FUNCTION) { - tokenStream.consumeKnownToken(nextSameLine); - kid = functionStmt(pos().begin, YieldIsName, AllowDefaultName, AsyncFunction); - if (!kid) - return null(); - break; - } - } + if (!processExport(node)) + return null(); - tokenStream.ungetToken(); - RootedPropertyName name(context, context->names().starDefaultStar); - nameNode = newName(name); - if (!nameNode) - return null(); - if (!noteDeclaredName(name, DeclarationKind::Const, pos())) - return null(); - kid = assignExpr(InAllowed, YieldIsKeyword, TripledotProhibited); - if (!kid) - return null(); - if (!MatchOrInsertSemicolonAfterExpression(tokenStream)) - return null(); - break; - } - } + return node; +} - ParseNode* node = handler.newExportDefaultDeclaration(kid, nameNode, - TokenPos(begin, pos().end)); - if (!node || !pc->sc()->asModuleContext()->builder.processExport(node)) - return null(); +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportVariableStatement(uint32_t begin) +{ + if (!abortIfSyntaxParser()) + return null(); - return node; - } + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_VAR)); - case TOK_CONST: - kid = lexicalDeclaration(YieldIsName, /* isConst = */ true); - if (!kid) - return null(); - if (!checkExportedNamesForDeclaration(kid)) - return null(); - break; + Node kid = declarationList(YieldIsName, PNK_VAR); + if (!kid) + return null(); + if (!matchOrInsertSemicolonAfterExpression()) + return null(); + if (!checkExportedNamesForDeclaration(kid)) + return null(); - case TOK_NAME: - if (tokenStream.currentName() == context->names().let) { - if (!checkUnescapedName()) - return null(); + Node node = handler.newExportDeclaration(kid, TokenPos(begin, pos().end)); + if (!node) + return null(); - kid = lexicalDeclaration(YieldIsName, /* isConst = */ false); - if (!kid) - return null(); - if (!checkExportedNamesForDeclaration(kid)) - return null(); - break; - } - MOZ_FALLTHROUGH; + if (!processExport(node)) + return null(); - default: - error(JSMSG_DECLARATION_AFTER_EXPORT); + return node; +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportFunctionDeclaration(uint32_t begin) +{ + if (!abortIfSyntaxParser()) + return null(); + + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_FUNCTION)); + + Node kid = functionStmt(pos().begin, YieldIsKeyword, NameRequired); + if (!kid) + return null(); + + if (!checkExportedNameForFunction(kid)) return null(); - } - ParseNode* node = handler.newExportDeclaration(kid, TokenPos(begin, pos().end)); - if (!node || !pc->sc()->asModuleContext()->builder.processExport(node)) + Node node = handler.newExportDeclaration(kid, TokenPos(begin, pos().end)); + if (!node) + return null(); + + if (!processExport(node)) return null(); return node; } -template<> -SyntaxParseHandler::Node -Parser<SyntaxParseHandler>::exportDeclaration() +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportClassDeclaration(uint32_t begin) { - JS_ALWAYS_FALSE(abortIfSyntaxParser()); - return SyntaxParseHandler::NodeFailure; + if (!abortIfSyntaxParser()) + return null(); + + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_CLASS)); + + Node kid = classDefinition(YieldIsKeyword, ClassStatement, NameRequired); + if (!kid) + return null(); + + if (!checkExportedNameForClass(kid)) + return null(); + + Node node = handler.newExportDeclaration(kid, TokenPos(begin, pos().end)); + if (!node) + return null(); + + if (!processExport(node)) + return null(); + + return node; +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportLexicalDeclaration(uint32_t begin, DeclarationKind kind) +{ + if (!abortIfSyntaxParser()) + return null(); + + MOZ_ASSERT(kind == DeclarationKind::Const || kind == DeclarationKind::Let); + MOZ_ASSERT_IF(kind == DeclarationKind::Const, tokenStream.isCurrentTokenType(TOK_CONST)); + MOZ_ASSERT_IF(kind == DeclarationKind::Let, tokenStream.isCurrentTokenType(TOK_LET)); + + Node kid = lexicalDeclaration(YieldIsName, kind); + if (!kid) + return null(); + if (!checkExportedNamesForDeclaration(kid)) + return null(); + + Node node = handler.newExportDeclaration(kid, TokenPos(begin, pos().end)); + if (!node) + return null(); + + if (!processExport(node)) + return null(); + + return node; +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportDefaultFunctionDeclaration(uint32_t begin, + FunctionAsyncKind asyncKind + /* = SyncFunction */) +{ + if (!abortIfSyntaxParser()) + return null(); + + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_FUNCTION)); + + Node kid = functionStmt(pos().begin, YieldIsKeyword, AllowDefaultName, asyncKind); + if (!kid) + return null(); + + Node node = handler.newExportDefaultDeclaration(kid, null(), TokenPos(begin, pos().end)); + if (!node) + return null(); + + if (!processExport(node)) + return null(); + + return node; +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportDefaultClassDeclaration(uint32_t begin) +{ + if (!abortIfSyntaxParser()) + return null(); + + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_CLASS)); + + Node kid = classDefinition(YieldIsKeyword, ClassStatement, AllowDefaultName); + if (!kid) + return null(); + + Node node = handler.newExportDefaultDeclaration(kid, null(), TokenPos(begin, pos().end)); + if (!node) + return null(); + + if (!processExport(node)) + return null(); + + return node; +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportDefaultAssignExpr(uint32_t begin) +{ + if (!abortIfSyntaxParser()) + return null(); + + RootedPropertyName name(context, context->names().starDefaultStar); + Node nameNode = newName(name); + if (!nameNode) + return null(); + if (!noteDeclaredName(name, DeclarationKind::Const, pos())) + return null(); + + Node kid = assignExpr(InAllowed, YieldIsKeyword, TripledotProhibited); + if (!kid) + return null(); + if (!matchOrInsertSemicolonAfterExpression()) + return null(); + + Node node = handler.newExportDefaultDeclaration(kid, nameNode, TokenPos(begin, pos().end)); + if (!node) + return null(); + + if (!processExport(node)) + return null(); + + return node; +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportDefault(uint32_t begin) +{ + if (!abortIfSyntaxParser()) + return null(); + + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_DEFAULT)); + + TokenKind tt; + if (!tokenStream.getToken(&tt, TokenStream::Operand)) + return null(); + + if (!checkExportedName(context->names().default_)) + return null(); + + switch (tt) { + case TOK_FUNCTION: + return exportDefaultFunctionDeclaration(begin); + + case TOK_ASYNC: { + TokenKind nextSameLine = TOK_EOF; + if (!tokenStream.peekTokenSameLine(&nextSameLine)) + return null(); + + if (nextSameLine == TOK_FUNCTION) { + tokenStream.consumeKnownToken(TOK_FUNCTION); + return exportDefaultFunctionDeclaration(begin, AsyncFunction); + } + + tokenStream.ungetToken(); + return exportDefaultAssignExpr(begin); + } + + case TOK_CLASS: + return exportDefaultClassDeclaration(begin); + + default: + tokenStream.ungetToken(); + return exportDefaultAssignExpr(begin); + } +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::exportDeclaration() +{ + if (!abortIfSyntaxParser()) + return null(); + + MOZ_ASSERT(tokenStream.currentToken().type == TOK_EXPORT); + + if (!pc->atModuleLevel()) { + error(JSMSG_EXPORT_DECL_AT_TOP_LEVEL); + return null(); + } + + uint32_t begin = pos().begin; + + TokenKind tt; + if (!tokenStream.getToken(&tt)) + return null(); + switch (tt) { + case TOK_MUL: + return exportBatch(begin); + + case TOK_LC: + return exportClause(begin); + + case TOK_VAR: + return exportVariableStatement(begin); + + case TOK_FUNCTION: + return exportFunctionDeclaration(begin); + + case TOK_CLASS: + return exportClassDeclaration(begin); + + case TOK_CONST: + return exportLexicalDeclaration(begin, DeclarationKind::Const); + + case TOK_LET: + return exportLexicalDeclaration(begin, DeclarationKind::Let); + + case TOK_DEFAULT: + return exportDefault(begin); + + default: + error(JSMSG_DECLARATION_AFTER_EXPORT); + return null(); + } } template <typename ParseHandler> @@ -5236,7 +5768,7 @@ Parser<ParseHandler>::expressionStatement(YieldHandling yieldHandling, InvokedPr /* possibleError = */ nullptr, invoked); if (!pnexpr) return null(); - if (!MatchOrInsertSemicolonAfterExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterExpression()) return null(); return handler.newExprStatement(pnexpr, pos().end); } @@ -5249,14 +5781,71 @@ Parser<ParseHandler>::consequentOrAlternative(YieldHandling yieldHandling) if (!tokenStream.peekToken(&next, TokenStream::Operand)) return null(); - if (next == TOK_FUNCTION) { - // Apply Annex B.3.4 in non-strict code to allow FunctionDeclaration as - // the consequent/alternative of an |if| or |else|. Parser::statement - // will report the strict mode error. - if (!pc->sc()->strict()) { - tokenStream.consumeKnownToken(next, TokenStream::Operand); - return functionStmt(pos().begin, yieldHandling, NameRequired); + // Annex B.3.4 says that unbraced FunctionDeclarations under if/else in + // non-strict code act as if they were braced: |if (x) function f() {}| + // parses as |if (x) { function f() {} }|. + // + // Careful! FunctionDeclaration doesn't include generators or async + // functions. + if (next == TOK_ASYNC) { + tokenStream.consumeKnownToken(next, TokenStream::Operand); + + // Peek only on the same line: ExpressionStatement's lookahead + // restriction is phrased as + // + // [lookahead ∉ { {, function, async [no LineTerminator here] function, class, let [ }] + // + // meaning that code like this is valid: + // + // if (true) + // async // ASI opportunity + // function clownshoes() {} + TokenKind maybeFunction; + if (!tokenStream.peekTokenSameLine(&maybeFunction)) + return null(); + + if (maybeFunction == TOK_FUNCTION) { + error(JSMSG_FORBIDDEN_AS_STATEMENT, "async function declarations"); + return null(); } + + // Otherwise this |async| begins an ExpressionStatement. + tokenStream.ungetToken(); + } else if (next == TOK_FUNCTION) { + tokenStream.consumeKnownToken(next, TokenStream::Operand); + + // Parser::statement would handle this, but as this function handles + // every other error case, it seems best to handle this. + if (pc->sc()->strict()) { + error(JSMSG_FORBIDDEN_AS_STATEMENT, "function declarations"); + return null(); + } + + TokenKind maybeStar; + if (!tokenStream.peekToken(&maybeStar)) + return null(); + + if (maybeStar == TOK_MUL) { + error(JSMSG_FORBIDDEN_AS_STATEMENT, "generator declarations"); + return null(); + } + + ParseContext::Statement stmt(pc, StatementKind::Block); + ParseContext::Scope scope(this); + if (!scope.init(pc)) + return null(); + + TokenPos funcPos = pos(); + Node fun = functionStmt(pos().begin, yieldHandling, NameRequired); + if (!fun) + return null(); + + Node block = handler.newStatementList(funcPos); + if (!block) + return null(); + + handler.addStatementToList(block, fun); + return finishLexicalScope(scope, block); } return statement(yieldHandling); @@ -5371,13 +5960,9 @@ Parser<ParseHandler>::matchInOrOf(bool* isForInp, bool* isForOfp) return false; *isForInp = tt == TOK_IN; - *isForOfp = tt == TOK_NAME && tokenStream.currentToken().name() == context->names().of; - if (!*isForInp && !*isForOfp) { + *isForOfp = tt == TOK_OF; + if (!*isForInp && !*isForOfp) tokenStream.ungetToken(); - } else { - if (tt == TOK_NAME && !checkUnescapedName()) - return false; - } MOZ_ASSERT_IF(*isForInp || *isForOfp, *isForInp != *isForOfp); return true; @@ -5427,15 +6012,12 @@ Parser<ParseHandler>::forHeadStart(YieldHandling yieldHandling, if (tt == TOK_CONST) { parsingLexicalDeclaration = true; tokenStream.consumeKnownToken(tt, TokenStream::Operand); - } else if (tt == TOK_NAME && - tokenStream.nextName() == context->names().let && - !tokenStream.nextNameContainsEscape()) - { + } else if (tt == TOK_LET) { // We could have a {For,Lexical}Declaration, or we could have a // LeftHandSideExpression with lookahead restrictions so it's not // ambiguous with the former. Check for a continuation of the former // to decide which we have. - tokenStream.consumeKnownToken(TOK_NAME, TokenStream::Operand); + tokenStream.consumeKnownToken(TOK_LET, TokenStream::Operand); TokenKind next; if (!tokenStream.peekToken(&next)) @@ -5512,7 +6094,7 @@ Parser<ParseHandler>::forHeadStart(YieldHandling yieldHandling, // Verify the left-hand side expression doesn't have a forbidden form. if (handler.isUnparenthesizedDestructuringPattern(*forInitialPart)) { - if (!checkDestructuringPattern(*forInitialPart, Nothing(), &possibleError)) + if (!possibleError.checkForDestructuringErrorOrWarning()) return false; } else if (handler.isNameAnyParentheses(*forInitialPart)) { const char* chars = handler.nameIsArgumentsEvalAnyParentheses(*forInitialPart, context); @@ -5556,7 +6138,7 @@ Parser<ParseHandler>::forStatement(YieldHandling yieldHandling) if (allowsForEachIn()) { bool matched; - if (!tokenStream.matchContextualKeyword(&matched, context->names().each)) + if (!tokenStream.matchToken(&matched, TOK_EACH)) return null(); if (matched) { iflags = JSITER_FOREACH; @@ -5867,7 +6449,7 @@ Parser<ParseHandler>::continueStatement(YieldHandling yieldHandling) return null(); } - if (!MatchOrInsertSemicolonAfterNonExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterNonExpression()) return null(); return handler.newContinueStatement(label, TokenPos(begin, pos().end)); @@ -5907,7 +6489,7 @@ Parser<ParseHandler>::breakStatement(YieldHandling yieldHandling) } } - if (!MatchOrInsertSemicolonAfterNonExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterNonExpression()) return null(); return handler.newBreakStatement(label, TokenPos(begin, pos().end)); @@ -5947,10 +6529,10 @@ Parser<ParseHandler>::returnStatement(YieldHandling yieldHandling) } if (exprNode) { - if (!MatchOrInsertSemicolonAfterExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterExpression()) return null(); } else { - if (!MatchOrInsertSemicolonAfterNonExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterNonExpression()) return null(); } @@ -6070,7 +6652,7 @@ Parser<ParseHandler>::yieldExpression(InHandling inHandling) if (pc->funHasReturnExpr #if JS_HAS_EXPR_CLOSURES - || pc->functionBox()->function()->isExprBody() + || pc->functionBox()->isExprBody() #endif ) { @@ -6247,7 +6829,7 @@ Parser<ParseHandler>::throwStatement(YieldHandling yieldHandling) if (!throwExpr) return null(); - if (!MatchOrInsertSemicolonAfterExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterExpression()) return null(); return handler.newThrowStatement(throwExpr, TokenPos(begin, pos().end)); @@ -6267,12 +6849,12 @@ Parser<ParseHandler>::tryStatement(YieldHandling yieldHandling) * kid3 is the finally statement * * catch nodes are ternary. - * kid1 is the lvalue (TOK_NAME, TOK_LB, or TOK_LC) + * kid1 is the lvalue (possible identifier, TOK_LB, or TOK_LC) * kid2 is the catch guard or null if no guard * kid3 is the catch block * * catch lvalue nodes are either: - * TOK_NAME for a single identifier + * a single identifier * TOK_RB or TOK_RC for a destructuring left-hand side * * finally nodes are TOK_LC statement lists. @@ -6282,6 +6864,8 @@ Parser<ParseHandler>::tryStatement(YieldHandling yieldHandling) { MUST_MATCH_TOKEN(TOK_LC, JSMSG_CURLY_BEFORE_TRY); + uint32_t openedPos = pos().begin; + ParseContext::Statement stmt(pc, StatementKind::Try); ParseContext::Scope scope(this); if (!scope.init(pc)) @@ -6295,7 +6879,9 @@ Parser<ParseHandler>::tryStatement(YieldHandling yieldHandling) if (!innerBlock) return null(); - MUST_MATCH_TOKEN_MOD(TOK_RC, TokenStream::Operand, JSMSG_CURLY_AFTER_TRY); + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RC, TokenStream::Operand, + reportMissingClosing(JSMSG_CURLY_AFTER_TRY, + JSMSG_CURLY_OPENED, openedPos)); } bool hasUnconditionalCatch = false; @@ -6347,22 +6933,18 @@ Parser<ParseHandler>::tryStatement(YieldHandling yieldHandling) return null(); break; - case TOK_NAME: - case TOK_YIELD: { - RootedPropertyName param(context, bindingIdentifier(yieldHandling)); - if (!param) + default: { + if (!TokenKindIsPossibleIdentifierName(tt)) { + error(JSMSG_CATCH_IDENTIFIER); return null(); - catchName = newName(param); + } + + catchName = bindingIdentifier(DeclarationKind::SimpleCatchParameter, + yieldHandling); if (!catchName) return null(); - if (!noteDeclaredName(param, DeclarationKind::SimpleCatchParameter, pos())) - return null(); break; } - - default: - error(JSMSG_CATCH_IDENTIFIER); - return null(); } Node catchGuard = null(); @@ -6411,6 +6993,8 @@ Parser<ParseHandler>::tryStatement(YieldHandling yieldHandling) if (tt == TOK_FINALLY) { MUST_MATCH_TOKEN(TOK_LC, JSMSG_CURLY_BEFORE_FINALLY); + uint32_t openedPos = pos().begin; + ParseContext::Statement stmt(pc, StatementKind::Finally); ParseContext::Scope scope(this); if (!scope.init(pc)) @@ -6424,7 +7008,9 @@ Parser<ParseHandler>::tryStatement(YieldHandling yieldHandling) if (!finallyBlock) return null(); - MUST_MATCH_TOKEN_MOD(TOK_RC, TokenStream::Operand, JSMSG_CURLY_AFTER_FINALLY); + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RC, TokenStream::Operand, + reportMissingClosing(JSMSG_CURLY_AFTER_FINALLY, + JSMSG_CURLY_OPENED, openedPos)); } else { tokenStream.ungetToken(); } @@ -6441,6 +7027,8 @@ typename ParseHandler::Node Parser<ParseHandler>::catchBlockStatement(YieldHandling yieldHandling, ParseContext::Scope& catchParamScope) { + uint32_t openedPos = pos().begin; + ParseContext::Statement stmt(pc, StatementKind::Block); // ES 13.15.7 CatchClauseEvaluation @@ -6460,7 +7048,9 @@ Parser<ParseHandler>::catchBlockStatement(YieldHandling yieldHandling, if (!list) return null(); - MUST_MATCH_TOKEN_MOD(TOK_RC, TokenStream::Operand, JSMSG_CURLY_AFTER_CATCH); + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RC, TokenStream::Operand, + reportMissingClosing(JSMSG_CURLY_AFTER_CATCH, + JSMSG_CURLY_OPENED, openedPos)); // The catch parameter names are not bound in the body scope, so remove // them before generating bindings. @@ -6474,7 +7064,7 @@ Parser<ParseHandler>::debuggerStatement() { TokenPos p; p.begin = pos().begin; - if (!MatchOrInsertSemicolonAfterNonExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterNonExpression()) return null(); p.end = pos().end; @@ -6514,6 +7104,7 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, { MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_CLASS)); + uint32_t classStartOffset = pos().begin; bool savedStrictness = setLocalStrictMode(true); TokenKind tt; @@ -6521,7 +7112,7 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, return null(); RootedPropertyName name(context); - if (tt == TOK_NAME || tt == TOK_YIELD) { + if (TokenKindIsPossibleIdentifier(tt)) { name = bindingIdentifier(yieldHandling); if (!name) return null(); @@ -6539,16 +7130,20 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, tokenStream.ungetToken(); } + // Push a ParseContext::ClassStatement to keep track of the constructor + // funbox. + ParseContext::ClassStatement classStmt(pc); + RootedAtom propAtom(context); // A named class creates a new lexical scope with a const binding of the - // class name. - Maybe<ParseContext::Statement> classStmt; - Maybe<ParseContext::Scope> classScope; + // class name for the "inner name". + Maybe<ParseContext::Statement> innerScopeStmt; + Maybe<ParseContext::Scope> innerScope; if (name) { - classStmt.emplace(pc, StatementKind::Block); - classScope.emplace(this); - if (!classScope->init(pc)) + innerScopeStmt.emplace(pc, StatementKind::Block); + innerScope.emplace(this); + if (!innerScope->init(pc)) return null(); } @@ -6575,10 +7170,10 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, if (!classMethods) return null(); - bool seenConstructor = false; + Maybe<DeclarationKind> declKind = Nothing(); for (;;) { TokenKind tt; - if (!tokenStream.getToken(&tt, TokenStream::KeywordIsName)) + if (!tokenStream.getToken(&tt)) return null(); if (tt == TOK_RC) break; @@ -6587,22 +7182,18 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, continue; bool isStatic = false; - if (tt == TOK_NAME && tokenStream.currentName() == context->names().static_) { - if (!tokenStream.peekToken(&tt, TokenStream::KeywordIsName)) + if (tt == TOK_STATIC) { + if (!tokenStream.peekToken(&tt)) return null(); if (tt == TOK_RC) { - tokenStream.consumeKnownToken(tt, TokenStream::KeywordIsName); + tokenStream.consumeKnownToken(tt); error(JSMSG_UNEXPECTED_TOKEN, "property name", TokenKindToDesc(tt)); return null(); } if (tt != TOK_LP) { - if (!checkUnescapedName()) - return null(); - isStatic = true; } else { - tokenStream.addModifierException(TokenStream::NoneIsKeywordIsName); tokenStream.ungetToken(); } } else { @@ -6614,7 +7205,7 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, return null(); PropertyType propType; - Node propName = propertyName(yieldHandling, classMethods, &propType, &propAtom); + Node propName = propertyName(yieldHandling, declKind, classMethods, &propType, &propAtom); if (!propName) return null(); @@ -6631,16 +7222,17 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, propType = PropertyType::GetterNoExpressionClosure; if (propType == PropertyType::Setter) propType = PropertyType::SetterNoExpressionClosure; - if (!isStatic && propAtom == context->names().constructor) { + + bool isConstructor = !isStatic && propAtom == context->names().constructor; + if (isConstructor) { if (propType != PropertyType::Method) { errorAt(nameOffset, JSMSG_BAD_METHOD_DEF); return null(); } - if (seenConstructor) { + if (classStmt.constructorBox) { errorAt(nameOffset, JSMSG_DUPLICATE_PROPERTY, "constructor"); return null(); } - seenConstructor = true; propType = hasHeritage ? PropertyType::DerivedConstructor : PropertyType::Constructor; } else if (isStatic && propAtom == context->names().prototype) { errorAt(nameOffset, JSMSG_BAD_METHOD_DEF); @@ -6665,7 +7257,12 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, if (!tokenStream.isCurrentTokenType(TOK_RB)) funName = propAtom; } - Node fn = methodDefinition(nameOffset, propType, funName); + + // Calling toString on constructors need to return the source text for + // the entire class. The end offset is unknown at this point in + // parsing and will be amended when class parsing finishes below. + Node fn = methodDefinition(isConstructor ? classStartOffset : nameOffset, + propType, funName); if (!fn) return null(); @@ -6676,6 +7273,15 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, return null(); } + // Amend the toStringEnd offset for the constructor now that we've + // finished parsing the class. + uint32_t classEndOffset = pos().end; + if (FunctionBox* ctorbox = classStmt.constructorBox) { + if (ctorbox->function()->isInterpretedLazy()) + ctorbox->function()->lazyScript()->setToStringEnd(classEndOffset); + ctorbox->toStringEnd = classEndOffset; + } + Node nameNode = null(); Node methodsOrBlock = classMethods; if (name) { @@ -6687,15 +7293,15 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, if (!innerName) return null(); - Node classBlock = finishLexicalScope(*classScope, classMethods); + Node classBlock = finishLexicalScope(*innerScope, classMethods); if (!classBlock) return null(); methodsOrBlock = classBlock; // Pop the inner scope. - classScope.reset(); - classStmt.reset(); + innerScope.reset(); + innerScopeStmt.reset(); Node outerName = null(); if (classContext == ClassStatement) { @@ -6715,16 +7321,15 @@ Parser<ParseHandler>::classDefinition(YieldHandling yieldHandling, MOZ_ALWAYS_TRUE(setLocalStrictMode(savedStrictness)); - return handler.newClass(nameNode, classHeritage, methodsOrBlock); + return handler.newClass(nameNode, classHeritage, methodsOrBlock, + TokenPos(classStartOffset, classEndOffset)); } template <class ParseHandler> bool Parser<ParseHandler>::nextTokenContinuesLetDeclaration(TokenKind next, YieldHandling yieldHandling) { - MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_NAME)); - MOZ_ASSERT(tokenStream.currentName() == context->names().let); - MOZ_ASSERT(!tokenStream.currentToken().nameContainsEscape()); + MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_LET)); #ifdef DEBUG TokenKind verify; @@ -6736,18 +7341,19 @@ Parser<ParseHandler>::nextTokenContinuesLetDeclaration(TokenKind next, YieldHand if (next == TOK_LB || next == TOK_LC) return true; - // Otherwise a let declaration must have a name. - if (next == TOK_NAME) { - if (tokenStream.nextName() == context->names().yield) { - MOZ_ASSERT(tokenStream.nextNameContainsEscape(), - "token stream should interpret unescaped 'yield' as TOK_YIELD"); - - // Same as |next == TOK_YIELD|. - return yieldHandling == YieldIsName; - } + // If we have the name "yield", the grammar parameter exactly states + // whether this is okay. (This wasn't true for SpiderMonkey's ancient + // legacy generator syntax, but that's dead now.) If YieldIsName, + // declaration-parsing code will (if necessary) enforce a strict mode + // restriction on defining "yield". If YieldIsKeyword, consider this the + // end of the declaration, in case ASI induces a semicolon that makes the + // "yield" valid. + if (next == TOK_YIELD) + return yieldHandling == YieldIsName; - // One non-"yield" TOK_NAME edge case deserves special comment. - // Consider this: + // Otherwise a let declaration must have a name. + if (TokenKindIsPossibleIdentifier(next)) { + // A "let" edge case deserves special comment. Consider this: // // let // not an ASI opportunity // let; @@ -6760,16 +7366,6 @@ Parser<ParseHandler>::nextTokenContinuesLetDeclaration(TokenKind next, YieldHand return true; } - // If we have the name "yield", the grammar parameter exactly states - // whether this is okay. (This wasn't true for SpiderMonkey's ancient - // legacy generator syntax, but that's dead now.) If YieldIsName, - // declaration-parsing code will (if necessary) enforce a strict mode - // restriction on defining "yield". If YieldIsKeyword, consider this the - // end of the declaration, in case ASI induces a semicolon that makes the - // "yield" valid. - if (next == TOK_YIELD) - return yieldHandling == YieldIsName; - // Otherwise not a let declaration. return false; } @@ -6781,7 +7377,7 @@ Parser<ParseHandler>::variableStatement(YieldHandling yieldHandling) Node vars = declarationList(yieldHandling, PNK_VAR); if (!vars) return null(); - if (!MatchOrInsertSemicolonAfterExpression(tokenStream)) + if (!matchOrInsertSemicolonAfterExpression()) return null(); return vars; } @@ -6832,16 +7428,21 @@ Parser<ParseHandler>::statement(YieldHandling yieldHandling) return expressionStatement(yieldHandling); } - case TOK_NAME: { + default: { + // Avoid getting next token with None. + if (tt == TOK_AWAIT && pc->isAsync()) + return expressionStatement(yieldHandling); + + if (!TokenKindIsPossibleIdentifier(tt)) + return expressionStatement(yieldHandling); + TokenKind next; if (!tokenStream.peekToken(&next)) return null(); // |let| here can only be an Identifier, not a declaration. Give nicer // errors for declaration-looking typos. - if (!tokenStream.currentToken().nameContainsEscape() && - tokenStream.currentName() == context->names().let) - { + if (tt == TOK_LET) { bool forbiddenLetDeclaration = false; if (pc->sc()->strict() || versionNumber() >= JSVERSION_1_7) { @@ -6851,7 +7452,7 @@ Parser<ParseHandler>::statement(YieldHandling yieldHandling) } else if (next == TOK_LB) { // Enforce ExpressionStatement's 'let [' lookahead restriction. forbiddenLetDeclaration = true; - } else if (next == TOK_LC || next == TOK_NAME) { + } else if (next == TOK_LC || TokenKindIsPossibleIdentifier(next)) { // 'let {' and 'let foo' aren't completely forbidden, if ASI // causes 'let' to be the entire Statement. But if they're // same-line, we can aggressively give a better error message. @@ -6862,7 +7463,7 @@ Parser<ParseHandler>::statement(YieldHandling yieldHandling) if (!tokenStream.peekTokenSameLine(&nextSameLine)) return null(); - MOZ_ASSERT(nextSameLine == TOK_NAME || + MOZ_ASSERT(TokenKindIsPossibleIdentifier(nextSameLine) || nextSameLine == TOK_LC || nextSameLine == TOK_EOL); @@ -6886,9 +7487,6 @@ Parser<ParseHandler>::statement(YieldHandling yieldHandling) case TOK_NEW: return expressionStatement(yieldHandling, PredictInvoked); - default: - return expressionStatement(yieldHandling); - // IfStatement[?Yield, ?Return] case TOK_IF: return ifStatement(yieldHandling); @@ -6934,7 +7532,7 @@ Parser<ParseHandler>::statement(YieldHandling yieldHandling) return withStatement(yieldHandling); // LabelledStatement[?Yield, ?Return] - // This is really handled by TOK_NAME and TOK_YIELD cases above. + // This is really handled by default and TOK_YIELD cases above. // ThrowStatement[?Yield] case TOK_THROW: @@ -7040,26 +7638,29 @@ Parser<ParseHandler>::statementListItem(YieldHandling yieldHandling, return expressionStatement(yieldHandling); } - case TOK_NAME: { + default: { + // Avoid getting next token with None. + if (tt == TOK_AWAIT && pc->isAsync()) + return expressionStatement(yieldHandling); + + if (!TokenKindIsPossibleIdentifier(tt)) + return expressionStatement(yieldHandling); + TokenKind next; if (!tokenStream.peekToken(&next)) return null(); - if (!tokenStream.currentToken().nameContainsEscape() && - tokenStream.currentName() == context->names().let && - nextTokenContinuesLetDeclaration(next, yieldHandling)) - { - return lexicalDeclaration(yieldHandling, /* isConst = */ false); - } + if (tt == TOK_LET && nextTokenContinuesLetDeclaration(next, yieldHandling)) + return lexicalDeclaration(yieldHandling, DeclarationKind::Let); - if (tokenStream.currentName() == context->names().async) { + if (tt == TOK_ASYNC) { TokenKind nextSameLine = TOK_EOF; if (!tokenStream.peekTokenSameLine(&nextSameLine)) return null(); if (nextSameLine == TOK_FUNCTION) { - uint32_t preludeStart = pos().begin; + uint32_t toStringStart = pos().begin; tokenStream.consumeKnownToken(TOK_FUNCTION); - return functionStmt(preludeStart, yieldHandling, NameRequired, AsyncFunction); + return functionStmt(toStringStart, yieldHandling, NameRequired, AsyncFunction); } } @@ -7072,9 +7673,6 @@ Parser<ParseHandler>::statementListItem(YieldHandling yieldHandling, case TOK_NEW: return expressionStatement(yieldHandling, PredictInvoked); - default: - return expressionStatement(yieldHandling); - // IfStatement[?Yield, ?Return] case TOK_IF: return ifStatement(yieldHandling); @@ -7120,7 +7718,7 @@ Parser<ParseHandler>::statementListItem(YieldHandling yieldHandling, return withStatement(yieldHandling); // LabelledStatement[?Yield, ?Return] - // This is really handled by TOK_NAME and TOK_YIELD cases above. + // This is really handled by default and TOK_YIELD cases above. // ThrowStatement[?Yield] case TOK_THROW: @@ -7149,7 +7747,7 @@ Parser<ParseHandler>::statementListItem(YieldHandling yieldHandling, case TOK_CONST: // [In] is the default behavior, because for-loops specially parse // their heads to handle |in| in this situation. - return lexicalDeclaration(yieldHandling, /* isConst = */ true); + return lexicalDeclaration(yieldHandling, DeclarationKind::Const); // ImportDeclaration (only inside modules) case TOK_IMPORT: @@ -7438,26 +8036,6 @@ Parser<ParseHandler>::condExpr1(InHandling inHandling, YieldHandling yieldHandli return handler.newConditional(condition, thenExpr, elseExpr); } -class AutoClearInDestructuringDecl -{ - ParseContext* pc_; - Maybe<DeclarationKind> saved_; - - public: - explicit AutoClearInDestructuringDecl(ParseContext* pc) - : pc_(pc), - saved_(pc->inDestructuringDecl) - { - pc->inDestructuringDecl = Nothing(); - if (saved_ && *saved_ == DeclarationKind::FormalParameter) - pc->functionBox()->hasParameterExprs = true; - } - - ~AutoClearInDestructuringDecl() { - pc_->inDestructuringDecl = saved_; - } -}; - template <typename ParseHandler> typename ParseHandler::Node Parser<ParseHandler>::assignExpr(InHandling inHandling, YieldHandling yieldHandling, @@ -7482,10 +8060,13 @@ Parser<ParseHandler>::assignExpr(InHandling inHandling, YieldHandling yieldHandl if (!tokenStream.getToken(&tt, TokenStream::Operand)) return null(); - uint32_t exprOffset = pos().begin; + TokenPos exprPos = pos(); bool endsExpr; + // This only handles identifiers that *never* have special meaning anywhere + // in the language. Contextual keywords, reserved words in strict mode, + // and other hard cases are handled outside this fast path. if (tt == TOK_NAME) { if (!tokenStream.nextTokenEndsExpr(&endsExpr)) return null(); @@ -7516,12 +8097,12 @@ Parser<ParseHandler>::assignExpr(InHandling inHandling, YieldHandling yieldHandl return yieldExpression(inHandling); bool maybeAsyncArrow = false; - if (tt == TOK_NAME && tokenStream.currentName() == context->names().async) { + if (tt == TOK_ASYNC) { TokenKind nextSameLine = TOK_EOF; if (!tokenStream.peekTokenSameLine(&nextSameLine)) return null(); - if (nextSameLine == TOK_NAME || nextSameLine == TOK_YIELD) + if (TokenKindIsPossibleIdentifier(nextSameLine)) maybeAsyncArrow = true; } @@ -7535,13 +8116,12 @@ Parser<ParseHandler>::assignExpr(InHandling inHandling, YieldHandling yieldHandl PossibleError possibleErrorInner(*this); Node lhs; if (maybeAsyncArrow) { - tokenStream.consumeKnownToken(TOK_NAME, TokenStream::Operand); - MOZ_ASSERT(tokenStream.currentName() == context->names().async); + tokenStream.consumeKnownToken(TOK_ASYNC, TokenStream::Operand); TokenKind tt; if (!tokenStream.getToken(&tt)) return null(); - MOZ_ASSERT(tt == TOK_NAME || tt == TOK_YIELD); + MOZ_ASSERT(TokenKindIsPossibleIdentifier(tt)); // Check yield validity here. RootedPropertyName name(context, bindingIdentifier(yieldHandling)); @@ -7604,28 +8184,24 @@ Parser<ParseHandler>::assignExpr(InHandling inHandling, YieldHandling yieldHandl if (!tokenStream.getToken(&next, TokenStream::Operand)) return null(); - uint32_t preludeStart = pos().begin; + uint32_t toStringStart = pos().begin; tokenStream.ungetToken(); GeneratorKind generatorKind = NotGenerator; FunctionAsyncKind asyncKind = SyncFunction; - if (next == TOK_NAME) { + if (next == TOK_ASYNC) { tokenStream.consumeKnownToken(next, TokenStream::Operand); - if (tokenStream.currentName() == context->names().async) { - TokenKind nextSameLine = TOK_EOF; - if (!tokenStream.peekTokenSameLine(&nextSameLine)) - return null(); + TokenKind nextSameLine = TOK_EOF; + if (!tokenStream.peekTokenSameLine(&nextSameLine)) + return null(); - if (nextSameLine == TOK_ARROW) { - tokenStream.ungetToken(); - } else { - generatorKind = StarGenerator; - asyncKind = AsyncFunction; - } - } else { + if (nextSameLine == TOK_ARROW) { tokenStream.ungetToken(); + } else { + generatorKind = StarGenerator; + asyncKind = AsyncFunction; } } @@ -7633,7 +8209,7 @@ Parser<ParseHandler>::assignExpr(InHandling inHandling, YieldHandling yieldHandl if (!pn) return null(); - Node arrowFunc = functionDefinition(preludeStart, pn, inHandling, yieldHandling, nullptr, + Node arrowFunc = functionDefinition(toStringStart, pn, inHandling, yieldHandling, nullptr, Arrow, generatorKind, asyncKind); if (!arrowFunc) return null(); @@ -7690,12 +8266,12 @@ Parser<ParseHandler>::assignExpr(InHandling inHandling, YieldHandling yieldHandl return null(); } - if (!checkDestructuringPattern(lhs, Nothing(), &possibleErrorInner)) + if (!possibleErrorInner.checkForDestructuringErrorOrWarning()) return null(); } else if (handler.isNameAnyParentheses(lhs)) { if (const char* chars = handler.nameIsArgumentsEvalAnyParentheses(lhs, context)) { // |chars| is "arguments" or "eval" here. - if (!strictModeErrorAt(exprOffset, JSMSG_BAD_STRICT_ASSIGN, chars)) + if (!strictModeErrorAt(exprPos.begin, JSMSG_BAD_STRICT_ASSIGN, chars)) return null(); } @@ -7703,23 +8279,22 @@ Parser<ParseHandler>::assignExpr(InHandling inHandling, YieldHandling yieldHandl } else if (handler.isPropertyAccess(lhs)) { // Permitted: no additional testing/fixup needed. } else if (handler.isFunctionCall(lhs)) { - if (!strictModeErrorAt(exprOffset, JSMSG_BAD_LEFTSIDE_OF_ASS)) + if (!strictModeErrorAt(exprPos.begin, JSMSG_BAD_LEFTSIDE_OF_ASS)) return null(); + + if (possibleError) + possibleError->setPendingDestructuringErrorAt(exprPos, JSMSG_BAD_DESTRUCT_TARGET); } else { - errorAt(exprOffset, JSMSG_BAD_LEFTSIDE_OF_ASS); + errorAt(exprPos.begin, JSMSG_BAD_LEFTSIDE_OF_ASS); return null(); } if (!possibleErrorInner.checkForExpressionError()) return null(); - Node rhs; - { - AutoClearInDestructuringDecl autoClear(pc); - rhs = assignExpr(inHandling, yieldHandling, TripledotProhibited); - if (!rhs) - return null(); - } + Node rhs = assignExpr(inHandling, yieldHandling, TripledotProhibited); + if (!rhs) + return null(); if (kind == PNK_ASSIGN) handler.checkAndSetIsDirectRHSAnonFunction(rhs); @@ -7874,20 +8449,17 @@ Parser<ParseHandler>::unaryExpr(YieldHandling yieldHandling, TripledotHandling t } case TOK_AWAIT: { - if (!pc->isAsync()) { - // TOK_AWAIT can be returned in module, even if it's not inside - // async function. - error(JSMSG_RESERVED_ID, "await"); - return null(); + if (pc->isAsync()) { + Node kid = unaryExpr(yieldHandling, tripledotHandling, possibleError, invoked); + if (!kid) + return null(); + pc->lastAwaitOffset = begin; + return newAwaitExpression(begin, kid); } - - Node kid = unaryExpr(yieldHandling, tripledotHandling, possibleError, invoked); - if (!kid) - return null(); - pc->lastAwaitOffset = begin; - return newAwaitExpression(begin, kid); } + MOZ_FALLTHROUGH; + default: { Node expr = memberExpr(yieldHandling, tripledotHandling, tt, /* allowCallSyntax = */ true, possibleError, invoked); @@ -7949,7 +8521,7 @@ Parser<ParseHandler>::generatorComprehensionLambda(unsigned begin) // Create box for fun->object early to root it. Directives directives(/* strict = */ outerpc->sc()->strict()); - FunctionBox* genFunbox = newFunctionBox(genfn, fun, /* preludeStart = */ 0, directives, + FunctionBox* genFunbox = newFunctionBox(genfn, fun, /* toStringStart = */ 0, directives, StarGenerator, SyncFunction, /* tryAnnexB = */ false); if (!genFunbox) return null(); @@ -7985,7 +8557,7 @@ Parser<ParseHandler>::generatorComprehensionLambda(unsigned begin) uint32_t end = pos().end; handler.setBeginPosition(comp, begin); handler.setEndPosition(comp, end); - genFunbox->bufEnd = end; + genFunbox->setEnd(end); handler.addStatementToList(body, comp); handler.setEndPosition(body, end); handler.setBeginPosition(genfn, begin); @@ -8025,8 +8597,10 @@ Parser<ParseHandler>::comprehensionFor(GeneratorKind comprehensionKind) // FIXME: Destructuring binding (bug 980828). - MUST_MATCH_TOKEN(TOK_NAME, JSMSG_NO_VARIABLE_NAME); - RootedPropertyName name(context, tokenStream.currentName()); + MUST_MATCH_TOKEN_FUNC(TokenKindIsPossibleIdentifier, JSMSG_NO_VARIABLE_NAME); + RootedPropertyName name(context, bindingIdentifier(YieldIsKeyword)); + if (!name) + return null(); if (name == context->names().let) { error(JSMSG_LET_COMP_BINDING); return null(); @@ -8036,7 +8610,7 @@ Parser<ParseHandler>::comprehensionFor(GeneratorKind comprehensionKind) if (!lhs) return null(); bool matched; - if (!tokenStream.matchContextualKeyword(&matched, context->names().of)) + if (!tokenStream.matchToken(&matched, TOK_OF)) return null(); if (!matched) { error(JSMSG_OF_AFTER_FOR_NAME); @@ -8371,9 +8945,9 @@ Parser<ParseHandler>::memberExpr(YieldHandling yieldHandling, TripledotHandling Node nextMember; if (tt == TOK_DOT) { - if (!tokenStream.getToken(&tt, TokenStream::KeywordIsName)) + if (!tokenStream.getToken(&tt)) return null(); - if (tt == TOK_NAME) { + if (TokenKindIsPossibleIdentifierName(tt)) { PropertyName* field = tokenStream.currentName(); if (handler.isSuperBase(lhs) && !checkAndMarkSuperScope()) { error(JSMSG_BAD_SUPERPROP, "property"); @@ -8448,8 +9022,27 @@ Parser<ParseHandler>::memberExpr(YieldHandling yieldHandling, TripledotHandling JSOp op = JSOP_CALL; bool maybeAsyncArrow = false; - if (tt == TOK_LP && handler.isNameAnyParentheses(lhs)) { - if (handler.nameIsEvalAnyParentheses(lhs, context)) { + if (PropertyName* prop = handler.maybeDottedProperty(lhs)) { + // Use the JSOP_FUN{APPLY,CALL} optimizations given the + // right syntax. + if (prop == context->names().apply) { + op = JSOP_FUNAPPLY; + if (pc->isFunctionBox()) { + pc->functionBox()->usesApply = true; + } + } else if (prop == context->names().call) { + op = JSOP_FUNCALL; + } + } else if (tt == TOK_LP) { + if (handler.isAsyncKeyword(lhs, context)) { + // |async (| can be the start of an async arrow + // function, so we need to defer reporting possible + // errors from destructuring syntax. To give better + // error messages, we only allow the AsyncArrowHead + // part of the CoverCallExpressionAndAsyncArrowHead + // syntax when the initial name is "async". + maybeAsyncArrow = true; + } else if (handler.isEvalAnyParentheses(lhs, context)) { // Select the right EVAL op and flag pc as having a // direct eval. op = pc->sc()->strict() ? JSOP_STRICTEVAL : JSOP_EVAL; @@ -8466,24 +9059,6 @@ Parser<ParseHandler>::memberExpr(YieldHandling yieldHandling, TripledotHandling // it. (If we're not in a method, that's fine, so // ignore the return value.) checkAndMarkSuperScope(); - } else if (handler.nameIsUnparenthesizedAsync(lhs, context)) { - // |async (| can be the start of an async arrow - // function, so we need to defer reporting possible - // errors from destructuring syntax. To give better - // error messages, we only allow the AsyncArrowHead - // part of the CoverCallExpressionAndAsyncArrowHead - // syntax when the initial name is "async". - maybeAsyncArrow = true; - } - } else if (PropertyName* prop = handler.maybeDottedProperty(lhs)) { - // Use the JSOP_FUN{APPLY,CALL} optimizations given the - // right syntax. - if (prop == context->names().apply) { - op = JSOP_FUNAPPLY; - if (pc->isFunctionBox()) - pc->functionBox()->usesApply = true; - } else if (prop == context->names().call) { - op = JSOP_FUNCALL; } } @@ -8542,106 +9117,117 @@ Parser<ParseHandler>::newName(PropertyName* name, TokenPos pos) } template <typename ParseHandler> -PropertyName* -Parser<ParseHandler>::labelOrIdentifierReference(YieldHandling yieldHandling, - bool yieldTokenizedAsName) -{ - PropertyName* ident; - bool isYield; - const Token& tok = tokenStream.currentToken(); - if (tok.type == TOK_NAME) { - MOZ_ASSERT(tok.name() != context->names().yield || - tok.nameContainsEscape() || - yieldTokenizedAsName, - "tokenizer should have treated unescaped 'yield' as TOK_YIELD"); - MOZ_ASSERT_IF(yieldTokenizedAsName, tok.name() == context->names().yield); - - ident = tok.name(); - isYield = ident == context->names().yield; - } else { - MOZ_ASSERT(tok.type == TOK_YIELD && !yieldTokenizedAsName); +bool +Parser<ParseHandler>::checkLabelOrIdentifierReference(HandlePropertyName ident, + uint32_t offset, + YieldHandling yieldHandling) +{ + if (ident == context->names().yield) { + if (yieldHandling == YieldIsKeyword || + versionNumber() >= JSVERSION_1_7) + { + errorAt(offset, JSMSG_RESERVED_ID, "yield"); + return false; + } + if (pc->sc()->needStrictChecks()) { + if (!strictModeErrorAt(offset, JSMSG_RESERVED_ID, "yield")) + return false; + } - ident = context->names().yield; - isYield = true; + return true; } - if (!isYield) { - if (pc->sc()->strict()) { - const char* badName = ident == context->names().let - ? "let" - : ident == context->names().static_ - ? "static" - : nullptr; - if (badName) { - error(JSMSG_RESERVED_ID, badName); - return nullptr; - } + if (ident == context->names().await) { + if (awaitIsKeyword()) { + errorAt(offset, JSMSG_RESERVED_ID, "await"); + return false; } - } else { - if (yieldHandling == YieldIsKeyword || - pc->sc()->strict() || - versionNumber() >= JSVERSION_1_7) - { - error(JSMSG_RESERVED_ID, "yield"); - return nullptr; + return true; + } + + if (IsKeyword(ident) || IsReservedWordLiteral(ident)) { + errorAt(offset, JSMSG_INVALID_ID, ReservedWordToCharZ(ident)); + return false; + } + + if (IsFutureReservedWord(ident)) { + errorAt(offset, JSMSG_RESERVED_ID, ReservedWordToCharZ(ident)); + return false; + } + + if (pc->sc()->needStrictChecks()) { + if (IsStrictReservedWord(ident)) { + if (!strictModeErrorAt(offset, JSMSG_RESERVED_ID, ReservedWordToCharZ(ident))) + return false; + return true; + } + + if (ident == context->names().let) { + if (!strictModeErrorAt(offset, JSMSG_RESERVED_ID, "let")) + return false; + return true; + } + + if (ident == context->names().static_) { + if (!strictModeErrorAt(offset, JSMSG_RESERVED_ID, "static")) + return false; + return true; } } - return ident; + return true; } template <typename ParseHandler> -PropertyName* -Parser<ParseHandler>::bindingIdentifier(YieldHandling yieldHandling) +bool +Parser<ParseHandler>::checkBindingIdentifier(HandlePropertyName ident, + uint32_t offset, + YieldHandling yieldHandling) { - PropertyName* ident; - bool isYield; - const Token& tok = tokenStream.currentToken(); - if (tok.type == TOK_NAME) { - MOZ_ASSERT(tok.name() != context->names().yield || tok.nameContainsEscape(), - "tokenizer should have treated unescaped 'yield' as TOK_YIELD"); + if (!checkLabelOrIdentifierReference(ident, offset, yieldHandling)) + return false; - ident = tok.name(); - isYield = ident == context->names().yield; - } else { - MOZ_ASSERT(tok.type == TOK_YIELD); + if (pc->sc()->needStrictChecks()) { + if (ident == context->names().arguments) { + if (!strictModeErrorAt(offset, JSMSG_BAD_STRICT_ASSIGN, "arguments")) + return false; + return true; + } - ident = context->names().yield; - isYield = true; + if (ident == context->names().eval) { + if (!strictModeErrorAt(offset, JSMSG_BAD_STRICT_ASSIGN, "eval")) + return false; + return true; + } } - if (!isYield) { - if (pc->sc()->strict()) { - const char* badName = ident == context->names().arguments - ? "arguments" - : ident == context->names().eval - ? "eval" - : nullptr; - if (badName) { - error(JSMSG_BAD_STRICT_ASSIGN, badName); - return nullptr; - } + return true; +} - badName = ident == context->names().let - ? "let" - : ident == context->names().static_ - ? "static" - : nullptr; - if (badName) { - error(JSMSG_RESERVED_ID, badName); - return nullptr; - } - } - } else { - if (yieldHandling == YieldIsKeyword || - pc->sc()->strict() || - versionNumber() >= JSVERSION_1_7) - { - error(JSMSG_RESERVED_ID, "yield"); - return nullptr; - } - } +template <typename ParseHandler> +PropertyName* +Parser<ParseHandler>::labelOrIdentifierReference(YieldHandling yieldHandling) +{ + // ES 2017 draft 12.1.1. + // StringValue of IdentifierName normalizes any Unicode escape sequences + // in IdentifierName hence such escapes cannot be used to write an + // Identifier whose code point sequence is the same as a ReservedWord. + // + // Use PropertyName* instead of TokenKind to reflect the normalization. + RootedPropertyName ident(context, tokenStream.currentName()); + if (!checkLabelOrIdentifierReference(ident, pos().begin, yieldHandling)) + return nullptr; + return ident; +} + +template <typename ParseHandler> +PropertyName* +Parser<ParseHandler>::bindingIdentifier(YieldHandling yieldHandling) +{ + RootedPropertyName ident(context, tokenStream.currentName()); + if (!checkBindingIdentifier(ident, pos().begin, yieldHandling)) + return nullptr; return ident; } @@ -8653,7 +9239,7 @@ Parser<ParseHandler>::identifierReference(Handle<PropertyName*> name) if (!pn) return null(); - if (!pc->inDestructuringDecl && !noteUsedName(name)) + if (!noteUsedName(name)) return null(); return pn; @@ -8668,8 +9254,23 @@ Parser<ParseHandler>::stringLiteral() template <typename ParseHandler> typename ParseHandler::Node -Parser<ParseHandler>::noSubstitutionTemplate() +Parser<ParseHandler>::noSubstitutionTaggedTemplate() +{ + if (tokenStream.hasInvalidTemplateEscape()) { + tokenStream.clearInvalidTemplateEscape(); + return handler.newRawUndefinedLiteral(pos()); + } + + return handler.newTemplateStringLiteral(stopStringCompression(), pos()); +} + +template <typename ParseHandler> +typename ParseHandler::Node +Parser<ParseHandler>::noSubstitutionUntaggedTemplate() { + if (!tokenStream.checkForInvalidTemplateEscapeError()) + return null(); + return handler.newTemplateStringLiteral(stopStringCompression(), pos()); } @@ -8705,6 +9306,74 @@ Parser<ParseHandler>::newRegExp() } template <typename ParseHandler> +void +Parser<ParseHandler>::checkDestructuringAssignmentTarget(Node expr, TokenPos exprPos, + PossibleError* possibleError) +{ + // Return early if a pending destructuring error is already present. + if (possibleError->hasPendingDestructuringError()) + return; + + if (pc->sc()->needStrictChecks()) { + if (handler.isArgumentsAnyParentheses(expr, context)) { + if (pc->sc()->strict()) { + possibleError->setPendingDestructuringErrorAt(exprPos, + JSMSG_BAD_STRICT_ASSIGN_ARGUMENTS); + } else { + possibleError->setPendingDestructuringWarningAt(exprPos, + JSMSG_BAD_STRICT_ASSIGN_ARGUMENTS); + } + return; + } + + if (handler.isEvalAnyParentheses(expr, context)) { + if (pc->sc()->strict()) { + possibleError->setPendingDestructuringErrorAt(exprPos, + JSMSG_BAD_STRICT_ASSIGN_EVAL); + } else { + possibleError->setPendingDestructuringWarningAt(exprPos, + JSMSG_BAD_STRICT_ASSIGN_EVAL); + } + return; + } + } + + // The expression must be either a simple assignment target, i.e. a name + // or a property accessor, or a nested destructuring pattern. + if (!handler.isUnparenthesizedDestructuringPattern(expr) && + !handler.isNameAnyParentheses(expr) && + !handler.isPropertyAccess(expr)) + { + // Parentheses are forbidden around destructuring *patterns* (but + // allowed around names). Use our nicer error message for + // parenthesized, nested patterns. + if (handler.isParenthesizedDestructuringPattern(expr)) + possibleError->setPendingDestructuringErrorAt(exprPos, JSMSG_BAD_DESTRUCT_PARENS); + else + possibleError->setPendingDestructuringErrorAt(exprPos, JSMSG_BAD_DESTRUCT_TARGET); + } +} + +template <typename ParseHandler> +void +Parser<ParseHandler>::checkDestructuringAssignmentElement(Node expr, TokenPos exprPos, + PossibleError* possibleError) +{ + // ES2018 draft rev 0719f44aab93215ed9a626b2f45bd34f36916834 + // 12.15.5 Destructuring Assignment + // + // AssignmentElement[Yield, Await]: + // DestructuringAssignmentTarget[?Yield, ?Await] + // DestructuringAssignmentTarget[?Yield, ?Await] Initializer[+In, ?Yield, ?Await] + + // If |expr| is an assignment element with an initializer expression, its + // destructuring assignment target was already validated in assignExpr(). + // Otherwise we need to check that |expr| is a valid destructuring target. + if (!handler.isUnparenthesizedAssignment(expr)) + checkDestructuringAssignmentTarget(expr, exprPos, possibleError); +} + +template <typename ParseHandler> typename ParseHandler::Node Parser<ParseHandler>::arrayInitializer(YieldHandling yieldHandling, PossibleError* possibleError) { @@ -8753,17 +9422,29 @@ Parser<ParseHandler>::arrayInitializer(YieldHandling yieldHandling, PossibleErro } else if (tt == TOK_TRIPLEDOT) { tokenStream.consumeKnownToken(TOK_TRIPLEDOT, TokenStream::Operand); uint32_t begin = pos().begin; + + TokenPos innerPos; + if (!tokenStream.peekTokenPos(&innerPos, TokenStream::Operand)) + return null(); + Node inner = assignExpr(InAllowed, yieldHandling, TripledotProhibited, possibleError); if (!inner) return null(); + if (possibleError) + checkDestructuringAssignmentTarget(inner, innerPos, possibleError); if (!handler.addSpreadElement(literal, begin, inner)) return null(); } else { + TokenPos elementPos; + if (!tokenStream.peekTokenPos(&elementPos, TokenStream::Operand)) + return null(); Node element = assignExpr(InAllowed, yieldHandling, TripledotProhibited, possibleError); if (!element) return null(); + if (possibleError) + checkDestructuringAssignmentElement(element, elementPos, possibleError); if (foldConstants && !FoldConstants(context, &element, this)) return null(); handler.addArrayElement(literal, element); @@ -8783,7 +9464,9 @@ Parser<ParseHandler>::arrayInitializer(YieldHandling yieldHandling, PossibleErro } } - MUST_MATCH_TOKEN_MOD(TOK_RB, modifier, JSMSG_BRACKET_AFTER_LIST); + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RB, modifier, + reportMissingClosing(JSMSG_BRACKET_AFTER_LIST, + JSMSG_BRACKET_OPENED, begin)); } handler.setEndPosition(literal, pos().end); return literal; @@ -8799,11 +9482,12 @@ DoubleToAtom(ExclusiveContext* cx, double value) template <typename ParseHandler> typename ParseHandler::Node -Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, +Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, + const Maybe<DeclarationKind>& maybeDecl, Node propList, PropertyType* propType, MutableHandleAtom propAtom) { TokenKind ltok; - if (!tokenStream.getToken(<ok, TokenStream::KeywordIsName)) + if (!tokenStream.getToken(<ok)) return null(); MOZ_ASSERT(ltok != TOK_RC, "caller should have handled TOK_RC"); @@ -8812,11 +9496,11 @@ Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, bool isAsync = false; if (ltok == TOK_MUL) { isGenerator = true; - if (!tokenStream.getToken(<ok, TokenStream::KeywordIsName)) + if (!tokenStream.getToken(<ok)) return null(); } - if (ltok == TOK_NAME && tokenStream.currentName() == context->names().async) { + if (ltok == TOK_ASYNC) { // AsyncMethod[Yield, Await]: // async [no LineTerminator here] PropertyName[?Yield, ?Await] ... // @@ -8832,16 +9516,13 @@ Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, // ComputedPropertyName[Yield, Await]: // [ ... TokenKind tt = TOK_EOF; - if (!tokenStream.peekTokenSameLine(&tt, TokenStream::KeywordIsName)) + if (!tokenStream.getToken(&tt)) return null(); - if (tt == TOK_STRING || tt == TOK_NUMBER || tt == TOK_LB || - tt == TOK_NAME || tt == TOK_YIELD) - { + if (tt != TOK_LP && tt != TOK_COLON && tt != TOK_RC && tt != TOK_ASSIGN) { isAsync = true; - tokenStream.consumeKnownToken(tt, TokenStream::KeywordIsName); ltok = tt; } else { - tokenStream.addModifierException(TokenStream::NoneIsKeywordIsName); + tokenStream.ungetToken(); } } @@ -8863,46 +9544,41 @@ Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, break; case TOK_LB: - propName = computedPropertyName(yieldHandling, propList); + propName = computedPropertyName(yieldHandling, maybeDecl, propList); if (!propName) return null(); break; - case TOK_NAME: { + default: { + if (!TokenKindIsPossibleIdentifierName(ltok)) { + error(JSMSG_UNEXPECTED_TOKEN, "property name", TokenKindToDesc(ltok)); + return null(); + } + propAtom.set(tokenStream.currentName()); // Do not look for accessor syntax on generators - if (isGenerator || isAsync || - !(propAtom.get() == context->names().get || - propAtom.get() == context->names().set)) - { + if (isGenerator || isAsync || !(ltok == TOK_GET || ltok == TOK_SET)) { propName = handler.newObjectLiteralPropertyName(propAtom, pos()); if (!propName) return null(); break; } - *propType = propAtom.get() == context->names().get ? PropertyType::Getter - : PropertyType::Setter; + *propType = ltok == TOK_GET ? PropertyType::Getter : PropertyType::Setter; // We have parsed |get| or |set|. Look for an accessor property // name next. TokenKind tt; - if (!tokenStream.peekToken(&tt, TokenStream::KeywordIsName)) + if (!tokenStream.peekToken(&tt)) return null(); - if (tt == TOK_NAME) { - if (!checkUnescapedName()) - return null(); - - tokenStream.consumeKnownToken(TOK_NAME, TokenStream::KeywordIsName); + if (TokenKindIsPossibleIdentifierName(tt)) { + tokenStream.consumeKnownToken(tt); propAtom.set(tokenStream.currentName()); return handler.newObjectLiteralPropertyName(propAtom, pos()); } if (tt == TOK_STRING) { - if (!checkUnescapedName()) - return null(); - - tokenStream.consumeKnownToken(TOK_STRING, TokenStream::KeywordIsName); + tokenStream.consumeKnownToken(TOK_STRING); propAtom.set(tokenStream.currentToken().atom()); @@ -8916,10 +9592,7 @@ Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, return stringLiteral(); } if (tt == TOK_NUMBER) { - if (!checkUnescapedName()) - return null(); - - tokenStream.consumeKnownToken(TOK_NUMBER, TokenStream::KeywordIsName); + tokenStream.consumeKnownToken(TOK_NUMBER); propAtom.set(DoubleToAtom(context, tokenStream.currentToken().number())); if (!propAtom.get()) @@ -8927,19 +9600,15 @@ Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, return newNumber(tokenStream.currentToken()); } if (tt == TOK_LB) { - if (!checkUnescapedName()) - return null(); + tokenStream.consumeKnownToken(TOK_LB); - tokenStream.consumeKnownToken(TOK_LB, TokenStream::KeywordIsName); - - return computedPropertyName(yieldHandling, propList); + return computedPropertyName(yieldHandling, maybeDecl, propList); } // Not an accessor property after all. propName = handler.newObjectLiteralPropertyName(propAtom.get(), pos()); if (!propName) return null(); - tokenStream.addModifierException(TokenStream::NoneIsKeywordIsName); break; } @@ -8957,10 +9626,6 @@ Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, return null(); break; } - - default: - error(JSMSG_BAD_PROP_ID); - return null(); } TokenKind tt; @@ -8976,7 +9641,9 @@ Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, return propName; } - if (ltok == TOK_NAME && (tt == TOK_COMMA || tt == TOK_RC || tt == TOK_ASSIGN)) { + if (TokenKindIsPossibleIdentifierName(ltok) && + (tt == TOK_COMMA || tt == TOK_RC || tt == TOK_ASSIGN)) + { if (isGenerator) { error(JSMSG_BAD_PROP_ID); return null(); @@ -9005,28 +9672,25 @@ Parser<ParseHandler>::propertyName(YieldHandling yieldHandling, Node propList, template <typename ParseHandler> typename ParseHandler::Node -Parser<ParseHandler>::computedPropertyName(YieldHandling yieldHandling, Node literal) +Parser<ParseHandler>::computedPropertyName(YieldHandling yieldHandling, + const Maybe<DeclarationKind>& maybeDecl, + Node literal) { uint32_t begin = pos().begin; - Node assignNode; - { - // Turn off the inDestructuringDecl flag when parsing computed property - // names. In short, when parsing 'let {[x + y]: z} = obj;', noteUsedName() - // should be called on x and y, but not on z. See the comment on - // Parser<>::checkDestructuringPattern() for details. - AutoClearInDestructuringDecl autoClear(pc); - assignNode = assignExpr(InAllowed, yieldHandling, TripledotProhibited); - if (!assignNode) - return null(); + if (maybeDecl) { + if (*maybeDecl == DeclarationKind::FormalParameter) + pc->functionBox()->hasParameterExprs = true; + } else { + handler.setListFlag(literal, PNX_NONCONST); } - MUST_MATCH_TOKEN(TOK_RB, JSMSG_COMP_PROP_UNTERM_EXPR); - Node propname = handler.newComputedName(assignNode, begin, pos().end); - if (!propname) + Node assignNode = assignExpr(InAllowed, yieldHandling, TripledotProhibited); + if (!assignNode) return null(); - handler.setListFlag(literal, PNX_NONCONST); - return propname; + + MUST_MATCH_TOKEN(TOK_RB, JSMSG_COMP_PROP_UNTERM_EXPR); + return handler.newComputedName(assignNode, begin, pos().end); } template <typename ParseHandler> @@ -9035,200 +9699,219 @@ Parser<ParseHandler>::objectLiteral(YieldHandling yieldHandling, PossibleError* { MOZ_ASSERT(tokenStream.isCurrentTokenType(TOK_LC)); + uint32_t openedPos = pos().begin; + Node literal = handler.newObjectLiteral(pos().begin); if (!literal) return null(); bool seenPrototypeMutation = false; bool seenCoverInitializedName = false; + Maybe<DeclarationKind> declKind = Nothing(); RootedAtom propAtom(context); for (;;) { TokenKind tt; - if (!tokenStream.getToken(&tt, TokenStream::KeywordIsName)) + if (!tokenStream.peekToken(&tt)) return null(); if (tt == TOK_RC) break; - TokenPos namePos = pos(); - - tokenStream.ungetToken(); - - PropertyType propType; - Node propName = propertyName(yieldHandling, literal, &propType, &propAtom); - if (!propName) - return null(); + if (tt == TOK_TRIPLEDOT) { + // object spread + tokenStream.consumeKnownToken(TOK_TRIPLEDOT); + uint32_t begin = pos().begin; - if (propType == PropertyType::Normal) { - Node propExpr = assignExpr(InAllowed, yieldHandling, TripledotProhibited, - possibleError); - if (!propExpr) + TokenPos innerPos; + if (!tokenStream.peekTokenPos(&innerPos, TokenStream::Operand)) return null(); - handler.checkAndSetIsDirectRHSAnonFunction(propExpr); - - if (foldConstants && !FoldConstants(context, &propExpr, this)) + Node inner = assignExpr(InAllowed, yieldHandling, TripledotProhibited, + possibleError); + if (!inner) + return null(); + if (possibleError) + checkDestructuringAssignmentTarget(inner, innerPos, possibleError); + if (!handler.addSpreadProperty(literal, begin, inner)) return null(); + } else { + TokenPos namePos = tokenStream.nextToken().pos; - if (propAtom == context->names().proto) { - if (seenPrototypeMutation) { - // Directly report the error when we're not in a - // destructuring context. - if (!possibleError) { - errorAt(namePos.begin, JSMSG_DUPLICATE_PROTO_PROPERTY); - return null(); - } + PropertyType propType; + Node propName = propertyName(yieldHandling, declKind, literal, &propType, &propAtom); + if (!propName) - // Otherwise delay error reporting until we've determined - // whether or not we're destructuring. - possibleError->setPendingExpressionErrorAt(namePos, - JSMSG_DUPLICATE_PROTO_PROPERTY); - } - seenPrototypeMutation = true; + return null(); - // Note: this occurs *only* if we observe TOK_COLON! Only - // __proto__: v mutates [[Prototype]]. Getters, setters, - // method/generator definitions, computed property name - // versions of all of these, and shorthands do not. - if (!handler.addPrototypeMutation(literal, namePos.begin, propExpr)) + if (propType == PropertyType::Normal) { + TokenPos exprPos; + if (!tokenStream.peekTokenPos(&exprPos, TokenStream::Operand)) return null(); - } else { - if (!handler.isConstant(propExpr)) - handler.setListFlag(literal, PNX_NONCONST); - if (!handler.addPropertyDefinition(literal, propName, propExpr)) + Node propExpr = assignExpr(InAllowed, yieldHandling, TripledotProhibited, + possibleError); + if (!propExpr) return null(); - } - } else if (propType == PropertyType::Shorthand) { - /* - * Support, e.g., |var {x, y} = o| as destructuring shorthand - * for |var {x: x, y: y} = o|, and |var o = {x, y}| as initializer - * shorthand for |var o = {x: x, y: y}|. - */ - TokenKind propToken = TOK_NAME; - if (!tokenStream.checkForKeyword(propAtom, &propToken)) - return null(); - if (propToken != TOK_NAME && propToken != TOK_YIELD) { - error(JSMSG_RESERVED_ID, TokenKindToDesc(propToken)); - return null(); - } + handler.checkAndSetIsDirectRHSAnonFunction(propExpr); - Rooted<PropertyName*> name(context, - identifierReference(yieldHandling, propToken == TOK_YIELD)); - if (!name) - return null(); + if (possibleError) + checkDestructuringAssignmentElement(propExpr, exprPos, possibleError); - Node nameExpr = identifierReference(name); - if (!nameExpr) - return null(); + if (foldConstants && !FoldConstants(context, &propExpr, this)) + return null(); - if (!handler.addShorthand(literal, propName, nameExpr)) - return null(); - } else if (propType == PropertyType::CoverInitializedName) { - /* - * Support, e.g., |var {x=1, y=2} = o| as destructuring shorthand - * with default values, as per ES6 12.14.5 - */ - TokenKind propToken = TOK_NAME; - if (!tokenStream.checkForKeyword(propAtom, &propToken)) - return null(); + if (propAtom == context->names().proto) { + if (seenPrototypeMutation) { + // Directly report the error when we're not in a + // destructuring context. + if (!possibleError) { + errorAt(namePos.begin, JSMSG_DUPLICATE_PROTO_PROPERTY); + return null(); + } - if (propToken != TOK_NAME && propToken != TOK_YIELD) { - error(JSMSG_RESERVED_ID, TokenKindToDesc(propToken)); - return null(); - } + // Otherwise delay error reporting until we've + // determined whether or not we're destructuring. + possibleError->setPendingExpressionErrorAt(namePos, + JSMSG_DUPLICATE_PROTO_PROPERTY); + } + seenPrototypeMutation = true; - Rooted<PropertyName*> name(context, - identifierReference(yieldHandling, propToken == TOK_YIELD)); - if (!name) - return null(); + // Note: this occurs *only* if we observe TOK_COLON! Only + // __proto__: v mutates [[Prototype]]. Getters, setters, + // method/generator definitions, computed property name + // versions of all of these, and shorthands do not. + if (!handler.addPrototypeMutation(literal, namePos.begin, propExpr)) + return null(); + } else { + if (!handler.isConstant(propExpr)) + handler.setListFlag(literal, PNX_NONCONST); - Node lhs = identifierReference(name); - if (!lhs) - return null(); + if (!handler.addPropertyDefinition(literal, propName, propExpr)) + return null(); + } + } else if (propType == PropertyType::Shorthand) { + /* + * Support, e.g., |({x, y} = o)| as destructuring shorthand + * for |({x: x, y: y} = o)|, and |var o = {x, y}| as + * initializer shorthand for |var o = {x: x, y: y}|. + */ + Rooted<PropertyName*> name(context, identifierReference(yieldHandling)); + if (!name) + return null(); - tokenStream.consumeKnownToken(TOK_ASSIGN); + Node nameExpr = identifierReference(name); + if (!nameExpr) + return null(); - if (!seenCoverInitializedName) { - // "shorthand default" or "CoverInitializedName" syntax is only - // valid in the case of destructuring. - seenCoverInitializedName = true; + if (possibleError) + checkDestructuringAssignmentTarget(nameExpr, namePos, possibleError); - if (!possibleError) { - // Destructuring defaults are definitely not allowed in this object literal, - // because of something the caller knows about the preceding code. - // For example, maybe the preceding token is an operator: `x + {y=z}`. - error(JSMSG_COLON_AFTER_ID); + if (!handler.addShorthand(literal, propName, nameExpr)) return null(); + } else if (propType == PropertyType::CoverInitializedName) { + /* + * Support, e.g., |({x=1, y=2} = o)| as destructuring + * shorthand with default values, as per ES6 12.14.5 + */ + Rooted<PropertyName*> name(context, identifierReference(yieldHandling)); + if (!name) + return null(); + + Node lhs = identifierReference(name); + if (!lhs) + return null(); + + tokenStream.consumeKnownToken(TOK_ASSIGN); + + if (!seenCoverInitializedName) { + // "shorthand default" or "CoverInitializedName" syntax is + // only valid in the case of destructuring. + seenCoverInitializedName = true; + + if (!possibleError) { + // Destructuring defaults are definitely not allowed + // in this object literal, because of something the + // caller knows about the preceding code. For example, + // maybe the preceding token is an operator: + // |x + {y=z}|. + error(JSMSG_COLON_AFTER_ID); + return null(); + } + + // Here we set a pending error so that later in the parse, + // once we've determined whether or not we're + // destructuring, the error can be reported or ignored + // appropriately. + possibleError->setPendingExpressionErrorAt(pos(), JSMSG_COLON_AFTER_ID); } - // Here we set a pending error so that later in the parse, once we've - // determined whether or not we're destructuring, the error can be - // reported or ignored appropriately. - possibleError->setPendingExpressionErrorAt(pos(), JSMSG_COLON_AFTER_ID); - } + if (const char* chars = handler.nameIsArgumentsEvalAnyParentheses(lhs, context)) { + // |chars| is "arguments" or "eval" here. + if (!strictModeErrorAt(namePos.begin, JSMSG_BAD_STRICT_ASSIGN, chars)) + return null(); + } - Node rhs; - { - // Clearing `inDestructuringDecl` allows name use to be noted - // in Parser::identifierReference. See bug 1255167. - AutoClearInDestructuringDecl autoClear(pc); - rhs = assignExpr(InAllowed, yieldHandling, TripledotProhibited); + Node rhs = assignExpr(InAllowed, yieldHandling, TripledotProhibited); if (!rhs) return null(); - } - handler.checkAndSetIsDirectRHSAnonFunction(rhs); + handler.checkAndSetIsDirectRHSAnonFunction(rhs); - Node propExpr = handler.newAssignment(PNK_ASSIGN, lhs, rhs, JSOP_NOP); - if (!propExpr) - return null(); - - if (!handler.addPropertyDefinition(literal, propName, propExpr)) - return null(); + Node propExpr = handler.newAssignment(PNK_ASSIGN, lhs, rhs, JSOP_NOP); + if (!propExpr) + return null(); - if (!abortIfSyntaxParser()) - return null(); - } else { - RootedAtom funName(context); - if (!tokenStream.isCurrentTokenType(TOK_RB)) { - funName = propAtom; + if (!handler.addPropertyDefinition(literal, propName, propExpr)) + return null(); + } else { + RootedAtom funName(context); + if (!tokenStream.isCurrentTokenType(TOK_RB)) { + funName = propAtom; - if (propType == PropertyType::Getter || propType == PropertyType::Setter) { - funName = prefixAccessorName(propType, propAtom); - if (!funName) - return null(); + if (propType == PropertyType::Getter || propType == PropertyType::Setter) { + funName = prefixAccessorName(propType, propAtom); + if (!funName) + return null(); + } } - } - Node fn = methodDefinition(namePos.begin, propType, funName); - if (!fn) - return null(); + Node fn = methodDefinition(namePos.begin, propType, funName); + if (!fn) + return null(); - handler.checkAndSetIsDirectRHSAnonFunction(fn); + handler.checkAndSetIsDirectRHSAnonFunction(fn); - JSOp op = JSOpFromPropertyType(propType); - if (!handler.addObjectMethodDefinition(literal, propName, fn, op)) - return null(); + JSOp op = JSOpFromPropertyType(propType); + if (!handler.addObjectMethodDefinition(literal, propName, fn, op)) + return null(); + + if (possibleError) { + possibleError->setPendingDestructuringErrorAt(namePos, + JSMSG_BAD_DESTRUCT_TARGET); + } + } } - if (!tokenStream.getToken(&tt)) + bool matched; + if (!tokenStream.matchToken(&matched, TOK_COMMA)) return null(); - if (tt == TOK_RC) + if (!matched) break; - if (tt != TOK_COMMA) { - error(JSMSG_CURLY_AFTER_LIST); - return null(); - } + if (tt == TOK_TRIPLEDOT && possibleError) + possibleError->setPendingDestructuringErrorAt(pos(), JSMSG_REST_WITH_COMMA); } + MUST_MATCH_TOKEN_MOD_WITH_REPORT(TOK_RC, TokenStream::None, + reportMissingClosing(JSMSG_CURLY_AFTER_LIST, + JSMSG_CURLY_OPENED, openedPos)); + handler.setEndPosition(literal, pos().end); return literal; } template <typename ParseHandler> typename ParseHandler::Node -Parser<ParseHandler>::methodDefinition(uint32_t preludeStart, PropertyType propType, +Parser<ParseHandler>::methodDefinition(uint32_t toStringStart, PropertyType propType, HandleAtom funName) { FunctionSyntaxKind kind; @@ -9282,7 +9965,7 @@ Parser<ParseHandler>::methodDefinition(uint32_t preludeStart, PropertyType propT if (!pn) return null(); - return functionDefinition(preludeStart, pn, InAllowed, yieldHandling, funName, + return functionDefinition(toStringStart, pn, InAllowed, yieldHandling, funName, kind, generatorKind, asyncKind); } @@ -9312,14 +9995,11 @@ Parser<ParseHandler>::tryNewTarget(Node &newTarget) if (!tokenStream.getToken(&next)) return false; - if (next != TOK_NAME || tokenStream.currentName() != context->names().target) { + if (next != TOK_TARGET) { error(JSMSG_UNEXPECTED_TOKEN, "target", TokenKindToDesc(next)); return false; } - if (!checkUnescapedName()) - return false; - if (!pc->sc()->allowNewTarget()) { errorAt(begin, JSMSG_BAD_NEWTARGET); return false; @@ -9389,7 +10069,6 @@ Parser<ParseHandler>::primaryExpr(YieldHandling yieldHandling, TripledotHandling if (!expr) return null(); MUST_MATCH_TOKEN(TOK_RP, JSMSG_PAREN_IN_PAREN); - handler.setEndPosition(expr, pos().end); return handler.parenthesize(expr); } @@ -9397,22 +10076,26 @@ Parser<ParseHandler>::primaryExpr(YieldHandling yieldHandling, TripledotHandling return templateLiteral(yieldHandling); case TOK_NO_SUBS_TEMPLATE: - return noSubstitutionTemplate(); + return noSubstitutionUntaggedTemplate(); case TOK_STRING: return stringLiteral(); - case TOK_YIELD: - case TOK_NAME: { - if (tokenStream.currentName() == context->names().async) { + default: { + if (!TokenKindIsPossibleIdentifier(tt)) { + error(JSMSG_UNEXPECTED_TOKEN, "expression", TokenKindToDesc(tt)); + return null(); + } + + if (tt == TOK_ASYNC) { TokenKind nextSameLine = TOK_EOF; if (!tokenStream.peekTokenSameLine(&nextSameLine)) return null(); if (nextSameLine == TOK_FUNCTION) { - uint32_t preludeStart = pos().begin; + uint32_t toStringStart = pos().begin; tokenStream.consumeKnownToken(TOK_FUNCTION); - return functionExpr(preludeStart, PredictUninvoked, AsyncFunction); + return functionExpr(toStringStart, PredictUninvoked, AsyncFunction); } } @@ -9476,7 +10159,7 @@ Parser<ParseHandler>::primaryExpr(YieldHandling yieldHandling, TripledotHandling // the enclosing code is strict mode code, any of "let", "yield", // or "arguments" should be prohibited. Argument-parsing code // handles that. - if (next != TOK_NAME && next != TOK_YIELD) { + if (!TokenKindIsPossibleIdentifier(next)) { error(JSMSG_UNEXPECTED_TOKEN, "rest argument name", TokenKindToDesc(next)); return null(); } @@ -9503,10 +10186,6 @@ Parser<ParseHandler>::primaryExpr(YieldHandling yieldHandling, TripledotHandling // Return an arbitrary expression node. See case TOK_RP above. return handler.newNullLiteral(pos()); } - - default: - error(JSMSG_UNEXPECTED_TOKEN, "expression", TokenKindToDesc(tt)); - return null(); } } @@ -9520,9 +10199,8 @@ Parser<ParseHandler>::exprInParens(InHandling inHandling, YieldHandling yieldHan return expr(inHandling, yieldHandling, tripledotHandling, possibleError, PredictInvoked); } -template <typename ParseHandler> bool -Parser<ParseHandler>::warnOnceAboutExprClosure() +ParserBase::warnOnceAboutExprClosure() { #ifndef RELEASE_OR_BETA JSContext* cx = context->maybeJSContext(); @@ -9538,9 +10216,8 @@ Parser<ParseHandler>::warnOnceAboutExprClosure() return true; } -template <typename ParseHandler> bool -Parser<ParseHandler>::warnOnceAboutForEach() +ParserBase::warnOnceAboutForEach() { JSContext* cx = context->maybeJSContext(); if (!cx) diff --git a/js/src/frontend/Parser.h b/js/src/frontend/Parser.h index 156a1c1b0..88d2dad18 100644 --- a/js/src/frontend/Parser.h +++ b/js/src/frontend/Parser.h @@ -85,6 +85,16 @@ class ParseContext : public Nestable<ParseContext> } }; + struct ClassStatement : public Statement + { + FunctionBox* constructorBox; + + explicit ClassStatement(ParseContext* pc) + : Statement(pc, StatementKind::Class), + constructorBox(nullptr) + { } + }; + // The intra-function scope stack. // // Tracks declared and used names within a scope. @@ -146,9 +156,9 @@ class ParseContext : public Nestable<ParseContext> } MOZ_MUST_USE bool addDeclaredName(ParseContext* pc, AddDeclaredNamePtr& p, JSAtom* name, - DeclarationKind kind) + DeclarationKind kind, uint32_t pos) { - return maybeReportOOM(pc, declared_->add(p, name, DeclaredNameInfo(kind))); + return maybeReportOOM(pc, declared_->add(p, name, DeclaredNameInfo(kind, pos))); } // Remove all VarForAnnexBLexicalFunction declarations of a certain @@ -330,17 +340,6 @@ class ParseContext : public Nestable<ParseContext> // pointer may be nullptr. Directives* newDirectives; - // Set when parsing a declaration-like destructuring pattern. This flag - // causes PrimaryExpr to create PN_NAME parse nodes for variable references - // which are not hooked into any definition's use chain, added to any tree - // context's AtomList, etc. etc. checkDestructuring will do that work - // later. - // - // The comments atop checkDestructuring explain the distinction between - // assignment-like and declaration-like destructuring patterns, and why - // they need to be treated differently. - mozilla::Maybe<DeclarationKind> inDestructuringDecl; - // Set when parsing a function and it has 'return <expr>;' bool funHasReturnExpr; @@ -432,6 +431,11 @@ class ParseContext : public Nestable<ParseContext> return Statement::findNearest<T>(innermostStatement_, predicate); } + template <typename T> + T* findInnermostStatement() { + return Statement::findNearest<T>(innermostStatement_); + } + AtomVector& positionalFormalParameterNames() { return *positionalFormalParameterNames_; } @@ -532,6 +536,13 @@ ParseContext::Statement::is<ParseContext::LabelStatement>() const return kind_ == StatementKind::Label; } +template <> +inline bool +ParseContext::Statement::is<ParseContext::ClassStatement>() const +{ + return kind_ == StatementKind::Class; +} + template <typename T> inline T& ParseContext::Statement::as() @@ -735,7 +746,155 @@ class UsedNameTracker }; template <typename ParseHandler> -class Parser final : private JS::AutoGCRooter, public StrictModeGetter +class AutoAwaitIsKeyword; + +class ParserBase : public StrictModeGetter +{ + private: + ParserBase* thisForCtor() { return this; } + + public: + ExclusiveContext* const context; + + LifoAlloc& alloc; + + TokenStream tokenStream; + LifoAlloc::Mark tempPoolMark; + + /* list of parsed objects for GC tracing */ + ObjectBox* traceListHead; + + /* innermost parse context (stack-allocated) */ + ParseContext* pc; + + // For tracking used names in this parsing session. + UsedNameTracker& usedNames; + + /* Compression token for aborting. */ + SourceCompressionTask* sct; + + ScriptSource* ss; + + /* Root atoms and objects allocated for the parsed tree. */ + AutoKeepAtoms keepAtoms; + + /* Perform constant-folding; must be true when interfacing with the emitter. */ + const bool foldConstants:1; + + protected: +#if DEBUG + /* Our fallible 'checkOptions' member function has been called. */ + bool checkOptionsCalled:1; +#endif + + /* + * Not all language constructs can be handled during syntax parsing. If it + * is not known whether the parse succeeds or fails, this bit is set and + * the parse will return false. + */ + bool abortedSyntaxParse:1; + + /* Unexpected end of input, i.e. TOK_EOF not at top-level. */ + bool isUnexpectedEOF_:1; + + bool awaitIsKeyword_:1; + + public: + bool awaitIsKeyword() const { + return awaitIsKeyword_; + } + + ParserBase(ExclusiveContext* cx, LifoAlloc& alloc, const ReadOnlyCompileOptions& options, + const char16_t* chars, size_t length, bool foldConstants, + UsedNameTracker& usedNames, Parser<SyntaxParseHandler>* syntaxParser, + LazyScript* lazyOuterFunction); + ~ParserBase(); + + const char* getFilename() const { return tokenStream.getFilename(); } + JSVersion versionNumber() const { return tokenStream.versionNumber(); } + TokenPos pos() const { return tokenStream.currentToken().pos; } + + // Determine whether |yield| is a valid name in the current context, or + // whether it's prohibited due to strictness, JS version, or occurrence + // inside a star generator. + bool yieldExpressionsSupported() { + return (versionNumber() >= JSVERSION_1_7 || pc->isGenerator()) && !pc->isAsync(); + } + + virtual bool strictMode() { return pc->sc()->strict(); } + bool setLocalStrictMode(bool strict) { + MOZ_ASSERT(tokenStream.debugHasNoLookahead()); + return pc->sc()->setLocalStrictMode(strict); + } + + const ReadOnlyCompileOptions& options() const { + return tokenStream.options(); + } + + bool hadAbortedSyntaxParse() { + return abortedSyntaxParse; + } + void clearAbortedSyntaxParse() { + abortedSyntaxParse = false; + } + + bool isUnexpectedEOF() const { return isUnexpectedEOF_; } + + bool reportNoOffset(ParseReportKind kind, bool strict, unsigned errorNumber, ...); + + /* Report the given error at the current offset. */ + void error(unsigned errorNumber, ...); + void errorWithNotes(UniquePtr<JSErrorNotes> notes, unsigned errorNumber, ...); + + /* Report the given error at the given offset. */ + void errorAt(uint32_t offset, unsigned errorNumber, ...); + void errorWithNotesAt(UniquePtr<JSErrorNotes> notes, uint32_t offset, + unsigned errorNumber, ...); + + /* + * Handle a strict mode error at the current offset. Report an error if in + * strict mode code, or warn if not, using the given error number and + * arguments. + */ + MOZ_MUST_USE bool strictModeError(unsigned errorNumber, ...); + + /* + * Handle a strict mode error at the given offset. Report an error if in + * strict mode code, or warn if not, using the given error number and + * arguments. + */ + MOZ_MUST_USE bool strictModeErrorAt(uint32_t offset, unsigned errorNumber, ...); + + /* Report the given warning at the current offset. */ + MOZ_MUST_USE bool warning(unsigned errorNumber, ...); + + /* Report the given warning at the given offset. */ + MOZ_MUST_USE bool warningAt(uint32_t offset, unsigned errorNumber, ...); + + /* + * If extra warnings are enabled, report the given warning at the current + * offset. + */ + MOZ_MUST_USE bool extraWarning(unsigned errorNumber, ...); + + /* + * If extra warnings are enabled, report the given warning at the given + * offset. + */ + MOZ_MUST_USE bool extraWarningAt(uint32_t offset, unsigned errorNumber, ...); + + bool isValidStrictBinding(PropertyName* name); + + bool warnOnceAboutExprClosure(); + bool warnOnceAboutForEach(); + + protected: + enum InvokedPrediction { PredictUninvoked = false, PredictInvoked = true }; + enum ForInitLocation { InForInit, NotInForInit }; +}; + +template <typename ParseHandler> +class Parser final : public ParserBase, private JS::AutoGCRooter { private: using Node = typename ParseHandler::Node; @@ -788,7 +947,7 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter class MOZ_STACK_CLASS PossibleError { private: - enum class ErrorKind { Expression, Destructuring }; + enum class ErrorKind { Expression, Destructuring, DestructuringWarning }; enum class ErrorState { None, Pending }; @@ -803,11 +962,12 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter Parser<ParseHandler>& parser_; Error exprError_; Error destructuringError_; + Error destructuringWarning_; // Returns the error report. Error& error(ErrorKind kind); - // Return true if an error is pending without reporting + // Return true if an error is pending without reporting. bool hasError(ErrorKind kind); // Resolve any pending error. @@ -819,7 +979,11 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter // If there is a pending error, report it and return false, otherwise // return true. - bool checkForError(ErrorKind kind); + MOZ_MUST_USE bool checkForError(ErrorKind kind); + + // If there is a pending warning, report it and return either false or + // true depending on the werror option, otherwise return true. + MOZ_MUST_USE bool checkForWarning(ErrorKind kind); // Transfer an existing error to another instance. void transferErrorTo(ErrorKind kind, PossibleError* other); @@ -827,23 +991,33 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter public: explicit PossibleError(Parser<ParseHandler>& parser); + // Return true if a pending destructuring error is present. + bool hasPendingDestructuringError(); + // Set a pending destructuring error. Only a single error may be set // per instance, i.e. subsequent calls to this method are ignored and // won't overwrite the existing pending error. void setPendingDestructuringErrorAt(const TokenPos& pos, unsigned errorNumber); + // Set a pending destructuring warning. Only a single warning may be + // set per instance, i.e. subsequent calls to this method are ignored + // and won't overwrite the existing pending warning. + void setPendingDestructuringWarningAt(const TokenPos& pos, unsigned errorNumber); + // Set a pending expression error. Only a single error may be set per // instance, i.e. subsequent calls to this method are ignored and won't // overwrite the existing pending error. void setPendingExpressionErrorAt(const TokenPos& pos, unsigned errorNumber); - // If there is a pending destructuring error, report it and return - // false, otherwise return true. Clears any pending expression error. - bool checkForDestructuringError(); + // If there is a pending destructuring error or warning, report it and + // return false, otherwise return true. Clears any pending expression + // error. + MOZ_MUST_USE bool checkForDestructuringErrorOrWarning(); // If there is a pending expression error, report it and return false, - // otherwise return true. Clears any pending destructuring error. - bool checkForExpressionError(); + // otherwise return true. Clears any pending destructuring error or + // warning. + MOZ_MUST_USE bool checkForExpressionError(); // Pass pending errors between possible error instances. This is useful // for extending the lifetime of a pending error beyond the scope of @@ -853,50 +1027,6 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter }; public: - ExclusiveContext* const context; - - LifoAlloc& alloc; - - TokenStream tokenStream; - LifoAlloc::Mark tempPoolMark; - - /* list of parsed objects for GC tracing */ - ObjectBox* traceListHead; - - /* innermost parse context (stack-allocated) */ - ParseContext* pc; - - // For tracking used names in this parsing session. - UsedNameTracker& usedNames; - - /* Compression token for aborting. */ - SourceCompressionTask* sct; - - ScriptSource* ss; - - /* Root atoms and objects allocated for the parsed tree. */ - AutoKeepAtoms keepAtoms; - - /* Perform constant-folding; must be true when interfacing with the emitter. */ - const bool foldConstants:1; - - private: -#if DEBUG - /* Our fallible 'checkOptions' member function has been called. */ - bool checkOptionsCalled:1; -#endif - - /* - * Not all language constructs can be handled during syntax parsing. If it - * is not known whether the parse succeeds or fails, this bit is set and - * the parse will return false. - */ - bool abortedSyntaxParse:1; - - /* Unexpected end of input, i.e. TOK_EOF not at top-level. */ - bool isUnexpectedEOF_:1; - - public: /* State specific to the kind of parse being performed. */ ParseHandler handler; @@ -904,45 +1034,14 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter void freeTree(Node node) { handler.freeTree(node); } public: - bool reportNoOffset(ParseReportKind kind, bool strict, unsigned errorNumber, ...); - - /* Report the given error at the current offset. */ - void error(unsigned errorNumber, ...); - - /* Report the given error at the given offset. */ - void errorAt(uint32_t offset, unsigned errorNumber, ...); - - /* - * Handle a strict mode error at the current offset. Report an error if in - * strict mode code, or warn if not, using the given error number and - * arguments. - */ - MOZ_MUST_USE bool strictModeError(unsigned errorNumber, ...); - - /* - * Handle a strict mode error at the given offset. Report an error if in - * strict mode code, or warn if not, using the given error number and - * arguments. - */ - MOZ_MUST_USE bool strictModeErrorAt(uint32_t offset, unsigned errorNumber, ...); - - /* Report the given warning at the current offset. */ - MOZ_MUST_USE bool warning(unsigned errorNumber, ...); - - /* Report the given warning at the given offset. */ - MOZ_MUST_USE bool warningAt(uint32_t offset, unsigned errorNumber, ...); - - /* - * If extra warnings are enabled, report the given warning at the current - * offset. - */ - MOZ_MUST_USE bool extraWarning(unsigned errorNumber, ...); - Parser(ExclusiveContext* cx, LifoAlloc& alloc, const ReadOnlyCompileOptions& options, const char16_t* chars, size_t length, bool foldConstants, UsedNameTracker& usedNames, Parser<SyntaxParseHandler>* syntaxParser, LazyScript* lazyOuterFunction); ~Parser(); + friend class AutoAwaitIsKeyword<ParseHandler>; + void setAwaitIsKeyword(bool isKeyword); + bool checkOptions(); // A Parser::Mark is the extension of the LifoAlloc::Mark to the entire @@ -967,9 +1066,6 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter friend void js::frontend::MarkParser(JSTracer* trc, JS::AutoGCRooter* parser); - const char* getFilename() const { return tokenStream.getFilename(); } - JSVersion versionNumber() const { return tokenStream.versionNumber(); } - /* * Parse a top-level JS script. */ @@ -980,7 +1076,7 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter * cx->tempLifoAlloc. */ ObjectBox* newObjectBox(JSObject* obj); - FunctionBox* newFunctionBox(Node fn, JSFunction* fun, uint32_t preludeStart, + FunctionBox* newFunctionBox(Node fn, JSFunction* fun, uint32_t toStringStart, Directives directives, GeneratorKind generatorKind, FunctionAsyncKind asyncKind, bool tryAnnexB); @@ -995,24 +1091,14 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter void trace(JSTracer* trc); - bool hadAbortedSyntaxParse() { - return abortedSyntaxParse; - } - void clearAbortedSyntaxParse() { - abortedSyntaxParse = false; - } - - bool isUnexpectedEOF() const { return isUnexpectedEOF_; } - - bool checkUnescapedName(); - private: Parser* thisForCtor() { return this; } JSAtom* stopStringCompression(); Node stringLiteral(); - Node noSubstitutionTemplate(); + Node noSubstitutionTaggedTemplate(); + Node noSubstitutionUntaggedTemplate(); Node templateLiteral(YieldHandling yieldHandling); bool taggedTemplate(YieldHandling yieldHandling, Node nodeList, TokenKind tt); bool appendToCallSiteObj(Node callSiteObj); @@ -1061,7 +1147,7 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter // Parse an inner function given an enclosing ParseContext and a // FunctionBox for the inner function. - bool innerFunction(Node pn, ParseContext* outerpc, FunctionBox* funbox, uint32_t preludeStart, + bool innerFunction(Node pn, ParseContext* outerpc, FunctionBox* funbox, uint32_t toStringStart, InHandling inHandling, YieldHandling yieldHandling, FunctionSyntaxKind kind, Directives inheritedDirectives, Directives* newDirectives); @@ -1070,35 +1156,14 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter // ParseContext is already on the stack. bool functionFormalParametersAndBody(InHandling inHandling, YieldHandling yieldHandling, Node pn, FunctionSyntaxKind kind, - mozilla::Maybe<uint32_t> parameterListEnd = mozilla::Nothing()); - - - // Determine whether |yield| is a valid name in the current context, or - // whether it's prohibited due to strictness, JS version, or occurrence - // inside a star generator. - bool yieldExpressionsSupported() { - return (versionNumber() >= JSVERSION_1_7 || pc->isGenerator()) && !pc->isAsync(); - } + mozilla::Maybe<uint32_t> parameterListEnd = mozilla::Nothing(), + bool isStandaloneFunction = false); // Match the current token against the BindingIdentifier production with // the given Yield parameter. If there is no match, report a syntax // error. PropertyName* bindingIdentifier(YieldHandling yieldHandling); - virtual bool strictMode() { return pc->sc()->strict(); } - bool setLocalStrictMode(bool strict) { - MOZ_ASSERT(tokenStream.debugHasNoLookahead()); - return pc->sc()->setLocalStrictMode(strict); - } - - const ReadOnlyCompileOptions& options() const { - return tokenStream.options(); - } - - private: - enum InvokedPrediction { PredictUninvoked = false, PredictInvoked = true }; - enum ForInitLocation { InForInit, NotInForInit }; - private: /* * JS parsers, from lowest to highest precedence. @@ -1116,10 +1181,10 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter * Some parsers have two versions: an always-inlined version (with an 'i' * suffix) and a never-inlined version (with an 'n' suffix). */ - Node functionStmt(uint32_t preludeStart, + Node functionStmt(uint32_t toStringStart, YieldHandling yieldHandling, DefaultHandling defaultHandling, FunctionAsyncKind asyncKind = SyncFunction); - Node functionExpr(uint32_t preludeStart, InvokedPrediction invoked = PredictUninvoked, + Node functionExpr(uint32_t toStringStart, InvokedPrediction invoked = PredictUninvoked, FunctionAsyncKind asyncKind = SyncFunction); Node statementList(YieldHandling yieldHandling); @@ -1160,9 +1225,27 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter // continues a LexicalDeclaration. bool nextTokenContinuesLetDeclaration(TokenKind next, YieldHandling yieldHandling); - Node lexicalDeclaration(YieldHandling yieldHandling, bool isConst); + Node lexicalDeclaration(YieldHandling yieldHandling, DeclarationKind kind); Node importDeclaration(); + + bool processExport(Node node); + bool processExportFrom(Node node); + + Node exportFrom(uint32_t begin, Node specList); + Node exportBatch(uint32_t begin); + bool checkLocalExportNames(Node node); + Node exportClause(uint32_t begin); + Node exportFunctionDeclaration(uint32_t begin); + Node exportVariableStatement(uint32_t begin); + Node exportClassDeclaration(uint32_t begin); + Node exportLexicalDeclaration(uint32_t begin, DeclarationKind kind); + Node exportDefaultFunctionDeclaration(uint32_t begin, + FunctionAsyncKind asyncKind = SyncFunction); + Node exportDefaultClassDeclaration(uint32_t begin); + Node exportDefaultAssignExpr(uint32_t begin); + Node exportDefault(uint32_t begin); + Node exportDeclaration(); Node expressionStatement(YieldHandling yieldHandling, InvokedPrediction invoked = PredictUninvoked); @@ -1250,7 +1333,7 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter bool tryNewTarget(Node& newTarget); bool checkAndMarkSuperScope(); - Node methodDefinition(uint32_t preludeStart, PropertyType propType, HandleAtom funName); + Node methodDefinition(uint32_t toStringStart, PropertyType propType, HandleAtom funName); /* * Additional JS parsers. @@ -1258,7 +1341,7 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter bool functionArguments(YieldHandling yieldHandling, FunctionSyntaxKind kind, Node funcpn); - Node functionDefinition(uint32_t preludeStart, Node pn, + Node functionDefinition(uint32_t toStringStart, Node pn, InHandling inHandling, YieldHandling yieldHandling, HandleAtom name, FunctionSyntaxKind kind, GeneratorKind generatorKind, FunctionAsyncKind asyncKind, @@ -1294,21 +1377,34 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter bool checkExportedName(JSAtom* exportName); bool checkExportedNamesForDeclaration(Node node); + bool checkExportedNameForClause(Node node); + bool checkExportedNameForFunction(Node node); + bool checkExportedNameForClass(Node node); + enum ClassContext { ClassStatement, ClassExpression }; Node classDefinition(YieldHandling yieldHandling, ClassContext classContext, DefaultHandling defaultHandling); - PropertyName* labelOrIdentifierReference(YieldHandling yieldHandling, - bool yieldTokenizedAsName); + bool checkLabelOrIdentifierReference(HandlePropertyName ident, + uint32_t offset, + YieldHandling yieldHandling); + + bool checkLocalExportName(HandlePropertyName ident, uint32_t offset) { + return checkLabelOrIdentifierReference(ident, offset, YieldIsName); + } + + bool checkBindingIdentifier(HandlePropertyName ident, + uint32_t offset, + YieldHandling yieldHandling); + + PropertyName* labelOrIdentifierReference(YieldHandling yieldHandling); PropertyName* labelIdentifier(YieldHandling yieldHandling) { - return labelOrIdentifierReference(yieldHandling, false); + return labelOrIdentifierReference(yieldHandling); } - PropertyName* identifierReference(YieldHandling yieldHandling, - bool yieldTokenizedAsName = false) - { - return labelOrIdentifierReference(yieldHandling, yieldTokenizedAsName); + PropertyName* identifierReference(YieldHandling yieldHandling) { + return labelOrIdentifierReference(yieldHandling); } PropertyName* importedBinding() { @@ -1337,23 +1433,27 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter Node newDotGeneratorName(); bool declareDotGeneratorName(); - bool skipLazyInnerFunction(Node pn, uint32_t preludeStart, FunctionSyntaxKind kind, + bool skipLazyInnerFunction(Node pn, uint32_t toStringStart, FunctionSyntaxKind kind, bool tryAnnexB); - bool innerFunction(Node pn, ParseContext* outerpc, HandleFunction fun, uint32_t preludeStart, + bool innerFunction(Node pn, ParseContext* outerpc, HandleFunction fun, uint32_t toStringStart, InHandling inHandling, YieldHandling yieldHandling, FunctionSyntaxKind kind, GeneratorKind generatorKind, FunctionAsyncKind asyncKind, bool tryAnnexB, Directives inheritedDirectives, Directives* newDirectives); - bool trySyntaxParseInnerFunction(Node pn, HandleFunction fun, uint32_t preludeStart, + bool trySyntaxParseInnerFunction(Node pn, HandleFunction fun, uint32_t toStringStart, InHandling inHandling, YieldHandling yieldHandling, FunctionSyntaxKind kind, GeneratorKind generatorKind, FunctionAsyncKind asyncKind, bool tryAnnexB, Directives inheritedDirectives, Directives* newDirectives); - bool finishFunctionScopes(); - bool finishFunction(); + bool finishFunctionScopes(bool isStandaloneFunction); + bool finishFunction(bool isStandaloneFunction = false); bool leaveInnerFunction(ParseContext* outerpc); + bool matchOrInsertSemicolonHelper(TokenStream::Modifier modifier); + bool matchOrInsertSemicolonAfterExpression(); + bool matchOrInsertSemicolonAfterNonExpression(); + public: enum FunctionCallBehavior { PermitAssignmentToFunctionCalls, @@ -1366,21 +1466,22 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter private: bool checkIncDecOperand(Node operand, uint32_t operandOffset); bool checkStrictAssignment(Node lhs); - bool checkStrictBinding(PropertyName* name, TokenPos pos); bool hasValidSimpleStrictParameterNames(); - bool isValidStrictBinding(PropertyName* name); + void reportMissingClosing(unsigned errorNumber, unsigned noteNumber, uint32_t openedPos); - void reportRedeclaration(HandlePropertyName name, DeclarationKind kind, TokenPos pos); - bool notePositionalFormalParameter(Node fn, HandlePropertyName name, + void reportRedeclaration(HandlePropertyName name, DeclarationKind prevKind, TokenPos pos, + uint32_t prevPos); + bool notePositionalFormalParameter(Node fn, HandlePropertyName name, uint32_t beginPos, bool disallowDuplicateParams, bool* duplicatedParam); bool noteDestructuredPositionalFormalParameter(Node fn, Node destruct); mozilla::Maybe<DeclarationKind> isVarRedeclaredInEval(HandlePropertyName name, DeclarationKind kind); - bool tryDeclareVar(HandlePropertyName name, DeclarationKind kind, - mozilla::Maybe<DeclarationKind>* redeclaredKind); - bool tryDeclareVarForAnnexBLexicalFunction(HandlePropertyName name, bool* tryAnnexB); + bool tryDeclareVar(HandlePropertyName name, DeclarationKind kind, uint32_t beginPos, + mozilla::Maybe<DeclarationKind>* redeclaredKind, uint32_t* prevPos); + bool tryDeclareVarForAnnexBLexicalFunction(HandlePropertyName name, uint32_t beginPos, + bool* tryAnnexB); bool checkLexicalDeclarationDirectlyWithinBlock(ParseContext::Statement& stmt, DeclarationKind kind, TokenPos pos); bool noteDeclaredName(HandlePropertyName name, DeclarationKind kind, TokenPos pos); @@ -1399,25 +1500,27 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter mozilla::Maybe<LexicalScope::Data*> newLexicalScopeData(ParseContext::Scope& scope); Node finishLexicalScope(ParseContext::Scope& scope, Node body); - Node propertyName(YieldHandling yieldHandling, Node propList, + Node propertyName(YieldHandling yieldHandling, + const mozilla::Maybe<DeclarationKind>& maybeDecl, Node propList, PropertyType* propType, MutableHandleAtom propAtom); - Node computedPropertyName(YieldHandling yieldHandling, Node literal); + Node computedPropertyName(YieldHandling yieldHandling, + const mozilla::Maybe<DeclarationKind>& maybeDecl, Node literal); Node arrayInitializer(YieldHandling yieldHandling, PossibleError* possibleError); Node newRegExp(); Node objectLiteral(YieldHandling yieldHandling, PossibleError* possibleError); - // Top-level entrypoint into destructuring pattern checking/name-analyzing. - bool checkDestructuringPattern(Node pattern, mozilla::Maybe<DeclarationKind> maybeDecl, - PossibleError* possibleError = nullptr); + Node bindingInitializer(Node lhs, DeclarationKind kind, YieldHandling yieldHandling); + Node bindingIdentifier(DeclarationKind kind, YieldHandling yieldHandling); + Node bindingIdentifierOrPattern(DeclarationKind kind, YieldHandling yieldHandling, + TokenKind tt); + Node objectBindingPattern(DeclarationKind kind, YieldHandling yieldHandling); + Node arrayBindingPattern(DeclarationKind kind, YieldHandling yieldHandling); - // Recursive methods for checking/name-analyzing subcomponents of a - // destructuring pattern. The array/object methods *must* be passed arrays - // or objects. The name method may be passed anything but will report an - // error if not passed a name. - bool checkDestructuringArray(Node arrayPattern, mozilla::Maybe<DeclarationKind> maybeDecl); - bool checkDestructuringObject(Node objectPattern, mozilla::Maybe<DeclarationKind> maybeDecl); - bool checkDestructuringName(Node expr, mozilla::Maybe<DeclarationKind> maybeDecl); + void checkDestructuringAssignmentTarget(Node expr, TokenPos exprPos, + PossibleError* possibleError); + void checkDestructuringAssignmentElement(Node expr, TokenPos exprPos, + PossibleError* possibleError); Node newNumber(const Token& tok) { return handler.newNumber(tok.number(), tok.decimalPoint(), tok.pos); @@ -1427,12 +1530,26 @@ class Parser final : private JS::AutoGCRooter, public StrictModeGetter JSAtom* prefixAccessorName(PropertyType propType, HandleAtom propAtom); - TokenPos pos() const { return tokenStream.currentToken().pos; } - bool asmJS(Node list); +}; - bool warnOnceAboutExprClosure(); - bool warnOnceAboutForEach(); +template <typename ParseHandler> +class MOZ_STACK_CLASS AutoAwaitIsKeyword +{ + private: + Parser<ParseHandler>* parser_; + bool oldAwaitIsKeyword_; + + public: + AutoAwaitIsKeyword(Parser<ParseHandler>* parser, bool awaitIsKeyword) { + parser_ = parser; + oldAwaitIsKeyword_ = parser_->awaitIsKeyword_; + parser_->setAwaitIsKeyword(awaitIsKeyword); + } + + ~AutoAwaitIsKeyword() { + parser_->setAwaitIsKeyword(oldAwaitIsKeyword_); + } }; } /* namespace frontend */ diff --git a/js/src/vm/Keywords.h b/js/src/frontend/ReservedWords.h index ef37c4419..27f5b11c1 100644 --- a/js/src/vm/Keywords.h +++ b/js/src/frontend/ReservedWords.h @@ -4,15 +4,16 @@ * License, v. 2.0. If a copy of the MPL was not distributed with this * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ -/* A higher-order macro for enumerating keyword tokens. */ +/* A higher-order macro for enumerating reserved word tokens. */ -#ifndef vm_Keywords_h -#define vm_Keywords_h +#ifndef vm_ReservedWords_h +#define vm_ReservedWords_h -#define FOR_EACH_JAVASCRIPT_KEYWORD(macro) \ +#define FOR_EACH_JAVASCRIPT_RESERVED_WORD(macro) \ macro(false, false_, TOK_FALSE) \ macro(true, true_, TOK_TRUE) \ macro(null, null, TOK_NULL) \ + \ /* Keywords. */ \ macro(break, break_, TOK_BREAK) \ macro(case, case_, TOK_CASE) \ @@ -36,31 +37,45 @@ macro(this, this_, TOK_THIS) \ macro(throw, throw_, TOK_THROW) \ macro(try, try_, TOK_TRY) \ - macro(typeof, typeof, TOK_TYPEOF) \ + macro(typeof, typeof_, TOK_TYPEOF) \ macro(var, var, TOK_VAR) \ macro(void, void_, TOK_VOID) \ macro(while, while_, TOK_WHILE) \ macro(with, with, TOK_WITH) \ macro(import, import, TOK_IMPORT) \ - macro(export, export, TOK_EXPORT) \ + macro(export, export_, TOK_EXPORT) \ macro(class, class_, TOK_CLASS) \ macro(extends, extends, TOK_EXTENDS) \ macro(super, super, TOK_SUPER) \ - /* Reserved keywords. */ \ - macro(enum, enum_, TOK_RESERVED) \ - /* Future reserved keywords, but only in strict mode. */ \ - macro(implements, implements, TOK_STRICT_RESERVED) \ - macro(interface, interface, TOK_STRICT_RESERVED) \ - macro(package, package, TOK_STRICT_RESERVED) \ - macro(private, private_, TOK_STRICT_RESERVED) \ - macro(protected, protected_, TOK_STRICT_RESERVED) \ - macro(public, public_, TOK_STRICT_RESERVED) \ + \ + /* Future reserved words. */ \ + macro(enum, enum_, TOK_ENUM) \ + \ + /* Future reserved words, but only in strict mode. */ \ + macro(implements, implements, TOK_IMPLEMENTS) \ + macro(interface, interface, TOK_INTERFACE) \ + macro(package, package, TOK_PACKAGE) \ + macro(private, private_, TOK_PRIVATE) \ + macro(protected, protected_, TOK_PROTECTED) \ + macro(public, public_, TOK_PUBLIC) \ + \ + /* Contextual keywords. */ \ + macro(as, as, TOK_AS) \ + macro(async, async, TOK_ASYNC) \ macro(await, await, TOK_AWAIT) \ + macro(each, each, TOK_EACH) \ + macro(from, from, TOK_FROM) \ + macro(get, get, TOK_GET) \ + macro(let, let, TOK_LET) \ + macro(of, of, TOK_OF) \ + macro(set, set, TOK_SET) \ + macro(static, static_, TOK_STATIC) \ + macro(target, target, TOK_TARGET) \ /* \ * Yield is a token inside function*. Outside of a function*, it is a \ - * future reserved keyword in strict mode, but a keyword in JS1.7 even \ + * future reserved word in strict mode, but a keyword in JS1.7 even \ * when strict. Punt logic to parser. \ */ \ macro(yield, yield, TOK_YIELD) -#endif /* vm_Keywords_h */ +#endif /* vm_ReservedWords_h */ diff --git a/js/src/frontend/SharedContext.h b/js/src/frontend/SharedContext.h index b20417d5d..013444690 100644 --- a/js/src/frontend/SharedContext.h +++ b/js/src/frontend/SharedContext.h @@ -38,6 +38,7 @@ enum class StatementKind : uint8_t ForOfLoop, DoLoop, WhileLoop, + Class, // Used only by BytecodeEmitter. Spread @@ -450,7 +451,8 @@ class FunctionBox : public ObjectBox, public SharedContext uint32_t bufEnd; uint32_t startLine; uint32_t startColumn; - uint32_t preludeStart; + uint32_t toStringStart; + uint32_t toStringEnd; uint16_t length; uint8_t generatorKindBits_; /* The GeneratorKind of this function. */ @@ -473,11 +475,14 @@ class FunctionBox : public ObjectBox, public SharedContext bool usesThis:1; /* contains 'this' */ bool usesReturn:1; /* contains a 'return' statement */ bool hasRest_:1; /* has rest parameter */ + bool isExprBody_:1; /* arrow function with expression + * body or expression closure: + * function(x) x*x */ FunctionContextFlags funCxFlags; FunctionBox(ExclusiveContext* cx, LifoAlloc& alloc, ObjectBox* traceListHead, JSFunction* fun, - uint32_t preludeStart, Directives directives, bool extraWarnings, + uint32_t toStringStart, Directives directives, bool extraWarnings, GeneratorKind generatorKind, FunctionAsyncKind asyncKind); MutableHandle<LexicalScope::Data*> namedLambdaBindings() { @@ -546,6 +551,11 @@ class FunctionBox : public ObjectBox, public SharedContext hasRest_ = true; } + bool isExprBody() const { return isExprBody_; } + void setIsExprBody() { + isExprBody_ = true; + } + void setGeneratorKind(GeneratorKind kind) { // A generator kind can be set at initialization, or when "yield" is // first seen. In both cases the transition can only happen from @@ -595,6 +605,14 @@ class FunctionBox : public ObjectBox, public SharedContext tokenStream.srcCoords.lineNumAndColumnIndex(bufStart, &startLine, &startColumn); } + void setEnd(uint32_t end) { + // For all functions except class constructors, the buffer and + // toString ending positions are the same. Class constructors override + // the toString ending position with the end of the class definition. + bufEnd = end; + toStringEnd = end; + } + void trace(JSTracer* trc) override; }; diff --git a/js/src/frontend/SourceNotes.h b/js/src/frontend/SourceNotes.h index dd2a95ad1..6ae184ae4 100644 --- a/js/src/frontend/SourceNotes.h +++ b/js/src/frontend/SourceNotes.h @@ -56,13 +56,14 @@ namespace js { M(SRC_NEXTCASE, "nextcase", 1) /* Distance forward from one CASE in a CONDSWITCH to \ the next. */ \ M(SRC_ASSIGNOP, "assignop", 0) /* += or another assign-op follows. */ \ + M(SRC_CLASS_SPAN, "class", 2) /* The starting and ending offsets for the class, used \ + for toString correctness for default ctors. */ \ M(SRC_TRY, "try", 1) /* JSOP_TRY, offset points to goto at the end of the \ try block. */ \ /* All notes above here are "gettable". See SN_IS_GETTABLE below. */ \ M(SRC_COLSPAN, "colspan", 1) /* Number of columns this opcode spans. */ \ M(SRC_NEWLINE, "newline", 0) /* Bytecode follows a source newline. */ \ M(SRC_SETLINE, "setline", 1) /* A file-absolute source line number note. */ \ - M(SRC_UNUSED20, "unused20", 0) /* Unused. */ \ M(SRC_UNUSED21, "unused21", 0) /* Unused. */ \ M(SRC_UNUSED22, "unused22", 0) /* Unused. */ \ M(SRC_UNUSED23, "unused23", 0) /* Unused. */ \ diff --git a/js/src/frontend/SyntaxParseHandler.h b/js/src/frontend/SyntaxParseHandler.h index 00ea9d35d..a604b599f 100644 --- a/js/src/frontend/SyntaxParseHandler.h +++ b/js/src/frontend/SyntaxParseHandler.h @@ -9,6 +9,8 @@ #include "mozilla/Attributes.h" +#include <string.h> + #include "frontend/ParseNode.h" #include "frontend/TokenStream.h" @@ -94,10 +96,13 @@ class SyntaxParseHandler // Nodes representing unparenthesized names. NodeUnparenthesizedArgumentsName, - NodeUnparenthesizedAsyncName, NodeUnparenthesizedEvalName, NodeUnparenthesizedName, + // Node representing the "async" name, which may actually be a + // contextual keyword. + NodePotentialAsyncKeyword, + // Valuable for recognizing potential destructuring patterns. NodeUnparenthesizedArray, NodeUnparenthesizedObject, @@ -183,8 +188,8 @@ class SyntaxParseHandler lastAtom = name; if (name == cx->names().arguments) return NodeUnparenthesizedArgumentsName; - if (name == cx->names().async) - return NodeUnparenthesizedAsyncName; + if (pos.begin + strlen("async") == pos.end && name == cx->names().async) + return NodePotentialAsyncKeyword; if (name == cx->names().eval) return NodeUnparenthesizedEvalName; return NodeUnparenthesizedName; @@ -219,6 +224,7 @@ class SyntaxParseHandler Node newThisLiteral(const TokenPos& pos, Node thisName) { return NodeGeneric; } Node newNullLiteral(const TokenPos& pos) { return NodeGeneric; } + Node newRawUndefinedLiteral(const TokenPos& pos) { return NodeGeneric; } template <class Boxer> Node newRegExp(RegExpObject* reobj, const TokenPos& pos, Boxer& boxer) { return NodeGeneric; } @@ -235,6 +241,10 @@ class SyntaxParseHandler return NodeUnparenthesizedUnary; } + Node newNullary(ParseNodeKind kind, JSOp op, const TokenPos& pos) { + return NodeGeneric; + } + Node newUnary(ParseNodeKind kind, JSOp op, uint32_t begin, Node kid) { return NodeUnparenthesizedUnary; } @@ -279,7 +289,7 @@ class SyntaxParseHandler Node newObjectLiteral(uint32_t begin) { return NodeUnparenthesizedObject; } Node newClassMethodList(uint32_t begin) { return NodeGeneric; } Node newClassNames(Node outer, Node inner, const TokenPos& pos) { return NodeGeneric; } - Node newClass(Node name, Node heritage, Node methodBlock) { return NodeGeneric; } + Node newClass(Node name, Node heritage, Node methodBlock, const TokenPos& pos) { return NodeGeneric; } Node newNewTarget(Node newHolder, Node targetHolder) { return NodeGeneric; } Node newPosHolder(const TokenPos& pos) { return NodeGeneric; } @@ -288,6 +298,7 @@ class SyntaxParseHandler MOZ_MUST_USE bool addPrototypeMutation(Node literal, uint32_t begin, Node expr) { return true; } MOZ_MUST_USE bool addPropertyDefinition(Node literal, Node name, Node expr) { return true; } MOZ_MUST_USE bool addShorthand(Node literal, Node name, Node expr) { return true; } + MOZ_MUST_USE bool addSpreadProperty(Node literal, uint32_t begin, Node inner) { return true; } MOZ_MUST_USE bool addObjectMethodDefinition(Node literal, Node name, Node fn, JSOp op) { return true; } MOZ_MUST_USE bool addClassMethodDefinition(Node literal, Node name, Node fn, JSOp op, bool isStatic) { return true; } Node newYieldExpression(uint32_t begin, Node value, Node gen) { return NodeGeneric; } @@ -302,6 +313,16 @@ class SyntaxParseHandler MOZ_MUST_USE bool prependInitialYield(Node stmtList, Node gen) { return true; } Node newEmptyStatement(const TokenPos& pos) { return NodeEmptyStatement; } + Node newExportDeclaration(Node kid, const TokenPos& pos) { + return NodeGeneric; + } + Node newExportFromDeclaration(uint32_t begin, Node exportSpecSet, Node moduleSpec) { + return NodeGeneric; + } + Node newExportDefaultDeclaration(Node kid, Node maybeBinding, const TokenPos& pos) { + return NodeGeneric; + } + Node newSetThis(Node thisName, Node value) { return value; } Node newExprStatement(Node expr, uint32_t end) { @@ -497,7 +518,7 @@ class SyntaxParseHandler return NodeParenthesizedArgumentsName; if (node == NodeUnparenthesizedEvalName) return NodeParenthesizedEvalName; - if (node == NodeUnparenthesizedName || node == NodeUnparenthesizedAsyncName) + if (node == NodeUnparenthesizedName || node == NodePotentialAsyncKeyword) return NodeParenthesizedName; if (node == NodeUnparenthesizedArray) @@ -528,9 +549,9 @@ class SyntaxParseHandler bool isUnparenthesizedName(Node node) { return node == NodeUnparenthesizedArgumentsName || - node == NodeUnparenthesizedAsyncName || node == NodeUnparenthesizedEvalName || - node == NodeUnparenthesizedName; + node == NodeUnparenthesizedName || + node == NodePotentialAsyncKeyword; } bool isNameAnyParentheses(Node node) { @@ -541,9 +562,11 @@ class SyntaxParseHandler node == NodeParenthesizedName; } - bool nameIsEvalAnyParentheses(Node node, ExclusiveContext* cx) { - MOZ_ASSERT(isNameAnyParentheses(node), - "must only call this function on known names"); + bool isArgumentsAnyParentheses(Node node, ExclusiveContext* cx) { + return node == NodeUnparenthesizedArgumentsName || node == NodeParenthesizedArgumentsName; + } + + bool isEvalAnyParentheses(Node node, ExclusiveContext* cx) { return node == NodeUnparenthesizedEvalName || node == NodeParenthesizedEvalName; } @@ -551,17 +574,15 @@ class SyntaxParseHandler MOZ_ASSERT(isNameAnyParentheses(node), "must only call this method on known names"); - if (nameIsEvalAnyParentheses(node, cx)) + if (isEvalAnyParentheses(node, cx)) return js_eval_str; - if (node == NodeUnparenthesizedArgumentsName || node == NodeParenthesizedArgumentsName) + if (isArgumentsAnyParentheses(node, cx)) return js_arguments_str; return nullptr; } - bool nameIsUnparenthesizedAsync(Node node, ExclusiveContext* cx) { - MOZ_ASSERT(isNameAnyParentheses(node), - "must only call this function on known names"); - return node == NodeUnparenthesizedAsyncName; + bool isAsyncKeyword(Node node, ExclusiveContext* cx) { + return node == NodePotentialAsyncKeyword; } PropertyName* maybeDottedProperty(Node node) { diff --git a/js/src/frontend/TokenKind.h b/js/src/frontend/TokenKind.h index 6f22d78e5..98f23fec8 100644 --- a/js/src/frontend/TokenKind.h +++ b/js/src/frontend/TokenKind.h @@ -81,9 +81,12 @@ \ macro(REGEXP, "regular expression literal") \ macro(TRUE, "boolean literal 'true'") \ + range(RESERVED_WORD_LITERAL_FIRST, TRUE) \ macro(FALSE, "boolean literal 'false'") \ macro(NULL, "null literal") \ + range(RESERVED_WORD_LITERAL_LAST, NULL) \ macro(THIS, "keyword 'this'") \ + range(KEYWORD_FIRST, THIS) \ macro(FUNCTION, "keyword 'function'") \ macro(IF, "keyword 'if'") \ macro(ELSE, "keyword 'else'") \ @@ -106,16 +109,43 @@ macro(FINALLY, "keyword 'finally'") \ macro(THROW, "keyword 'throw'") \ macro(DEBUGGER, "keyword 'debugger'") \ - macro(YIELD, "keyword 'yield'") \ - macro(AWAIT, "keyword 'await'") \ macro(EXPORT, "keyword 'export'") \ macro(IMPORT, "keyword 'import'") \ macro(CLASS, "keyword 'class'") \ macro(EXTENDS, "keyword 'extends'") \ macro(SUPER, "keyword 'super'") \ - macro(RESERVED, "reserved keyword") \ - /* reserved keywords in strict mode */ \ - macro(STRICT_RESERVED, "reserved keyword") \ + range(KEYWORD_LAST, SUPER) \ + \ + /* contextual keywords */ \ + macro(AS, "'as'") \ + range(CONTEXTUAL_KEYWORD_FIRST, AS) \ + macro(ASYNC, "'async'") \ + macro(AWAIT, "'await'") \ + macro(EACH, "'each'") \ + macro(FROM, "'from'") \ + macro(GET, "'get'") \ + macro(LET, "'let'") \ + macro(OF, "'of'") \ + macro(SET, "'set'") \ + macro(STATIC, "'static'") \ + macro(TARGET, "'target'") \ + macro(YIELD, "'yield'") \ + range(CONTEXTUAL_KEYWORD_LAST, YIELD) \ + \ + /* future reserved words */ \ + macro(ENUM, "reserved word 'enum'") \ + range(FUTURE_RESERVED_KEYWORD_FIRST, ENUM) \ + range(FUTURE_RESERVED_KEYWORD_LAST, ENUM) \ + \ + /* reserved words in strict mode */ \ + macro(IMPLEMENTS, "reserved word 'implements'") \ + range(STRICT_RESERVED_KEYWORD_FIRST, IMPLEMENTS) \ + macro(INTERFACE, "reserved word 'interface'") \ + macro(PACKAGE, "reserved word 'package'") \ + macro(PRIVATE, "reserved word 'private'") \ + macro(PROTECTED, "reserved word 'protected'") \ + macro(PUBLIC, "reserved word 'public'") \ + range(STRICT_RESERVED_KEYWORD_LAST, PUBLIC) \ \ /* \ * The following token types occupy contiguous ranges to enable easy \ @@ -149,7 +179,9 @@ range(RELOP_LAST, GE) \ \ macro(INSTANCEOF, "keyword 'instanceof'") \ + range(KEYWORD_BINOP_FIRST, INSTANCEOF) \ macro(IN, "keyword 'in'") \ + range(KEYWORD_BINOP_LAST, IN) \ \ /* Shift ops, per TokenKindIsShift. */ \ macro(LSH, "'<<'") \ @@ -168,7 +200,9 @@ \ /* Unary operation tokens. */ \ macro(TYPEOF, "keyword 'typeof'") \ + range(KEYWORD_UNOP_FIRST, TYPEOF) \ macro(VOID, "keyword 'void'") \ + range(KEYWORD_UNOP_LAST, VOID) \ macro(NOT, "'!'") \ macro(BITNOT, "'~'") \ \ @@ -239,6 +273,61 @@ TokenKindIsAssignment(TokenKind tt) return TOK_ASSIGNMENT_START <= tt && tt <= TOK_ASSIGNMENT_LAST; } +inline MOZ_MUST_USE bool +TokenKindIsKeyword(TokenKind tt) +{ + return (TOK_KEYWORD_FIRST <= tt && tt <= TOK_KEYWORD_LAST) || + (TOK_KEYWORD_BINOP_FIRST <= tt && tt <= TOK_KEYWORD_BINOP_LAST) || + (TOK_KEYWORD_UNOP_FIRST <= tt && tt <= TOK_KEYWORD_UNOP_LAST); +} + +inline MOZ_MUST_USE bool +TokenKindIsContextualKeyword(TokenKind tt) +{ + return TOK_CONTEXTUAL_KEYWORD_FIRST <= tt && tt <= TOK_CONTEXTUAL_KEYWORD_LAST; +} + +inline MOZ_MUST_USE bool +TokenKindIsFutureReservedWord(TokenKind tt) +{ + return TOK_FUTURE_RESERVED_KEYWORD_FIRST <= tt && tt <= TOK_FUTURE_RESERVED_KEYWORD_LAST; +} + +inline MOZ_MUST_USE bool +TokenKindIsStrictReservedWord(TokenKind tt) +{ + return TOK_STRICT_RESERVED_KEYWORD_FIRST <= tt && tt <= TOK_STRICT_RESERVED_KEYWORD_LAST; +} + +inline MOZ_MUST_USE bool +TokenKindIsReservedWordLiteral(TokenKind tt) +{ + return TOK_RESERVED_WORD_LITERAL_FIRST <= tt && tt <= TOK_RESERVED_WORD_LITERAL_LAST; +} + +inline MOZ_MUST_USE bool +TokenKindIsReservedWord(TokenKind tt) +{ + return TokenKindIsKeyword(tt) || + TokenKindIsFutureReservedWord(tt) || + TokenKindIsReservedWordLiteral(tt); +} + +inline MOZ_MUST_USE bool +TokenKindIsPossibleIdentifier(TokenKind tt) +{ + return tt == TOK_NAME || + TokenKindIsContextualKeyword(tt) || + TokenKindIsStrictReservedWord(tt); +} + +inline MOZ_MUST_USE bool +TokenKindIsPossibleIdentifierName(TokenKind tt) +{ + return TokenKindIsPossibleIdentifier(tt) || + TokenKindIsReservedWord(tt); +} + } // namespace frontend } // namespace js diff --git a/js/src/frontend/TokenStream.cpp b/js/src/frontend/TokenStream.cpp index 8438ff7c5..b8623d545 100644 --- a/js/src/frontend/TokenStream.cpp +++ b/js/src/frontend/TokenStream.cpp @@ -8,6 +8,7 @@ #include "frontend/TokenStream.h" +#include "mozilla/ArrayUtils.h" #include "mozilla/IntegerTypeTraits.h" #include "mozilla/PodOperations.h" @@ -23,80 +24,81 @@ #include "jsnum.h" #include "frontend/BytecodeCompiler.h" +#include "frontend/ReservedWords.h" #include "js/CharacterEncoding.h" #include "js/UniquePtr.h" #include "vm/HelperThreads.h" -#include "vm/Keywords.h" #include "vm/StringBuffer.h" #include "vm/Unicode.h" using namespace js; using namespace js::frontend; +using mozilla::ArrayLength; using mozilla::Maybe; using mozilla::PodAssign; using mozilla::PodCopy; using mozilla::PodZero; -struct KeywordInfo { - const char* chars; // C string with keyword text +struct ReservedWordInfo { + const char* chars; // C string with reserved word text TokenKind tokentype; }; -static const KeywordInfo keywords[] = { -#define KEYWORD_INFO(keyword, name, type) \ - {js_##keyword##_str, type}, - FOR_EACH_JAVASCRIPT_KEYWORD(KEYWORD_INFO) -#undef KEYWORD_INFO +static const ReservedWordInfo reservedWords[] = { +#define RESERVED_WORD_INFO(word, name, type) \ + {js_##word##_str, type}, + FOR_EACH_JAVASCRIPT_RESERVED_WORD(RESERVED_WORD_INFO) +#undef RESERVED_WORD_INFO }; -// Returns a KeywordInfo for the specified characters, or nullptr if the string -// is not a keyword. +// Returns a ReservedWordInfo for the specified characters, or nullptr if the +// string is not a reserved word. template <typename CharT> -static const KeywordInfo* -FindKeyword(const CharT* s, size_t length) +static const ReservedWordInfo* +FindReservedWord(const CharT* s, size_t length) { MOZ_ASSERT(length != 0); size_t i; - const KeywordInfo* kw; + const ReservedWordInfo* rw; const char* chars; -#define JSKW_LENGTH() length -#define JSKW_AT(column) s[column] -#define JSKW_GOT_MATCH(index) i = (index); goto got_match; -#define JSKW_TEST_GUESS(index) i = (index); goto test_guess; -#define JSKW_NO_MATCH() goto no_match; -#include "jsautokw.h" -#undef JSKW_NO_MATCH -#undef JSKW_TEST_GUESS -#undef JSKW_GOT_MATCH -#undef JSKW_AT -#undef JSKW_LENGTH +#define JSRW_LENGTH() length +#define JSRW_AT(column) s[column] +#define JSRW_GOT_MATCH(index) i = (index); goto got_match; +#define JSRW_TEST_GUESS(index) i = (index); goto test_guess; +#define JSRW_NO_MATCH() goto no_match; +#include "frontend/ReservedWordsGenerated.h" +#undef JSRW_NO_MATCH +#undef JSRW_TEST_GUESS +#undef JSRW_GOT_MATCH +#undef JSRW_AT +#undef JSRW_LENGTH got_match: - return &keywords[i]; + return &reservedWords[i]; test_guess: - kw = &keywords[i]; - chars = kw->chars; + rw = &reservedWords[i]; + chars = rw->chars; do { if (*s++ != (unsigned char)(*chars++)) goto no_match; } while (--length != 0); - return kw; + return rw; no_match: return nullptr; } -static const KeywordInfo* -FindKeyword(JSLinearString* str) +static const ReservedWordInfo* +FindReservedWord(JSLinearString* str) { JS::AutoCheckCannotGC nogc; return str->hasLatin1Chars() - ? FindKeyword(str->latin1Chars(nogc), str->length()) - : FindKeyword(str->twoByteChars(nogc), str->length()); + ? FindReservedWord(str->latin1Chars(nogc), str->length()) + : FindReservedWord(str->twoByteChars(nogc), str->length()); } template <typename CharT> @@ -186,7 +188,68 @@ frontend::IsIdentifier(const char16_t* chars, size_t length) bool frontend::IsKeyword(JSLinearString* str) { - return FindKeyword(str) != nullptr; + if (const ReservedWordInfo* rw = FindReservedWord(str)) + return TokenKindIsKeyword(rw->tokentype); + + return false; +} + +bool +frontend::IsFutureReservedWord(JSLinearString* str) +{ + if (const ReservedWordInfo* rw = FindReservedWord(str)) + return TokenKindIsFutureReservedWord(rw->tokentype); + + return false; +} + +bool +frontend::IsStrictReservedWord(JSLinearString* str) +{ + if (const ReservedWordInfo* rw = FindReservedWord(str)) + return TokenKindIsStrictReservedWord(rw->tokentype); + + return false; +} + +bool +frontend::IsReservedWordLiteral(JSLinearString* str) +{ + if (const ReservedWordInfo* rw = FindReservedWord(str)) + return TokenKindIsReservedWordLiteral(rw->tokentype); + + return false; +} + +const char* +frontend::ReservedWordToCharZ(PropertyName* str) +{ + const ReservedWordInfo* rw = FindReservedWord(str); + if (rw == nullptr) + return nullptr; + + switch (rw->tokentype) { +#define EMIT_CASE(word, name, type) case type: return js_##word##_str; + FOR_EACH_JAVASCRIPT_RESERVED_WORD(EMIT_CASE) +#undef EMIT_CASE + default: + MOZ_ASSERT_UNREACHABLE("Not a reserved word PropertyName."); + } + return nullptr; +} + +PropertyName* +TokenStream::reservedWordToPropertyName(TokenKind tt) const +{ + MOZ_ASSERT(tt != TOK_NAME); + switch (tt) { +#define EMIT_CASE(word, name, type) case type: return cx->names().name; + FOR_EACH_JAVASCRIPT_RESERVED_WORD(EMIT_CASE) +#undef EMIT_CASE + default: + MOZ_ASSERT_UNREACHABLE("Not a reserved word TokenKind."); + } + return nullptr; } TokenStream::SourceCoords::SourceCoords(ExclusiveContext* cx, uint32_t ln) @@ -223,8 +286,13 @@ TokenStream::SourceCoords::add(uint32_t lineNum, uint32_t lineStartOffset) // only if lineStartOffsets_.append succeeds, to keep sentinel. // Otherwise return false to tell TokenStream about OOM. uint32_t maxPtr = MAX_PTR; - if (!lineStartOffsets_.append(maxPtr)) + if (!lineStartOffsets_.append(maxPtr)) { + static_assert(mozilla::IsSame<decltype(lineStartOffsets_.allocPolicy()), + TempAllocPolicy&>::value, + "this function's caller depends on it reporting an " + "error on failure, as TempAllocPolicy ensures"); return false; + } lineStartOffsets_[lineIndex] = lineStartOffset; } else { @@ -554,8 +622,9 @@ TokenStream::advance(size_t position) MOZ_MAKE_MEM_UNDEFINED(&cur->type, sizeof(cur->type)); lookahead = 0; - if (flags.hitOOM) - return reportError(JSMSG_OUT_OF_MEMORY); + if (flags.hitOOM) { + return false; + } return true; } @@ -599,8 +668,8 @@ TokenStream::seek(const Position& pos, const TokenStream& other) } bool -TokenStream::reportStrictModeErrorNumberVA(uint32_t offset, bool strictMode, unsigned errorNumber, - va_list args) +TokenStream::reportStrictModeErrorNumberVA(UniquePtr<JSErrorNotes> notes, uint32_t offset, + bool strictMode, unsigned errorNumber, va_list args) { // In strict mode code, this is an error, not merely a warning. unsigned flags; @@ -611,7 +680,7 @@ TokenStream::reportStrictModeErrorNumberVA(uint32_t offset, bool strictMode, uns else return true; - return reportCompileErrorNumberVA(offset, flags, errorNumber, args); + return reportCompileErrorNumberVA(Move(notes), offset, flags, errorNumber, args); } void @@ -637,8 +706,8 @@ CompileError::throwError(JSContext* cx) } bool -TokenStream::reportCompileErrorNumberVA(uint32_t offset, unsigned flags, unsigned errorNumber, - va_list args) +TokenStream::reportCompileErrorNumberVA(UniquePtr<JSErrorNotes> notes, uint32_t offset, + unsigned flags, unsigned errorNumber, va_list args) { bool warning = JSREPORT_IS_WARNING(flags); @@ -655,6 +724,7 @@ TokenStream::reportCompileErrorNumberVA(uint32_t offset, unsigned flags, unsigne return false; CompileError& err = *tempErrPtr; + err.notes = Move(notes); err.flags = flags; err.errorNumber = errorNumber; err.filename = filename; @@ -746,7 +816,7 @@ TokenStream::reportStrictModeError(unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); - bool result = reportStrictModeErrorNumberVA(currentToken().pos.begin, strictMode(), + bool result = reportStrictModeErrorNumberVA(nullptr, currentToken().pos.begin, strictMode(), errorNumber, args); va_end(args); return result; @@ -757,8 +827,8 @@ TokenStream::reportError(unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); - bool result = reportCompileErrorNumberVA(currentToken().pos.begin, JSREPORT_ERROR, errorNumber, - args); + bool result = reportCompileErrorNumberVA(nullptr, currentToken().pos.begin, JSREPORT_ERROR, + errorNumber, args); va_end(args); return result; } @@ -768,30 +838,32 @@ TokenStream::reportErrorNoOffset(unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); - bool result = reportCompileErrorNumberVA(NoOffset, JSREPORT_ERROR, errorNumber, - args); + bool result = reportCompileErrorNumberVA(nullptr, NoOffset, JSREPORT_ERROR, + errorNumber, args); va_end(args); return result; } bool -TokenStream::reportWarning(unsigned errorNumber, ...) +TokenStream::warning(unsigned errorNumber, ...) { va_list args; va_start(args, errorNumber); - bool result = reportCompileErrorNumberVA(currentToken().pos.begin, JSREPORT_WARNING, + bool result = reportCompileErrorNumberVA(nullptr, currentToken().pos.begin, JSREPORT_WARNING, errorNumber, args); va_end(args); return result; } bool -TokenStream::reportExtraWarningErrorNumberVA(uint32_t offset, unsigned errorNumber, va_list args) +TokenStream::reportExtraWarningErrorNumberVA(UniquePtr<JSErrorNotes> notes, uint32_t offset, + unsigned errorNumber, va_list args) { if (!options().extraWarningsOption) return true; - return reportCompileErrorNumberVA(offset, JSREPORT_STRICT|JSREPORT_WARNING, errorNumber, args); + return reportCompileErrorNumberVA(Move(notes), offset, JSREPORT_STRICT|JSREPORT_WARNING, + errorNumber, args); } void @@ -802,7 +874,34 @@ TokenStream::reportAsmJSError(uint32_t offset, unsigned errorNumber, ...) unsigned flags = options().throwOnAsmJSValidationFailureOption ? JSREPORT_ERROR : JSREPORT_WARNING; - reportCompileErrorNumberVA(offset, flags, errorNumber, args); + reportCompileErrorNumberVA(nullptr, offset, flags, errorNumber, args); + va_end(args); +} + +void +TokenStream::error(unsigned errorNumber, ...) +{ + va_list args; + va_start(args, errorNumber); +#ifdef DEBUG + bool result = +#endif + reportCompileErrorNumberVA(nullptr, currentToken().pos.begin, JSREPORT_ERROR, + errorNumber, args); + MOZ_ASSERT(!result, "reporting an error returned true?"); + va_end(args); +} + +void +TokenStream::errorAt(uint32_t offset, unsigned errorNumber, ...) +{ + va_list args; + va_start(args, errorNumber); +#ifdef DEBUG + bool result = +#endif + reportCompileErrorNumberVA(nullptr, offset, JSREPORT_ERROR, errorNumber, args); + MOZ_ASSERT(!result, "reporting an error returned true?"); va_end(args); } @@ -934,34 +1033,49 @@ TokenStream::getDirectives(bool isMultiline, bool shouldWarnDeprecated) bool TokenStream::getDirective(bool isMultiline, bool shouldWarnDeprecated, - const char* directive, int directiveLength, + const char* directive, uint8_t directiveLength, const char* errorMsgPragma, UniqueTwoByteChars* destination) { MOZ_ASSERT(directiveLength <= 18); char16_t peeked[18]; - int32_t c; if (peekChars(directiveLength, peeked) && CharsMatch(peeked, directive)) { - if (shouldWarnDeprecated && - !reportWarning(JSMSG_DEPRECATED_PRAGMA, errorMsgPragma)) - return false; + if (shouldWarnDeprecated) { + if (!warning(JSMSG_DEPRECATED_PRAGMA, errorMsgPragma)) + return false; + } skipChars(directiveLength); tokenbuf.clear(); - while ((c = peekChar()) && c != EOF && !unicode::IsSpaceOrBOM2(c)) { - getChar(); + do { + int32_t c; + if (!peekChar(&c)) + return false; + + if (c == EOF || unicode::IsSpaceOrBOM2(c)) + break; + + consumeKnownChar(c); + // Debugging directives can occur in both single- and multi-line // comments. If we're currently inside a multi-line comment, we also // need to recognize multi-line comment terminators. - if (isMultiline && c == '*' && peekChar() == '/') { - ungetChar('*'); - break; + if (isMultiline && c == '*') { + int32_t c2; + if (!peekChar(&c2)) + return false; + + if (c2 == '/') { + ungetChar('*'); + break; + } } + if (!tokenbuf.append(c)) return false; - } + } while (true); if (tokenbuf.empty()) { // The directive's URL was missing, but this is not quite an @@ -993,7 +1107,10 @@ TokenStream::getDisplayURL(bool isMultiline, bool shouldWarnDeprecated) // developer would like to refer to the source as from the source's actual // URL. - return getDirective(isMultiline, shouldWarnDeprecated, " sourceURL=", 11, + static const char sourceURLDirective[] = " sourceURL="; + constexpr uint8_t sourceURLDirectiveLength = ArrayLength(sourceURLDirective) - 1; + return getDirective(isMultiline, shouldWarnDeprecated, + sourceURLDirective, sourceURLDirectiveLength, "sourceURL", &displayURL_); } @@ -1003,7 +1120,10 @@ TokenStream::getSourceMappingURL(bool isMultiline, bool shouldWarnDeprecated) // Match comments of the form "//# sourceMappingURL=<url>" or // "/\* //# sourceMappingURL=<url> *\/" - return getDirective(isMultiline, shouldWarnDeprecated, " sourceMappingURL=", 18, + static const char sourceMappingURLDirective[] = " sourceMappingURL="; + constexpr uint8_t sourceMappingURLDirectiveLength = ArrayLength(sourceMappingURLDirective) - 1; + return getDirective(isMultiline, shouldWarnDeprecated, + sourceMappingURLDirective, sourceMappingURLDirectiveLength, "sourceMappingURL", &sourceMapURL_); } @@ -1110,36 +1230,6 @@ TokenStream::putIdentInTokenbuf(const char16_t* identStart) return true; } -bool -TokenStream::checkForKeyword(const KeywordInfo* kw, TokenKind* ttp) -{ - if (!awaitIsKeyword && kw->tokentype == TOK_AWAIT) { - if (ttp) - *ttp = TOK_NAME; - return true; - } - - if (kw->tokentype == TOK_RESERVED) - return reportError(JSMSG_RESERVED_ID, kw->chars); - - if (kw->tokentype == TOK_STRICT_RESERVED) - return reportStrictModeError(JSMSG_RESERVED_ID, kw->chars); - - // Working keyword. - *ttp = kw->tokentype; - return true; -} - -bool -TokenStream::checkForKeyword(JSAtom* atom, TokenKind* ttp) -{ - const KeywordInfo* kw = FindKeyword(atom); - if (!kw) - return true; - - return checkForKeyword(kw, ttp); -} - enum FirstCharKind { // A char16_t has the 'OneChar' kind if it, by itself, constitutes a valid // token that cannot also be a prefix of a longer token. E.g. ';' has the @@ -1363,36 +1453,18 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) length = userbuf.addressOfNextRawChar() - identStart; } - // Represent keywords as keyword tokens unless told otherwise. - if (modifier != KeywordIsName) { - if (const KeywordInfo* kw = FindKeyword(chars, length)) { - // That said, keywords can't contain escapes. (Contexts where - // keywords are treated as names, that also sometimes treat - // keywords as keywords, must manually check this requirement.) - // There are two exceptions - // 1) StrictReservedWords: These keywords need to be treated as - // names in non-strict mode. - // 2) yield is also treated as a name if it contains an escape - // sequence. The parser must handle this case separately. - if (hadUnicodeEscape && !( - (kw->tokentype == TOK_STRICT_RESERVED && !strictMode()) || - kw->tokentype == TOK_YIELD)) - { - reportError(JSMSG_ESCAPED_KEYWORD); - goto error; - } - - tp->type = TOK_NAME; - if (!checkForKeyword(kw, &tp->type)) - goto error; - if (tp->type != TOK_NAME && !hadUnicodeEscape) - goto out; + // Represent reserved words as reserved word tokens. + if (!hadUnicodeEscape) { + if (const ReservedWordInfo* rw = FindReservedWord(chars, length)) { + tp->type = rw->tokentype; + goto out; } } JSAtom* atom = AtomizeChars(cx, chars, length); - if (!atom) + if (!atom) { goto error; + } tp->type = TOK_NAME; tp->setName(atom->asPropertyName()); goto out; @@ -1538,10 +1610,11 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) // grammar. We might not always be so permissive, so we warn // about it. if (c >= '8') { - if (!reportWarning(JSMSG_BAD_OCTAL, c == '8' ? "08" : "09")) { + if (!warning(JSMSG_BAD_OCTAL, c == '8' ? "08" : "09")) goto error; - } - goto decimal; // use the decimal scanner for the rest of the number + + // Use the decimal scanner for the rest of the number. + goto decimal; } c = getCharIgnoreEOL(); } @@ -1690,7 +1763,8 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) case '/': // Look for a single-line comment. if (matchChar('/')) { - c = peekChar(); + if (!peekChar(&c)) + goto error; if (c == '@' || c == '#') { bool shouldWarn = getChar() == '@'; if (!getDirectives(false, shouldWarn)) @@ -1757,7 +1831,8 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) RegExpFlag reflags = NoFlags; unsigned length = tokenbuf.length() + 1; while (true) { - c = peekChar(); + if (!peekChar(&c)) + goto error; if (c == 'g' && !(reflags & GlobalFlag)) reflags = RegExpFlag(reflags | GlobalFlag); else if (c == 'i' && !(reflags & IgnoreCaseFlag)) @@ -1774,7 +1849,8 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) length++; } - c = peekChar(); + if (!peekChar(&c)) + goto error; if (JS7_ISLET(c)) { char buf[2] = { '\0', '\0' }; tp->pos.begin += length + 1; @@ -1797,8 +1873,13 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) case '-': if (matchChar('-')) { - if (peekChar() == '>' && !flags.isDirtyLine) + int32_t c2; + if (!peekChar(&c2)) + goto error; + + if (c2 == '>' && !flags.isDirtyLine) goto skipline; + tp->type = TOK_DEC; } else { tp->type = matchChar('=') ? TOK_SUBASSIGN : TOK_SUB; @@ -1814,8 +1895,9 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) MOZ_CRASH("should have jumped to |out| or |error|"); out: - if (flags.hitOOM) - return reportError(JSMSG_OUT_OF_MEMORY); + if (flags.hitOOM) { + return false; + } flags.isDirtyLine = true; tp->pos.end = userbuf.offset(); @@ -1831,8 +1913,9 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) return true; error: - if (flags.hitOOM) - return reportError(JSMSG_OUT_OF_MEMORY); + if (flags.hitOOM) { + return false; + } flags.isDirtyLine = true; tp->pos.end = userbuf.offset(); @@ -1850,37 +1933,6 @@ TokenStream::getTokenInternal(TokenKind* ttp, Modifier modifier) } bool -TokenStream::getBracedUnicode(uint32_t* cp) -{ - consumeKnownChar('{'); - - bool first = true; - int32_t c; - uint32_t code = 0; - while (true) { - c = getCharIgnoreEOL(); - if (c == EOF) - return false; - if (c == '}') { - if (first) - return false; - break; - } - - if (!JS7_ISHEX(c)) - return false; - - code = (code << 4) | JS7_UNHEX(c); - if (code > unicode::NonBMPMax) - return false; - first = false; - } - - *cp = code; - return true; -} - -bool TokenStream::getStringOrTemplateToken(int untilChar, Token** tp) { int c; @@ -1897,11 +1949,15 @@ TokenStream::getStringOrTemplateToken(int untilChar, Token** tp) while ((c = getCharIgnoreEOL()) != untilChar) { if (c == EOF) { ungetCharIgnoreEOL(c); - reportError(JSMSG_UNTERMINATED_STRING); + error(JSMSG_UNTERMINATED_STRING); return false; } if (c == '\\') { + // When parsing templates, we don't immediately report errors for + // invalid escapes; these are handled by the parser. + // In those cases we don't append to tokenbuf, since it won't be + // read. switch (c = getChar()) { case 'b': c = '\b'; break; case 'f': c = '\f'; break; @@ -1917,12 +1973,73 @@ TokenStream::getStringOrTemplateToken(int untilChar, Token** tp) // Unicode character specification. case 'u': { - if (peekChar() == '{') { - uint32_t code; - if (!getBracedUnicode(&code)) { - reportError(JSMSG_MALFORMED_ESCAPE, "Unicode"); - return false; - } + uint32_t code = 0; + + int32_t c2; + if (!peekChar(&c2)) + return false; + + uint32_t start = userbuf.offset() - 2; + + if (c2 == '{') { + consumeKnownChar('{'); + + bool first = true; + bool valid = true; + do { + int32_t c = getCharIgnoreEOL(); + if (c == EOF) { + if (parsingTemplate) { + setInvalidTemplateEscape(start, InvalidEscapeType::Unicode); + valid = false; + break; + } + reportInvalidEscapeError(start, InvalidEscapeType::Unicode); + return false; + } + if (c == '}') { + if (first) { + if (parsingTemplate) { + setInvalidTemplateEscape(start, InvalidEscapeType::Unicode); + valid = false; + break; + } + reportInvalidEscapeError(start, InvalidEscapeType::Unicode); + return false; + } + break; + } + + if (!JS7_ISHEX(c)) { + if (parsingTemplate) { + // We put the character back so that we read + // it on the next pass, which matters if it + // was '`' or '\'. + ungetCharIgnoreEOL(c); + setInvalidTemplateEscape(start, InvalidEscapeType::Unicode); + valid = false; + break; + } + reportInvalidEscapeError(start, InvalidEscapeType::Unicode); + return false; + } + + code = (code << 4) | JS7_UNHEX(c); + if (code > unicode::NonBMPMax) { + if (parsingTemplate) { + setInvalidTemplateEscape(start + 3, InvalidEscapeType::UnicodeOverflow); + valid = false; + break; + } + reportInvalidEscapeError(start + 3, InvalidEscapeType::UnicodeOverflow); + return false; + } + + first = false; + } while (true); + + if (!valid) + continue; MOZ_ASSERT(code <= unicode::NonBMPMax); if (code < unicode::NonBMPMin) { @@ -1945,7 +2062,11 @@ TokenStream::getStringOrTemplateToken(int untilChar, Token** tp) c = (c << 4) + JS7_UNHEX(cp[3]); skipChars(4); } else { - reportError(JSMSG_MALFORMED_ESCAPE, "Unicode"); + if (parsingTemplate) { + setInvalidTemplateEscape(start, InvalidEscapeType::Unicode); + continue; + } + reportInvalidEscapeError(start, InvalidEscapeType::Unicode); return false; } break; @@ -1958,7 +2079,12 @@ TokenStream::getStringOrTemplateToken(int untilChar, Token** tp) c = (JS7_UNHEX(cp[0]) << 4) + JS7_UNHEX(cp[1]); skipChars(2); } else { - reportError(JSMSG_MALFORMED_ESCAPE, "hexadecimal"); + uint32_t start = userbuf.offset() - 2; + if (parsingTemplate) { + setInvalidTemplateEscape(start, InvalidEscapeType::Hexadecimal); + continue; + } + reportInvalidEscapeError(start, InvalidEscapeType::Hexadecimal); return false; } break; @@ -1969,13 +2095,14 @@ TokenStream::getStringOrTemplateToken(int untilChar, Token** tp) if (JS7_ISOCT(c)) { int32_t val = JS7_UNOCT(c); - c = peekChar(); + if (!peekChar(&c)) + return false; // Strict mode code allows only \0, then a non-digit. if (val != 0 || JS7_ISDEC(c)) { if (parsingTemplate) { - reportError(JSMSG_DEPRECATED_OCTAL); - return false; + setInvalidTemplateEscape(userbuf.offset() - 2, InvalidEscapeType::Octal); + continue; } if (!reportStrictModeError(JSMSG_DEPRECATED_OCTAL)) return false; @@ -1985,7 +2112,8 @@ TokenStream::getStringOrTemplateToken(int untilChar, Token** tp) if (JS7_ISOCT(c)) { val = 8 * val + JS7_UNOCT(c); getChar(); - c = peekChar(); + if (!peekChar(&c)) + return false; if (JS7_ISOCT(c)) { int32_t save = val; val = 8 * val + JS7_UNOCT(c); @@ -2003,7 +2131,7 @@ TokenStream::getStringOrTemplateToken(int untilChar, Token** tp) } else if (TokenBuf::isRawEOLChar(c)) { if (!parsingTemplate) { ungetCharIgnoreEOL(c); - reportError(JSMSG_UNTERMINATED_STRING); + error(JSMSG_UNTERMINATED_STRING); return false; } if (c == '\r') { diff --git a/js/src/frontend/TokenStream.h b/js/src/frontend/TokenStream.h index 6ba9fba5a..2744fd144 100644 --- a/js/src/frontend/TokenStream.h +++ b/js/src/frontend/TokenStream.h @@ -26,14 +26,13 @@ #include "js/UniquePtr.h" #include "js/Vector.h" #include "vm/RegExpObject.h" +#include "vm/String.h" struct KeywordInfo; namespace js { namespace frontend { -class AutoAwaitIsKeyword; - struct TokenPos { uint32_t begin; // Offset of the token's first char. uint32_t end; // Offset of 1 past the token's last char. @@ -80,6 +79,20 @@ struct TokenPos { enum DecimalPoint { NoDecimal = false, HasDecimal = true }; +enum class InvalidEscapeType { + // No invalid character escapes. + None, + // A malformed \x escape. + Hexadecimal, + // A malformed \u escape. + Unicode, + // An otherwise well-formed \u escape which represents a + // codepoint > 10FFFF. + UnicodeOverflow, + // An octal escape in a template token. + Octal +}; + class TokenStream; struct Token @@ -106,9 +119,6 @@ struct Token // TOK_DIV. Operand, - // Treat keywords as names by returning TOK_NAME. - KeywordIsName, - // Treat subsequent characters as the tail of a template literal, after // a template substitution, beginning with a "}", continuing with zero // or more template literal characters, and ending with either "${" or @@ -150,10 +160,6 @@ struct Token // If a semicolon is inserted automatically, the next token is already // gotten with None, but we expect Operand. OperandIsNone, - - // If name of method definition is `get` or `set`, the next token is - // already gotten with KeywordIsName, but we expect None. - NoneIsKeywordIsName, }; friend class TokenStream; @@ -210,11 +216,6 @@ struct Token return u.name->JSAtom::asPropertyName(); // poor-man's type verification } - bool nameContainsEscape() const { - PropertyName* n = name(); - return pos.begin + n->length() != pos.end; - } - JSAtom* atom() const { MOZ_ASSERT(type == TOK_STRING || type == TOK_TEMPLATE_HEAD || @@ -240,10 +241,22 @@ struct Token }; class CompileError : public JSErrorReport { -public: + public: void throwError(JSContext* cx); }; +extern const char* +ReservedWordToCharZ(PropertyName* str); + +extern MOZ_MUST_USE bool +IsFutureReservedWord(JSLinearString* str); + +extern MOZ_MUST_USE bool +IsReservedWordLiteral(JSLinearString* str); + +extern MOZ_MUST_USE bool +IsStrictReservedWord(JSLinearString* str); + // Ideally, tokenizing would be entirely independent of context. But the // strict mode flag, which is in SharedContext, affects tokenizing, and // TokenStream needs to see it. @@ -330,25 +343,26 @@ class MOZ_STACK_CLASS TokenStream JSVersion versionNumber() const { return VersionNumber(options().version); } JSVersion versionWithFlags() const { return options().version; } + private: + PropertyName* reservedWordToPropertyName(TokenKind tt) const; + + public: PropertyName* currentName() const { - if (isCurrentTokenType(TOK_YIELD)) - return cx->names().yield; - MOZ_ASSERT(isCurrentTokenType(TOK_NAME)); - return currentToken().name(); + if (isCurrentTokenType(TOK_NAME)) { + return currentToken().name(); + } + + MOZ_ASSERT(TokenKindIsPossibleIdentifierName(currentToken().type)); + return reservedWordToPropertyName(currentToken().type); } PropertyName* nextName() const { - if (nextToken().type == TOK_YIELD) - return cx->names().yield; - MOZ_ASSERT(nextToken().type == TOK_NAME); - return nextToken().name(); - } + if (nextToken().type != TOK_NAME) { + return nextToken().name(); + } - bool nextNameContainsEscape() const { - if (nextToken().type == TOK_YIELD) - return false; - MOZ_ASSERT(nextToken().type == TOK_NAME); - return nextToken().nameContainsEscape(); + MOZ_ASSERT(TokenKindIsPossibleIdentifierName(nextToken().type)); + return reservedWordToPropertyName(nextToken().type); } bool isCurrentTokenAssignment() const { @@ -361,21 +375,47 @@ class MOZ_STACK_CLASS TokenStream bool hadError() const { return flags.hadError; } void clearSawOctalEscape() { flags.sawOctalEscape = false; } + bool hasInvalidTemplateEscape() const { + return invalidTemplateEscapeType != InvalidEscapeType::None; + } + void clearInvalidTemplateEscape() { + invalidTemplateEscapeType = InvalidEscapeType::None; + } + + // If there is an invalid escape in a template, report it and return false, + // otherwise return true. + bool checkForInvalidTemplateEscapeError() { + if (invalidTemplateEscapeType == InvalidEscapeType::None) + return true; + + reportInvalidEscapeError(invalidTemplateEscapeOffset, invalidTemplateEscapeType); + return false; + } + // TokenStream-specific error reporters. bool reportError(unsigned errorNumber, ...); bool reportErrorNoOffset(unsigned errorNumber, ...); - bool reportWarning(unsigned errorNumber, ...); + + // Report the given error at the current offset. + void error(unsigned errorNumber, ...); + + // Report the given error at the given offset. + void errorAt(uint32_t offset, unsigned errorNumber, ...); + + // Warn at the current offset. + MOZ_MUST_USE bool warning(unsigned errorNumber, ...); static const uint32_t NoOffset = UINT32_MAX; // General-purpose error reporters. You should avoid calling these - // directly, and instead use the more succinct alternatives (e.g. - // reportError()) in TokenStream, Parser, and BytecodeEmitter. - bool reportCompileErrorNumberVA(uint32_t offset, unsigned flags, unsigned errorNumber, - va_list args); - bool reportStrictModeErrorNumberVA(uint32_t offset, bool strictMode, unsigned errorNumber, - va_list args); - bool reportExtraWarningErrorNumberVA(uint32_t offset, unsigned errorNumber, va_list args); + // directly, and instead use the more succinct alternatives (error(), + // warning(), &c.) in TokenStream, Parser, and BytecodeEmitter. + bool reportCompileErrorNumberVA(UniquePtr<JSErrorNotes> notes, uint32_t offset, unsigned flags, + unsigned errorNumber, va_list args); + bool reportStrictModeErrorNumberVA(UniquePtr<JSErrorNotes> notes, uint32_t offset, + bool strictMode, unsigned errorNumber, va_list args); + bool reportExtraWarningErrorNumberVA(UniquePtr<JSErrorNotes> notes, uint32_t offset, + unsigned errorNumber, va_list args); // asm.js reporter void reportAsmJSError(uint32_t offset, unsigned errorNumber, ...); @@ -414,6 +454,33 @@ class MOZ_STACK_CLASS TokenStream bool reportStrictModeError(unsigned errorNumber, ...); bool strictMode() const { return strictModeGetter && strictModeGetter->strictMode(); } + void setInvalidTemplateEscape(uint32_t offset, InvalidEscapeType type) { + MOZ_ASSERT(type != InvalidEscapeType::None); + if (invalidTemplateEscapeType != InvalidEscapeType::None) + return; + invalidTemplateEscapeOffset = offset; + invalidTemplateEscapeType = type; + } + void reportInvalidEscapeError(uint32_t offset, InvalidEscapeType type) { + switch (type) { + case InvalidEscapeType::None: + MOZ_ASSERT_UNREACHABLE("unexpected InvalidEscapeType"); + return; + case InvalidEscapeType::Hexadecimal: + errorAt(offset, JSMSG_MALFORMED_ESCAPE, "hexadecimal"); + return; + case InvalidEscapeType::Unicode: + errorAt(offset, JSMSG_MALFORMED_ESCAPE, "Unicode"); + return; + case InvalidEscapeType::UnicodeOverflow: + errorAt(offset, JSMSG_UNICODE_OVERFLOW, "escape sequence"); + return; + case InvalidEscapeType::Octal: + errorAt(offset, JSMSG_DEPRECATED_OCTAL); + return; + } + } + static JSAtom* atomize(ExclusiveContext* cx, CharBuffer& cb); MOZ_MUST_USE bool putIdentInTokenbuf(const char16_t* identStart); @@ -431,21 +498,19 @@ class MOZ_STACK_CLASS TokenStream {} }; - bool awaitIsKeyword = false; - friend class AutoAwaitIsKeyword; + uint32_t invalidTemplateEscapeOffset = 0; + InvalidEscapeType invalidTemplateEscapeType = InvalidEscapeType::None; public: typedef Token::Modifier Modifier; static constexpr Modifier None = Token::None; static constexpr Modifier Operand = Token::Operand; - static constexpr Modifier KeywordIsName = Token::KeywordIsName; static constexpr Modifier TemplateTail = Token::TemplateTail; typedef Token::ModifierException ModifierException; static constexpr ModifierException NoException = Token::NoException; static constexpr ModifierException NoneIsOperand = Token::NoneIsOperand; static constexpr ModifierException OperandIsNone = Token::OperandIsNone; - static constexpr ModifierException NoneIsKeywordIsName = Token::NoneIsKeywordIsName; void addModifierException(ModifierException modifierException) { #ifdef DEBUG @@ -474,10 +539,6 @@ class MOZ_STACK_CLASS TokenStream MOZ_ASSERT(next.type != TOK_DIV && next.type != TOK_REGEXP, "next token requires contextual specifier to be parsed unambiguously"); break; - case NoneIsKeywordIsName: - MOZ_ASSERT(next.modifier == KeywordIsName); - MOZ_ASSERT(next.type != TOK_NAME); - break; default: MOZ_CRASH("unexpected modifier exception"); } @@ -504,18 +565,17 @@ class MOZ_STACK_CLASS TokenStream return; } - if (lookaheadToken.modifierException == NoneIsKeywordIsName) { - // getToken() permissibly following getToken(KeywordIsName). - if (modifier == None && lookaheadToken.modifier == KeywordIsName) - return; - } - MOZ_ASSERT_UNREACHABLE("this token was previously looked up with a " "different modifier, potentially making " "tokenization non-deterministic"); #endif } + const Token& nextToken() const { + MOZ_ASSERT(hasLookahead()); + return tokens[(cursor + 1) & ntokensMask]; + } + // Advance to the next token. If the token stream encountered an error, // return false. Otherwise return true and store the token kind in |*ttp|. MOZ_MUST_USE bool getToken(TokenKind* ttp, Modifier modifier = None) { @@ -644,36 +704,6 @@ class MOZ_STACK_CLASS TokenStream MOZ_ALWAYS_TRUE(matched); } - // Like matchToken(..., TOK_NAME) but further matching the name token only - // if it has the given characters, without containing escape sequences. - // If the name token has the given characters yet *does* contain an escape, - // a syntax error will be reported. - // - // This latter behavior makes this method unsuitable for use in any context - // where ASI might occur. In such places, an escaped "contextual keyword" - // on a new line is the start of an ExpressionStatement, not a continuation - // of a StatementListItem (or ImportDeclaration or ExportDeclaration, in - // modules). - MOZ_MUST_USE bool matchContextualKeyword(bool* matchedp, Handle<PropertyName*> keyword, - Modifier modifier = None) - { - TokenKind token; - if (!getToken(&token, modifier)) - return false; - if (token == TOK_NAME && currentToken().name() == keyword) { - if (currentToken().nameContainsEscape()) { - reportError(JSMSG_ESCAPED_KEYWORD); - return false; - } - - *matchedp = true; - } else { - *matchedp = false; - ungetToken(); - } - return true; - } - MOZ_MUST_USE bool nextTokenEndsExpr(bool* endsExpr) { TokenKind tt; if (!peekToken(&tt)) @@ -739,19 +769,6 @@ class MOZ_STACK_CLASS TokenStream return sourceMapURL_.get(); } - // If |atom| is not a keyword in this version, return true with *ttp - // unchanged. - // - // If it is a reserved word in this version and strictness mode, and thus - // can't be present in correct code, report a SyntaxError and return false. - // - // If it is a keyword, like "if", return true with the keyword's TokenKind - // in *ttp. - MOZ_MUST_USE bool checkForKeyword(JSAtom* atom, TokenKind* ttp); - - // Same semantics as above, but for the provided keyword. - MOZ_MUST_USE bool checkForKeyword(const KeywordInfo* kw, TokenKind* ttp); - // This class maps a userbuf offset (which is 0-indexed) to a line number // (which is 1-indexed) and a column index (which is 0-indexed). class SourceCoords @@ -947,7 +964,6 @@ class MOZ_STACK_CLASS TokenStream MOZ_MUST_USE bool getTokenInternal(TokenKind* ttp, Modifier modifier); - MOZ_MUST_USE bool getBracedUnicode(uint32_t* code); MOZ_MUST_USE bool getStringOrTemplateToken(int untilChar, Token** tp); int32_t getChar(); @@ -964,7 +980,7 @@ class MOZ_STACK_CLASS TokenStream MOZ_MUST_USE bool getDirectives(bool isMultiline, bool shouldWarnDeprecated); MOZ_MUST_USE bool getDirective(bool isMultiline, bool shouldWarnDeprecated, - const char* directive, int directiveLength, + const char* directive, uint8_t directiveLength, const char* errorMsgPragma, UniquePtr<char16_t[], JS::FreePolicy>* destination); MOZ_MUST_USE bool getDisplayURL(bool isMultiline, bool shouldWarnDeprecated); @@ -982,29 +998,30 @@ class MOZ_STACK_CLASS TokenStream MOZ_ASSERT(c == expect); } - int32_t peekChar() { - int32_t c = getChar(); - ungetChar(c); - return c; + MOZ_MUST_USE bool peekChar(int32_t* c) { + *c = getChar(); + ungetChar(*c); + return true; } - void skipChars(int n) { - while (--n >= 0) - getChar(); + void skipChars(uint8_t n) { + while (n-- > 0) { + MOZ_ASSERT(userbuf.hasRawChars()); + mozilla::DebugOnly<int32_t> c = getCharIgnoreEOL(); + MOZ_ASSERT(c != '\n'); + } } - void skipCharsIgnoreEOL(int n) { - while (--n >= 0) + void skipCharsIgnoreEOL(uint8_t n) { + while (n-- > 0) { + MOZ_ASSERT(userbuf.hasRawChars()); getCharIgnoreEOL(); + } } void updateLineInfoForEOL(); void updateFlagsForEOL(); - const Token& nextToken() const { - MOZ_ASSERT(hasLookahead()); - return tokens[(cursor + 1) & ntokensMask]; - } bool hasLookahead() const { return lookahead > 0; } @@ -1029,25 +1046,6 @@ class MOZ_STACK_CLASS TokenStream StrictModeGetter* strictModeGetter; // used to test for strict mode }; -class MOZ_STACK_CLASS AutoAwaitIsKeyword -{ -private: - TokenStream* ts_; - bool oldAwaitIsKeyword_; - -public: - AutoAwaitIsKeyword(TokenStream* ts, bool awaitIsKeyword) { - ts_ = ts; - oldAwaitIsKeyword_ = ts_->awaitIsKeyword; - ts_->awaitIsKeyword = awaitIsKeyword; - } - - ~AutoAwaitIsKeyword() { - ts_->awaitIsKeyword = oldAwaitIsKeyword_; - ts_ = nullptr; - } -}; - extern const char* TokenKindToDesc(TokenKind tt); diff --git a/js/src/irregexp/RegExpParser.cpp b/js/src/irregexp/RegExpParser.cpp index ccc6ae3eb..8bd88047a 100644 --- a/js/src/irregexp/RegExpParser.cpp +++ b/js/src/irregexp/RegExpParser.cpp @@ -243,10 +243,10 @@ RegExpParser<CharT>::RegExpParser(frontend::TokenStream& ts, LifoAlloc* alloc, template <typename CharT> RegExpTree* -RegExpParser<CharT>::ReportError(unsigned errorNumber) +RegExpParser<CharT>::ReportError(unsigned errorNumber, const char* param /* = nullptr */) { gc::AutoSuppressGC suppressGC(ts.context()); - ts.reportError(errorNumber); + ts.reportError(errorNumber, param); return nullptr; } @@ -350,7 +350,7 @@ RegExpParser<CharT>::ParseBracedHexEscape(widechar* value) } code = (code << 4) | d; if (code > unicode::NonBMPMax) { - ReportError(JSMSG_UNICODE_OVERFLOW); + ReportError(JSMSG_UNICODE_OVERFLOW, "regular expression"); return false; } Advance(); diff --git a/js/src/irregexp/RegExpParser.h b/js/src/irregexp/RegExpParser.h index b5228a86f..0a7e61858 100644 --- a/js/src/irregexp/RegExpParser.h +++ b/js/src/irregexp/RegExpParser.h @@ -211,7 +211,7 @@ class RegExpParser bool ParseBackReferenceIndex(int* index_out); bool ParseClassAtom(char16_t* char_class, widechar *value); - RegExpTree* ReportError(unsigned errorNumber); + RegExpTree* ReportError(unsigned errorNumber, const char* param = nullptr); void Advance(); void Advance(int dist) { next_pos_ += dist - 1; diff --git a/js/src/jit-test/modules/export-default-async-asi.js b/js/src/jit-test/modules/export-default-async-asi.js new file mode 100644 index 000000000..a69a7aa3d --- /dev/null +++ b/js/src/jit-test/modules/export-default-async-asi.js @@ -0,0 +1,2 @@ +export default async // ASI occurs here due to the [no LineTerminator here] restriction on default-exporting an async function +function async() { return 17; } diff --git a/js/src/jit-test/tests/asm.js/import-function-toPrimitive.js b/js/src/jit-test/tests/asm.js/import-function-toPrimitive.js new file mode 100644 index 000000000..aa529b465 --- /dev/null +++ b/js/src/jit-test/tests/asm.js/import-function-toPrimitive.js @@ -0,0 +1,26 @@ +var counter = 0; + +function f(stdlib, foreign) +{ + "use asm"; + var a = +foreign.a; + var b = +foreign.b; + function g() {} + return g; +} + +var foreign = + { + a: function() {}, + b: /value that doesn't coerce purely/, + }; + +foreign.a[Symbol.toPrimitive] = + function() + { + counter++; + return 0; + }; + +f(null, foreign); +assertEq(counter, 1); diff --git a/js/src/jit-test/tests/baseline/bug1344334.js b/js/src/jit-test/tests/baseline/bug1344334.js new file mode 100644 index 000000000..66994338a --- /dev/null +++ b/js/src/jit-test/tests/baseline/bug1344334.js @@ -0,0 +1,14 @@ +if (!('oomTest' in this)) + quit(); + +function f(s) { + s + "x"; + s.indexOf("y") === 0; + oomTest(new Function(s)); +} +var s = ` + class TestClass { constructor() {} } + for (var fun of hasPrototype) {} +`; +if (s.length) + f(s); diff --git a/js/src/jit-test/tests/basic/bug713226.js b/js/src/jit-test/tests/basic/bug713226.js index 3ae991f43..36858b86c 100644 --- a/js/src/jit-test/tests/basic/bug713226.js +++ b/js/src/jit-test/tests/basic/bug713226.js @@ -8,7 +8,7 @@ function addDebug(g, id) {\ var debuggerGlobal = newGlobal();\ debuggerGlobal.debuggee = g;\ debuggerGlobal.id = id;\ - debuggerGlobal.print = function (s) { (g) += s; };\ + debuggerGlobal.print = function (s) { print(s); };\ debuggerGlobal.eval('var dbg = new Debugger(debuggee);dbg.onDebuggerStatement = function () { print(id); debugger; };');\ return debuggerGlobal;\ }\ diff --git a/js/src/jit-test/tests/basic/hasnativemethodpure-optimization.js b/js/src/jit-test/tests/basic/hasnativemethodpure-optimization.js new file mode 100644 index 000000000..2f5e99186 --- /dev/null +++ b/js/src/jit-test/tests/basic/hasnativemethodpure-optimization.js @@ -0,0 +1,21 @@ +load(libdir + "asserts.js"); + +let string = Object.defineProperty(new String("123"), "valueOf", { + get: function() { throw "get-valueOf"; } +}); +assertThrowsValue(() => "" + string, "get-valueOf"); + +string = Object.defineProperty(new String("123"), "toString", { + get: function() { throw "get-toString"; } +}); +assertThrowsValue(() => string.toLowerCase(), "get-toString"); + +string = Object.defineProperty(new String("123"), Symbol.toPrimitive, { + get: function() { throw "get-toPrimitive"; } +}); +assertThrowsValue(() => string.toLowerCase(), "get-toPrimitive"); + +let number = Object.defineProperty(new Number(123), "valueOf", { + get: function() { throw "get-valueOf"; } +}); +assertThrowsValue(() => +number, "get-valueOf");
\ No newline at end of file diff --git a/js/src/jit-test/tests/basic/testFunctionStatementAliasLocals.js b/js/src/jit-test/tests/basic/testFunctionStatementAliasLocals.js index 7be49b7f3..be7f528b9 100644 --- a/js/src/jit-test/tests/basic/testFunctionStatementAliasLocals.js +++ b/js/src/jit-test/tests/basic/testFunctionStatementAliasLocals.js @@ -8,9 +8,11 @@ assertEq(typeof f1(true), "function"); assertEq(f1(false), 3); function f2(b, w) { + // Annex B doesn't apply to functions in blocks with the same name as a + // parameter. if (b) function w() {} return w; } -assertEq(typeof f2(true, 3), "function"); +assertEq(typeof f2(true, 3), "number"); assertEq(f2(false, 3), 3); diff --git a/js/src/jit-test/tests/class/bug1357506.js b/js/src/jit-test/tests/class/bug1357506.js new file mode 100644 index 000000000..52a5643e6 --- /dev/null +++ b/js/src/jit-test/tests/class/bug1357506.js @@ -0,0 +1,8 @@ +// Test that constructors that abort due to asm.js do not assert due to the +// parser keeping track of the FunctionBox corresponding to the constructor. + +class a { + constructor() { + "use asm"; + } +} diff --git a/js/src/jit-test/tests/class/bug1359622.js b/js/src/jit-test/tests/class/bug1359622.js new file mode 100644 index 000000000..b4a0df749 --- /dev/null +++ b/js/src/jit-test/tests/class/bug1359622.js @@ -0,0 +1,4 @@ +setDiscardSource(true) +evaluate(` + unescape(class get { static staticMethod() {} }); +`); diff --git a/js/src/jit-test/tests/debug/wasm-12.js b/js/src/jit-test/tests/debug/wasm-12.js new file mode 100644 index 000000000..18d3b574d --- /dev/null +++ b/js/src/jit-test/tests/debug/wasm-12.js @@ -0,0 +1,26 @@ +// Tests that wasm module scripts have special URLs. + +if (!wasmIsSupported()) + quit(); + +var g = newGlobal(); +g.eval(` +function initWasm(s) { return new WebAssembly.Instance(new WebAssembly.Module(wasmTextToBinary(s))); } +o = initWasm('(module (func) (export "" 0))'); +o2 = initWasm('(module (func) (func) (export "" 1))'); +`); + +function isWasm(script) { return script.format === "wasm"; } + +function isValidWasmURL(url) { + // The URLs will have the following format: + // wasm: [<uri-econded-filename-of-host> ":"] <64-bit-hash> + return /^wasm:(?:[^:]*:)*?[0-9a-f]{16}$/.test(url); +} + +var dbg = new Debugger(g); +var foundScripts = dbg.findScripts().filter(isWasm); +assertEq(foundScripts.length, 2); +assertEq(isValidWasmURL(foundScripts[0].source.url), true); +assertEq(isValidWasmURL(foundScripts[1].source.url), true); +assertEq(foundScripts[0].source.url != foundScripts[1].source.url, true); diff --git a/js/src/jit-test/tests/modules/export-declaration.js b/js/src/jit-test/tests/modules/export-declaration.js index 3c4a9b735..9925f2c68 100644 --- a/js/src/jit-test/tests/modules/export-declaration.js +++ b/js/src/jit-test/tests/modules/export-declaration.js @@ -403,12 +403,52 @@ assertThrowsInstanceOf(function() { parseAsModule("export {,} from 'a'"); }, SyntaxError); +program([ + exportDeclaration( + null, + [ + exportSpecifier( + ident("true"), + ident("true") + ), + ], + lit("b"), + false + ) +]).assert(parseAsModule("export { true } from 'b'")); + +program([ + exportDeclaration( + null, + [ + exportSpecifier( + ident("true"), + ident("name") + ), + ], + lit("b"), + false + ) +]).assert(parseAsModule("export { true as name } from 'b'")); + +assertThrowsInstanceOf(function() { + parseAsModule("export { true }"); +}, SyntaxError); + +assertThrowsInstanceOf(function() { + parseAsModule("export { true as name }"); +}, SyntaxError); + +assertThrowsInstanceOf(function() { + parseAsModule("export { static }"); +}, SyntaxError); + assertThrowsInstanceOf(function() { - parseAsModule("export { true as a } from 'b'"); + parseAsModule("export { static as name }"); }, SyntaxError); assertThrowsInstanceOf(function () { - parseAsModule("export { a } from 'b' f();"); + parseAsModule("export { name } from 'b' f();"); }, SyntaxError); assertThrowsInstanceOf(function () { diff --git a/js/src/jit-test/tests/modules/function-redeclaration.js b/js/src/jit-test/tests/modules/function-redeclaration.js new file mode 100644 index 000000000..b84704641 --- /dev/null +++ b/js/src/jit-test/tests/modules/function-redeclaration.js @@ -0,0 +1,94 @@ +load(libdir + "asserts.js"); + +var functionDeclarations = [ + "function f(){}", + "function* f(){}", + "async function f(){}", +]; + +var varDeclarations = [ + "var f", + "{ var f; }", + "for (var f in null);", + "for (var f of null);", + "for (var f; ;);", +]; + +var lexicalDeclarations = [ + "let f;", + "const f = 0;", + "class f {};", +]; + +var imports = [ + "import f from '';", + "import f, {} from '';", + "import d, {f} from '';", + "import d, {f as f} from '';", + "import d, {foo as f} from '';", + "import f, * as d from '';", + "import d, * as f from '';", + "import {f} from '';", + "import {f as f} from '';", + "import {foo as f} from '';", + "import* as f from '';", +]; + +var exports = [ + "export var f;", + ...functionDeclarations.map(fn => `export ${fn};`), + ...lexicalDeclarations.map(ld => `export ${ld};`), + ...functionDeclarations.map(fn => `export default ${fn};`), + "export default class f {};", +]; + +var redeclarations = [ + ...functionDeclarations, + ...varDeclarations, + ...lexicalDeclarations, + ...imports, + ...exports, +]; + +var noredeclarations = [ + ...functionDeclarations.map(fn => `{ ${fn} }`), + ...lexicalDeclarations.map(ld => `{ ${ld} }`), + ...["let", "const"].map(ld => `for (${ld} f in null);`), + ...["let", "const"].map(ld => `for (${ld} f of null);`), + ...["let", "const"].map(ld => `for (${ld} f = 0; ;);`), + "export {f};", + "export {f as f};", + "export {foo as f}; var foo;", + "export {f} from '';", + "export {f as f} from '';", + "export {foo as f} from '';", +]; + +for (var decl of functionDeclarations) { + for (var redecl of redeclarations) { + assertThrowsInstanceOf(() => { + parseModule(` + ${decl} + ${redecl} + `); + }, SyntaxError); + + assertThrowsInstanceOf(() => { + parseModule(` + ${redecl} + ${decl} + `); + }, SyntaxError); + } + + for (var redecl of noredeclarations) { + parseModule(` + ${decl} + ${redecl} + `); + parseModule(` + ${redecl} + ${decl} + `); + } +} diff --git a/js/src/jit-test/tests/parser/arrow-rest.js b/js/src/jit-test/tests/parser/arrow-rest.js index 53750f25b..b1429066e 100644 --- a/js/src/jit-test/tests/parser/arrow-rest.js +++ b/js/src/jit-test/tests/parser/arrow-rest.js @@ -39,7 +39,7 @@ testThrow(` testThrow(` ({...a)=> -`, 2); +`, 6); testThrow(` function f([... ...a)=> @@ -47,7 +47,7 @@ function f([... ...a)=> testThrow(` function f({...a)=> -`, 12); +`, 16); // arrow @@ -67,7 +67,7 @@ var [... ...a)=> testThrow(` var {...a)=> -`, 5); +`, 9); // initializer diff --git a/js/src/jit-test/tests/parser/missing-closing-brace.js b/js/src/jit-test/tests/parser/missing-closing-brace.js new file mode 100644 index 000000000..6820954ae --- /dev/null +++ b/js/src/jit-test/tests/parser/missing-closing-brace.js @@ -0,0 +1,90 @@ +function test(source, [lineNumber, columnNumber], openType = "{", closeType = "}") { + let caught = false; + try { + Reflect.parse(source, { source: "foo.js" }); + } catch (e) { + assertEq(e.message.includes("missing " + closeType + " "), true); + let notes = getErrorNotes(e); + assertEq(notes.length, 1); + let note = notes[0]; + assertEq(note.message, openType + " opened at line " + lineNumber + ", column " + columnNumber); + assertEq(note.fileName, "foo.js"); + assertEq(note.lineNumber, lineNumber); + assertEq(note.columnNumber, columnNumber); + caught = true; + } + assertEq(caught, true); +} + +// Function + +test(` +function test1() { +} +function test2() { + if (true) { + //} +} +function test3() { +} +`, [4, 17]); + +// Block statement. +test(` +{ + if (true) { +} +`, [2, 0]); +test(` +if (true) { + if (true) { +} +`, [2, 10]); +test(` +for (;;) { + if (true) { +} +`, [2, 9]); +test(` +while (true) { + if (true) { +} +`, [2, 13]); +test(` +do { + do { +} while(true); +`, [2, 3]); + +// try-catch-finally. +test(` +try { + if (true) { +} +`, [2, 4]); +test(` +try { +} catch (e) { + if (true) { +} +`, [3, 12]); +test(` +try { +} finally { + if (true) { +} +`, [3, 10]); + +// Object literal. +test(` +var x = { + foo: { +}; +`, [2, 8]); + +// Array literal. +test(` +var x = [ + [ +]; +`, [2, 8], "[", "]"); diff --git a/js/src/jit-test/tests/parser/redeclaration.js b/js/src/jit-test/tests/parser/redeclaration.js new file mode 100644 index 000000000..f719021ac --- /dev/null +++ b/js/src/jit-test/tests/parser/redeclaration.js @@ -0,0 +1,230 @@ +// Error message for redeclaration should show the position where the variable +// was declared. + +const npos = -1; + +function test_one(fun, filename, name, + [prevLineNumber, prevColumnNumber], + [lineNumber, columnNumber]) { + let caught = false; + try { + fun(); + } catch (e) { + assertEq(e.message.includes("redeclaration"), true); + assertEq(e.lineNumber, lineNumber); + assertEq(e.columnNumber, columnNumber); + let notes = getErrorNotes(e); + if (prevLineNumber == npos) { + assertEq(notes.length, 0); + } else { + assertEq(notes.length, 1); + let note = notes[0]; + assertEq(note.message, + `Previously declared at line ${prevLineNumber}, column ${prevColumnNumber}`); + assertEq(note.lineNumber, prevLineNumber); + assertEq(note.columnNumber, prevColumnNumber); + if (filename) + assertEq(note.fileName, filename); + } + caught = true; + } + assertEq(caught, true); +} + +function test_parse(source, ...args) { + test_one(() => { + Reflect.parse(source, { source: "foo.js" }); + }, "foo.js", ...args); +} + +function test_eval(source, ...args) { + test_one(() => { + eval(source); + }, undefined, ...args); +} + +function test(...args) { + test_parse(...args); + test_eval(...args); +} + +// let + +test(` +let a, a; +`, "a", [2, 4], [2, 7]); + +test(` +let a; +let a; +`, "a", [2, 4], [3, 4]); + +test(` +let a; +const a = 1; +`, "a", [2, 4], [3, 6]); + +test(` +let a; +var a; +`, "a", [2, 4], [3, 4]); + +test(` +let a; +function a() { +} +`, "a", [2, 4], [3, 9]); + +test(` +{ + let a; + function a() { + } +} +`, "a", [3, 6], [4, 11]); + +// const + +test(` +const a = 1, a = 2; +`, "a", [2, 6], [2, 13]); + +test(` +const a = 1; +const a = 2; +`, "a", [2, 6], [3, 6]); + +test(` +const a = 1; +let a; +`, "a", [2, 6], [3, 4]); + +test(` +const a = 1; +var a; +`, "a", [2, 6], [3, 4]); + +test(` +const a = 1; +function a() { +} +`, "a", [2, 6], [3, 9]); + +test(` +{ + const a = 1; + function a() { + } +} +`, "a", [3, 8], [4, 11]); + +// var + +test(` +var a; +let a; +`, "a", [2, 4], [3, 4]); + +test(` +var a; +const a = 1; +`, "a", [2, 4], [3, 6]); + +// function + +test(` +function a() {}; +let a; +`, "a", [2, 9], [3, 4]); + +test(` +function a() {}; +const a = 1; +`, "a", [2, 9], [3, 6]); + +// Annex B lexical function + +test(` +{ + function a() {}; + let a; +} +`, "a", [3, 11], [4, 6]); + +test(` +{ + function a() {}; + const a = 1; +} +`, "a", [3, 11], [4, 8]); + +// catch parameter + +test(` +try { +} catch (a) { + let a; +} +`, "a", [3, 9], [4, 6]); + +test(` +try { +} catch (a) { + const a = 1; +} +`, "a", [3, 9], [4, 8]); + +test(` +try { +} catch (a) { + function a() { + } +} +`, "a", [3, 9], [4, 11]); + +// parameter + +test(` +function f(a) { + let a; +} +`, "a", [2, 11], [3, 6]); + +test(` +function f(a) { + const a = 1; +} +`, "a", [2, 11], [3, 8]); + +test(` +function f([a]) { + let a; +} +`, "a", [2, 12], [3, 6]); + +test(` +function f({a}) { + let a; +} +`, "a", [2, 12], [3, 6]); + +test(` +function f(...a) { + let a; +} +`, "a", [2, 14], [3, 6]); + +test(` +function f(a=1) { + let a; +} +`, "a", [2, 11], [3, 6]); + +// eval +// We don't have position information at runtime. +// No note should be shown. + +test_eval(` +let a; +eval("var a"); +`, "a", [npos, npos], [1, 4]); diff --git a/js/src/jit-test/tests/profiler/AutoEntryMonitor-01.js b/js/src/jit-test/tests/profiler/AutoEntryMonitor-01.js index d66548680..e9dd5d526 100644 --- a/js/src/jit-test/tests/profiler/AutoEntryMonitor-01.js +++ b/js/src/jit-test/tests/profiler/AutoEntryMonitor-01.js @@ -31,7 +31,7 @@ cold_and_warm(Object.prototype.toString, { ToString: {} }, []); var toS = { toString: function myToString() { return "string"; } }; cold_and_warm(toS.toString, { ToString: toS }, [ "myToString" ]); -cold_and_warm(undefined, { ToNumber: {} }, []); +cold_and_warm(undefined, { ToNumber: 5 }, []); var vOf = { valueOf: function myValueOf() { return 42; } }; cold_and_warm(vOf.valueOf, { ToNumber: vOf }, [ "myValueOf" ]); diff --git a/js/src/jit/BaselineCompiler.cpp b/js/src/jit/BaselineCompiler.cpp index 6b64bfb44..b2f9d3b23 100644 --- a/js/src/jit/BaselineCompiler.cpp +++ b/js/src/jit/BaselineCompiler.cpp @@ -3292,6 +3292,12 @@ BaselineCompiler::emit_JSOP_CALL() } bool +BaselineCompiler::emit_JSOP_CALL_IGNORES_RV() +{ + return emitCall(); +} + +bool BaselineCompiler::emit_JSOP_CALLITER() { return emitCall(); diff --git a/js/src/jit/BaselineCompiler.h b/js/src/jit/BaselineCompiler.h index 910a52980..95e0c77ad 100644 --- a/js/src/jit/BaselineCompiler.h +++ b/js/src/jit/BaselineCompiler.h @@ -159,6 +159,7 @@ namespace jit { _(JSOP_INITALIASEDLEXICAL) \ _(JSOP_UNINITIALIZED) \ _(JSOP_CALL) \ + _(JSOP_CALL_IGNORES_RV) \ _(JSOP_CALLITER) \ _(JSOP_FUNCALL) \ _(JSOP_FUNAPPLY) \ diff --git a/js/src/jit/BaselineIC.cpp b/js/src/jit/BaselineIC.cpp index 2f20ffa4f..a001357f8 100644 --- a/js/src/jit/BaselineIC.cpp +++ b/js/src/jit/BaselineIC.cpp @@ -10,6 +10,8 @@ #include "mozilla/SizePrintfMacros.h" #include "mozilla/TemplateLib.h" +#include "jsfriendapi.h" +#include "jsfun.h" #include "jslibmath.h" #include "jstypes.h" @@ -321,7 +323,14 @@ DoTypeUpdateFallback(JSContext* cx, BaselineFrame* frame, ICUpdatedStub* stub, H MOZ_CRASH("Invalid stub"); } - return stub->addUpdateStubForValue(cx, script /* = outerScript */, obj, id, value); + if (!stub->addUpdateStubForValue(cx, script /* = outerScript */, obj, id, value)) { + // The calling JIT code assumes this function is infallible (for + // instance we may reallocate dynamic slots before calling this), + // so ignore OOMs if we failed to attach a stub. + cx->recoverFromOutOfMemory(); + } + + return true; } typedef bool (*DoTypeUpdateFallbackFn)(JSContext*, BaselineFrame*, ICUpdatedStub*, HandleValue, @@ -2253,14 +2262,20 @@ DenseOrUnboxedArraySetElemStubExists(JSContext* cx, ICStub::Kind kind, for (ICStubConstIterator iter = stub->beginChainConst(); !iter.atEnd(); iter++) { if (kind == ICStub::SetElem_DenseOrUnboxedArray && iter->isSetElem_DenseOrUnboxedArray()) { ICSetElem_DenseOrUnboxedArray* nstub = iter->toSetElem_DenseOrUnboxedArray(); - if (obj->maybeShape() == nstub->shape() && obj->getGroup(cx) == nstub->group()) + if (obj->maybeShape() == nstub->shape() && + JSObject::getGroup(cx, obj) == nstub->group()) + { return true; + } } if (kind == ICStub::SetElem_DenseOrUnboxedArrayAdd && iter->isSetElem_DenseOrUnboxedArrayAdd()) { ICSetElem_DenseOrUnboxedArrayAdd* nstub = iter->toSetElem_DenseOrUnboxedArrayAdd(); - if (obj->getGroup(cx) == nstub->group() && SetElemAddHasSameShapes(nstub, obj)) + if (JSObject::getGroup(cx, obj) == nstub->group() && + SetElemAddHasSameShapes(nstub, obj)) + { return true; + } } } return false; @@ -2446,7 +2461,7 @@ DoSetElemFallback(JSContext* cx, BaselineFrame* frame, ICSetElem_Fallback* stub_ &addingCase, &protoDepth)) { RootedShape shape(cx, obj->maybeShape()); - RootedObjectGroup group(cx, obj->getGroup(cx)); + RootedObjectGroup group(cx, JSObject::getGroup(cx, obj)); if (!group) return false; @@ -4277,7 +4292,7 @@ DoSetPropFallback(JSContext* cx, BaselineFrame* frame, ICSetProp_Fallback* stub_ if (!obj) return false; RootedShape oldShape(cx, obj->maybeShape()); - RootedObjectGroup oldGroup(cx, obj->getGroup(cx)); + RootedObjectGroup oldGroup(cx, JSObject::getGroup(cx, obj)); if (!oldGroup) return false; RootedReceiverGuard oldGuard(cx, ReceiverGuard(obj)); @@ -5175,14 +5190,13 @@ GetTemplateObjectForNative(JSContext* cx, HandleFunction target, const CallArgs& if (native == js::array_slice) { if (args.thisv().isObject()) { - JSObject* obj = &args.thisv().toObject(); + RootedObject obj(cx, &args.thisv().toObject()); if (!obj->isSingleton()) { if (obj->group()->maybePreliminaryObjects()) { *skipAttach = true; return true; } - res.set(NewFullyAllocatedArrayTryReuseGroup(cx, &args.thisv().toObject(), 0, - TenuredObject)); + res.set(NewFullyAllocatedArrayTryReuseGroup(cx, obj, 0, TenuredObject)); return !!res; } } @@ -5489,11 +5503,17 @@ TryAttachCallStub(JSContext* cx, ICCall_Fallback* stub, HandleScript script, jsb MOZ_ASSERT_IF(templateObject, !templateObject->group()->maybePreliminaryObjects()); } + bool ignoresReturnValue = false; + if (op == JSOP_CALL_IGNORES_RV && fun->isNative()) { + const JSJitInfo* jitInfo = fun->jitInfo(); + ignoresReturnValue = jitInfo && jitInfo->type() == JSJitInfo::IgnoresReturnValueNative; + } + JitSpew(JitSpew_BaselineIC, " Generating Call_Native stub (fun=%p, cons=%s, spread=%s)", fun.get(), constructing ? "yes" : "no", isSpread ? "yes" : "no"); ICCall_Native::Compiler compiler(cx, stub->fallbackMonitorStub()->firstMonitorStub(), - fun, templateObject, constructing, isSpread, - script->pcToOffset(pc)); + fun, templateObject, constructing, ignoresReturnValue, + isSpread, script->pcToOffset(pc)); ICStub* newStub = compiler.getStub(compiler.getStubSpace(script)); if (!newStub) return false; @@ -5596,12 +5616,14 @@ DoCallFallback(JSContext* cx, BaselineFrame* frame, ICCall_Fallback* stub_, uint MOZ_ASSERT(argc == GET_ARGC(pc)); bool constructing = (op == JSOP_NEW); + bool ignoresReturnValue = (op == JSOP_CALL_IGNORES_RV); // Ensure vp array is rooted - we may GC in here. size_t numValues = argc + 2 + constructing; AutoArrayRooter vpRoot(cx, numValues, vp); - CallArgs callArgs = CallArgsFromSp(argc + constructing, vp + numValues, constructing); + CallArgs callArgs = CallArgsFromSp(argc + constructing, vp + numValues, constructing, + ignoresReturnValue); RootedValue callee(cx, vp[0]); // Handle funapply with JSOP_ARGUMENTS @@ -5631,6 +5653,7 @@ DoCallFallback(JSContext* cx, BaselineFrame* frame, ICCall_Fallback* stub_, uint return false; } else { MOZ_ASSERT(op == JSOP_CALL || + op == JSOP_CALL_IGNORES_RV || op == JSOP_CALLITER || op == JSOP_FUNCALL || op == JSOP_FUNAPPLY || @@ -6681,7 +6704,12 @@ ICCall_Native::Compiler::generateStubCode(MacroAssembler& masm) // stub and use that instead of the original one. masm.callWithABI(Address(ICStubReg, ICCall_Native::offsetOfNative())); #else - masm.callWithABI(Address(callee, JSFunction::offsetOfNativeOrScript())); + if (ignoresReturnValue_) { + masm.loadPtr(Address(callee, JSFunction::offsetOfJitInfo()), callee); + masm.callWithABI(Address(callee, JSJitInfo::offsetOfIgnoresReturnValueNative())); + } else { + masm.callWithABI(Address(callee, JSFunction::offsetOfNativeOrScript())); + } #endif // Test for failure. @@ -7961,7 +7989,7 @@ ICUpdatedStub* ICSetElemDenseOrUnboxedArrayAddCompiler::getStubSpecific(ICStubSpace* space, Handle<ShapeVector> shapes) { - RootedObjectGroup group(cx, obj_->getGroup(cx)); + RootedObjectGroup group(cx, JSObject::getGroup(cx, obj_)); if (!group) return nullptr; Rooted<JitCode*> stubCode(cx, getStubCode()); @@ -8098,7 +8126,7 @@ ICSetProp_Native::ICSetProp_Native(JitCode* stubCode, ObjectGroup* group, Shape* ICSetProp_Native* ICSetProp_Native::Compiler::getStub(ICStubSpace* space) { - RootedObjectGroup group(cx, obj_->getGroup(cx)); + RootedObjectGroup group(cx, JSObject::getGroup(cx, obj_)); if (!group) return nullptr; diff --git a/js/src/jit/BaselineIC.h b/js/src/jit/BaselineIC.h index 98f0e1c59..e1ad12559 100644 --- a/js/src/jit/BaselineIC.h +++ b/js/src/jit/BaselineIC.h @@ -1940,7 +1940,7 @@ class ICSetPropNativeAddCompiler : public ICStubCompiler template <size_t ProtoChainDepth> ICUpdatedStub* getStubSpecific(ICStubSpace* space, Handle<ShapeVector> shapes) { - RootedObjectGroup newGroup(cx, obj_->getGroup(cx)); + RootedObjectGroup newGroup(cx, JSObject::getGroup(cx, obj_)); if (!newGroup) return nullptr; @@ -2277,6 +2277,7 @@ class ICSetProp_CallNative : public ICSetPropCallSetter // Call // JSOP_CALL +// JSOP_CALL_IGNORES_RV // JSOP_FUNAPPLY // JSOP_FUNCALL // JSOP_NEW @@ -2547,6 +2548,7 @@ class ICCall_Native : public ICMonitoredStub protected: ICStub* firstMonitorStub_; bool isConstructing_; + bool ignoresReturnValue_; bool isSpread_; RootedFunction callee_; RootedObject templateObject_; @@ -2556,17 +2558,19 @@ class ICCall_Native : public ICMonitoredStub virtual int32_t getKey() const { return static_cast<int32_t>(engine_) | (static_cast<int32_t>(kind) << 1) | - (static_cast<int32_t>(isConstructing_) << 17) | - (static_cast<int32_t>(isSpread_) << 18); + (static_cast<int32_t>(isSpread_) << 17) | + (static_cast<int32_t>(isConstructing_) << 18) | + (static_cast<int32_t>(ignoresReturnValue_) << 19); } public: Compiler(JSContext* cx, ICStub* firstMonitorStub, HandleFunction callee, HandleObject templateObject, - bool isConstructing, bool isSpread, uint32_t pcOffset) + bool isConstructing, bool ignoresReturnValue, bool isSpread, uint32_t pcOffset) : ICCallStubCompiler(cx, ICStub::Call_Native), firstMonitorStub_(firstMonitorStub), isConstructing_(isConstructing), + ignoresReturnValue_(ignoresReturnValue), isSpread_(isSpread), callee_(cx, callee), templateObject_(cx, templateObject), diff --git a/js/src/jit/BaselineJIT.cpp b/js/src/jit/BaselineJIT.cpp index d0e297c2d..5c21926b5 100644 --- a/js/src/jit/BaselineJIT.cpp +++ b/js/src/jit/BaselineJIT.cpp @@ -273,7 +273,7 @@ jit::BaselineCompile(JSContext* cx, JSScript* script, bool forceDebugInstrumenta MOZ_ASSERT(script->canBaselineCompile()); MOZ_ASSERT(IsBaselineEnabled(cx)); - script->ensureNonLazyCanonicalFunction(cx); + script->ensureNonLazyCanonicalFunction(); LifoAlloc alloc(TempAllocator::PreferredLifoChunkSize); TempAllocator* temp = alloc.new_<TempAllocator>(&alloc); diff --git a/js/src/jit/CodeGenerator.cpp b/js/src/jit/CodeGenerator.cpp index fcb711237..205812942 100644 --- a/js/src/jit/CodeGenerator.cpp +++ b/js/src/jit/CodeGenerator.cpp @@ -1053,7 +1053,7 @@ PrepareAndExecuteRegExp(JSContext* cx, MacroAssembler& masm, Register regexp, Re Address pairsVectorAddress(masm.getStackPointer(), pairsVectorStartOffset); - RegExpStatics* res = cx->global()->getRegExpStatics(cx); + RegExpStatics* res = GlobalObject::getRegExpStatics(cx, cx->global()); if (!res) return false; #ifdef JS_USE_LINK_REGISTER @@ -3688,7 +3688,13 @@ CodeGenerator::visitCallNative(LCallNative* call) masm.passABIArg(argContextReg); masm.passABIArg(argUintNReg); masm.passABIArg(argVpReg); - masm.callWithABI(JS_FUNC_TO_DATA_PTR(void*, target->native())); + JSNative native = target->native(); + if (call->ignoresReturnValue()) { + const JSJitInfo* jitInfo = target->jitInfo(); + if (jitInfo && jitInfo->type() == JSJitInfo::IgnoresReturnValueNative) + native = jitInfo->ignoresReturnValueMethod; + } + masm.callWithABI(JS_FUNC_TO_DATA_PTR(void*, native)); emitTracelogStopEvent(TraceLogger_Call); @@ -3845,13 +3851,15 @@ CodeGenerator::visitCallGetIntrinsicValue(LCallGetIntrinsicValue* lir) callVM(GetIntrinsicValueInfo, lir); } -typedef bool (*InvokeFunctionFn)(JSContext*, HandleObject, bool, uint32_t, Value*, MutableHandleValue); +typedef bool (*InvokeFunctionFn)(JSContext*, HandleObject, bool, bool, uint32_t, Value*, + MutableHandleValue); static const VMFunction InvokeFunctionInfo = FunctionInfo<InvokeFunctionFn>(InvokeFunction, "InvokeFunction"); void CodeGenerator::emitCallInvokeFunction(LInstruction* call, Register calleereg, - bool constructing, uint32_t argc, uint32_t unusedStack) + bool constructing, bool ignoresReturnValue, + uint32_t argc, uint32_t unusedStack) { // Nestle %esp up to the argument vector. // Each path must account for framePushed_ separately, for callVM to be valid. @@ -3859,6 +3867,7 @@ CodeGenerator::emitCallInvokeFunction(LInstruction* call, Register calleereg, pushArg(masm.getStackPointer()); // argv. pushArg(Imm32(argc)); // argc. + pushArg(Imm32(ignoresReturnValue)); pushArg(Imm32(constructing)); // constructing. pushArg(calleereg); // JSFunction*. @@ -3945,8 +3954,8 @@ CodeGenerator::visitCallGeneric(LCallGeneric* call) // Handle uncompiled or native functions. masm.bind(&invoke); - emitCallInvokeFunction(call, calleereg, call->isConstructing(), call->numActualArgs(), - unusedStack); + emitCallInvokeFunction(call, calleereg, call->isConstructing(), call->ignoresReturnValue(), + call->numActualArgs(), unusedStack); masm.bind(&end); @@ -4001,7 +4010,8 @@ CodeGenerator::visitCallKnown(LCallKnown* call) masm.checkStackAlignment(); if (target->isClassConstructor() && !call->isConstructing()) { - emitCallInvokeFunction(call, calleereg, call->isConstructing(), call->numActualArgs(), unusedStack); + emitCallInvokeFunction(call, calleereg, call->isConstructing(), call->ignoresReturnValue(), + call->numActualArgs(), unusedStack); return; } @@ -4045,7 +4055,8 @@ CodeGenerator::visitCallKnown(LCallKnown* call) if (call->isConstructing() && target->nargs() > call->numActualArgs()) emitCallInvokeFunctionShuffleNewTarget(call, calleereg, target->nargs(), unusedStack); else - emitCallInvokeFunction(call, calleereg, call->isConstructing(), call->numActualArgs(), unusedStack); + emitCallInvokeFunction(call, calleereg, call->isConstructing(), call->ignoresReturnValue(), + call->numActualArgs(), unusedStack); masm.bind(&end); @@ -4072,6 +4083,7 @@ CodeGenerator::emitCallInvokeFunction(T* apply, Register extraStackSize) pushArg(objreg); // argv. pushArg(ToRegister(apply->getArgc())); // argc. + pushArg(Imm32(false)); // ignoresReturnValue. pushArg(Imm32(false)); // isConstrucing. pushArg(ToRegister(apply->getFunction())); // JSFunction*. @@ -4428,19 +4440,6 @@ CodeGenerator::visitApplyArrayGeneric(LApplyArrayGeneric* apply) emitApplyGeneric(apply); } -typedef bool (*ArraySpliceDenseFn)(JSContext*, HandleObject, uint32_t, uint32_t); -static const VMFunction ArraySpliceDenseInfo = - FunctionInfo<ArraySpliceDenseFn>(ArraySpliceDense, "ArraySpliceDense"); - -void -CodeGenerator::visitArraySplice(LArraySplice* lir) -{ - pushArg(ToRegister(lir->getDeleteCount())); - pushArg(ToRegister(lir->getStart())); - pushArg(ToRegister(lir->getObject())); - callVM(ArraySpliceDenseInfo, lir); -} - void CodeGenerator::visitBail(LBail* lir) { diff --git a/js/src/jit/CodeGenerator.h b/js/src/jit/CodeGenerator.h index b5f170d84..12f1238ef 100644 --- a/js/src/jit/CodeGenerator.h +++ b/js/src/jit/CodeGenerator.h @@ -165,8 +165,8 @@ class CodeGenerator final : public CodeGeneratorSpecific void visitOutOfLineCallPostWriteElementBarrier(OutOfLineCallPostWriteElementBarrier* ool); void visitCallNative(LCallNative* call); void emitCallInvokeFunction(LInstruction* call, Register callereg, - bool isConstructing, uint32_t argc, - uint32_t unusedStack); + bool isConstructing, bool ignoresReturnValue, + uint32_t argc, uint32_t unusedStack); void visitCallGeneric(LCallGeneric* call); void emitCallInvokeFunctionShuffleNewTarget(LCallKnown *call, Register calleeReg, @@ -251,7 +251,6 @@ class CodeGenerator final : public CodeGeneratorSpecific void emitSetPropertyPolymorphic(LInstruction* lir, Register obj, Register scratch, const ConstantOrRegister& value); void visitSetPropertyPolymorphicV(LSetPropertyPolymorphicV* ins); - void visitArraySplice(LArraySplice* splice); void visitSetPropertyPolymorphicT(LSetPropertyPolymorphicT* ins); void visitAbsI(LAbsI* lir); void visitAtan2D(LAtan2D* lir); diff --git a/js/src/jit/InlinableNatives.h b/js/src/jit/InlinableNatives.h index 18535389a..1d0506f74 100644 --- a/js/src/jit/InlinableNatives.h +++ b/js/src/jit/InlinableNatives.h @@ -15,7 +15,6 @@ _(ArrayShift) \ _(ArrayPush) \ _(ArraySlice) \ - _(ArraySplice) \ \ _(AtomicsCompareExchange) \ _(AtomicsExchange) \ diff --git a/js/src/jit/Ion.cpp b/js/src/jit/Ion.cpp index c61b414e0..b8a2d2fba 100644 --- a/js/src/jit/Ion.cpp +++ b/js/src/jit/Ion.cpp @@ -2153,7 +2153,7 @@ IonCompile(JSContext* cx, JSScript* script, // Make sure the script's canonical function isn't lazy. We can't de-lazify // it in a helper thread. - script->ensureNonLazyCanonicalFunction(cx); + script->ensureNonLazyCanonicalFunction(); TrackPropertiesForSingletonScopes(cx, script, baselineFrame); diff --git a/js/src/jit/IonAnalysis.cpp b/js/src/jit/IonAnalysis.cpp index 41c71c9c3..5fc624fb1 100644 --- a/js/src/jit/IonAnalysis.cpp +++ b/js/src/jit/IonAnalysis.cpp @@ -4055,7 +4055,7 @@ AnalyzePoppedThis(JSContext* cx, ObjectGroup* group, // Add the property to the object, being careful not to update type information. DebugOnly<unsigned> slotSpan = baseobj->slotSpan(); MOZ_ASSERT(!baseobj->containsPure(id)); - if (!baseobj->addDataProperty(cx, id, baseobj->slotSpan(), JSPROP_ENUMERATE)) + if (!NativeObject::addDataProperty(cx, baseobj, id, baseobj->slotSpan(), JSPROP_ENUMERATE)) return false; MOZ_ASSERT(baseobj->slotSpan() != slotSpan); MOZ_ASSERT(!baseobj->inDictionaryMode()); @@ -4132,7 +4132,7 @@ CmpInstructions(const void* a, const void* b) } bool -jit::AnalyzeNewScriptDefiniteProperties(JSContext* cx, JSFunction* fun, +jit::AnalyzeNewScriptDefiniteProperties(JSContext* cx, HandleFunction fun, ObjectGroup* group, HandlePlainObject baseobj, Vector<TypeNewScript::Initializer>* initializerList) { @@ -4142,7 +4142,7 @@ jit::AnalyzeNewScriptDefiniteProperties(JSContext* cx, JSFunction* fun, // which will definitely be added to the created object before it has a // chance to escape and be accessed elsewhere. - RootedScript script(cx, fun->getOrCreateScript(cx)); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, fun)); if (!script) return false; diff --git a/js/src/jit/IonAnalysis.h b/js/src/jit/IonAnalysis.h index 1ce8edc80..efd31415b 100644 --- a/js/src/jit/IonAnalysis.h +++ b/js/src/jit/IonAnalysis.h @@ -196,7 +196,7 @@ MCompare* ConvertLinearInequality(TempAllocator& alloc, MBasicBlock* block, const LinearSum& sum); MOZ_MUST_USE bool -AnalyzeNewScriptDefiniteProperties(JSContext* cx, JSFunction* fun, +AnalyzeNewScriptDefiniteProperties(JSContext* cx, HandleFunction fun, ObjectGroup* group, HandlePlainObject baseobj, Vector<TypeNewScript::Initializer>* initializerList); diff --git a/js/src/jit/IonBuilder.cpp b/js/src/jit/IonBuilder.cpp index a54a58add..2d053de5a 100644 --- a/js/src/jit/IonBuilder.cpp +++ b/js/src/jit/IonBuilder.cpp @@ -466,7 +466,8 @@ IonBuilder::canInlineTarget(JSFunction* target, CallInfo& callInfo) // Allow constructing lazy scripts when performing the definite properties // analysis, as baseline has not been used to warm the caller up yet. if (target->isInterpreted() && info().analysisMode() == Analysis_DefiniteProperties) { - RootedScript script(analysisContext, target->getOrCreateScript(analysisContext)); + RootedFunction fun(analysisContext, target); + RootedScript script(analysisContext, JSFunction::getOrCreateScript(analysisContext, fun)); if (!script) return InliningDecision_Error; @@ -1938,6 +1939,7 @@ IonBuilder::inspectOpcode(JSOp op) return jsop_funapply(GET_ARGC(pc)); case JSOP_CALL: + case JSOP_CALL_IGNORES_RV: case JSOP_CALLITER: case JSOP_NEW: case JSOP_SUPERCALL: @@ -1945,7 +1947,8 @@ IonBuilder::inspectOpcode(JSOp op) if (!outermostBuilder()->iterators_.append(current->peek(-1))) return false; } - return jsop_call(GET_ARGC(pc), (JSOp)*pc == JSOP_NEW || (JSOp)*pc == JSOP_SUPERCALL); + return jsop_call(GET_ARGC(pc), (JSOp)*pc == JSOP_NEW || (JSOp)*pc == JSOP_SUPERCALL, + (JSOp)*pc == JSOP_CALL_IGNORES_RV); case JSOP_EVAL: case JSOP_STRICTEVAL: @@ -5873,7 +5876,7 @@ IonBuilder::inlineGenericFallback(JSFunction* target, CallInfo& callInfo, MBasic return false; // Create a new CallInfo to track modified state within this block. - CallInfo fallbackInfo(alloc(), callInfo.constructing()); + CallInfo fallbackInfo(alloc(), callInfo.constructing(), callInfo.ignoresReturnValue()); if (!fallbackInfo.init(callInfo)) return false; fallbackInfo.popFormals(fallbackBlock); @@ -5912,7 +5915,7 @@ IonBuilder::inlineObjectGroupFallback(CallInfo& callInfo, MBasicBlock* dispatchB MOZ_ASSERT(cache->idempotent()); // Create a new CallInfo to track modified state within the fallback path. - CallInfo fallbackInfo(alloc(), callInfo.constructing()); + CallInfo fallbackInfo(alloc(), callInfo.constructing(), callInfo.ignoresReturnValue()); if (!fallbackInfo.init(callInfo)) return false; @@ -6088,7 +6091,7 @@ IonBuilder::inlineCalls(CallInfo& callInfo, const ObjectVector& targets, BoolVec inlineBlock->rewriteSlot(funIndex, funcDef); // Create a new CallInfo to track modified state within the inline block. - CallInfo inlineInfo(alloc(), callInfo.constructing()); + CallInfo inlineInfo(alloc(), callInfo.constructing(), callInfo.ignoresReturnValue()); if (!inlineInfo.init(callInfo)) return false; inlineInfo.popFormals(inlineBlock); @@ -6537,7 +6540,8 @@ IonBuilder::jsop_funcall(uint32_t argc) TemporaryTypeSet* calleeTypes = current->peek(calleeDepth)->resultTypeSet(); JSFunction* native = getSingleCallTarget(calleeTypes); if (!native || !native->isNative() || native->native() != &fun_call) { - CallInfo callInfo(alloc(), false); + CallInfo callInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); if (!callInfo.init(current, argc)) return false; return makeCall(native, callInfo); @@ -6562,7 +6566,8 @@ IonBuilder::jsop_funcall(uint32_t argc) argc -= 1; } - CallInfo callInfo(alloc(), false); + CallInfo callInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); if (!callInfo.init(current, argc)) return false; @@ -6599,7 +6604,8 @@ IonBuilder::jsop_funapply(uint32_t argc) TemporaryTypeSet* calleeTypes = current->peek(calleeDepth)->resultTypeSet(); JSFunction* native = getSingleCallTarget(calleeTypes); if (argc != 2 || info().analysisMode() == Analysis_ArgumentsUsage) { - CallInfo callInfo(alloc(), false); + CallInfo callInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); if (!callInfo.init(current, argc)) return false; return makeCall(native, callInfo); @@ -6628,7 +6634,8 @@ IonBuilder::jsop_funapply(uint32_t argc) return jsop_funapplyarray(argc); } - CallInfo callInfo(alloc(), false); + CallInfo callInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); if (!callInfo.init(current, argc)) return false; return makeCall(native, callInfo); @@ -6737,7 +6744,8 @@ IonBuilder::jsop_funapplyarguments(uint32_t argc) // can inline the apply() target and don't care about the actual arguments // that were passed in. - CallInfo callInfo(alloc(), false); + CallInfo callInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); // Vp MDefinition* vp = current->pop(); @@ -6783,7 +6791,7 @@ IonBuilder::jsop_funapplyarguments(uint32_t argc) } bool -IonBuilder::jsop_call(uint32_t argc, bool constructing) +IonBuilder::jsop_call(uint32_t argc, bool constructing, bool ignoresReturnValue) { startTrackingOptimizations(); @@ -6809,7 +6817,7 @@ IonBuilder::jsop_call(uint32_t argc, bool constructing) if (calleeTypes && !getPolyCallTargets(calleeTypes, constructing, targets, 4)) return false; - CallInfo callInfo(alloc(), constructing); + CallInfo callInfo(alloc(), constructing, ignoresReturnValue); if (!callInfo.init(current, argc)) return false; @@ -6945,7 +6953,8 @@ IonBuilder::makeCallHelper(JSFunction* target, CallInfo& callInfo) } MCall* call = MCall::New(alloc(), target, targetArgs + 1 + callInfo.constructing(), - callInfo.argc(), callInfo.constructing(), isDOMCall); + callInfo.argc(), callInfo.constructing(), + callInfo.ignoresReturnValue(), isDOMCall); if (!call) return nullptr; @@ -7046,7 +7055,7 @@ IonBuilder::jsop_eval(uint32_t argc) // Emit a normal call if the eval has never executed. This keeps us from // disabling compilation for the script when testing with --ion-eager. if (calleeTypes && calleeTypes->empty()) - return jsop_call(argc, /* constructing = */ false); + return jsop_call(argc, /* constructing = */ false, false); JSFunction* singleton = getSingleCallTarget(calleeTypes); if (!singleton) @@ -7062,7 +7071,8 @@ IonBuilder::jsop_eval(uint32_t argc) if (info().funMaybeLazy()->isArrow()) return abort("Direct eval from arrow function"); - CallInfo callInfo(alloc(), /* constructing = */ false); + CallInfo callInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); if (!callInfo.init(current, argc)) return false; callInfo.setImplicitlyUsedUnchecked(); @@ -7101,7 +7111,8 @@ IonBuilder::jsop_eval(uint32_t argc) current->push(dynamicName); current->push(constant(UndefinedValue())); // thisv - CallInfo evalCallInfo(alloc(), /* constructing = */ false); + CallInfo evalCallInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); if (!evalCallInfo.init(current, /* argc = */ 0)) return false; @@ -7118,7 +7129,7 @@ IonBuilder::jsop_eval(uint32_t argc) return resumeAfter(ins) && pushTypeBarrier(ins, types, BarrierKind::TypeSet); } - return jsop_call(argc, /* constructing = */ false); + return jsop_call(argc, /* constructing = */ false, false); } bool @@ -12000,7 +12011,8 @@ IonBuilder::getPropTryCommonGetter(bool* emitted, MDefinition* obj, PropertyName current->push(obj); - CallInfo callInfo(alloc(), false); + CallInfo callInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); if (!callInfo.init(current, 0)) return false; @@ -12495,7 +12507,8 @@ IonBuilder::setPropTryCommonSetter(bool* emitted, MDefinition* obj, // Call the setter. Note that we have to push the original value, not // the setter's return value. - CallInfo callInfo(alloc(), false); + CallInfo callInfo(alloc(), /* constructing = */ false, + /* ignoresReturnValue = */ BytecodeIsPopped(pc)); if (!callInfo.init(current, 1)) return false; diff --git a/js/src/jit/IonBuilder.h b/js/src/jit/IonBuilder.h index dd40b4bd6..1f763a4f2 100644 --- a/js/src/jit/IonBuilder.h +++ b/js/src/jit/IonBuilder.h @@ -699,6 +699,7 @@ class IonBuilder MOZ_MUST_USE bool jsop_funapplyarguments(uint32_t argc); MOZ_MUST_USE bool jsop_funapplyarray(uint32_t argc); MOZ_MUST_USE bool jsop_call(uint32_t argc, bool constructing); + MOZ_MUST_USE bool jsop_call(uint32_t argc, bool constructing, bool ignoresReturnValue); MOZ_MUST_USE bool jsop_eval(uint32_t argc); MOZ_MUST_USE bool jsop_ifeq(JSOp op); MOZ_MUST_USE bool jsop_try(); @@ -820,7 +821,6 @@ class IonBuilder InliningStatus inlineArrayPush(CallInfo& callInfo); InliningStatus inlineArraySlice(CallInfo& callInfo); InliningStatus inlineArrayJoin(CallInfo& callInfo); - InliningStatus inlineArraySplice(CallInfo& callInfo); // Math natives. InliningStatus inlineMathAbs(CallInfo& callInfo); @@ -1352,16 +1352,21 @@ class CallInfo MDefinition* newTargetArg_; MDefinitionVector args_; - bool constructing_; - bool setter_; + bool constructing_:1; + + // True if the caller does not use the return value. + bool ignoresReturnValue_:1; + + bool setter_:1; public: - CallInfo(TempAllocator& alloc, bool constructing) + CallInfo(TempAllocator& alloc, bool constructing, bool ignoresReturnValue) : fun_(nullptr), thisArg_(nullptr), newTargetArg_(nullptr), args_(alloc), constructing_(constructing), + ignoresReturnValue_(ignoresReturnValue), setter_(false) { } @@ -1370,6 +1375,7 @@ class CallInfo fun_ = callInfo.fun(); thisArg_ = callInfo.thisArg(); + ignoresReturnValue_ = callInfo.ignoresReturnValue(); if (constructing()) newTargetArg_ = callInfo.getNewTarget(); @@ -1466,6 +1472,10 @@ class CallInfo return constructing_; } + bool ignoresReturnValue() const { + return ignoresReturnValue_; + } + void setNewTarget(MDefinition* newTarget) { MOZ_ASSERT(constructing()); newTargetArg_ = newTarget; diff --git a/js/src/jit/IonCaches.cpp b/js/src/jit/IonCaches.cpp index 9901bdd07..48e0792bb 100644 --- a/js/src/jit/IonCaches.cpp +++ b/js/src/jit/IonCaches.cpp @@ -3316,7 +3316,7 @@ SetPropertyIC::update(JSContext* cx, HandleScript outerScript, size_t cacheIndex RootedObjectGroup oldGroup(cx); RootedShape oldShape(cx); if (cache.canAttachStub()) { - oldGroup = obj->getGroup(cx); + oldGroup = JSObject::getGroup(cx, obj); if (!oldGroup) return false; diff --git a/js/src/jit/Lowering.cpp b/js/src/jit/Lowering.cpp index 68417138b..22f1d5f70 100644 --- a/js/src/jit/Lowering.cpp +++ b/js/src/jit/Lowering.cpp @@ -657,16 +657,6 @@ LIRGenerator::visitAssertRecoveredOnBailout(MAssertRecoveredOnBailout* assertion } void -LIRGenerator::visitArraySplice(MArraySplice* ins) -{ - LArraySplice* lir = new(alloc()) LArraySplice(useRegisterAtStart(ins->object()), - useRegisterAtStart(ins->start()), - useRegisterAtStart(ins->deleteCount())); - add(lir, ins); - assignSafepoint(lir, ins); -} - -void LIRGenerator::visitGetDynamicName(MGetDynamicName* ins) { MDefinition* envChain = ins->getEnvironmentChain(); diff --git a/js/src/jit/Lowering.h b/js/src/jit/Lowering.h index b096bb143..9342ef471 100644 --- a/js/src/jit/Lowering.h +++ b/js/src/jit/Lowering.h @@ -107,7 +107,6 @@ class LIRGenerator : public LIRGeneratorSpecific void visitCall(MCall* call); void visitApplyArgs(MApplyArgs* apply); void visitApplyArray(MApplyArray* apply); - void visitArraySplice(MArraySplice* splice); void visitBail(MBail* bail); void visitUnreachable(MUnreachable* unreachable); void visitEncodeSnapshot(MEncodeSnapshot* ins); diff --git a/js/src/jit/MCallOptimize.cpp b/js/src/jit/MCallOptimize.cpp index 359f04639..5eee30e49 100644 --- a/js/src/jit/MCallOptimize.cpp +++ b/js/src/jit/MCallOptimize.cpp @@ -85,8 +85,6 @@ IonBuilder::inlineNativeCall(CallInfo& callInfo, JSFunction* target) return inlineArrayPush(callInfo); case InlinableNative::ArraySlice: return inlineArraySlice(callInfo); - case InlinableNative::ArraySplice: - return inlineArraySplice(callInfo); // Atomic natives. case InlinableNative::AtomicsCompareExchange: @@ -654,46 +652,6 @@ IonBuilder::inlineArrayPopShift(CallInfo& callInfo, MArrayPopShift::Mode mode) } IonBuilder::InliningStatus -IonBuilder::inlineArraySplice(CallInfo& callInfo) -{ - if (callInfo.argc() != 2 || callInfo.constructing()) { - trackOptimizationOutcome(TrackedOutcome::CantInlineNativeBadForm); - return InliningStatus_NotInlined; - } - - // Ensure |this|, argument and result are objects. - if (getInlineReturnType() != MIRType::Object) - return InliningStatus_NotInlined; - if (callInfo.thisArg()->type() != MIRType::Object) - return InliningStatus_NotInlined; - if (callInfo.getArg(0)->type() != MIRType::Int32) - return InliningStatus_NotInlined; - if (callInfo.getArg(1)->type() != MIRType::Int32) - return InliningStatus_NotInlined; - - callInfo.setImplicitlyUsedUnchecked(); - - // Specialize arr.splice(start, deleteCount) with unused return value and - // avoid creating the result array in this case. - if (!BytecodeIsPopped(pc)) { - trackOptimizationOutcome(TrackedOutcome::CantInlineGeneric); - return InliningStatus_NotInlined; - } - - MArraySplice* ins = MArraySplice::New(alloc(), - callInfo.thisArg(), - callInfo.getArg(0), - callInfo.getArg(1)); - - current->add(ins); - pushConstant(UndefinedValue()); - - if (!resumeAfter(ins)) - return InliningStatus_Error; - return InliningStatus_Inlined; -} - -IonBuilder::InliningStatus IonBuilder::inlineArrayJoin(CallInfo& callInfo) { if (callInfo.argc() != 1 || callInfo.constructing()) { diff --git a/js/src/jit/MIR.cpp b/js/src/jit/MIR.cpp index fa9cc3019..10671cfda 100644 --- a/js/src/jit/MIR.cpp +++ b/js/src/jit/MIR.cpp @@ -1970,7 +1970,7 @@ WrappedFunction::WrappedFunction(JSFunction* fun) MCall* MCall::New(TempAllocator& alloc, JSFunction* target, size_t maxArgc, size_t numActualArgs, - bool construct, bool isDOMCall) + bool construct, bool ignoresReturnValue, bool isDOMCall) { WrappedFunction* wrappedTarget = target ? new(alloc) WrappedFunction(target) : nullptr; MOZ_ASSERT(maxArgc >= numActualArgs); @@ -1979,7 +1979,7 @@ MCall::New(TempAllocator& alloc, JSFunction* target, size_t maxArgc, size_t numA MOZ_ASSERT(!construct); ins = new(alloc) MCallDOMNative(wrappedTarget, numActualArgs); } else { - ins = new(alloc) MCall(wrappedTarget, numActualArgs, construct); + ins = new(alloc) MCall(wrappedTarget, numActualArgs, construct, ignoresReturnValue); } if (!ins->init(alloc, maxArgc + NumNonArgumentOperands)) return nullptr; diff --git a/js/src/jit/MIR.h b/js/src/jit/MIR.h index 9076339f1..6c376d528 100644 --- a/js/src/jit/MIR.h +++ b/js/src/jit/MIR.h @@ -4043,14 +4043,18 @@ class MCall uint32_t numActualArgs_; // True if the call is for JSOP_NEW. - bool construct_; + bool construct_:1; - bool needsArgCheck_; + // True if the caller does not use the return value. + bool ignoresReturnValue_:1; - MCall(WrappedFunction* target, uint32_t numActualArgs, bool construct) + bool needsArgCheck_:1; + + MCall(WrappedFunction* target, uint32_t numActualArgs, bool construct, bool ignoresReturnValue) : target_(target), numActualArgs_(numActualArgs), construct_(construct), + ignoresReturnValue_(ignoresReturnValue), needsArgCheck_(true) { setResultType(MIRType::Value); @@ -4059,7 +4063,7 @@ class MCall public: INSTRUCTION_HEADER(Call) static MCall* New(TempAllocator& alloc, JSFunction* target, size_t maxArgc, size_t numActualArgs, - bool construct, bool isDOMCall); + bool construct, bool ignoresReturnValue, bool isDOMCall); void initFunction(MDefinition* func) { initOperand(FunctionOperandIndex, func); @@ -4104,6 +4108,10 @@ class MCall return construct_; } + bool ignoresReturnValue() const { + return ignoresReturnValue_; + } + // The number of stack arguments is the max between the number of formal // arguments and the number of actual arguments. The number of stack // argument includes the |undefined| padding added in case of underflow. @@ -4147,7 +4155,7 @@ class MCallDOMNative : public MCall // virtual things from MCall. protected: MCallDOMNative(WrappedFunction* target, uint32_t numActualArgs) - : MCall(target, numActualArgs, false) + : MCall(target, numActualArgs, false, false) { MOZ_ASSERT(getJitInfo()->type() != JSJitInfo::InlinableNative); @@ -4162,7 +4170,8 @@ class MCallDOMNative : public MCall } friend MCall* MCall::New(TempAllocator& alloc, JSFunction* target, size_t maxArgc, - size_t numActualArgs, bool construct, bool isDOMCall); + size_t numActualArgs, bool construct, bool ignoresReturnValue, + bool isDOMCall); const JSJitInfo* getJitInfo() const; public: @@ -4177,27 +4186,6 @@ class MCallDOMNative : public MCall virtual void computeMovable() override; }; -// arr.splice(start, deleteCount) with unused return value. -class MArraySplice - : public MTernaryInstruction, - public Mix3Policy<ObjectPolicy<0>, IntPolicy<1>, IntPolicy<2> >::Data -{ - private: - - MArraySplice(MDefinition* object, MDefinition* start, MDefinition* deleteCount) - : MTernaryInstruction(object, start, deleteCount) - { } - - public: - INSTRUCTION_HEADER(ArraySplice) - TRIVIAL_NEW_WRAPPERS - NAMED_OPERANDS((0, object), (1, start), (2, deleteCount)) - - bool possiblyCalls() const override { - return true; - } -}; - // fun.apply(self, arguments) class MApplyArgs : public MAryInstruction<3>, diff --git a/js/src/jit/MOpcodes.h b/js/src/jit/MOpcodes.h index ab37604b4..9e460a2ba 100644 --- a/js/src/jit/MOpcodes.h +++ b/js/src/jit/MOpcodes.h @@ -69,7 +69,6 @@ namespace jit { _(Call) \ _(ApplyArgs) \ _(ApplyArray) \ - _(ArraySplice) \ _(Bail) \ _(Unreachable) \ _(EncodeSnapshot) \ diff --git a/js/src/jit/VMFunctions.cpp b/js/src/jit/VMFunctions.cpp index 402d910b9..1ff7adfd1 100644 --- a/js/src/jit/VMFunctions.cpp +++ b/js/src/jit/VMFunctions.cpp @@ -54,8 +54,8 @@ VMFunction::addToFunctions() } bool -InvokeFunction(JSContext* cx, HandleObject obj, bool constructing, uint32_t argc, Value* argv, - MutableHandleValue rval) +InvokeFunction(JSContext* cx, HandleObject obj, bool constructing, bool ignoresReturnValue, + uint32_t argc, Value* argv, MutableHandleValue rval) { TraceLoggerThread* logger = TraceLoggerForMainThread(cx->runtime()); TraceLogStartEvent(logger, TraceLogger_Call); @@ -104,7 +104,7 @@ InvokeFunction(JSContext* cx, HandleObject obj, bool constructing, uint32_t argc return InternalConstructWithProvidedThis(cx, fval, thisv, cargs, newTarget, rval); } - InvokeArgs args(cx); + InvokeArgsMaybeIgnoresReturnValue args(cx, ignoresReturnValue); if (!args.init(cx, argc)) return false; @@ -120,7 +120,7 @@ InvokeFunctionShuffleNewTarget(JSContext* cx, HandleObject obj, uint32_t numActu { MOZ_ASSERT(numFormalArgs > numActualArgs); argv[1 + numActualArgs] = argv[1 + numFormalArgs]; - return InvokeFunction(cx, obj, true, numActualArgs, argv, rval); + return InvokeFunction(cx, obj, true, false, numActualArgs, argv, rval); } bool @@ -304,18 +304,6 @@ template bool StringsEqual<true>(JSContext* cx, HandleString lhs, HandleString r template bool StringsEqual<false>(JSContext* cx, HandleString lhs, HandleString rhs, bool* res); bool -ArraySpliceDense(JSContext* cx, HandleObject obj, uint32_t start, uint32_t deleteCount) -{ - JS::AutoValueArray<4> argv(cx); - argv[0].setUndefined(); - argv[1].setObject(*obj); - argv[2].set(Int32Value(start)); - argv[3].set(Int32Value(deleteCount)); - - return js::array_splice_impl(cx, 2, argv.begin(), false); -} - -bool ArrayPopDense(JSContext* cx, HandleObject obj, MutableHandleValue rval) { MOZ_ASSERT(obj->is<ArrayObject>()); @@ -555,7 +543,7 @@ CreateThis(JSContext* cx, HandleObject callee, HandleObject newTarget, MutableHa if (callee->is<JSFunction>()) { RootedFunction fun(cx, &callee->as<JSFunction>()); if (fun->isInterpreted() && fun->isConstructor()) { - JSScript* script = fun->getOrCreateScript(cx); + JSScript* script = JSFunction::getOrCreateScript(cx, fun); if (!script || !script->ensureHasTypes(cx)) return false; if (fun->isBoundFunction() || script->isDerivedClassConstructor()) { diff --git a/js/src/jit/VMFunctions.h b/js/src/jit/VMFunctions.h index 9a2edd0f3..94f741397 100644 --- a/js/src/jit/VMFunctions.h +++ b/js/src/jit/VMFunctions.h @@ -584,8 +584,8 @@ class AutoDetectInvalidation }; MOZ_MUST_USE bool -InvokeFunction(JSContext* cx, HandleObject obj0, bool constructing, uint32_t argc, Value* argv, - MutableHandleValue rval); +InvokeFunction(JSContext* cx, HandleObject obj0, bool constructing, bool ignoresReturnValue, + uint32_t argc, Value* argv, MutableHandleValue rval); MOZ_MUST_USE bool InvokeFunctionShuffleNewTarget(JSContext* cx, HandleObject obj, uint32_t numActualArgs, uint32_t numFormalArgs, Value* argv, MutableHandleValue rval); @@ -739,9 +739,6 @@ JSObject* CreateDerivedTypedObj(JSContext* cx, HandleObject descr, HandleObject owner, int32_t offset); MOZ_MUST_USE bool -ArraySpliceDense(JSContext* cx, HandleObject obj, uint32_t start, uint32_t deleteCount); - -MOZ_MUST_USE bool Recompile(JSContext* cx); MOZ_MUST_USE bool ForcedRecompile(JSContext* cx); diff --git a/js/src/jit/arm64/Architecture-arm64.h b/js/src/jit/arm64/Architecture-arm64.h index e74340f13..bee212db7 100644 --- a/js/src/jit/arm64/Architecture-arm64.h +++ b/js/src/jit/arm64/Architecture-arm64.h @@ -299,10 +299,12 @@ static const uint32_t ION_FRAME_SLACK_SIZE = 24; static const uint32_t ShadowStackSpace = 0; -// TODO: -// This constant needs to be updated to account for whatever near/far branching -// strategy is used by ARM64. -static const uint32_t JumpImmediateRange = UINT32_MAX; +// When our only strategy for far jumps is to encode the offset directly, and +// not insert any jump islands during assembly for even further jumps, then the +// architecture restricts us to -2^27 .. 2^27-4, to fit into a signed 28-bit +// value. We further reduce this range to allow the far-jump inserting code to +// have some breathing room. +static const uint32_t JumpImmediateRange = ((1 << 27) - (20 * 1024 * 1024)); static const uint32_t ABIStackAlignment = 16; static const uint32_t CodeAlignment = 16; diff --git a/js/src/jit/shared/LIR-shared.h b/js/src/jit/shared/LIR-shared.h index ffa4d8367..ecf02816e 100644 --- a/js/src/jit/shared/LIR-shared.h +++ b/js/src/jit/shared/LIR-shared.h @@ -1898,6 +1898,9 @@ class LJSCallInstructionHelper : public LCallInstructionHelper<Defs, Operands, T bool isConstructing() const { return mir()->isConstructing(); } + bool ignoresReturnValue() const { + return mir()->ignoresReturnValue(); + } }; // Generates a polymorphic callsite, wherein the function being called is @@ -2218,34 +2221,6 @@ class LApplyArrayGeneric : public LCallInstructionHelper<BOX_PIECES, BOX_PIECES } }; -class LArraySplice : public LCallInstructionHelper<0, 3, 0> -{ - public: - LIR_HEADER(ArraySplice) - - LArraySplice(const LAllocation& object, const LAllocation& start, - const LAllocation& deleteCount) - { - setOperand(0, object); - setOperand(1, start); - setOperand(2, deleteCount); - } - - MArraySplice* mir() const { - return mir_->toArraySplice(); - } - - const LAllocation* getObject() { - return getOperand(0); - } - const LAllocation* getStart() { - return getOperand(1); - } - const LAllocation* getDeleteCount() { - return getOperand(2); - } -}; - class LGetDynamicName : public LCallInstructionHelper<BOX_PIECES, 2, 3> { public: diff --git a/js/src/jit/shared/LOpcodes-shared.h b/js/src/jit/shared/LOpcodes-shared.h index deae92839..e260d7e94 100644 --- a/js/src/jit/shared/LOpcodes-shared.h +++ b/js/src/jit/shared/LOpcodes-shared.h @@ -69,7 +69,6 @@ _(NewArrayDynamicLength) \ _(NewTypedArray) \ _(NewTypedArrayDynamicLength) \ - _(ArraySplice) \ _(NewObject) \ _(NewTypedObject) \ _(NewNamedLambdaObject) \ diff --git a/js/src/js.msg b/js/src/js.msg index 4ded69a25..f57b36a90 100644 --- a/js/src/js.msg +++ b/js/src/js.msg @@ -63,6 +63,7 @@ MSG_DEF(JSMSG_SPREAD_TOO_LARGE, 0, JSEXN_RANGEERR, "array too large due t MSG_DEF(JSMSG_BAD_WEAKMAP_KEY, 0, JSEXN_TYPEERR, "cannot use the given object as a weak map key") MSG_DEF(JSMSG_BAD_GETTER_OR_SETTER, 1, JSEXN_TYPEERR, "invalid {0} usage") MSG_DEF(JSMSG_BAD_ARRAY_LENGTH, 0, JSEXN_RANGEERR, "invalid array length") +MSG_DEF(JSMSG_REDECLARED_PREV, 2, JSEXN_NOTE, "Previously declared at line {0}, column {1}") MSG_DEF(JSMSG_REDECLARED_VAR, 2, JSEXN_SYNTAXERR, "redeclaration of {0} {1}") MSG_DEF(JSMSG_UNDECLARED_VAR, 1, JSEXN_REFERENCEERR, "assignment to undeclared variable {0}") MSG_DEF(JSMSG_GETTER_ONLY, 1, JSEXN_TYPEERR, "setting getter-only property {0}") @@ -186,6 +187,7 @@ MSG_DEF(JSMSG_AS_AFTER_IMPORT_STAR, 0, JSEXN_SYNTAXERR, "missing keyword 'as' MSG_DEF(JSMSG_AS_AFTER_RESERVED_WORD, 1, JSEXN_SYNTAXERR, "missing keyword 'as' after reserved word '{0}'") MSG_DEF(JSMSG_ASYNC_GENERATOR, 0, JSEXN_SYNTAXERR, "generator function or method can't be async") MSG_DEF(JSMSG_AWAIT_IN_DEFAULT, 0, JSEXN_SYNTAXERR, "await can't be used in default expression") +MSG_DEF(JSMSG_AWAIT_OUTSIDE_ASYNC, 0, JSEXN_SYNTAXERR, "await is only valid in async functions") MSG_DEF(JSMSG_BAD_ARROW_ARGS, 0, JSEXN_SYNTAXERR, "invalid arrow-function arguments (parentheses around the arrow-function may help)") MSG_DEF(JSMSG_BAD_BINDING, 1, JSEXN_SYNTAXERR, "redefining {0} is deprecated") MSG_DEF(JSMSG_BAD_CONST_DECL, 0, JSEXN_SYNTAXERR, "missing = in const declaration") @@ -209,6 +211,8 @@ MSG_DEF(JSMSG_BAD_POW_LEFTSIDE, 0, JSEXN_SYNTAXERR, "unparenthesized unar MSG_DEF(JSMSG_BAD_PROP_ID, 0, JSEXN_SYNTAXERR, "invalid property id") MSG_DEF(JSMSG_BAD_RETURN_OR_YIELD, 1, JSEXN_SYNTAXERR, "{0} not in function") MSG_DEF(JSMSG_BAD_STRICT_ASSIGN, 1, JSEXN_SYNTAXERR, "'{0}' can't be defined or assigned to in strict mode code") +MSG_DEF(JSMSG_BAD_STRICT_ASSIGN_ARGUMENTS, 0, JSEXN_SYNTAXERR, "'arguments' can't be defined or assigned to in strict mode code") +MSG_DEF(JSMSG_BAD_STRICT_ASSIGN_EVAL, 0, JSEXN_SYNTAXERR, "'eval' can't be defined or assigned to in strict mode code") MSG_DEF(JSMSG_BAD_SWITCH, 0, JSEXN_SYNTAXERR, "invalid switch statement") MSG_DEF(JSMSG_BAD_SUPER, 0, JSEXN_SYNTAXERR, "invalid use of keyword 'super'") MSG_DEF(JSMSG_BAD_SUPERPROP, 1, JSEXN_SYNTAXERR, "use of super {0} accesses only valid within methods or eval code within methods") @@ -216,6 +220,7 @@ MSG_DEF(JSMSG_BAD_SUPERCALL, 0, JSEXN_SYNTAXERR, "super() is only vali MSG_DEF(JSMSG_BRACKET_AFTER_ARRAY_COMPREHENSION, 0, JSEXN_SYNTAXERR, "missing ] after array comprehension") MSG_DEF(JSMSG_BRACKET_AFTER_LIST, 0, JSEXN_SYNTAXERR, "missing ] after element list") MSG_DEF(JSMSG_BRACKET_IN_INDEX, 0, JSEXN_SYNTAXERR, "missing ] in index expression") +MSG_DEF(JSMSG_BRACKET_OPENED, 2, JSEXN_NOTE, "[ opened at line {0}, column {1}") MSG_DEF(JSMSG_CATCH_AFTER_GENERAL, 0, JSEXN_SYNTAXERR, "catch after unconditional catch") MSG_DEF(JSMSG_CATCH_IDENTIFIER, 0, JSEXN_SYNTAXERR, "missing identifier in catch") MSG_DEF(JSMSG_CATCH_OR_FINALLY, 0, JSEXN_SYNTAXERR, "missing catch or finally after try") @@ -226,6 +231,7 @@ MSG_DEF(JSMSG_COLON_IN_COND, 0, JSEXN_SYNTAXERR, "missing : in conditi MSG_DEF(JSMSG_COMP_PROP_UNTERM_EXPR, 0, JSEXN_SYNTAXERR, "missing ] in computed property name") MSG_DEF(JSMSG_CONTRARY_NONDIRECTIVE, 1, JSEXN_SYNTAXERR, "'{0}' statement won't be enforced as a directive because it isn't in directive prologue position") MSG_DEF(JSMSG_CURLY_AFTER_BODY, 0, JSEXN_SYNTAXERR, "missing } after function body") +MSG_DEF(JSMSG_CURLY_OPENED, 2, JSEXN_NOTE, "{ opened at line {0}, column {1}") MSG_DEF(JSMSG_CURLY_AFTER_CATCH, 0, JSEXN_SYNTAXERR, "missing } after catch block") MSG_DEF(JSMSG_CURLY_AFTER_FINALLY, 0, JSEXN_SYNTAXERR, "missing } after finally block") MSG_DEF(JSMSG_CURLY_AFTER_LIST, 0, JSEXN_SYNTAXERR, "missing } after property list") @@ -264,6 +270,7 @@ MSG_DEF(JSMSG_IMPORT_DECL_AT_TOP_LEVEL, 0, JSEXN_SYNTAXERR, "import declarations MSG_DEF(JSMSG_OF_AFTER_FOR_LOOP_DECL, 0, JSEXN_SYNTAXERR, "a declaration in the head of a for-of loop can't have an initializer") MSG_DEF(JSMSG_IN_AFTER_LEXICAL_FOR_DECL,0,JSEXN_SYNTAXERR, "a lexical declaration in the head of a for-in loop can't have an initializer") MSG_DEF(JSMSG_INVALID_FOR_IN_DECL_WITH_INIT,0,JSEXN_SYNTAXERR,"for-in loop head declarations may not have initializers") +MSG_DEF(JSMSG_INVALID_ID, 1, JSEXN_SYNTAXERR, "{0} is an invalid identifier") MSG_DEF(JSMSG_LABEL_NOT_FOUND, 0, JSEXN_SYNTAXERR, "label not found") MSG_DEF(JSMSG_LET_COMP_BINDING, 0, JSEXN_SYNTAXERR, "'let' is not a valid name for a comprehension variable") MSG_DEF(JSMSG_LEXICAL_DECL_NOT_IN_BLOCK, 1, JSEXN_SYNTAXERR, "{0} declaration not directly within block") @@ -501,7 +508,7 @@ MSG_DEF(JSMSG_RANGE_WITH_CLASS_ESCAPE, 0, JSEXN_SYNTAXERR, "character class esca MSG_DEF(JSMSG_RAW_BRACE_IN_REGEP, 0, JSEXN_SYNTAXERR, "raw brace is not allowed in regular expression with unicode flag") MSG_DEF(JSMSG_RAW_BRACKET_IN_REGEP, 0, JSEXN_SYNTAXERR, "raw bracket is not allowed in regular expression with unicode flag") MSG_DEF(JSMSG_TOO_MANY_PARENS, 0, JSEXN_INTERNALERR, "too many parentheses in regular expression") -MSG_DEF(JSMSG_UNICODE_OVERFLOW, 0, JSEXN_SYNTAXERR, "unicode codepoint should not be greater than 0x10FFFF in regular expression") +MSG_DEF(JSMSG_UNICODE_OVERFLOW, 1, JSEXN_SYNTAXERR, "Unicode codepoint must not be greater than 0x10FFFF in {0}") MSG_DEF(JSMSG_UNMATCHED_RIGHT_PAREN, 0, JSEXN_SYNTAXERR, "unmatched ) in regular expression") MSG_DEF(JSMSG_UNTERM_CLASS, 0, JSEXN_SYNTAXERR, "unterminated character class") diff --git a/js/src/jsapi-tests/moz.build b/js/src/jsapi-tests/moz.build index 277a145b0..c176fbf0a 100644 --- a/js/src/jsapi-tests/moz.build +++ b/js/src/jsapi-tests/moz.build @@ -37,6 +37,7 @@ UNIFIED_SOURCES += [ 'testForOfIterator.cpp', 'testForwardSetProperty.cpp', 'testFreshGlobalEvalRedefinition.cpp', + 'testFunctionBinding.cpp', 'testFunctionProperties.cpp', 'testGCAllocator.cpp', 'testGCCellPtr.cpp', diff --git a/js/src/jsapi-tests/testFunctionBinding.cpp b/js/src/jsapi-tests/testFunctionBinding.cpp new file mode 100644 index 000000000..33632db14 --- /dev/null +++ b/js/src/jsapi-tests/testFunctionBinding.cpp @@ -0,0 +1,58 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * + * Test function name binding. + */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "jsfriendapi.h" + +#include "jsapi-tests/tests.h" + +using namespace js; + +BEGIN_TEST(test_functionBinding) +{ + RootedFunction fun(cx); + + JS::CompileOptions options(cx); + options.setFileAndLine(__FILE__, __LINE__); + + // Named function shouldn't have it's binding. + const char s1chars[] = "return (typeof s1) == 'undefined';"; + JS::AutoObjectVector emptyScopeChain(cx); + CHECK(JS::CompileFunction(cx, emptyScopeChain, options, "s1", 0, nullptr, s1chars, + strlen(s1chars), &fun)); + CHECK(fun); + + JS::AutoValueVector args(cx); + RootedValue rval(cx); + CHECK(JS::Call(cx, UndefinedHandleValue, fun, args, &rval)); + CHECK(rval.isBoolean()); + CHECK(rval.toBoolean()); + + // Named function shouldn't have `anonymous` binding. + const char s2chars[] = "return (typeof anonymous) == 'undefined';"; + CHECK(JS::CompileFunction(cx, emptyScopeChain, options, "s2", 0, nullptr, s2chars, + strlen(s2chars), &fun)); + CHECK(fun); + + CHECK(JS::Call(cx, UndefinedHandleValue, fun, args, &rval)); + CHECK(rval.isBoolean()); + CHECK(rval.toBoolean()); + + // Anonymous function shouldn't have `anonymous` binding. + const char s3chars[] = "return (typeof anonymous) == 'undefined';"; + CHECK(JS::CompileFunction(cx, emptyScopeChain, options, nullptr, 0, nullptr, s3chars, + strlen(s3chars), &fun)); + CHECK(fun); + + CHECK(JS::Call(cx, UndefinedHandleValue, fun, args, &rval)); + CHECK(rval.isBoolean()); + CHECK(rval.toBoolean()); + + return true; +} +END_TEST(test_functionBinding) diff --git a/js/src/jsapi-tests/testUbiNode.cpp b/js/src/jsapi-tests/testUbiNode.cpp index 075e777d6..00b1253e7 100644 --- a/js/src/jsapi-tests/testUbiNode.cpp +++ b/js/src/jsapi-tests/testUbiNode.cpp @@ -646,7 +646,7 @@ BEGIN_TEST(test_JS_ubi_Node_scriptFilename) CHECK(obj->is<JSFunction>()); JS::RootedFunction func(cx, &obj->as<JSFunction>()); - JS::RootedScript script(cx, func->getOrCreateScript(cx)); + JS::RootedScript script(cx, JSFunction::getOrCreateScript(cx, func)); CHECK(script); CHECK(script->filename()); diff --git a/js/src/jsapi.cpp b/js/src/jsapi.cpp index 9ee29ffe4..7cc7bd035 100644 --- a/js/src/jsapi.cpp +++ b/js/src/jsapi.cpp @@ -69,7 +69,6 @@ #include "js/Proxy.h" #include "js/SliceBudget.h" #include "js/StructuredClone.h" -#include "js/UniquePtr.h" #include "js/Utility.h" #include "vm/AsyncFunction.h" #include "vm/DateObject.h" @@ -1022,7 +1021,7 @@ JS_ResolveStandardClass(JSContext* cx, HandleObject obj, HandleId id, bool* reso CHECK_REQUEST(cx); assertSameCompartment(cx, obj, id); - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); *resolved = false; if (!JSID_IS_ATOM(id)) @@ -1066,10 +1065,7 @@ JS_ResolveStandardClass(JSContext* cx, HandleObject obj, HandleId id, bool* reso // more way: its prototype chain is lazily initialized. That is, // global->getProto() might be null right now because we haven't created // Object.prototype yet. Force it now. - if (!global->getOrCreateObjectPrototype(cx)) - return false; - - return true; + return GlobalObject::getOrCreateObjectPrototype(cx, global); } JS_PUBLIC_API(bool) @@ -1102,8 +1098,7 @@ JS_EnumerateStandardClasses(JSContext* cx, HandleObject obj) AssertHeapIsIdle(cx); CHECK_REQUEST(cx); assertSameCompartment(cx, obj); - MOZ_ASSERT(obj->is<GlobalObject>()); - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); return GlobalObject::initStandardClasses(cx, global); } @@ -1159,7 +1154,8 @@ JS_GetObjectPrototype(JSContext* cx, HandleObject forObj) { CHECK_REQUEST(cx); assertSameCompartment(cx, forObj); - return forObj->global().getOrCreateObjectPrototype(cx); + Rooted<GlobalObject*> global(cx, &forObj->global()); + return GlobalObject::getOrCreateObjectPrototype(cx, global); } JS_PUBLIC_API(JSObject*) @@ -1167,7 +1163,8 @@ JS_GetFunctionPrototype(JSContext* cx, HandleObject forObj) { CHECK_REQUEST(cx); assertSameCompartment(cx, forObj); - return forObj->global().getOrCreateFunctionPrototype(cx); + Rooted<GlobalObject*> global(cx, &forObj->global()); + return GlobalObject::getOrCreateFunctionPrototype(cx, global); } JS_PUBLIC_API(JSObject*) @@ -3489,7 +3486,7 @@ CreateNonSyntacticEnvironmentChain(JSContext* cx, AutoObjectVector& envChain, // declaration was qualified by "var". There is only sadness. // // See JSObject::isQualifiedVarObj. - if (!env->setQualifiedVarObj(cx)) + if (!JSObject::setQualifiedVarObj(cx, env)) return false; // Also get a non-syntactic lexical environment to capture 'let' and @@ -3549,7 +3546,7 @@ CloneFunctionObject(JSContext* cx, HandleObject funobj, HandleObject env, Handle RootedFunction fun(cx, &funobj->as<JSFunction>()); if (fun->isInterpretedLazy()) { AutoCompartment ac(cx, funobj); - if (!fun->getOrCreateScript(cx)) + if (!JSFunction::getOrCreateScript(cx, fun)) return nullptr; } @@ -3581,7 +3578,7 @@ CloneFunctionObject(JSContext* cx, HandleObject funobj, HandleObject env, Handle // Fail here if we OOM during debug asserting. // CloneFunctionReuseScript will delazify the script anyways, so we // are not creating an extra failure condition for DEBUG builds. - if (!fun->getOrCreateScript(cx)) + if (!JSFunction::getOrCreateScript(cx, fun)) return nullptr; MOZ_ASSERT(scope->as<GlobalScope>().isSyntactic() || fun->nonLazyScript()->hasNonSyntacticScope()); @@ -4234,7 +4231,7 @@ JS_GetFunctionScript(JSContext* cx, HandleFunction fun) return nullptr; if (fun->isInterpretedLazy()) { AutoCompartment funCompartment(cx, fun); - JSScript* script = fun->getOrCreateScript(cx); + JSScript* script = JSFunction::getOrCreateScript(cx, fun); if (!script) MOZ_CRASH(); return script; @@ -4405,14 +4402,15 @@ JS_DecompileScript(JSContext* cx, HandleScript script, const char* name, unsigne AssertHeapIsIdle(cx); CHECK_REQUEST(cx); - script->ensureNonLazyCanonicalFunction(cx); + script->ensureNonLazyCanonicalFunction(); RootedFunction fun(cx, script->functionNonDelazifying()); if (fun) return JS_DecompileFunction(cx, fun, indent); bool haveSource = script->scriptSource()->hasSourceData(); if (!haveSource && !JSScript::loadSource(cx, script->scriptSource(), &haveSource)) return nullptr; - return haveSource ? script->sourceData(cx) : NewStringCopyZ<CanGC>(cx, "[no source]"); + return haveSource ? JSScript::sourceData(cx, script) + : NewStringCopyZ<CanGC>(cx, "[no source]"); } JS_PUBLIC_API(JSString*) @@ -4884,7 +4882,7 @@ JS::CallOriginalPromiseResolve(JSContext* cx, JS::HandleValue resolutionValue) assertSameCompartment(cx, resolutionValue); RootedObject promise(cx, PromiseObject::unforgeableResolve(cx, resolutionValue)); - MOZ_ASSERT_IF(promise, promise->is<PromiseObject>()); + MOZ_ASSERT_IF(promise, CheckedUnwrap(promise)->is<PromiseObject>()); return promise; } @@ -4896,7 +4894,7 @@ JS::CallOriginalPromiseReject(JSContext* cx, JS::HandleValue rejectionValue) assertSameCompartment(cx, rejectionValue); RootedObject promise(cx, PromiseObject::unforgeableReject(cx, rejectionValue)); - MOZ_ASSERT_IF(promise, promise->is<PromiseObject>()); + MOZ_ASSERT_IF(promise, CheckedUnwrap(promise)->is<PromiseObject>()); return promise; } @@ -4926,8 +4924,8 @@ ResolveOrRejectPromise(JSContext* cx, JS::HandleObject promiseObj, JS::HandleVal } return reject - ? promise->reject(cx, resultOrReason) - : promise->resolve(cx, resultOrReason); + ? PromiseObject::reject(cx, promise, resultOrReason) + : PromiseObject::resolve(cx, promise, resultOrReason); } JS_PUBLIC_API(bool) @@ -6014,7 +6012,8 @@ JS_SetRegExpInput(JSContext* cx, HandleObject obj, HandleString input) CHECK_REQUEST(cx); assertSameCompartment(cx, input); - RegExpStatics* res = obj->as<GlobalObject>().getRegExpStatics(cx); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + RegExpStatics* res = GlobalObject::getRegExpStatics(cx, global); if (!res) return false; @@ -6029,7 +6028,8 @@ JS_ClearRegExpStatics(JSContext* cx, HandleObject obj) CHECK_REQUEST(cx); MOZ_ASSERT(obj); - RegExpStatics* res = obj->as<GlobalObject>().getRegExpStatics(cx); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + RegExpStatics* res = GlobalObject::getRegExpStatics(cx, global); if (!res) return false; @@ -6044,7 +6044,8 @@ JS_ExecuteRegExp(JSContext* cx, HandleObject obj, HandleObject reobj, char16_t* AssertHeapIsIdle(cx); CHECK_REQUEST(cx); - RegExpStatics* res = obj->as<GlobalObject>().getRegExpStatics(cx); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + RegExpStatics* res = GlobalObject::getRegExpStatics(cx, global); if (!res) return false; @@ -6052,7 +6053,7 @@ JS_ExecuteRegExp(JSContext* cx, HandleObject obj, HandleObject reobj, char16_t* if (!input) return false; - return ExecuteRegExpLegacy(cx, res, reobj->as<RegExpObject>(), input, indexp, test, rval); + return ExecuteRegExpLegacy(cx, res, reobj.as<RegExpObject>(), input, indexp, test, rval); } JS_PUBLIC_API(bool) @@ -6066,7 +6067,7 @@ JS_ExecuteRegExpNoStatics(JSContext* cx, HandleObject obj, char16_t* chars, size if (!input) return false; - return ExecuteRegExpLegacy(cx, nullptr, obj->as<RegExpObject>(), input, indexp, test, + return ExecuteRegExpLegacy(cx, nullptr, obj.as<RegExpObject>(), input, indexp, test, rval); } @@ -6298,7 +6299,7 @@ JSErrorReport::freeLinebuf() } JSString* -JSErrorReport::newMessageString(JSContext* cx) +JSErrorBase::newMessageString(JSContext* cx) { if (!message_) return cx->runtime()->emptyString; @@ -6307,7 +6308,7 @@ JSErrorReport::newMessageString(JSContext* cx) } void -JSErrorReport::freeMessage() +JSErrorBase::freeMessage() { if (ownsMessage_) { js_free((void*)message_.get()); @@ -6316,6 +6317,132 @@ JSErrorReport::freeMessage() message_ = JS::ConstUTF8CharsZ(); } +JSErrorNotes::JSErrorNotes() + : notes_() +{} + +JSErrorNotes::~JSErrorNotes() +{ +} + +static UniquePtr<JSErrorNotes::Note> +CreateErrorNoteVA(JSContext* cx, + const char* filename, unsigned lineno, unsigned column, + JSErrorCallback errorCallback, void* userRef, + const unsigned errorNumber, + ErrorArgumentsType argumentsType, va_list ap) +{ + auto note = MakeUnique<JSErrorNotes::Note>(); + if (!note) + return nullptr; + + note->errorNumber = errorNumber; + note->filename = filename; + note->lineno = lineno; + note->column = column; + + if (!ExpandErrorArgumentsVA(cx, errorCallback, userRef, errorNumber, + nullptr, argumentsType, note.get(), ap)) { + return nullptr; + } + + return note; +} + +bool +JSErrorNotes::addNoteASCII(ExclusiveContext* cx, + const char* filename, unsigned lineno, unsigned column, + JSErrorCallback errorCallback, void* userRef, + const unsigned errorNumber, ...) +{ + va_list ap; + va_start(ap, errorNumber); + auto note = CreateErrorNoteVA(cx->asJSContext(), filename, lineno, column, errorCallback, userRef, + errorNumber, ArgumentsAreASCII, ap); + va_end(ap); + + if (!note) + return false; + if (!notes_.append(Move(note))) + return false; + return true; +} + +bool +JSErrorNotes::addNoteLatin1(ExclusiveContext* cx, + const char* filename, unsigned lineno, unsigned column, + JSErrorCallback errorCallback, void* userRef, + const unsigned errorNumber, ...) +{ + va_list ap; + va_start(ap, errorNumber); + auto note = CreateErrorNoteVA(cx->asJSContext(), filename, lineno, column, errorCallback, userRef, + errorNumber, ArgumentsAreLatin1, ap); + va_end(ap); + + if (!note) + return false; + if (!notes_.append(Move(note))) + return false; + return true; +} + +bool +JSErrorNotes::addNoteUTF8(ExclusiveContext* cx, + const char* filename, unsigned lineno, unsigned column, + JSErrorCallback errorCallback, void* userRef, + const unsigned errorNumber, ...) +{ + va_list ap; + va_start(ap, errorNumber); + auto note = CreateErrorNoteVA(cx->asJSContext(), filename, lineno, column, errorCallback, userRef, + errorNumber, ArgumentsAreUTF8, ap); + va_end(ap); + + if (!note) + return false; + if (!notes_.append(Move(note))) + return false; + return true; +} + +size_t +JSErrorNotes::length() +{ + return notes_.length(); +} + +UniquePtr<JSErrorNotes> +JSErrorNotes::copy(JSContext* cx) +{ + auto copiedNotes = MakeUnique<JSErrorNotes>(); + if (!copiedNotes) + return nullptr; + + for (auto&& note : *this) { + js::UniquePtr<JSErrorNotes::Note> copied(CopyErrorNote(cx, note.get())); + if (!copied) + return nullptr; + + if (!copiedNotes->notes_.append(Move(copied))) + return nullptr; + } + + return copiedNotes; +} + +JSErrorNotes::iterator +JSErrorNotes::begin() +{ + return iterator(notes_.begin()); +} + +JSErrorNotes::iterator +JSErrorNotes::end() +{ + return iterator(notes_.end()); +} + JS_PUBLIC_API(bool) JS_ThrowStopIteration(JSContext* cx) { diff --git a/js/src/jsapi.h b/js/src/jsapi.h index 3f65dad34..67b3d4267 100644 --- a/js/src/jsapi.h +++ b/js/src/jsapi.h @@ -18,6 +18,7 @@ #include "mozilla/RefPtr.h" #include "mozilla/Variant.h" +#include <iterator> #include <stdarg.h> #include <stddef.h> #include <stdint.h> @@ -36,6 +37,7 @@ #include "js/Realm.h" #include "js/RootingAPI.h" #include "js/TracingAPI.h" +#include "js/UniquePtr.h" #include "js/Utility.h" #include "js/Value.h" #include "js/Vector.h" @@ -652,6 +654,7 @@ typedef enum JSExnType { JSEXN_WASMRUNTIMEERROR, JSEXN_ERROR_LIMIT, JSEXN_WARN = JSEXN_ERROR_LIMIT, + JSEXN_NOTE, JSEXN_LIMIT } JSExnType; @@ -5362,14 +5365,130 @@ JS_ReportOutOfMemory(JSContext* cx); extern JS_PUBLIC_API(void) JS_ReportAllocationOverflow(JSContext* cx); -class JSErrorReport +/** + * Base class that implements parts shared by JSErrorReport and + * JSErrorNotes::Note. + */ +class JSErrorBase { // The (default) error message. // If ownsMessage_ is true, the it is freed in destructor. JS::ConstUTF8CharsZ message_; + public: + JSErrorBase() + : filename(nullptr), lineno(0), column(0), + errorNumber(0), + ownsMessage_(false) + {} + + ~JSErrorBase() { + freeMessage(); + } + + // Source file name, URL, etc., or null. + const char* filename; + + // Source line number. + unsigned lineno; + + // Zero-based column index in line. + unsigned column; + + // the error number, e.g. see js.msg. + unsigned errorNumber; + + private: + bool ownsMessage_ : 1; + + public: + const JS::ConstUTF8CharsZ message() const { + return message_; + } + + void initOwnedMessage(const char* messageArg) { + initBorrowedMessage(messageArg); + ownsMessage_ = true; + } + void initBorrowedMessage(const char* messageArg) { + MOZ_ASSERT(!message_); + message_ = JS::ConstUTF8CharsZ(messageArg, strlen(messageArg)); + } + + JSString* newMessageString(JSContext* cx); + + private: + void freeMessage(); +}; + +/** + * Notes associated with JSErrorReport. + */ +class JSErrorNotes +{ + public: + class Note : public JSErrorBase + {}; + + private: + // Stores pointers to each note. + js::Vector<js::UniquePtr<Note>, 1, js::SystemAllocPolicy> notes_; + + public: + JSErrorNotes(); + ~JSErrorNotes(); + + // Add an note to the given position. + bool addNoteASCII(js::ExclusiveContext* cx, + const char* filename, unsigned lineno, unsigned column, + JSErrorCallback errorCallback, void* userRef, + const unsigned errorNumber, ...); + bool addNoteLatin1(js::ExclusiveContext* cx, + const char* filename, unsigned lineno, unsigned column, + JSErrorCallback errorCallback, void* userRef, + const unsigned errorNumber, ...); + bool addNoteUTF8(js::ExclusiveContext* cx, + const char* filename, unsigned lineno, unsigned column, + JSErrorCallback errorCallback, void* userRef, + const unsigned errorNumber, ...); + + size_t length(); + + // Create a deep copy of notes. + js::UniquePtr<JSErrorNotes> copy(JSContext* cx); + + class iterator : public std::iterator<std::input_iterator_tag, js::UniquePtr<Note>> + { + js::UniquePtr<Note>* note_; + public: + explicit iterator(js::UniquePtr<Note>* note = nullptr) : note_(note) + {} + + bool operator==(iterator other) const { + return note_ == other.note_; + } + bool operator!=(iterator other) const { + return !(*this == other); + } + iterator& operator++() { + note_++; + return *this; + } + reference operator*() { + return *note_; + } + }; + iterator begin(); + iterator end(); +}; + +/** + * Describes a single error or warning that occurs in the execution of script. + */ +class JSErrorReport : public JSErrorBase +{ // Offending source line without final '\n'. - // If ownsLinebuf__ is true, the buffer is freed in destructor. + // If ownsLinebuf_ is true, the buffer is freed in destructor. const char16_t* linebuf_; // Number of chars in linebuf_. Does not include trailing '\0'. @@ -5381,28 +5500,29 @@ class JSErrorReport public: JSErrorReport() : linebuf_(nullptr), linebufLength_(0), tokenOffset_(0), - filename(nullptr), lineno(0), column(0), - flags(0), errorNumber(0), - exnType(0), isMuted(false), - ownsLinebuf_(false), ownsMessage_(false) + notes(nullptr), + flags(0), exnType(0), isMuted(false), + ownsLinebuf_(false) {} ~JSErrorReport() { freeLinebuf(); - freeMessage(); } - const char* filename; /* source file name, URL, etc., or null */ - unsigned lineno; /* source line number */ - unsigned column; /* zero-based column index in line */ - unsigned flags; /* error/warning, etc. */ - unsigned errorNumber; /* the error number, e.g. see js.msg */ - int16_t exnType; /* One of the JSExnType constants */ - bool isMuted : 1; /* See the comment in ReadOnlyCompileOptions. */ + // Associated notes, or nullptr if there's no note. + js::UniquePtr<JSErrorNotes> notes; + + // error/warning, etc. + unsigned flags; + + // One of the JSExnType constants. + int16_t exnType; + + // See the comment in ReadOnlyCompileOptions. + bool isMuted : 1; private: bool ownsLinebuf_ : 1; - bool ownsMessage_ : 1; public: const char16_t* linebuf() const { @@ -5414,29 +5534,16 @@ class JSErrorReport size_t tokenOffset() const { return tokenOffset_; } - void initOwnedLinebuf(const char16_t* linebufArg, size_t linebufLengthArg, size_t tokenOffsetArg) { + void initOwnedLinebuf(const char16_t* linebufArg, size_t linebufLengthArg, + size_t tokenOffsetArg) { initBorrowedLinebuf(linebufArg, linebufLengthArg, tokenOffsetArg); ownsLinebuf_ = true; } - void initBorrowedLinebuf(const char16_t* linebufArg, size_t linebufLengthArg, size_t tokenOffsetArg); - void freeLinebuf(); - - const JS::ConstUTF8CharsZ message() const { - return message_; - } - - void initOwnedMessage(const char* messageArg) { - initBorrowedMessage(messageArg); - ownsMessage_ = true; - } - void initBorrowedMessage(const char* messageArg) { - MOZ_ASSERT(!message_); - message_ = JS::ConstUTF8CharsZ(messageArg, strlen(messageArg)); - } + void initBorrowedLinebuf(const char16_t* linebufArg, size_t linebufLengthArg, + size_t tokenOffsetArg); - JSString* newMessageString(JSContext* cx); - - void freeMessage(); + private: + void freeLinebuf(); }; /* diff --git a/js/src/jsarray.cpp b/js/src/jsarray.cpp index ff581beec..e618c319f 100644 --- a/js/src/jsarray.cpp +++ b/js/src/jsarray.cpp @@ -602,7 +602,7 @@ js::ArraySetLength(JSContext* cx, Handle<ArrayObject*> arr, HandleId id, // for..in iteration over the array. Keys deleted before being reached // during the iteration must not be visited, and suppressing them here // would be too costly. - ObjectGroup* arrGroup = arr->getGroup(cx); + ObjectGroup* arrGroup = JSObject::getGroup(cx, arr); if (MOZ_UNLIKELY(!arrGroup)) return false; if (!arr->isIndexed() && !MOZ_UNLIKELY(arrGroup->hasAllFlags(OBJECT_FLAG_ITERATED))) { @@ -1285,7 +1285,7 @@ InitArrayElements(JSContext* cx, HandleObject obj, uint32_t start, if (count == 0) return true; - ObjectGroup* group = obj->getGroup(cx); + ObjectGroup* group = JSObject::getGroup(cx, obj); if (!group) return false; @@ -1662,11 +1662,11 @@ MatchNumericComparator(JSContext* cx, const Value& v) if (!obj.is<JSFunction>()) return Match_None; - JSFunction* fun = &obj.as<JSFunction>(); + RootedFunction fun(cx, &obj.as<JSFunction>()); if (!fun->isInterpreted() || fun->isClassConstructor()) return Match_None; - JSScript* script = fun->getOrCreateScript(cx); + JSScript* script = JSFunction::getOrCreateScript(cx, fun); if (!script) return Match_Failure; @@ -2144,7 +2144,7 @@ ArrayShiftDenseKernel(JSContext* cx, HandleObject obj, MutableHandleValue rval) if (ObjectMayHaveExtraIndexedProperties(obj)) return DenseElementResult::Incomplete; - RootedObjectGroup group(cx, obj->getGroup(cx)); + RootedObjectGroup group(cx, JSObject::getGroup(cx, obj)); if (MOZ_UNLIKELY(!group)) return DenseElementResult::Failure; @@ -2340,7 +2340,7 @@ CanOptimizeForDenseStorage(HandleObject arr, uint32_t startingIndex, uint32_t co * deleted if a hole is moved from one location to another location not yet * visited. See bug 690622. */ - ObjectGroup* arrGroup = arr->getGroup(cx); + ObjectGroup* arrGroup = JSObject::getGroup(cx, arr); if (!arrGroup) { cx->recoverFromOutOfMemory(); return false; @@ -2380,13 +2380,6 @@ CopyDenseElements(JSContext* cx, NativeObject* dst, NativeObject* src, return DenseElementResult::Success; } -/* ES 2016 draft Mar 25, 2016 22.1.3.26. */ -bool -js::array_splice(JSContext* cx, unsigned argc, Value* vp) -{ - return array_splice_impl(cx, argc, vp, true); -} - static inline bool ArraySpliceCopy(JSContext* cx, HandleObject arr, HandleObject obj, uint32_t actualStart, uint32_t actualDeleteCount) @@ -2416,8 +2409,8 @@ ArraySpliceCopy(JSContext* cx, HandleObject arr, HandleObject obj, return SetLengthProperty(cx, arr, actualDeleteCount); } -bool -js::array_splice_impl(JSContext* cx, unsigned argc, Value* vp, bool returnValueIsUsed) +static bool +array_splice_impl(JSContext* cx, unsigned argc, Value* vp, bool returnValueIsUsed) { AutoSPSEntry pseudoFrame(cx->runtime(), "Array.prototype.splice"); CallArgs args = CallArgsFromVp(argc, vp); @@ -2667,6 +2660,19 @@ js::array_splice_impl(JSContext* cx, unsigned argc, Value* vp, bool returnValueI return true; } +/* ES 2016 draft Mar 25, 2016 22.1.3.26. */ +bool +js::array_splice(JSContext* cx, unsigned argc, Value* vp) +{ + return array_splice_impl(cx, argc, vp, true); +} + +static bool +array_splice_noRetVal(JSContext* cx, unsigned argc, Value* vp) +{ + return array_splice_impl(cx, argc, vp, false); +} + struct SortComparatorIndexes { bool operator()(uint32_t a, uint32_t b, bool* lessOrEqualp) { @@ -3084,6 +3090,15 @@ array_of(JSContext* cx, unsigned argc, Value* vp) return true; } +const JSJitInfo js::array_splice_info = { + { (JSJitGetterOp)array_splice_noRetVal }, + { 0 }, /* unused */ + { 0 }, /* unused */ + JSJitInfo::IgnoresReturnValueNative, + JSJitInfo::AliasEverything, + JSVAL_TYPE_UNDEFINED, +}; + static const JSFunctionSpec array_methods[] = { #if JS_HAS_TOSOURCE JS_FN(js_toSource_str, array_toSource, 0,0), @@ -3099,7 +3114,7 @@ static const JSFunctionSpec array_methods[] = { JS_INLINABLE_FN("pop", array_pop, 0,0, ArrayPop), JS_INLINABLE_FN("shift", array_shift, 0,0, ArrayShift), JS_FN("unshift", array_unshift, 1,0), - JS_INLINABLE_FN("splice", array_splice, 2,0, ArraySplice), + JS_FNINFO("splice", array_splice, &array_splice_info, 2,0), /* Pythonic sequence methods. */ JS_SELF_HOSTED_FN("concat", "ArrayConcat", 1,0), @@ -3246,7 +3261,7 @@ static JSObject* CreateArrayPrototype(JSContext* cx, JSProtoKey key) { MOZ_ASSERT(key == JSProto_Array); - RootedObject proto(cx, cx->global()->getOrCreateObjectPrototype(cx)); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, cx->global())); if (!proto) return nullptr; @@ -3266,7 +3281,7 @@ CreateArrayPrototype(JSContext* cx, JSProtoKey key) metadata)); if (!arrayProto || !JSObject::setSingleton(cx, arrayProto) || - !arrayProto->setDelegate(cx) || + !JSObject::setDelegate(cx, arrayProto) || !AddLengthProperty(cx, arrayProto)) { return nullptr; @@ -3586,7 +3601,7 @@ js::NewPartlyAllocatedArrayTryUseGroup(ExclusiveContext* cx, HandleObjectGroup g // will have unknown property types. template <uint32_t maxLength> static inline ArrayObject* -NewArrayTryReuseGroup(JSContext* cx, JSObject* obj, size_t length, +NewArrayTryReuseGroup(JSContext* cx, HandleObject obj, size_t length, NewObjectKind newKind = GenericObject) { if (!obj->is<ArrayObject>()) @@ -3595,7 +3610,7 @@ NewArrayTryReuseGroup(JSContext* cx, JSObject* obj, size_t length, if (obj->staticPrototype() != cx->global()->maybeGetArrayPrototype()) return NewArray<maxLength>(cx, length, nullptr, newKind); - RootedObjectGroup group(cx, obj->getGroup(cx)); + RootedObjectGroup group(cx, JSObject::getGroup(cx, obj)); if (!group) return nullptr; @@ -3603,14 +3618,14 @@ NewArrayTryReuseGroup(JSContext* cx, JSObject* obj, size_t length, } ArrayObject* -js::NewFullyAllocatedArrayTryReuseGroup(JSContext* cx, JSObject* obj, size_t length, +js::NewFullyAllocatedArrayTryReuseGroup(JSContext* cx, HandleObject obj, size_t length, NewObjectKind newKind) { return NewArrayTryReuseGroup<UINT32_MAX>(cx, obj, length, newKind); } ArrayObject* -js::NewPartlyAllocatedArrayTryReuseGroup(JSContext* cx, JSObject* obj, size_t length) +js::NewPartlyAllocatedArrayTryReuseGroup(JSContext* cx, HandleObject obj, size_t length) { return NewArrayTryReuseGroup<ArrayObject::EagerAllocationMaxLength>(cx, obj, length); } @@ -3643,7 +3658,7 @@ js::NewCopiedArrayTryUseGroup(ExclusiveContext* cx, HandleObjectGroup group, if (!obj) return nullptr; - DenseElementResult result = obj->setOrExtendDenseElements(cx->asJSContext(), 0, vp, length, updateTypes); + DenseElementResult result = obj->setOrExtendDenseElements(cx, 0, vp, length, updateTypes); if (result == DenseElementResult::Failure) return nullptr; MOZ_ASSERT(result == DenseElementResult::Success); diff --git a/js/src/jsarray.h b/js/src/jsarray.h index ec2e4f514..d0084731f 100644 --- a/js/src/jsarray.h +++ b/js/src/jsarray.h @@ -83,11 +83,11 @@ extern ArrayObject* NewPartlyAllocatedArrayTryUseGroup(ExclusiveContext* cx, HandleObjectGroup group, size_t length); extern ArrayObject* -NewFullyAllocatedArrayTryReuseGroup(JSContext* cx, JSObject* obj, size_t length, +NewFullyAllocatedArrayTryReuseGroup(JSContext* cx, HandleObject obj, size_t length, NewObjectKind newKind = GenericObject); extern ArrayObject* -NewPartlyAllocatedArrayTryReuseGroup(JSContext* cx, JSObject* obj, size_t length); +NewPartlyAllocatedArrayTryReuseGroup(JSContext* cx, HandleObject obj, size_t length); extern ArrayObject* NewFullyAllocatedArrayForCallingAllocationSite(JSContext* cx, size_t length, @@ -147,9 +147,6 @@ extern bool array_pop(JSContext* cx, unsigned argc, js::Value* vp); extern bool -array_splice_impl(JSContext* cx, unsigned argc, js::Value* vp, bool pop); - -extern bool array_join(JSContext* cx, unsigned argc, js::Value* vp); extern void @@ -173,6 +170,8 @@ array_reverse(JSContext* cx, unsigned argc, js::Value* vp); extern bool array_splice(JSContext* cx, unsigned argc, js::Value* vp); +extern const JSJitInfo array_splice_info; + /* * Append the given (non-hole) value to the end of an array. The array must be * a newborn array -- that is, one which has not been exposed to script for diff --git a/js/src/jsatom.cpp b/js/src/jsatom.cpp index 2a3c58638..280ec3e9c 100644 --- a/js/src/jsatom.cpp +++ b/js/src/jsatom.cpp @@ -54,41 +54,9 @@ FOR_EACH_COMMON_PROPERTYNAME(CONST_CHAR_STR) #undef CONST_CHAR_STR /* Constant strings that are not atomized. */ -const char js_break_str[] = "break"; -const char js_case_str[] = "case"; -const char js_catch_str[] = "catch"; -const char js_class_str[] = "class"; -const char js_const_str[] = "const"; -const char js_continue_str[] = "continue"; -const char js_debugger_str[] = "debugger"; -const char js_default_str[] = "default"; -const char js_do_str[] = "do"; -const char js_else_str[] = "else"; -const char js_enum_str[] = "enum"; -const char js_export_str[] = "export"; -const char js_extends_str[] = "extends"; -const char js_finally_str[] = "finally"; -const char js_for_str[] = "for"; const char js_getter_str[] = "getter"; -const char js_if_str[] = "if"; -const char js_implements_str[] = "implements"; -const char js_import_str[] = "import"; -const char js_in_str[] = "in"; -const char js_instanceof_str[] = "instanceof"; -const char js_interface_str[] = "interface"; -const char js_package_str[] = "package"; -const char js_private_str[] = "private"; -const char js_protected_str[] = "protected"; -const char js_public_str[] = "public"; const char js_send_str[] = "send"; const char js_setter_str[] = "setter"; -const char js_switch_str[] = "switch"; -const char js_this_str[] = "this"; -const char js_try_str[] = "try"; -const char js_typeof_str[] = "typeof"; -const char js_void_str[] = "void"; -const char js_while_str[] = "while"; -const char js_with_str[] = "with"; // Use a low initial capacity for atom hash tables to avoid penalizing runtimes // which create a small number of atoms. diff --git a/js/src/jsatom.h b/js/src/jsatom.h index 496dcbb4c..0a5fd3c14 100644 --- a/js/src/jsatom.h +++ b/js/src/jsatom.h @@ -142,44 +142,9 @@ FOR_EACH_COMMON_PROPERTYNAME(DECLARE_CONST_CHAR_STR) #undef DECLARE_CONST_CHAR_STR /* Constant strings that are not atomized. */ -extern const char js_break_str[]; -extern const char js_case_str[]; -extern const char js_catch_str[]; -extern const char js_class_str[]; -extern const char js_close_str[]; -extern const char js_const_str[]; -extern const char js_continue_str[]; -extern const char js_debugger_str[]; -extern const char js_default_str[]; -extern const char js_do_str[]; -extern const char js_else_str[]; -extern const char js_enum_str[]; -extern const char js_export_str[]; -extern const char js_extends_str[]; -extern const char js_finally_str[]; -extern const char js_for_str[]; extern const char js_getter_str[]; -extern const char js_if_str[]; -extern const char js_implements_str[]; -extern const char js_import_str[]; -extern const char js_in_str[]; -extern const char js_instanceof_str[]; -extern const char js_interface_str[]; -extern const char js_package_str[]; -extern const char js_private_str[]; -extern const char js_protected_str[]; -extern const char js_public_str[]; extern const char js_send_str[]; extern const char js_setter_str[]; -extern const char js_static_str[]; -extern const char js_super_str[]; -extern const char js_switch_str[]; -extern const char js_this_str[]; -extern const char js_try_str[]; -extern const char js_typeof_str[]; -extern const char js_void_str[]; -extern const char js_while_str[]; -extern const char js_with_str[]; namespace js { diff --git a/js/src/jsbool.cpp b/js/src/jsbool.cpp index c8109b02c..b2d07c628 100644 --- a/js/src/jsbool.cpp +++ b/js/src/jsbool.cpp @@ -137,14 +137,14 @@ js::InitBooleanClass(JSContext* cx, HandleObject obj) { MOZ_ASSERT(obj->isNative()); - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); - Rooted<BooleanObject*> booleanProto(cx, global->createBlankPrototype<BooleanObject>(cx)); + Rooted<BooleanObject*> booleanProto(cx, GlobalObject::createBlankPrototype<BooleanObject>(cx, global)); if (!booleanProto) return nullptr; booleanProto->setFixedSlot(BooleanObject::PRIMITIVE_VALUE_SLOT, BooleanValue(false)); - RootedFunction ctor(cx, global->createConstructor(cx, Boolean, cx->names().Boolean, 1)); + RootedFunction ctor(cx, GlobalObject::createConstructor(cx, Boolean, cx->names().Boolean, 1)); if (!ctor) return nullptr; diff --git a/js/src/jscntxt.cpp b/js/src/jscntxt.cpp index 31d62332d..441b006d6 100644 --- a/js/src/jscntxt.cpp +++ b/js/src/jscntxt.cpp @@ -381,49 +381,16 @@ js::ReportUsageErrorASCII(JSContext* cx, HandleObject callee, const char* msg) } } -bool -js::PrintError(JSContext* cx, FILE* file, JS::ConstUTF8CharsZ toStringResult, - JSErrorReport* report, bool reportWarnings) -{ - MOZ_ASSERT(report); - - /* Conditionally ignore reported warnings. */ - if (JSREPORT_IS_WARNING(report->flags) && !reportWarnings) - return false; - - char* prefix = nullptr; - if (report->filename) - prefix = JS_smprintf("%s:", report->filename); - if (report->lineno) { - char* tmp = prefix; - prefix = JS_smprintf("%s%u:%u ", tmp ? tmp : "", report->lineno, report->column); - JS_free(cx, tmp); - } - if (JSREPORT_IS_WARNING(report->flags)) { - char* tmp = prefix; - prefix = JS_smprintf("%s%swarning: ", - tmp ? tmp : "", - JSREPORT_IS_STRICT(report->flags) ? "strict " : ""); - JS_free(cx, tmp); - } - - const char* message = toStringResult ? toStringResult.c_str() : report->message().c_str(); - - /* embedded newlines -- argh! */ - const char* ctmp; - while ((ctmp = strchr(message, '\n')) != 0) { - ctmp++; - if (prefix) - fputs(prefix, file); - fwrite(message, 1, ctmp - message, file); - message = ctmp; - } - - /* If there were no filename or lineno, the prefix might be empty */ - if (prefix) - fputs(prefix, file); - fputs(message, file); +enum class PrintErrorKind { + Error, + Warning, + StrictWarning, + Note +}; +static void +PrintErrorLine(JSContext* cx, FILE* file, const char* prefix, JSErrorReport* report) +{ if (const char16_t* linebuf = report->linebuf()) { size_t n = report->linebufLength(); @@ -453,9 +420,96 @@ js::PrintError(JSContext* cx, FILE* file, JS::ConstUTF8CharsZ toStringResult, } fputc('^', file); } +} + +static void +PrintErrorLine(JSContext* cx, FILE* file, const char* prefix, JSErrorNotes::Note* note) +{ +} + +template <typename T> +static bool +PrintSingleError(JSContext* cx, FILE* file, JS::ConstUTF8CharsZ toStringResult, + T* report, PrintErrorKind kind) +{ + UniquePtr<char> prefix; + if (report->filename) + prefix.reset(JS_smprintf("%s:", report->filename)); + + if (report->lineno) { + UniquePtr<char> tmp(JS_smprintf("%s%u:%u ", prefix ? prefix.get() : "", report->lineno, + report->column)); + prefix = Move(tmp); + } + + if (kind != PrintErrorKind::Error) { + const char* kindPrefix = nullptr; + switch (kind) { + case PrintErrorKind::Error: + break; + case PrintErrorKind::Warning: + kindPrefix = "warning"; + break; + case PrintErrorKind::StrictWarning: + kindPrefix = "strict warning"; + break; + case PrintErrorKind::Note: + kindPrefix = "note"; + break; + } + + UniquePtr<char> tmp(JS_smprintf("%s%s: ", prefix ? prefix.get() : "", kindPrefix)); + prefix = Move(tmp); + } + + const char* message = toStringResult ? toStringResult.c_str() : report->message().c_str(); + + /* embedded newlines -- argh! */ + const char* ctmp; + while ((ctmp = strchr(message, '\n')) != 0) { + ctmp++; + if (prefix) + fputs(prefix.get(), file); + fwrite(message, 1, ctmp - message, file); + message = ctmp; + } + + /* If there were no filename or lineno, the prefix might be empty */ + if (prefix) + fputs(prefix.get(), file); + fputs(message, file); + + PrintErrorLine(cx, file, prefix.get(), report); fputc('\n', file); + fflush(file); - JS_free(cx, prefix); + return true; +} + +bool +js::PrintError(JSContext* cx, FILE* file, JS::ConstUTF8CharsZ toStringResult, + JSErrorReport* report, bool reportWarnings) +{ + MOZ_ASSERT(report); + + /* Conditionally ignore reported warnings. */ + if (JSREPORT_IS_WARNING(report->flags) && !reportWarnings) + return false; + + PrintErrorKind kind = PrintErrorKind::Error; + if (JSREPORT_IS_WARNING(report->flags)) { + if (JSREPORT_IS_STRICT(report->flags)) + kind = PrintErrorKind::StrictWarning; + else + kind = PrintErrorKind::Warning; + } + PrintSingleError(cx, file, toStringResult, report, kind); + + if (report->notes) { + for (auto&& note : *report->notes) + PrintSingleError(cx, file, JS::ConstUTF8CharsZ(), note.get(), PrintErrorKind::Note); + } + return true; } @@ -557,6 +611,18 @@ class MOZ_RAII AutoMessageArgs } }; +static void +SetExnType(JSErrorReport* reportp, int16_t exnType) +{ + reportp->exnType = exnType; +} + +static void +SetExnType(JSErrorNotes::Note* notep, int16_t exnType) +{ + // Do nothing for JSErrorNotes::Note. +} + /* * The arguments from ap need to be packaged up into an array and stored * into the report struct. @@ -568,12 +634,13 @@ class MOZ_RAII AutoMessageArgs * * Returns true if the expansion succeeds (can fail if out of memory). */ +template <typename T> bool -js::ExpandErrorArgumentsVA(ExclusiveContext* cx, JSErrorCallback callback, +ExpandErrorArgumentsHelper(ExclusiveContext* cx, JSErrorCallback callback, void* userRef, const unsigned errorNumber, const char16_t** messageArgs, ErrorArgumentsType argumentsType, - JSErrorReport* reportp, va_list ap) + T* reportp, va_list ap) { const JSErrorFormatString* efs; @@ -586,7 +653,7 @@ js::ExpandErrorArgumentsVA(ExclusiveContext* cx, JSErrorCallback callback, } if (efs) { - reportp->exnType = efs->exnType; + SetExnType(reportp, efs->exnType); MOZ_ASSERT_IF(argumentsType == ArgumentsAreASCII, JS::StringIsASCII(efs->format)); @@ -670,6 +737,28 @@ js::ExpandErrorArgumentsVA(ExclusiveContext* cx, JSErrorCallback callback, } bool +js::ExpandErrorArgumentsVA(ExclusiveContext* cx, JSErrorCallback callback, + void* userRef, const unsigned errorNumber, + const char16_t** messageArgs, + ErrorArgumentsType argumentsType, + JSErrorReport* reportp, va_list ap) +{ + return ExpandErrorArgumentsHelper(cx, callback, userRef, errorNumber, + messageArgs, argumentsType, reportp, ap); +} + +bool +js::ExpandErrorArgumentsVA(JSContext* cx, JSErrorCallback callback, + void* userRef, const unsigned errorNumber, + const char16_t** messageArgs, + ErrorArgumentsType argumentsType, + JSErrorNotes::Note* notep, va_list ap) +{ + return ExpandErrorArgumentsHelper(cx, callback, userRef, errorNumber, + messageArgs, argumentsType, notep, ap); +} + +bool js::ReportErrorNumberVA(JSContext* cx, unsigned flags, JSErrorCallback callback, void* userRef, const unsigned errorNumber, ErrorArgumentsType argumentsType, va_list ap) @@ -832,6 +921,52 @@ js::ReportValueErrorFlags(JSContext* cx, unsigned flags, const unsigned errorNum return ok; } +JSObject* +js::CreateErrorNotesArray(JSContext* cx, JSErrorReport* report) +{ + RootedArrayObject notesArray(cx, NewDenseEmptyArray(cx)); + if (!notesArray) + return nullptr; + + if (!report->notes) + return notesArray; + + for (auto&& note : *report->notes) { + RootedPlainObject noteObj(cx, NewBuiltinClassInstance<PlainObject>(cx)); + if (!noteObj) + return nullptr; + + RootedString messageStr(cx, note->newMessageString(cx)); + if (!messageStr) + return nullptr; + RootedValue messageVal(cx, StringValue(messageStr)); + if (!DefineProperty(cx, noteObj, cx->names().message, messageVal)) + return nullptr; + + RootedValue filenameVal(cx); + if (note->filename) { + RootedString filenameStr(cx, NewStringCopyZ<CanGC>(cx, note->filename)); + if (!filenameStr) + return nullptr; + filenameVal = StringValue(filenameStr); + } + if (!DefineProperty(cx, noteObj, cx->names().fileName, filenameVal)) + return nullptr; + + RootedValue linenoVal(cx, Int32Value(note->lineno)); + if (!DefineProperty(cx, noteObj, cx->names().lineNumber, linenoVal)) + return nullptr; + RootedValue columnVal(cx, Int32Value(note->column)); + if (!DefineProperty(cx, noteObj, cx->names().columnNumber, columnVal)) + return nullptr; + + if (!NewbornArrayPush(cx, notesArray, ObjectValue(*noteObj))) + return nullptr; + } + + return notesArray; +} + const JSErrorFormatString js_ErrorFormatString[JSErr_Limit] = { #define MSG_DEF(name, count, exception, format) \ { #name, format, count, exception } , diff --git a/js/src/jscntxt.h b/js/src/jscntxt.h index 0a2841242..c949d18fd 100644 --- a/js/src/jscntxt.h +++ b/js/src/jscntxt.h @@ -621,6 +621,13 @@ ExpandErrorArgumentsVA(ExclusiveContext* cx, JSErrorCallback callback, ErrorArgumentsType argumentsType, JSErrorReport* reportp, va_list ap); +extern bool +ExpandErrorArgumentsVA(JSContext* cx, JSErrorCallback callback, + void* userRef, const unsigned errorNumber, + const char16_t** messageArgs, + ErrorArgumentsType argumentsType, + JSErrorNotes::Note* notep, va_list ap); + /* |callee| requires a usage string provided by JS_DefineFunctionsWithHelp. */ extern void ReportUsageErrorASCII(JSContext* cx, HandleObject callee, const char* msg); @@ -678,6 +685,9 @@ ReportValueErrorFlags(JSContext* cx, unsigned flags, const unsigned errorNumber, ((void)ReportValueErrorFlags(cx, JSREPORT_ERROR, errorNumber, \ spindex, v, fallback, arg1, arg2)) +JSObject* +CreateErrorNotesArray(JSContext* cx, JSErrorReport* report); + } /* namespace js */ extern const JSErrorFormatString js_ErrorFormatString[JSErr_Limit]; diff --git a/js/src/jscompartment.cpp b/js/src/jscompartment.cpp index 6024a1768..d0caeb558 100644 --- a/js/src/jscompartment.cpp +++ b/js/src/jscompartment.cpp @@ -1075,18 +1075,18 @@ CreateLazyScriptsForCompartment(JSContext* cx) // Create scripts for each lazy function, updating the list of functions to // process with any newly exposed inner functions in created scripts. // A function cannot be delazified until its outer script exists. + RootedFunction fun(cx); for (size_t i = 0; i < lazyFunctions.length(); i++) { - JSFunction* fun = &lazyFunctions[i]->as<JSFunction>(); + fun = &lazyFunctions[i]->as<JSFunction>(); // lazyFunctions may have been populated with multiple functions for // a lazy script. if (!fun->isInterpretedLazy()) continue; - LazyScript* lazy = fun->lazyScript(); - bool lazyScriptHadNoScript = !lazy->maybeScript(); + bool lazyScriptHadNoScript = !fun->lazyScript()->maybeScript(); - JSScript* script = fun->getOrCreateScript(cx); + JSScript* script = JSFunction::getOrCreateScript(cx, fun); if (!script) return false; if (lazyScriptHadNoScript && !AddInnerLazyFunctionsFromScript(script, lazyFunctions)) diff --git a/js/src/jsdate.cpp b/js/src/jsdate.cpp index 52294a5df..c6a369e2d 100755 --- a/js/src/jsdate.cpp +++ b/js/src/jsdate.cpp @@ -3163,7 +3163,7 @@ js::DateConstructor(JSContext* cx, unsigned argc, Value* vp) static JSObject* CreateDatePrototype(JSContext* cx, JSProtoKey key) { - return cx->global()->createBlankPrototype(cx, &DateObject::protoClass_); + return GlobalObject::createBlankPrototype(cx, cx->global(), &DateObject::protoClass_); } static bool diff --git a/js/src/jsexn.cpp b/js/src/jsexn.cpp index 1e70a3890..65cc81a1a 100644 --- a/js/src/jsexn.cpp +++ b/js/src/jsexn.cpp @@ -201,28 +201,77 @@ ErrorObject::classes[JSEXN_ERROR_LIMIT] = { IMPLEMENT_ERROR_CLASS(RuntimeError) }; -JSErrorReport* -js::CopyErrorReport(JSContext* cx, JSErrorReport* report) +size_t +ExtraMallocSize(JSErrorReport* report) +{ + if (report->linebuf()) + return (report->linebufLength() + 1) * sizeof(char16_t); + + return 0; +} + +size_t +ExtraMallocSize(JSErrorNotes::Note* note) +{ + return 0; +} + +bool +CopyExtraData(JSContext* cx, uint8_t** cursor, JSErrorReport* copy, JSErrorReport* report) +{ + if (report->linebuf()) { + size_t linebufSize = (report->linebufLength() + 1) * sizeof(char16_t); + const char16_t* linebufCopy = (const char16_t*)(*cursor); + js_memcpy(*cursor, report->linebuf(), linebufSize); + *cursor += linebufSize; + copy->initBorrowedLinebuf(linebufCopy, report->linebufLength(), report->tokenOffset()); + } + + /* Copy non-pointer members. */ + copy->isMuted = report->isMuted; + copy->exnType = report->exnType; + + /* Note that this is before it gets flagged with JSREPORT_EXCEPTION */ + copy->flags = report->flags; + + /* Deep copy notes. */ + if (report->notes) { + auto copiedNotes = report->notes->copy(cx); + if (!copiedNotes) + return false; + copy->notes = Move(copiedNotes); + } else { + copy->notes.reset(nullptr); + } + + return true; +} + +bool +CopyExtraData(JSContext* cx, uint8_t** cursor, JSErrorNotes::Note* copy, JSErrorNotes::Note* report) +{ + return true; +} + +template <typename T> +static T* +CopyErrorHelper(JSContext* cx, T* report) { /* - * We use a single malloc block to make a deep copy of JSErrorReport with + * We use a single malloc block to make a deep copy of JSErrorReport or + * JSErrorNotes::Note, except JSErrorNotes linked from JSErrorReport with * the following layout: - * JSErrorReport + * JSErrorReport or JSErrorNotes::Note * char array with characters for message_ - * char16_t array with characters for linebuf * char array with characters for filename + * char16_t array with characters for linebuf (only for JSErrorReport) * Such layout together with the properties enforced by the following * asserts does not need any extra alignment padding. */ - JS_STATIC_ASSERT(sizeof(JSErrorReport) % sizeof(const char*) == 0); + JS_STATIC_ASSERT(sizeof(T) % sizeof(const char*) == 0); JS_STATIC_ASSERT(sizeof(const char*) % sizeof(char16_t) == 0); -#define JS_CHARS_SIZE(chars) ((js_strlen(chars) + 1) * sizeof(char16_t)) - size_t filenameSize = report->filename ? strlen(report->filename) + 1 : 0; - size_t linebufSize = 0; - if (report->linebuf()) - linebufSize = (report->linebufLength() + 1) * sizeof(char16_t); size_t messageSize = 0; if (report->message()) messageSize = strlen(report->message().c_str()) + 1; @@ -231,13 +280,13 @@ js::CopyErrorReport(JSContext* cx, JSErrorReport* report) * The mallocSize can not overflow since it represents the sum of the * sizes of already allocated objects. */ - size_t mallocSize = sizeof(JSErrorReport) + messageSize + linebufSize + filenameSize; + size_t mallocSize = sizeof(T) + messageSize + filenameSize + ExtraMallocSize(report); uint8_t* cursor = cx->pod_calloc<uint8_t>(mallocSize); if (!cursor) return nullptr; - JSErrorReport* copy = (JSErrorReport*)cursor; - cursor += sizeof(JSErrorReport); + T* copy = new (cursor) T(); + cursor += sizeof(T); if (report->message()) { copy->initBorrowedMessage((const char*)cursor); @@ -245,33 +294,40 @@ js::CopyErrorReport(JSContext* cx, JSErrorReport* report) cursor += messageSize; } - if (report->linebuf()) { - const char16_t* linebufCopy = (const char16_t*)cursor; - js_memcpy(cursor, report->linebuf(), linebufSize); - cursor += linebufSize; - copy->initBorrowedLinebuf(linebufCopy, report->linebufLength(), report->tokenOffset()); - } - if (report->filename) { copy->filename = (const char*)cursor; js_memcpy(cursor, report->filename, filenameSize); + cursor += filenameSize; } - MOZ_ASSERT(cursor + filenameSize == (uint8_t*)copy + mallocSize); + + if (!CopyExtraData(cx, &cursor, copy, report)) { + /* js_delete calls destructor for T and js_free for pod_calloc. */ + js_delete(copy); + return nullptr; + } + + MOZ_ASSERT(cursor == (uint8_t*)copy + mallocSize); /* Copy non-pointer members. */ - copy->isMuted = report->isMuted; copy->lineno = report->lineno; copy->column = report->column; copy->errorNumber = report->errorNumber; - copy->exnType = report->exnType; - - /* Note that this is before it gets flagged with JSREPORT_EXCEPTION */ - copy->flags = report->flags; -#undef JS_CHARS_SIZE return copy; } +JSErrorNotes::Note* +js::CopyErrorNote(JSContext* cx, JSErrorNotes::Note* note) +{ + return CopyErrorHelper(cx, note); +} + +JSErrorReport* +js::CopyErrorReport(JSContext* cx, JSErrorReport* report) +{ + return CopyErrorHelper(cx, report); +} + struct SuppressErrorsGuard { JSContext* cx; @@ -322,7 +378,7 @@ exn_finalize(FreeOp* fop, JSObject* obj) { MOZ_ASSERT(fop->maybeOffMainThread()); if (JSErrorReport* report = obj->as<ErrorObject>().getErrorReport()) - fop->free_(report); + fop->delete_(report); } JSErrorReport* @@ -512,14 +568,17 @@ ErrorObject::createProto(JSContext* cx, JSProtoKey key) { JSExnType type = ExnTypeFromProtoKey(key); - if (type == JSEXN_ERR) - return cx->global()->createBlankPrototype(cx, &ErrorObject::protoClasses[JSEXN_ERR]); + if (type == JSEXN_ERR) { + return GlobalObject::createBlankPrototype(cx, cx->global(), + &ErrorObject::protoClasses[JSEXN_ERR]); + } RootedObject protoProto(cx, GlobalObject::getOrCreateErrorPrototype(cx, cx->global())); if (!protoProto) return nullptr; - return cx->global()->createBlankPrototypeInheriting(cx, &ErrorObject::protoClasses[type], + return GlobalObject::createBlankPrototypeInheriting(cx, cx->global(), + &ErrorObject::protoClasses[type], protoProto); } @@ -586,6 +645,7 @@ js::ErrorToException(JSContext* cx, JSErrorReport* reportp, const JSErrorFormatString* errorString = callback(userRef, errorNumber); JSExnType exnType = errorString ? static_cast<JSExnType>(errorString->exnType) : JSEXN_ERR; MOZ_ASSERT(exnType < JSEXN_LIMIT); + MOZ_ASSERT(exnType != JSEXN_NOTE); if (exnType == JSEXN_WARN) { // werror must be enabled, so we use JSEXN_ERR. @@ -669,7 +729,7 @@ ErrorReportToString(JSContext* cx, JSErrorReport* reportp) */ JSExnType type = static_cast<JSExnType>(reportp->exnType); RootedString str(cx); - if (type != JSEXN_WARN) + if (type != JSEXN_WARN && type != JSEXN_NOTE) str = ClassName(GetExceptionProtoKey(type), cx); /* diff --git a/js/src/jsexn.h b/js/src/jsexn.h index ae6335209..00120d89c 100644 --- a/js/src/jsexn.h +++ b/js/src/jsexn.h @@ -18,6 +18,9 @@ namespace js { class ErrorObject; +JSErrorNotes::Note* +CopyErrorNote(JSContext* cx, JSErrorNotes::Note* note); + JSErrorReport* CopyErrorReport(JSContext* cx, JSErrorReport* report); @@ -67,7 +70,8 @@ static_assert(JSEXN_ERR == 0 && JSProto_Error + JSEXN_WASMCOMPILEERROR == JSProto_CompileError && JSProto_Error + JSEXN_WASMRUNTIMEERROR == JSProto_RuntimeError && JSEXN_WASMRUNTIMEERROR + 1 == JSEXN_WARN && - JSEXN_WARN + 1 == JSEXN_LIMIT, + JSEXN_WARN + 1 == JSEXN_NOTE && + JSEXN_NOTE + 1 == JSEXN_LIMIT, "GetExceptionProtoKey and ExnTypeFromProtoKey require that " "each corresponding JSExnType and JSProtoKey value be separated " "by the same constant value"); diff --git a/js/src/jsfriendapi.cpp b/js/src/jsfriendapi.cpp index 5baba0beb..f7622cb44 100644 --- a/js/src/jsfriendapi.cpp +++ b/js/src/jsfriendapi.cpp @@ -113,7 +113,7 @@ JS_SplicePrototype(JSContext* cx, HandleObject obj, HandleObject proto) } Rooted<TaggedProto> tagged(cx, TaggedProto(proto)); - return obj->splicePrototype(cx, obj->getClass(), tagged); + return JSObject::splicePrototype(cx, obj, obj->getClass(), tagged); } JS_FRIEND_API(JSObject*) diff --git a/js/src/jsfriendapi.h b/js/src/jsfriendapi.h index d29285483..351667fb3 100644 --- a/js/src/jsfriendapi.h +++ b/js/src/jsfriendapi.h @@ -2254,6 +2254,7 @@ struct JSJitInfo { Method, StaticMethod, InlinableNative, + IgnoresReturnValueNative, // Must be last OpTypeCount }; @@ -2345,8 +2346,13 @@ struct JSJitInfo { JSJitMethodOp method; /** A DOM static method, used for Promise wrappers */ JSNative staticMethod; + JSNative ignoresReturnValueMethod; }; + static unsigned offsetOfIgnoresReturnValueNative() { + return offsetof(JSJitInfo, ignoresReturnValueMethod); + } + union { uint16_t protoID; js::jit::InlinableNative inlinableNative; diff --git a/js/src/jsfun.cpp b/js/src/jsfun.cpp index e624aa415..9edf238ef 100644 --- a/js/src/jsfun.cpp +++ b/js/src/jsfun.cpp @@ -129,6 +129,11 @@ IsFunctionInStrictMode(JSFunction* fun) return IsAsmJSStrictModeModuleOrFunction(fun); } +static bool +IsNewerTypeFunction(JSFunction* fun) { + return fun->isArrow() || fun->isGenerator() || fun->isAsync() || fun->isMethod(); +} + // Beware: this function can be invoked on *any* function! That includes // natives, strict mode functions, bound functions, arrow functions, // self-hosted functions and constructors, asm.js functions, functions with @@ -142,7 +147,9 @@ ArgumentsRestrictions(JSContext* cx, HandleFunction fun) // a strict mode function, or a bound function. // TODO (bug 1057208): ensure semantics are correct for all possible // pairings of callee/caller. - if (fun->isBuiltin() || IsFunctionInStrictMode(fun) || fun->isBoundFunction()) { + if (fun->isBuiltin() || IsFunctionInStrictMode(fun) || + fun->isBoundFunction() || IsNewerTypeFunction(fun)) + { ThrowTypeErrorBehavior(cx); return false; } @@ -229,7 +236,9 @@ CallerRestrictions(JSContext* cx, HandleFunction fun) // a strict mode function, or a bound function. // TODO (bug 1057208): ensure semantics are correct for all possible // pairings of callee/caller. - if (fun->isBuiltin() || IsFunctionInStrictMode(fun) || fun->isBoundFunction()) { + if (fun->isBuiltin() || IsFunctionInStrictMode(fun) || + fun->isBoundFunction() || IsNewerTypeFunction(fun)) + { ThrowTypeErrorBehavior(cx); return false; } @@ -275,6 +284,8 @@ CallerGetterImpl(JSContext* cx, const CallArgs& args) } RootedObject caller(cx, iter.callee(cx)); + if (caller->is<JSFunction>() && caller->as<JSFunction>().isAsync()) + caller = GetWrappedAsyncFunction(&caller->as<JSFunction>()); if (!cx->compartment()->wrap(cx, &caller)) return false; @@ -295,6 +306,8 @@ CallerGetterImpl(JSContext* cx, const CallArgs& args) } JSFunction* callerFun = &callerObj->as<JSFunction>(); + if (IsWrappedAsyncFunction(callerFun)) + callerFun = GetUnwrappedAsyncFunction(callerFun); MOZ_ASSERT(!callerFun->isBuiltin(), "non-builtin iterator returned a builtin?"); if (callerFun->strict()) { @@ -366,7 +379,7 @@ ResolveInterpretedFunctionPrototype(JSContext* cx, HandleFunction fun, HandleId if (isStarGenerator) objProto = GlobalObject::getOrCreateStarGeneratorObjectPrototype(cx, global); else - objProto = fun->global().getOrCreateObjectPrototype(cx); + objProto = GlobalObject::getOrCreateObjectPrototype(cx, global); if (!objProto) return false; @@ -463,7 +476,7 @@ fun_resolve(JSContext* cx, HandleObject obj, HandleId id, bool* resolvedp) if (fun->hasResolvedLength()) return true; - if (!fun->getUnresolvedLength(cx, &v)) + if (!JSFunction::getUnresolvedLength(cx, fun, &v)) return false; } else { if (fun->hasResolvedName()) @@ -808,12 +821,13 @@ CreateFunctionPrototype(JSContext* cx, JSProtoKey key) sourceObject, begin, ss->length(), - 0)); + 0, + ss->length())); if (!script || !JSScript::initFunctionPrototype(cx, script, functionProto)) return nullptr; functionProto->initScript(script); - ObjectGroup* protoGroup = functionProto->getGroup(cx); + ObjectGroup* protoGroup = JSObject::getGroup(cx, functionProto); if (!protoGroup) return nullptr; @@ -848,6 +862,28 @@ CreateFunctionPrototype(JSContext* cx, JSProtoKey key) if (!throwTypeError || !PreventExtensions(cx, throwTypeError)) return nullptr; + // The "length" property of %ThrowTypeError% is non-configurable, adjust + // the default property attributes accordingly. + Rooted<PropertyDescriptor> nonConfigurableDesc(cx); + nonConfigurableDesc.setAttributes(JSPROP_PERMANENT | JSPROP_IGNORE_READONLY | + JSPROP_IGNORE_ENUMERATE | JSPROP_IGNORE_VALUE); + + RootedId lengthId(cx, NameToId(cx->names().length)); + ObjectOpResult lengthResult; + if (!NativeDefineProperty(cx, throwTypeError, lengthId, nonConfigurableDesc, lengthResult)) + return nullptr; + MOZ_ASSERT(lengthResult); + + // Non-standard: Also change "name" to non-configurable. ECMAScript defines + // %ThrowTypeError% as an anonymous function, i.e. it shouldn't actually + // get an own "name" property. To be consistent with other built-in, + // anonymous functions, we don't delete %ThrowTypeError%'s "name" property. + RootedId nameId(cx, NameToId(cx->names().name)); + ObjectOpResult nameResult; + if (!NativeDefineProperty(cx, throwTypeError, nameId, nonConfigurableDesc, nameResult)) + return nullptr; + MOZ_ASSERT(nameResult); + self->setThrowTypeError(throwTypeError); return functionProto; @@ -886,80 +922,10 @@ const Class JSFunction::class_ = { const Class* const js::FunctionClassPtr = &JSFunction::class_; -/* Find the body of a function (not including braces). */ -bool -js::FindBody(JSContext* cx, HandleFunction fun, HandleLinearString src, size_t* bodyStart, - size_t* bodyEnd) -{ - // We don't need principals, since those are only used for error reporting. - CompileOptions options(cx); - options.setFileAndLine("internal-findBody", 0); - - // For asm.js/wasm modules, there's no script. - if (fun->hasScript()) - options.setVersion(fun->nonLazyScript()->getVersion()); - - AutoKeepAtoms keepAtoms(cx->perThreadData); - - AutoStableStringChars stableChars(cx); - if (!stableChars.initTwoByte(cx, src)) - return false; - - const mozilla::Range<const char16_t> srcChars = stableChars.twoByteRange(); - TokenStream ts(cx, options, srcChars.begin().get(), srcChars.length(), nullptr); - int nest = 0; - bool onward = true; - // Skip arguments list. - do { - TokenKind tt; - if (!ts.getToken(&tt)) - return false; - switch (tt) { - case TOK_NAME: - case TOK_YIELD: - if (nest == 0) - onward = false; - break; - case TOK_LP: - nest++; - break; - case TOK_RP: - if (--nest == 0) - onward = false; - break; - default: - break; - } - } while (onward); - TokenKind tt; - if (!ts.getToken(&tt)) - return false; - if (tt == TOK_ARROW) { - if (!ts.getToken(&tt)) - return false; - } - bool braced = tt == TOK_LC; - MOZ_ASSERT_IF(fun->isExprBody(), !braced); - *bodyStart = ts.currentToken().pos.begin; - if (braced) - *bodyStart += 1; - mozilla::RangedPtr<const char16_t> end = srcChars.end(); - if (end[-1] == '}') { - end--; - } else { - MOZ_ASSERT(!braced); - for (; unicode::IsSpaceOrBOM2(end[-1]); end--) - ; - } - *bodyEnd = end - srcChars.begin(); - MOZ_ASSERT(*bodyStart <= *bodyEnd); - return true; -} - JSString* js::FunctionToString(JSContext* cx, HandleFunction fun, bool prettyPrint) { - if (fun->isInterpretedLazy() && !fun->getOrCreateScript(cx)) + if (fun->isInterpretedLazy() && !JSFunction::getOrCreateScript(cx, fun)) return nullptr; if (IsAsmJSModule(fun)) @@ -989,7 +955,13 @@ js::FunctionToString(JSContext* cx, HandleFunction fun, bool prettyPrint) } bool funIsNonArrowLambda = fun->isLambda() && !fun->isArrow(); - bool haveSource = fun->isInterpreted() && !fun->isSelfHostedBuiltin(); + + // Default class constructors are self-hosted, but have their source + // objects overridden to refer to the span of the class statement or + // expression. Non-default class constructors are never self-hosted. So, + // all class constructors always have source. + bool haveSource = fun->isInterpreted() && (fun->isClassConstructor() || + !fun->isSelfHostedBuiltin()); // If we're not in pretty mode, put parentheses around lambda functions // so that eval returns lambda, not function statement. @@ -1030,7 +1002,7 @@ js::FunctionToString(JSContext* cx, HandleFunction fun, bool prettyPrint) }; if (haveSource) { - Rooted<JSFlatString*> src(cx, script->sourceDataWithPrelude(cx)); + Rooted<JSFlatString*> src(cx, JSScript::sourceDataForToString(cx, script)); if (!src) return nullptr; @@ -1041,7 +1013,20 @@ js::FunctionToString(JSContext* cx, HandleFunction fun, bool prettyPrint) if (!out.append(")")) return nullptr; } - } else if (fun->isInterpreted() && !fun->isSelfHostedBuiltin()) { + } else if (fun->isInterpreted() && + (!fun->isSelfHostedBuiltin() || + fun->infallibleIsDefaultClassConstructor(cx))) + { + // Default class constructors should always haveSource except; + // + // 1. Source has been discarded for the whole compartment. + // + // 2. The source is marked as "lazy", i.e., retrieved on demand, and + // the embedding has not provided a hook to retrieve sources. + MOZ_ASSERT_IF(fun->infallibleIsDefaultClassConstructor(cx), + !cx->runtime()->sourceHook || + !script->scriptSource()->sourceRetrievable() || + fun->compartment()->behaviors().discardSource()); if (!AppendPrelude() || !out.append("() {\n ") || !out.append("[sourceless code]") || @@ -1050,29 +1035,16 @@ js::FunctionToString(JSContext* cx, HandleFunction fun, bool prettyPrint) return nullptr; } } else { - MOZ_ASSERT(!fun->isExprBody()); - bool derived = fun->infallibleIsDefaultClassConstructor(cx); - if (derived && fun->isDerivedClassConstructor()) { - if (!AppendPrelude() || - !out.append("(...args) {\n ") || - !out.append("super(...args);\n}")) - { - return nullptr; - } - } else { - if (!AppendPrelude() || - !out.append("() {\n ")) - return nullptr; + if (!AppendPrelude() || + !out.append("() {\n ")) + return nullptr; - if (!derived) { - if (!out.append("[native code]")) - return nullptr; - } + if (!out.append("[native code]")) + return nullptr; - if (!out.append("\n}")) - return nullptr; - } + if (!out.append("\n}")) + return nullptr; } return out.finishString(); } @@ -1301,34 +1273,33 @@ JSFunction::isDerivedClassConstructor() return derived; } -bool -JSFunction::getLength(JSContext* cx, uint16_t* length) +/* static */ bool +JSFunction::getLength(JSContext* cx, HandleFunction fun, uint16_t* length) { - JS::RootedFunction self(cx, this); - MOZ_ASSERT(!self->isBoundFunction()); - if (self->isInterpretedLazy() && !self->getOrCreateScript(cx)) + MOZ_ASSERT(!fun->isBoundFunction()); + if (fun->isInterpretedLazy() && !getOrCreateScript(cx, fun)) return false; - *length = self->isNative() ? self->nargs() : self->nonLazyScript()->funLength(); + *length = fun->isNative() ? fun->nargs() : fun->nonLazyScript()->funLength(); return true; } -bool -JSFunction::getUnresolvedLength(JSContext* cx, MutableHandleValue v) +/* static */ bool +JSFunction::getUnresolvedLength(JSContext* cx, HandleFunction fun, MutableHandleValue v) { - MOZ_ASSERT(!IsInternalFunctionObject(*this)); - MOZ_ASSERT(!hasResolvedLength()); + MOZ_ASSERT(!IsInternalFunctionObject(*fun)); + MOZ_ASSERT(!fun->hasResolvedLength()); // Bound functions' length can have values up to MAX_SAFE_INTEGER, so // they're handled differently from other functions. - if (isBoundFunction()) { - MOZ_ASSERT(getExtendedSlot(BOUND_FUN_LENGTH_SLOT).isNumber()); - v.set(getExtendedSlot(BOUND_FUN_LENGTH_SLOT)); + if (fun->isBoundFunction()) { + MOZ_ASSERT(fun->getExtendedSlot(BOUND_FUN_LENGTH_SLOT).isNumber()); + v.set(fun->getExtendedSlot(BOUND_FUN_LENGTH_SLOT)); return true; } uint16_t length; - if (!getLength(cx, &length)) + if (!JSFunction::getLength(cx, fun, &length)) return false; v.setInt32(length); @@ -1385,13 +1356,11 @@ GetBoundFunctionArguments(const JSFunction* boundFun) } const js::Value& -JSFunction::getBoundFunctionArgument(JSContext* cx, unsigned which) const +JSFunction::getBoundFunctionArgument(unsigned which) const { MOZ_ASSERT(which < getBoundFunctionArgumentCount()); - RootedArrayObject boundArgs(cx, GetBoundFunctionArguments(this)); - RootedValue res(cx); - return boundArgs->getDenseElement(which); + return GetBoundFunctionArguments(this)->getDenseElement(which); } size_t @@ -1428,7 +1397,7 @@ JSFunction::createScriptForLazilyInterpretedFunction(JSContext* cx, HandleFuncti } if (fun != lazy->functionNonDelazifying()) { - if (!lazy->functionDelazifying(cx)) + if (!LazyScript::functionDelazifying(cx, lazy)) return false; script = lazy->functionNonDelazifying()->nonLazyScript(); if (!script) diff --git a/js/src/jsfun.h b/js/src/jsfun.h index 1c7da57ec..234169507 100644 --- a/js/src/jsfun.h +++ b/js/src/jsfun.h @@ -58,8 +58,6 @@ class JSFunction : public js::NativeObject CONSTRUCTOR = 0x0002, /* function that can be called as a constructor */ EXTENDED = 0x0004, /* structure is FunctionExtended */ BOUND_FUN = 0x0008, /* function was created with Function.prototype.bind. */ - EXPR_BODY = 0x0010, /* arrow function with expression body or - * expression closure: function(x) x*x */ HAS_GUESSED_ATOM = 0x0020, /* function had no explicit name, but a name was guessed for it anyway */ LAMBDA = 0x0040, /* function comes from a FunctionExpression, ArrowFunction, or @@ -102,7 +100,7 @@ class JSFunction : public js::NativeObject INTERPRETED_GENERATOR = INTERPRETED, NO_XDR_FLAGS = RESOLVED_LENGTH | RESOLVED_NAME, - STABLE_ACROSS_CLONES = CONSTRUCTOR | EXPR_BODY | HAS_GUESSED_ATOM | LAMBDA | + STABLE_ACROSS_CLONES = CONSTRUCTOR | HAS_GUESSED_ATOM | LAMBDA | SELF_HOSTED | HAS_COMPILE_TIME_NAME | FUNCTION_KIND_MASK }; @@ -187,7 +185,6 @@ class JSFunction : public js::NativeObject bool isAsmJSNative() const { return kind() == AsmJS; } /* Possible attributes of an interpreted function: */ - bool isExprBody() const { return flags() & EXPR_BODY; } bool hasCompileTimeName() const { return flags() & HAS_COMPILE_TIME_NAME; } bool hasGuessedAtom() const { return flags() & HAS_GUESSED_ATOM; } bool isLambda() const { return flags() & LAMBDA; } @@ -290,11 +287,6 @@ class JSFunction : public js::NativeObject flags_ |= SELF_HOSTED; } - // Can be called multiple times by the parser. - void setIsExprBody() { - flags_ |= EXPR_BODY; - } - void setArrow() { setKind(Arrow); } @@ -314,7 +306,8 @@ class JSFunction : public js::NativeObject nonLazyScript()->setAsyncKind(asyncKind); } - bool getUnresolvedLength(JSContext* cx, js::MutableHandleValue v); + static bool getUnresolvedLength(JSContext* cx, js::HandleFunction fun, + js::MutableHandleValue v); JSAtom* getUnresolvedName(JSContext* cx); @@ -419,16 +412,15 @@ class JSFunction : public js::NativeObject // // - For functions known to have a JSScript, nonLazyScript() will get it. - JSScript* getOrCreateScript(JSContext* cx) { - MOZ_ASSERT(isInterpreted()); + static JSScript* getOrCreateScript(JSContext* cx, js::HandleFunction fun) { + MOZ_ASSERT(fun->isInterpreted()); MOZ_ASSERT(cx); - if (isInterpretedLazy()) { - JS::RootedFunction self(cx, this); - if (!createScriptForLazilyInterpretedFunction(cx, self)) + if (fun->isInterpretedLazy()) { + if (!createScriptForLazilyInterpretedFunction(cx, fun)) return nullptr; - return self->nonLazyScript(); + return fun->nonLazyScript(); } - return nonLazyScript(); + return fun->nonLazyScript(); } JSScript* existingScriptNonDelazifying() const { @@ -486,7 +478,7 @@ class JSFunction : public js::NativeObject return u.i.s.script_; } - bool getLength(JSContext* cx, uint16_t* length); + static bool getLength(JSContext* cx, js::HandleFunction fun, uint16_t* length); js::LazyScript* lazyScript() const { MOZ_ASSERT(isInterpretedLazy() && u.i.s.lazy_); @@ -593,13 +585,17 @@ class JSFunction : public js::NativeObject return offsetof(JSFunction, u.nativeOrScript); } + static unsigned offsetOfJitInfo() { + return offsetof(JSFunction, u.n.jitinfo); + } + inline void trace(JSTracer* trc); /* Bound function accessors. */ JSObject* getBoundFunctionTarget() const; const js::Value& getBoundFunctionThis() const; - const js::Value& getBoundFunctionArgument(JSContext* cx, unsigned which) const; + const js::Value& getBoundFunctionArgument(unsigned which) const; size_t getBoundFunctionArgumentCount() const; private: @@ -802,10 +798,6 @@ CloneFunctionAndScript(JSContext* cx, HandleFunction fun, HandleObject parent, gc::AllocKind kind = gc::AllocKind::FUNCTION, HandleObject proto = nullptr); -extern bool -FindBody(JSContext* cx, HandleFunction fun, HandleLinearString src, size_t* bodyStart, - size_t* bodyEnd); - } // namespace js inline js::FunctionExtended* diff --git a/js/src/jsfuninlines.h b/js/src/jsfuninlines.h index e134def61..13fe51e26 100644 --- a/js/src/jsfuninlines.h +++ b/js/src/jsfuninlines.h @@ -88,7 +88,7 @@ CloneFunctionObjectIfNotSingleton(JSContext* cx, HandleFunction fun, HandleObjec if (CanReuseScriptForClone(cx->compartment(), fun, parent)) return CloneFunctionReuseScript(cx, fun, parent, kind, newKind, proto); - RootedScript script(cx, fun->getOrCreateScript(cx)); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, fun)); if (!script) return nullptr; RootedScope enclosingScope(cx, script->enclosingScope()); diff --git a/js/src/jsiter.cpp b/js/src/jsiter.cpp index 004c7fc0d..749e15d27 100644 --- a/js/src/jsiter.cpp +++ b/js/src/jsiter.cpp @@ -654,7 +654,7 @@ VectorToKeyIterator(JSContext* cx, HandleObject obj, unsigned flags, AutoIdVecto { MOZ_ASSERT(!(flags & JSITER_FOREACH)); - if (obj->isSingleton() && !obj->setIteratedSingleton(cx)) + if (obj->isSingleton() && !JSObject::setIteratedSingleton(cx, obj)) return false; MarkObjectGroupFlags(cx, obj, OBJECT_FLAG_ITERATED); @@ -698,7 +698,7 @@ VectorToValueIterator(JSContext* cx, HandleObject obj, unsigned flags, AutoIdVec { MOZ_ASSERT(flags & JSITER_FOREACH); - if (obj->isSingleton() && !obj->setIteratedSingleton(cx)) + if (obj->isSingleton() && !JSObject::setIteratedSingleton(cx, obj)) return false; MarkObjectGroupFlags(cx, obj, OBJECT_FLAG_ITERATED); @@ -921,7 +921,7 @@ js::CreateItrResultObject(JSContext* cx, HandleValue value, bool done) // FIXME: We can cache the iterator result object shape somewhere. AssertHeapIsIdle(cx); - RootedObject proto(cx, cx->global()->getOrCreateObjectPrototype(cx)); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, cx->global())); if (!proto) return nullptr; @@ -1497,7 +1497,7 @@ GlobalObject::initIteratorProto(JSContext* cx, Handle<GlobalObject*> global) if (global->getReservedSlot(ITERATOR_PROTO).isObject()) return true; - RootedObject proto(cx, global->createBlankPrototype<PlainObject>(cx)); + RootedObject proto(cx, GlobalObject::createBlankPrototype<PlainObject>(cx, global)); if (!proto || !DefinePropertiesAndFunctions(cx, proto, nullptr, iterator_proto_methods)) return false; @@ -1516,7 +1516,8 @@ GlobalObject::initArrayIteratorProto(JSContext* cx, Handle<GlobalObject*> global return false; const Class* cls = &ArrayIteratorPrototypeClass; - RootedObject proto(cx, global->createBlankPrototypeInheriting(cx, cls, iteratorProto)); + RootedObject proto(cx, GlobalObject::createBlankPrototypeInheriting(cx, global, cls, + iteratorProto)); if (!proto || !DefinePropertiesAndFunctions(cx, proto, nullptr, array_iterator_methods) || !DefineToStringTag(cx, proto, cx->names().ArrayIterator)) @@ -1539,7 +1540,8 @@ GlobalObject::initStringIteratorProto(JSContext* cx, Handle<GlobalObject*> globa return false; const Class* cls = &StringIteratorPrototypeClass; - RootedObject proto(cx, global->createBlankPrototypeInheriting(cx, cls, iteratorProto)); + RootedObject proto(cx, GlobalObject::createBlankPrototypeInheriting(cx, global, cls, + iteratorProto)); if (!proto || !DefinePropertiesAndFunctions(cx, proto, nullptr, string_iterator_methods) || !DefineToStringTag(cx, proto, cx->names().StringIterator)) @@ -1560,7 +1562,8 @@ js::InitLegacyIteratorClass(JSContext* cx, HandleObject obj) return &global->getPrototype(JSProto_Iterator).toObject(); RootedObject iteratorProto(cx); - iteratorProto = global->createBlankPrototype(cx, &PropertyIteratorObject::class_); + iteratorProto = GlobalObject::createBlankPrototype(cx, global, + &PropertyIteratorObject::class_); if (!iteratorProto) return nullptr; @@ -1572,7 +1575,7 @@ js::InitLegacyIteratorClass(JSContext* cx, HandleObject obj) ni->init(nullptr, nullptr, 0 /* flags */, 0, 0); Rooted<JSFunction*> ctor(cx); - ctor = global->createConstructor(cx, IteratorConstructor, cx->names().Iterator, 2); + ctor = GlobalObject::createConstructor(cx, IteratorConstructor, cx->names().Iterator, 2); if (!ctor) return nullptr; if (!LinkConstructorAndPrototype(cx, ctor, iteratorProto)) @@ -1593,7 +1596,8 @@ js::InitStopIterationClass(JSContext* cx, HandleObject obj) { Handle<GlobalObject*> global = obj.as<GlobalObject>(); if (!global->getPrototype(JSProto_StopIteration).isObject()) { - RootedObject proto(cx, global->createBlankPrototype(cx, &StopIterationObject::class_)); + RootedObject proto(cx, GlobalObject::createBlankPrototype(cx, global, + &StopIterationObject::class_)); if (!proto || !FreezeObject(cx, proto)) return nullptr; diff --git a/js/src/jsmath.cpp b/js/src/jsmath.cpp index 08fbe048c..78a231003 100644 --- a/js/src/jsmath.cpp +++ b/js/src/jsmath.cpp @@ -1417,7 +1417,8 @@ static const JSFunctionSpec math_static_methods[] = { JSObject* js::InitMathClass(JSContext* cx, HandleObject obj) { - RootedObject proto(cx, obj->as<GlobalObject>().getOrCreateObjectPrototype(cx)); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!proto) return nullptr; RootedObject Math(cx, NewObjectWithGivenProto(cx, &MathClass, proto, SingletonObject)); diff --git a/js/src/jsnum.cpp b/js/src/jsnum.cpp index 28ed15159..bde1f918e 100644 --- a/js/src/jsnum.cpp +++ b/js/src/jsnum.cpp @@ -1005,15 +1005,16 @@ js::InitNumberClass(JSContext* cx, HandleObject obj) /* XXX must do at least once per new thread, so do it per JSContext... */ FIX_FPU(); - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); - RootedObject numberProto(cx, global->createBlankPrototype(cx, &NumberObject::class_)); + RootedObject numberProto(cx, GlobalObject::createBlankPrototype(cx, global, + &NumberObject::class_)); if (!numberProto) return nullptr; numberProto->as<NumberObject>().setPrimitiveValue(0); RootedFunction ctor(cx); - ctor = global->createConstructor(cx, Number, cx->names().Number, 1); + ctor = GlobalObject::createConstructor(cx, Number, cx->names().Number, 1); if (!ctor) return nullptr; diff --git a/js/src/jsobj.cpp b/js/src/jsobj.cpp index 2364f707e..6f9596924 100644 --- a/js/src/jsobj.cpp +++ b/js/src/jsobj.cpp @@ -471,7 +471,7 @@ js::SetIntegrityLevel(JSContext* cx, HandleObject obj, IntegrityLevel level) // Steps 8-9, loosely interpreted. if (obj->isNative() && !obj->as<NativeObject>().inDictionaryMode() && - !obj->is<TypedArrayObject>()) + !obj->is<TypedArrayObject>() && !obj->is<MappedArgumentsObject>()) { HandleNativeObject nobj = obj.as<NativeObject>(); @@ -884,7 +884,7 @@ CreateThisForFunctionWithGroup(JSContext* cx, HandleObjectGroup group, if (newKind == SingletonObject) { Rooted<TaggedProto> proto(cx, TaggedProto(templateObject->staticPrototype())); - if (!res->splicePrototype(cx, &PlainObject::class_, proto)) + if (!JSObject::splicePrototype(cx, res, &PlainObject::class_, proto)) return nullptr; } else { res->setGroup(group); @@ -952,7 +952,7 @@ js::CreateThisForFunctionWithProto(JSContext* cx, HandleObject callee, HandleObj } if (res) { - JSScript* script = callee->as<JSFunction>().getOrCreateScript(cx); + JSScript* script = JSFunction::getOrCreateScript(cx, callee.as<JSFunction>()); if (!script) return nullptr; TypeScript::SetThis(cx, script, TypeSet::ObjectType(res)); @@ -1430,40 +1430,41 @@ js::XDRObjectLiteral(XDRState<XDR_ENCODE>* xdr, MutableHandleObject obj); template bool js::XDRObjectLiteral(XDRState<XDR_DECODE>* xdr, MutableHandleObject obj); -bool -NativeObject::fillInAfterSwap(JSContext* cx, const Vector<Value>& values, void* priv) +/* static */ bool +NativeObject::fillInAfterSwap(JSContext* cx, HandleNativeObject obj, + const Vector<Value>& values, void* priv) { // This object has just been swapped with some other object, and its shape // no longer reflects its allocated size. Correct this information and // fill the slots in with the specified values. - MOZ_ASSERT(slotSpan() == values.length()); + MOZ_ASSERT(obj->slotSpan() == values.length()); // Make sure the shape's numFixedSlots() is correct. - size_t nfixed = gc::GetGCKindSlots(asTenured().getAllocKind(), getClass()); - if (nfixed != shape_->numFixedSlots()) { - if (!generateOwnShape(cx)) + size_t nfixed = gc::GetGCKindSlots(obj->asTenured().getAllocKind(), obj->getClass()); + if (nfixed != obj->shape_->numFixedSlots()) { + if (!NativeObject::generateOwnShape(cx, obj)) return false; - shape_->setNumFixedSlots(nfixed); + obj->shape_->setNumFixedSlots(nfixed); } - if (hasPrivate()) - setPrivate(priv); + if (obj->hasPrivate()) + obj->setPrivate(priv); else MOZ_ASSERT(!priv); - if (slots_) { - js_free(slots_); - slots_ = nullptr; + if (obj->slots_) { + js_free(obj->slots_); + obj->slots_ = nullptr; } - if (size_t ndynamic = dynamicSlotsCount(nfixed, values.length(), getClass())) { - slots_ = cx->zone()->pod_malloc<HeapSlot>(ndynamic); - if (!slots_) + if (size_t ndynamic = dynamicSlotsCount(nfixed, values.length(), obj->getClass())) { + obj->slots_ = cx->zone()->pod_malloc<HeapSlot>(ndynamic); + if (!obj->slots_) return false; - Debug_SetSlotRangeToCrashOnTouch(slots_, ndynamic); + Debug_SetSlotRangeToCrashOnTouch(obj->slots_, ndynamic); } - initSlotRange(0, values.begin(), values.length()); + obj->initSlotRange(0, values.begin(), values.length()); return true; } @@ -1489,9 +1490,9 @@ JSObject::swap(JSContext* cx, HandleObject a, HandleObject b) AutoCompartment ac(cx, a); - if (!a->getGroup(cx)) + if (!JSObject::getGroup(cx, a)) oomUnsafe.crash("JSObject::swap"); - if (!b->getGroup(cx)) + if (!JSObject::getGroup(cx, b)) oomUnsafe.crash("JSObject::swap"); /* @@ -1573,10 +1574,14 @@ JSObject::swap(JSContext* cx, HandleObject a, HandleObject b) a->fixDictionaryShapeAfterSwap(); b->fixDictionaryShapeAfterSwap(); - if (na && !b->as<NativeObject>().fillInAfterSwap(cx, avals, apriv)) - oomUnsafe.crash("fillInAfterSwap"); - if (nb && !a->as<NativeObject>().fillInAfterSwap(cx, bvals, bpriv)) - oomUnsafe.crash("fillInAfterSwap"); + if (na) { + if (!NativeObject::fillInAfterSwap(cx, b.as<NativeObject>(), avals, apriv)) + oomUnsafe.crash("fillInAfterSwap"); + } + if (nb) { + if (!NativeObject::fillInAfterSwap(cx, a.as<NativeObject>(), bvals, bpriv)) + oomUnsafe.crash("fillInAfterSwap"); + } } // Swapping the contents of two objects invalidates type sets which contain @@ -1722,7 +1727,7 @@ DefineConstructorAndPrototype(JSContext* cx, HandleObject obj, JSProtoKey key, H /* Bootstrap Function.prototype (see also JS_InitStandardClasses). */ Rooted<TaggedProto> tagged(cx, TaggedProto(proto)); - if (ctor->getClass() == clasp && !ctor->splicePrototype(cx, clasp, tagged)) + if (ctor->getClass() == clasp && !JSObject::splicePrototype(cx, ctor, clasp, tagged)) goto bad; } @@ -1839,10 +1844,10 @@ js::SetClassAndProto(JSContext* cx, HandleObject obj, // We always generate a new shape if the object is a singleton, // regardless of the uncacheable-proto flag. ICs may rely on // this. - if (!oldproto->as<NativeObject>().generateOwnShape(cx)) + if (!NativeObject::generateOwnShape(cx, oldproto.as<NativeObject>())) return false; } else { - if (!oldproto->setUncacheableProto(cx)) + if (!JSObject::setUncacheableProto(cx, oldproto)) return false; } if (!obj->isDelegate()) { @@ -1854,15 +1859,18 @@ js::SetClassAndProto(JSContext* cx, HandleObject obj, oldproto = oldproto->staticPrototype(); } - if (proto.isObject() && !proto.toObject()->setDelegate(cx)) - return false; + if (proto.isObject()) { + RootedObject protoObj(cx, proto.toObject()); + if (!JSObject::setDelegate(cx, protoObj)) + return false; + } if (obj->isSingleton()) { /* * Just splice the prototype, but mark the properties as unknown for * consistent behavior. */ - if (!obj->splicePrototype(cx, clasp, proto)) + if (!JSObject::splicePrototype(cx, obj, clasp, proto)) return false; MarkObjectGroupUnknownProperties(cx, obj->group()); return true; @@ -1982,7 +1990,8 @@ js::GetObjectFromIncumbentGlobal(JSContext* cx, MutableHandleObject obj) { AutoCompartment ac(cx, globalObj); - obj.set(globalObj->as<GlobalObject>().getOrCreateObjectPrototype(cx)); + Handle<GlobalObject*> global = globalObj.as<GlobalObject>(); + obj.set(GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!obj) return false; } @@ -2195,7 +2204,8 @@ js::LookupNameUnqualified(JSContext* cx, HandlePropertyName name, HandleObject e // environments. if (env->is<DebugEnvironmentProxy>()) { RootedValue v(cx); - if (!env->as<DebugEnvironmentProxy>().getMaybeSentinelValue(cx, id, &v)) + Rooted<DebugEnvironmentProxy*> envProxy(cx, &env->as<DebugEnvironmentProxy>()); + if (!DebugEnvironmentProxy::getMaybeSentinelValue(cx, envProxy, id, &v)) return false; isTDZ = IsUninitializedLexical(v); } else { @@ -2326,9 +2336,18 @@ js::LookupOwnPropertyPure(ExclusiveContext* cx, JSObject* obj, jsid id, Shape** } static inline bool -NativeGetPureInline(NativeObject* pobj, Shape* shape, Value* vp) +NativeGetPureInline(NativeObject* pobj, jsid id, Shape* shape, Value* vp) { - /* Fail if we have a custom getter. */ + if (IsImplicitDenseOrTypedArrayElement(shape)) { + // For simplicity we ignore the TypedArray with string index case. + if (!JSID_IS_INT(id)) + return false; + + *vp = pobj->getDenseOrTypedArrayElement(JSID_TO_INT(id)); + return true; + } + + // Fail if we have a custom getter. if (!shape->hasDefaultGetter()) return false; @@ -2355,13 +2374,13 @@ js::GetPropertyPure(ExclusiveContext* cx, JSObject* obj, jsid id, Value* vp) return true; } - return pobj->isNative() && NativeGetPureInline(&pobj->as<NativeObject>(), shape, vp); + return pobj->isNative() && NativeGetPureInline(&pobj->as<NativeObject>(), id, shape, vp); } static inline bool NativeGetGetterPureInline(Shape* shape, JSFunction** fp) { - if (shape->hasGetterObject()) { + if (!IsImplicitDenseOrTypedArrayElement(shape) && shape->hasGetterObject()) { if (shape->getterObject()->is<JSFunction>()) { *fp = &shape->getterObject()->as<JSFunction>(); return true; @@ -2442,7 +2461,7 @@ js::HasOwnDataPropertyPure(JSContext* cx, JSObject* obj, jsid id, bool* result) return true; } -bool +/* static */ bool JSObject::reportReadOnly(JSContext* cx, jsid id, unsigned report) { RootedValue val(cx, IdToValue(id)); @@ -2451,7 +2470,7 @@ JSObject::reportReadOnly(JSContext* cx, jsid id, unsigned report) nullptr, nullptr); } -bool +/* static */ bool JSObject::reportNotConfigurable(JSContext* cx, jsid id, unsigned report) { RootedValue val(cx, IdToValue(id)); @@ -2460,10 +2479,10 @@ JSObject::reportNotConfigurable(JSContext* cx, jsid id, unsigned report) nullptr, nullptr); } -bool -JSObject::reportNotExtensible(JSContext* cx, unsigned report) +/* static */ bool +JSObject::reportNotExtensible(JSContext* cx, HandleObject obj, unsigned report) { - RootedValue val(cx, ObjectValue(*this)); + RootedValue val(cx, ObjectValue(*obj)); return ReportValueErrorFlags(cx, report, JSMSG_OBJECT_NOT_EXTENSIBLE, JSDVG_IGNORE_STACK, val, nullptr, nullptr, nullptr); @@ -2535,7 +2554,7 @@ js::SetPrototype(JSContext* cx, HandleObject obj, HandleObject proto, JS::Object // [[Prototype]] chain is always properly immutable, even in the presence // of lazy standard classes. if (obj->is<GlobalObject>()) { - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); if (!GlobalObject::ensureConstructor(cx, global, JSProto_Object)) return false; } @@ -2602,7 +2621,7 @@ js::PreventExtensions(JSContext* cx, HandleObject obj, ObjectOpResult& result, I } } - if (!obj->setFlags(cx, BaseShape::NOT_EXTENSIBLE, JSObject::GENERATE_SHAPE)) { + if (!JSObject::setFlags(cx, obj, BaseShape::NOT_EXTENSIBLE, JSObject::GENERATE_SHAPE)) { // We failed to mark the object non-extensible, so reset the frozen // flag on the elements. MOZ_ASSERT(obj->nonProxyIsExtensible()); @@ -2742,7 +2761,7 @@ js::SetImmutablePrototype(ExclusiveContext* cx, HandleObject obj, bool* succeede return Proxy::setImmutablePrototype(cx->asJSContext(), obj, succeeded); } - if (!obj->setFlags(cx, BaseShape::IMMUTABLE_PROTOTYPE)) + if (!JSObject::setFlags(cx, obj, BaseShape::IMMUTABLE_PROTOTYPE)) return false; *succeeded = true; return true; @@ -2852,24 +2871,6 @@ js::GetObjectClassName(JSContext* cx, HandleObject obj) /* * */ -bool -js::HasDataProperty(JSContext* cx, NativeObject* obj, jsid id, Value* vp) -{ - if (JSID_IS_INT(id) && obj->containsDenseElement(JSID_TO_INT(id))) { - *vp = obj->getDenseElement(JSID_TO_INT(id)); - return true; - } - - if (Shape* shape = obj->lookup(cx, id)) { - if (shape->hasDefaultGetter() && shape->hasSlot()) { - *vp = obj->getSlot(shape->slot()); - return true; - } - } - - return false; -} - extern bool PropertySpecNameToId(JSContext* cx, const char* name, MutableHandleId id, js::PinningBehavior pin = js::DoNotPinAtom); @@ -2985,7 +2986,7 @@ JS::OrdinaryToPrimitive(JSContext* cx, HandleObject obj, JSType hint, MutableHan /* Optimize (new String(...)).toString(). */ if (clasp == &StringObject::class_) { StringObject* nobj = &obj->as<StringObject>(); - if (ClassMethodIsNative(cx, nobj, &StringObject::class_, id, str_toString)) { + if (HasNativeMethodPure(nobj, cx->names().toString, str_toString, cx)) { vp.setString(nobj->unbox()); return true; } @@ -3007,7 +3008,7 @@ JS::OrdinaryToPrimitive(JSContext* cx, HandleObject obj, JSType hint, MutableHan /* Optimize new String(...).valueOf(). */ if (clasp == &StringObject::class_) { StringObject* nobj = &obj->as<StringObject>(); - if (ClassMethodIsNative(cx, nobj, &StringObject::class_, id, str_toString)) { + if (HasNativeMethodPure(nobj, cx->names().valueOf, str_toString, cx)) { vp.setString(nobj->unbox()); return true; } @@ -3016,7 +3017,7 @@ JS::OrdinaryToPrimitive(JSContext* cx, HandleObject obj, JSType hint, MutableHan /* Optimize new Number(...).valueOf(). */ if (clasp == &NumberObject::class_) { NumberObject* nobj = &obj->as<NumberObject>(); - if (ClassMethodIsNative(cx, nobj, &NumberObject::class_, id, num_valueOf)) { + if (HasNativeMethodPure(nobj, cx->names().valueOf, num_valueOf, cx)) { vp.setNumber(nobj->unbox()); return true; } @@ -3858,10 +3859,10 @@ displayAtomFromObjectGroup(ObjectGroup& group) return script->function()->displayAtom(); } -bool -JSObject::constructorDisplayAtom(JSContext* cx, js::MutableHandleAtom name) +/* static */ bool +JSObject::constructorDisplayAtom(JSContext* cx, js::HandleObject obj, js::MutableHandleAtom name) { - ObjectGroup *g = getGroup(cx); + ObjectGroup *g = JSObject::getGroup(cx, obj); if (!g) return false; diff --git a/js/src/jsobj.h b/js/src/jsobj.h index af79131af..db2c22b76 100644 --- a/js/src/jsobj.h +++ b/js/src/jsobj.h @@ -200,8 +200,8 @@ class JSObject : public js::gc::Cell GENERATE_SHAPE }; - bool setFlags(js::ExclusiveContext* cx, js::BaseShape::Flag flags, - GenerateShape generateShape = GENERATE_NONE); + static bool setFlags(js::ExclusiveContext* cx, JS::HandleObject obj, js::BaseShape::Flag flags, + GenerateShape generateShape = GENERATE_NONE); inline bool hasAllFlags(js::BaseShape::Flag flags) const; /* @@ -214,16 +214,16 @@ class JSObject : public js::gc::Cell * (see Purge{Scope,Proto}Chain in jsobj.cpp). */ inline bool isDelegate() const; - bool setDelegate(js::ExclusiveContext* cx) { - return setFlags(cx, js::BaseShape::DELEGATE, GENERATE_SHAPE); + static bool setDelegate(js::ExclusiveContext* cx, JS::HandleObject obj) { + return setFlags(cx, obj, js::BaseShape::DELEGATE, GENERATE_SHAPE); } inline bool isBoundFunction() const; inline bool hasSpecialEquality() const; inline bool watched() const; - bool setWatched(js::ExclusiveContext* cx) { - return setFlags(cx, js::BaseShape::WATCHED, GENERATE_SHAPE); + static bool setWatched(js::ExclusiveContext* cx, JS::HandleObject obj) { + return setFlags(cx, obj, js::BaseShape::WATCHED, GENERATE_SHAPE); } // A "qualified" varobj is the object on which "qualified" variable @@ -247,8 +247,8 @@ class JSObject : public js::gc::Cell // (e.g., Gecko and XPConnect), as they often wish to run scripts under a // scope that captures var bindings. inline bool isQualifiedVarObj() const; - bool setQualifiedVarObj(js::ExclusiveContext* cx) { - return setFlags(cx, js::BaseShape::QUALIFIED_VAROBJ); + static bool setQualifiedVarObj(js::ExclusiveContext* cx, JS::HandleObject obj) { + return setFlags(cx, obj, js::BaseShape::QUALIFIED_VAROBJ); } // An "unqualified" varobj is the object on which "unqualified" @@ -262,11 +262,11 @@ class JSObject : public js::gc::Cell // generate a new shape when their prototype changes, regardless of this // hasUncacheableProto flag. inline bool hasUncacheableProto() const; - bool setUncacheableProto(js::ExclusiveContext* cx) { - MOZ_ASSERT(hasStaticPrototype(), + static bool setUncacheableProto(js::ExclusiveContext* cx, JS::HandleObject obj) { + MOZ_ASSERT(obj->hasStaticPrototype(), "uncacheability as a concept is only applicable to static " "(not dynamically-computed) prototypes"); - return setFlags(cx, js::BaseShape::UNCACHEABLE_PROTO, GENERATE_SHAPE); + return setFlags(cx, obj, js::BaseShape::UNCACHEABLE_PROTO, GENERATE_SHAPE); } /* @@ -274,8 +274,8 @@ class JSObject : public js::gc::Cell * PropertyTree::MAX_HEIGHT. */ inline bool hadElementsAccess() const; - bool setHadElementsAccess(js::ExclusiveContext* cx) { - return setFlags(cx, js::BaseShape::HAD_ELEMENTS_ACCESS); + static bool setHadElementsAccess(js::ExclusiveContext* cx, JS::HandleObject obj) { + return setFlags(cx, obj, js::BaseShape::HAD_ELEMENTS_ACCESS); } /* @@ -288,7 +288,8 @@ class JSObject : public js::gc::Cell * If this object was instantiated with `new Ctor`, return the constructor's * display atom. Otherwise, return nullptr. */ - bool constructorDisplayAtom(JSContext* cx, js::MutableHandleAtom name); + static bool constructorDisplayAtom(JSContext* cx, js::HandleObject obj, + js::MutableHandleAtom name); /* * The same as constructorDisplayAtom above, however if this object has a @@ -348,7 +349,7 @@ class JSObject : public js::gc::Cell // Change an existing object to have a singleton group. static bool changeToSingleton(JSContext* cx, js::HandleObject obj); - inline js::ObjectGroup* getGroup(JSContext* cx); + static inline js::ObjectGroup* getGroup(JSContext* cx, js::HandleObject obj); const js::GCPtrObjectGroup& groupFromGC() const { /* Direct field access for use by GC. */ @@ -420,8 +421,8 @@ class JSObject : public js::gc::Cell * is purged on GC. */ inline bool isIteratedSingleton() const; - bool setIteratedSingleton(js::ExclusiveContext* cx) { - return setFlags(cx, js::BaseShape::ITERATED_SINGLETON); + static bool setIteratedSingleton(js::ExclusiveContext* cx, JS::HandleObject obj) { + return setFlags(cx, obj, js::BaseShape::ITERATED_SINGLETON); } /* @@ -433,18 +434,19 @@ class JSObject : public js::gc::Cell // Mark an object as having its 'new' script information cleared. inline bool wasNewScriptCleared() const; - bool setNewScriptCleared(js::ExclusiveContext* cx) { - return setFlags(cx, js::BaseShape::NEW_SCRIPT_CLEARED); + static bool setNewScriptCleared(js::ExclusiveContext* cx, JS::HandleObject obj) { + return setFlags(cx, obj, js::BaseShape::NEW_SCRIPT_CLEARED); } /* Set a new prototype for an object with a singleton type. */ - bool splicePrototype(JSContext* cx, const js::Class* clasp, js::Handle<js::TaggedProto> proto); + static bool splicePrototype(JSContext* cx, js::HandleObject obj, const js::Class* clasp, + js::Handle<js::TaggedProto> proto); /* * For bootstrapping, whether to splice a prototype for Function.prototype * or the global object. */ - bool shouldSplicePrototype(JSContext* cx); + bool shouldSplicePrototype(); /* * Environment chains. @@ -518,8 +520,9 @@ class JSObject : public js::gc::Cell public: static bool reportReadOnly(JSContext* cx, jsid id, unsigned report = JSREPORT_ERROR); - bool reportNotConfigurable(JSContext* cx, jsid id, unsigned report = JSREPORT_ERROR); - bool reportNotExtensible(JSContext* cx, unsigned report = JSREPORT_ERROR); + static bool reportNotConfigurable(JSContext* cx, jsid id, unsigned report = JSREPORT_ERROR); + static bool reportNotExtensible(JSContext* cx, js::HandleObject obj, + unsigned report = JSREPORT_ERROR); static bool nonNativeSetProperty(JSContext* cx, js::HandleObject obj, js::HandleId id, js::HandleValue v, js::HandleValue receiver, diff --git a/js/src/jsobjinlines.h b/js/src/jsobjinlines.h index b1d817bca..c132ee6b2 100644 --- a/js/src/jsobjinlines.h +++ b/js/src/jsobjinlines.h @@ -117,17 +117,16 @@ JSObject::setSingleton(js::ExclusiveContext* cx, js::HandleObject obj) return true; } -inline js::ObjectGroup* -JSObject::getGroup(JSContext* cx) +/* static */ inline js::ObjectGroup* +JSObject::getGroup(JSContext* cx, js::HandleObject obj) { - MOZ_ASSERT(cx->compartment() == compartment()); - if (hasLazyGroup()) { - JS::RootedObject self(cx, this); - if (cx->compartment() != compartment()) + MOZ_ASSERT(cx->compartment() == obj->compartment()); + if (obj->hasLazyGroup()) { + if (cx->compartment() != obj->compartment()) MOZ_CRASH(); - return makeLazyGroup(cx, self); + return makeLazyGroup(cx, obj); } - return group_; + return obj->group_; } inline void @@ -557,48 +556,30 @@ IsNativeFunction(const js::Value& v, JSNative native) return IsFunctionObject(v, &fun) && fun->maybeNative() == native; } -/* - * When we have an object of a builtin class, we don't quite know what its - * valueOf/toString methods are, since these methods may have been overwritten - * or shadowed. However, we can still do better than the general case by - * hard-coding the necessary properties for us to find the native we expect. - * - * TODO: a per-thread shape-based cache would be faster and simpler. - */ +// Return whether looking up a method on 'obj' definitely resolves to the +// original specified native function. The method may conservatively return +// 'false' in the case of proxies or other non-native objects. static MOZ_ALWAYS_INLINE bool -ClassMethodIsNative(JSContext* cx, NativeObject* obj, const Class* clasp, jsid methodid, JSNative native) +HasNativeMethodPure(JSObject* obj, PropertyName* name, JSNative native, JSContext* cx) { - MOZ_ASSERT(obj->getClass() == clasp); - Value v; - if (!HasDataProperty(cx, obj, methodid, &v)) { - JSObject* proto = obj->staticPrototype(); - if (!proto || proto->getClass() != clasp || !HasDataProperty(cx, &proto->as<NativeObject>(), methodid, &v)) - return false; - } + if (!GetPropertyPure(cx, obj, NameToId(name), &v)) + return false; return IsNativeFunction(v, native); } -// Return whether looking up 'valueOf' on 'obj' definitely resolves to the -// original Object.prototype.valueOf. The method may conservatively return -// 'false' in the case of proxies or other non-native objects. +// Return whether 'obj' definitely has no @@toPrimitive method. static MOZ_ALWAYS_INLINE bool -HasObjectValueOf(JSObject* obj, JSContext* cx) +HasNoToPrimitiveMethodPure(JSObject* obj, JSContext* cx) { - if (obj->is<ProxyObject>() || !obj->isNative()) + jsid id = SYMBOL_TO_JSID(cx->wellKnownSymbols().toPrimitive); + JSObject* pobj; + Shape* shape; + if (!LookupPropertyPure(cx, obj, id, &pobj, &shape)) return false; - jsid valueOf = NameToId(cx->names().valueOf); - - Value v; - while (!HasDataProperty(cx, &obj->as<NativeObject>(), valueOf, &v)) { - obj = obj->staticPrototype(); - if (!obj || obj->is<ProxyObject>() || !obj->isNative()) - return false; - } - - return IsNativeFunction(v, obj_valueOf); + return !shape; } /* ES6 draft rev 28 (2014 Oct 14) 7.1.14 */ diff --git a/js/src/json.cpp b/js/src/json.cpp index 425a2f117..08382b97b 100644 --- a/js/src/json.cpp +++ b/js/src/json.cpp @@ -971,9 +971,9 @@ static const JSFunctionSpec json_static_methods[] = { JSObject* js::InitJSONClass(JSContext* cx, HandleObject obj) { - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); - RootedObject proto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!proto) return nullptr; RootedObject JSON(cx, NewObjectWithGivenProto(cx, &JSONClass, proto, SingletonObject)); diff --git a/js/src/jsopcode.cpp b/js/src/jsopcode.cpp index 6adb5401e..d1ae3cd5e 100644 --- a/js/src/jsopcode.cpp +++ b/js/src/jsopcode.cpp @@ -132,7 +132,8 @@ js::StackUses(JSScript* script, jsbytecode* pc) return 2 + GET_ARGC(pc) + 1; default: /* stack: fun, this, [argc arguments] */ - MOZ_ASSERT(op == JSOP_CALL || op == JSOP_EVAL || op == JSOP_CALLITER || + MOZ_ASSERT(op == JSOP_CALL || op == JSOP_CALL_IGNORES_RV || op == JSOP_EVAL || + op == JSOP_CALLITER || op == JSOP_STRICTEVAL || op == JSOP_FUNCALL || op == JSOP_FUNAPPLY); return 2 + GET_ARGC(pc); } @@ -1363,6 +1364,7 @@ ExpressionDecompiler::decompilePC(jsbytecode* pc) case JSOP_NEWTARGET: return write("new.target"); case JSOP_CALL: + case JSOP_CALL_IGNORES_RV: case JSOP_CALLITER: case JSOP_FUNCALL: return decompilePCForStackOperand(pc, -int32_t(GET_ARGC(pc) + 2)) && @@ -1662,7 +1664,7 @@ DecompileArgumentFromStack(JSContext* cx, int formalIndex, char** res) /* Don't handle getters, setters or calls from fun.call/fun.apply. */ JSOp op = JSOp(*current); - if (op != JSOP_CALL && op != JSOP_NEW) + if (op != JSOP_CALL && op != JSOP_CALL_IGNORES_RV && op != JSOP_NEW) return true; if (static_cast<unsigned>(formalIndex) >= GET_ARGC(current)) @@ -1725,6 +1727,8 @@ js::CallResultEscapes(jsbytecode* pc) if (*pc == JSOP_CALL) pc += JSOP_CALL_LENGTH; + else if (*pc == JSOP_CALL_IGNORES_RV) + pc += JSOP_CALL_IGNORES_RV_LENGTH; else if (*pc == JSOP_SPREADCALL) pc += JSOP_SPREADCALL_LENGTH; else @@ -2214,6 +2218,7 @@ GenerateLcovInfo(JSContext* cx, JSCompartment* comp, GenericPrinter& out) return false; RootedScript script(cx); + RootedFunction fun(cx); do { script = queue.popCopy(); compCover.collectCodeCoverageInfo(comp, script->sourceObject(), script); @@ -2231,15 +2236,15 @@ GenerateLcovInfo(JSContext* cx, JSCompartment* comp, GenericPrinter& out) // Only continue on JSFunction objects. if (!obj->is<JSFunction>()) continue; - JSFunction& fun = obj->as<JSFunction>(); + fun = &obj->as<JSFunction>(); // Let's skip wasm for now. - if (!fun.isInterpreted()) + if (!fun->isInterpreted()) continue; // Queue the script in the list of script associated to the // current source. - JSScript* childScript = fun.getOrCreateScript(cx); + JSScript* childScript = JSFunction::getOrCreateScript(cx, fun); if (!childScript || !queue.append(childScript)) return false; } diff --git a/js/src/jsscript.cpp b/js/src/jsscript.cpp index 33ae56d6f..fc7438e3b 100644 --- a/js/src/jsscript.cpp +++ b/js/src/jsscript.cpp @@ -235,7 +235,8 @@ XDRRelazificationInfo(XDRState<mode>* xdr, HandleFunction fun, HandleScript scri { uint32_t begin = script->sourceStart(); uint32_t end = script->sourceEnd(); - uint32_t preludeStart = script->preludeStart(); + uint32_t toStringStart = script->toStringStart(); + uint32_t toStringEnd = script->toStringEnd(); uint32_t lineno = script->lineno(); uint32_t column = script->column(); @@ -243,7 +244,8 @@ XDRRelazificationInfo(XDRState<mode>* xdr, HandleFunction fun, HandleScript scri packedFields = lazy->packedFields(); MOZ_ASSERT(begin == lazy->begin()); MOZ_ASSERT(end == lazy->end()); - MOZ_ASSERT(preludeStart == lazy->preludeStart()); + MOZ_ASSERT(toStringStart == lazy->toStringStart()); + MOZ_ASSERT(toStringEnd == lazy->toStringEnd()); MOZ_ASSERT(lineno == lazy->lineno()); MOZ_ASSERT(column == lazy->column()); // We can assert we have no inner functions because we don't @@ -257,7 +259,12 @@ XDRRelazificationInfo(XDRState<mode>* xdr, HandleFunction fun, HandleScript scri if (mode == XDR_DECODE) { lazy.set(LazyScript::Create(cx, fun, script, enclosingScope, script, - packedFields, begin, end, preludeStart, lineno, column)); + packedFields, begin, end, toStringStart, lineno, column)); + + if (!lazy) + return false; + + lazy->setToStringEnd(toStringEnd); // As opposed to XDRLazyScript, we need to restore the runtime bits // of the script, as we are trying to match the fact this function @@ -319,6 +326,7 @@ js::XDRScript(XDRState<mode>* xdr, HandleScope scriptEnclosingScope, HandleScrip IsStarGenerator, IsAsync, HasRest, + IsExprBody, OwnSource, ExplicitUseStrict, SelfHosted, @@ -436,6 +444,8 @@ js::XDRScript(XDRState<mode>* xdr, HandleScope scriptEnclosingScope, HandleScrip scriptBits |= (1 << IsAsync); if (script->hasRest()) scriptBits |= (1 << HasRest); + if (script->isExprBody()) + scriptBits |= (1 << IsExprBody); if (script->hasSingletons()) scriptBits |= (1 << HasSingleton); if (script->treatAsRunOnce()) @@ -519,7 +529,7 @@ js::XDRScript(XDRState<mode>* xdr, HandleScope scriptEnclosingScope, HandleScrip sourceObject = &enclosingScript->sourceObject()->as<ScriptSourceObject>(); } - script = JSScript::Create(cx, options, sourceObject, 0, 0, 0); + script = JSScript::Create(cx, options, sourceObject, 0, 0, 0, 0); if (!script) return false; @@ -589,6 +599,8 @@ js::XDRScript(XDRState<mode>* xdr, HandleScope scriptEnclosingScope, HandleScrip script->setAsyncKind(AsyncFunction); if (scriptBits & (1 << HasRest)) script->setHasRest(); + if (scriptBits & (1 << IsExprBody)) + script->setIsExprBody(); } JS_STATIC_ASSERT(sizeof(jsbytecode) == 1); @@ -602,7 +614,9 @@ js::XDRScript(XDRState<mode>* xdr, HandleScope scriptEnclosingScope, HandleScrip return false; if (!xdr->codeUint32(&script->sourceEnd_)) return false; - if (!xdr->codeUint32(&script->preludeStart_)) + if (!xdr->codeUint32(&script->toStringStart_)) + return false; + if (!xdr->codeUint32(&script->toStringEnd_)) return false; if (!xdr->codeUint32(&lineno) || @@ -934,7 +948,8 @@ js::XDRLazyScript(XDRState<mode>* xdr, HandleScope enclosingScope, HandleScript { uint32_t begin; uint32_t end; - uint32_t preludeStart; + uint32_t toStringStart; + uint32_t toStringEnd; uint32_t lineno; uint32_t column; uint64_t packedFields; @@ -948,14 +963,16 @@ js::XDRLazyScript(XDRState<mode>* xdr, HandleScope enclosingScope, HandleScript begin = lazy->begin(); end = lazy->end(); - preludeStart = lazy->preludeStart(); + toStringStart = lazy->toStringStart(); + toStringEnd = lazy->toStringEnd(); lineno = lazy->lineno(); column = lazy->column(); packedFields = lazy->packedFields(); } if (!xdr->codeUint32(&begin) || !xdr->codeUint32(&end) || - !xdr->codeUint32(&preludeStart) || + !xdr->codeUint32(&toStringStart) || + !xdr->codeUint32(&toStringEnd) || !xdr->codeUint32(&lineno) || !xdr->codeUint32(&column) || !xdr->codeUint64(&packedFields)) { @@ -964,9 +981,10 @@ js::XDRLazyScript(XDRState<mode>* xdr, HandleScope enclosingScope, HandleScript if (mode == XDR_DECODE) { lazy.set(LazyScript::Create(cx, fun, nullptr, enclosingScope, enclosingScript, - packedFields, begin, end, preludeStart, lineno, column)); + packedFields, begin, end, toStringStart, lineno, column)); if (!lazy) return false; + lazy->setToStringEnd(toStringEnd); fun->initLazyScript(lazy); } } @@ -1010,6 +1028,15 @@ JSScript::setSourceObject(JSObject* object) sourceObject_ = object; } +void +JSScript::setDefaultClassConstructorSpan(JSObject* sourceObject, uint32_t start, uint32_t end) +{ + MOZ_ASSERT(isDefaultClassConstructor()); + setSourceObject(sourceObject); + toStringStart_ = start; + toStringEnd_ = end; +} + js::ScriptSourceObject& JSScript::scriptSourceUnwrap() const { return UncheckedUnwrap(sourceObject())->as<ScriptSourceObject>(); @@ -1430,18 +1457,18 @@ JSScript::loadSource(JSContext* cx, ScriptSource* ss, bool* worked) return true; } -JSFlatString* -JSScript::sourceData(JSContext* cx) +/* static */ JSFlatString* +JSScript::sourceData(JSContext* cx, HandleScript script) { - MOZ_ASSERT(scriptSource()->hasSourceData()); - return scriptSource()->substring(cx, sourceStart(), sourceEnd()); + MOZ_ASSERT(script->scriptSource()->hasSourceData()); + return script->scriptSource()->substring(cx, script->sourceStart(), script->sourceEnd()); } -JSFlatString* -JSScript::sourceDataWithPrelude(JSContext* cx) +/* static */ JSFlatString* +JSScript::sourceDataForToString(JSContext* cx, HandleScript script) { - MOZ_ASSERT(scriptSource()->hasSourceData()); - return scriptSource()->substring(cx, preludeStart(), sourceEnd()); + MOZ_ASSERT(script->scriptSource()->hasSourceData()); + return script->scriptSource()->substring(cx, script->toStringStart(), script->toStringEnd()); } UncompressedSourceCache::AutoHoldEntry::AutoHoldEntry() @@ -2443,9 +2470,15 @@ JSScript::initCompartment(ExclusiveContext* cx) /* static */ JSScript* JSScript::Create(ExclusiveContext* cx, const ReadOnlyCompileOptions& options, HandleObject sourceObject, uint32_t bufStart, uint32_t bufEnd, - uint32_t preludeStart) + uint32_t toStringStart, uint32_t toStringEnd) { + // bufStart and bufEnd specify the range of characters parsed by the + // Parser to produce this script. toStringStart and toStringEnd specify + // the range of characters to be returned for Function.prototype.toString. MOZ_ASSERT(bufStart <= bufEnd); + MOZ_ASSERT(toStringStart <= toStringEnd); + MOZ_ASSERT(toStringStart <= bufStart); + MOZ_ASSERT(toStringEnd >= bufEnd); RootedScript script(cx, Allocate<JSScript>(cx)); if (!script) @@ -2465,7 +2498,8 @@ JSScript::Create(ExclusiveContext* cx, const ReadOnlyCompileOptions& options, script->setSourceObject(sourceObject); script->sourceStart_ = bufStart; script->sourceEnd_ = bufEnd; - script->preludeStart_ = preludeStart; + script->toStringStart_ = toStringStart; + script->toStringEnd_ = toStringEnd; return script; } @@ -2660,6 +2694,8 @@ JSScript::initFromFunctionBox(ExclusiveContext* cx, HandleScript script, script->setAsyncKind(funbox->asyncKind()); if (funbox->hasRest()) script->setHasRest(); + if (funbox->isExprBody()) + script->setIsExprBody(); PositionalFormalParameterIter fi(script); while (fi && !fi.closedOver()) @@ -3261,7 +3297,7 @@ js::detail::CopyScript(JSContext* cx, HandleScript src, HandleScript dst, } else { if (innerFun->isInterpretedLazy()) { AutoCompartment ac(cx, innerFun); - if (!innerFun->getOrCreateScript(cx)) + if (!JSFunction::getOrCreateScript(cx, innerFun)) return false; } @@ -3320,6 +3356,7 @@ js::detail::CopyScript(JSContext* cx, HandleScript src, HandleScript dst, dst->isDefaultClassConstructor_ = src->isDefaultClassConstructor(); dst->isAsync_ = src->asyncKind() == AsyncFunction; dst->hasRest_ = src->hasRest_; + dst->isExprBody_ = src->isExprBody_; if (nconsts != 0) { GCPtrValue* vector = Rebase<GCPtrValue>(dst, src, src->consts()->vector); @@ -3399,7 +3436,7 @@ CreateEmptyScriptForClone(JSContext* cx, HandleScript src) .setVersion(src->getVersion()); return JSScript::Create(cx, options, sourceObject, src->sourceStart(), src->sourceEnd(), - src->preludeStart()); + src->toStringStart(), src->toStringEnd()); } JSScript* @@ -3950,7 +3987,7 @@ JSScript::formalLivesInArgumentsObject(unsigned argSlot) LazyScript::LazyScript(JSFunction* fun, void* table, uint64_t packedFields, uint32_t begin, uint32_t end, - uint32_t preludeStart, uint32_t lineno, uint32_t column) + uint32_t toStringStart, uint32_t lineno, uint32_t column) : script_(nullptr), function_(fun), enclosingScope_(nullptr), @@ -3959,11 +3996,13 @@ LazyScript::LazyScript(JSFunction* fun, void* table, uint64_t packedFields, packedFields_(packedFields), begin_(begin), end_(end), - preludeStart_(preludeStart), + toStringStart_(toStringStart), + toStringEnd_(end), lineno_(lineno), column_(column) { MOZ_ASSERT(begin <= end); + MOZ_ASSERT(toStringStart <= begin); } void @@ -4009,7 +4048,7 @@ LazyScript::maybeForwardedScriptSource() const /* static */ LazyScript* LazyScript::CreateRaw(ExclusiveContext* cx, HandleFunction fun, uint64_t packedFields, uint32_t begin, uint32_t end, - uint32_t preludeStart, uint32_t lineno, uint32_t column) + uint32_t toStringStart, uint32_t lineno, uint32_t column) { union { PackedView p; @@ -4038,7 +4077,7 @@ LazyScript::CreateRaw(ExclusiveContext* cx, HandleFunction fun, cx->compartment()->scheduleDelazificationForDebugger(); return new (res) LazyScript(fun, table.forget(), packed, begin, end, - preludeStart, lineno, column); + toStringStart, lineno, column); } /* static */ LazyScript* @@ -4047,7 +4086,7 @@ LazyScript::Create(ExclusiveContext* cx, HandleFunction fun, Handle<GCVector<JSFunction*, 8>> innerFunctions, JSVersion version, uint32_t begin, uint32_t end, - uint32_t preludeStart, uint32_t lineno, uint32_t column) + uint32_t toStringStart, uint32_t lineno, uint32_t column) { union { PackedView p; @@ -4059,6 +4098,7 @@ LazyScript::Create(ExclusiveContext* cx, HandleFunction fun, p.hasThisBinding = false; p.isAsync = false; p.hasRest = false; + p.isExprBody = false; p.numClosedOverBindings = closedOverBindings.length(); p.numInnerFunctions = innerFunctions.length(); p.generatorKindBits = GeneratorKindAsBits(NotGenerator); @@ -4070,7 +4110,7 @@ LazyScript::Create(ExclusiveContext* cx, HandleFunction fun, p.isDerivedClassConstructor = false; p.needsHomeObject = false; - LazyScript* res = LazyScript::CreateRaw(cx, fun, packedFields, begin, end, preludeStart, + LazyScript* res = LazyScript::CreateRaw(cx, fun, packedFields, begin, end, toStringStart, lineno, column); if (!res) return nullptr; @@ -4092,7 +4132,7 @@ LazyScript::Create(ExclusiveContext* cx, HandleFunction fun, HandleScript script, HandleScope enclosingScope, HandleScript enclosingScript, uint64_t packedFields, uint32_t begin, uint32_t end, - uint32_t preludeStart, uint32_t lineno, uint32_t column) + uint32_t toStringStart, uint32_t lineno, uint32_t column) { // Dummy atom which is not a valid property name. RootedAtom dummyAtom(cx, cx->names().comma); @@ -4101,7 +4141,7 @@ LazyScript::Create(ExclusiveContext* cx, HandleFunction fun, // holding this lazy script. HandleFunction dummyFun = fun; - LazyScript* res = LazyScript::CreateRaw(cx, fun, packedFields, begin, end, preludeStart, + LazyScript* res = LazyScript::CreateRaw(cx, fun, packedFields, begin, end, toStringStart, lineno, column); if (!res) return nullptr; @@ -4287,7 +4327,7 @@ JSScript::AutoDelazify::holdScript(JS::HandleFunction fun) script_ = fun->nonLazyScript(); } else { JSAutoCompartment ac(cx_, fun); - script_ = fun->getOrCreateScript(cx_); + script_ = JSFunction::getOrCreateScript(cx_, fun); if (script_) { oldDoNotRelazify_ = script_->doNotRelazify_; script_->setDoNotRelazify(true); diff --git a/js/src/jsscript.h b/js/src/jsscript.h index bb8635581..85eb2938d 100644 --- a/js/src/jsscript.h +++ b/js/src/jsscript.h @@ -853,19 +853,36 @@ class JSScript : public js::gc::TenuredCell uint32_t bodyScopeIndex_; /* index into the scopes array of the body scope */ - // Range of characters in scriptSource which contains this script's source. - // each field points the following location. + // Range of characters in scriptSource which contains this script's + // source, that is, the range used by the Parser to produce this script. + // + // Most scripted functions have sourceStart_ == toStringStart_ and + // sourceEnd_ == toStringEnd_. However, for functions with extra + // qualifiers (e.g. generators, async) and for class constructors (which + // need to return the entire class source), their values differ. + // + // Each field points the following locations. // // function * f(a, b) { return a + b; } // ^ ^ ^ // | | | // | sourceStart_ sourceEnd_ - // | - // preludeStart_ + // | | + // toStringStart_ toStringEnd_ + // + // And, in the case of class constructors, an additional toStringEnd + // offset is used. // + // class C { constructor() { this.field = 42; } } + // ^ ^ ^ ^ + // | | | `---------` + // | sourceStart_ sourceEnd_ | + // | | + // toStringStart_ toStringEnd_ uint32_t sourceStart_; uint32_t sourceEnd_; - uint32_t preludeStart_; + uint32_t toStringStart_; + uint32_t toStringEnd_; // Number of times the script has been called or has had backedges taken. // When running in ion, also increased for any inlined scripts. Reset if @@ -1021,12 +1038,13 @@ class JSScript : public js::gc::TenuredCell bool isAsync_:1; bool hasRest_:1; + bool isExprBody_:1; // Add padding so JSScript is gc::Cell aligned. Make padding protected // instead of private to suppress -Wunused-private-field compiler warnings. protected: #if JS_BITS_PER_WORD == 32 - uint32_t padding; + // Currently no padding is needed. #endif // @@ -1036,8 +1054,9 @@ class JSScript : public js::gc::TenuredCell public: static JSScript* Create(js::ExclusiveContext* cx, const JS::ReadOnlyCompileOptions& options, - js::HandleObject sourceObject, uint32_t sourceStart, - uint32_t sourceEnd, uint32_t preludeStart); + js::HandleObject sourceObject, + uint32_t sourceStart, uint32_t sourceEnd, + uint32_t toStringStart, uint32_t toStringEnd); void initCompartment(js::ExclusiveContext* cx); @@ -1184,8 +1203,12 @@ class JSScript : public js::gc::TenuredCell return sourceEnd_; } - size_t preludeStart() const { - return preludeStart_; + uint32_t toStringStart() const { + return toStringStart_; + } + + uint32_t toStringEnd() const { + return toStringEnd_; } bool noScriptRval() const { @@ -1329,6 +1352,13 @@ class JSScript : public js::gc::TenuredCell hasRest_ = true; } + bool isExprBody() const { + return isExprBody_; + } + void setIsExprBody() { + isExprBody_ = true; + } + void setNeedsHomeObject() { needsHomeObject_ = true; } @@ -1464,6 +1494,7 @@ class JSScript : public js::gc::TenuredCell bool isRelazifiable() const { return (selfHosted() || lazyScript) && !hasInnerFunctions_ && !types_ && !isGenerator() && !hasBaselineScript() && !hasAnyIonScript() && + !isDefaultClassConstructor() && !doNotRelazify_; } void setLazyScript(js::LazyScript* lazy) { @@ -1491,7 +1522,7 @@ class JSScript : public js::gc::TenuredCell * De-lazifies the canonical function. Must be called before entering code * that expects the function to be non-lazy. */ - inline void ensureNonLazyCanonicalFunction(JSContext* cx); + inline void ensureNonLazyCanonicalFunction(); js::ModuleObject* module() const { if (bodyScope()->is<js::ModuleScope>()) @@ -1510,8 +1541,8 @@ class JSScript : public js::gc::TenuredCell // directly, via lazy arguments or a rest parameter. bool mayReadFrameArgsDirectly(); - JSFlatString* sourceData(JSContext* cx); - JSFlatString* sourceDataWithPrelude(JSContext* cx); + static JSFlatString* sourceData(JSContext* cx, JS::HandleScript script); + static JSFlatString* sourceDataForToString(JSContext* cx, JS::HandleScript script); static bool loadSource(JSContext* cx, js::ScriptSource* ss, bool* worked); @@ -1526,6 +1557,8 @@ class JSScript : public js::gc::TenuredCell const char* filename() const { return scriptSource()->filename(); } const char* maybeForwardedFilename() const { return maybeForwardedScriptSource()->filename(); } + void setDefaultClassConstructorSpan(JSObject* sourceObject, uint32_t start, uint32_t end); + public: /* Return whether this script was compiled for 'eval' */ @@ -1931,12 +1964,11 @@ class LazyScript : public gc::TenuredCell // instead of private to suppress -Wunused-private-field compiler warnings. protected: #if JS_BITS_PER_WORD == 32 - // uint32_t padding; - // Currently no padding is needed. + uint32_t padding; #endif private: - static const uint32_t NumClosedOverBindingsBits = 21; + static const uint32_t NumClosedOverBindingsBits = 20; static const uint32_t NumInnerFunctionsBits = 20; struct PackedView { @@ -1946,7 +1978,12 @@ class LazyScript : public gc::TenuredCell uint32_t shouldDeclareArguments : 1; uint32_t hasThisBinding : 1; uint32_t isAsync : 1; + uint32_t isExprBody : 1; + uint32_t numClosedOverBindings : NumClosedOverBindingsBits; + + // -- 32bit boundary -- + uint32_t numInnerFunctions : NumInnerFunctionsBits; uint32_t generatorKindBits : 2; @@ -1975,14 +2012,15 @@ class LazyScript : public gc::TenuredCell // See the comment in JSScript for the details. uint32_t begin_; uint32_t end_; - uint32_t preludeStart_; + uint32_t toStringStart_; + uint32_t toStringEnd_; // Line and column of |begin_| position, that is the position where we // start parsing. uint32_t lineno_; uint32_t column_; LazyScript(JSFunction* fun, void* table, uint64_t packedFields, - uint32_t begin, uint32_t end, uint32_t preludeStart, + uint32_t begin, uint32_t end, uint32_t toStringStart, uint32_t lineno, uint32_t column); // Create a LazyScript without initializing the closedOverBindings and the @@ -1990,7 +2028,7 @@ class LazyScript : public gc::TenuredCell // with valid atoms and functions. static LazyScript* CreateRaw(ExclusiveContext* cx, HandleFunction fun, uint64_t packedData, uint32_t begin, uint32_t end, - uint32_t preludeStart, uint32_t lineno, uint32_t column); + uint32_t toStringStart, uint32_t lineno, uint32_t column); public: static const uint32_t NumClosedOverBindingsLimit = 1 << NumClosedOverBindingsBits; @@ -2002,7 +2040,7 @@ class LazyScript : public gc::TenuredCell const frontend::AtomVector& closedOverBindings, Handle<GCVector<JSFunction*, 8>> innerFunctions, JSVersion version, uint32_t begin, uint32_t end, - uint32_t preludeStart, uint32_t lineno, uint32_t column); + uint32_t toStringStart, uint32_t lineno, uint32_t column); // Create a LazyScript and initialize the closedOverBindings and the // innerFunctions with dummy values to be replaced in a later initialization @@ -2017,11 +2055,11 @@ class LazyScript : public gc::TenuredCell HandleScript script, HandleScope enclosingScope, HandleScript enclosingScript, uint64_t packedData, uint32_t begin, uint32_t end, - uint32_t preludeStart, uint32_t lineno, uint32_t column); + uint32_t toStringStart, uint32_t lineno, uint32_t column); void initRuntimeFields(uint64_t packedFields); - inline JSFunction* functionDelazifying(JSContext* cx) const; + static inline JSFunction* functionDelazifying(JSContext* cx, Handle<LazyScript*>); JSFunction* functionNonDelazifying() const { return function_; } @@ -2104,6 +2142,13 @@ class LazyScript : public gc::TenuredCell p_.hasRest = true; } + bool isExprBody() const { + return p_.isExprBody; + } + void setIsExprBody() { + p_.isExprBody = true; + } + bool strict() const { return p_.strict; } @@ -2190,8 +2235,11 @@ class LazyScript : public gc::TenuredCell uint32_t end() const { return end_; } - uint32_t preludeStart() const { - return preludeStart_; + uint32_t toStringStart() const { + return toStringStart_; + } + uint32_t toStringEnd() const { + return toStringEnd_; } uint32_t lineno() const { return lineno_; @@ -2200,6 +2248,12 @@ class LazyScript : public gc::TenuredCell return column_; } + void setToStringEnd(uint32_t toStringEnd) { + MOZ_ASSERT(toStringStart_ <= toStringEnd); + MOZ_ASSERT(toStringEnd_ >= end_); + toStringEnd_ = toStringEnd; + } + bool hasUncompiledEnclosingScript() const; friend class GCMarker; diff --git a/js/src/jsscriptinlines.h b/js/src/jsscriptinlines.h index da23804ac..e1052111b 100644 --- a/js/src/jsscriptinlines.h +++ b/js/src/jsscriptinlines.h @@ -74,13 +74,13 @@ void SetFrameArgumentsObject(JSContext* cx, AbstractFramePtr frame, HandleScript script, JSObject* argsobj); -inline JSFunction* -LazyScript::functionDelazifying(JSContext* cx) const +/* static */ inline JSFunction* +LazyScript::functionDelazifying(JSContext* cx, Handle<LazyScript*> script) { - Rooted<const LazyScript*> self(cx, this); - if (self->function_ && !self->function_->getOrCreateScript(cx)) + RootedFunction fun(cx, script->function_); + if (script->function_ && !JSFunction::getOrCreateScript(cx, fun)) return nullptr; - return self->function_; + return script->function_; } } // namespace js @@ -100,7 +100,7 @@ JSScript::functionDelazifying() const } inline void -JSScript::ensureNonLazyCanonicalFunction(JSContext* cx) +JSScript::ensureNonLazyCanonicalFunction() { // Infallibly delazify the canonical script. JSFunction* fun = function(); diff --git a/js/src/jsstr.cpp b/js/src/jsstr.cpp index d7db5129d..74f61b87d 100644 --- a/js/src/jsstr.cpp +++ b/js/src/jsstr.cpp @@ -461,9 +461,13 @@ ToStringForStringFunction(JSContext* cx, HandleValue thisv) RootedObject obj(cx, &thisv.toObject()); if (obj->is<StringObject>()) { StringObject* nobj = &obj->as<StringObject>(); - Rooted<jsid> id(cx, NameToId(cx->names().toString)); - if (ClassMethodIsNative(cx, nobj, &StringObject::class_, id, str_toString)) + // We have to make sure that the ToPrimitive call from ToString + // would be unobservable. + if (HasNoToPrimitiveMethodPure(nobj, cx) && + HasNativeMethodPure(nobj, cx->names().toString, str_toString, cx)) + { return nobj->unbox(); + } } } else if (thisv.isNullOrUndefined()) { JS_ReportErrorNumberASCII(cx, GetErrorMessage, nullptr, JSMSG_CANT_CONVERT_TO, @@ -2901,8 +2905,8 @@ StringObject::assignInitialShape(ExclusiveContext* cx, Handle<StringObject*> obj { MOZ_ASSERT(obj->empty()); - return obj->addDataProperty(cx, cx->names().length, LENGTH_SLOT, - JSPROP_PERMANENT | JSPROP_READONLY); + return NativeObject::addDataProperty(cx, obj, cx->names().length, LENGTH_SLOT, + JSPROP_PERMANENT | JSPROP_READONLY); } JSObject* @@ -2910,17 +2914,20 @@ js::InitStringClass(JSContext* cx, HandleObject obj) { MOZ_ASSERT(obj->isNative()); - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); Rooted<JSString*> empty(cx, cx->runtime()->emptyString); - RootedObject proto(cx, global->createBlankPrototype(cx, &StringObject::class_)); - if (!proto || !proto->as<StringObject>().init(cx, empty)) + RootedObject proto(cx, GlobalObject::createBlankPrototype(cx, global, &StringObject::class_)); + if (!proto) + return nullptr; + Handle<StringObject*> protoObj = proto.as<StringObject>(); + if (!StringObject::init(cx, protoObj, empty)) return nullptr; /* Now create the String function. */ RootedFunction ctor(cx); - ctor = global->createConstructor(cx, StringConstructor, cx->names().String, 1, - AllocKind::FUNCTION, &jit::JitInfo_String); + ctor = GlobalObject::createConstructor(cx, StringConstructor, cx->names().String, 1, + AllocKind::FUNCTION, &jit::JitInfo_String); if (!ctor) return nullptr; diff --git a/js/src/jswatchpoint.cpp b/js/src/jswatchpoint.cpp index e37323555..34479a990 100644 --- a/js/src/jswatchpoint.cpp +++ b/js/src/jswatchpoint.cpp @@ -64,7 +64,7 @@ WatchpointMap::watch(JSContext* cx, HandleObject obj, HandleId id, { MOZ_ASSERT(JSID_IS_STRING(id) || JSID_IS_INT(id) || JSID_IS_SYMBOL(id)); - if (!obj->setWatched(cx)) + if (!JSObject::setWatched(cx, obj)) return false; Watchpoint w(handler, closure, false); diff --git a/js/src/jswrapper.h b/js/src/jswrapper.h index 84ebe2732..5f3704e32 100644 --- a/js/src/jswrapper.h +++ b/js/src/jswrapper.h @@ -136,7 +136,7 @@ class JS_FRIEND_API(Wrapper) : public BaseProxyHandler static JSObject* New(JSContext* cx, JSObject* obj, const Wrapper* handler, const WrapperOptions& options = WrapperOptions()); - static JSObject* Renew(JSContext* cx, JSObject* existing, JSObject* obj, const Wrapper* handler); + static JSObject* Renew(JSObject* existing, JSObject* obj, const Wrapper* handler); static const Wrapper* wrapperHandler(JSObject* wrapper); diff --git a/js/src/moz.build b/js/src/moz.build index eb30866c8..a0f074d1c 100644 --- a/js/src/moz.build +++ b/js/src/moz.build @@ -619,11 +619,11 @@ else: 'perf/pm_stub.cpp' ] -GENERATED_FILES += ['jsautokw.h'] -jsautokw = GENERATED_FILES['jsautokw.h'] -jsautokw.script = 'jsautokw.py' -jsautokw.inputs += [ - 'vm/Keywords.h' +GENERATED_FILES += ['frontend/ReservedWordsGenerated.h'] +ReservedWordsGenerated = GENERATED_FILES['frontend/ReservedWordsGenerated.h'] +ReservedWordsGenerated.script = 'frontend/GenerateReservedWords.py' +ReservedWordsGenerated.inputs += [ + 'frontend/ReservedWords.h' ] # JavaScript must be built shared, even for static builds, as it is used by diff --git a/js/src/proxy/CrossCompartmentWrapper.cpp b/js/src/proxy/CrossCompartmentWrapper.cpp index 2a6cb5400..246639956 100644 --- a/js/src/proxy/CrossCompartmentWrapper.cpp +++ b/js/src/proxy/CrossCompartmentWrapper.cpp @@ -89,7 +89,7 @@ CrossCompartmentWrapper::getPrototype(JSContext* cx, HandleObject wrapper, if (!GetPrototype(cx, wrapped, protop)) return false; if (protop) { - if (!protop->setDelegate(cx)) + if (!JSObject::setDelegate(cx, protop)) return false; } } @@ -122,7 +122,7 @@ CrossCompartmentWrapper::getPrototypeIfOrdinary(JSContext* cx, HandleObject wrap return true; if (protop) { - if (!protop->setDelegate(cx)) + if (!JSObject::setDelegate(cx, protop)) return false; } } diff --git a/js/src/proxy/Proxy.cpp b/js/src/proxy/Proxy.cpp index b43fd02d2..2c1cffb77 100644 --- a/js/src/proxy/Proxy.cpp +++ b/js/src/proxy/Proxy.cpp @@ -774,7 +774,7 @@ js::NewProxyObject(JSContext* cx, const BaseProxyHandler* handler, HandleValue p } void -ProxyObject::renew(JSContext* cx, const BaseProxyHandler* handler, const Value& priv) +ProxyObject::renew(const BaseProxyHandler* handler, const Value& priv) { MOZ_ASSERT(!IsInsideNursery(this)); MOZ_ASSERT_IF(IsCrossCompartmentWrapper(this), IsDeadProxyObject(this)); @@ -796,9 +796,9 @@ js::InitProxyClass(JSContext* cx, HandleObject obj) JS_FS_END }; - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); RootedFunction ctor(cx); - ctor = global->createConstructor(cx, proxy, cx->names().Proxy, 2); + ctor = GlobalObject::createConstructor(cx, proxy, cx->names().Proxy, 2); if (!ctor) return nullptr; diff --git a/js/src/proxy/Wrapper.cpp b/js/src/proxy/Wrapper.cpp index 43d559ff3..67f437262 100644 --- a/js/src/proxy/Wrapper.cpp +++ b/js/src/proxy/Wrapper.cpp @@ -312,9 +312,9 @@ Wrapper::New(JSContext* cx, JSObject* obj, const Wrapper* handler, } JSObject* -Wrapper::Renew(JSContext* cx, JSObject* existing, JSObject* obj, const Wrapper* handler) +Wrapper::Renew(JSObject* existing, JSObject* obj, const Wrapper* handler) { - existing->as<ProxyObject>().renew(cx, handler, ObjectValue(*obj)); + existing->as<ProxyObject>().renew(handler, ObjectValue(*obj)); return existing; } diff --git a/js/src/shell/js.cpp b/js/src/shell/js.cpp index 617b5e902..51cd11fe8 100644 --- a/js/src/shell/js.cpp +++ b/js/src/shell/js.cpp @@ -2310,7 +2310,7 @@ ValueToScript(JSContext* cx, HandleValue v, JSFunction** funp = nullptr) return nullptr; } - JSScript* script = fun->getOrCreateScript(cx); + JSScript* script = JSFunction::getOrCreateScript(cx, fun); if (!script) return nullptr; @@ -2550,6 +2550,14 @@ SrcNotes(JSContext* cx, HandleScript script, Sprinter* sp) return false; break; + case SRC_CLASS_SPAN: { + unsigned startOffset = GetSrcNoteOffset(sn, 0); + unsigned endOffset = GetSrcNoteOffset(sn, 1); + if (!sp->jsprintf(" %u %u", startOffset, endOffset)) + return false; + break; + } + default: MOZ_ASSERT_UNREACHABLE("unrecognized srcnote"); } @@ -2689,7 +2697,7 @@ DisassembleScript(JSContext* cx, HandleScript script, HandleFunction fun, if (sp->put(" CONSTRUCTOR") < 0) return false; } - if (fun->isExprBody()) { + if (script->isExprBody()) { if (sp->put(" EXPRESSION_CLOSURE") < 0) return false; } @@ -2726,7 +2734,7 @@ DisassembleScript(JSContext* cx, HandleScript script, HandleFunction fun, RootedFunction fun(cx, &obj->as<JSFunction>()); if (fun->isInterpreted()) { - RootedScript script(cx, fun->getOrCreateScript(cx)); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, fun)); if (script) { if (!DisassembleScript(cx, script, fun, lines, recursive, sourceNotes, sp)) return false; @@ -3488,8 +3496,8 @@ GroupOf(JSContext* cx, unsigned argc, JS::Value* vp) JS_ReportErrorASCII(cx, "groupOf: object expected"); return false; } - JSObject* obj = &args[0].toObject(); - ObjectGroup* group = obj->getGroup(cx); + RootedObject obj(cx, &args[0].toObject()); + ObjectGroup* group = JSObject::getGroup(cx, obj); if (!group) return false; args.rval().set(JS_NumberValue(double(uintptr_t(group) >> 3))); @@ -5403,7 +5411,7 @@ DumpScopeChain(JSContext* cx, unsigned argc, Value* vp) ReportUsageErrorASCII(cx, callee, "Argument must be an interpreted function"); return false; } - script = fun->getOrCreateScript(cx); + script = JSFunction::getOrCreateScript(cx, fun); } else { script = obj->as<ModuleObject>().script(); } @@ -6419,6 +6427,14 @@ CreateLastWarningObject(JSContext* cx, JSErrorReport* report) if (!DefineProperty(cx, warningObj, cx->names().columnNumber, columnVal)) return false; + RootedObject notesArray(cx, CreateErrorNotesArray(cx, report)); + if (!notesArray) + return false; + + RootedValue notesArrayVal(cx, ObjectValue(*notesArray)); + if (!DefineProperty(cx, warningObj, cx->names().notes, notesArrayVal)) + return false; + GetShellContext(cx)->lastWarning.setObject(*warningObj); return true; } diff --git a/js/src/tests/ecma_2017/AsyncFunctions/await-error.js b/js/src/tests/ecma_2017/AsyncFunctions/await-error.js new file mode 100644 index 000000000..1f40ea8a0 --- /dev/null +++ b/js/src/tests/ecma_2017/AsyncFunctions/await-error.js @@ -0,0 +1,16 @@ +var BUGNUMBER = 1317153; +var summary = "await outside of async function should provide better error"; + +print(BUGNUMBER + ": " + summary); + +let caught = false; +try { + eval("await 10"); +} catch(e) { + assertEq(e.message, "await is only valid in async functions"); + caught = true; +} +assertEq(caught, true); + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_2017/AsyncFunctions/await-in-arrow-parameters.js b/js/src/tests/ecma_2017/AsyncFunctions/await-in-arrow-parameters.js new file mode 100644 index 000000000..ebb4ea9da --- /dev/null +++ b/js/src/tests/ecma_2017/AsyncFunctions/await-in-arrow-parameters.js @@ -0,0 +1,94 @@ +var ieval = eval; +var AsyncFunction = async function(){}.constructor; + +var functionContext = { + Function: { + constructor: Function, + toSourceBody: code => `function f() { ${code} }`, + toSourceParameter: code => `function f(x = ${code}) { }`, + }, + AsyncFunction: { + constructor: AsyncFunction, + toSourceBody: code => `async function f() { ${code} }`, + toSourceParameter: code => `async function f(x = ${code}) { }`, + }, +}; + +function assertSyntaxError(kind, code) { + var {constructor, toSourceBody, toSourceParameter} = functionContext[kind]; + var body = toSourceBody(code); + var parameter = toSourceParameter(code); + + assertThrowsInstanceOf(() => { constructor(code); }, SyntaxError, constructor.name + ":" + code); + assertThrowsInstanceOf(() => { constructor(`x = ${code}`, ""); }, SyntaxError, constructor.name + ":" + code); + + assertThrowsInstanceOf(() => { eval(body); }, SyntaxError, "eval:" + body); + assertThrowsInstanceOf(() => { ieval(body); }, SyntaxError, "indirect eval:" + body); + + assertThrowsInstanceOf(() => { eval(parameter); }, SyntaxError, "eval:" + parameter); + assertThrowsInstanceOf(() => { ieval(parameter); }, SyntaxError, "indirect eval:" + parameter); +} + +function assertNoSyntaxError(kind, code) { + var {constructor, toSourceBody, toSourceParameter} = functionContext[kind]; + var body = toSourceBody(code); + var parameter = toSourceParameter(code); + + constructor(code); + constructor(`x = ${code}`, ""); + + eval(body); + ieval(body); + + eval(parameter); + ieval(parameter); +} + +function assertSyntaxErrorAsync(code) { + assertNoSyntaxError("Function", code); + assertSyntaxError("AsyncFunction", code); +} + +function assertSyntaxErrorBoth(code) { + assertSyntaxError("Function", code); + assertSyntaxError("AsyncFunction", code); +} + + +// Bug 1353691 +// |await| expression is invalid in arrow functions in async-context. +// |await/r/g| first parses as |AwaitExpression RegularExpressionLiteral|, when reparsing the +// arrow function, it is parsed as |IdentRef DIV IdentRef DIV IdentRef|. We need to ensure in this +// case, that we still treat |await| as a keyword and hence throw a SyntaxError. +assertSyntaxErrorAsync("(a = await/r/g) => {}"); +assertSyntaxErrorBoth("async(a = await/r/g) => {}"); + +// Also applies when nesting arrow functions. +assertSyntaxErrorAsync("(a = (b = await/r/g) => {}) => {}"); +assertSyntaxErrorBoth("async(a = (b = await/r/g) => {}) => {}"); +assertSyntaxErrorBoth("(a = async(b = await/r/g) => {}) => {}"); +assertSyntaxErrorBoth("async(a = async(b = await/r/g) => {}) => {}"); + + +// Bug 1355860 +// |await| cannot be used as rest-binding parameter in arrow functions in async-context. +assertSyntaxErrorAsync("(...await) => {}"); +assertSyntaxErrorBoth("async(...await) => {}"); + +assertSyntaxErrorAsync("(a, ...await) => {}"); +assertSyntaxErrorBoth("async(a, ...await) => {}"); + +// Also test nested arrow functions. +assertSyntaxErrorAsync("(a = (...await) => {}) => {}"); +assertSyntaxErrorBoth("(a = async(...await) => {}) => {}"); +assertSyntaxErrorBoth("async(a = (...await) => {}) => {}"); +assertSyntaxErrorBoth("async(a = async(...await) => {}) => {}"); + +assertSyntaxErrorAsync("(a = (b, ...await) => {}) => {}"); +assertSyntaxErrorBoth("(a = async(b, ...await) => {}) => {}"); +assertSyntaxErrorBoth("async(a = (b, ...await) => {}) => {}"); +assertSyntaxErrorBoth("async(a = async(b, ...await) => {}) => {}"); + + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_2017/AsyncFunctions/forbidden-as-consequent.js b/js/src/tests/ecma_2017/AsyncFunctions/forbidden-as-consequent.js new file mode 100644 index 000000000..656ed46de --- /dev/null +++ b/js/src/tests/ecma_2017/AsyncFunctions/forbidden-as-consequent.js @@ -0,0 +1,14 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +assertThrowsInstanceOf(() => eval("if (1) async function foo() {}"), + SyntaxError); +assertThrowsInstanceOf(() => eval("'use strict'; if (1) async function foo() {}"), + SyntaxError); + +var async = 42; +assertEq(eval("if (1) async \n function foo() {}"), 42); + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_2017/AsyncFunctions/inner-caller.js b/js/src/tests/ecma_2017/AsyncFunctions/inner-caller.js new file mode 100644 index 000000000..523eb79ea --- /dev/null +++ b/js/src/tests/ecma_2017/AsyncFunctions/inner-caller.js @@ -0,0 +1,26 @@ +var BUGNUMBER = 1185106; +var summary = "caller property of function inside async function should return wrapped async function"; + +print(BUGNUMBER + ": " + summary); + +(async function f() { + var inner = (function g() { + return g.caller; + })(); + assertEq(inner, f); +})(); + +(async function f() { + "use strict"; + try { + (function g() { + return g.caller; + })(); + assertEq(true, false); + } catch (e) { + assertEq(e instanceof TypeError, true); + } +})(); + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_6/Class/parenExprToString.js b/js/src/tests/ecma_6/Class/parenExprToString.js new file mode 100644 index 000000000..a93972ce9 --- /dev/null +++ b/js/src/tests/ecma_6/Class/parenExprToString.js @@ -0,0 +1,8 @@ +// Test that parenthesized class expressions don't get their toString offsets +// messed up. + +assertEq((class {}).toString(), "class {}"); +assertEq(((class {})).toString(), "class {}"); + +if (typeof reportCompare === "function") + reportCompare(0, 0, "OK"); diff --git a/js/src/tests/ecma_6/Comprehensions/for-reserved-word.js b/js/src/tests/ecma_6/Comprehensions/for-reserved-word.js new file mode 100644 index 000000000..9b320fc91 --- /dev/null +++ b/js/src/tests/ecma_6/Comprehensions/for-reserved-word.js @@ -0,0 +1,107 @@ +var BUGNUMBER = 1340089; +var summary = "Comprehension should check the binding names"; + +print(BUGNUMBER + ": " + summary); + +// Non strict mode. +// Keywords, literals, 'let', and 'yield' are not allowed. + +assertThrowsInstanceOf(function () { + eval("[for (true of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + eval("(for (true of [1]) 2)"); +}, SyntaxError); + +assertThrowsInstanceOf(function () { + eval("[for (throw of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + eval("(for (throw of [1]) 2)"); +}, SyntaxError); + +assertThrowsInstanceOf(function () { + eval("[for (let of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + eval("(for (let of [1]) 2)"); +}, SyntaxError); + +assertThrowsInstanceOf(function () { + eval("[for (yield of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + eval("(for (yield of [1]) 2)"); +}, SyntaxError); + +eval("[for (public of [1]) 2]"); +eval("(for (public of [1]) 2)"); + +eval("[for (static of [1]) 2]"); +eval("(for (static of [1]) 2)"); + +// Strict mode. +// All reserved words are not allowed. + +assertThrowsInstanceOf(function () { + "use strict"; + eval("[for (true of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + "use strict"; + eval("(for (true of [1]) 2)"); +}, SyntaxError); + +assertThrowsInstanceOf(function () { + "use strict"; + eval("[for (throw of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + "use strict"; + eval("(for (throw of [1]) 2)"); +}, SyntaxError); + +assertThrowsInstanceOf(function () { + "use strict"; + eval("[for (let of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + "use strict"; + eval("(for (let of [1]) 2)"); +}, SyntaxError); + +assertThrowsInstanceOf(function () { + "use strict"; + eval("[for (yield of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + "use strict"; + eval("(for (yield of [1]) 2)"); +}, SyntaxError); + +assertThrowsInstanceOf(function () { + "use strict"; + eval("[for (public of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + "use strict"; + eval("(for (public of [1]) 2)"); +}, SyntaxError); + +assertThrowsInstanceOf(function () { + "use strict"; + eval("[for (static of [1]) 2]"); +}, SyntaxError); +assertThrowsInstanceOf(function () { + "use strict"; + eval("(for (static of [1]) 2)"); +}, SyntaxError); + +(function () { + "use strict"; + eval("[for (await of [1]) 2]"); + eval("(for (await of [1]) 2)"); +})(); + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_6/Function/constructor-binding.js b/js/src/tests/ecma_6/Function/constructor-binding.js new file mode 100644 index 000000000..e82274d27 --- /dev/null +++ b/js/src/tests/ecma_6/Function/constructor-binding.js @@ -0,0 +1,11 @@ +var BUGNUMBER = 636635; +var summary = "A function created by Function constructor shouldn't have anonymous binding"; + +print(BUGNUMBER + ": " + summary); + +assertEq(new Function("return typeof anonymous")(), "undefined"); +assertEq(new Function("return function() { return typeof anonymous; }")()(), "undefined"); +assertEq(new Function("return function() { eval(''); return typeof anonymous; }")()(), "undefined"); + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_6/Function/throw-type-error.js b/js/src/tests/ecma_6/Function/throw-type-error.js new file mode 100644 index 000000000..68dd6e1d0 --- /dev/null +++ b/js/src/tests/ecma_6/Function/throw-type-error.js @@ -0,0 +1,16 @@ +// Any copyright is dedicated to the Public Domain. +// http://creativecommons.org/publicdomain/zero/1.0/ + +const ThrowTypeError = function(){ + "use strict"; + return Object.getOwnPropertyDescriptor(arguments, "callee").get; +}(); + +assertDeepEq(Object.getOwnPropertyDescriptor(ThrowTypeError, "length"), { + value: 0, writable: false, enumerable: false, configurable: false +}); + +assertEq(Object.isFrozen(ThrowTypeError), true); + +if (typeof reportCompare == "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_6/Generators/forbidden-as-consequent.js b/js/src/tests/ecma_6/Generators/forbidden-as-consequent.js new file mode 100644 index 000000000..13647e154 --- /dev/null +++ b/js/src/tests/ecma_6/Generators/forbidden-as-consequent.js @@ -0,0 +1,11 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +assertThrowsInstanceOf(() => eval("if (1) function* foo() {}"), + SyntaxError); +assertThrowsInstanceOf(() => eval("'use strict'; if (1) function* foo() {}"), + SyntaxError); + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_6/LexicalEnvironment/block-scoped-functions-annex-b-parameter.js b/js/src/tests/ecma_6/LexicalEnvironment/block-scoped-functions-annex-b-parameter.js new file mode 100644 index 000000000..ae7fbe879 --- /dev/null +++ b/js/src/tests/ecma_6/LexicalEnvironment/block-scoped-functions-annex-b-parameter.js @@ -0,0 +1,21 @@ +// Annex B.3.3.1 disallows Annex B lexical function behavior when redeclaring a +// parameter. + +(function(f) { + if (true) function f() { } + assertEq(f, 123); +}(123)); + +(function(f) { + { function f() { } } + assertEq(f, 123); +}(123)); + +(function(f = 123) { + assertEq(f, 123); + { function f() { } } + assertEq(f, 123); +}()); + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/ecma_6/TemplateStrings/tagTempl.js b/js/src/tests/ecma_6/TemplateStrings/tagTempl.js index 1e3f52bfb..99c2098dc 100644 --- a/js/src/tests/ecma_6/TemplateStrings/tagTempl.js +++ b/js/src/tests/ecma_6/TemplateStrings/tagTempl.js @@ -287,5 +287,176 @@ assertEq(String.raw`h\r\ney${4}there\n`, "h\\r\\ney4there\\n"); assertEq(String.raw`hey`, "hey"); assertEq(String.raw``, ""); +// Invalid escape sequences +check(raw`\01`, ["\\01"]); +check(raw`\01${0}right`, ["\\01","right"]); +check(raw`left${0}\01`, ["left","\\01"]); +check(raw`left${0}\01${1}right`, ["left","\\01","right"]); +check(raw`\1`, ["\\1"]); +check(raw`\1${0}right`, ["\\1","right"]); +check(raw`left${0}\1`, ["left","\\1"]); +check(raw`left${0}\1${1}right`, ["left","\\1","right"]); +check(raw`\xg`, ["\\xg"]); +check(raw`\xg${0}right`, ["\\xg","right"]); +check(raw`left${0}\xg`, ["left","\\xg"]); +check(raw`left${0}\xg${1}right`, ["left","\\xg","right"]); +check(raw`\xAg`, ["\\xAg"]); +check(raw`\xAg${0}right`, ["\\xAg","right"]); +check(raw`left${0}\xAg`, ["left","\\xAg"]); +check(raw`left${0}\xAg${1}right`, ["left","\\xAg","right"]); +check(raw`\u0`, ["\\u0"]); +check(raw`\u0${0}right`, ["\\u0","right"]); +check(raw`left${0}\u0`, ["left","\\u0"]); +check(raw`left${0}\u0${1}right`, ["left","\\u0","right"]); +check(raw`\u0g`, ["\\u0g"]); +check(raw`\u0g${0}right`, ["\\u0g","right"]); +check(raw`left${0}\u0g`, ["left","\\u0g"]); +check(raw`left${0}\u0g${1}right`, ["left","\\u0g","right"]); +check(raw`\u00g`, ["\\u00g"]); +check(raw`\u00g${0}right`, ["\\u00g","right"]); +check(raw`left${0}\u00g`, ["left","\\u00g"]); +check(raw`left${0}\u00g${1}right`, ["left","\\u00g","right"]); +check(raw`\u000g`, ["\\u000g"]); +check(raw`\u000g${0}right`, ["\\u000g","right"]); +check(raw`left${0}\u000g`, ["left","\\u000g"]); +check(raw`left${0}\u000g${1}right`, ["left","\\u000g","right"]); +check(raw`\u{}`, ["\\u{}"]); +check(raw`\u{}${0}right`, ["\\u{}","right"]); +check(raw`left${0}\u{}`, ["left","\\u{}"]); +check(raw`left${0}\u{}${1}right`, ["left","\\u{}","right"]); +check(raw`\u{-0}`, ["\\u{-0}"]); +check(raw`\u{-0}${0}right`, ["\\u{-0}","right"]); +check(raw`left${0}\u{-0}`, ["left","\\u{-0}"]); +check(raw`left${0}\u{-0}${1}right`, ["left","\\u{-0}","right"]); +check(raw`\u{g}`, ["\\u{g}"]); +check(raw`\u{g}${0}right`, ["\\u{g}","right"]); +check(raw`left${0}\u{g}`, ["left","\\u{g}"]); +check(raw`left${0}\u{g}${1}right`, ["left","\\u{g}","right"]); +check(raw`\u{0`, ["\\u{0"]); +check(raw`\u{0${0}right`, ["\\u{0","right"]); +check(raw`left${0}\u{0`, ["left","\\u{0"]); +check(raw`left${0}\u{0${1}right`, ["left","\\u{0","right"]); +check(raw`\u{\u{0}`, ["\\u{\\u{0}"]); +check(raw`\u{\u{0}${0}right`, ["\\u{\\u{0}","right"]); +check(raw`left${0}\u{\u{0}`, ["left","\\u{\\u{0}"]); +check(raw`left${0}\u{\u{0}${1}right`, ["left","\\u{\\u{0}","right"]); +check(raw`\u{110000}`, ["\\u{110000}"]); +check(raw`\u{110000}${0}right`, ["\\u{110000}","right"]); +check(raw`left${0}\u{110000}`, ["left","\\u{110000}"]); +check(raw`left${0}\u{110000}${1}right`, ["left","\\u{110000}","right"]); + +check(cooked`\01`, [void 0]); +check(cooked`\01${0}right`, [void 0,"right"]); +check(cooked`left${0}\01`, ["left",void 0]); +check(cooked`left${0}\01${1}right`, ["left",void 0,"right"]); +check(cooked`\1`, [void 0]); +check(cooked`\1${0}right`, [void 0,"right"]); +check(cooked`left${0}\1`, ["left",void 0]); +check(cooked`left${0}\1${1}right`, ["left",void 0,"right"]); +check(cooked`\xg`, [void 0]); +check(cooked`\xg${0}right`, [void 0,"right"]); +check(cooked`left${0}\xg`, ["left",void 0]); +check(cooked`left${0}\xg${1}right`, ["left",void 0,"right"]); +check(cooked`\xAg`, [void 0]); +check(cooked`\xAg${0}right`, [void 0,"right"]); +check(cooked`left${0}\xAg`, ["left",void 0]); +check(cooked`left${0}\xAg${1}right`, ["left",void 0,"right"]); +check(cooked`\u0`, [void 0]); +check(cooked`\u0${0}right`, [void 0,"right"]); +check(cooked`left${0}\u0`, ["left",void 0]); +check(cooked`left${0}\u0${1}right`, ["left",void 0,"right"]); +check(cooked`\u0g`, [void 0]); +check(cooked`\u0g${0}right`, [void 0,"right"]); +check(cooked`left${0}\u0g`, ["left",void 0]); +check(cooked`left${0}\u0g${1}right`, ["left",void 0,"right"]); +check(cooked`\u00g`, [void 0]); +check(cooked`\u00g${0}right`, [void 0,"right"]); +check(cooked`left${0}\u00g`, ["left",void 0]); +check(cooked`left${0}\u00g${1}right`, ["left",void 0,"right"]); +check(cooked`\u000g`, [void 0]); +check(cooked`\u000g${0}right`, [void 0,"right"]); +check(cooked`left${0}\u000g`, ["left",void 0]); +check(cooked`left${0}\u000g${1}right`, ["left",void 0,"right"]); +check(cooked`\u{}`, [void 0]); +check(cooked`\u{}${0}right`, [void 0,"right"]); +check(cooked`left${0}\u{}`, ["left",void 0]); +check(cooked`left${0}\u{}${1}right`, ["left",void 0,"right"]); +check(cooked`\u{-0}`, [void 0]); +check(cooked`\u{-0}${0}right`, [void 0,"right"]); +check(cooked`left${0}\u{-0}`, ["left",void 0]); +check(cooked`left${0}\u{-0}${1}right`, ["left",void 0,"right"]); +check(cooked`\u{g}`, [void 0]); +check(cooked`\u{g}${0}right`, [void 0,"right"]); +check(cooked`left${0}\u{g}`, ["left",void 0]); +check(cooked`left${0}\u{g}${1}right`, ["left",void 0,"right"]); +check(cooked`\u{0`, [void 0]); +check(cooked`\u{0${0}right`, [void 0,"right"]); +check(cooked`left${0}\u{0`, ["left",void 0]); +check(cooked`left${0}\u{0${1}right`, ["left",void 0,"right"]); +check(cooked`\u{\u{0}`, [void 0]); +check(cooked`\u{\u{0}${0}right`, [void 0,"right"]); +check(cooked`left${0}\u{\u{0}`, ["left",void 0]); +check(cooked`left${0}\u{\u{0}${1}right`, ["left",void 0,"right"]); +check(cooked`\u{110000}`, [void 0]); +check(cooked`\u{110000}${0}right`, [void 0,"right"]); +check(cooked`left${0}\u{110000}`, ["left",void 0]); +check(cooked`left${0}\u{110000}${1}right`, ["left",void 0,"right"]); + +syntaxError("`\\01`"); +syntaxError("`\\01${0}right`"); +syntaxError("`left${0}\\01`"); +syntaxError("`left${0}\\01${1}right`"); +syntaxError("`\\1`"); +syntaxError("`\\1${0}right`"); +syntaxError("`left${0}\\1`"); +syntaxError("`left${0}\\1${1}right`"); +syntaxError("`\\xg`"); +syntaxError("`\\xg${0}right`"); +syntaxError("`left${0}\\xg`"); +syntaxError("`left${0}\\xg${1}right`"); +syntaxError("`\\xAg`"); +syntaxError("`\\xAg${0}right`"); +syntaxError("`left${0}\\xAg`"); +syntaxError("`left${0}\\xAg${1}right`"); +syntaxError("`\\u0`"); +syntaxError("`\\u0${0}right`"); +syntaxError("`left${0}\\u0`"); +syntaxError("`left${0}\\u0${1}right`"); +syntaxError("`\\u0g`"); +syntaxError("`\\u0g${0}right`"); +syntaxError("`left${0}\\u0g`"); +syntaxError("`left${0}\\u0g${1}right`"); +syntaxError("`\\u00g`"); +syntaxError("`\\u00g${0}right`"); +syntaxError("`left${0}\\u00g`"); +syntaxError("`left${0}\\u00g${1}right`"); +syntaxError("`\\u000g`"); +syntaxError("`\\u000g${0}right`"); +syntaxError("`left${0}\\u000g`"); +syntaxError("`left${0}\\u000g${1}right`"); +syntaxError("`\\u{}`"); +syntaxError("`\\u{}${0}right`"); +syntaxError("`left${0}\\u{}`"); +syntaxError("`left${0}\\u{}${1}right`"); +syntaxError("`\\u{-0}`"); +syntaxError("`\\u{-0}${0}right`"); +syntaxError("`left${0}\\u{-0}`"); +syntaxError("`left${0}\\u{-0}${1}right`"); +syntaxError("`\\u{g}`"); +syntaxError("`\\u{g}${0}right`"); +syntaxError("`left${0}\\u{g}`"); +syntaxError("`left${0}\\u{g}${1}right`"); +syntaxError("`\\u{0`"); +syntaxError("`\\u{0${0}right`"); +syntaxError("`left${0}\\u{0`"); +syntaxError("`left${0}\\u{0${1}right`"); +syntaxError("`\\u{\\u{0}`"); +syntaxError("`\\u{\\u{0}${0}right`"); +syntaxError("`left${0}\\u{\\u{0}`"); +syntaxError("`left${0}\\u{\\u{0}${1}right`"); +syntaxError("`\\u{110000}`"); +syntaxError("`\\u{110000}${0}right`"); +syntaxError("`left${0}\\u{110000}`"); +syntaxError("`left${0}\\u{110000}${1}right`"); reportCompare(0, 0, "ok"); diff --git a/js/src/tests/ecma_6/extensions/newer-type-functions-caller-arguments.js b/js/src/tests/ecma_6/extensions/newer-type-functions-caller-arguments.js new file mode 100644 index 000000000..7fed18037 --- /dev/null +++ b/js/src/tests/ecma_6/extensions/newer-type-functions-caller-arguments.js @@ -0,0 +1,43 @@ +// Tests that newer-type functions (i.e. anything not defined by regular function declarations and +// expressions) throw when accessing their 'arguments' and 'caller' properties. + +// 9.2.7 (AddRestrictedFunctionProperties) defines accessors on Function.prototype which throw on +// every 'get' and 'set' of 'caller' and 'arguments'. +// Additionally, 16.2 (Forbidden Extensions) forbids adding properties to all non-"legacy" function +// declarations and expressions. This creates the effect that all newer-style functions act like +// strict-mode functions when accessing their 'caller' and 'arguments' properties. + +const container = { + async asyncMethod() {}, + *genMethod() {}, + method() {} +}; + +[ + async function(){}, + function*(){}, + () => {}, + async () => {}, + + container.asyncMethod, + container.genMethod, + container.method +].forEach(f => { + checkArgumentsAccess(f); + checkCallerAccess(f); +}); + +function checkArgumentsAccess(f) { + assertThrowsInstanceOf(() => f.arguments, TypeError, + `Expected 'arguments' property access to throw on ${f}`); +} + +function checkCallerAccess(f) { + assertThrowsInstanceOf(() => f.caller, TypeError, + `Expected 'caller' property access to throw on ${f}`); +} + +if (typeof reportCompare === "function") + reportCompare(true, true); + +print("Tests complete"); diff --git a/js/src/tests/ecma_7/AsyncFunctions/async-contains-unicode-escape.js b/js/src/tests/ecma_7/AsyncFunctions/async-contains-unicode-escape.js new file mode 100644 index 000000000..d53dff696 --- /dev/null +++ b/js/src/tests/ecma_7/AsyncFunctions/async-contains-unicode-escape.js @@ -0,0 +1,54 @@ +var BUGNUMBER = 1315815; +var summary = "async/await containing escapes"; + +print(BUGNUMBER + ": " + summary); + +// Using "eval" as the argument name is fugly, but it means evals below are +// *direct* evals, and so their effects in the unescaped case won't extend +// past each separate |test| call (as would happen if we used a different name +// that made each eval into an indirect eval, affecting code in the global +// scope). +function test(code, eval) +{ + var unescaped = code.replace("###", "async"); + var escaped = code.replace("###", "\\u0061"); + + assertThrowsInstanceOf(() => eval(escaped), SyntaxError); + eval(unescaped); +} + +test("### function f() {}", eval); +test("var x = ### function f() {}", eval); +test("### x => {};", eval); +test("var x = ### x => {}", eval); +test("### () => {};", eval); +test("var x = ### () => {}", eval); +test("### (y) => {};", eval); +test("var x = ### (y) => {}", eval); +test("({ ### x() {} })", eval); +test("var x = ### function f() {}", eval); + +if (typeof parseModule === "function") + test("export default ### function f() {}", parseModule); + +assertThrowsInstanceOf(() => eval("async await => 1;"), + SyntaxError); +assertThrowsInstanceOf(() => eval("async aw\\u0061it => 1;"), + SyntaxError); + +var async = 0; +assertEq(\u0061sync, 0); + +var obj = { \u0061sync() { return 1; } }; +assertEq(obj.async(), 1); + +async = function() { return 42; }; + +var z = async(obj); +assertEq(z, 42); + +var w = async(obj)=>{}; +assertEq(typeof w, "function"); + +if (typeof reportCompare === "function") + reportCompare(true, true); diff --git a/js/src/tests/js1_8/regress/regress-467495-05.js b/js/src/tests/js1_8/regress/regress-467495-05.js index 505fb6bd6..ecf47b8fe 100644 --- a/js/src/tests/js1_8/regress/regress-467495-05.js +++ b/js/src/tests/js1_8/regress/regress-467495-05.js @@ -20,7 +20,7 @@ function test() printBugNumber(BUGNUMBER); printStatus (summary); - expect = 'function x() {}'; + expect = '1'; function g(x) { if (1) function x() {} return x; } print(actual = g(1) + ''); diff --git a/js/src/tests/js1_8/regress/regress-467495-06.js b/js/src/tests/js1_8/regress/regress-467495-06.js index d8bc81c83..72adeee9e 100644 --- a/js/src/tests/js1_8/regress/regress-467495-06.js +++ b/js/src/tests/js1_8/regress/regress-467495-06.js @@ -32,7 +32,7 @@ function test() var r = f(0); - if (typeof(r[0]) != "function") + if (typeof(r[0]) != "number") actual += "Bad r[0]"; if (typeof(r[1]) != "function") diff --git a/js/src/tests/js1_8_5/reflect-parse/object-rest.js b/js/src/tests/js1_8_5/reflect-parse/object-rest.js new file mode 100644 index 000000000..5af06909b --- /dev/null +++ b/js/src/tests/js1_8_5/reflect-parse/object-rest.js @@ -0,0 +1,45 @@ +// |reftest| skip-if(!xulRuntime.shell) + +function property(key, value = key, shorthand = key === value) { + return { key, value, shorthand }; +} + +function assertDestrAssign(src, pattern) { + assertExpr(`(${src} = 0)`, aExpr("=", pattern, lit(0))); +} + +function assertDestrBinding(src, pattern) { + assertDecl(`var ${src} = 0`, varDecl([{id: pattern, init: lit(0)}])); +} + +function test() { + // Target expression must be a simple assignment target or a nested pattern + // in object assignment patterns. + assertDestrAssign("{...x}", objPatt([spread(ident("x"))])); + assertDestrAssign("{...(x)}", objPatt([spread(ident("x"))])); + assertDestrAssign("{...obj.p}", objPatt([spread(dotExpr(ident("obj"), ident("p")))])); + assertDestrAssign("{...{}}", objPatt([spread(objPatt([]))])); + assertDestrAssign("{...[]}", objPatt([spread(arrPatt([]))])); + + // Object binding patterns only allow binding identifiers or nested patterns. + assertDestrBinding("{...x}", objPatt([spread(ident("x"))])); + assertDestrBinding("{...{}}", objPatt([spread(objPatt([]))])); + assertDestrBinding("{...[]}", objPatt([spread(arrPatt([]))])); + + // The rest-property can be preceded by other properties. + for (var assertDestr of [assertDestrAssign, assertDestrBinding]) { + assertDestr("{a, ...x}", objPatt([property(ident("a")), spread(ident("x"))])); + assertDestr("{a: b, ...x}", objPatt([property(ident("a"), ident("b")), spread(ident("x"))])); + assertDestr("{[a]: b, ...x}", objPatt([property(comp(ident("a")), ident("b")), spread(ident("x"))])); + } + + // Tests when __proto__ is used in the object pattern. + for (var assertDestr of [assertDestrAssign, assertDestrBinding]) { + assertDestr("{...__proto__}", objPatt([spread(ident("__proto__"))])); + assertDestr("{__proto__, ...x}", objPatt([property(ident("__proto__")), spread(ident("x"))])); + } + assertDestrAssign("{__proto__: a, ...x}", objPatt([property(lit("__proto__"), ident("a")), spread(ident("x"))])); + assertDestrBinding("{__proto__: a, ...x}", objPatt([property(ident("__proto__"), ident("a")), spread(ident("x"))])); +} + +runtest(test); diff --git a/js/src/tests/js1_8_5/reflect-parse/object-spread.js b/js/src/tests/js1_8_5/reflect-parse/object-spread.js new file mode 100644 index 000000000..a4b269c40 --- /dev/null +++ b/js/src/tests/js1_8_5/reflect-parse/object-spread.js @@ -0,0 +1,29 @@ +// |reftest| skip-if(!xulRuntime.shell) + +function property(key, value = key, shorthand = key === value) { + return { key, value, shorthand }; +} + +function test() { + // Any expression can be spreaded. + assertExpr("({...x})", objExpr([spread(ident("x"))])); + assertExpr("({...f()})", objExpr([spread(callExpr(ident("f"), []))])); + assertExpr("({...123})", objExpr([spread(lit(123))])); + + // Multiple spread expression are allowed. + assertExpr("({...x, ...obj.p})", objExpr([spread(ident("x")), spread(dotExpr(ident("obj"), ident("p")))])); + + // Spread expression can appear anywhere in an object literal. + assertExpr("({p, ...x})", objExpr([property(ident("p")), spread(ident("x"))])); + assertExpr("({p: a, ...x})", objExpr([property(ident("p"), ident("a")), spread(ident("x"))])); + assertExpr("({...x, p: a})", objExpr([spread(ident("x")), property(ident("p"), ident("a"))])); + + // Trailing comma after spread expression is allowed. + assertExpr("({...x,})", objExpr([spread(ident("x"))])); + + // __proto__ is not special in spread expressions. + assertExpr("({...__proto__})", objExpr([spread(ident("__proto__"))])); + assertExpr("({...__proto__, ...__proto__})", objExpr([spread(ident("__proto__")), spread(ident("__proto__"))])); +} + +runtest(test); diff --git a/js/src/tests/js1_8_5/reflect-parse/templateStrings.js b/js/src/tests/js1_8_5/reflect-parse/templateStrings.js index c87ba96b8..fb12afd00 100644 --- a/js/src/tests/js1_8_5/reflect-parse/templateStrings.js +++ b/js/src/tests/js1_8_5/reflect-parse/templateStrings.js @@ -7,6 +7,8 @@ assertStringExpr("`hey\nthere`", literal("hey\nthere")); assertExpr("`hey${\"there\"}`", templateLit([lit("hey"), lit("there"), lit("")])); assertExpr("`hey${\"there\"}mine`", templateLit([lit("hey"), lit("there"), lit("mine")])); assertExpr("`hey${a == 5}mine`", templateLit([lit("hey"), binExpr("==", ident("a"), lit(5)), lit("mine")])); +assertExpr("func`hey\\x`", taggedTemplate(ident("func"), template(["hey\\x"], [void 0]))); +assertExpr("func`hey${4}\\x`", taggedTemplate(ident("func"), template(["hey","\\x"], ["hey",void 0], lit(4)))); assertExpr("`hey${`there${\"how\"}`}mine`", templateLit([lit("hey"), templateLit([lit("there"), lit("how"), lit("")]), lit("mine")])); assertExpr("func`hey`", taggedTemplate(ident("func"), template(["hey"], ["hey"]))); diff --git a/js/src/tests/test262/built-ins/Object/getOwnPropertyDescriptors/shell.js b/js/src/tests/test262/built-ins/Object/getOwnPropertyDescriptors/shell.js index 6ed766e94..e69de29bb 100644 --- a/js/src/tests/test262/built-ins/Object/getOwnPropertyDescriptors/shell.js +++ b/js/src/tests/test262/built-ins/Object/getOwnPropertyDescriptors/shell.js @@ -1,27 +0,0 @@ -var assert = { - sameValue: assertEq, - notSameValue(a, b, msg) { - try { - assertEq(a, b); - throw "equal" - } catch (e) { - if (e === "equal") - throw new Error("Assertion failed: expected different values, got " + a); - } - }, - throws(ctor, f) { - var fullmsg; - try { - f(); - } catch (exc) { - if (exc instanceof ctor) - return; - fullmsg = "Assertion failed: expected exception " + ctor.name + ", got " + exc; - } - if (fullmsg === undefined) - fullmsg = "Assertion failed: expected exception " + ctor.name + ", no exception thrown"; - if (msg !== undefined) - fullmsg += " - " + msg; - throw new Error(fullmsg); - } -} diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-1.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-1.js new file mode 100755 index 000000000..08925e079 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-1.js @@ -0,0 +1,17 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped value is not changed when property was made non-configurable. +flags: [noStrict] +---*/ + +function argumentsNonConfigurable(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); +} +argumentsNonConfigurable(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-2.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-2.js new file mode 100755 index 000000000..265481e01 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-2.js @@ -0,0 +1,19 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, variable is + changed with SetMutableBinding. +flags: [noStrict] +---*/ + +function argumentsAndSetMutableBinding(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + a = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndSetMutableBinding(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-3.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-3.js new file mode 100755 index 000000000..6877a0c9d --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-3.js @@ -0,0 +1,19 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + is changed with [[DefineOwnProperty]]. +flags: [noStrict] +---*/ + +function argumentsAndDefineOwnProperty(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + Object.defineProperty(arguments, "0", {value: 2}); + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndDefineOwnProperty(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-4.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-4.js new file mode 100755 index 000000000..d2ac4d376 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-4.js @@ -0,0 +1,19 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + is changed with [[Set]]. +flags: [noStrict] +---*/ + +function argumentsAndSet(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + arguments[0] = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndSet(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-1.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-1.js new file mode 100755 index 000000000..67f971369 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-1.js @@ -0,0 +1,19 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + was not deleted. [[Delete]] operation returns false. +flags: [noStrict] +---*/ + +function argumentsAndDelete(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + assert.sameValue(delete arguments[0], false); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); +} +argumentsAndDelete(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-2.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-2.js new file mode 100755 index 000000000..9a089eaac --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-2.js @@ -0,0 +1,24 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + was not deleted. Variable is changed with SetMutableBinding. +flags: [noStrict] +---*/ + +function argumentsAndDeleteSetMutableBinding(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + // Precondition: Delete is unsuccessful and doesn't affect mapping. + assert.sameValue(delete arguments[0], false); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + a = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndDeleteSetMutableBinding(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-3.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-3.js new file mode 100755 index 000000000..26676a4ee --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-3.js @@ -0,0 +1,25 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + was not deleted. Arguments property is changed with + [[DefineOwnProperty]]. +flags: [noStrict] +---*/ + +function argumentsAndDeleteDefineOwnProperty(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + // Precondition: Delete is unsuccessful and doesn't affect mapping. + assert.sameValue(delete arguments[0], false); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + Object.defineProperty(arguments, "0", {value: 2}); + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndDeleteDefineOwnProperty(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-4.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-4.js new file mode 100755 index 000000000..ed96a0e67 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-delete-4.js @@ -0,0 +1,25 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + was not deleted. Arguments property is changed with + [[Set]]. +flags: [noStrict] +---*/ + +function argumentsAndDeleteSet(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + // Precondition: Delete is unsuccessful and doesn't affect mapping. + assert.sameValue(delete arguments[0], false); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + arguments[0] = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndDeleteSet(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-1.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-1.js new file mode 100755 index 000000000..cfeba05c4 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-1.js @@ -0,0 +1,24 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-configurable and + non-writable. Perform property attribute changes with a single + [[DefineOwnProperty]] call. Mapped values are unchanged, mapping + itself is removed. +flags: [noStrict] +---*/ + +function argumentsNonConfigurableAndNonWritable(a) { + Object.defineProperty(arguments, "0", {configurable: false, writable: false}); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + // Postcondition: Arguments mapping is removed. + a = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 1); +} +argumentsNonConfigurableAndNonWritable(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-2.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-2.js new file mode 100755 index 000000000..69c0e125b --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-2.js @@ -0,0 +1,25 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-configurable and + non-writable. Perform property attribute changes with two + consecutive [[DefineOwnProperty]] calls. Mapped values are + unchanged, mapping itself is removed. +flags: [noStrict] +---*/ + +function argumentsNonConfigurableThenNonWritable(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + Object.defineProperty(arguments, "0", {writable: false}); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + // Postcondition: Arguments mapping is removed. + a = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 1); +} +argumentsNonConfigurableThenNonWritable(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-3.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-3.js new file mode 100755 index 000000000..dca0adcd2 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-3.js @@ -0,0 +1,28 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-configurable and + non-writable. Perform property attribute changes with two + [[DefineOwnProperty]] calls. Add intervening call to + SetMutableBinding. +flags: [noStrict] +---*/ + +function argumentsNonConfigurableThenNonWritableWithInterveningSetMutableBinding(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + a = 2; + Object.defineProperty(arguments, "0", {writable: false}); + assert.sameValue(a, 2); + // `arguments[0] === 1` per ES2015, Rev 38, April 14, 2015 Final Draft. + // Specification bug: https://bugs.ecmascript.org/show_bug.cgi?id=4371 + assert.sameValue(arguments[0], 2); + + // Postcondition: Arguments mapping is removed. + a = 3; + assert.sameValue(a, 3); + assert.sameValue(arguments[0], 2); +} +argumentsNonConfigurableThenNonWritableWithInterveningSetMutableBinding(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-4.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-4.js new file mode 100755 index 000000000..80d56fe1c --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-4.js @@ -0,0 +1,25 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-configurable and + non-writable. Perform property attribute changes with two + [[DefineOwnProperty]] calls. Add intervening call to [[Set]]. +flags: [noStrict] +---*/ + +function argumentsNonConfigurableThenNonWritableWithInterveningSet(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + arguments[0] = 2; + Object.defineProperty(arguments, "0", {writable: false}); + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); + + // Postcondition: Arguments mapping is removed. + a = 3; + assert.sameValue(a, 3); + assert.sameValue(arguments[0], 2); +} +argumentsNonConfigurableThenNonWritableWithInterveningSet(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-5.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-5.js new file mode 100755 index 000000000..bbb951502 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-nonwritable-5.js @@ -0,0 +1,26 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-configurable and + non-writable. Perform property attribute changes with two + [[DefineOwnProperty]] calls. Add intervening call to + [[DefineOwnProperty]]. +flags: [noStrict] +---*/ + +function argumentsNonConfigurableThenNonWritableWithDefineOwnProperty(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + Object.defineProperty(arguments, "0", {value: 2}); + Object.defineProperty(arguments, "0", {writable: false}); + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); + + // Postcondition: Arguments mapping is removed. + a = 3; + assert.sameValue(a, 3); + assert.sameValue(arguments[0], 2); +} +argumentsNonConfigurableThenNonWritableWithDefineOwnProperty(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-1.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-1.js new file mode 100755 index 000000000..b918f75a1 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-1.js @@ -0,0 +1,21 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + was not deleted. [[Delete]] operations throws TypeError if called + from strict-mode code. +flags: [noStrict] +---*/ + +function argumentsAndStrictDelete(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + var args = arguments; + assert.throws(TypeError, function() { "use strict"; delete args[0]; }); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); +} +argumentsAndStrictDelete(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-2.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-2.js new file mode 100755 index 000000000..01afbe4de --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-2.js @@ -0,0 +1,26 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + was not deleted. [[Delete]] operations throws TypeError if called + from strict-mode code. Variable is changed with SetMutableBinding. +flags: [noStrict] +---*/ + +function argumentsAndStrictDeleteSetMutableBinding(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + // Precondition: Delete is unsuccessful and doesn't affect mapping. + var args = arguments; + assert.throws(TypeError, function() { "use strict"; delete args[0]; }); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + a = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndStrictDeleteSetMutableBinding(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-3.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-3.js new file mode 100755 index 000000000..9aa2a2ed2 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-3.js @@ -0,0 +1,27 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + was not deleted. [[Delete]] operations throws TypeError if called + from strict-mode code. Arguments property is changed with + [[DefineOwnProperty]]. +flags: [noStrict] +---*/ + +function argumentsAndStrictDeleteDefineOwnProperty(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + // Precondition: Delete is unsuccessful and doesn't affect mapping. + var args = arguments; + assert.throws(TypeError, function() { "use strict"; delete args[0]; }); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + Object.defineProperty(arguments, "0", {value: 2}); + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndStrictDeleteDefineOwnProperty(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-4.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-4.js new file mode 100755 index 000000000..b48018843 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonconfigurable-strict-delete-4.js @@ -0,0 +1,26 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapping works when property is non-configurable, arguments property + was not deleted. [[Delete]] operations throws TypeError if called + from strict-mode code. Arguments property is changed with [[Set]]. +flags: [noStrict] +---*/ + +function argumentsAndStrictDeleteSet(a) { + Object.defineProperty(arguments, "0", {configurable: false}); + + // Precondition: Delete is unsuccessful and doesn't affect mapping. + var args = arguments; + assert.throws(TypeError, function() { "use strict"; delete args[0]; }); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + arguments[0] = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 2); +} +argumentsAndStrictDeleteSet(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-1.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-1.js new file mode 100755 index 000000000..2dae07678 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-1.js @@ -0,0 +1,25 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-writable and + non-configurable. Perform property attribute changes with two + consecutive [[DefineOwnProperty]] calls. Mapped values are + unchanged, mapping itself is removed. +flags: [noStrict] +---*/ + +function argumentsNonWritableThenNonConfigurable(a) { + Object.defineProperty(arguments, "0", {writable: false}); + Object.defineProperty(arguments, "0", {configurable: false}); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + // Postcondition: Arguments mapping is removed. + a = 2; + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 1); +} +argumentsNonWritableThenNonConfigurable(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-2.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-2.js new file mode 100755 index 000000000..63585b437 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-2.js @@ -0,0 +1,26 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-writable and + non-configurable. Perform property attribute changes with two + [[DefineOwnProperty]] calls. Add intervening call to + SetMutableBinding. +flags: [noStrict] +---*/ + +function argumentsNonWritableThenNonConfigurableWithInterveningSetMutableBinding(a) { + Object.defineProperty(arguments, "0", {writable: false}); + a = 2; + Object.defineProperty(arguments, "0", {configurable: false}); + assert.sameValue(a, 2); + assert.sameValue(arguments[0], 1); + + // Postcondition: Arguments mapping is removed. + a = 3; + assert.sameValue(a, 3); + assert.sameValue(arguments[0], 1); +} +argumentsNonWritableThenNonConfigurableWithInterveningSetMutableBinding(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-3.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-3.js new file mode 100755 index 000000000..2bd1bc9c1 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-3.js @@ -0,0 +1,25 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-writable and + non-configurable. Perform property attribute changes with two + [[DefineOwnProperty]] calls. Add intervening call to [[Set]]. +flags: [noStrict] +---*/ + +function argumentsNonWritableThenNonConfigurableWithInterveningSet(a) { + Object.defineProperty(arguments, "0", {writable: false}); + arguments[0] = 2; + Object.defineProperty(arguments, "0", {configurable: false}); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 1); + + // Postcondition: Arguments mapping is removed. + a = 3; + assert.sameValue(a, 3); + assert.sameValue(arguments[0], 1); +} +argumentsNonWritableThenNonConfigurableWithInterveningSet(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-4.js b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-4.js new file mode 100755 index 000000000..ea40a49a8 --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/mapped-arguments-nonwritable-nonconfigurable-4.js @@ -0,0 +1,26 @@ +// Copyright (C) 2015 André Bargull. All rights reserved. +// This code is governed by the BSD license found in the LICENSE file. + +/*--- +info: Mapped arguments object with non-configurable property +description: > + Mapped arguments property is changed to non-writable and + non-configurable. Perform property attribute changes with two + [[DefineOwnProperty]] calls. Add intervening call to + [[DefineOwnProperty]]. +flags: [noStrict] +---*/ + +function argumentsNonWritableThenNonConfigurableWithInterveningDefineOwnProperty(a) { + Object.defineProperty(arguments, "0", {writable: false}); + Object.defineProperty(arguments, "0", {value: 2}); + Object.defineProperty(arguments, "0", {configurable: false}); + assert.sameValue(a, 1); + assert.sameValue(arguments[0], 2); + + // Postcondition: Arguments mapping is removed. + a = 3; + assert.sameValue(a, 3); + assert.sameValue(arguments[0], 2); +} +argumentsNonWritableThenNonConfigurableWithInterveningDefineOwnProperty(1); diff --git a/js/src/tests/test262/language/arguments-object/mapped/shell.js b/js/src/tests/test262/language/arguments-object/mapped/shell.js new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/mapped/shell.js diff --git a/js/src/tests/test262/language/arguments-object/shell.js b/js/src/tests/test262/language/arguments-object/shell.js new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/js/src/tests/test262/language/arguments-object/shell.js diff --git a/js/src/tests/test262/language/shell.js b/js/src/tests/test262/language/shell.js new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/js/src/tests/test262/language/shell.js diff --git a/js/src/tests/test262/shell.js b/js/src/tests/test262/shell.js index b70bb5dbb..462ec9cf8 100644 --- a/js/src/tests/test262/shell.js +++ b/js/src/tests/test262/shell.js @@ -938,3 +938,31 @@ var fnGlobalObject = (function() var global = Function("return this")(); return function fnGlobalObject() { return global; }; })(); + +var assert = { + sameValue: assertEq, + notSameValue(a, b, msg) { + try { + assertEq(a, b); + throw "equal" + } catch (e) { + if (e === "equal") + throw new Error("Assertion failed: expected different values, got " + a); + } + }, + throws(ctor, f) { + var fullmsg; + try { + f(); + } catch (exc) { + if (exc instanceof ctor) + return; + fullmsg = "Assertion failed: expected exception " + ctor.name + ", got " + exc; + } + if (fullmsg === undefined) + fullmsg = "Assertion failed: expected exception " + ctor.name + ", no exception thrown"; + if (msg !== undefined) + fullmsg += " - " + msg; + throw new Error(fullmsg); + } +} diff --git a/js/src/vm/ArgumentsObject.cpp b/js/src/vm/ArgumentsObject.cpp index 717aa1050..66e0f40a2 100644 --- a/js/src/vm/ArgumentsObject.cpp +++ b/js/src/vm/ArgumentsObject.cpp @@ -214,7 +214,7 @@ ArgumentsObject::createTemplateObject(JSContext* cx, bool mapped) ? &MappedArgumentsObject::class_ : &UnmappedArgumentsObject::class_; - RootedObject proto(cx, cx->global()->getOrCreateObjectPrototype(cx)); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, cx->global())); if (!proto) return nullptr; @@ -475,7 +475,7 @@ MappedArgSetter(JSContext* cx, HandleObject obj, HandleId id, MutableHandleValue attrs &= (JSPROP_ENUMERATE | JSPROP_PERMANENT); /* only valid attributes */ RootedFunction callee(cx, &argsobj->callee()); - RootedScript script(cx, callee->getOrCreateScript(cx)); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, callee)); if (!script) return false; @@ -590,6 +590,64 @@ MappedArgumentsObject::obj_enumerate(JSContext* cx, HandleObject obj) return true; } +// ES 2017 draft 9.4.4.2 +/* static */ bool +MappedArgumentsObject::obj_defineProperty(JSContext* cx, HandleObject obj, HandleId id, + Handle<PropertyDescriptor> desc, ObjectOpResult& result) +{ + // Step 1. + Rooted<MappedArgumentsObject*> argsobj(cx, &obj->as<MappedArgumentsObject>()); + + // Steps 2-3. + bool isMapped = false; + if (JSID_IS_INT(id)) { + unsigned arg = unsigned(JSID_TO_INT(id)); + isMapped = arg < argsobj->initialLength() && !argsobj->isElementDeleted(arg); + } + + // Step 4. + Rooted<PropertyDescriptor> newArgDesc(cx, desc); + if (!desc.isAccessorDescriptor() && isMapped) { + // In this case the live mapping is supposed to keep working, + // we have to pass along the Getter/Setter otherwise they are overwritten. + newArgDesc.setGetter(MappedArgGetter); + newArgDesc.setSetter(MappedArgSetter); + } + + // Steps 5-6. NativeDefineProperty will lookup [[Value]] for us. + if (!NativeDefineProperty(cx, obj.as<NativeObject>(), id, newArgDesc, result)) + return false; + // Step 7. + if (!result.ok()) + return true; + + // Step 8. + if (isMapped) { + unsigned arg = unsigned(JSID_TO_INT(id)); + if (desc.isAccessorDescriptor()) { + if (!argsobj->markElementDeleted(cx, arg)) + return false; + } else { + if (desc.hasValue()) { + RootedFunction callee(cx, &argsobj->callee()); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, callee)); + if (!script) + return false; + argsobj->setElement(cx, arg, desc.value()); + if (arg < script->functionNonDelazifying()->nargs()) + TypeScript::SetArgument(cx, script, arg, desc.value()); + } + if (desc.hasWritable() && !desc.writable()) { + if (!argsobj->markElementDeleted(cx, arg)) + return false; + } + } + } + + // Step 9. + return result.succeed(); +} + static bool UnmappedArgGetter(JSContext* cx, HandleObject obj, HandleId id, MutableHandleValue vp) { @@ -804,6 +862,11 @@ const ClassOps MappedArgumentsObject::classOps_ = { ArgumentsObject::trace }; +const ObjectOps MappedArgumentsObject::objectOps_ = { + nullptr, /* lookupProperty */ + MappedArgumentsObject::obj_defineProperty +}; + const Class MappedArgumentsObject::class_ = { "Arguments", JSCLASS_DELAY_METADATA_BUILDER | @@ -811,7 +874,10 @@ const Class MappedArgumentsObject::class_ = { JSCLASS_HAS_CACHED_PROTO(JSProto_Object) | JSCLASS_SKIP_NURSERY_FINALIZE | JSCLASS_BACKGROUND_FINALIZE, - &MappedArgumentsObject::classOps_ + &MappedArgumentsObject::classOps_, + nullptr, + nullptr, + &MappedArgumentsObject::objectOps_ }; /* diff --git a/js/src/vm/ArgumentsObject.h b/js/src/vm/ArgumentsObject.h index 247c7cd94..988e41951 100644 --- a/js/src/vm/ArgumentsObject.h +++ b/js/src/vm/ArgumentsObject.h @@ -389,6 +389,7 @@ class ArgumentsObject : public NativeObject class MappedArgumentsObject : public ArgumentsObject { static const ClassOps classOps_; + static const ObjectOps objectOps_; public: static const Class class_; @@ -410,6 +411,8 @@ class MappedArgumentsObject : public ArgumentsObject private: static bool obj_enumerate(JSContext* cx, HandleObject obj); static bool obj_resolve(JSContext* cx, HandleObject obj, HandleId id, bool* resolvedp); + static bool obj_defineProperty(JSContext* cx, HandleObject obj, HandleId id, + Handle<JS::PropertyDescriptor> desc, ObjectOpResult& result); }; class UnmappedArgumentsObject : public ArgumentsObject diff --git a/js/src/vm/ArrayBufferObject.cpp b/js/src/vm/ArrayBufferObject.cpp index 1053fa99d..392724b21 100644 --- a/js/src/vm/ArrayBufferObject.cpp +++ b/js/src/vm/ArrayBufferObject.cpp @@ -140,7 +140,7 @@ static const Class ArrayBufferObjectProtoClass = { static JSObject* CreateArrayBufferPrototype(JSContext* cx, JSProtoKey key) { - return cx->global()->createBlankPrototype(cx, &ArrayBufferObjectProtoClass); + return GlobalObject::createBlankPrototype(cx, cx->global(), &ArrayBufferObjectProtoClass); } static const ClassOps ArrayBufferObjectClassOps = { @@ -344,7 +344,7 @@ ArrayBufferObject::detach(JSContext* cx, Handle<ArrayBufferObject*> buffer, // Make sure the global object's group has been instantiated, so the // flag change will be observed. AutoEnterOOMUnsafeRegion oomUnsafe; - if (!cx->global()->getGroup(cx)) + if (!JSObject::getGroup(cx, cx->global())) oomUnsafe.crash("ArrayBufferObject::detach"); MarkObjectGroupFlags(cx, cx->global(), OBJECT_FLAG_TYPED_OBJECT_HAS_DETACHED_BUFFER); cx->compartment()->detachedTypedObjects = 1; diff --git a/js/src/vm/AsyncFunction.cpp b/js/src/vm/AsyncFunction.cpp index f50c87114..e14b77424 100644 --- a/js/src/vm/AsyncFunction.cpp +++ b/js/src/vm/AsyncFunction.cpp @@ -118,7 +118,7 @@ js::WrapAsyncFunctionWithProto(JSContext* cx, HandleFunction unwrapped, HandleOb RootedAtom funName(cx, unwrapped->explicitName()); uint16_t length; - if (!unwrapped->getLength(cx, &length)) + if (!JSFunction::getLength(cx, unwrapped, &length)) return nullptr; // Steps 3 (partially). diff --git a/js/src/vm/CommonPropertyNames.h b/js/src/vm/CommonPropertyNames.h index 8a36df083..fd1c9f5e6 100644 --- a/js/src/vm/CommonPropertyNames.h +++ b/js/src/vm/CommonPropertyNames.h @@ -38,6 +38,7 @@ macro(Bool32x4, Bool32x4, "Bool32x4") \ macro(Bool64x2, Bool64x2, "Bool64x2") \ macro(boundWithSpace, boundWithSpace, "bound ") \ + macro(break, break_, "break") \ macro(breakdown, breakdown, "breakdown") \ macro(buffer, buffer, "buffer") \ macro(builder, builder, "builder") \ @@ -52,8 +53,10 @@ macro(callee, callee, "callee") \ macro(caller, caller, "caller") \ macro(callFunction, callFunction, "callFunction") \ + macro(case, case_, "case") \ macro(caseFirst, caseFirst, "caseFirst") \ - macro(class_, class_, "class") \ + macro(catch, catch_, "catch") \ + macro(class, class_, "class") \ macro(close, close, "close") \ macro(Collator, Collator, "Collator") \ macro(CollatorCompareGet, CollatorCompareGet, "Intl_Collator_compare_get") \ @@ -62,10 +65,14 @@ macro(comma, comma, ",") \ macro(compare, compare, "compare") \ macro(configurable, configurable, "configurable") \ + macro(const, const_, "const") \ macro(construct, construct, "construct") \ macro(constructContentFunction, constructContentFunction, "constructContentFunction") \ macro(constructor, constructor, "constructor") \ + macro(continue, continue_, "continue") \ macro(ConvertAndCopyTo, ConvertAndCopyTo, "ConvertAndCopyTo") \ + macro(CopyDataProperties, CopyDataProperties, "CopyDataProperties") \ + macro(CopyDataPropertiesUnfiltered, CopyDataPropertiesUnfiltered, "CopyDataPropertiesUnfiltered") \ macro(copyWithin, copyWithin, "copyWithin") \ macro(count, count, "count") \ macro(CreateResolvingFunctions, CreateResolvingFunctions, "CreateResolvingFunctions") \ @@ -76,28 +83,32 @@ macro(DateTimeFormatFormatToParts, DateTimeFormatFormatToParts, "Intl_DateTimeFormat_formatToParts") \ macro(day, day, "day") \ macro(dayPeriod, dayPeriod, "dayPeriod") \ + macro(debugger, debugger, "debugger") \ macro(decodeURI, decodeURI, "decodeURI") \ macro(decodeURIComponent, decodeURIComponent, "decodeURIComponent") \ macro(DefaultBaseClassConstructor, DefaultBaseClassConstructor, "DefaultBaseClassConstructor") \ macro(DefaultDerivedClassConstructor, DefaultDerivedClassConstructor, "DefaultDerivedClassConstructor") \ - macro(default_, default_, "default") \ + macro(default, default_, "default") \ macro(defineGetter, defineGetter, "__defineGetter__") \ macro(defineProperty, defineProperty, "defineProperty") \ macro(defineSetter, defineSetter, "__defineSetter__") \ macro(delete, delete_, "delete") \ macro(deleteProperty, deleteProperty, "deleteProperty") \ macro(displayURL, displayURL, "displayURL") \ + macro(do, do_, "do") \ macro(done, done, "done") \ macro(dotGenerator, dotGenerator, ".generator") \ macro(dotThis, dotThis, ".this") \ macro(each, each, "each") \ macro(elementType, elementType, "elementType") \ + macro(else, else_, "else") \ macro(empty, empty, "") \ macro(emptyRegExp, emptyRegExp, "(?:)") \ macro(encodeURI, encodeURI, "encodeURI") \ macro(encodeURIComponent, encodeURIComponent, "encodeURIComponent") \ macro(endTimestamp, endTimestamp, "endTimestamp") \ macro(entries, entries, "entries") \ + macro(enum, enum_, "enum") \ macro(enumerable, enumerable, "enumerable") \ macro(enumerate, enumerate, "enumerate") \ macro(era, era, "era") \ @@ -105,11 +116,14 @@ macro(escape, escape, "escape") \ macro(eval, eval, "eval") \ macro(exec, exec, "exec") \ + macro(export, export_, "export") \ + macro(extends, extends, "extends") \ macro(false, false_, "false") \ macro(fieldOffsets, fieldOffsets, "fieldOffsets") \ macro(fieldTypes, fieldTypes, "fieldTypes") \ macro(fileName, fileName, "fileName") \ macro(fill, fill, "fill") \ + macro(finally, finally_, "finally") \ macro(find, find, "find") \ macro(findIndex, findIndex, "findIndex") \ macro(firstDayOfWeek, firstDayOfWeek, "firstDayOfWeek") \ @@ -121,6 +135,7 @@ macro(Float32x4, Float32x4, "Float32x4") \ macro(float64, float64, "float64") \ macro(Float64x2, Float64x2, "Float64x2") \ + macro(for, for_, "for") \ macro(forceInterpreter, forceInterpreter, "forceInterpreter") \ macro(forEach, forEach, "forEach") \ macro(format, format, "format") \ @@ -146,8 +161,12 @@ macro(hasOwn, hasOwn, "hasOwn") \ macro(hasOwnProperty, hasOwnProperty, "hasOwnProperty") \ macro(hour, hour, "hour") \ + macro(if, if_, "if") \ macro(ignoreCase, ignoreCase, "ignoreCase") \ macro(ignorePunctuation, ignorePunctuation, "ignorePunctuation") \ + macro(implements, implements, "implements") \ + macro(import, import, "import") \ + macro(in, in, "in") \ macro(includes, includes, "includes") \ macro(incumbentGlobal, incumbentGlobal, "incumbentGlobal") \ macro(index, index, "index") \ @@ -158,12 +177,14 @@ macro(innermost, innermost, "innermost") \ macro(inNursery, inNursery, "inNursery") \ macro(input, input, "input") \ + macro(instanceof, instanceof, "instanceof") \ macro(int8, int8, "int8") \ macro(int16, int16, "int16") \ macro(int32, int32, "int32") \ macro(Int8x16, Int8x16, "Int8x16") \ macro(Int16x8, Int16x8, "Int16x8") \ macro(Int32x4, Int32x4, "Int32x4") \ + macro(interface, interface, "interface") \ macro(InterpretGeneratorResume, InterpretGeneratorResume, "InterpretGeneratorResume") \ macro(isEntryPoint, isEntryPoint, "isEntryPoint") \ macro(isExtensible, isExtensible, "isExtensible") \ @@ -217,6 +238,7 @@ macro(noFilename, noFilename, "noFilename") \ macro(nonincrementalReason, nonincrementalReason, "nonincrementalReason") \ macro(noStack, noStack, "noStack") \ + macro(notes, notes, "notes") \ macro(NumberFormat, NumberFormat, "NumberFormat") \ macro(NumberFormatFormatGet, NumberFormatFormatGet, "Intl_NumberFormat_format_get") \ macro(numeric, numeric, "numeric") \ @@ -238,13 +260,18 @@ macro(other, other, "other") \ macro(outOfMemory, outOfMemory, "out of memory") \ macro(ownKeys, ownKeys, "ownKeys") \ + macro(Object_valueOf, Object_valueOf, "Object_valueOf") \ + macro(package, package, "package") \ macro(parseFloat, parseFloat, "parseFloat") \ macro(parseInt, parseInt, "parseInt") \ macro(pattern, pattern, "pattern") \ macro(pending, pending, "pending") \ + macro(public, public_, "public") \ macro(preventExtensions, preventExtensions, "preventExtensions") \ + macro(private, private_, "private") \ macro(promise, promise, "promise") \ macro(propertyIsEnumerable, propertyIsEnumerable, "propertyIsEnumerable") \ + macro(protected, protected_, "protected") \ macro(proto, proto, "__proto__") \ macro(prototype, prototype, "prototype") \ macro(proxy, proxy, "proxy") \ @@ -293,10 +320,12 @@ macro(StructType, StructType, "StructType") \ macro(style, style, "style") \ macro(super, super, "super") \ + macro(switch, switch_, "switch") \ macro(Symbol_iterator_fun, Symbol_iterator_fun, "[Symbol.iterator]") \ macro(target, target, "target") \ macro(test, test, "test") \ macro(then, then, "then") \ + macro(this, this_, "this") \ macro(throw, throw_, "throw") \ macro(timestamp, timestamp, "timestamp") \ macro(timeZone, timeZone, "timeZone") \ @@ -309,7 +338,9 @@ macro(toString, toString, "toString") \ macro(toUTCString, toUTCString, "toUTCString") \ macro(true, true_, "true") \ + macro(try, try_, "try") \ macro(type, type, "type") \ + macro(typeof, typeof_, "typeof") \ macro(uint8, uint8, "uint8") \ macro(uint8Clamped, uint8Clamped, "uint8Clamped") \ macro(uint16, uint16, "uint16") \ @@ -329,6 +360,7 @@ macro(useAsm, useAsm, "use asm") \ macro(useGrouping, useGrouping, "useGrouping") \ macro(useStrict, useStrict, "use strict") \ + macro(void, void_, "void") \ macro(value, value, "value") \ macro(valueOf, valueOf, "valueOf") \ macro(values, values, "values") \ @@ -343,6 +375,8 @@ macro(weekday, weekday, "weekday") \ macro(weekendEnd, weekendEnd, "weekendEnd") \ macro(weekendStart, weekendStart, "weekendStart") \ + macro(while, while_, "while") \ + macro(with, with, "with") \ macro(writable, writable, "writable") \ macro(year, year, "year") \ macro(yield, yield, "yield") \ diff --git a/js/src/vm/Debugger.cpp b/js/src/vm/Debugger.cpp index d16781326..d68d1b75e 100644 --- a/js/src/vm/Debugger.cpp +++ b/js/src/vm/Debugger.cpp @@ -224,7 +224,7 @@ EnsureFunctionHasScript(JSContext* cx, HandleFunction fun) { if (fun->isInterpretedLazy()) { AutoCompartment ac(cx, fun); - return !!fun->getOrCreateScript(cx); + return !!JSFunction::getOrCreateScript(cx, fun); } return true; } @@ -2234,7 +2234,7 @@ Debugger::appendAllocationSite(JSContext* cx, HandleObject obj, HandleSavedFrame RootedAtom ctorName(cx); { AutoCompartment ac(cx, obj); - if (!obj->constructorDisplayAtom(cx, &ctorName)) + if (!JSObject::constructorDisplayAtom(cx, obj, &ctorName)) return false; } @@ -7227,8 +7227,8 @@ static const JSFunctionSpec DebuggerSource_methods[] = { /* static */ NativeObject* DebuggerFrame::initClass(JSContext* cx, HandleObject dbgCtor, HandleObject obj) { - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); return InitClass(cx, dbgCtor, objProto, &class_, construct, 0, properties_, methods_, nullptr, nullptr); @@ -8666,6 +8666,14 @@ DebuggerObject::errorMessageNameGetter(JSContext *cx, unsigned argc, Value* vp) } /* static */ bool +DebuggerObject::errorNotesGetter(JSContext *cx, unsigned argc, Value* vp) +{ + THIS_DEBUGOBJECT(cx, argc, vp, "get errorNotes", args, object) + + return DebuggerObject::getErrorNotes(cx, object, args.rval()); +} + +/* static */ bool DebuggerObject::errorLineNumberGetter(JSContext *cx, unsigned argc, Value* vp) { THIS_DEBUGOBJECT(cx, argc, vp, "get errorLineNumber", args, object) @@ -9324,6 +9332,7 @@ const JSPropertySpec DebuggerObject::properties_[] = { JS_PSG("global", DebuggerObject::globalGetter, 0), JS_PSG("allocationSite", DebuggerObject::allocationSiteGetter, 0), JS_PSG("errorMessageName", DebuggerObject::errorMessageNameGetter, 0), + JS_PSG("errorNotes", DebuggerObject::errorNotesGetter, 0), JS_PSG("errorLineNumber", DebuggerObject::errorLineNumberGetter, 0), JS_PSG("errorColumnNumber", DebuggerObject::errorColumnNumberGetter, 0), JS_PSG("isProxy", DebuggerObject::isProxyGetter, 0), @@ -9376,8 +9385,8 @@ const JSFunctionSpec DebuggerObject::methods_[] = { /* static */ NativeObject* DebuggerObject::initClass(JSContext* cx, HandleObject obj, HandleObject debugCtor) { - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); RootedNativeObject objectProto(cx, InitClass(cx, debugCtor, objProto, &class_, construct, 0, properties_, @@ -9611,7 +9620,7 @@ DebuggerObject::getBoundArguments(JSContext* cx, HandleDebuggerObject object, if (!result.resize(length)) return false; for (size_t i = 0; i < length; i++) { - result[i].set(referent->getBoundFunctionArgument(cx, i)); + result[i].set(referent->getBoundFunctionArgument(i)); if (!dbg->wrapDebuggeeValue(cx, result[i])) return false; } @@ -9695,6 +9704,30 @@ DebuggerObject::getErrorMessageName(JSContext* cx, HandleDebuggerObject object, } /* static */ bool +DebuggerObject::getErrorNotes(JSContext* cx, HandleDebuggerObject object, + MutableHandleValue result) +{ + RootedObject referent(cx, object->referent()); + JSErrorReport* report; + if (!getErrorReport(cx, referent, report)) + return false; + + if (!report) { + result.setUndefined(); + return true; + } + + RootedObject errorNotesArray(cx, CreateErrorNotesArray(cx, report)); + if (!errorNotesArray) + return false; + + if (!cx->compartment()->wrap(cx, &errorNotesArray)) + return false; + result.setObject(*errorNotesArray); + return true; +} + +/* static */ bool DebuggerObject::getErrorLineNumber(JSContext* cx, HandleDebuggerObject object, MutableHandleValue result) { @@ -10577,8 +10610,8 @@ const JSFunctionSpec DebuggerEnvironment::methods_[] = { /* static */ NativeObject* DebuggerEnvironment::initClass(JSContext* cx, HandleObject dbgCtor, HandleObject obj) { - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); - RootedObject objProto(cx, global->getOrCreateObjectPrototype(cx)); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); + RootedObject objProto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); return InitClass(cx, dbgCtor, objProto, &DebuggerEnvironment::class_, construct, 0, properties_, methods_, nullptr, nullptr); @@ -10774,7 +10807,8 @@ DebuggerEnvironment::getVariable(JSContext* cx, HandleDebuggerEnvironment enviro // // See wrapDebuggeeValue for how the sentinel values are wrapped. if (referent->is<DebugEnvironmentProxy>()) { - if (!referent->as<DebugEnvironmentProxy>().getMaybeSentinelValue(cx, id, result)) + Rooted<DebugEnvironmentProxy*> env(cx, &referent->as<DebugEnvironmentProxy>()); + if (!DebugEnvironmentProxy::getMaybeSentinelValue(cx, env, id, result)) return false; } else { if (!GetProperty(cx, referent, referent, id, result)) @@ -10942,9 +10976,9 @@ JS_DefineDebuggerObject(JSContext* cx, HandleObject obj) memoryProto(cx); RootedObject debuggeeWouldRunProto(cx); RootedValue debuggeeWouldRunCtor(cx); - Rooted<GlobalObject*> global(cx, &obj->as<GlobalObject>()); + Handle<GlobalObject*> global = obj.as<GlobalObject>(); - objProto = global->getOrCreateObjectPrototype(cx); + objProto = GlobalObject::getOrCreateObjectPrototype(cx, global); if (!objProto) return false; debugProto = InitClass(cx, obj, diff --git a/js/src/vm/Debugger.h b/js/src/vm/Debugger.h index 3239ade6d..cdcf2d67f 100644 --- a/js/src/vm/Debugger.h +++ b/js/src/vm/Debugger.h @@ -1246,6 +1246,8 @@ class DebuggerObject : public NativeObject MutableHandleObject result); static MOZ_MUST_USE bool getErrorMessageName(JSContext* cx, HandleDebuggerObject object, MutableHandleString result); + static MOZ_MUST_USE bool getErrorNotes(JSContext* cx, HandleDebuggerObject object, + MutableHandleValue result); static MOZ_MUST_USE bool getErrorLineNumber(JSContext* cx, HandleDebuggerObject object, MutableHandleValue result); static MOZ_MUST_USE bool getErrorColumnNumber(JSContext* cx, HandleDebuggerObject object, @@ -1371,6 +1373,7 @@ class DebuggerObject : public NativeObject static MOZ_MUST_USE bool globalGetter(JSContext* cx, unsigned argc, Value* vp); static MOZ_MUST_USE bool allocationSiteGetter(JSContext* cx, unsigned argc, Value* vp); static MOZ_MUST_USE bool errorMessageNameGetter(JSContext* cx, unsigned argc, Value* vp); + static MOZ_MUST_USE bool errorNotesGetter(JSContext* cx, unsigned argc, Value* vp); static MOZ_MUST_USE bool errorLineNumberGetter(JSContext* cx, unsigned argc, Value* vp); static MOZ_MUST_USE bool errorColumnNumberGetter(JSContext* cx, unsigned argc, Value* vp); static MOZ_MUST_USE bool isProxyGetter(JSContext* cx, unsigned argc, Value* vp); diff --git a/js/src/vm/EnvironmentObject.cpp b/js/src/vm/EnvironmentObject.cpp index 34c39eabf..a5aac2ab4 100644 --- a/js/src/vm/EnvironmentObject.cpp +++ b/js/src/vm/EnvironmentObject.cpp @@ -816,7 +816,7 @@ NonSyntacticVariablesObject::create(JSContext* cx) return nullptr; MOZ_ASSERT(obj->isUnqualifiedVarObj()); - if (!obj->setQualifiedVarObj(cx)) + if (!JSObject::setQualifiedVarObj(cx, obj)) return nullptr; obj->initEnclosingEnvironment(&cx->global()->lexicalEnvironment()); @@ -957,7 +957,7 @@ LexicalEnvironmentObject::createHollowForDebug(JSContext* cx, Handle<LexicalScop return nullptr; } - if (!env->setFlags(cx, BaseShape::NOT_EXTENSIBLE, JSObject::GENERATE_SHAPE)) + if (!JSObject::setFlags(cx, env, BaseShape::NOT_EXTENSIBLE, JSObject::GENERATE_SHAPE)) return nullptr; env->initScopeUnchecked(scope); @@ -1425,7 +1425,8 @@ class DebugEnvironmentProxyHandler : public BaseProxyHandler /* Handle unaliased formals, vars, lets, and consts at function scope. */ if (env->is<CallObject>()) { CallObject& callobj = env->as<CallObject>(); - RootedScript script(cx, callobj.callee().getOrCreateScript(cx)); + RootedFunction fun(cx, &callobj.callee()); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, fun)); if (!script->ensureHasTypes(cx) || !script->ensureHasAnalyzedArgsUsage(cx)) return false; @@ -2233,11 +2234,11 @@ DebugEnvironmentProxy::isForDeclarative() const e.is<LexicalEnvironmentObject>(); } -bool -DebugEnvironmentProxy::getMaybeSentinelValue(JSContext* cx, HandleId id, MutableHandleValue vp) +/* static */ bool +DebugEnvironmentProxy::getMaybeSentinelValue(JSContext* cx, Handle<DebugEnvironmentProxy*> env, + HandleId id, MutableHandleValue vp) { - Rooted<DebugEnvironmentProxy*> self(cx, this); - return DebugEnvironmentProxyHandler::singleton.getMaybeSentinelValue(cx, self, id, vp); + return DebugEnvironmentProxyHandler::singleton.getMaybeSentinelValue(cx, env, id, vp); } bool @@ -2960,7 +2961,7 @@ js::GetDebugEnvironmentForFunction(JSContext* cx, HandleFunction fun) MOZ_ASSERT(CanUseDebugEnvironmentMaps(cx)); if (!DebugEnvironments::updateLiveEnvironments(cx)) return nullptr; - JSScript* script = fun->getOrCreateScript(cx); + JSScript* script = JSFunction::getOrCreateScript(cx, fun); if (!script) return nullptr; EnvironmentIter ei(cx, fun->environment(), script->enclosingScope()); @@ -3468,11 +3469,13 @@ RemoveReferencedNames(JSContext* cx, HandleScript script, PropertyNameSet& remai if (script->hasObjects()) { ObjectArray* objects = script->objects(); + RootedFunction fun(cx); + RootedScript innerScript(cx); for (size_t i = 0; i < objects->length; i++) { JSObject* obj = objects->vector[i]; if (obj->is<JSFunction>() && obj->as<JSFunction>().isInterpreted()) { - JSFunction* fun = &obj->as<JSFunction>(); - RootedScript innerScript(cx, fun->getOrCreateScript(cx)); + fun = &obj->as<JSFunction>(); + innerScript = JSFunction::getOrCreateScript(cx, fun); if (!innerScript) return false; @@ -3535,11 +3538,13 @@ AnalyzeEntrainedVariablesInScript(JSContext* cx, HandleScript script, HandleScri if (innerScript->hasObjects()) { ObjectArray* objects = innerScript->objects(); + RootedFunction fun(cx); + RootedScript innerInnerScript(cx); for (size_t i = 0; i < objects->length; i++) { JSObject* obj = objects->vector[i]; if (obj->is<JSFunction>() && obj->as<JSFunction>().isInterpreted()) { - JSFunction* fun = &obj->as<JSFunction>(); - RootedScript innerInnerScript(cx, fun->getOrCreateScript(cx)); + fun = &obj->as<JSFunction>(); + innerInnerScript = JSFunction::getOrCreateScript(cx, fun); if (!innerInnerScript || !AnalyzeEntrainedVariablesInScript(cx, script, innerInnerScript)) { @@ -3570,11 +3575,13 @@ js::AnalyzeEntrainedVariables(JSContext* cx, HandleScript script) return true; ObjectArray* objects = script->objects(); + RootedFunction fun(cx); + RootedScript innerScript(cx); for (size_t i = 0; i < objects->length; i++) { JSObject* obj = objects->vector[i]; if (obj->is<JSFunction>() && obj->as<JSFunction>().isInterpreted()) { - JSFunction* fun = &obj->as<JSFunction>(); - RootedScript innerScript(cx, fun->getOrCreateScript(cx)); + fun = &obj->as<JSFunction>(); + innerScript = JSFunction::getOrCreateScript(cx, fun); if (!innerScript) return false; diff --git a/js/src/vm/EnvironmentObject.h b/js/src/vm/EnvironmentObject.h index 032286116..c527cd1b0 100644 --- a/js/src/vm/EnvironmentObject.h +++ b/js/src/vm/EnvironmentObject.h @@ -872,7 +872,8 @@ class DebugEnvironmentProxy : public ProxyObject // Get a property by 'id', but returns sentinel values instead of throwing // on exceptional cases. - bool getMaybeSentinelValue(JSContext* cx, HandleId id, MutableHandleValue vp); + static bool getMaybeSentinelValue(JSContext* cx, Handle<DebugEnvironmentProxy*> env, + HandleId id, MutableHandleValue vp); // Returns true iff this is a function environment with its own this-binding // (all functions except arrow functions and generator expression lambdas). diff --git a/js/src/vm/ErrorObject.cpp b/js/src/vm/ErrorObject.cpp index d8d29830b..271132801 100644 --- a/js/src/vm/ErrorObject.cpp +++ b/js/src/vm/ErrorObject.cpp @@ -29,11 +29,11 @@ js::ErrorObject::assignInitialShape(ExclusiveContext* cx, Handle<ErrorObject*> o { MOZ_ASSERT(obj->empty()); - if (!obj->addDataProperty(cx, cx->names().fileName, FILENAME_SLOT, 0)) + if (!NativeObject::addDataProperty(cx, obj, cx->names().fileName, FILENAME_SLOT, 0)) return nullptr; - if (!obj->addDataProperty(cx, cx->names().lineNumber, LINENUMBER_SLOT, 0)) + if (!NativeObject::addDataProperty(cx, obj, cx->names().lineNumber, LINENUMBER_SLOT, 0)) return nullptr; - return obj->addDataProperty(cx, cx->names().columnNumber, COLUMNNUMBER_SLOT, 0); + return NativeObject::addDataProperty(cx, obj, cx->names().columnNumber, COLUMNNUMBER_SLOT, 0); } /* static */ bool @@ -57,7 +57,7 @@ js::ErrorObject::init(JSContext* cx, Handle<ErrorObject*> obj, JSExnType type, // |new Error()|. RootedShape messageShape(cx); if (message) { - messageShape = obj->addDataProperty(cx, cx->names().message, MESSAGE_SLOT, 0); + messageShape = NativeObject::addDataProperty(cx, obj, cx->names().message, MESSAGE_SLOT, 0); if (!messageShape) return false; MOZ_ASSERT(messageShape->slot() == MESSAGE_SLOT); diff --git a/js/src/vm/ErrorReporting.cpp b/js/src/vm/ErrorReporting.cpp new file mode 100644 index 000000000..5877f3a4b --- /dev/null +++ b/js/src/vm/ErrorReporting.cpp @@ -0,0 +1,124 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "vm/ErrorReporting.h" + +#include "mozilla/Move.h" + +#include <stdarg.h> + +#include "jscntxt.h" +#include "jsexn.h" + +using mozilla::Move; + +using JS::UniqueTwoByteChars; + +void +CallWarningReporter(JSContext* cx, JSErrorReport* reportp) +{ + MOZ_ASSERT(reportp); + MOZ_ASSERT(JSREPORT_IS_WARNING(reportp->flags)); + + if (JS::WarningReporter warningReporter = cx->runtime()->warningReporter) + warningReporter(cx, reportp); +} + +void +CompileError::throwError(JSContext* cx) +{ + if (JSREPORT_IS_WARNING(flags)) { + CallWarningReporter(cx, this); + return; + } + + // If there's a runtime exception type associated with this error + // number, set that as the pending exception. For errors occuring at + // compile time, this is very likely to be a JSEXN_SYNTAXERR. + // + // If an exception is thrown but not caught, the JSREPORT_EXCEPTION + // flag will be set in report.flags. Proper behavior for an error + // reporter is to ignore a report with this flag for all but top-level + // compilation errors. The exception will remain pending, and so long + // as the non-top-level "load", "eval", or "compile" native function + // returns false, the top-level reporter will eventually receive the + // uncaught exception report. + ErrorToException(cx, this, nullptr, nullptr); +} + +bool +ReportCompileWarning(JSContext* cx, ErrorMetadata&& metadata, UniquePtr<JSErrorNotes> notes, + unsigned flags, unsigned errorNumber, va_list args) +{ + // On the main thread, report the error immediately. When compiling off + // thread, save the error so that the thread finishing the parse can report + // it later. + CompileError tempErr; + CompileError* err = &tempErr; + if (!cx->isJSContext() && !cx->addPendingCompileError(&err)) { + return false; + } + + err->notes = Move(notes); + err->flags = flags; + err->errorNumber = errorNumber; + + err->filename = metadata.filename; + err->lineno = metadata.lineNumber; + err->column = metadata.columnNumber; + err->isMuted = metadata.isMuted; + + if (UniqueTwoByteChars lineOfContext = Move(metadata.lineOfContext)) + err->initOwnedLinebuf(lineOfContext.release(), metadata.lineLength, metadata.tokenOffset); + + if (!ExpandErrorArgumentsVA(cx, GetErrorMessage, nullptr, errorNumber, + nullptr, ArgumentsAreLatin1, err, args)) + { + return false; + } + + if (cx->isJSContext()) { + err->throwError(cx->asJSContext()); + } + + return true; +} + +void +ReportCompileError(JSContext* cx, ErrorMetadata&& metadata, UniquePtr<JSErrorNotes> notes, + unsigned flags, unsigned errorNumber, va_list args) +{ + // On the main thread, report the error immediately. When compiling off + // thread, save the error so that the thread finishing the parse can report + // it later. + CompileError tempErr; + CompileError* err = &tempErr; + if (!cx->isJSContext() && !cx->addPendingCompileError(&err)) { + return; + } + + err->notes = Move(notes); + err->flags = flags; + err->errorNumber = errorNumber; + + err->filename = metadata.filename; + err->lineno = metadata.lineNumber; + err->column = metadata.columnNumber; + err->isMuted = metadata.isMuted; + + if (UniqueTwoByteChars lineOfContext = Move(metadata.lineOfContext)) + err->initOwnedLinebuf(lineOfContext.release(), metadata.lineLength, metadata.tokenOffset); + + if (!ExpandErrorArgumentsVA(cx, GetErrorMessage, nullptr, errorNumber, + nullptr, ArgumentsAreLatin1, err, args)) + { + return; + } + + if (cx->isJSContext()) { + err->throwError(cx->asJSContext()); + } +} diff --git a/js/src/vm/ErrorReporting.h b/js/src/vm/ErrorReporting.h new file mode 100644 index 000000000..02bbe2c63 --- /dev/null +++ b/js/src/vm/ErrorReporting.h @@ -0,0 +1,91 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef vm_ErrorReporting_h +#define vm_ErrorReporting_h + +#include "mozilla/Move.h" + +#include <stdarg.h> + +#include "jsapi.h" // for JSErrorNotes, JSErrorReport + +#include "js/UniquePtr.h" // for UniquePtr +#include "js/Utility.h" // for UniqueTwoByteChars + +struct JSContext; + +namespace js { + +/** + * Metadata for a compilation error (or warning) at a particular offset, or at + * no offset (i.e. with respect to a script overall). + */ +struct ErrorMetadata +{ + // The file/URL where the error occurred. + const char* filename; + + // The line and column numbers where the error occurred. If the error + // is with respect to the entire script and not with respect to a + // particular location, these will both be zero. + uint32_t lineNumber; + uint32_t columnNumber; + + // If the error occurs at a particular location, context surrounding the + // location of the error: the line that contained the error, or a small + // portion of it if the line is long. + // + // This information is provided on a best-effort basis: code populating + // ErrorMetadata instances isn't obligated to supply this. + JS::UniqueTwoByteChars lineOfContext; + + // If |lineOfContext| is non-null, its length. + size_t lineLength; + + // If |lineOfContext| is non-null, the offset within it of the token that + // triggered the error. + size_t tokenOffset; + + // Whether the error is "muted" because it derives from a cross-origin + // load. See the comment in TransitiveCompileOptions in jsapi.h for + // details. + bool isMuted; +}; + +class CompileError : public JSErrorReport +{ + public: + void throwError(JSContext* cx); +}; + +/** Send a JSErrorReport to the warningReporter callback. */ +extern void +CallWarningReporter(JSContext* cx, JSErrorReport* report); + +/** + * Report a compile error during script processing prior to execution of the + * script. + */ +extern void +ReportCompileError(ErrorMetadata&& metadata, UniquePtr<JSErrorNotes> notes, + unsigned flags, unsigned errorNumber, va_list args); + +/** + * Report a compile warning during script processing prior to execution of the + * script. Returns true if the warning was successfully reported, false if an + * error occurred. + * + * This function DOES NOT respect an existing werror option. If the caller + * wishes such option to be respected, it must do so itself. + */ +extern MOZ_MUST_USE bool +ReportCompileWarning(JSContext* cx, ErrorMetadata&& metadata, UniquePtr<JSErrorNotes> notes, + unsigned flags, unsigned errorNumber, va_list args); + +} // namespace js + +#endif /* vm_ErrorReporting_h */ diff --git a/js/src/vm/GeneratorObject.cpp b/js/src/vm/GeneratorObject.cpp index 690c0bf48..ba28501e6 100644 --- a/js/src/vm/GeneratorObject.cpp +++ b/js/src/vm/GeneratorObject.cpp @@ -256,7 +256,7 @@ static const JSFunctionSpec legacy_generator_methods[] = { static JSObject* NewSingletonObjectWithObjectPrototype(JSContext* cx, Handle<GlobalObject*> global) { - RootedObject proto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!proto) return nullptr; return NewObjectWithGivenProto<PlainObject>(cx, proto, SingletonObject); @@ -265,7 +265,7 @@ NewSingletonObjectWithObjectPrototype(JSContext* cx, Handle<GlobalObject*> globa JSObject* js::NewSingletonObjectWithFunctionPrototype(JSContext* cx, Handle<GlobalObject*> global) { - RootedObject proto(cx, global->getOrCreateFunctionPrototype(cx)); + RootedObject proto(cx, GlobalObject::getOrCreateFunctionPrototype(cx, global)); if (!proto) return nullptr; return NewObjectWithGivenProto<PlainObject>(cx, proto, SingletonObject); @@ -278,7 +278,7 @@ GlobalObject::initLegacyGeneratorProto(JSContext* cx, Handle<GlobalObject*> glob return true; RootedObject proto(cx, NewSingletonObjectWithObjectPrototype(cx, global)); - if (!proto || !proto->setDelegate(cx)) + if (!proto || !JSObject::setDelegate(cx, proto)) return false; if (!DefinePropertiesAndFunctions(cx, proto, nullptr, legacy_generator_methods)) return false; @@ -297,9 +297,9 @@ GlobalObject::initStarGenerators(JSContext* cx, Handle<GlobalObject*> global) if (!iteratorProto) return false; - RootedObject genObjectProto(cx, global->createBlankPrototypeInheriting(cx, - &PlainObject::class_, - iteratorProto)); + RootedObject genObjectProto(cx, GlobalObject::createBlankPrototypeInheriting(cx, global, + &PlainObject::class_, + iteratorProto)); if (!genObjectProto) return false; if (!DefinePropertiesAndFunctions(cx, genObjectProto, nullptr, star_generator_methods) || @@ -309,7 +309,7 @@ GlobalObject::initStarGenerators(JSContext* cx, Handle<GlobalObject*> global) } RootedObject genFunctionProto(cx, NewSingletonObjectWithFunctionPrototype(cx, global)); - if (!genFunctionProto || !genFunctionProto->setDelegate(cx)) + if (!genFunctionProto || !JSObject::setDelegate(cx, genFunctionProto)) return false; if (!LinkConstructorAndPrototype(cx, genFunctionProto, genObjectProto) || !DefineToStringTag(cx, genFunctionProto, cx->names().GeneratorFunction)) diff --git a/js/src/vm/GlobalObject.cpp b/js/src/vm/GlobalObject.cpp index c90b6b85f..85707e1c6 100644 --- a/js/src/vm/GlobalObject.cpp +++ b/js/src/vm/GlobalObject.cpp @@ -329,15 +329,15 @@ GlobalObject::createInternal(JSContext* cx, const Class* clasp) cx->compartment()->initGlobal(*global); - if (!global->setQualifiedVarObj(cx)) + if (!JSObject::setQualifiedVarObj(cx, global)) return nullptr; - if (!global->setDelegate(cx)) + if (!JSObject::setDelegate(cx, global)) return nullptr; return global; } -GlobalObject* +/* static */ GlobalObject* GlobalObject::new_(JSContext* cx, const Class* clasp, JSPrincipals* principals, JS::OnNewGlobalHookOption hookOption, const JS::CompartmentOptions& options) @@ -398,7 +398,7 @@ GlobalObject::emptyGlobalScope() const GlobalObject::getOrCreateEval(JSContext* cx, Handle<GlobalObject*> global, MutableHandleObject eval) { - if (!global->getOrCreateObjectPrototype(cx)) + if (!getOrCreateObjectPrototype(cx, global)) return false; eval.set(&global->getSlot(EVAL).toObject()); return true; @@ -573,7 +573,7 @@ GlobalObject::warnOnceAbout(JSContext* cx, HandleObject obj, WarnOnceFlag flag, return true; } -JSFunction* +/* static */ JSFunction* GlobalObject::createConstructor(JSContext* cx, Native ctor, JSAtom* nameArg, unsigned length, gc::AllocKind kind, const JSJitInfo* jitInfo) { @@ -595,28 +595,27 @@ CreateBlankProto(JSContext* cx, const Class* clasp, HandleObject proto, HandleOb RootedNativeObject blankProto(cx, NewNativeObjectWithGivenProto(cx, clasp, proto, SingletonObject)); - if (!blankProto || !blankProto->setDelegate(cx)) + if (!blankProto || !JSObject::setDelegate(cx, blankProto)) return nullptr; return blankProto; } -NativeObject* -GlobalObject::createBlankPrototype(JSContext* cx, const Class* clasp) +/* static */ NativeObject* +GlobalObject::createBlankPrototype(JSContext* cx, Handle<GlobalObject*> global, const Class* clasp) { - Rooted<GlobalObject*> self(cx, this); - RootedObject objectProto(cx, getOrCreateObjectPrototype(cx)); + RootedObject objectProto(cx, getOrCreateObjectPrototype(cx, global)); if (!objectProto) return nullptr; - return CreateBlankProto(cx, clasp, objectProto, self); + return CreateBlankProto(cx, clasp, objectProto, global); } -NativeObject* -GlobalObject::createBlankPrototypeInheriting(JSContext* cx, const Class* clasp, HandleObject proto) +/* static */ NativeObject* +GlobalObject::createBlankPrototypeInheriting(JSContext* cx, Handle<GlobalObject*> global, + const Class* clasp, HandleObject proto) { - Rooted<GlobalObject*> self(cx, this); - return CreateBlankProto(cx, clasp, proto, self); + return CreateBlankProto(cx, clasp, proto, global); } bool @@ -729,21 +728,20 @@ GlobalObject::hasRegExpStatics() const return !getSlot(REGEXP_STATICS).isUndefined(); } -RegExpStatics* -GlobalObject::getRegExpStatics(ExclusiveContext* cx) const +/* static */ RegExpStatics* +GlobalObject::getRegExpStatics(ExclusiveContext* cx, Handle<GlobalObject*> global) { MOZ_ASSERT(cx); - Rooted<GlobalObject*> self(cx, const_cast<GlobalObject*>(this)); RegExpStaticsObject* resObj = nullptr; - const Value& val = this->getSlot(REGEXP_STATICS); + const Value& val = global->getSlot(REGEXP_STATICS); if (!val.isObject()) { MOZ_ASSERT(val.isUndefined()); - resObj = RegExpStatics::create(cx, self); + resObj = RegExpStatics::create(cx, global); if (!resObj) return nullptr; - self->initSlot(REGEXP_STATICS, ObjectValue(*resObj)); + global->initSlot(REGEXP_STATICS, ObjectValue(*resObj)); } else { resObj = &val.toObject().as<RegExpStaticsObject>(); } @@ -866,7 +864,7 @@ GlobalObject::addIntrinsicValue(JSContext* cx, Handle<GlobalObject*> global, /* static */ bool GlobalObject::ensureModulePrototypesCreated(JSContext *cx, Handle<GlobalObject*> global) { - return global->getOrCreateObject(cx, MODULE_PROTO, initModuleProto) && - global->getOrCreateObject(cx, IMPORT_ENTRY_PROTO, initImportEntryProto) && - global->getOrCreateObject(cx, EXPORT_ENTRY_PROTO, initExportEntryProto); + return getOrCreateObject(cx, global, MODULE_PROTO, initModuleProto) && + getOrCreateObject(cx, global, IMPORT_ENTRY_PROTO, initImportEntryProto) && + getOrCreateObject(cx, global, EXPORT_ENTRY_PROTO, initExportEntryProto); } diff --git a/js/src/vm/GlobalObject.h b/js/src/vm/GlobalObject.h index 3534ef2f6..5aacfc5dc 100644 --- a/js/src/vm/GlobalObject.h +++ b/js/src/vm/GlobalObject.h @@ -290,8 +290,8 @@ class GlobalObject : public NativeObject * Create a constructor function with the specified name and length using * ctor, a method which creates objects with the given class. */ - JSFunction* - createConstructor(JSContext* cx, JSNative ctor, JSAtom* name, unsigned length, + static JSFunction* + createConstructor(JSContext* cx, JSNative ctor, JSAtom* name, unsigned length, gc::AllocKind kind = gc::AllocKind::FUNCTION, const JSJitInfo* jitInfo = nullptr); @@ -303,48 +303,44 @@ class GlobalObject : public NativeObject * complete the minimal initialization to make the returned object safe to * touch. */ - NativeObject* createBlankPrototype(JSContext* cx, const js::Class* clasp); + static NativeObject* + createBlankPrototype(JSContext* cx, Handle<GlobalObject*> global, const js::Class* clasp); /* * Identical to createBlankPrototype, but uses proto as the [[Prototype]] * of the returned blank prototype. */ - NativeObject* createBlankPrototypeInheriting(JSContext* cx, const js::Class* clasp, - HandleObject proto); + static NativeObject* + createBlankPrototypeInheriting(JSContext* cx, Handle<GlobalObject*> global, + const js::Class* clasp, HandleObject proto); template <typename T> - T* createBlankPrototype(JSContext* cx) { - NativeObject* res = createBlankPrototype(cx, &T::class_); + static T* + createBlankPrototype(JSContext* cx, Handle<GlobalObject*> global) { + NativeObject* res = createBlankPrototype(cx, global, &T::class_); return res ? &res->template as<T>() : nullptr; } - NativeObject* getOrCreateObjectPrototype(JSContext* cx) { - if (functionObjectClassesInitialized()) - return &getPrototype(JSProto_Object).toObject().as<NativeObject>(); - RootedGlobalObject self(cx, this); - if (!ensureConstructor(cx, self, JSProto_Object)) + static NativeObject* + getOrCreateObjectPrototype(JSContext* cx, Handle<GlobalObject*> global) { + if (global->functionObjectClassesInitialized()) + return &global->getPrototype(JSProto_Object).toObject().as<NativeObject>(); + if (!ensureConstructor(cx, global, JSProto_Object)) return nullptr; - return &self->getPrototype(JSProto_Object).toObject().as<NativeObject>(); - } - - static NativeObject* getOrCreateObjectPrototype(JSContext* cx, Handle<GlobalObject*> global) { - return global->getOrCreateObjectPrototype(cx); + return &global->getPrototype(JSProto_Object).toObject().as<NativeObject>(); } - NativeObject* getOrCreateFunctionPrototype(JSContext* cx) { - if (functionObjectClassesInitialized()) - return &getPrototype(JSProto_Function).toObject().as<NativeObject>(); - RootedGlobalObject self(cx, this); - if (!ensureConstructor(cx, self, JSProto_Object)) + static NativeObject* + getOrCreateFunctionPrototype(JSContext* cx, Handle<GlobalObject*> global) { + if (global->functionObjectClassesInitialized()) + return &global->getPrototype(JSProto_Function).toObject().as<NativeObject>(); + if (!ensureConstructor(cx, global, JSProto_Object)) return nullptr; - return &self->getPrototype(JSProto_Function).toObject().as<NativeObject>(); - } - - static NativeObject* getOrCreateFunctionPrototype(JSContext* cx, Handle<GlobalObject*> global) { - return global->getOrCreateFunctionPrototype(cx); + return &global->getPrototype(JSProto_Function).toObject().as<NativeObject>(); } - static NativeObject* getOrCreateArrayPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateArrayPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_Array)) return nullptr; return &global->getPrototype(JSProto_Array).toObject().as<NativeObject>(); @@ -356,37 +352,43 @@ class GlobalObject : public NativeObject return nullptr; } - static NativeObject* getOrCreateBooleanPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateBooleanPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_Boolean)) return nullptr; return &global->getPrototype(JSProto_Boolean).toObject().as<NativeObject>(); } - static NativeObject* getOrCreateNumberPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateNumberPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_Number)) return nullptr; return &global->getPrototype(JSProto_Number).toObject().as<NativeObject>(); } - static NativeObject* getOrCreateStringPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateStringPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_String)) return nullptr; return &global->getPrototype(JSProto_String).toObject().as<NativeObject>(); } - static NativeObject* getOrCreateSymbolPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateSymbolPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_Symbol)) return nullptr; return &global->getPrototype(JSProto_Symbol).toObject().as<NativeObject>(); } - static NativeObject* getOrCreatePromisePrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreatePromisePrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_Promise)) return nullptr; return &global->getPrototype(JSProto_Promise).toObject().as<NativeObject>(); } - static NativeObject* getOrCreateRegExpPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateRegExpPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_RegExp)) return nullptr; return &global->getPrototype(JSProto_RegExp).toObject().as<NativeObject>(); @@ -398,28 +400,30 @@ class GlobalObject : public NativeObject return nullptr; } - static NativeObject* getOrCreateSavedFramePrototype(JSContext* cx, - Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateSavedFramePrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_SavedFrame)) return nullptr; return &global->getPrototype(JSProto_SavedFrame).toObject().as<NativeObject>(); } - static JSObject* getOrCreateArrayBufferPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static JSObject* + getOrCreateArrayBufferPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_ArrayBuffer)) return nullptr; return &global->getPrototype(JSProto_ArrayBuffer).toObject(); } - JSObject* getOrCreateSharedArrayBufferPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static JSObject* + getOrCreateSharedArrayBufferPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_SharedArrayBuffer)) return nullptr; return &global->getPrototype(JSProto_SharedArrayBuffer).toObject(); } - static JSObject* getOrCreateCustomErrorPrototype(JSContext* cx, - Handle<GlobalObject*> global, - JSExnType exnType) + static JSObject* + getOrCreateCustomErrorPrototype(JSContext* cx, Handle<GlobalObject*> global, + JSExnType exnType) { JSProtoKey key = GetExceptionProtoKey(exnType); if (!ensureConstructor(cx, global, key)) @@ -439,35 +443,41 @@ class GlobalObject : public NativeObject return getOrCreateCustomErrorPrototype(cx, global, JSEXN_ERR); } - static NativeObject* getOrCreateSetPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateSetPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_Set)) return nullptr; return &global->getPrototype(JSProto_Set).toObject().as<NativeObject>(); } - static NativeObject* getOrCreateWeakSetPrototype(JSContext* cx, Handle<GlobalObject*> global) { + static NativeObject* + getOrCreateWeakSetPrototype(JSContext* cx, Handle<GlobalObject*> global) { if (!ensureConstructor(cx, global, JSProto_WeakSet)) return nullptr; return &global->getPrototype(JSProto_WeakSet).toObject().as<NativeObject>(); } - JSObject* getOrCreateIntlObject(JSContext* cx) { - return getOrCreateObject(cx, APPLICATION_SLOTS + JSProto_Intl, initIntlObject); + static JSObject* + getOrCreateIntlObject(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, APPLICATION_SLOTS + JSProto_Intl, initIntlObject); } - JSObject* getOrCreateTypedObjectModule(JSContext* cx) { - return getOrCreateObject(cx, APPLICATION_SLOTS + JSProto_TypedObject, initTypedObjectModule); + static JSObject* + getOrCreateTypedObjectModule(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, APPLICATION_SLOTS + JSProto_TypedObject, + initTypedObjectModule); } - JSObject* getOrCreateSimdGlobalObject(JSContext* cx) { - return getOrCreateObject(cx, APPLICATION_SLOTS + JSProto_SIMD, initSimdObject); + static JSObject* + getOrCreateSimdGlobalObject(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, APPLICATION_SLOTS + JSProto_SIMD, initSimdObject); } // Get the type descriptor for one of the SIMD types. // simdType is one of the JS_SIMDTYPEREPR_* constants. // Implemented in builtin/SIMD.cpp. - static SimdTypeDescr* getOrCreateSimdTypeDescr(JSContext* cx, Handle<GlobalObject*> global, - SimdType simdType); + static SimdTypeDescr* + getOrCreateSimdTypeDescr(JSContext* cx, Handle<GlobalObject*> global, SimdType simdType); TypedObjectModuleObject& getTypedObjectModule() const; @@ -475,16 +485,19 @@ class GlobalObject : public NativeObject return &getPrototype(JSProto_Iterator).toObject(); } - JSObject* getOrCreateCollatorPrototype(JSContext* cx) { - return getOrCreateObject(cx, COLLATOR_PROTO, initIntlObject); + static JSObject* + getOrCreateCollatorPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, COLLATOR_PROTO, initIntlObject); } - JSObject* getOrCreateNumberFormatPrototype(JSContext* cx) { - return getOrCreateObject(cx, NUMBER_FORMAT_PROTO, initIntlObject); + static JSObject* + getOrCreateNumberFormatPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, NUMBER_FORMAT_PROTO, initIntlObject); } - JSObject* getOrCreateDateTimeFormatPrototype(JSContext* cx) { - return getOrCreateObject(cx, DATE_TIME_FORMAT_PROTO, initIntlObject); + static JSObject* + getOrCreateDateTimeFormatPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, DATE_TIME_FORMAT_PROTO, initIntlObject); } static bool ensureModulePrototypesCreated(JSContext *cx, Handle<GlobalObject*> global); @@ -539,88 +552,86 @@ class GlobalObject : public NativeObject private: typedef bool (*ObjectInitOp)(JSContext* cx, Handle<GlobalObject*> global); - JSObject* getOrCreateObject(JSContext* cx, unsigned slot, ObjectInitOp init) { - Value v = getSlotRef(slot); + static JSObject* + getOrCreateObject(JSContext* cx, Handle<GlobalObject*> global, unsigned slot, + ObjectInitOp init) + { + Value v = global->getSlotRef(slot); if (v.isObject()) return &v.toObject(); - RootedGlobalObject self(cx, this); - if (!init(cx, self)) + if (!init(cx, global)) return nullptr; - return &self->getSlot(slot).toObject(); + return &global->getSlot(slot).toObject(); } public: - static NativeObject* getOrCreateIteratorPrototype(JSContext* cx, Handle<GlobalObject*> global) - { - return MaybeNativeObject(global->getOrCreateObject(cx, ITERATOR_PROTO, initIteratorProto)); + static NativeObject* + getOrCreateIteratorPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return MaybeNativeObject(getOrCreateObject(cx, global, ITERATOR_PROTO, initIteratorProto)); } - static NativeObject* getOrCreateArrayIteratorPrototype(JSContext* cx, Handle<GlobalObject*> global) - { - return MaybeNativeObject(global->getOrCreateObject(cx, ARRAY_ITERATOR_PROTO, initArrayIteratorProto)); + static NativeObject* + getOrCreateArrayIteratorPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return MaybeNativeObject(getOrCreateObject(cx, global, ARRAY_ITERATOR_PROTO, + initArrayIteratorProto)); } - static NativeObject* getOrCreateStringIteratorPrototype(JSContext* cx, - Handle<GlobalObject*> global) - { - return MaybeNativeObject(global->getOrCreateObject(cx, STRING_ITERATOR_PROTO, initStringIteratorProto)); + static NativeObject* + getOrCreateStringIteratorPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return MaybeNativeObject(getOrCreateObject(cx, global, STRING_ITERATOR_PROTO, + initStringIteratorProto)); } - static NativeObject* getOrCreateLegacyGeneratorObjectPrototype(JSContext* cx, - Handle<GlobalObject*> global) - { - return MaybeNativeObject(global->getOrCreateObject(cx, LEGACY_GENERATOR_OBJECT_PROTO, - initLegacyGeneratorProto)); + static NativeObject* + getOrCreateLegacyGeneratorObjectPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return MaybeNativeObject(getOrCreateObject(cx, global, LEGACY_GENERATOR_OBJECT_PROTO, + initLegacyGeneratorProto)); } - static NativeObject* getOrCreateStarGeneratorObjectPrototype(JSContext* cx, - Handle<GlobalObject*> global) + static NativeObject* + getOrCreateStarGeneratorObjectPrototype(JSContext* cx, Handle<GlobalObject*> global) { - return MaybeNativeObject(global->getOrCreateObject(cx, STAR_GENERATOR_OBJECT_PROTO, initStarGenerators)); + return MaybeNativeObject(getOrCreateObject(cx, global, STAR_GENERATOR_OBJECT_PROTO, + initStarGenerators)); } - static NativeObject* getOrCreateStarGeneratorFunctionPrototype(JSContext* cx, - Handle<GlobalObject*> global) - { - return MaybeNativeObject(global->getOrCreateObject(cx, STAR_GENERATOR_FUNCTION_PROTO, initStarGenerators)); + static NativeObject* + getOrCreateStarGeneratorFunctionPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return MaybeNativeObject(getOrCreateObject(cx, global, STAR_GENERATOR_FUNCTION_PROTO, + initStarGenerators)); } - static JSObject* getOrCreateStarGeneratorFunction(JSContext* cx, - Handle<GlobalObject*> global) - { - return global->getOrCreateObject(cx, STAR_GENERATOR_FUNCTION, initStarGenerators); + static JSObject* + getOrCreateStarGeneratorFunction(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, STAR_GENERATOR_FUNCTION, initStarGenerators); } - static NativeObject* getOrCreateAsyncFunctionPrototype(JSContext* cx, - Handle<GlobalObject*> global) - { - return MaybeNativeObject(global->getOrCreateObject(cx, ASYNC_FUNCTION_PROTO, - initAsyncFunction)); + static NativeObject* + getOrCreateAsyncFunctionPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return MaybeNativeObject(getOrCreateObject(cx, global, ASYNC_FUNCTION_PROTO, + initAsyncFunction)); } - static JSObject* getOrCreateAsyncFunction(JSContext* cx, - Handle<GlobalObject*> global) - { - return global->getOrCreateObject(cx, ASYNC_FUNCTION, initAsyncFunction); + static JSObject* + getOrCreateAsyncFunction(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, ASYNC_FUNCTION, initAsyncFunction); } - static JSObject* getOrCreateMapIteratorPrototype(JSContext* cx, - Handle<GlobalObject*> global) - { - return global->getOrCreateObject(cx, MAP_ITERATOR_PROTO, initMapIteratorProto); + static JSObject* + getOrCreateMapIteratorPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, MAP_ITERATOR_PROTO, initMapIteratorProto); } - static JSObject* getOrCreateSetIteratorPrototype(JSContext* cx, - Handle<GlobalObject*> global) - { - return global->getOrCreateObject(cx, SET_ITERATOR_PROTO, initSetIteratorProto); + static JSObject* + getOrCreateSetIteratorPrototype(JSContext* cx, Handle<GlobalObject*> global) { + return getOrCreateObject(cx, global, SET_ITERATOR_PROTO, initSetIteratorProto); } - JSObject* getOrCreateDataViewPrototype(JSContext* cx) { - RootedGlobalObject self(cx, this); - if (!ensureConstructor(cx, self, JSProto_DataView)) + static JSObject* + getOrCreateDataViewPrototype(JSContext* cx, Handle<GlobalObject*> global) { + if (!ensureConstructor(cx, global, JSProto_DataView)) return nullptr; - return &self->getPrototype(JSProto_DataView).toObject(); + return &global->getPrototype(JSProto_DataView).toObject(); } static JSFunction* @@ -678,8 +689,9 @@ class GlobalObject : public NativeObject return true; } - static bool getIntrinsicValue(JSContext* cx, Handle<GlobalObject*> global, - HandlePropertyName name, MutableHandleValue value) + static bool + getIntrinsicValue(JSContext* cx, Handle<GlobalObject*> global, + HandlePropertyName name, MutableHandleValue value) { bool exists = false; if (!GlobalObject::maybeGetIntrinsicValue(cx, global, name, value, &exists)) @@ -709,7 +721,8 @@ class GlobalObject : public NativeObject unsigned nargs, MutableHandleValue funVal); bool hasRegExpStatics() const; - RegExpStatics* getRegExpStatics(ExclusiveContext* cx) const; + static RegExpStatics* getRegExpStatics(ExclusiveContext* cx, + Handle<GlobalObject*> global); RegExpStatics* getAlreadyCreatedRegExpStatics() const; JSObject* getThrowTypeError() const { @@ -996,7 +1009,7 @@ GenericCreateConstructor(JSContext* cx, JSProtoKey key) // Note - We duplicate the trick from ClassName() so that we don't need to // include jsatominlines.h here. PropertyName* name = (&cx->names().Null)[key]; - return cx->global()->createConstructor(cx, ctor, name, length, kind, jitInfo); + return GlobalObject::createConstructor(cx, ctor, name, length, kind, jitInfo); } inline JSObject* @@ -1009,7 +1022,7 @@ GenericCreatePrototype(JSContext* cx, JSProtoKey key) if (!GlobalObject::ensureConstructor(cx, cx->global(), protoKey)) return nullptr; RootedObject parentProto(cx, &cx->global()->getPrototype(protoKey).toObject()); - return cx->global()->createBlankPrototypeInheriting(cx, clasp, parentProto); + return GlobalObject::createBlankPrototypeInheriting(cx, cx->global(), clasp, parentProto); } inline JSProtoKey diff --git a/js/src/vm/HelperThreads.cpp b/js/src/vm/HelperThreads.cpp index bd29d0c79..44915521f 100644 --- a/js/src/vm/HelperThreads.cpp +++ b/js/src/vm/HelperThreads.cpp @@ -1291,7 +1291,7 @@ GlobalHelperThreadState::finishModuleParseTask(JSContext* cx, void* token) MOZ_ASSERT(script->module()); RootedModuleObject module(cx, script->module()); - module->fixEnvironmentsAfterCompartmentMerge(cx); + module->fixEnvironmentsAfterCompartmentMerge(); if (!ModuleObject::Freeze(cx, module)) return nullptr; diff --git a/js/src/vm/Interpreter-inl.h b/js/src/vm/Interpreter-inl.h index a2c8e220a..acfa8f74b 100644 --- a/js/src/vm/Interpreter-inl.h +++ b/js/src/vm/Interpreter-inl.h @@ -830,7 +830,7 @@ class FastCallGuard if (useIon_ && fun_) { if (!script_) { - script_ = fun_->getOrCreateScript(cx); + script_ = JSFunction::getOrCreateScript(cx, fun_); if (!script_) return false; } diff --git a/js/src/vm/Interpreter.cpp b/js/src/vm/Interpreter.cpp index 0f83c3435..030f0f3b6 100644 --- a/js/src/vm/Interpreter.cpp +++ b/js/src/vm/Interpreter.cpp @@ -261,11 +261,16 @@ SetPropertyOperation(JSContext* cx, JSOp op, HandleValue lval, HandleId id, Hand } static JSFunction* -MakeDefaultConstructor(JSContext* cx, JSOp op, JSAtom* atom, HandleObject proto) +MakeDefaultConstructor(JSContext* cx, HandleScript script, jsbytecode* pc, HandleObject proto) { + JSOp op = JSOp(*pc); + JSAtom* atom = script->getAtom(pc); bool derived = op == JSOP_DERIVEDCONSTRUCTOR; MOZ_ASSERT(derived == !!proto); + jssrcnote* classNote = GetSrcNote(cx, script, pc); + MOZ_ASSERT(classNote && SN_TYPE(classNote) == SRC_CLASS_SPAN); + PropertyName* lookup = derived ? cx->names().DefaultDerivedClassConstructor : cx->names().DefaultBaseClassConstructor; @@ -285,6 +290,17 @@ MakeDefaultConstructor(JSContext* cx, JSOp op, JSAtom* atom, HandleObject proto) MOZ_ASSERT(ctor->infallibleIsDefaultClassConstructor(cx)); + // Create the script now, as the source span needs to be overridden for + // toString. Calling toString on a class constructor must not return the + // source for just the constructor function. + JSScript *ctorScript = JSFunction::getOrCreateScript(cx, ctor); + if (!ctorScript) + return nullptr; + uint32_t classStartOffset = GetSrcNoteOffset(classNote, 0); + uint32_t classEndOffset = GetSrcNoteOffset(classNote, 1); + ctorScript->setDefaultClassConstructorSpan(script->sourceObject(), classStartOffset, + classEndOffset); + return ctor; } @@ -373,7 +389,7 @@ js::RunScript(JSContext* cx, RunState& state) SPSEntryMarker marker(cx->runtime(), state.script()); - state.script()->ensureNonLazyCanonicalFunction(cx); + state.script()->ensureNonLazyCanonicalFunction(); if (jit::IsIonEnabled(cx)) { jit::MethodStatus status = jit::CanEnter(cx, state); @@ -446,7 +462,7 @@ js::InternalCallOrConstruct(JSContext* cx, const CallArgs& args, MaybeConstruct } /* Invoke native functions. */ - JSFunction* fun = &args.callee().as<JSFunction>(); + RootedFunction fun(cx, &args.callee().as<JSFunction>()); if (construct != CONSTRUCT && fun->isClassConstructor()) { JS_ReportErrorNumberASCII(cx, GetErrorMessage, nullptr, JSMSG_CANT_CALL_CLASS_CONSTRUCTOR); return false; @@ -454,10 +470,16 @@ js::InternalCallOrConstruct(JSContext* cx, const CallArgs& args, MaybeConstruct if (fun->isNative()) { MOZ_ASSERT_IF(construct, !fun->isConstructor()); - return CallJSNative(cx, fun->native(), args); + JSNative native = fun->native(); + if (!construct && args.ignoresReturnValue()) { + const JSJitInfo* jitInfo = fun->jitInfo(); + if (jitInfo && jitInfo->type() == JSJitInfo::IgnoresReturnValueNative) + native = jitInfo->ignoresReturnValueMethod; + } + return CallJSNative(cx, native, args); } - if (!fun->getOrCreateScript(cx)) + if (!JSFunction::getOrCreateScript(cx, fun)) return false; /* Run function until JSOP_RETRVAL, JSOP_RETURN or error. */ @@ -1543,7 +1565,7 @@ SetObjectElementOperation(JSContext* cx, HandleObject obj, HandleId id, HandleVa } } - if (obj->isNative() && !JSID_IS_INT(id) && !obj->setHadElementsAccess(cx)) + if (obj->isNative() && !JSID_IS_INT(id) && !JSObject::setHadElementsAccess(cx, obj)) return false; ObjectOpResult result; @@ -2959,6 +2981,7 @@ CASE(JSOP_FUNAPPLY) CASE(JSOP_NEW) CASE(JSOP_CALL) +CASE(JSOP_CALL_IGNORES_RV) CASE(JSOP_CALLITER) CASE(JSOP_SUPERCALL) CASE(JSOP_FUNCALL) @@ -2967,10 +2990,11 @@ CASE(JSOP_FUNCALL) cx->runtime()->spsProfiler.updatePC(script, REGS.pc); MaybeConstruct construct = MaybeConstruct(*REGS.pc == JSOP_NEW || *REGS.pc == JSOP_SUPERCALL); + bool ignoresReturnValue = *REGS.pc == JSOP_CALL_IGNORES_RV; unsigned argStackSlots = GET_ARGC(REGS.pc) + construct; MOZ_ASSERT(REGS.stackDepth() >= 2u + GET_ARGC(REGS.pc)); - CallArgs args = CallArgsFromSp(argStackSlots, REGS.sp, construct); + CallArgs args = CallArgsFromSp(argStackSlots, REGS.sp, construct, ignoresReturnValue); JSFunction* maybeFun; bool isFunction = IsFunctionObject(args.calleev(), &maybeFun); @@ -3000,7 +3024,7 @@ CASE(JSOP_FUNCALL) { MOZ_ASSERT(maybeFun); ReservedRooted<JSFunction*> fun(&rootFunction0, maybeFun); - ReservedRooted<JSScript*> funScript(&rootScript0, fun->getOrCreateScript(cx)); + ReservedRooted<JSScript*> funScript(&rootScript0, JSFunction::getOrCreateScript(cx, fun)); if (!funScript) goto error; @@ -4174,8 +4198,8 @@ CASE(JSOP_DERIVEDCONSTRUCTOR) MOZ_ASSERT(REGS.sp[-1].isObject()); ReservedRooted<JSObject*> proto(&rootObject0, ®S.sp[-1].toObject()); - JSFunction* constructor = MakeDefaultConstructor(cx, JSOp(*REGS.pc), script->getAtom(REGS.pc), - proto); + JSFunction* constructor = MakeDefaultConstructor(cx, script, REGS.pc, proto); + if (!constructor) goto error; @@ -4185,8 +4209,7 @@ END_CASE(JSOP_DERIVEDCONSTRUCTOR) CASE(JSOP_CLASSCONSTRUCTOR) { - JSFunction* constructor = MakeDefaultConstructor(cx, JSOp(*REGS.pc), script->getAtom(REGS.pc), - nullptr); + JSFunction* constructor = MakeDefaultConstructor(cx, script, REGS.pc, nullptr); if (!constructor) goto error; PUSH_OBJECT(*constructor); @@ -4725,7 +4748,8 @@ js::RunOnceScriptPrologue(JSContext* cx, HandleScript script) // Force instantiation of the script's function's group to ensure the flag // is preserved in type information. - if (!script->functionNonDelazifying()->getGroup(cx)) + RootedFunction fun(cx, script->functionNonDelazifying()); + if (!JSObject::getGroup(cx, fun)) return false; MarkObjectGroupFlags(cx, script->functionNonDelazifying(), OBJECT_FLAG_RUNONCE_INVALIDATED); diff --git a/js/src/vm/NativeObject-inl.h b/js/src/vm/NativeObject-inl.h index 052a3385c..e55e3db04 100644 --- a/js/src/vm/NativeObject-inl.h +++ b/js/src/vm/NativeObject-inl.h @@ -236,7 +236,7 @@ NativeObject::ensureDenseElements(ExclusiveContext* cx, uint32_t index, uint32_t } inline DenseElementResult -NativeObject::setOrExtendDenseElements(JSContext* cx, uint32_t start, const Value* vp, +NativeObject::setOrExtendDenseElements(ExclusiveContext* cx, uint32_t start, const Value* vp, uint32_t count, ShouldUpdateTypes updateTypes) { diff --git a/js/src/vm/NativeObject.cpp b/js/src/vm/NativeObject.cpp index a3f28653a..da0f59fe2 100644 --- a/js/src/vm/NativeObject.cpp +++ b/js/src/vm/NativeObject.cpp @@ -672,10 +672,10 @@ NativeObject::maybeDensifySparseElements(js::ExclusiveContext* cx, HandleNativeO */ if (shape != obj->lastProperty()) { shape = shape->previous(); - if (!obj->removeProperty(cx, id)) + if (!NativeObject::removeProperty(cx, obj, id)) return DenseElementResult::Failure; } else { - if (!obj->removeProperty(cx, id)) + if (!NativeObject::removeProperty(cx, obj, id)) return DenseElementResult::Failure; shape = obj->lastProperty(); } @@ -691,7 +691,7 @@ NativeObject::maybeDensifySparseElements(js::ExclusiveContext* cx, HandleNativeO * flag so that we will not start using sparse indexes again if we need * to grow the object. */ - if (!obj->clearFlag(cx, BaseShape::INDEXED)) + if (!NativeObject::clearFlag(cx, obj, BaseShape::INDEXED)) return DenseElementResult::Failure; return DenseElementResult::Success; @@ -996,23 +996,22 @@ NativeObject::freeSlot(ExclusiveContext* cx, uint32_t slot) setSlot(slot, UndefinedValue()); } -Shape* -NativeObject::addDataProperty(ExclusiveContext* cx, jsid idArg, uint32_t slot, unsigned attrs) +/* static */ Shape* +NativeObject::addDataProperty(ExclusiveContext* cx, HandleNativeObject obj, + jsid idArg, uint32_t slot, unsigned attrs) { MOZ_ASSERT(!(attrs & (JSPROP_GETTER | JSPROP_SETTER))); - RootedNativeObject self(cx, this); RootedId id(cx, idArg); - return addProperty(cx, self, id, nullptr, nullptr, slot, attrs, 0); + return addProperty(cx, obj, id, nullptr, nullptr, slot, attrs, 0); } -Shape* -NativeObject::addDataProperty(ExclusiveContext* cx, HandlePropertyName name, - uint32_t slot, unsigned attrs) +/* static */ Shape* +NativeObject::addDataProperty(ExclusiveContext* cx, HandleNativeObject obj, + HandlePropertyName name, uint32_t slot, unsigned attrs) { MOZ_ASSERT(!(attrs & (JSPROP_GETTER | JSPROP_SETTER))); - RootedNativeObject self(cx, this); RootedId id(cx, NameToId(name)); - return addProperty(cx, self, id, nullptr, nullptr, slot, attrs, 0); + return addProperty(cx, obj, id, nullptr, nullptr, slot, attrs, 0); } template <AllowGC allowGC> @@ -1046,7 +1045,7 @@ CallAddPropertyHook(ExclusiveContext* cx, HandleNativeObject obj, HandleShape sh RootedId id(cx, shape->propid()); if (!CallJSAddPropertyOp(cx->asJSContext(), addProperty, obj, id, value)) { - obj->removeProperty(cx, shape->propid()); + NativeObject::removeProperty(cx, obj, shape->propid()); return false; } } @@ -1118,7 +1117,7 @@ PurgeProtoChain(ExclusiveContext* cx, JSObject* objArg, HandleId id) shape = obj->as<NativeObject>().lookup(cx, id); if (shape) - return obj->as<NativeObject>().shadowingShapeChange(cx, *shape); + return NativeObject::shadowingShapeChange(cx, obj.as<NativeObject>(), *shape); obj = obj->staticPrototype(); } @@ -2529,7 +2528,7 @@ js::NativeDeleteProperty(JSContext* cx, HandleNativeObject obj, HandleId id, obj->setDenseElementHole(cx, JSID_TO_INT(id)); } else { - if (!obj->removeProperty(cx, id)) + if (!NativeObject::removeProperty(cx, obj, id)) return false; } diff --git a/js/src/vm/NativeObject.h b/js/src/vm/NativeObject.h index d9d8b8aec..9cc6d5436 100644 --- a/js/src/vm/NativeObject.h +++ b/js/src/vm/NativeObject.h @@ -491,8 +491,8 @@ class NativeObject : public ShapedObject void checkShapeConsistency() { } #endif - Shape* - replaceWithNewEquivalentShape(ExclusiveContext* cx, + static Shape* + replaceWithNewEquivalentShape(ExclusiveContext* cx, HandleNativeObject obj, Shape* existingShape, Shape* newShape = nullptr, bool accessorShape = false); @@ -510,7 +510,7 @@ class NativeObject : public ShapedObject */ bool setSlotSpan(ExclusiveContext* cx, uint32_t span); - bool toDictionaryMode(ExclusiveContext* cx); + static MOZ_MUST_USE bool toDictionaryMode(ExclusiveContext* cx, HandleNativeObject obj); private: friend class TenuringTracer; @@ -609,12 +609,15 @@ class NativeObject : public ShapedObject } public: - bool generateOwnShape(ExclusiveContext* cx, Shape* newShape = nullptr) { - return replaceWithNewEquivalentShape(cx, lastProperty(), newShape); + static MOZ_MUST_USE bool generateOwnShape(ExclusiveContext* cx, HandleNativeObject obj, + Shape* newShape = nullptr) + { + return replaceWithNewEquivalentShape(cx, obj, obj->lastProperty(), newShape); } - bool shadowingShapeChange(ExclusiveContext* cx, const Shape& shape); - bool clearFlag(ExclusiveContext* cx, BaseShape::Flag flag); + static MOZ_MUST_USE bool shadowingShapeChange(ExclusiveContext* cx, HandleNativeObject obj, + const Shape& shape); + static bool clearFlag(ExclusiveContext* cx, HandleNativeObject obj, BaseShape::Flag flag); // The maximum number of slots in an object. // |MAX_SLOTS_COUNT * sizeof(JS::Value)| shouldn't overflow @@ -741,10 +744,10 @@ class NativeObject : public ShapedObject bool allowDictionary = true); /* Add a data property whose id is not yet in this scope. */ - Shape* addDataProperty(ExclusiveContext* cx, - jsid id_, uint32_t slot, unsigned attrs); - Shape* addDataProperty(ExclusiveContext* cx, HandlePropertyName name, - uint32_t slot, unsigned attrs); + static Shape* addDataProperty(ExclusiveContext* cx, HandleNativeObject obj, + jsid id_, uint32_t slot, unsigned attrs); + static Shape* addDataProperty(ExclusiveContext* cx, HandleNativeObject obj, + HandlePropertyName name, uint32_t slot, unsigned attrs); /* Add or overwrite a property for id in this scope. */ static Shape* @@ -764,7 +767,7 @@ class NativeObject : public ShapedObject unsigned attrs, JSGetterOp getter, JSSetterOp setter); /* Remove the property named by id from this object. */ - bool removeProperty(ExclusiveContext* cx, jsid id); + static bool removeProperty(ExclusiveContext* cx, HandleNativeObject obj, jsid id); /* Clear the scope, making it empty. */ static void clear(ExclusiveContext* cx, HandleNativeObject obj); @@ -783,7 +786,8 @@ class NativeObject : public ShapedObject unsigned flags, ShapeTable::Entry* entry, bool allowDictionary, const AutoKeepShapeTables& keep); - bool fillInAfterSwap(JSContext* cx, const Vector<Value>& values, void* priv); + static MOZ_MUST_USE bool fillInAfterSwap(JSContext* cx, HandleNativeObject obj, + const Vector<Value>& values, void* priv); public: // Return true if this object has been converted from shared-immutable @@ -1146,7 +1150,7 @@ class NativeObject : public ShapedObject } inline DenseElementResult - setOrExtendDenseElements(JSContext* cx, uint32_t start, const Value* vp, uint32_t count, + setOrExtendDenseElements(ExclusiveContext* cx, uint32_t start, const Value* vp, uint32_t count, ShouldUpdateTypes updateTypes = ShouldUpdateTypes::Update); bool shouldConvertDoubleElements() { @@ -1470,19 +1474,6 @@ NativeGetExistingProperty(JSContext* cx, HandleObject receiver, HandleNativeObje /* * */ -/* - * If obj has an already-resolved data property for id, return true and - * store the property value in *vp. - */ -extern bool -HasDataProperty(JSContext* cx, NativeObject* obj, jsid id, Value* vp); - -inline bool -HasDataProperty(JSContext* cx, NativeObject* obj, PropertyName* name, Value* vp) -{ - return HasDataProperty(cx, obj, NameToId(name), vp); -} - extern bool GetPropertyForNameLookup(JSContext* cx, HandleObject obj, HandleId id, MutableHandleValue vp); diff --git a/js/src/vm/ObjectGroup.cpp b/js/src/vm/ObjectGroup.cpp index 676792379..ec0a7aec1 100644 --- a/js/src/vm/ObjectGroup.cpp +++ b/js/src/vm/ObjectGroup.cpp @@ -249,7 +249,7 @@ ObjectGroup::useSingletonForAllocationSite(JSScript* script, jsbytecode* pc, con ///////////////////////////////////////////////////////////////////// bool -JSObject::shouldSplicePrototype(JSContext* cx) +JSObject::shouldSplicePrototype() { /* * During bootstrapping, if inference is enabled we need to make sure not @@ -262,33 +262,36 @@ JSObject::shouldSplicePrototype(JSContext* cx) return isSingleton(); } -bool -JSObject::splicePrototype(JSContext* cx, const Class* clasp, Handle<TaggedProto> proto) +/* static */ bool +JSObject::splicePrototype(JSContext* cx, HandleObject obj, const Class* clasp, + Handle<TaggedProto> proto) { - MOZ_ASSERT(cx->compartment() == compartment()); - - RootedObject self(cx, this); + MOZ_ASSERT(cx->compartment() == obj->compartment()); /* * For singleton groups representing only a single JSObject, the proto * can be rearranged as needed without destroying type information for * the old or new types. */ - MOZ_ASSERT(self->isSingleton()); + MOZ_ASSERT(obj->isSingleton()); // Windows may not appear on prototype chains. MOZ_ASSERT_IF(proto.isObject(), !IsWindow(proto.toObject())); - if (proto.isObject() && !proto.toObject()->setDelegate(cx)) - return false; + if (proto.isObject()) { + RootedObject protoObj(cx, proto.toObject()); + if (!JSObject::setDelegate(cx, protoObj)) + return false; + } // Force type instantiation when splicing lazy group. - RootedObjectGroup group(cx, self->getGroup(cx)); + RootedObjectGroup group(cx, JSObject::getGroup(cx, obj)); if (!group) return false; RootedObjectGroup protoGroup(cx, nullptr); if (proto.isObject()) { - protoGroup = proto.toObject()->getGroup(cx); + RootedObject protoObj(cx, proto.toObject()); + protoGroup = JSObject::getGroup(cx, protoObj); if (!protoGroup) return false; } @@ -307,7 +310,7 @@ JSObject::makeLazyGroup(JSContext* cx, HandleObject obj) /* De-lazification of functions can GC, so we need to do it up here. */ if (obj->is<JSFunction>() && obj->as<JSFunction>().isInterpretedLazy()) { RootedFunction fun(cx, &obj->as<JSFunction>()); - if (!fun->getOrCreateScript(cx)) + if (!JSFunction::getOrCreateScript(cx, fun)) return nullptr; } @@ -346,7 +349,7 @@ JSObject::makeLazyGroup(JSContext* cx, HandleObject obj) JSObject::setNewGroupUnknown(JSContext* cx, const js::Class* clasp, JS::HandleObject obj) { ObjectGroup::setDefaultNewGroupUnknown(cx, clasp, obj); - return obj->setFlags(cx, BaseShape::NEW_GROUP_UNKNOWN); + return JSObject::setFlags(cx, obj, BaseShape::NEW_GROUP_UNKNOWN); } ///////////////////////////////////////////////////////////////////// @@ -508,7 +511,7 @@ ObjectGroup::defaultNewGroup(ExclusiveContext* cx, const Class* clasp, if (proto.isObject() && !proto.toObject()->isDelegate()) { RootedObject protoObj(cx, proto.toObject()); - if (!protoObj->setDelegate(cx)) + if (!JSObject::setDelegate(cx, protoObj)) return nullptr; // Objects which are prototypes of one another should be singletons, so diff --git a/js/src/vm/Opcodes.h b/js/src/vm/Opcodes.h index 095ef57ae..3c4d61a67 100644 --- a/js/src/vm/Opcodes.h +++ b/js/src/vm/Opcodes.h @@ -2282,14 +2282,23 @@ * Operands: * Stack: => */ \ - macro(JSOP_JUMPTARGET, 230, "jumptarget", NULL, 1, 0, 0, JOF_BYTE) + macro(JSOP_JUMPTARGET, 230, "jumptarget", NULL, 1, 0, 0, JOF_BYTE)\ + /* + * Like JSOP_CALL, but tells the function that the return value is ignored. + * stack. + * Category: Statements + * Type: Function + * Operands: uint16_t argc + * Stack: callee, this, args[0], ..., args[argc-1] => rval + * nuses: (argc+2) + */ \ + macro(JSOP_CALL_IGNORES_RV, 231, "call-ignores-rv", NULL, 3, -1, 1, JOF_UINT16|JOF_INVOKE|JOF_TYPESET) /* * In certain circumstances it may be useful to "pad out" the opcode space to * a power of two. Use this macro to do so. */ #define FOR_EACH_TRAILING_UNUSED_OPCODE(macro) \ - macro(231) \ macro(232) \ macro(233) \ macro(234) \ diff --git a/js/src/vm/ProxyObject.h b/js/src/vm/ProxyObject.h index a0a929b20..d86d72cc9 100644 --- a/js/src/vm/ProxyObject.h +++ b/js/src/vm/ProxyObject.h @@ -104,7 +104,7 @@ class ProxyObject : public ShapedObject public: static unsigned grayLinkExtraSlot(JSObject* obj); - void renew(JSContext* cx, const BaseProxyHandler* handler, const Value& priv); + void renew(const BaseProxyHandler* handler, const Value& priv); static void trace(JSTracer* trc, JSObject* obj); diff --git a/js/src/vm/RegExpObject.cpp b/js/src/vm/RegExpObject.cpp index e0b44e1eb..ef97ed816 100644 --- a/js/src/vm/RegExpObject.cpp +++ b/js/src/vm/RegExpObject.cpp @@ -129,10 +129,10 @@ RegExpSharedReadBarrier(JSContext* cx, RegExpShared* shared) shared->unmarkGray(); } -bool -RegExpObject::getShared(JSContext* cx, RegExpGuard* g) +/* static */ bool +RegExpObject::getShared(JSContext* cx, Handle<RegExpObject*> regexp, RegExpGuard* g) { - if (RegExpShared* shared = maybeShared()) { + if (RegExpShared* shared = regexp->maybeShared()) { // Fetching a RegExpShared from an object requires a read // barrier, as the shared pointer might be weak. RegExpSharedReadBarrier(cx, shared); @@ -141,7 +141,7 @@ RegExpObject::getShared(JSContext* cx, RegExpGuard* g) return true; } - return createShared(cx, g); + return createShared(cx, regexp, g); } /* static */ bool @@ -199,7 +199,7 @@ RegExpObject::trace(JSTracer* trc, JSObject* obj) static JSObject* CreateRegExpPrototype(JSContext* cx, JSProtoKey key) { - return cx->global()->createBlankPrototype(cx, &RegExpObject::protoClass_); + return GlobalObject::createBlankPrototype(cx, cx->global(), &RegExpObject::protoClass_); } static const ClassOps RegExpObjectClassOps = { @@ -279,16 +279,14 @@ RegExpObject::create(ExclusiveContext* cx, HandleAtom source, RegExpFlag flags, return regexp; } -bool -RegExpObject::createShared(JSContext* cx, RegExpGuard* g) +/* static */ bool +RegExpObject::createShared(JSContext* cx, Handle<RegExpObject*> regexp, RegExpGuard* g) { - Rooted<RegExpObject*> self(cx, this); - - MOZ_ASSERT(!maybeShared()); - if (!cx->compartment()->regExps.get(cx, getSource(), getFlags(), g)) + MOZ_ASSERT(!regexp->maybeShared()); + if (!cx->compartment()->regExps.get(cx, regexp->getSource(), regexp->getFlags(), g)) return false; - self->setShared(**g); + regexp->setShared(**g); return true; } @@ -300,7 +298,8 @@ RegExpObject::assignInitialShape(ExclusiveContext* cx, Handle<RegExpObject*> sel JS_STATIC_ASSERT(LAST_INDEX_SLOT == 0); /* The lastIndex property alone is writable but non-configurable. */ - return self->addDataProperty(cx, cx->names().lastIndex, LAST_INDEX_SLOT, JSPROP_PERMANENT); + return NativeObject::addDataProperty(cx, self, cx->names().lastIndex, LAST_INDEX_SLOT, + JSPROP_PERMANENT); } void @@ -891,11 +890,12 @@ RegExpShared::dumpBytecode(JSContext* cx, bool match_only, HandleLinearString in return true; } -bool -RegExpObject::dumpBytecode(JSContext* cx, bool match_only, HandleLinearString input) +/* static */ bool +RegExpObject::dumpBytecode(JSContext* cx, Handle<RegExpObject*> regexp, + bool match_only, HandleLinearString input) { RegExpGuard g(cx); - if (!getShared(cx, &g)) + if (!getShared(cx, regexp, &g)) return false; return g.re()->dumpBytecode(cx, match_only, input); @@ -1430,7 +1430,7 @@ js::CloneRegExpObject(JSContext* cx, JSObject* obj_) Rooted<JSAtom*> source(cx, regex->getSource()); RegExpGuard g(cx); - if (!regex->getShared(cx, &g)) + if (!RegExpObject::getShared(cx, regex, &g)) return nullptr; clone->initAndZeroLastIndex(source, g->getFlags(), cx); diff --git a/js/src/vm/RegExpObject.h b/js/src/vm/RegExpObject.h index dc428a973..f1ea101ed 100644 --- a/js/src/vm/RegExpObject.h +++ b/js/src/vm/RegExpObject.h @@ -483,7 +483,8 @@ class RegExpObject : public NativeObject static bool isOriginalFlagGetter(JSNative native, RegExpFlag* mask); - bool getShared(JSContext* cx, RegExpGuard* g); + static MOZ_MUST_USE bool getShared(JSContext* cx, Handle<RegExpObject*> regexp, + RegExpGuard* g); void setShared(RegExpShared& shared) { MOZ_ASSERT(!maybeShared()); @@ -500,7 +501,8 @@ class RegExpObject : public NativeObject void initAndZeroLastIndex(HandleAtom source, RegExpFlag flags, ExclusiveContext* cx); #ifdef DEBUG - bool dumpBytecode(JSContext* cx, bool match_only, HandleLinearString input); + static MOZ_MUST_USE bool dumpBytecode(JSContext* cx, Handle<RegExpObject*> regexp, + bool match_only, HandleLinearString input); #endif private: @@ -508,7 +510,8 @@ class RegExpObject : public NativeObject * Precondition: the syntax for |source| has already been validated. * Side effect: sets the private field. */ - bool createShared(JSContext* cx, RegExpGuard* g); + static MOZ_MUST_USE bool createShared(JSContext* cx, Handle<RegExpObject*> regexp, + RegExpGuard* g); RegExpShared* maybeShared() const { return static_cast<RegExpShared*>(NativeObject::getPrivate(PRIVATE_SLOT)); } @@ -531,7 +534,7 @@ inline bool RegExpToShared(JSContext* cx, HandleObject obj, RegExpGuard* g) { if (obj->is<RegExpObject>()) - return obj->as<RegExpObject>().getShared(cx, g); + return RegExpObject::getShared(cx, obj.as<RegExpObject>(), g); return Proxy::regexp_toShared(cx, obj, g); } diff --git a/js/src/vm/Scope.cpp b/js/src/vm/Scope.cpp index a71c03695..0f80d7b69 100644 --- a/js/src/vm/Scope.cpp +++ b/js/src/vm/Scope.cpp @@ -669,6 +669,14 @@ FunctionScope::script() const return canonicalFunction()->nonLazyScript(); } +/* static */ bool +FunctionScope::isSpecialName(ExclusiveContext* cx, JSAtom* name) +{ + return name == cx->names().arguments || + name == cx->names().dotThis || + name == cx->names().dotGenerator; +} + /* static */ Shape* FunctionScope::getEmptyEnvironmentShape(ExclusiveContext* cx, bool hasParameterExprs) { diff --git a/js/src/vm/Scope.h b/js/src/vm/Scope.h index 1d04fd9f6..4a4ae8090 100644 --- a/js/src/vm/Scope.h +++ b/js/src/vm/Scope.h @@ -446,10 +446,11 @@ Scope::is<LexicalScope>() const } // -// Scope corresponding to a function. Holds formal parameter names and, if the -// function parameters contain no expressions that might possibly be -// evaluated, the function's var bindings. For example, in these functions, -// the FunctionScope will store a/b/c bindings but not d/e/f bindings: +// Scope corresponding to a function. Holds formal parameter names, special +// internal names (see FunctionScope::isSpecialName), and, if the function +// parameters contain no expressions that might possibly be evaluated, the +// function's var bindings. For example, in these functions, the FunctionScope +// will store a/b/c bindings but not d/e/f bindings: // // function f1(a, b) { // var c; @@ -562,6 +563,8 @@ class FunctionScope : public Scope return data().nonPositionalFormalStart; } + static bool isSpecialName(ExclusiveContext* cx, JSAtom* name); + static Shape* getEmptyEnvironmentShape(ExclusiveContext* cx, bool hasParameterExprs); }; diff --git a/js/src/vm/SelfHosting.cpp b/js/src/vm/SelfHosting.cpp index ccd4cc8d7..792a00490 100644 --- a/js/src/vm/SelfHosting.cpp +++ b/js/src/vm/SelfHosting.cpp @@ -477,7 +477,7 @@ intrinsic_FinishBoundFunctionInit(JSContext* cx, unsigned argc, Value* vp) // Try to avoid invoking the resolve hook. if (targetObj->is<JSFunction>() && !targetObj->as<JSFunction>().hasResolvedLength()) { RootedValue targetLength(cx); - if (!targetObj->as<JSFunction>().getUnresolvedLength(cx, &targetLength)) + if (!JSFunction::getUnresolvedLength(cx, targetObj.as<JSFunction>(), &targetLength)) return false; length = Max(0.0, targetLength.toNumber() - argCount); @@ -2154,7 +2154,7 @@ static const JSFunctionSpec intrinsic_functions[] = { JS_INLINABLE_FN("std_Array_slice", array_slice, 2,0, ArraySlice), JS_FN("std_Array_sort", array_sort, 1,0), JS_FN("std_Array_reverse", array_reverse, 0,0), - JS_INLINABLE_FN("std_Array_splice", array_splice, 2,0, ArraySplice), + JS_FNINFO("std_Array_splice", array_splice, &array_splice_info, 2,0), JS_FN("std_Date_now", date_now, 0,0), JS_FN("std_Date_valueOf", date_valueOf, 0,0), @@ -3008,7 +3008,7 @@ JSRuntime::cloneSelfHostedFunctionScript(JSContext* cx, HandlePropertyName name, MOZ_ASSERT(targetFun->isInterpretedLazy()); MOZ_ASSERT(targetFun->isSelfHostedBuiltin()); - RootedScript sourceScript(cx, sourceFun->getOrCreateScript(cx)); + RootedScript sourceScript(cx, JSFunction::getOrCreateScript(cx, sourceFun)); if (!sourceScript) return false; diff --git a/js/src/vm/Shape.cpp b/js/src/vm/Shape.cpp index 306a2c540..8fe2145e5 100644 --- a/js/src/vm/Shape.cpp +++ b/js/src/vm/Shape.cpp @@ -460,15 +460,13 @@ NativeObject::getChildProperty(ExclusiveContext* cx, return shape; } -bool -js::NativeObject::toDictionaryMode(ExclusiveContext* cx) +/* static */ bool +js::NativeObject::toDictionaryMode(ExclusiveContext* cx, HandleNativeObject obj) { - MOZ_ASSERT(!inDictionaryMode()); - MOZ_ASSERT(cx->isInsideCurrentCompartment(this)); - - uint32_t span = slotSpan(); + MOZ_ASSERT(!obj->inDictionaryMode()); + MOZ_ASSERT(cx->isInsideCurrentCompartment(obj)); - Rooted<NativeObject*> self(cx, this); + uint32_t span = obj->slotSpan(); // Clone the shapes into a new dictionary list. Don't update the last // property of this object until done, otherwise a GC triggered while @@ -476,7 +474,7 @@ js::NativeObject::toDictionaryMode(ExclusiveContext* cx) RootedShape root(cx); RootedShape dictionaryShape(cx); - RootedShape shape(cx, lastProperty()); + RootedShape shape(cx, obj->lastProperty()); while (shape) { MOZ_ASSERT(!shape->inDictionary()); @@ -488,7 +486,7 @@ js::NativeObject::toDictionaryMode(ExclusiveContext* cx) GCPtrShape* listp = dictionaryShape ? &dictionaryShape->parent : nullptr; StackShape child(shape); - dprop->initDictionaryShape(child, self->numFixedSlots(), listp); + dprop->initDictionaryShape(child, obj->numFixedSlots(), listp); if (!dictionaryShape) root = dprop; @@ -503,18 +501,18 @@ js::NativeObject::toDictionaryMode(ExclusiveContext* cx) return false; } - if (IsInsideNursery(self) && - !cx->asJSContext()->gc.nursery.queueDictionaryModeObjectToSweep(self)) + if (IsInsideNursery(obj) && + !cx->asJSContext()->gc.nursery.queueDictionaryModeObjectToSweep(obj)) { ReportOutOfMemory(cx); return false; } MOZ_ASSERT(root->listp == nullptr); - root->listp = &self->shape_; - self->shape_ = root; + root->listp = &obj->shape_; + obj->shape_ = root; - MOZ_ASSERT(self->inDictionaryMode()); + MOZ_ASSERT(obj->inDictionaryMode()); root->base()->setSlotSpan(span); return true; @@ -534,7 +532,7 @@ NativeObject::addProperty(ExclusiveContext* cx, HandleNativeObject obj, HandleId return nullptr; if (!extensible) { if (cx->isJSContext()) - obj->reportNotExtensible(cx->asJSContext()); + JSObject::reportNotExtensible(cx->asJSContext(), obj); return nullptr; } @@ -592,7 +590,7 @@ NativeObject::addPropertyInternal(ExclusiveContext* cx, if (allowDictionary && (!stableSlot || ShouldConvertToDictionary(obj))) { - if (!obj->toDictionaryMode(cx)) + if (!toDictionaryMode(cx, obj)) return nullptr; table = obj->lastProperty()->maybeTable(keep); entry = &table->search<MaybeAdding::Adding>(id, keep); @@ -727,7 +725,7 @@ CheckCanChangeAttrs(ExclusiveContext* cx, JSObject* obj, Shape* shape, unsigned* (*attrsp & (JSPROP_GETTER | JSPROP_SETTER | JSPROP_SHARED))) { if (cx->isJSContext()) - obj->reportNotConfigurable(cx->asJSContext(), shape->propid()); + JSObject::reportNotConfigurable(cx->asJSContext(), shape->propid()); return false; } @@ -785,7 +783,7 @@ NativeObject::putProperty(ExclusiveContext* cx, HandleNativeObject obj, HandleId if (!extensible) { if (cx->isJSContext()) - obj->reportNotExtensible(cx->asJSContext()); + JSObject::reportNotExtensible(cx->asJSContext(), obj); return nullptr; } @@ -834,7 +832,7 @@ NativeObject::putProperty(ExclusiveContext* cx, HandleNativeObject obj, HandleId * addPropertyInternal because a failure under add would lose data. */ if (shape != obj->lastProperty() && !obj->inDictionaryMode()) { - if (!obj->toDictionaryMode(cx)) + if (!toDictionaryMode(cx, obj)) return nullptr; ShapeTable* table = obj->lastProperty()->maybeTable(keep); MOZ_ASSERT(table); @@ -853,10 +851,11 @@ NativeObject::putProperty(ExclusiveContext* cx, HandleNativeObject obj, HandleId */ bool updateLast = (shape == obj->lastProperty()); bool accessorShape = getter || setter || (attrs & (JSPROP_GETTER | JSPROP_SETTER)); - shape = obj->replaceWithNewEquivalentShape(cx, shape, nullptr, accessorShape); + shape = NativeObject::replaceWithNewEquivalentShape(cx, obj, shape, nullptr, + accessorShape); if (!shape) return nullptr; - if (!updateLast && !obj->generateOwnShape(cx)) + if (!updateLast && !NativeObject::generateOwnShape(cx, obj)) return nullptr; /* @@ -968,16 +967,15 @@ NativeObject::changeProperty(ExclusiveContext* cx, HandleNativeObject obj, Handl return newShape; } -bool -NativeObject::removeProperty(ExclusiveContext* cx, jsid id_) +/* static */ bool +NativeObject::removeProperty(ExclusiveContext* cx, HandleNativeObject obj, jsid id_) { RootedId id(cx, id_); - RootedNativeObject self(cx, this); AutoKeepShapeTables keep(cx); ShapeTable::Entry* entry; RootedShape shape(cx); - if (!Shape::search(cx, lastProperty(), id, keep, shape.address(), &entry)) + if (!Shape::search(cx, obj->lastProperty(), id, keep, shape.address(), &entry)) return false; if (!shape) @@ -987,10 +985,10 @@ NativeObject::removeProperty(ExclusiveContext* cx, jsid id_) * If shape is not the last property added, or the last property cannot * be removed, switch to dictionary mode. */ - if (!self->inDictionaryMode() && (shape != self->lastProperty() || !self->canRemoveLastProperty())) { - if (!self->toDictionaryMode(cx)) + if (!obj->inDictionaryMode() && (shape != obj->lastProperty() || !obj->canRemoveLastProperty())) { + if (!toDictionaryMode(cx, obj)) return false; - ShapeTable* table = self->lastProperty()->maybeTable(keep); + ShapeTable* table = obj->lastProperty()->maybeTable(keep); MOZ_ASSERT(table); entry = &table->search<MaybeAdding::NotAdding>(shape->propid(), keep); shape = entry->shape(); @@ -1004,21 +1002,21 @@ NativeObject::removeProperty(ExclusiveContext* cx, jsid id_) * the object or table, so the remaining removal is infallible. */ RootedShape spare(cx); - if (self->inDictionaryMode()) { + if (obj->inDictionaryMode()) { /* For simplicity, always allocate an accessor shape for now. */ spare = Allocate<AccessorShape>(cx); if (!spare) return false; new (spare) Shape(shape->base()->unowned(), 0); - if (shape == self->lastProperty()) { + if (shape == obj->lastProperty()) { /* * Get an up to date unowned base shape for the new last property * when removing the dictionary's last property. Information in * base shapes for non-last properties may be out of sync with the * object's state. */ - RootedShape previous(cx, self->lastProperty()->parent); - StackBaseShape base(self->lastProperty()->base()); + RootedShape previous(cx, obj->lastProperty()->parent); + StackBaseShape base(obj->lastProperty()->base()); BaseShape* nbase = BaseShape::getUnowned(cx, base); if (!nbase) return false; @@ -1028,7 +1026,7 @@ NativeObject::removeProperty(ExclusiveContext* cx, jsid id_) /* If shape has a slot, free its slot number. */ if (shape->hasSlot()) { - self->freeSlot(cx, shape->slot()); + obj->freeSlot(cx, shape->slot()); if (cx->isJSContext()) ++cx->asJSContext()->runtime()->propertyRemovals; } @@ -1038,8 +1036,8 @@ NativeObject::removeProperty(ExclusiveContext* cx, jsid id_) * doubly linked list, hashed by lastProperty()->table. So we can edit the * list and hash in place. */ - if (self->inDictionaryMode()) { - ShapeTable* table = self->lastProperty()->maybeTable(keep); + if (obj->inDictionaryMode()) { + ShapeTable* table = obj->lastProperty()->maybeTable(keep); MOZ_ASSERT(table); if (entry->hadCollision()) { @@ -1056,23 +1054,23 @@ NativeObject::removeProperty(ExclusiveContext* cx, jsid id_) * checks not to alter significantly the complexity of the * delete in debug builds, see bug 534493. */ - Shape* aprop = self->lastProperty(); + Shape* aprop = obj->lastProperty(); for (int n = 50; --n >= 0 && aprop->parent; aprop = aprop->parent) - MOZ_ASSERT_IF(aprop != shape, self->contains(cx, aprop)); + MOZ_ASSERT_IF(aprop != shape, obj->contains(cx, aprop)); #endif } { /* Remove shape from its non-circular doubly linked list. */ - Shape* oldLastProp = self->lastProperty(); - shape->removeFromDictionary(self); + Shape* oldLastProp = obj->lastProperty(); + shape->removeFromDictionary(obj); /* Hand off table from the old to new last property. */ - oldLastProp->handoffTableTo(self->lastProperty()); + oldLastProp->handoffTableTo(obj->lastProperty()); } /* Generate a new shape for the object, infallibly. */ - JS_ALWAYS_TRUE(self->generateOwnShape(cx, spare)); + JS_ALWAYS_TRUE(NativeObject::generateOwnShape(cx, obj, spare)); /* Consider shrinking table if its load factor is <= .25. */ uint32_t size = table->capacity(); @@ -1085,11 +1083,11 @@ NativeObject::removeProperty(ExclusiveContext* cx, jsid id_) * lazily make via a later hashify the exact table for the new property * lineage. */ - MOZ_ASSERT(shape == self->lastProperty()); - self->removeLastProperty(cx); + MOZ_ASSERT(shape == obj->lastProperty()); + obj->removeLastProperty(cx); } - self->checkShapeConsistency(); + obj->checkShapeConsistency(); return true; } @@ -1133,35 +1131,30 @@ NativeObject::rollbackProperties(ExclusiveContext* cx, HandleNativeObject obj, u if (slot < slotSpan) break; } - if (!obj->removeProperty(cx, obj->lastProperty()->propid())) + if (!NativeObject::removeProperty(cx, obj, obj->lastProperty()->propid())) return false; } return true; } -Shape* -NativeObject::replaceWithNewEquivalentShape(ExclusiveContext* cx, Shape* oldShape, Shape* newShape, - bool accessorShape) +/* static */ Shape* +NativeObject::replaceWithNewEquivalentShape(ExclusiveContext* cx, HandleNativeObject obj, + Shape* oldShape, Shape* newShape, bool accessorShape) { MOZ_ASSERT(cx->isInsideCurrentZone(oldShape)); - MOZ_ASSERT_IF(oldShape != lastProperty(), - inDictionaryMode() && lookup(cx, oldShape->propidRef()) == oldShape); - - NativeObject* self = this; + MOZ_ASSERT_IF(oldShape != obj->lastProperty(), + obj->inDictionaryMode() && obj->lookup(cx, oldShape->propidRef()) == oldShape); - if (!inDictionaryMode()) { - RootedNativeObject selfRoot(cx, self); + if (!obj->inDictionaryMode()) { RootedShape newRoot(cx, newShape); - if (!toDictionaryMode(cx)) + if (!toDictionaryMode(cx, obj)) return nullptr; - oldShape = selfRoot->lastProperty(); - self = selfRoot; + oldShape = obj->lastProperty(); newShape = newRoot; } if (!newShape) { - RootedNativeObject selfRoot(cx, self); RootedShape oldRoot(cx, oldShape); newShape = (oldShape->isAccessorShape() || accessorShape) ? Allocate<AccessorShape>(cx) @@ -1169,12 +1162,11 @@ NativeObject::replaceWithNewEquivalentShape(ExclusiveContext* cx, Shape* oldShap if (!newShape) return nullptr; new (newShape) Shape(oldRoot->base()->unowned(), 0); - self = selfRoot; oldShape = oldRoot; } AutoCheckCannotGC nogc; - ShapeTable* table = self->lastProperty()->ensureTableForDictionary(cx, nogc); + ShapeTable* table = obj->lastProperty()->ensureTableForDictionary(cx, nogc); if (!table) return nullptr; @@ -1187,12 +1179,12 @@ NativeObject::replaceWithNewEquivalentShape(ExclusiveContext* cx, Shape* oldShap * enumeration order (see bug 601399). */ StackShape nshape(oldShape); - newShape->initDictionaryShape(nshape, self->numFixedSlots(), oldShape->listp); + newShape->initDictionaryShape(nshape, obj->numFixedSlots(), oldShape->listp); MOZ_ASSERT(newShape->parent == oldShape); - oldShape->removeFromDictionary(self); + oldShape->removeFromDictionary(obj); - if (newShape == self->lastProperty()) + if (newShape == obj->lastProperty()) oldShape->handoffTableTo(newShape); if (entry) @@ -1200,63 +1192,63 @@ NativeObject::replaceWithNewEquivalentShape(ExclusiveContext* cx, Shape* oldShap return newShape; } -bool -NativeObject::shadowingShapeChange(ExclusiveContext* cx, const Shape& shape) +/* static */ bool +NativeObject::shadowingShapeChange(ExclusiveContext* cx, HandleNativeObject obj, const Shape& shape) { - return generateOwnShape(cx); + return generateOwnShape(cx, obj); } -bool -JSObject::setFlags(ExclusiveContext* cx, BaseShape::Flag flags, GenerateShape generateShape) +/* static */ bool +JSObject::setFlags(ExclusiveContext* cx, HandleObject obj, BaseShape::Flag flags, + GenerateShape generateShape) { - if (hasAllFlags(flags)) + if (obj->hasAllFlags(flags)) return true; - RootedObject self(cx, this); - - Shape* existingShape = self->ensureShape(cx); + Shape* existingShape = obj->ensureShape(cx); if (!existingShape) return false; - if (isNative() && as<NativeObject>().inDictionaryMode()) { - if (generateShape == GENERATE_SHAPE && !as<NativeObject>().generateOwnShape(cx)) - return false; - StackBaseShape base(self->as<NativeObject>().lastProperty()); + if (obj->isNative() && obj->as<NativeObject>().inDictionaryMode()) { + if (generateShape == GENERATE_SHAPE) { + if (!NativeObject::generateOwnShape(cx, obj.as<NativeObject>())) + return false; + } + StackBaseShape base(obj->as<NativeObject>().lastProperty()); base.flags |= flags; UnownedBaseShape* nbase = BaseShape::getUnowned(cx, base); if (!nbase) return false; - self->as<NativeObject>().lastProperty()->base()->adoptUnowned(nbase); + obj->as<NativeObject>().lastProperty()->base()->adoptUnowned(nbase); return true; } - Shape* newShape = Shape::setObjectFlags(cx, flags, self->taggedProto(), existingShape); + Shape* newShape = Shape::setObjectFlags(cx, flags, obj->taggedProto(), existingShape); if (!newShape) return false; - // The success of the |JSObject::ensureShape| call above means that |self| + // The success of the |JSObject::ensureShape| call above means that |obj| // can be assumed to have a shape. - self->as<ShapedObject>().setShape(newShape); + obj->as<ShapedObject>().setShape(newShape); return true; } -bool -NativeObject::clearFlag(ExclusiveContext* cx, BaseShape::Flag flag) +/* static */ bool +NativeObject::clearFlag(ExclusiveContext* cx, HandleNativeObject obj, BaseShape::Flag flag) { - MOZ_ASSERT(inDictionaryMode()); + MOZ_ASSERT(obj->inDictionaryMode()); - RootedNativeObject self(cx, &as<NativeObject>()); - MOZ_ASSERT(self->lastProperty()->getObjectFlags() & flag); + MOZ_ASSERT(obj->lastProperty()->getObjectFlags() & flag); - StackBaseShape base(self->lastProperty()); + StackBaseShape base(obj->lastProperty()); base.flags &= ~flag; UnownedBaseShape* nbase = BaseShape::getUnowned(cx, base); if (!nbase) return false; - self->lastProperty()->base()->adoptUnowned(nbase); + obj->lastProperty()->base()->adoptUnowned(nbase); return true; } diff --git a/js/src/vm/Shape.h b/js/src/vm/Shape.h index 978798aaa..fd6d843e0 100644 --- a/js/src/vm/Shape.h +++ b/js/src/vm/Shape.h @@ -905,9 +905,6 @@ class Shape : public gc::TenuredCell setter() == rawSetter; } - bool set(JSContext* cx, HandleNativeObject obj, HandleObject receiver, MutableHandleValue vp, - ObjectOpResult& result); - BaseShape* base() const { return base_.get(); } bool hasSlot() const { diff --git a/js/src/vm/SharedArrayObject.cpp b/js/src/vm/SharedArrayObject.cpp index c69306aac..0dff41201 100644 --- a/js/src/vm/SharedArrayObject.cpp +++ b/js/src/vm/SharedArrayObject.cpp @@ -366,7 +366,8 @@ static const Class SharedArrayBufferObjectProtoClass = { static JSObject* CreateSharedArrayBufferPrototype(JSContext* cx, JSProtoKey key) { - return cx->global()->createBlankPrototype(cx, &SharedArrayBufferObjectProtoClass); + return GlobalObject::createBlankPrototype(cx, cx->global(), + &SharedArrayBufferObjectProtoClass); } static const ClassOps SharedArrayBufferObjectClassOps = { diff --git a/js/src/vm/Stack-inl.h b/js/src/vm/Stack-inl.h index a51c0aa14..11a19d175 100644 --- a/js/src/vm/Stack-inl.h +++ b/js/src/vm/Stack-inl.h @@ -306,7 +306,7 @@ InterpreterStack::pushInlineFrame(JSContext* cx, InterpreterRegs& regs, const Ca MOZ_ASSERT(regs.sp == args.end()); MOZ_ASSERT(callee->nonLazyScript() == script); - script->ensureNonLazyCanonicalFunction(cx); + script->ensureNonLazyCanonicalFunction(); InterpreterFrame* prev = regs.fp(); jsbytecode* prevpc = regs.pc; @@ -336,13 +336,13 @@ InterpreterStack::resumeGeneratorCallFrame(JSContext* cx, InterpreterRegs& regs, HandleObject envChain) { MOZ_ASSERT(callee->isGenerator()); - RootedScript script(cx, callee->getOrCreateScript(cx)); + RootedScript script(cx, JSFunction::getOrCreateScript(cx, callee)); InterpreterFrame* prev = regs.fp(); jsbytecode* prevpc = regs.pc; Value* prevsp = regs.sp; MOZ_ASSERT(prev); - script->ensureNonLazyCanonicalFunction(cx); + script->ensureNonLazyCanonicalFunction(); LifoAlloc::Mark mark = allocator_.mark(); diff --git a/js/src/vm/Stack.h b/js/src/vm/Stack.h index dc9306c99..23e621344 100644 --- a/js/src/vm/Stack.h +++ b/js/src/vm/Stack.h @@ -1006,6 +1006,17 @@ class InvokeArgs : public detail::GenericArgsBase<NO_CONSTRUCT> explicit InvokeArgs(JSContext* cx) : Base(cx) {} }; +/** Function call args of statically-unknown count. */ +class InvokeArgsMaybeIgnoresReturnValue : public detail::GenericArgsBase<NO_CONSTRUCT> +{ + using Base = detail::GenericArgsBase<NO_CONSTRUCT>; + + public: + explicit InvokeArgsMaybeIgnoresReturnValue(JSContext* cx, bool ignoresReturnValue) : Base(cx) { + this->ignoresReturnValue_ = ignoresReturnValue; + } +}; + /** Function call args of statically-known count. */ template <size_t N> class FixedInvokeArgs : public detail::FixedArgsBase<NO_CONSTRUCT, N> diff --git a/js/src/vm/StringObject-inl.h b/js/src/vm/StringObject-inl.h index 5fc1656f6..38191fc7a 100644 --- a/js/src/vm/StringObject-inl.h +++ b/js/src/vm/StringObject-inl.h @@ -15,31 +15,29 @@ namespace js { -inline bool -StringObject::init(JSContext* cx, HandleString str) +/* static */ inline bool +StringObject::init(JSContext* cx, Handle<StringObject*> obj, HandleString str) { - MOZ_ASSERT(numFixedSlots() == 2); + MOZ_ASSERT(obj->numFixedSlots() == 2); - Rooted<StringObject*> self(cx, this); - - if (!EmptyShape::ensureInitialCustomShape<StringObject>(cx, self)) + if (!EmptyShape::ensureInitialCustomShape<StringObject>(cx, obj)) return false; - MOZ_ASSERT(self->lookup(cx, NameToId(cx->names().length))->slot() == LENGTH_SLOT); + MOZ_ASSERT(obj->lookup(cx, NameToId(cx->names().length))->slot() == LENGTH_SLOT); - self->setStringThis(str); + obj->setStringThis(str); return true; } -inline StringObject* +/* static */ inline StringObject* StringObject::create(JSContext* cx, HandleString str, HandleObject proto, NewObjectKind newKind) { JSObject* obj = NewObjectWithClassProto(cx, &class_, proto, newKind); if (!obj) return nullptr; Rooted<StringObject*> strobj(cx, &obj->as<StringObject>()); - if (!strobj->init(cx, str)) + if (!StringObject::init(cx, strobj, str)) return nullptr; return strobj; } diff --git a/js/src/vm/StringObject.h b/js/src/vm/StringObject.h index 119e3d9fa..561e0478a 100644 --- a/js/src/vm/StringObject.h +++ b/js/src/vm/StringObject.h @@ -56,7 +56,7 @@ class StringObject : public NativeObject } private: - inline bool init(JSContext* cx, HandleString str); + static inline bool init(JSContext* cx, Handle<StringObject*> obj, HandleString str); void setStringThis(JSString* str) { MOZ_ASSERT(getReservedSlot(PRIMITIVE_VALUE_SLOT).isUndefined()); diff --git a/js/src/vm/TypeInference.cpp b/js/src/vm/TypeInference.cpp index ba809fc4e..7c2c0194e 100644 --- a/js/src/vm/TypeInference.cpp +++ b/js/src/vm/TypeInference.cpp @@ -1319,7 +1319,8 @@ js::EnsureTrackPropertyTypes(JSContext* cx, JSObject* obj, jsid id) AutoEnterAnalysis enter(cx); if (obj->hasLazyGroup()) { AutoEnterOOMUnsafeRegion oomUnsafe; - if (!obj->getGroup(cx)) { + RootedObject objRoot(cx, obj); + if (!JSObject::getGroup(cx, objRoot)) { oomUnsafe.crash("Could not allocate ObjectGroup in EnsureTrackPropertyTypes"); return; } @@ -1338,9 +1339,12 @@ HeapTypeSetKey::instantiate(JSContext* cx) { if (maybeTypes()) return true; - if (object()->isSingleton() && !object()->singleton()->getGroup(cx)) { - cx->clearPendingException(); - return false; + if (object()->isSingleton()) { + RootedObject obj(cx, object()->singleton()); + if (!JSObject::getGroup(cx, obj)) { + cx->clearPendingException(); + return false; + } } JSObject* obj = object()->isSingleton() ? object()->singleton() : nullptr; maybeTypes_ = object()->maybeGroup()->getProperty(cx, obj, id()); @@ -2941,7 +2945,8 @@ ObjectGroup::clearNewScript(ExclusiveContext* cx, ObjectGroup* replacement /* = // Mark the constructing function as having its 'new' script cleared, so we // will not try to construct another one later. - if (!newScript->function()->setNewScriptCleared(cx)) + RootedFunction fun(cx, newScript->function()); + if (!JSObject::setNewScriptCleared(cx, fun)) cx->recoverFromOutOfMemory(); } @@ -3088,7 +3093,7 @@ js::AddClearDefiniteGetterSetterForPrototypeChain(JSContext* cx, ObjectGroup* gr */ RootedObject proto(cx, group->proto().toObjectOrNull()); while (proto) { - ObjectGroup* protoGroup = proto->getGroup(cx); + ObjectGroup* protoGroup = JSObject::getGroup(cx, proto); if (!protoGroup) { cx->recoverFromOutOfMemory(); return false; @@ -3712,7 +3717,8 @@ TypeNewScript::maybeAnalyze(JSContext* cx, ObjectGroup* group, bool* regenerate, Vector<Initializer> initializerVector(cx); RootedPlainObject templateRoot(cx, templateObject()); - if (!jit::AnalyzeNewScriptDefiniteProperties(cx, function(), group, templateRoot, &initializerVector)) + RootedFunction fun(cx, function()); + if (!jit::AnalyzeNewScriptDefiniteProperties(cx, fun, group, templateRoot, &initializerVector)) return false; if (!group->newScript()) diff --git a/js/src/vm/TypedArrayObject.cpp b/js/src/vm/TypedArrayObject.cpp index ae97be0de..8b0302917 100644 --- a/js/src/vm/TypedArrayObject.cpp +++ b/js/src/vm/TypedArrayObject.cpp @@ -361,7 +361,7 @@ class TypedArrayObjectTemplate : public TypedArrayObject return nullptr; const Class* clasp = TypedArrayObject::protoClassForType(ArrayTypeID()); - return global->createBlankPrototypeInheriting(cx, clasp, typedArrayProto); + return GlobalObject::createBlankPrototypeInheriting(cx, global, clasp, typedArrayProto); } static JSObject* @@ -1892,7 +1892,7 @@ DataViewObject::constructWrapped(JSContext* cx, HandleObject bufobj, const CallA Rooted<GlobalObject*> global(cx, cx->compartment()->maybeGlobal()); if (!proto) { - proto = global->getOrCreateDataViewPrototype(cx); + proto = GlobalObject::getOrCreateDataViewPrototype(cx, global); if (!proto) return false; } @@ -2892,12 +2892,13 @@ DataViewObject::initClass(JSContext* cx) if (global->isStandardClassResolved(JSProto_DataView)) return true; - RootedNativeObject proto(cx, global->createBlankPrototype(cx, &DataViewObject::protoClass)); + RootedNativeObject proto(cx, GlobalObject::createBlankPrototype(cx, global, + &DataViewObject::protoClass)); if (!proto) return false; - RootedFunction ctor(cx, global->createConstructor(cx, DataViewObject::class_constructor, - cx->names().DataView, 3)); + RootedFunction ctor(cx, GlobalObject::createConstructor(cx, DataViewObject::class_constructor, + cx->names().DataView, 3)); if (!ctor) return false; diff --git a/js/src/wasm/AsmJS.cpp b/js/src/wasm/AsmJS.cpp index a318d67a9..52b8eeed1 100644 --- a/js/src/wasm/AsmJS.cpp +++ b/js/src/wasm/AsmJS.cpp @@ -34,6 +34,7 @@ #include "frontend/Parser.h" #include "gc/Policy.h" #include "js/MemoryMetrics.h" +#include "vm/SelfHosting.h" #include "vm/StringBuffer.h" #include "vm/Time.h" #include "vm/TypedArrayObject.h" @@ -318,7 +319,7 @@ struct js::AsmJSMetadata : Metadata, AsmJSMetadataCacheablePod // Function constructor, this will be the first character in the function // source. Otherwise, it will be the opening parenthesis of the arguments // list. - uint32_t preludeStart; + uint32_t toStringStart; uint32_t srcStart; uint32_t srcBodyStart; bool strict; @@ -1759,7 +1760,7 @@ class MOZ_STACK_CLASS ModuleValidator if (!asmJSMetadata_) return false; - asmJSMetadata_->preludeStart = moduleFunctionNode_->pn_funbox->preludeStart; + asmJSMetadata_->toStringStart = moduleFunctionNode_->pn_funbox->toStringStart; asmJSMetadata_->srcStart = moduleFunctionNode_->pn_body->pn_pos.begin; asmJSMetadata_->srcBodyStart = parser_.tokenStream.currentToken().pos.end; asmJSMetadata_->strict = parser_.pc->sc()->strict() && @@ -3250,10 +3251,9 @@ CheckModuleLevelName(ModuleValidator& m, ParseNode* usepn, PropertyName* name) static bool CheckFunctionHead(ModuleValidator& m, ParseNode* fn) { - JSFunction* fun = FunctionObject(fn); if (fn->pn_funbox->hasRest()) return m.fail(fn, "rest args not allowed"); - if (fun->isExprBody()) + if (fn->pn_funbox->isExprBody()) return m.fail(fn, "expression closures not allowed"); if (fn->pn_funbox->hasDestructuringArgs) return m.fail(fn, "destructuring args not allowed"); @@ -7051,13 +7051,13 @@ ParseFunction(ModuleValidator& m, ParseNode** fnOut, unsigned* line) TokenStream& tokenStream = m.tokenStream(); tokenStream.consumeKnownToken(TOK_FUNCTION, TokenStream::Operand); - uint32_t preludeStart = tokenStream.currentToken().pos.begin; + uint32_t toStringStart = tokenStream.currentToken().pos.begin; *line = tokenStream.srcCoords.lineNum(tokenStream.currentToken().pos.end); TokenKind tk; if (!tokenStream.getToken(&tk, TokenStream::Operand)) return false; - if (tk != TOK_NAME && tk != TOK_YIELD) + if (!TokenKindIsPossibleIdentifier(tk)) return false; // The regular parser will throw a SyntaxError, no need to m.fail. RootedPropertyName name(m.cx(), m.parser().bindingIdentifier(YieldIsName)); @@ -7074,7 +7074,7 @@ ParseFunction(ModuleValidator& m, ParseNode** fnOut, unsigned* line) ParseContext* outerpc = m.parser().pc; Directives directives(outerpc); - FunctionBox* funbox = m.parser().newFunctionBox(fn, fun, preludeStart, directives, NotGenerator, + FunctionBox* funbox = m.parser().newFunctionBox(fn, fun, toStringStart, directives, NotGenerator, SyncFunction, /* tryAnnexB = */ false); if (!funbox) return false; @@ -7466,6 +7466,20 @@ GetDataProperty(JSContext* cx, HandleValue objVal, ImmutablePropertyNamePtr fiel } static bool +HasObjectValueOfMethodPure(JSObject* obj, JSContext* cx) +{ + Value v; + if (!GetPropertyPure(cx, obj, NameToId(cx->names().valueOf), &v)) + return false; + + JSFunction* fun; + if (!IsFunctionObject(v, &fun)) + return false; + + return IsSelfHostedFunctionWithName(fun, cx->names().Object_valueOf); +} + +static bool HasPureCoercion(JSContext* cx, HandleValue v) { // Unsigned SIMD types are not allowed in function signatures. @@ -7479,10 +7493,10 @@ HasPureCoercion(JSContext* cx, HandleValue v) // coercions are not observable and coercion via ToNumber/ToInt32 // definitely produces NaN/0. We should remove this special case later once // most apps have been built with newer Emscripten. - jsid toString = NameToId(cx->names().toString); if (v.toObject().is<JSFunction>() && - HasObjectValueOf(&v.toObject(), cx) && - ClassMethodIsNative(cx, &v.toObject().as<JSFunction>(), &JSFunction::class_, toString, fun_toString)) + HasNoToPrimitiveMethodPure(&v.toObject(), cx) && + HasObjectValueOfMethodPure(&v.toObject(), cx) && + HasNativeMethodPure(&v.toObject(), cx->names().toString, fun_toString, cx)) { return true; } @@ -8057,7 +8071,7 @@ HandleInstantiationFailure(JSContext* cx, CallArgs args, const AsmJSMetadata& me return false; } - uint32_t begin = metadata.preludeStart; + uint32_t begin = metadata.toStringStart; uint32_t end = metadata.srcEndAfterCurly(); Rooted<JSFlatString*> src(cx, source->substringDontDeflate(cx, begin, end)); if (!src) @@ -8540,7 +8554,7 @@ LookupAsmJSModuleInCache(ExclusiveContext* cx, AsmJSParser& parser, bool* loaded return true; // See AsmJSMetadata comment as well as ModuleValidator::init(). - asmJSMetadata->preludeStart = parser.pc->functionBox()->preludeStart; + asmJSMetadata->toStringStart = parser.pc->functionBox()->toStringStart; asmJSMetadata->srcStart = parser.pc->functionBox()->functionNode->pn_body->pn_pos.begin; asmJSMetadata->srcBodyStart = parser.tokenStream.currentToken().pos.end; asmJSMetadata->strict = parser.pc->sc()->strict() && !parser.pc->sc()->hasExplicitUseStrict(); @@ -8838,7 +8852,7 @@ js::AsmJSModuleToString(JSContext* cx, HandleFunction fun, bool addParenToLambda MOZ_ASSERT(IsAsmJSModule(fun)); const AsmJSMetadata& metadata = AsmJSModuleFunctionToModule(fun).metadata().asAsmJS(); - uint32_t begin = metadata.preludeStart; + uint32_t begin = metadata.toStringStart; uint32_t end = metadata.srcEndAfterCurly(); ScriptSource* source = metadata.scriptSource.get(); diff --git a/js/src/wasm/WasmJS.cpp b/js/src/wasm/WasmJS.cpp index 0b030c844..8d4f575b2 100644 --- a/js/src/wasm/WasmJS.cpp +++ b/js/src/wasm/WasmJS.cpp @@ -1659,7 +1659,7 @@ Reject(JSContext* cx, const CompileArgs& args, UniqueChars error, Handle<Promise if (!cx->getPendingException(&rejectionValue)) return false; - return promise->reject(cx, rejectionValue); + return PromiseObject::reject(cx, promise, rejectionValue); } RootedObject stack(cx, promise->allocationSite()); @@ -1687,7 +1687,7 @@ Reject(JSContext* cx, const CompileArgs& args, UniqueChars error, Handle<Promise return false; RootedValue rejectionValue(cx, ObjectValue(*errorObj)); - return promise->reject(cx, rejectionValue); + return PromiseObject::reject(cx, promise, rejectionValue); } static bool @@ -1699,7 +1699,7 @@ ResolveCompilation(JSContext* cx, Module& module, Handle<PromiseObject*> promise return false; RootedValue resolutionValue(cx, ObjectValue(*moduleObj)); - return promise->resolve(cx, resolutionValue); + return PromiseObject::resolve(cx, promise, resolutionValue); } struct CompileTask : PromiseTask @@ -1734,7 +1734,7 @@ RejectWithPendingException(JSContext* cx, Handle<PromiseObject*> promise) if (!GetAndClearException(cx, &rejectionValue)) return false; - return promise->reject(cx, rejectionValue); + return PromiseObject::reject(cx, promise, rejectionValue); } static bool @@ -1822,7 +1822,7 @@ ResolveInstantiation(JSContext* cx, Module& module, HandleObject importObj, return false; val = ObjectValue(*resultObj); - return promise->resolve(cx, val); + return PromiseObject::resolve(cx, promise, val); } struct InstantiateTask : CompileTask @@ -1894,7 +1894,7 @@ WebAssembly_instantiate(JSContext* cx, unsigned argc, Value* vp) return RejectWithPendingException(cx, promise, callArgs); RootedValue resolutionValue(cx, ObjectValue(*instanceObj)); - if (!promise->resolve(cx, resolutionValue)) + if (!PromiseObject::resolve(cx, promise, resolutionValue)) return false; } else { auto task = cx->make_unique<InstantiateTask>(cx, promise, importObj); @@ -2018,7 +2018,7 @@ js::InitWebAssemblyClass(JSContext* cx, HandleObject obj) Handle<GlobalObject*> global = obj.as<GlobalObject>(); MOZ_ASSERT(!global->isStandardClassResolved(JSProto_WebAssembly)); - RootedObject proto(cx, global->getOrCreateObjectPrototype(cx)); + RootedObject proto(cx, GlobalObject::getOrCreateObjectPrototype(cx, global)); if (!proto) return nullptr; diff --git a/js/xpconnect/idl/moz.build b/js/xpconnect/idl/moz.build index 2438b1a5a..0808d3450 100644 --- a/js/xpconnect/idl/moz.build +++ b/js/xpconnect/idl/moz.build @@ -7,7 +7,6 @@ XPIDL_SOURCES += [ 'mozIJSSubScriptLoader.idl', 'nsIAddonInterposition.idl', - 'nsIScriptError.idl', 'nsIXPConnect.idl', 'nsIXPCScriptable.idl', 'xpccomponents.idl', diff --git a/js/xpconnect/src/XPCComponents.cpp b/js/xpconnect/src/XPCComponents.cpp index dbb63092e..07ce7460b 100644 --- a/js/xpconnect/src/XPCComponents.cpp +++ b/js/xpconnect/src/XPCComponents.cpp @@ -34,9 +34,11 @@ #include "nsDOMClassInfo.h" #include "ShimInterfaceInfo.h" #include "nsIAddonInterposition.h" +#include "nsIScriptError.h" #include "nsISimpleEnumerator.h" #include "nsPIDOMWindow.h" #include "nsGlobalWindow.h" +#include "nsScriptError.h" using namespace mozilla; using namespace JS; diff --git a/js/xpconnect/src/XPCConvert.cpp b/js/xpconnect/src/XPCConvert.cpp index 37932b452..77f09f4a5 100644 --- a/js/xpconnect/src/XPCConvert.cpp +++ b/js/xpconnect/src/XPCConvert.cpp @@ -11,9 +11,11 @@ #include "xpcprivate.h" #include "nsIAtom.h" +#include "nsIScriptError.h" #include "nsWrapperCache.h" #include "nsJSUtils.h" #include "nsQueryObject.h" +#include "nsScriptError.h" #include "WrapperFactory.h" #include "nsWrapperCacheInlines.h" diff --git a/js/xpconnect/src/XPCModule.h b/js/xpconnect/src/XPCModule.h index d62764625..506e8945a 100644 --- a/js/xpconnect/src/XPCModule.h +++ b/js/xpconnect/src/XPCModule.h @@ -23,7 +23,6 @@ NS_GENERIC_FACTORY_CONSTRUCTOR(nsJSID) NS_GENERIC_FACTORY_SINGLETON_CONSTRUCTOR(nsIXPConnect, nsXPConnect::GetSingleton) -NS_GENERIC_FACTORY_CONSTRUCTOR(nsScriptError) NS_GENERIC_FACTORY_CONSTRUCTOR(mozJSComponentLoader) NS_GENERIC_FACTORY_CONSTRUCTOR(mozJSSubScriptLoader) @@ -31,14 +30,12 @@ NS_GENERIC_FACTORY_CONSTRUCTOR(mozJSSubScriptLoader) NS_DEFINE_NAMED_CID(NS_JS_ID_CID); NS_DEFINE_NAMED_CID(NS_XPCONNECT_CID); NS_DEFINE_NAMED_CID(NS_XPCEXCEPTION_CID); -NS_DEFINE_NAMED_CID(NS_SCRIPTERROR_CID); NS_DEFINE_NAMED_CID(MOZJSCOMPONENTLOADER_CID); NS_DEFINE_NAMED_CID(MOZ_JSSUBSCRIPTLOADER_CID); #define XPCONNECT_CIDENTRIES \ { &kNS_JS_ID_CID, false, nullptr, nsJSIDConstructor }, \ { &kNS_XPCONNECT_CID, false, nullptr, nsIXPConnectConstructor }, \ - { &kNS_SCRIPTERROR_CID, false, nullptr, nsScriptErrorConstructor }, \ { &kMOZJSCOMPONENTLOADER_CID, false, nullptr, mozJSComponentLoaderConstructor },\ { &kMOZ_JSSUBSCRIPTLOADER_CID, false, nullptr, mozJSSubScriptLoaderConstructor }, @@ -46,7 +43,6 @@ NS_DEFINE_NAMED_CID(MOZ_JSSUBSCRIPTLOADER_CID); { XPC_ID_CONTRACTID, &kNS_JS_ID_CID }, \ { XPC_XPCONNECT_CONTRACTID, &kNS_XPCONNECT_CID }, \ { XPC_CONTEXT_STACK_CONTRACTID, &kNS_XPCONNECT_CID }, \ - { NS_SCRIPTERROR_CONTRACTID, &kNS_SCRIPTERROR_CID }, \ { MOZJSCOMPONENTLOADER_CONTRACTID, &kMOZJSCOMPONENTLOADER_CID }, \ { MOZJSSUBSCRIPTLOADER_CONTRACTID, &kMOZ_JSSUBSCRIPTLOADER_CID }, diff --git a/js/xpconnect/src/XPCWrappedJSClass.cpp b/js/xpconnect/src/XPCWrappedJSClass.cpp index 2c9fd66bc..e90373e3d 100644 --- a/js/xpconnect/src/XPCWrappedJSClass.cpp +++ b/js/xpconnect/src/XPCWrappedJSClass.cpp @@ -10,6 +10,7 @@ #include "jsprf.h" #include "nsArrayEnumerator.h" #include "nsContentUtils.h" +#include "nsIScriptError.h" #include "nsWrapperCache.h" #include "AccessCheck.h" #include "nsJSUtils.h" diff --git a/js/xpconnect/src/XPCWrappedNativeInfo.cpp b/js/xpconnect/src/XPCWrappedNativeInfo.cpp index 302454fb5..4b0330af6 100644 --- a/js/xpconnect/src/XPCWrappedNativeInfo.cpp +++ b/js/xpconnect/src/XPCWrappedNativeInfo.cpp @@ -11,6 +11,7 @@ #include "mozilla/MemoryReporting.h" #include "mozilla/XPTInterfaceInfoManager.h" +#include "nsIScriptError.h" #include "nsPrintfCString.h" using namespace JS; diff --git a/js/xpconnect/src/moz.build b/js/xpconnect/src/moz.build index 7e787bb56..7d9cd5b37 100644 --- a/js/xpconnect/src/moz.build +++ b/js/xpconnect/src/moz.build @@ -14,8 +14,6 @@ EXPORTS += [ UNIFIED_SOURCES += [ 'ExportHelpers.cpp', - 'nsScriptError.cpp', - 'nsScriptErrorWithStack.cpp', 'nsXPConnect.cpp', 'Sandbox.cpp', 'XPCCallContext.cpp', @@ -58,6 +56,7 @@ LOCAL_INCLUDES += [ '../wrappers', '/caps', '/dom/base', + '/dom/bindings', '/dom/html', '/dom/svg', '/dom/workers', diff --git a/js/xpconnect/src/nsXPConnect.cpp b/js/xpconnect/src/nsXPConnect.cpp index 0466175b1..0d1a6be0a 100644 --- a/js/xpconnect/src/nsXPConnect.cpp +++ b/js/xpconnect/src/nsXPConnect.cpp @@ -33,7 +33,9 @@ #include "nsIObjectOutputStream.h" #include "nsScriptSecurityManager.h" #include "nsIPermissionManager.h" +#include "nsIScriptError.h" #include "nsContentUtils.h" +#include "nsScriptError.h" #include "jsfriendapi.h" using namespace mozilla; @@ -170,9 +172,31 @@ nsXPConnect::IsISupportsDescendant(nsIInterfaceInfo* info) } void +xpc::ErrorBase::Init(JSErrorBase* aReport) +{ + if (!aReport->filename) { + mFileName.SetIsVoid(true); + } else { + mFileName.AssignWithConversion(aReport->filename); + } + + mLineNumber = aReport->lineno; + mColumn = aReport->column; +} + +void +xpc::ErrorNote::Init(JSErrorNotes::Note* aNote) +{ + xpc::ErrorBase::Init(aNote); + + ErrorNoteToMessageString(aNote, mErrorMsg); +} + +void xpc::ErrorReport::Init(JSErrorReport* aReport, const char* aToStringResult, bool aIsChrome, uint64_t aWindowID) { + xpc::ErrorBase::Init(aReport); mCategory = aIsChrome ? NS_LITERAL_CSTRING("chrome javascript") : NS_LITERAL_CSTRING("content javascript"); mWindowID = aWindowID; @@ -182,12 +206,6 @@ xpc::ErrorReport::Init(JSErrorReport* aReport, const char* aToStringResult, AppendUTF8toUTF16(aToStringResult, mErrorMsg); } - if (!aReport->filename) { - mFileName.SetIsVoid(true); - } else { - mFileName.AssignWithConversion(aReport->filename); - } - mSourceLine.Assign(aReport->linebuf(), aReport->linebufLength()); const JSErrorFormatString* efs = js::GetErrorMessage(nullptr, aReport->errorNumber); @@ -197,10 +215,20 @@ xpc::ErrorReport::Init(JSErrorReport* aReport, const char* aToStringResult, mErrorMsgName.AssignASCII(efs->name); } - mLineNumber = aReport->lineno; - mColumn = aReport->column; mFlags = aReport->flags; mIsMuted = aReport->isMuted; + + if (aReport->notes) { + if (!mNotes.SetLength(aReport->notes->length(), fallible)) { + return; + } + + size_t i = 0; + for (auto&& note : *aReport->notes) { + mNotes.ElementAt(i).Init(note.get()); + i++; + } + } } void @@ -226,6 +254,59 @@ xpc::ErrorReport::Init(JSContext* aCx, mozilla::dom::Exception* aException, static LazyLogModule gJSDiagnostics("JSDiagnostics"); void +xpc::ErrorBase::AppendErrorDetailsTo(nsCString& error) +{ + error.Append(NS_LossyConvertUTF16toASCII(mFileName)); + error.AppendLiteral(", line "); + error.AppendInt(mLineNumber, 10); + error.AppendLiteral(": "); + error.Append(NS_LossyConvertUTF16toASCII(mErrorMsg)); +} + +void +xpc::ErrorNote::LogToStderr() +{ + if (!nsContentUtils::DOMWindowDumpEnabled()) { + return; + } + + nsAutoCString error; + error.AssignLiteral("JavaScript note: "); + AppendErrorDetailsTo(error); + + fprintf(stderr, "%s\n", error.get()); + fflush(stderr); +} + +void +xpc::ErrorReport::LogToStderr() +{ + if (!nsContentUtils::DOMWindowDumpEnabled()) { + return; + } + + nsAutoCString error; + error.AssignLiteral("JavaScript "); + if (JSREPORT_IS_STRICT(mFlags)) { + error.AppendLiteral("strict "); + } + if (JSREPORT_IS_WARNING(mFlags)) { + error.AppendLiteral("warning: "); + } else { + error.AppendLiteral("error: "); + } + AppendErrorDetailsTo(error); + + fprintf(stderr, "%s\n", error.get()); + fflush(stderr); + + for (size_t i = 0, len = mNotes.Length(); i < len; i++) { + ErrorNote& note = mNotes[i]; + note.LogToStderr(); + } +} + +void xpc::ErrorReport::LogToConsole() { LogToConsoleWithStack(nullptr); @@ -233,25 +314,7 @@ xpc::ErrorReport::LogToConsole() void xpc::ErrorReport::LogToConsoleWithStack(JS::HandleObject aStack) { - // Log to stdout. - if (nsContentUtils::DOMWindowDumpEnabled()) { - nsAutoCString error; - error.AssignLiteral("JavaScript "); - if (JSREPORT_IS_STRICT(mFlags)) - error.AppendLiteral("strict "); - if (JSREPORT_IS_WARNING(mFlags)) - error.AppendLiteral("warning: "); - else - error.AppendLiteral("error: "); - error.Append(NS_LossyConvertUTF16toASCII(mFileName)); - error.AppendLiteral(", line "); - error.AppendInt(mLineNumber, 10); - error.AppendLiteral(": "); - error.Append(NS_LossyConvertUTF16toASCII(mErrorMsg)); - - fprintf(stderr, "%s\n", error.get()); - fflush(stderr); - } + LogToStderr(); MOZ_LOG(gJSDiagnostics, JSREPORT_IS_WARNING(mFlags) ? LogLevel::Warning : LogLevel::Error, @@ -263,8 +326,9 @@ xpc::ErrorReport::LogToConsoleWithStack(JS::HandleObject aStack) // mechanisms. nsCOMPtr<nsIConsoleService> consoleService = do_GetService(NS_CONSOLESERVICE_CONTRACTID); + NS_ENSURE_TRUE_VOID(consoleService); - nsCOMPtr<nsIScriptError> errorObject; + RefPtr<nsScriptErrorBase> errorObject; if (mWindowID && aStack) { // Only set stack on messages related to a document // As we cache messages in the console service, @@ -275,18 +339,38 @@ xpc::ErrorReport::LogToConsoleWithStack(JS::HandleObject aStack) errorObject = new nsScriptError(); } errorObject->SetErrorMessageName(mErrorMsgName); - NS_ENSURE_TRUE_VOID(consoleService); nsresult rv = errorObject->InitWithWindowID(mErrorMsg, mFileName, mSourceLine, mLineNumber, mColumn, mFlags, mCategory, mWindowID); NS_ENSURE_SUCCESS_VOID(rv); + + for (size_t i = 0, len = mNotes.Length(); i < len; i++) { + ErrorNote& note = mNotes[i]; + + nsScriptErrorNote* noteObject = new nsScriptErrorNote(); + noteObject->Init(note.mErrorMsg, note.mFileName, + note.mLineNumber, note.mColumn); + errorObject->AddNote(noteObject); + } + consoleService->LogMessage(errorObject); } /* static */ void +xpc::ErrorNote::ErrorNoteToMessageString(JSErrorNotes::Note* aNote, + nsAString& aString) +{ + aString.Truncate(); + if (aNote->message()) { + aString.Append(NS_ConvertUTF8toUTF16(aNote->message().c_str())); + } +} + +/* static */ +void xpc::ErrorReport::ErrorReportToMessageString(JSErrorReport* aReport, nsAString& aString) { diff --git a/js/xpconnect/src/xpcprivate.h b/js/xpconnect/src/xpcprivate.h index 347b406eb..e55cc06e0 100644 --- a/js/xpconnect/src/xpcprivate.h +++ b/js/xpconnect/src/xpcprivate.h @@ -128,7 +128,6 @@ #include "MainThreadUtils.h" #include "nsIConsoleService.h" -#include "nsIScriptError.h" #include "nsIException.h" #include "nsVariant.h" @@ -2552,77 +2551,6 @@ extern char* xpc_PrintJSStack(JSContext* cx, bool showArgs, bool showLocals, bool showThisProps); -/***************************************************************************/ - -// Definition of nsScriptError, defined here because we lack a place to put -// XPCOM objects associated with the JavaScript engine. -class nsScriptErrorBase : public nsIScriptError { -public: - nsScriptErrorBase(); - - // TODO - do something reasonable on getting null from these babies. - - NS_DECL_NSICONSOLEMESSAGE - NS_DECL_NSISCRIPTERROR - -protected: - virtual ~nsScriptErrorBase(); - - void - InitializeOnMainThread(); - - nsString mMessage; - nsString mMessageName; - nsString mSourceName; - uint32_t mLineNumber; - nsString mSourceLine; - uint32_t mColumnNumber; - uint32_t mFlags; - nsCString mCategory; - // mOuterWindowID is set on the main thread from InitializeOnMainThread(). - uint64_t mOuterWindowID; - uint64_t mInnerWindowID; - int64_t mTimeStamp; - // mInitializedOnMainThread and mIsFromPrivateWindow are set on the main - // thread from InitializeOnMainThread(). - mozilla::Atomic<bool> mInitializedOnMainThread; - bool mIsFromPrivateWindow; -}; - -class nsScriptError final : public nsScriptErrorBase { -public: - nsScriptError() {} - NS_DECL_THREADSAFE_ISUPPORTS - -private: - virtual ~nsScriptError() {} -}; - -class nsScriptErrorWithStack : public nsScriptErrorBase { -public: - explicit nsScriptErrorWithStack(JS::HandleObject); - - NS_DECL_CYCLE_COLLECTING_ISUPPORTS - NS_DECL_CYCLE_COLLECTION_SCRIPT_HOLDER_CLASS(nsScriptErrorWithStack) - - NS_IMETHOD Init(const nsAString& message, - const nsAString& sourceName, - const nsAString& sourceLine, - uint32_t lineNumber, - uint32_t columnNumber, - uint32_t flags, - const char* category) override; - - NS_IMETHOD GetStack(JS::MutableHandleValue) override; - NS_IMETHOD ToString(nsACString& aResult) override; - -private: - virtual ~nsScriptErrorWithStack(); - // Complete stackframe where the error happened. - // Must be SavedFrame object. - JS::Heap<JSObject*> mStack; -}; - /****************************************************************************** * Handles pre/post script processing. */ diff --git a/js/xpconnect/src/xpcpublic.h b/js/xpconnect/src/xpcpublic.h index fc8670d46..399cd2181 100644 --- a/js/xpconnect/src/xpcpublic.h +++ b/js/xpconnect/src/xpcpublic.h @@ -515,13 +515,50 @@ AllowCPOWsInAddon(const nsACString& addonId, bool allow); bool ExtraWarningsForSystemJS(); -class ErrorReport { +class ErrorBase { + public: + nsString mErrorMsg; + nsString mFileName; + uint32_t mLineNumber; + uint32_t mColumn; + + ErrorBase() : mLineNumber(0) + , mColumn(0) + {} + + void Init(JSErrorBase* aReport); + + void AppendErrorDetailsTo(nsCString& error); +}; + +class ErrorNote : public ErrorBase { + public: + void Init(JSErrorNotes::Note* aNote); + + // Produce an error event message string from the given JSErrorNotes::Note. + // This may produce an empty string if aNote doesn't have a message + // attached. + static void ErrorNoteToMessageString(JSErrorNotes::Note* aNote, + nsAString& aString); + + // Log the error note to the stderr. + void LogToStderr(); +}; + +class ErrorReport : public ErrorBase { public: NS_INLINE_DECL_THREADSAFE_REFCOUNTING(ErrorReport); + nsTArray<ErrorNote> mNotes; + + nsCString mCategory; + nsString mSourceLine; + nsString mErrorMsgName; + uint64_t mWindowID; + uint32_t mFlags; + bool mIsMuted; + ErrorReport() : mWindowID(0) - , mLineNumber(0) - , mColumn(0) , mFlags(0) , mIsMuted(false) {} @@ -530,6 +567,7 @@ class ErrorReport { bool aIsChrome, uint64_t aWindowID); void Init(JSContext* aCx, mozilla::dom::Exception* aException, bool aIsChrome, uint64_t aWindowID); + // Log the error report to the console. Which console will depend on the // window id it was initialized with. void LogToConsole(); @@ -544,18 +582,8 @@ class ErrorReport { static void ErrorReportToMessageString(JSErrorReport* aReport, nsAString& aString); - public: - - nsCString mCategory; - nsString mErrorMsgName; - nsString mErrorMsg; - nsString mFileName; - nsString mSourceLine; - uint64_t mWindowID; - uint32_t mLineNumber; - uint32_t mColumn; - uint32_t mFlags; - bool mIsMuted; + // Log the error report to the stderr. + void LogToStderr(); private: ~ErrorReport() {} diff --git a/js/xpconnect/tests/chrome/test_bug1041626.xul b/js/xpconnect/tests/chrome/test_bug1041626.xul index c7c7b7024..11529fbe4 100644 --- a/js/xpconnect/tests/chrome/test_bug1041626.xul +++ b/js/xpconnect/tests/chrome/test_bug1041626.xul @@ -28,9 +28,6 @@ https://bugzilla.mozilla.org/show_bug.cgi?id=1041626 ok(Cu.isXrayWrapper(window[0].location), "Location is Xrayed"); let xrayOwnProperties = Object.getOwnPropertyNames(window[0].location); - todo(xrayOwnProperties.indexOf('toJSON') != -1, - "dummy toJSON on Location should show up in Xrayable properties"); - xrayOwnProperties.push('toJSON'); let realOwnProperties = Object.getOwnPropertyNames(window[0].wrappedJSObject.location); ok(realOwnProperties.length > 2); diff --git a/js/xpconnect/wrappers/WrapperFactory.cpp b/js/xpconnect/wrappers/WrapperFactory.cpp index 0031fb127..8c9d38788 100644 --- a/js/xpconnect/wrappers/WrapperFactory.cpp +++ b/js/xpconnect/wrappers/WrapperFactory.cpp @@ -536,7 +536,7 @@ WrapperFactory::Rewrap(JSContext* cx, HandleObject existing, HandleObject obj) DEBUG_CheckUnwrapSafety(obj, wrapper, origin, target); if (existing) - return Wrapper::Renew(cx, existing, obj, wrapper); + return Wrapper::Renew(existing, obj, wrapper); return Wrapper::New(cx, obj, wrapper); } diff --git a/layout/base/nsPresShell.cpp b/layout/base/nsPresShell.cpp index dacc6603b..264b52b18 100644 --- a/layout/base/nsPresShell.cpp +++ b/layout/base/nsPresShell.cpp @@ -8178,9 +8178,6 @@ PresShell::HandleEventInternal(WidgetEvent* aEvent, } } } - if (aEvent->mMessage == eKeyDown) { - mIsLastKeyDownCanceled = aEvent->mFlags.mDefaultPrevented; - } break; } case eMouseUp: @@ -8970,9 +8967,6 @@ PresShell::FireOrClearDelayedEvents(bool aFireEvents) !doc->EventHandlingSuppressed()) { nsAutoPtr<DelayedEvent> ev(mDelayedEvents[0].forget()); mDelayedEvents.RemoveElementAt(0); - if (ev->IsKeyPressEvent() && mIsLastKeyDownCanceled) { - continue; - } ev->Dispatch(); } if (!doc->EventHandlingSuppressed()) { @@ -9767,12 +9761,6 @@ PresShell::DelayedKeyEvent::DelayedKeyEvent(WidgetKeyboardEvent* aEvent) : mEvent = keyEvent; } -bool -PresShell::DelayedKeyEvent::IsKeyPressEvent() -{ - return mEvent->mMessage == eKeyPress; -} - // Start of DEBUG only code #ifdef DEBUG diff --git a/layout/base/nsPresShell.h b/layout/base/nsPresShell.h index 10548880a..f20370d73 100644 --- a/layout/base/nsPresShell.h +++ b/layout/base/nsPresShell.h @@ -618,7 +618,6 @@ protected: public: virtual ~DelayedEvent() { } virtual void Dispatch() { } - virtual bool IsKeyPressEvent() { return false; } }; class DelayedInputEvent : public DelayedEvent @@ -643,7 +642,6 @@ protected: { public: explicit DelayedKeyEvent(mozilla::WidgetKeyboardEvent* aEvent); - virtual bool IsKeyPressEvent() override; }; // Check if aEvent is a mouse event and record the mouse location for later @@ -954,8 +952,6 @@ protected: // Whether the widget has received a paint message yet. bool mHasReceivedPaintMessage : 1; - bool mIsLastKeyDownCanceled : 1; - static bool sDisableNonTestMouseEvents; }; diff --git a/layout/build/moz.build b/layout/build/moz.build index 5b607c171..ecf180d78 100644 --- a/layout/build/moz.build +++ b/layout/build/moz.build @@ -31,6 +31,7 @@ LOCAL_INCLUDES += [ '/docshell/base', '/dom/audiochannel', '/dom/base', + '/dom/bindings', '/dom/canvas', '/dom/filesystem', '/dom/geolocation', diff --git a/layout/build/nsLayoutModule.cpp b/layout/build/nsLayoutModule.cpp index 8bb70f85c..9313b8e45 100644 --- a/layout/build/nsLayoutModule.cpp +++ b/layout/build/nsLayoutModule.cpp @@ -35,6 +35,7 @@ #include "nsIObserver.h" #include "nsIObserverService.h" #include "nsIScriptNameSpaceManager.h" +#include "nsIScriptError.h" #include "nsISelection.h" #include "nsCaret.h" #include "nsPlainTextSerializer.h" @@ -192,6 +193,8 @@ static void Shutdown(); #include "mozilla/dom/PresentationDeviceManager.h" #include "mozilla/dom/PresentationTCPSessionTransport.h" +#include "nsScriptError.h" + #include "mozilla/TextInputProcessor.h" using namespace mozilla; @@ -560,6 +563,8 @@ NS_GENERIC_FACTORY_CONSTRUCTOR(UDPSocketChild) NS_GENERIC_FACTORY_SINGLETON_CONSTRUCTOR(GeckoMediaPluginService, GeckoMediaPluginService::GetGeckoMediaPluginService) +NS_GENERIC_FACTORY_CONSTRUCTOR(nsScriptError) + #ifdef ACCESSIBILITY #include "xpcAccessibilityService.h" @@ -720,6 +725,8 @@ NS_DEFINE_NAMED_CID(PRESENTATION_TCP_SESSION_TRANSPORT_CID); NS_DEFINE_NAMED_CID(TEXT_INPUT_PROCESSOR_CID); +NS_DEFINE_NAMED_CID(NS_SCRIPTERROR_CID); + static nsresult CreateWindowCommandTableConstructor(nsISupports *aOuter, REFNSIID aIID, void **aResult) @@ -978,6 +985,7 @@ static const mozilla::Module::CIDEntry kLayoutCIDs[] = { { &kPRESENTATION_DEVICE_MANAGER_CID, false, nullptr, PresentationDeviceManagerConstructor }, { &kPRESENTATION_TCP_SESSION_TRANSPORT_CID, false, nullptr, PresentationTCPSessionTransportConstructor }, { &kTEXT_INPUT_PROCESSOR_CID, false, nullptr, TextInputProcessorConstructor }, + { &kNS_SCRIPTERROR_CID, false, nullptr, nsScriptErrorConstructor }, { nullptr } }; @@ -1109,6 +1117,7 @@ static const mozilla::Module::ContractIDEntry kLayoutContracts[] = { { PRESENTATION_DEVICE_MANAGER_CONTRACTID, &kPRESENTATION_DEVICE_MANAGER_CID }, { PRESENTATION_TCP_SESSION_TRANSPORT_CONTRACTID, &kPRESENTATION_TCP_SESSION_TRANSPORT_CID }, { "@mozilla.org/text-input-processor;1", &kTEXT_INPUT_PROCESSOR_CID }, + { NS_SCRIPTERROR_CONTRACTID, &kNS_SCRIPTERROR_CID }, { nullptr } }; diff --git a/media/libnestegg/include/nestegg.h b/media/libnestegg/include/nestegg.h index 777555f7b..2a9f08f5d 100644 --- a/media/libnestegg/include/nestegg.h +++ b/media/libnestegg/include/nestegg.h @@ -73,6 +73,7 @@ extern "C" { #define NESTEGG_CODEC_OPUS 3 /**< Track uses Xiph Opus codec. */ #define NESTEGG_CODEC_AV1 4 /**< Track uses AOMedia AV1 codec. */ #define NESTEGG_CODEC_AVC1 5 /**< Track uses AVC1 'h264' */ +#define NESTEGG_CODEC_AAC 6 /**< Track uses AAC 'mp4a' */ #define NESTEGG_CODEC_UNKNOWN INT_MAX /**< Track uses unknown codec. */ #define NESTEGG_VIDEO_MONO 0 /**< Track is mono video. */ diff --git a/media/libnestegg/src/nestegg.c b/media/libnestegg/src/nestegg.c index 6f0d55b46..051bc50fa 100644 --- a/media/libnestegg/src/nestegg.c +++ b/media/libnestegg/src/nestegg.c @@ -158,6 +158,7 @@ enum ebml_type_enum { #define TRACK_ID_VORBIS "A_VORBIS" #define TRACK_ID_OPUS "A_OPUS" #define TRACK_ID_AVC1 "V_MPEG4/ISO/AVC" +#define TRACK_ID_AAC "A_AAC" /* Track Encryption */ #define CONTENT_ENC_ALGO_AES 5 @@ -2405,6 +2406,9 @@ nestegg_track_codec_id(nestegg * ctx, unsigned int track) if (strcmp(codec_id, TRACK_ID_AVC1) == 0) return NESTEGG_CODEC_AVC1; + if (strcmp(codec_id, TRACK_ID_AAC) == 0) + return NESTEGG_CODEC_AAC; + return NESTEGG_CODEC_UNKNOWN; } @@ -2425,7 +2429,8 @@ nestegg_track_codec_data_count(nestegg * ctx, unsigned int track, codec_id = nestegg_track_codec_id(ctx, track); - if (codec_id == NESTEGG_CODEC_OPUS) { + if (codec_id == NESTEGG_CODEC_OPUS || + codec_id == NESTEGG_CODEC_AAC) { *count = 1; return 0; } @@ -2464,7 +2469,8 @@ nestegg_track_codec_data(nestegg * ctx, unsigned int track, unsigned int item, if (nestegg_track_codec_id(ctx, track) != NESTEGG_CODEC_VORBIS && nestegg_track_codec_id(ctx, track) != NESTEGG_CODEC_OPUS && - nestegg_track_codec_id(ctx, track) != NESTEGG_CODEC_AVC1) + nestegg_track_codec_id(ctx, track) != NESTEGG_CODEC_AVC1 && + nestegg_track_codec_id(ctx, track) != NESTEGG_CODEC_AAC) return -1; if (ne_get_binary(entry->codec_private, &codec_private) != 0) @@ -2777,6 +2783,19 @@ nestegg_read_packet(nestegg * ctx, nestegg_packet ** pkt) if (r != 1) return r; + /* Some files have a crc32 element, since it also has to be first it + conflicts with the timecode spec. Just ignore it */ + if (id == ID_CRC32) { + ctx->log(ctx, NESTEGG_LOG_DEBUG, + "read_packet: skipping crc element in a cluster"); + r = ne_io_read_skip(ctx->io, size); + if (r != 1) + return r; + r = ne_read_element(ctx, &id, &size); + if (r != 1) + return r; + } + /* Timecode must be the first element in a Cluster, per spec. */ if (id != ID_TIMECODE) return -1; diff --git a/modules/libpref/init/all.js b/modules/libpref/init/all.js index 38c3ced91..cd4284a9e 100644 --- a/modules/libpref/init/all.js +++ b/modules/libpref/init/all.js @@ -1331,6 +1331,10 @@ pref("image.animation_mode", "normal"); // Same-origin policy for file URIs, "false" is traditional pref("security.fileuri.strict_origin_policy", true); +// Treat all file URIs as having a unique origin. +// Only has an effect if strict origin policy is true. +pref("security.fileuri.unique_origin", true); + // If this pref is true, prefs in the logging.config branch will be cleared on // startup. This is done so that setting a log-file and log-modules at runtime // doesn't persist across restarts leading to huge logfile and low disk space. diff --git a/netwerk/base/nsNetUtil.cpp b/netwerk/base/nsNetUtil.cpp index 653a9003e..2974e26b0 100644 --- a/netwerk/base/nsNetUtil.cpp +++ b/netwerk/base/nsNetUtil.cpp @@ -10,6 +10,7 @@ #include "mozilla/LoadContext.h" #include "mozilla/LoadInfo.h" #include "mozilla/BasePrincipal.h" +#include "mozilla/Preferences.h" #include "mozilla/Telemetry.h" #include "nsNetUtil.h" #include "nsNetUtilInlines.h" @@ -1821,33 +1822,40 @@ NS_RelaxStrictFileOriginPolicy(nsIURI *aTargetURI, return false; } - // - // If the file to be loaded is in a subdirectory of the source - // (or same-dir if source is not a directory) then it will - // inherit its source principal and be scriptable by that source. - // - bool sourceIsDir; - bool allowed = false; - nsresult rv = sourceFile->IsDirectory(&sourceIsDir); - if (NS_SUCCEEDED(rv) && sourceIsDir) { - rv = sourceFile->Contains(targetFile, &allowed); - } else { - nsCOMPtr<nsIFile> sourceParent; - rv = sourceFile->GetParent(getter_AddRefs(sourceParent)); - if (NS_SUCCEEDED(rv) && sourceParent) { - rv = sourceParent->Equals(targetFile, &allowed); - if (NS_FAILED(rv) || !allowed) { - rv = sourceParent->Contains(targetFile, &allowed); - } else { - MOZ_ASSERT(aAllowDirectoryTarget, - "sourceFile->Parent == targetFile, but targetFile " - "should've been disallowed if it is a directory"); + bool uniqueOrigin = true; + uniqueOrigin = Preferences::GetBool("security.fileuri.unique_origin"); + + // If treating all files as unique origins, we can skip this because + // it should always be refused. + if (!uniqueOrigin) { + // + // If the file to be loaded is in a subdirectory of the source + // (or same-dir if source is not a directory) then it will + // inherit its source principal and be scriptable by that source. + // + bool sourceIsDir; + bool allowed = false; + nsresult rv = sourceFile->IsDirectory(&sourceIsDir); + if (NS_SUCCEEDED(rv) && sourceIsDir) { + rv = sourceFile->Contains(targetFile, &allowed); + } else { + nsCOMPtr<nsIFile> sourceParent; + rv = sourceFile->GetParent(getter_AddRefs(sourceParent)); + if (NS_SUCCEEDED(rv) && sourceParent) { + rv = sourceParent->Equals(targetFile, &allowed); + if (NS_FAILED(rv) || !allowed) { + rv = sourceParent->Contains(targetFile, &allowed); + } else { + MOZ_ASSERT(aAllowDirectoryTarget, + "sourceFile->Parent == targetFile, but targetFile " + "should've been disallowed if it is a directory"); + } } } - } - if (NS_SUCCEEDED(rv) && allowed) { - return true; + if (NS_SUCCEEDED(rv) && allowed) { + return true; + } } return false; diff --git a/netwerk/base/nsStandardURL.cpp b/netwerk/base/nsStandardURL.cpp index dff4ecbc0..7317240c2 100644 --- a/netwerk/base/nsStandardURL.cpp +++ b/netwerk/base/nsStandardURL.cpp @@ -575,7 +575,7 @@ nsStandardURL::ValidIPv6orHostname(const char *host, uint32_t length) } const char *end = host + length; - if (end != net_FindCharInSet(host, end, CONTROL_CHARACTERS " #/:?@[\\]*<>|\"")) { + if (end != net_FindCharInSet(host, end, CONTROL_CHARACTERS " #/:?@[\\]*<>|\"^")) { // We still allow % because it is in the ID of addons. // Any percent encoded ASCII characters that are not allowed in the // hostname are not percent decoded, and will be parsed just fine. diff --git a/netwerk/protocol/http/AlternateServices.cpp b/netwerk/protocol/http/AlternateServices.cpp index ee2fa9331..10bd61928 100644 --- a/netwerk/protocol/http/AlternateServices.cpp +++ b/netwerk/protocol/http/AlternateServices.cpp @@ -121,6 +121,11 @@ AltSvcMapping::ProcessHeader(const nsCString &buf, const nsCString &originScheme continue; } + if (NS_FAILED(NS_CheckPortSafety(portno, originScheme.get()))) { + LOG(("Alt Svc does not allow port %d, ignoring request", portno)); + continue; + } + // unescape modifies a c string in place, so afterwards // update nsCString length nsUnescape(npnToken.BeginWriting()); diff --git a/netwerk/protocol/http/Http2Push.cpp b/netwerk/protocol/http/Http2Push.cpp index b6fc485e2..34fc425d2 100644 --- a/netwerk/protocol/http/Http2Push.cpp +++ b/netwerk/protocol/http/Http2Push.cpp @@ -30,8 +30,8 @@ class CallChannelOnPush final : public Runnable { Http2PushedStream *pushStream) : mAssociatedChannel(associatedChannel) , mPushedURI(pushedURI) - , mPushedStream(pushStream) { + mPushedStreamWrapper = new Http2PushedStreamWrapper(pushStream); } NS_IMETHOD Run() override @@ -40,21 +40,94 @@ class CallChannelOnPush final : public Runnable { RefPtr<nsHttpChannel> channel; CallQueryInterface(mAssociatedChannel, channel.StartAssignment()); MOZ_ASSERT(channel); - if (channel && NS_SUCCEEDED(channel->OnPush(mPushedURI, mPushedStream))) { + if (channel && NS_SUCCEEDED(channel->OnPush(mPushedURI, mPushedStreamWrapper))) { return NS_OK; } LOG3(("Http2PushedStream Orphan %p failed OnPush\n", this)); - mPushedStream->OnPushFailed(); + mPushedStreamWrapper->OnPushFailed(); return NS_OK; } private: nsCOMPtr<nsIHttpChannelInternal> mAssociatedChannel; const nsCString mPushedURI; - Http2PushedStream *mPushedStream; + RefPtr<Http2PushedStreamWrapper> mPushedStreamWrapper; }; +// Because WeakPtr isn't thread-safe we must ensure that the object is destroyed +// on the socket thread, so any Release() called on a different thread is +// dispatched to the socket thread. +bool Http2PushedStreamWrapper::DispatchRelease() { + if (PR_GetCurrentThread() == gSocketThread) { + return false; + } + + gSocketTransportService->Dispatch( + NewNonOwningRunnableMethod(this, &Http2PushedStreamWrapper::Release), + NS_DISPATCH_NORMAL); + + return true; +} + +NS_IMPL_ADDREF(Http2PushedStreamWrapper) +NS_IMETHODIMP_(MozExternalRefCountType) +Http2PushedStreamWrapper::Release() { + nsrefcnt count = mRefCnt - 1; + if (DispatchRelease()) { + // Redispatched to the socket thread. + return count; + } + + MOZ_ASSERT(0 != mRefCnt, "dup release"); + count = --mRefCnt; + NS_LOG_RELEASE(this, count, "Http2PushedStreamWrapper"); + + if (0 == count) { + mRefCnt = 1; + delete (this); + return 0; + } + + return count; +} + +NS_INTERFACE_MAP_BEGIN(Http2PushedStreamWrapper) +NS_INTERFACE_MAP_END + +Http2PushedStreamWrapper::Http2PushedStreamWrapper( + Http2PushedStream* aPushStream) { + MOZ_ASSERT(PR_GetCurrentThread() == gSocketThread, "not on socket thread"); + mStream = aPushStream; + mRequestString = aPushStream->GetRequestString(); +} + +Http2PushedStreamWrapper::~Http2PushedStreamWrapper() { + MOZ_ASSERT(PR_GetCurrentThread() == gSocketThread, "not on socket thread"); +} + +Http2PushedStream* Http2PushedStreamWrapper::GetStream() { + MOZ_ASSERT(PR_GetCurrentThread() == gSocketThread, "not on socket thread"); + if (mStream) { + Http2Stream* stream = mStream; + return static_cast<Http2PushedStream*>(stream); + } + return nullptr; +} + +void Http2PushedStreamWrapper::OnPushFailed() { + if (PR_GetCurrentThread() == gSocketThread) { + if (mStream) { + Http2Stream* stream = mStream; + static_cast<Http2PushedStream*>(stream)->OnPushFailed(); + } + } else { + gSocketTransportService->Dispatch( + NewRunnableMethod(this, &Http2PushedStreamWrapper::OnPushFailed), + NS_DISPATCH_NORMAL); + } +} + ////////////////////////////////////////// // Http2PushedStream ////////////////////////////////////////// diff --git a/netwerk/protocol/http/Http2Push.h b/netwerk/protocol/http/Http2Push.h index fd39eb2c7..d4b71c1ef 100644 --- a/netwerk/protocol/http/Http2Push.h +++ b/netwerk/protocol/http/Http2Push.h @@ -123,6 +123,24 @@ private: uint32_t mBufferedHTTP1Consumed; }; +class Http2PushedStreamWrapper : public nsISupports { +public: + NS_DECL_THREADSAFE_ISUPPORTS + bool DispatchRelease(); + + explicit Http2PushedStreamWrapper(Http2PushedStream* aPushStream); + + nsCString& GetRequestString() { return mRequestString; } + Http2PushedStream* GetStream(); + void OnPushFailed(); + +private: + virtual ~Http2PushedStreamWrapper(); + + nsCString mRequestString; + WeakPtr<Http2Stream> mStream; +}; + } // namespace net } // namespace mozilla diff --git a/netwerk/protocol/http/Http2Session.cpp b/netwerk/protocol/http/Http2Session.cpp index 4a178f091..86e8c74f6 100644 --- a/netwerk/protocol/http/Http2Session.cpp +++ b/netwerk/protocol/http/Http2Session.cpp @@ -380,12 +380,24 @@ Http2Session::AddStream(nsAHttpTransaction *aHttpTransaction, if (mClosed || mShouldGoAway) { nsHttpTransaction *trans = aHttpTransaction->QueryHttpTransaction(); - if (trans && !trans->GetPushedStream()) { - LOG3(("Http2Session::AddStream %p atrans=%p trans=%p session unusable - resched.\n", - this, aHttpTransaction, trans)); - aHttpTransaction->SetConnection(nullptr); - gHttpHandler->InitiateTransaction(trans, trans->Priority()); - return true; + if (trans) { + RefPtr<Http2PushedStreamWrapper> pushedStreamWrapper; + pushedStreamWrapper = trans->GetPushedStream(); + if (!pushedStreamWrapper || !pushedStreamWrapper->GetStream()) { + LOG3( + ("Http2Session::AddStream %p atrans=%p trans=%p session unusable - " + "resched.\n", this, aHttpTransaction, trans)); + aHttpTransaction->SetConnection(nullptr); + nsresult rv = + gHttpHandler->InitiateTransaction(trans, trans->Priority()); + if (NS_FAILED(rv)) { + LOG3( + ("Http2Session::AddStream %p atrans=%p trans=%p failed to " + "initiate transaction (%08x).\n", + this, aHttpTransaction, trans, static_cast<uint32_t>(rv))); + } + return true; + } } } diff --git a/netwerk/protocol/http/Http2Stream.cpp b/netwerk/protocol/http/Http2Stream.cpp index 581ebe016..22d8142c9 100644 --- a/netwerk/protocol/http/Http2Stream.cpp +++ b/netwerk/protocol/http/Http2Stream.cpp @@ -442,12 +442,14 @@ Http2Stream::ParseHttpRequestHeaders(const char *buf, requestContext->GetSpdyPushCache(&cache); } + RefPtr<Http2PushedStreamWrapper> pushedStreamWrapper; Http2PushedStream *pushedStream = nullptr; // If a push stream is attached to the transaction via onPush, match only with that // one. This occurs when a push was made with in conjunction with a nsIHttpPushListener nsHttpTransaction *trans = mTransaction->QueryHttpTransaction(); - if (trans && (pushedStream = trans->TakePushedStream())) { + if (trans && (pushedStreamWrapper = trans->TakePushedStream()) && + (pushedStream = pushedStreamWrapper->GetStream())) { if (pushedStream->mSession == mSession) { LOG3(("Pushed Stream match based on OnPush correlation %p", pushedStream)); } else { diff --git a/netwerk/protocol/http/Http2Stream.h b/netwerk/protocol/http/Http2Stream.h index 8783eefed..30ade870f 100644 --- a/netwerk/protocol/http/Http2Stream.h +++ b/netwerk/protocol/http/Http2Stream.h @@ -28,6 +28,7 @@ class Http2Decompressor; class Http2Stream : public nsAHttpSegmentReader , public nsAHttpSegmentWriter + , public SupportsWeakPtr<Http2Stream> { public: NS_DECL_NSAHTTPSEGMENTREADER diff --git a/netwerk/protocol/http/nsHttpChannel.cpp b/netwerk/protocol/http/nsHttpChannel.cpp index 481df5ff0..05383916f 100644 --- a/netwerk/protocol/http/nsHttpChannel.cpp +++ b/netwerk/protocol/http/nsHttpChannel.cpp @@ -7828,7 +7828,7 @@ nsHttpChannel::AwaitingCacheCallbacks() } void -nsHttpChannel::SetPushedStream(Http2PushedStream *stream) +nsHttpChannel::SetPushedStream(Http2PushedStreamWrapper *stream) { MOZ_ASSERT(stream); MOZ_ASSERT(!mPushedStream); @@ -7836,7 +7836,7 @@ nsHttpChannel::SetPushedStream(Http2PushedStream *stream) } nsresult -nsHttpChannel::OnPush(const nsACString &url, Http2PushedStream *pushedStream) +nsHttpChannel::OnPush(const nsACString &url, Http2PushedStreamWrapper *pushedStream) { MOZ_ASSERT(NS_IsMainThread()); LOG(("nsHttpChannel::OnPush [this=%p]\n", this)); diff --git a/netwerk/protocol/http/nsHttpChannel.h b/netwerk/protocol/http/nsHttpChannel.h index 0038e1f71..defd710c3 100644 --- a/netwerk/protocol/http/nsHttpChannel.h +++ b/netwerk/protocol/http/nsHttpChannel.h @@ -126,7 +126,7 @@ public: const nsID& aChannelId, nsContentPolicyType aContentPolicyType) override; - nsresult OnPush(const nsACString &uri, Http2PushedStream *pushedStream); + nsresult OnPush(const nsACString &uri, Http2PushedStreamWrapper *pushedStream); static bool IsRedirectStatus(uint32_t status); @@ -448,7 +448,7 @@ private: nsresult OpenCacheInputStream(nsICacheEntry* cacheEntry, bool startBuffering, bool checkingAppCacheEntry); - void SetPushedStream(Http2PushedStream *stream); + void SetPushedStream(Http2PushedStreamWrapper *stream); void SetDoNotTrack(); @@ -578,9 +578,10 @@ private: nsTArray<nsContinueRedirectionFunc> mRedirectFuncStack; // Needed for accurate DNS timing - RefPtr<nsDNSPrefetch> mDNSPrefetch; + RefPtr<nsDNSPrefetch> mDNSPrefetch; - Http2PushedStream *mPushedStream; + RefPtr<Http2PushedStreamWrapper> mPushedStream; + // True if the channel's principal was found on a phishing, malware, or // tracking (if tracking protection is enabled) blocklist bool mLocalBlocklist; diff --git a/netwerk/protocol/http/nsHttpConnectionMgr.cpp b/netwerk/protocol/http/nsHttpConnectionMgr.cpp index 907f33436..d402b4104 100644 --- a/netwerk/protocol/http/nsHttpConnectionMgr.cpp +++ b/netwerk/protocol/http/nsHttpConnectionMgr.cpp @@ -373,8 +373,12 @@ nsHttpConnectionMgr::VerifyTraffic() nsresult nsHttpConnectionMgr::DoShiftReloadConnectionCleanup(nsHttpConnectionInfo *aCI) { + RefPtr<nsHttpConnectionInfo> ci; + if (aCI) { + ci = aCI->Clone(); + } return PostEvent(&nsHttpConnectionMgr::OnMsgDoShiftReloadConnectionCleanup, - 0, aCI); + 0, ci); } class SpeculativeConnectArgs : public ARefBase @@ -504,9 +508,13 @@ nsHttpConnectionMgr::UpdateParam(nsParamName name, uint16_t value) } nsresult -nsHttpConnectionMgr::ProcessPendingQ(nsHttpConnectionInfo *ci) +nsHttpConnectionMgr::ProcessPendingQ(nsHttpConnectionInfo* aCI) { - LOG(("nsHttpConnectionMgr::ProcessPendingQ [ci=%s]\n", ci->HashKey().get())); + LOG(("nsHttpConnectionMgr::ProcessPendingQ [ci=%s]\n", aCI->HashKey().get())); + RefPtr<nsHttpConnectionInfo> ci; + if (aCI) { + ci = aCI->Clone(); + } return PostEvent(&nsHttpConnectionMgr::OnMsgProcessPendingQ, 0, ci); } @@ -1819,13 +1827,18 @@ nsHttpConnectionMgr::ProcessNewTransaction(nsHttpTransaction *trans) trans->SetPendingTime(); - Http2PushedStream *pushedStream = trans->GetPushedStream(); - if (pushedStream) { - LOG((" ProcessNewTransaction %p tied to h2 session push %p\n", - trans, pushedStream->Session())); - return pushedStream->Session()-> - AddStream(trans, trans->Priority(), false, nullptr) ? - NS_OK : NS_ERROR_UNEXPECTED; + RefPtr<Http2PushedStreamWrapper> pushedStreamWrapper = + trans->GetPushedStream(); + if (pushedStreamWrapper) { + Http2PushedStream* pushedStream = pushedStreamWrapper->GetStream(); + if (pushedStream) { + LOG((" ProcessNewTransaction %p tied to h2 session push %p\n", trans, + pushedStream->Session())); + return pushedStream->Session()->AddStream(trans, trans->Priority(), false, + nullptr) + ? NS_OK + : NS_ERROR_UNEXPECTED; + } } nsresult rv = NS_OK; diff --git a/netwerk/protocol/http/nsHttpHandler.h b/netwerk/protocol/http/nsHttpHandler.h index 67b9ebe0e..402147577 100644 --- a/netwerk/protocol/http/nsHttpHandler.h +++ b/netwerk/protocol/http/nsHttpHandler.h @@ -246,7 +246,8 @@ public: uint32_t caps = 0) { TickleWifi(callbacks); - return mConnMgr->SpeculativeConnect(ci, callbacks, caps); + RefPtr<nsHttpConnectionInfo> clone = ci->Clone(); + return mConnMgr->SpeculativeConnect(clone, callbacks, caps); } // Alternate Services Maps are main thread only diff --git a/netwerk/protocol/http/nsHttpTransaction.h b/netwerk/protocol/http/nsHttpTransaction.h index 262796d71..1197bd98e 100644 --- a/netwerk/protocol/http/nsHttpTransaction.h +++ b/netwerk/protocol/http/nsHttpTransaction.h @@ -131,14 +131,14 @@ public: nsHttpTransaction *QueryHttpTransaction() override { return this; } - Http2PushedStream *GetPushedStream() { return mPushedStream; } - Http2PushedStream *TakePushedStream() - { - Http2PushedStream *r = mPushedStream; - mPushedStream = nullptr; - return r; + already_AddRefed<Http2PushedStreamWrapper> GetPushedStream() { + return do_AddRef(mPushedStream); } - void SetPushedStream(Http2PushedStream *push) { mPushedStream = push; } + already_AddRefed<Http2PushedStreamWrapper> TakePushedStream() {
+ return mPushedStream.forget();
+ }
+
+ void SetPushedStream(Http2PushedStreamWrapper* push) { mPushedStream = push; } uint32_t InitialRwin() const { return mInitialRwin; }; bool ChannelPipeFull() { return mWaitingOnPipeOut; } @@ -264,7 +264,7 @@ private: // so far been skipped. uint32_t mInvalidResponseBytesRead; - Http2PushedStream *mPushedStream; + RefPtr<Http2PushedStreamWrapper> mPushedStream; uint32_t mInitialRwin; nsHttpChunkedDecoder *mChunkedDecoder; diff --git a/parser/html/javasrc/Tokenizer.java b/parser/html/javasrc/Tokenizer.java index d9eaafeb3..70e1df75c 100644 --- a/parser/html/javasrc/Tokenizer.java +++ b/parser/html/javasrc/Tokenizer.java @@ -3850,12 +3850,9 @@ public class Tokenizer implements Locator { tokenHandler.characters( Tokenizer.LT_SOLIDUS, 0, 2); emitStrBuf(); - if (c == '\u0000') { - emitReplacementCharacter(buf, pos); - } else { - cstart = pos; // don't drop the - // character - } + cstart = pos; // don't drop the + // character + reconsume = true; state = transition(state, returnState, reconsume, pos); continue stateloop; } diff --git a/parser/html/nsHtml5Tokenizer.cpp b/parser/html/nsHtml5Tokenizer.cpp index a9db8d0c1..e70c081bf 100644 --- a/parser/html/nsHtml5Tokenizer.cpp +++ b/parser/html/nsHtml5Tokenizer.cpp @@ -2093,11 +2093,8 @@ nsHtml5Tokenizer::stateLoop(int32_t state, char16_t c, int32_t pos, char16_t* bu default: { tokenHandler->characters(nsHtml5Tokenizer::LT_SOLIDUS, 0, 2); emitStrBuf(); - if (c == '\0') { - emitReplacementCharacter(buf, pos); - } else { - cstart = pos; - } + cstart = pos; + reconsume = true; state = P::transition(mViewSource, returnState, reconsume, pos); NS_HTML5_CONTINUE(stateloop); } diff --git a/security/nss/coreconf/coreconf.dep b/security/nss/coreconf/coreconf.dep index 590d1bfae..5182f7555 100644 --- a/security/nss/coreconf/coreconf.dep +++ b/security/nss/coreconf/coreconf.dep @@ -10,4 +10,3 @@ */ #error "Do not include this header file." - diff --git a/security/nss/lib/cryptohi/seckey.c b/security/nss/lib/cryptohi/seckey.c index 080909772..173096050 100644 --- a/security/nss/lib/cryptohi/seckey.c +++ b/security/nss/lib/cryptohi/seckey.c @@ -639,6 +639,11 @@ seckey_ExtractPublicKey(const CERTSubjectPublicKeyInfo *spki) return pubk; break; case SEC_OID_ANSIX962_EC_PUBLIC_KEY: + /* A basic sanity check on inputs. */ + if (spki->algorithm.parameters.len == 0 || newOs.len == 0) { + PORT_SetError(SEC_ERROR_INPUT_LEN); + break; + } pubk->keyType = ecKey; pubk->u.ec.size = 0; diff --git a/security/nss/lib/freebl/dh.c b/security/nss/lib/freebl/dh.c index 6f2bafda2..b2d6d7430 100644 --- a/security/nss/lib/freebl/dh.c +++ b/security/nss/lib/freebl/dh.c @@ -210,7 +210,8 @@ DH_Derive(SECItem *publicValue, unsigned int len = 0; unsigned int nb; unsigned char *secret = NULL; - if (!publicValue || !prime || !privateValue || !derivedSecret) { + if (!publicValue || !publicValue->len || !prime || !prime->len || + !privateValue || !privateValue->len || !derivedSecret) { PORT_SetError(SEC_ERROR_INVALID_ARGS); return SECFailure; } diff --git a/security/nss/lib/freebl/ec.c b/security/nss/lib/freebl/ec.c index 6468a10d6..ddbcc2340 100644 --- a/security/nss/lib/freebl/ec.c +++ b/security/nss/lib/freebl/ec.c @@ -202,8 +202,8 @@ ec_NewKey(ECParams *ecParams, ECPrivateKey **privKey, #endif MP_DIGITS(&k) = 0; - if (!ecParams || !privKey || !privKeyBytes || (privKeyLen < 0) || - !ecParams->name) { + if (!ecParams || ecParams->name == ECCurve_noName || + !privKey || !privKeyBytes || privKeyLen <= 0) { PORT_SetError(SEC_ERROR_INVALID_ARGS); return SECFailure; } @@ -391,7 +391,7 @@ EC_NewKey(ECParams *ecParams, ECPrivateKey **privKey) int len; unsigned char *privKeyBytes = NULL; - if (!ecParams) { + if (!ecParams || ecParams->name == ECCurve_noName || !privKey) { PORT_SetError(SEC_ERROR_INVALID_ARGS); return SECFailure; } @@ -430,7 +430,8 @@ EC_ValidatePublicKey(ECParams *ecParams, SECItem *publicValue) mp_err err = MP_OKAY; int len; - if (!ecParams || !publicValue || !ecParams->name) { + if (!ecParams || ecParams->name == ECCurve_noName || + !publicValue || !publicValue->len) { PORT_SetError(SEC_ERROR_INVALID_ARGS); return SECFailure; } @@ -536,8 +537,9 @@ ECDH_Derive(SECItem *publicValue, int i; #endif - if (!publicValue || !ecParams || !privateValue || !derivedSecret || - !ecParams->name) { + if (!publicValue || !publicValue->len || + !ecParams || ecParams->name == ECCurve_noName || + !privateValue || !privateValue->len || !derivedSecret) { PORT_SetError(SEC_ERROR_INVALID_ARGS); return SECFailure; } diff --git a/security/nss/lib/freebl/ecl/ecp_25519.c b/security/nss/lib/freebl/ecl/ecp_25519.c index 38bd34c50..7b331b28f 100644 --- a/security/nss/lib/freebl/ecl/ecp_25519.c +++ b/security/nss/lib/freebl/ecl/ecp_25519.c @@ -114,6 +114,9 @@ ec_Curve25519_pt_mul(SECItem *X, SECItem *k, SECItem *P) } px = P->data; } + if (k->len != 32) { + return SECFailure; + } SECStatus rv = ec_Curve25519_mul(X->data, k->data, px); if (NSS_SecureMemcmpZero(X->data, X->len) == 0) { diff --git a/security/nss/lib/nss/nss.h b/security/nss/lib/nss/nss.h index 0a235941f..ea54ce0cd 100644 --- a/security/nss/lib/nss/nss.h +++ b/security/nss/lib/nss/nss.h @@ -22,10 +22,10 @@ * The format of the version string should be * "<major version>.<minor version>[.<patch level>[.<build number>]][ <ECC>][ <Beta>]" */ -#define NSS_VERSION "3.41.1" _NSS_CUSTOMIZED +#define NSS_VERSION "3.41.2" _NSS_CUSTOMIZED #define NSS_VMAJOR 3 #define NSS_VMINOR 41 -#define NSS_VPATCH 1 +#define NSS_VPATCH 2 #define NSS_VBUILD 0 #define NSS_BETA PR_FALSE diff --git a/security/nss/lib/pk11wrap/pk11akey.c b/security/nss/lib/pk11wrap/pk11akey.c index c6070e264..9a914272d 100644 --- a/security/nss/lib/pk11wrap/pk11akey.c +++ b/security/nss/lib/pk11wrap/pk11akey.c @@ -190,7 +190,6 @@ PK11_ImportPublicKey(PK11SlotInfo *slot, SECKEYPublicKey *pubKey, attrs++; PK11_SETATTRS(attrs, CKA_DERIVE, &cktrue, sizeof(CK_BBOOL)); attrs++; - signedattr = attrs; PK11_SETATTRS(attrs, CKA_EC_PARAMS, pubKey->u.ec.DEREncodedParams.data, pubKey->u.ec.DEREncodedParams.len); @@ -224,10 +223,13 @@ PK11_ImportPublicKey(PK11SlotInfo *slot, SECKEYPublicKey *pubKey, } templateCount = attrs - theTemplate; - signedcount = attrs - signedattr; PORT_Assert(templateCount <= (sizeof(theTemplate) / sizeof(CK_ATTRIBUTE))); - for (attrs = signedattr; signedcount; attrs++, signedcount--) { - pk11_SignedToUnsigned(attrs); + if (pubKey->keyType != ecKey) { + PORT_Assert(signedattr); + signedcount = attrs - signedattr; + for (attrs = signedattr; signedcount; attrs++, signedcount--) { + pk11_SignedToUnsigned(attrs); + } } rv = PK11_CreateNewObject(slot, CK_INVALID_SESSION, theTemplate, templateCount, isToken, &objectID); @@ -1074,9 +1076,13 @@ pk11_loadPrivKeyWithFlags(PK11SlotInfo *slot, SECKEYPrivateKey *privKey, &cktrue, &ckfalse); /* Not everyone can handle zero padded key values, give - * them the raw data as unsigned */ - for (ap = attrs; extra_count; ap++, extra_count--) { - pk11_SignedToUnsigned(ap); + * them the raw data as unsigned. The exception is EC, + * where the values are encoded or zero-preserving + * per-RFC5915 */ + if (privKey->keyType != ecKey) { + for (ap = attrs; extra_count; ap++, extra_count--) { + pk11_SignedToUnsigned(ap); + } } /* now Store the puppies */ diff --git a/security/nss/lib/pk11wrap/pk11cert.c b/security/nss/lib/pk11wrap/pk11cert.c index 819769643..a880b1ab8 100644 --- a/security/nss/lib/pk11wrap/pk11cert.c +++ b/security/nss/lib/pk11wrap/pk11cert.c @@ -184,7 +184,9 @@ PK11_IsUserCert(PK11SlotInfo *slot, CERTCertificate *cert, SECKEY_DestroyPublicKey(pubKey); return PR_FALSE; } - pk11_SignedToUnsigned(&theTemplate); + if (pubKey->keyType != ecKey) { + pk11_SignedToUnsigned(&theTemplate); + } if (pk11_FindObjectByTemplate(slot, &theTemplate, 1) != CK_INVALID_HANDLE) { SECKEY_DestroyPublicKey(pubKey); return PR_TRUE; diff --git a/security/nss/lib/pk11wrap/pk11pk12.c b/security/nss/lib/pk11wrap/pk11pk12.c index 47b6702c6..9888ace69 100644 --- a/security/nss/lib/pk11wrap/pk11pk12.c +++ b/security/nss/lib/pk11wrap/pk11pk12.c @@ -505,7 +505,7 @@ PK11_ImportAndReturnPrivateKey(PK11SlotInfo *slot, SECKEYRawPrivateKey *lpk, } PK11_SETATTRS(attrs, CKA_ID, ck_id->data, ck_id->len); attrs++; - signedattr = attrs; + /* No signed attrs for EC */ /* curveOID always is a copy of AlgorithmID.parameters. */ PK11_SETATTRS(attrs, CKA_EC_PARAMS, lpk->u.ec.curveOID.data, lpk->u.ec.curveOID.len); @@ -523,11 +523,12 @@ PK11_ImportAndReturnPrivateKey(PK11SlotInfo *slot, SECKEYRawPrivateKey *lpk, } templateCount = attrs - theTemplate; PORT_Assert(templateCount <= sizeof(theTemplate) / sizeof(CK_ATTRIBUTE)); - PORT_Assert(signedattr != NULL); - signedcount = attrs - signedattr; - - for (ap = signedattr; signedcount; ap++, signedcount--) { - pk11_SignedToUnsigned(ap); + if (lpk->keyType != ecKey) { + PORT_Assert(signedattr); + signedcount = attrs - signedattr; + for (ap = signedattr; signedcount; ap++, signedcount--) { + pk11_SignedToUnsigned(ap); + } } rv = PK11_CreateNewObject(slot, CK_INVALID_SESSION, diff --git a/security/nss/lib/softoken/legacydb/lgattr.c b/security/nss/lib/softoken/legacydb/lgattr.c index 542b0c968..3d77bd056 100644 --- a/security/nss/lib/softoken/legacydb/lgattr.c +++ b/security/nss/lib/softoken/legacydb/lgattr.c @@ -950,9 +950,9 @@ lg_FindECPrivateKeyAttribute(NSSLOWKEYPrivateKey *key, CK_ATTRIBUTE_TYPE type, case CKA_UNWRAP: return LG_CLONE_ATTR(attribute, type, lg_StaticFalseAttr); case CKA_VALUE: - return lg_CopyPrivAttrSigned(attribute, type, - key->u.ec.privateValue.data, - key->u.ec.privateValue.len, sdbpw); + return lg_CopyPrivAttribute(attribute, type, + key->u.ec.privateValue.data, + key->u.ec.privateValue.len, sdbpw); case CKA_EC_PARAMS: return lg_CopyAttributeSigned(attribute, type, key->u.ec.ecParams.DEREncoding.data, diff --git a/security/nss/lib/softoken/pkcs11c.c b/security/nss/lib/softoken/pkcs11c.c index 7eec3d7ee..884702cc1 100644 --- a/security/nss/lib/softoken/pkcs11c.c +++ b/security/nss/lib/softoken/pkcs11c.c @@ -7568,7 +7568,7 @@ NSC_DeriveKey(CK_SESSION_HANDLE hSession, rv = ECDH_Derive(&ecPoint, &privKey->u.ec.ecParams, &ecScalar, withCofactor, &tmp); - PORT_Free(ecScalar.data); + PORT_ZFree(ecScalar.data, ecScalar.len); ecScalar.data = NULL; if (privKey != sourceKey->objectInfo) { nsslowkey_DestroyPrivateKey(privKey); diff --git a/security/nss/lib/softoken/softkver.h b/security/nss/lib/softoken/softkver.h index f72ad577c..73a38b010 100644 --- a/security/nss/lib/softoken/softkver.h +++ b/security/nss/lib/softoken/softkver.h @@ -17,10 +17,10 @@ * The format of the version string should be * "<major version>.<minor version>[.<patch level>[.<build number>]][ <ECC>][ <Beta>]" */ -#define SOFTOKEN_VERSION "3.41.1" SOFTOKEN_ECC_STRING +#define SOFTOKEN_VERSION "3.41.2" SOFTOKEN_ECC_STRING #define SOFTOKEN_VMAJOR 3 #define SOFTOKEN_VMINOR 41 -#define SOFTOKEN_VPATCH 1 +#define SOFTOKEN_VPATCH 2 #define SOFTOKEN_VBUILD 0 #define SOFTOKEN_BETA PR_FALSE diff --git a/security/nss/lib/ssl/ssl3con.c b/security/nss/lib/ssl/ssl3con.c index 3b5c69b11..d98521a52 100644 --- a/security/nss/lib/ssl/ssl3con.c +++ b/security/nss/lib/ssl/ssl3con.c @@ -64,6 +64,7 @@ static SECStatus ssl3_FlushHandshakeMessages(sslSocket *ss, PRInt32 flags); static CK_MECHANISM_TYPE ssl3_GetHashMechanismByHashType(SSLHashType hashType); static CK_MECHANISM_TYPE ssl3_GetMgfMechanismByHashType(SSLHashType hash); PRBool ssl_IsRsaPssSignatureScheme(SSLSignatureScheme scheme); +PRBool ssl_IsRsaPkcs1SignatureScheme(SSLSignatureScheme scheme); const PRUint8 ssl_hello_retry_random[] = { 0xCF, 0x21, 0xAD, 0x74, 0xE5, 0x9A, 0x61, 0x11, @@ -4060,6 +4061,9 @@ ssl_SignatureSchemeValid(SSLSignatureScheme scheme, SECOidTag spkiOid, if (ssl_SignatureSchemeToHashType(scheme) == ssl_hash_sha1) { return PR_FALSE; } + if (ssl_IsRsaPkcs1SignatureScheme(scheme)) { + return PR_FALSE; + } /* With TLS 1.3, EC keys should have been selected based on calling * ssl_SignatureSchemeFromSpki(), reject them otherwise. */ return spkiOid != SEC_OID_ANSIX962_EC_PUBLIC_KEY; @@ -4309,6 +4313,22 @@ ssl_IsRsaPssSignatureScheme(SSLSignatureScheme scheme) return PR_FALSE; } +PRBool +ssl_IsRsaPkcs1SignatureScheme(SSLSignatureScheme scheme) +{ + switch (scheme) { + case ssl_sig_rsa_pkcs1_sha256: + case ssl_sig_rsa_pkcs1_sha384: + case ssl_sig_rsa_pkcs1_sha512: + case ssl_sig_rsa_pkcs1_sha1: + return PR_TRUE; + + default: + return PR_FALSE; + } + return PR_FALSE; +} + SSLAuthType ssl_SignatureSchemeToAuthType(SSLSignatureScheme scheme) { diff --git a/security/nss/lib/util/nssutil.h b/security/nss/lib/util/nssutil.h index f75da7eef..a2be260b0 100644 --- a/security/nss/lib/util/nssutil.h +++ b/security/nss/lib/util/nssutil.h @@ -19,10 +19,10 @@ * The format of the version string should be * "<major version>.<minor version>[.<patch level>[.<build number>]][ <Beta>]" */ -#define NSSUTIL_VERSION "3.41.1" +#define NSSUTIL_VERSION "3.41.2" #define NSSUTIL_VMAJOR 3 #define NSSUTIL_VMINOR 41 -#define NSSUTIL_VPATCH 1 +#define NSSUTIL_VPATCH 2 #define NSSUTIL_VBUILD 0 #define NSSUTIL_BETA PR_FALSE diff --git a/security/nss/lib/util/quickder.c b/security/nss/lib/util/quickder.c index 7a6ac1c53..70ae42b27 100644 --- a/security/nss/lib/util/quickder.c +++ b/security/nss/lib/util/quickder.c @@ -757,6 +757,13 @@ DecodeItem(void* dest, } case SEC_ASN1_BIT_STRING: { + /* Can't be 8 or more spare bits, or any spare bits + * if there are no octets. */ + if (temp.data[0] >= 8 || (temp.data[0] > 0 && temp.len == 1)) { + PORT_SetError(SEC_ERROR_BAD_DER); + rv = SECFailure; + break; + } /* change the length in the SECItem to be the number of bits */ temp.len = (temp.len - 1) * 8 - (temp.data[0] & 0x7); diff --git a/testing/web-platform/meta/MANIFEST.json b/testing/web-platform/meta/MANIFEST.json index 7edded5dc..03dda4a1f 100644 --- a/testing/web-platform/meta/MANIFEST.json +++ b/testing/web-platform/meta/MANIFEST.json @@ -18166,6 +18166,18 @@ "url": "/html/browsers/history/the-location-interface/location-stringifier.html" }, { + "path": "html/browsers/history/the-location-interface/location-symbol-toprimitive.html", + "url": "/html/browsers/history/the-location-interface/location-symbol-toprimitive.html" + }, + { + "path": "html/browsers/history/the-location-interface/location-tojson.html", + "url": "/html/browsers/history/the-location-interface/location-tojson.html" + }, + { + "path": "html/browsers/history/the-location-interface/location-valueof.html", + "url": "/html/browsers/history/the-location-interface/location-valueof.html" + }, + { "path": "html/browsers/history/the-location-interface/location_assign.html", "url": "/html/browsers/history/the-location-interface/location_assign.html" }, diff --git a/testing/web-platform/tests/html/browsers/history/the-location-interface/location-stringifier.html b/testing/web-platform/tests/html/browsers/history/the-location-interface/location-stringifier.html index d23323b37..bde54b266 100644 --- a/testing/web-platform/tests/html/browsers/history/the-location-interface/location-stringifier.html +++ b/testing/web-platform/tests/html/browsers/history/the-location-interface/location-stringifier.html @@ -8,4 +8,17 @@ <div id=log></div> <script> test_stringifier_attribute(location, "href", true); + +test(function() { + const prop1 = Object.getOwnPropertyDescriptor(location, "toString"), + prop2 = Object.getOwnPropertyDescriptor(location, "href") + + assert_true(prop1.enumerable) + assert_false(prop1.writable) + assert_false(prop1.configurable) + + assert_true(prop2.enumerable) + assert_false(prop2.configurable) + assert_equals(typeof prop2.get, "function") +}) </script> diff --git a/testing/web-platform/tests/html/browsers/history/the-location-interface/location-symbol-toprimitive.html b/testing/web-platform/tests/html/browsers/history/the-location-interface/location-symbol-toprimitive.html new file mode 100644 index 000000000..e666a3e70 --- /dev/null +++ b/testing/web-platform/tests/html/browsers/history/the-location-interface/location-symbol-toprimitive.html @@ -0,0 +1,14 @@ +<!DOCTYPE html> +<title>Location Symbol.toPrimitive</title> +<script src=/resources/testharness.js></script> +<script src=/resources/testharnessreport.js></script> +<div id=log></div> +<script> +test(() => { + assert_equals(location[Symbol.toPrimitive], undefined) + const prop = Object.getOwnPropertyDescriptor(location, Symbol.toPrimitive) + assert_false(prop.enumerable) + assert_false(prop.writable) + assert_false(prop.configurable) +}) +</script> diff --git a/testing/web-platform/tests/html/browsers/history/the-location-interface/location-tojson.html b/testing/web-platform/tests/html/browsers/history/the-location-interface/location-tojson.html new file mode 100644 index 000000000..5f20a6e15 --- /dev/null +++ b/testing/web-platform/tests/html/browsers/history/the-location-interface/location-tojson.html @@ -0,0 +1,13 @@ +<!DOCTYPE html> +<title>Location has no toJSON</title> +<script src=/resources/testharness.js></script> +<script src=/resources/testharnessreport.js></script> +<div id=log></div> +<script> +test(() => { + assert_equals(location.toJSON, undefined) + assert_equals(Object.getOwnPropertyDescriptor(location, "toJSON"), undefined) + assert_false(location.hasOwnProperty("toJSON")) +}) +</script> +<!-- See https://github.com/whatwg/html/pull/2294 for context. (And the HTML Standard of course.) --> diff --git a/testing/web-platform/tests/html/browsers/history/the-location-interface/location-valueof.html b/testing/web-platform/tests/html/browsers/history/the-location-interface/location-valueof.html new file mode 100644 index 000000000..978bbb63a --- /dev/null +++ b/testing/web-platform/tests/html/browsers/history/the-location-interface/location-valueof.html @@ -0,0 +1,15 @@ +<!DOCTYPE html> +<title>Location valueOf</title> +<script src=/resources/testharness.js></script> +<script src=/resources/testharnessreport.js></script> +<div id=log></div> +<script> +test(() => { + assert_equals(location.valueOf, Object.prototype.valueOf) + assert_equals(typeof location.valueOf.call(5), "object") + const prop = Object.getOwnPropertyDescriptor(location, "valueOf") + assert_false(prop.enumerable) + assert_false(prop.writable) + assert_false(prop.configurable) +}) +</script> diff --git a/toolkit/components/passwordmgr/test/subtst_master_pass.html b/toolkit/components/passwordmgr/test/subtst_master_pass.html index 14174726a..20211866a 100644 --- a/toolkit/components/passwordmgr/test/subtst_master_pass.html +++ b/toolkit/components/passwordmgr/test/subtst_master_pass.html @@ -2,6 +2,11 @@ This form triggers a MP and gets filled in.<br> <form> Username: <input type="text" id="userfield" name="u"><br> -Password: <input type="password" id="passfield" name="p" - oninput="parent.postMessage('filled', '*');"><br> +Password: <input type="password" id="passfield" name="p"><br> +<script> + // Only notify when we fill in the password field. + document.getElementById("passfield").addEventListener("input", function() { + parent.postMessage("filled", "*"); + }); +</script> </form> |