Add m-esr52 at 52.6.0

45 files changed, 14443 insertions, 0 deletions

diff --git a/python/pytest/_pytest/__init__.py b/python/pytest/_pytest/__init__.py
new file mode 100644
index 000000000..23dac6d05
--- /dev/null
+++ b/python/pytest/_pytest/__init__.py
@@ -0,0 +1,2 @@
+#
+__version__ = '2.9.2'
diff --git a/python/pytest/_pytest/_argcomplete.py b/python/pytest/_pytest/_argcomplete.py
new file mode 100644
index 000000000..955855a96
--- /dev/null
+++ b/python/pytest/_pytest/_argcomplete.py
@@ -0,0 +1,101 @@
+
+"""allow bash-completion for argparse with argcomplete if installed
+needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail
+to find the magic string, so _ARGCOMPLETE env. var is never set, and
+this does not need special code.
+
+argcomplete does not support python 2.5 (although the changes for that
+are minor).
+
+Function try_argcomplete(parser) should be called directly before
+the call to ArgumentParser.parse_args().
+
+The filescompleter is what you normally would use on the positional
+arguments specification, in order to get "dirname/" after "dirn<TAB>"
+instead of the default "dirname ":
+
+   optparser.add_argument(Config._file_or_dir, nargs='*'
+                               ).completer=filescompleter
+
+Other, application specific, completers should go in the file
+doing the add_argument calls as they need to be specified as .completer
+attributes as well. (If argcomplete is not installed, the function the
+attribute points to will not be used).
+
+SPEEDUP
+=======
+The generic argcomplete script for bash-completion
+(/etc/bash_completion.d/python-argcomplete.sh )
+uses a python program to determine startup script generated by pip.
+You can speed up completion somewhat by changing this script to include
+  # PYTHON_ARGCOMPLETE_OK
+so the the python-argcomplete-check-easy-install-script does not
+need to be called to find the entry point of the code and see if that is
+marked  with PYTHON_ARGCOMPLETE_OK
+
+INSTALL/DEBUGGING
+=================
+To include this support in another application that has setup.py generated
+scripts:
+- add the line:
+    # PYTHON_ARGCOMPLETE_OK
+  near the top of the main python entry point
+- include in the file calling parse_args():
+    from _argcomplete import try_argcomplete, filescompleter
+   , call try_argcomplete just before parse_args(), and optionally add
+   filescompleter to the positional arguments' add_argument()
+If things do not work right away:
+- switch on argcomplete debugging with (also helpful when doing custom
+  completers):
+    export _ARC_DEBUG=1
+- run:
+    python-argcomplete-check-easy-install-script $(which appname)
+    echo $?
+  will echo 0 if the magic line has been found, 1 if not
+- sometimes it helps to find early on errors using:
+    _ARGCOMPLETE=1 _ARC_DEBUG=1 appname
+  which should throw a KeyError: 'COMPLINE' (which is properly set by the
+  global argcomplete script).
+"""
+
+import sys
+import os
+from glob import glob
+
+class FastFilesCompleter:
+    'Fast file completer class'
+    def __init__(self, directories=True):
+        self.directories = directories
+
+    def __call__(self, prefix, **kwargs):
+        """only called on non option completions"""
+        if os.path.sep in prefix[1:]: #
+            prefix_dir = len(os.path.dirname(prefix) + os.path.sep)
+        else:
+            prefix_dir = 0
+        completion = []
+        globbed = []
+        if '*' not in prefix and '?' not in prefix:
+            if prefix[-1] == os.path.sep:  # we are on unix, otherwise no bash
+                globbed.extend(glob(prefix + '.*'))
+            prefix += '*'
+        globbed.extend(glob(prefix))
+        for x in sorted(globbed):
+            if os.path.isdir(x):
+                x += '/'
+            # append stripping the prefix (like bash, not like compgen)
+            completion.append(x[prefix_dir:])
+        return completion
+
+if os.environ.get('_ARGCOMPLETE'):
+    try:
+        import argcomplete.completers
+    except ImportError:
+        sys.exit(-1)
+    filescompleter = FastFilesCompleter()
+
+    def try_argcomplete(parser):
+        argcomplete.autocomplete(parser)
+else:
+    def try_argcomplete(parser): pass
+    filescompleter = None
diff --git a/python/pytest/_pytest/_code/__init__.py b/python/pytest/_pytest/_code/__init__.py
new file mode 100644
index 000000000..c046b9716
--- /dev/null
+++ b/python/pytest/_pytest/_code/__init__.py
@@ -0,0 +1,12 @@
+""" python inspection/code generation API """
+from .code import Code  # noqa
+from .code import ExceptionInfo  # noqa
+from .code import Frame  # noqa
+from .code import Traceback  # noqa
+from .code import getrawcode  # noqa
+from .code import patch_builtins  # noqa
+from .code import unpatch_builtins  # noqa
+from .source import Source  # noqa
+from .source import compile_ as compile  # noqa
+from .source import getfslineno  # noqa
+
diff --git a/python/pytest/_pytest/_code/_py2traceback.py b/python/pytest/_pytest/_code/_py2traceback.py
new file mode 100644
index 000000000..a830d9899
--- /dev/null
+++ b/python/pytest/_pytest/_code/_py2traceback.py
@@ -0,0 +1,81 @@
+# copied from python-2.7.3's traceback.py
+# CHANGES:
+# - some_str is replaced, trying to create unicode strings
+#
+import types
+
+def format_exception_only(etype, value):
+    """Format the exception part of a traceback.
+
+    The arguments are the exception type and value such as given by
+    sys.last_type and sys.last_value. The return value is a list of
+    strings, each ending in a newline.
+
+    Normally, the list contains a single string; however, for
+    SyntaxError exceptions, it contains several lines that (when
+    printed) display detailed information about where the syntax
+    error occurred.
+
+    The message indicating which exception occurred is always the last
+    string in the list.
+
+    """
+
+    # An instance should not have a meaningful value parameter, but
+    # sometimes does, particularly for string exceptions, such as
+    # >>> raise string1, string2  # deprecated
+    #
+    # Clear these out first because issubtype(string1, SyntaxError)
+    # would throw another exception and mask the original problem.
+    if (isinstance(etype, BaseException) or
+        isinstance(etype, types.InstanceType) or
+        etype is None or type(etype) is str):
+        return [_format_final_exc_line(etype, value)]
+
+    stype = etype.__name__
+
+    if not issubclass(etype, SyntaxError):
+        return [_format_final_exc_line(stype, value)]
+
+    # It was a syntax error; show exactly where the problem was found.
+    lines = []
+    try:
+        msg, (filename, lineno, offset, badline) = value.args
+    except Exception:
+        pass
+    else:
+        filename = filename or "<string>"
+        lines.append('  File "%s", line %d\n' % (filename, lineno))
+        if badline is not None:
+            if isinstance(badline, bytes):  # python 2 only
+                badline = badline.decode('utf-8', 'replace')
+            lines.append(u'    %s\n' % badline.strip())
+            if offset is not None:
+                caretspace = badline.rstrip('\n')[:offset].lstrip()
+                # non-space whitespace (likes tabs) must be kept for alignment
+                caretspace = ((c.isspace() and c or ' ') for c in caretspace)
+                # only three spaces to account for offset1 == pos 0
+                lines.append('   %s^\n' % ''.join(caretspace))
+        value = msg
+
+    lines.append(_format_final_exc_line(stype, value))
+    return lines
+
+def _format_final_exc_line(etype, value):
+    """Return a list of a single line -- normal case for format_exception_only"""
+    valuestr = _some_str(value)
+    if value is None or not valuestr:
+        line = "%s\n" % etype
+    else:
+        line = "%s: %s\n" % (etype, valuestr)
+    return line
+
+def _some_str(value):
+    try:
+        return unicode(value)
+    except Exception:
+        try:
+            return str(value)
+        except Exception:
+            pass
+    return '<unprintable %s object>' % type(value).__name__
diff --git a/python/pytest/_pytest/_code/code.py b/python/pytest/_pytest/_code/code.py
new file mode 100644
index 000000000..8995cc1f7
--- /dev/null
+++ b/python/pytest/_pytest/_code/code.py
@@ -0,0 +1,805 @@
+import sys
+from inspect import CO_VARARGS, CO_VARKEYWORDS
+
+import py
+
+builtin_repr = repr
+
+reprlib = py.builtin._tryimport('repr', 'reprlib')
+
+if sys.version_info[0] >= 3:
+    from traceback import format_exception_only
+else:
+    from ._py2traceback import format_exception_only
+
+class Code(object):
+    """ wrapper around Python code objects """
+    def __init__(self, rawcode):
+        if not hasattr(rawcode, "co_filename"):
+            rawcode = getrawcode(rawcode)
+        try:
+            self.filename = rawcode.co_filename
+            self.firstlineno = rawcode.co_firstlineno - 1
+            self.name = rawcode.co_name
+        except AttributeError:
+            raise TypeError("not a code object: %r" %(rawcode,))
+        self.raw = rawcode
+
+    def __eq__(self, other):
+        return self.raw == other.raw
+
+    def __ne__(self, other):
+        return not self == other
+
+    @property
+    def path(self):
+        """ return a path object pointing to source code (note that it
+        might not point to an actually existing file). """
+        p = py.path.local(self.raw.co_filename)
+        # maybe don't try this checking
+        if not p.check():
+            # XXX maybe try harder like the weird logic
+            # in the standard lib [linecache.updatecache] does?
+            p = self.raw.co_filename
+        return p
+
+    @property
+    def fullsource(self):
+        """ return a _pytest._code.Source object for the full source file of the code
+        """
+        from _pytest._code import source
+        full, _ = source.findsource(self.raw)
+        return full
+
+    def source(self):
+        """ return a _pytest._code.Source object for the code object's source only
+        """
+        # return source only for that part of code
+        import _pytest._code
+        return _pytest._code.Source(self.raw)
+
+    def getargs(self, var=False):
+        """ return a tuple with the argument names for the code object
+
+            if 'var' is set True also return the names of the variable and
+            keyword arguments when present
+        """
+        # handfull shortcut for getting args
+        raw = self.raw
+        argcount = raw.co_argcount
+        if var:
+            argcount += raw.co_flags & CO_VARARGS
+            argcount += raw.co_flags & CO_VARKEYWORDS
+        return raw.co_varnames[:argcount]
+
+class Frame(object):
+    """Wrapper around a Python frame holding f_locals and f_globals
+    in which expressions can be evaluated."""
+
+    def __init__(self, frame):
+        self.lineno = frame.f_lineno - 1
+        self.f_globals = frame.f_globals
+        self.f_locals = frame.f_locals
+        self.raw = frame
+        self.code = Code(frame.f_code)
+
+    @property
+    def statement(self):
+        """ statement this frame is at """
+        import _pytest._code
+        if self.code.fullsource is None:
+            return _pytest._code.Source("")
+        return self.code.fullsource.getstatement(self.lineno)
+
+    def eval(self, code, **vars):
+        """ evaluate 'code' in the frame
+
+            'vars' are optional additional local variables
+
+            returns the result of the evaluation
+        """
+        f_locals = self.f_locals.copy()
+        f_locals.update(vars)
+        return eval(code, self.f_globals, f_locals)
+
+    def exec_(self, code, **vars):
+        """ exec 'code' in the frame
+
+            'vars' are optiona; additional local variables
+        """
+        f_locals = self.f_locals.copy()
+        f_locals.update(vars)
+        py.builtin.exec_(code, self.f_globals, f_locals )
+
+    def repr(self, object):
+        """ return a 'safe' (non-recursive, one-line) string repr for 'object'
+        """
+        return py.io.saferepr(object)
+
+    def is_true(self, object):
+        return object
+
+    def getargs(self, var=False):
+        """ return a list of tuples (name, value) for all arguments
+
+            if 'var' is set True also include the variable and keyword
+            arguments when present
+        """
+        retval = []
+        for arg in self.code.getargs(var):
+            try:
+                retval.append((arg, self.f_locals[arg]))
+            except KeyError:
+                pass     # this can occur when using Psyco
+        return retval
+
+class TracebackEntry(object):
+    """ a single entry in a traceback """
+
+    _repr_style = None
+    exprinfo = None
+
+    def __init__(self, rawentry):
+        self._rawentry = rawentry
+        self.lineno = rawentry.tb_lineno - 1
+
+    def set_repr_style(self, mode):
+        assert mode in ("short", "long")
+        self._repr_style = mode
+
+    @property
+    def frame(self):
+        import _pytest._code
+        return _pytest._code.Frame(self._rawentry.tb_frame)
+
+    @property
+    def relline(self):
+        return self.lineno - self.frame.code.firstlineno
+
+    def __repr__(self):
+        return "<TracebackEntry %s:%d>" %(self.frame.code.path, self.lineno+1)
+
+    @property
+    def statement(self):
+        """ _pytest._code.Source object for the current statement """
+        source = self.frame.code.fullsource
+        return source.getstatement(self.lineno)
+
+    @property
+    def path(self):
+        """ path to the source code """
+        return self.frame.code.path
+
+    def getlocals(self):
+        return self.frame.f_locals
+    locals = property(getlocals, None, None, "locals of underlaying frame")
+
+    def reinterpret(self):
+        """Reinterpret the failing statement and returns a detailed information
+           about what operations are performed."""
+        from _pytest.assertion.reinterpret import reinterpret
+        if self.exprinfo is None:
+            source = py.builtin._totext(self.statement).strip()
+            x = reinterpret(source, self.frame, should_fail=True)
+            if not py.builtin._istext(x):
+                raise TypeError("interpret returned non-string %r" % (x,))
+            self.exprinfo = x
+        return self.exprinfo
+
+    def getfirstlinesource(self):
+        # on Jython this firstlineno can be -1 apparently
+        return max(self.frame.code.firstlineno, 0)
+
+    def getsource(self, astcache=None):
+        """ return failing source code. """
+        # we use the passed in astcache to not reparse asttrees
+        # within exception info printing
+        from _pytest._code.source import getstatementrange_ast
+        source = self.frame.code.fullsource
+        if source is None:
+            return None
+        key = astnode = None
+        if astcache is not None:
+            key = self.frame.code.path
+            if key is not None:
+                astnode = astcache.get(key, None)
+        start = self.getfirstlinesource()
+        try:
+            astnode, _, end = getstatementrange_ast(self.lineno, source,
+                                                    astnode=astnode)
+        except SyntaxError:
+            end = self.lineno + 1
+        else:
+            if key is not None:
+                astcache[key] = astnode
+        return source[start:end]
+
+    source = property(getsource)
+
+    def ishidden(self):
+        """ return True if the current frame has a var __tracebackhide__
+            resolving to True
+
+            mostly for internal use
+        """
+        try:
+            return self.frame.f_locals['__tracebackhide__']
+        except KeyError:
+            try:
+                return self.frame.f_globals['__tracebackhide__']
+            except KeyError:
+                return False
+
+    def __str__(self):
+        try:
+            fn = str(self.path)
+        except py.error.Error:
+            fn = '???'
+        name = self.frame.code.name
+        try:
+            line = str(self.statement).lstrip()
+        except KeyboardInterrupt:
+            raise
+        except:
+            line = "???"
+        return "  File %r:%d in %s\n  %s\n" %(fn, self.lineno+1, name, line)
+
+    def name(self):
+        return self.frame.code.raw.co_name
+    name = property(name, None, None, "co_name of underlaying code")
+
+class Traceback(list):
+    """ Traceback objects encapsulate and offer higher level
+        access to Traceback entries.
+    """
+    Entry = TracebackEntry
+    def __init__(self, tb):
+        """ initialize from given python traceback object. """
+        if hasattr(tb, 'tb_next'):
+            def f(cur):
+                while cur is not None:
+                    yield self.Entry(cur)
+                    cur = cur.tb_next
+            list.__init__(self, f(tb))
+        else:
+            list.__init__(self, tb)
+
+    def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None):
+        """ return a Traceback instance wrapping part of this Traceback
+
+            by provding any combination of path, lineno and firstlineno, the
+            first frame to start the to-be-returned traceback is determined
+
+            this allows cutting the first part of a Traceback instance e.g.
+            for formatting reasons (removing some uninteresting bits that deal
+            with handling of the exception/traceback)
+        """
+        for x in self:
+            code = x.frame.code
+            codepath = code.path
+            if ((path is None or codepath == path) and
+                (excludepath is None or not hasattr(codepath, 'relto') or
+                 not codepath.relto(excludepath)) and
+                (lineno is None or x.lineno == lineno) and
+                (firstlineno is None or x.frame.code.firstlineno == firstlineno)):
+                return Traceback(x._rawentry)
+        return self
+
+    def __getitem__(self, key):
+        val = super(Traceback, self).__getitem__(key)
+        if isinstance(key, type(slice(0))):
+            val = self.__class__(val)
+        return val
+
+    def filter(self, fn=lambda x: not x.ishidden()):
+        """ return a Traceback instance with certain items removed
+
+            fn is a function that gets a single argument, a TracebackEntry
+            instance, and should return True when the item should be added
+            to the Traceback, False when not
+
+            by default this removes all the TracebackEntries which are hidden
+            (see ishidden() above)
+        """
+        return Traceback(filter(fn, self))
+
+    def getcrashentry(self):
+        """ return last non-hidden traceback entry that lead
+        to the exception of a traceback.
+        """
+        for i in range(-1, -len(self)-1, -1):
+            entry = self[i]
+            if not entry.ishidden():
+                return entry
+        return self[-1]
+
+    def recursionindex(self):
+        """ return the index of the frame/TracebackEntry where recursion
+            originates if appropriate, None if no recursion occurred
+        """
+        cache = {}
+        for i, entry in enumerate(self):
+            # id for the code.raw is needed to work around
+            # the strange metaprogramming in the decorator lib from pypi
+            # which generates code objects that have hash/value equality
+            #XXX needs a test
+            key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno
+            #print "checking for recursion at", key
+            l = cache.setdefault(key, [])
+            if l:
+                f = entry.frame
+                loc = f.f_locals
+                for otherloc in l:
+                    if f.is_true(f.eval(co_equal,
+                        __recursioncache_locals_1=loc,
+                        __recursioncache_locals_2=otherloc)):
+                        return i
+            l.append(entry.frame.f_locals)
+        return None
+
+co_equal = compile('__recursioncache_locals_1 == __recursioncache_locals_2',
+                   '?', 'eval')
+
+class ExceptionInfo(object):
+    """ wraps sys.exc_info() objects and offers
+        help for navigating the traceback.
+    """
+    _striptext = ''
+    def __init__(self, tup=None, exprinfo=None):
+        import _pytest._code
+        if tup is None:
+            tup = sys.exc_info()
+            if exprinfo is None and isinstance(tup[1], AssertionError):
+                exprinfo = getattr(tup[1], 'msg', None)
+                if exprinfo is None:
+                    exprinfo = str(tup[1])
+                if exprinfo and exprinfo.startswith('assert '):
+                    self._striptext = 'AssertionError: '
+        self._excinfo = tup
+        #: the exception class
+        self.type = tup[0]
+        #: the exception instance
+        self.value = tup[1]
+        #: the exception raw traceback
+        self.tb = tup[2]
+        #: the exception type name
+        self.typename = self.type.__name__
+        #: the exception traceback (_pytest._code.Traceback instance)
+        self.traceback = _pytest._code.Traceback(self.tb)
+
+    def __repr__(self):
+        return "<ExceptionInfo %s tblen=%d>" % (self.typename, len(self.traceback))
+
+    def exconly(self, tryshort=False):
+        """ return the exception as a string
+
+            when 'tryshort' resolves to True, and the exception is a
+            _pytest._code._AssertionError, only the actual exception part of
+            the exception representation is returned (so 'AssertionError: ' is
+            removed from the beginning)
+        """
+        lines = format_exception_only(self.type, self.value)
+        text = ''.join(lines)
+        text = text.rstrip()
+        if tryshort:
+            if text.startswith(self._striptext):
+                text = text[len(self._striptext):]
+        return text
+
+    def errisinstance(self, exc):
+        """ return True if the exception is an instance of exc """
+        return isinstance(self.value, exc)
+
+    def _getreprcrash(self):
+        exconly = self.exconly(tryshort=True)
+        entry = self.traceback.getcrashentry()
+        path, lineno = entry.frame.code.raw.co_filename, entry.lineno
+        return ReprFileLocation(path, lineno+1, exconly)
+
+    def getrepr(self, showlocals=False, style="long",
+            abspath=False, tbfilter=True, funcargs=False):
+        """ return str()able representation of this exception info.
+            showlocals: show locals per traceback entry
+            style: long|short|no|native traceback style
+            tbfilter: hide entries (where __tracebackhide__ is true)
+
+            in case of style==native, tbfilter and showlocals is ignored.
+        """
+        if style == 'native':
+            return ReprExceptionInfo(ReprTracebackNative(
+                py.std.traceback.format_exception(
+                    self.type,
+                    self.value,
+                    self.traceback[0]._rawentry,
+                )), self._getreprcrash())
+
+        fmt = FormattedExcinfo(showlocals=showlocals, style=style,
+            abspath=abspath, tbfilter=tbfilter, funcargs=funcargs)
+        return fmt.repr_excinfo(self)
+
+    def __str__(self):
+        entry = self.traceback[-1]
+        loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly())
+        return str(loc)
+
+    def __unicode__(self):
+        entry = self.traceback[-1]
+        loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly())
+        return unicode(loc)
+
+
+class FormattedExcinfo(object):
+    """ presenting information about failing Functions and Generators. """
+    # for traceback entries
+    flow_marker = ">"
+    fail_marker = "E"
+
+    def __init__(self, showlocals=False, style="long", abspath=True, tbfilter=True, funcargs=False):
+        self.showlocals = showlocals
+        self.style = style
+        self.tbfilter = tbfilter
+        self.funcargs = funcargs
+        self.abspath = abspath
+        self.astcache = {}
+
+    def _getindent(self, source):
+        # figure out indent for given source
+        try:
+            s = str(source.getstatement(len(source)-1))
+        except KeyboardInterrupt:
+            raise
+        except:
+            try:
+                s = str(source[-1])
+            except KeyboardInterrupt:
+                raise
+            except:
+                return 0
+        return 4 + (len(s) - len(s.lstrip()))
+
+    def _getentrysource(self, entry):
+        source = entry.getsource(self.astcache)
+        if source is not None:
+            source = source.deindent()
+        return source
+
+    def _saferepr(self, obj):
+        return py.io.saferepr(obj)
+
+    def repr_args(self, entry):
+        if self.funcargs:
+            args = []
+            for argname, argvalue in entry.frame.getargs(var=True):
+                args.append((argname, self._saferepr(argvalue)))
+            return ReprFuncArgs(args)
+
+    def get_source(self, source, line_index=-1, excinfo=None, short=False):
+        """ return formatted and marked up source lines. """
+        import _pytest._code
+        lines = []
+        if source is None or line_index >= len(source.lines):
+            source = _pytest._code.Source("???")
+            line_index = 0
+        if line_index < 0:
+            line_index += len(source)
+        space_prefix = "    "
+        if short:
+            lines.append(space_prefix + source.lines[line_index].strip())
+        else:
+            for line in source.lines[:line_index]:
+                lines.append(space_prefix + line)
+            lines.append(self.flow_marker + "   " + source.lines[line_index])
+            for line in source.lines[line_index+1:]:
+                lines.append(space_prefix + line)
+        if excinfo is not None:
+            indent = 4 if short else self._getindent(source)
+            lines.extend(self.get_exconly(excinfo, indent=indent, markall=True))
+        return lines
+
+    def get_exconly(self, excinfo, indent=4, markall=False):
+        lines = []
+        indent = " " * indent
+        # get the real exception information out
+        exlines = excinfo.exconly(tryshort=True).split('\n')
+        failindent = self.fail_marker + indent[1:]
+        for line in exlines:
+            lines.append(failindent + line)
+            if not markall:
+                failindent = indent
+        return lines
+
+    def repr_locals(self, locals):
+        if self.showlocals:
+            lines = []
+            keys = [loc for loc in locals if loc[0] != "@"]
+            keys.sort()
+            for name in keys:
+                value = locals[name]
+                if name == '__builtins__':
+                    lines.append("__builtins__ = <builtins>")
+                else:
+                    # This formatting could all be handled by the
+                    # _repr() function, which is only reprlib.Repr in
+                    # disguise, so is very configurable.
+                    str_repr = self._saferepr(value)
+                    #if len(str_repr) < 70 or not isinstance(value,
+                    #                            (list, tuple, dict)):
+                    lines.append("%-10s = %s" %(name, str_repr))
+                    #else:
+                    #    self._line("%-10s =\\" % (name,))
+                    #    # XXX
+                    #    py.std.pprint.pprint(value, stream=self.excinfowriter)
+            return ReprLocals(lines)
+
+    def repr_traceback_entry(self, entry, excinfo=None):
+        import _pytest._code
+        source = self._getentrysource(entry)
+        if source is None:
+            source = _pytest._code.Source("???")
+            line_index = 0
+        else:
+            # entry.getfirstlinesource() can be -1, should be 0 on jython
+            line_index = entry.lineno - max(entry.getfirstlinesource(), 0)
+
+        lines = []
+        style = entry._repr_style
+        if style is None:
+            style = self.style
+        if style in ("short", "long"):
+            short = style == "short"
+            reprargs = self.repr_args(entry) if not short else None
+            s = self.get_source(source, line_index, excinfo, short=short)
+            lines.extend(s)
+            if short:
+                message = "in %s" %(entry.name)
+            else:
+                message = excinfo and excinfo.typename or ""
+            path = self._makepath(entry.path)
+            filelocrepr = ReprFileLocation(path, entry.lineno+1, message)
+            localsrepr = None
+            if not short:
+                localsrepr =  self.repr_locals(entry.locals)
+            return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style)
+        if excinfo:
+            lines.extend(self.get_exconly(excinfo, indent=4))
+        return ReprEntry(lines, None, None, None, style)
+
+    def _makepath(self, path):
+        if not self.abspath:
+            try:
+                np = py.path.local().bestrelpath(path)
+            except OSError:
+                return path
+            if len(np) < len(str(path)):
+                path = np
+        return path
+
+    def repr_traceback(self, excinfo):
+        traceback = excinfo.traceback
+        if self.tbfilter:
+            traceback = traceback.filter()
+        recursionindex = None
+        if is_recursion_error(excinfo):
+            recursionindex = traceback.recursionindex()
+        last = traceback[-1]
+        entries = []
+        extraline = None
+        for index, entry in enumerate(traceback):
+            einfo = (last == entry) and excinfo or None
+            reprentry = self.repr_traceback_entry(entry, einfo)
+            entries.append(reprentry)
+            if index == recursionindex:
+                extraline = "!!! Recursion detected (same locals & position)"
+                break
+        return ReprTraceback(entries, extraline, style=self.style)
+
+    def repr_excinfo(self, excinfo):
+        reprtraceback = self.repr_traceback(excinfo)
+        reprcrash = excinfo._getreprcrash()
+        return ReprExceptionInfo(reprtraceback, reprcrash)
+
+class TerminalRepr:
+    def __str__(self):
+        s = self.__unicode__()
+        if sys.version_info[0] < 3:
+            s = s.encode('utf-8')
+        return s
+
+    def __unicode__(self):
+        # FYI this is called from pytest-xdist's serialization of exception
+        # information.
+        io = py.io.TextIO()
+        tw = py.io.TerminalWriter(file=io)
+        self.toterminal(tw)
+        return io.getvalue().strip()
+
+    def __repr__(self):
+        return "<%s instance at %0x>" %(self.__class__, id(self))
+
+
+class ReprExceptionInfo(TerminalRepr):
+    def __init__(self, reprtraceback, reprcrash):
+        self.reprtraceback = reprtraceback
+        self.reprcrash = reprcrash
+        self.sections = []
+
+    def addsection(self, name, content, sep="-"):
+        self.sections.append((name, content, sep))
+
+    def toterminal(self, tw):
+        self.reprtraceback.toterminal(tw)
+        for name, content, sep in self.sections:
+            tw.sep(sep, name)
+            tw.line(content)
+
+class ReprTraceback(TerminalRepr):
+    entrysep = "_ "
+
+    def __init__(self, reprentries, extraline, style):
+        self.reprentries = reprentries
+        self.extraline = extraline
+        self.style = style
+
+    def toterminal(self, tw):
+        # the entries might have different styles
+        for i, entry in enumerate(self.reprentries):
+            if entry.style == "long":
+                tw.line("")
+            entry.toterminal(tw)
+            if i < len(self.reprentries) - 1:
+                next_entry = self.reprentries[i+1]
+                if entry.style == "long" or \
+                   entry.style == "short" and next_entry.style == "long":
+                    tw.sep(self.entrysep)
+
+        if self.extraline:
+            tw.line(self.extraline)
+
+class ReprTracebackNative(ReprTraceback):
+    def __init__(self, tblines):
+        self.style = "native"
+        self.reprentries = [ReprEntryNative(tblines)]
+        self.extraline = None
+
+class ReprEntryNative(TerminalRepr):
+    style = "native"
+
+    def __init__(self, tblines):
+        self.lines = tblines
+
+    def toterminal(self, tw):
+        tw.write("".join(self.lines))
+
+class ReprEntry(TerminalRepr):
+    localssep = "_ "
+
+    def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style):
+        self.lines = lines
+        self.reprfuncargs = reprfuncargs
+        self.reprlocals = reprlocals
+        self.reprfileloc = filelocrepr
+        self.style = style
+
+    def toterminal(self, tw):
+        if self.style == "short":
+            self.reprfileloc.toterminal(tw)
+            for line in self.lines:
+                red = line.startswith("E   ")
+                tw.line(line, bold=True, red=red)
+            #tw.line("")
+            return
+        if self.reprfuncargs:
+            self.reprfuncargs.toterminal(tw)
+        for line in self.lines:
+            red = line.startswith("E   ")
+            tw.line(line, bold=True, red=red)
+        if self.reprlocals:
+            #tw.sep(self.localssep, "Locals")
+            tw.line("")
+            self.reprlocals.toterminal(tw)
+        if self.reprfileloc:
+            if self.lines:
+                tw.line("")
+            self.reprfileloc.toterminal(tw)
+
+    def __str__(self):
+        return "%s\n%s\n%s" % ("\n".join(self.lines),
+                               self.reprlocals,
+                               self.reprfileloc)
+
+class ReprFileLocation(TerminalRepr):
+    def __init__(self, path, lineno, message):
+        self.path = str(path)
+        self.lineno = lineno
+        self.message = message
+
+    def toterminal(self, tw):
+        # filename and lineno output for each entry,
+        # using an output format that most editors unterstand
+        msg = self.message
+        i = msg.find("\n")
+        if i != -1:
+            msg = msg[:i]
+        tw.line("%s:%s: %s" %(self.path, self.lineno, msg))
+
+class ReprLocals(TerminalRepr):
+    def __init__(self, lines):
+        self.lines = lines
+
+    def toterminal(self, tw):
+        for line in self.lines:
+            tw.line(line)
+
+class ReprFuncArgs(TerminalRepr):
+    def __init__(self, args):
+        self.args = args
+
+    def toterminal(self, tw):
+        if self.args:
+            linesofar = ""
+            for name, value in self.args:
+                ns = "%s = %s" %(name, value)
+                if len(ns) + len(linesofar) + 2 > tw.fullwidth:
+                    if linesofar:
+                        tw.line(linesofar)
+                    linesofar =  ns
+                else:
+                    if linesofar:
+                        linesofar += ", " + ns
+                    else:
+                        linesofar = ns
+            if linesofar:
+                tw.line(linesofar)
+            tw.line("")
+
+
+
+oldbuiltins = {}
+
+def patch_builtins(assertion=True, compile=True):
+    """ put compile and AssertionError builtins to Python's builtins. """
+    if assertion:
+        from _pytest.assertion import reinterpret
+        l = oldbuiltins.setdefault('AssertionError', [])
+        l.append(py.builtin.builtins.AssertionError)
+        py.builtin.builtins.AssertionError = reinterpret.AssertionError
+    if compile:
+        import _pytest._code
+        l = oldbuiltins.setdefault('compile', [])
+        l.append(py.builtin.builtins.compile)
+        py.builtin.builtins.compile = _pytest._code.compile
+
+def unpatch_builtins(assertion=True, compile=True):
+    """ remove compile and AssertionError builtins from Python builtins. """
+    if assertion:
+        py.builtin.builtins.AssertionError = oldbuiltins['AssertionError'].pop()
+    if compile:
+        py.builtin.builtins.compile = oldbuiltins['compile'].pop()
+
+def getrawcode(obj, trycall=True):
+    """ return code object for given function. """
+    try:
+        return obj.__code__
+    except AttributeError:
+        obj = getattr(obj, 'im_func', obj)
+        obj = getattr(obj, 'func_code', obj)
+        obj = getattr(obj, 'f_code', obj)
+        obj = getattr(obj, '__code__', obj)
+        if trycall and not hasattr(obj, 'co_firstlineno'):
+            if hasattr(obj, '__call__') and not py.std.inspect.isclass(obj):
+                x = getrawcode(obj.__call__, trycall=False)
+                if hasattr(x, 'co_firstlineno'):
+                    return x
+        return obj
+
+if sys.version_info[:2] >= (3, 5):  # RecursionError introduced in 3.5
+    def is_recursion_error(excinfo):
+        return excinfo.errisinstance(RecursionError)  # noqa
+else:
+    def is_recursion_error(excinfo):
+        if not excinfo.errisinstance(RuntimeError):
+            return False
+        try:
+            return "maximum recursion depth exceeded" in str(excinfo.value)
+        except UnicodeError:
+            return False
diff --git a/python/pytest/_pytest/_code/source.py b/python/pytest/_pytest/_code/source.py
new file mode 100644
index 000000000..a1521f8a2
--- /dev/null
+++ b/python/pytest/_pytest/_code/source.py
@@ -0,0 +1,421 @@
+from __future__ import generators
+
+from bisect import bisect_right
+import sys
+import inspect, tokenize
+import py
+from types import ModuleType
+cpy_compile = compile
+
+try:
+    import _ast
+    from _ast import PyCF_ONLY_AST as _AST_FLAG
+except ImportError:
+    _AST_FLAG = 0
+    _ast = None
+
+
+class Source(object):
+    """ a immutable object holding a source code fragment,
+        possibly deindenting it.
+    """
+    _compilecounter = 0
+    def __init__(self, *parts, **kwargs):
+        self.lines = lines = []
+        de = kwargs.get('deindent', True)
+        rstrip = kwargs.get('rstrip', True)
+        for part in parts:
+            if not part:
+                partlines = []
+            if isinstance(part, Source):
+                partlines = part.lines
+            elif isinstance(part, (tuple, list)):
+                partlines = [x.rstrip("\n") for x in part]
+            elif isinstance(part, py.builtin._basestring):
+                partlines = part.split('\n')
+                if rstrip:
+                    while partlines:
+                        if partlines[-1].strip():
+                            break
+                        partlines.pop()
+            else:
+                partlines = getsource(part, deindent=de).lines
+            if de:
+                partlines = deindent(partlines)
+            lines.extend(partlines)
+
+    def __eq__(self, other):
+        try:
+            return self.lines == other.lines
+        except AttributeError:
+            if isinstance(other, str):
+                return str(self) == other
+            return False
+
+    def __getitem__(self, key):
+        if isinstance(key, int):
+            return self.lines[key]
+        else:
+            if key.step not in (None, 1):
+                raise IndexError("cannot slice a Source with a step")
+            return self.__getslice__(key.start, key.stop)
+
+    def __len__(self):
+        return len(self.lines)
+
+    def __getslice__(self, start, end):
+        newsource = Source()
+        newsource.lines = self.lines[start:end]
+        return newsource
+
+    def strip(self):
+        """ return new source object with trailing
+            and leading blank lines removed.
+        """
+        start, end = 0, len(self)
+        while start < end and not self.lines[start].strip():
+            start += 1
+        while end > start and not self.lines[end-1].strip():
+            end -= 1
+        source = Source()
+        source.lines[:] = self.lines[start:end]
+        return source
+
+    def putaround(self, before='', after='', indent=' ' * 4):
+        """ return a copy of the source object with
+            'before' and 'after' wrapped around it.
+        """
+        before = Source(before)
+        after = Source(after)
+        newsource = Source()
+        lines = [ (indent + line) for line in self.lines]
+        newsource.lines = before.lines + lines +  after.lines
+        return newsource
+
+    def indent(self, indent=' ' * 4):
+        """ return a copy of the source object with
+            all lines indented by the given indent-string.
+        """
+        newsource = Source()
+        newsource.lines = [(indent+line) for line in self.lines]
+        return newsource
+
+    def getstatement(self, lineno, assertion=False):
+        """ return Source statement which contains the
+            given linenumber (counted from 0).
+        """
+        start, end = self.getstatementrange(lineno, assertion)
+        return self[start:end]
+
+    def getstatementrange(self, lineno, assertion=False):
+        """ return (start, end) tuple which spans the minimal
+            statement region which containing the given lineno.
+        """
+        if not (0 <= lineno < len(self)):
+            raise IndexError("lineno out of range")
+        ast, start, end = getstatementrange_ast(lineno, self)
+        return start, end
+
+    def deindent(self, offset=None):
+        """ return a new source object deindented by offset.
+            If offset is None then guess an indentation offset from
+            the first non-blank line.  Subsequent lines which have a
+            lower indentation offset will be copied verbatim as
+            they are assumed to be part of multilines.
+        """
+        # XXX maybe use the tokenizer to properly handle multiline
+        #     strings etc.pp?
+        newsource = Source()
+        newsource.lines[:] = deindent(self.lines, offset)
+        return newsource
+
+    def isparseable(self, deindent=True):
+        """ return True if source is parseable, heuristically
+            deindenting it by default.
+        """
+        try:
+            import parser
+        except ImportError:
+            syntax_checker = lambda x: compile(x, 'asd', 'exec')
+        else:
+            syntax_checker = parser.suite
+
+        if deindent:
+            source = str(self.deindent())
+        else:
+            source = str(self)
+        try:
+            #compile(source+'\n', "x", "exec")
+            syntax_checker(source+'\n')
+        except KeyboardInterrupt:
+            raise
+        except Exception:
+            return False
+        else:
+            return True
+
+    def __str__(self):
+        return "\n".join(self.lines)
+
+    def compile(self, filename=None, mode='exec',
+                flag=generators.compiler_flag,
+                dont_inherit=0, _genframe=None):
+        """ return compiled code object. if filename is None
+            invent an artificial filename which displays
+            the source/line position of the caller frame.
+        """
+        if not filename or py.path.local(filename).check(file=0):
+            if _genframe is None:
+                _genframe = sys._getframe(1) # the caller
+            fn,lineno = _genframe.f_code.co_filename, _genframe.f_lineno
+            base = "<%d-codegen " % self._compilecounter
+            self.__class__._compilecounter += 1
+            if not filename:
+                filename = base + '%s:%d>' % (fn, lineno)
+            else:
+                filename = base + '%r %s:%d>' % (filename, fn, lineno)
+        source = "\n".join(self.lines) + '\n'
+        try:
+            co = cpy_compile(source, filename, mode, flag)
+        except SyntaxError:
+            ex = sys.exc_info()[1]
+            # re-represent syntax errors from parsing python strings
+            msglines = self.lines[:ex.lineno]
+            if ex.offset:
+                msglines.append(" "*ex.offset + '^')
+            msglines.append("(code was compiled probably from here: %s)" % filename)
+            newex = SyntaxError('\n'.join(msglines))
+            newex.offset = ex.offset
+            newex.lineno = ex.lineno
+            newex.text = ex.text
+            raise newex
+        else:
+            if flag & _AST_FLAG:
+                return co
+            lines = [(x + "\n") for x in self.lines]
+            if sys.version_info[0] >= 3:
+                # XXX py3's inspect.getsourcefile() checks for a module
+                # and a pep302 __loader__ ... we don't have a module
+                # at code compile-time so we need to fake it here
+                m = ModuleType("_pycodecompile_pseudo_module")
+                py.std.inspect.modulesbyfile[filename] = None
+                py.std.sys.modules[None] = m
+                m.__loader__ = 1
+            py.std.linecache.cache[filename] = (1, None, lines, filename)
+            return co
+
+#
+# public API shortcut functions
+#
+
+def compile_(source, filename=None, mode='exec', flags=
+            generators.compiler_flag, dont_inherit=0):
+    """ compile the given source to a raw code object,
+        and maintain an internal cache which allows later
+        retrieval of the source code for the code object
+        and any recursively created code objects.
+    """
+    if _ast is not None and isinstance(source, _ast.AST):
+        # XXX should Source support having AST?
+        return cpy_compile(source, filename, mode, flags, dont_inherit)
+    _genframe = sys._getframe(1) # the caller
+    s = Source(source)
+    co = s.compile(filename, mode, flags, _genframe=_genframe)
+    return co
+
+
+def getfslineno(obj):
+    """ Return source location (path, lineno) for the given object.
+    If the source cannot be determined return ("", -1)
+    """
+    import _pytest._code
+    try:
+        code = _pytest._code.Code(obj)
+    except TypeError:
+        try:
+            fn = (py.std.inspect.getsourcefile(obj) or
+                  py.std.inspect.getfile(obj))
+        except TypeError:
+            return "", -1
+
+        fspath = fn and py.path.local(fn) or None
+        lineno = -1
+        if fspath:
+            try:
+                _, lineno = findsource(obj)
+            except IOError:
+                pass
+    else:
+        fspath = code.path
+        lineno = code.firstlineno
+    assert isinstance(lineno, int)
+    return fspath, lineno
+
+#
+# helper functions
+#
+
+def findsource(obj):
+    try:
+        sourcelines, lineno = py.std.inspect.findsource(obj)
+    except py.builtin._sysex:
+        raise
+    except:
+        return None, -1
+    source = Source()
+    source.lines = [line.rstrip() for line in sourcelines]
+    return source, lineno
+
+def getsource(obj, **kwargs):
+    import _pytest._code
+    obj = _pytest._code.getrawcode(obj)
+    try:
+        strsrc = inspect.getsource(obj)
+    except IndentationError:
+        strsrc = "\"Buggy python version consider upgrading, cannot get source\""
+    assert isinstance(strsrc, str)
+    return Source(strsrc, **kwargs)
+
+def deindent(lines, offset=None):
+    if offset is None:
+        for line in lines:
+            line = line.expandtabs()
+            s = line.lstrip()
+            if s:
+                offset = len(line)-len(s)
+                break
+        else:
+            offset = 0
+    if offset == 0:
+        return list(lines)
+    newlines = []
+    def readline_generator(lines):
+        for line in lines:
+            yield line + '\n'
+        while True:
+            yield ''
+
+    it = readline_generator(lines)
+
+    try:
+        for _, _, (sline, _), (eline, _), _ in tokenize.generate_tokens(lambda: next(it)):
+            if sline > len(lines):
+                break # End of input reached
+            if sline > len(newlines):
+                line = lines[sline - 1].expandtabs()
+                if line.lstrip() and line[:offset].isspace():
+                    line = line[offset:] # Deindent
+                newlines.append(line)
+
+            for i in range(sline, eline):
+                # Don't deindent continuing lines of
+                # multiline tokens (i.e. multiline strings)
+                newlines.append(lines[i])
+    except (IndentationError, tokenize.TokenError):
+        pass
+    # Add any lines we didn't see. E.g. if an exception was raised.
+    newlines.extend(lines[len(newlines):])
+    return newlines
+
+
+def get_statement_startend2(lineno, node):
+    import ast
+    # flatten all statements and except handlers into one lineno-list
+    # AST's line numbers start indexing at 1
+    l = []
+    for x in ast.walk(node):
+        if isinstance(x, _ast.stmt) or isinstance(x, _ast.ExceptHandler):
+            l.append(x.lineno - 1)
+            for name in "finalbody", "orelse":
+                val = getattr(x, name, None)
+                if val:
+                    # treat the finally/orelse part as its own statement
+                    l.append(val[0].lineno - 1 - 1)
+    l.sort()
+    insert_index = bisect_right(l, lineno)
+    start = l[insert_index - 1]
+    if insert_index >= len(l):
+        end = None
+    else:
+        end = l[insert_index]
+    return start, end
+
+
+def getstatementrange_ast(lineno, source, assertion=False, astnode=None):
+    if astnode is None:
+        content = str(source)
+        if sys.version_info < (2,7):
+            content += "\n"
+        try:
+            astnode = compile(content, "source", "exec", 1024)  # 1024 for AST
+        except ValueError:
+            start, end = getstatementrange_old(lineno, source, assertion)
+            return None, start, end
+    start, end = get_statement_startend2(lineno, astnode)
+    # we need to correct the end:
+    # - ast-parsing strips comments
+    # - there might be empty lines
+    # - we might have lesser indented code blocks at the end
+    if end is None:
+        end = len(source.lines)
+
+    if end > start + 1:
+        # make sure we don't span differently indented code blocks
+        # by using the BlockFinder helper used which inspect.getsource() uses itself
+        block_finder = inspect.BlockFinder()
+        # if we start with an indented line, put blockfinder to "started" mode
+        block_finder.started = source.lines[start][0].isspace()
+        it = ((x + "\n") for x in source.lines[start:end])
+        try:
+            for tok in tokenize.generate_tokens(lambda: next(it)):
+                block_finder.tokeneater(*tok)
+        except (inspect.EndOfBlock, IndentationError):
+            end = block_finder.last + start
+        except Exception:
+            pass
+
+    # the end might still point to a comment or empty line, correct it
+    while end:
+        line = source.lines[end - 1].lstrip()
+        if line.startswith("#") or not line:
+            end -= 1
+        else:
+            break
+    return astnode, start, end
+
+
+def getstatementrange_old(lineno, source, assertion=False):
+    """ return (start, end) tuple which spans the minimal
+        statement region which containing the given lineno.
+        raise an IndexError if no such statementrange can be found.
+    """
+    # XXX this logic is only used on python2.4 and below
+    # 1. find the start of the statement
+    from codeop import compile_command
+    for start in range(lineno, -1, -1):
+        if assertion:
+            line = source.lines[start]
+            # the following lines are not fully tested, change with care
+            if 'super' in line and 'self' in line and '__init__' in line:
+                raise IndexError("likely a subclass")
+            if "assert" not in line and "raise" not in line:
+                continue
+        trylines = source.lines[start:lineno+1]
+        # quick hack to prepare parsing an indented line with
+        # compile_command() (which errors on "return" outside defs)
+        trylines.insert(0, 'def xxx():')
+        trysource = '\n '.join(trylines)
+        #              ^ space here
+        try:
+            compile_command(trysource)
+        except (SyntaxError, OverflowError, ValueError):
+            continue
+
+        # 2. find the end of the statement
+        for end in range(lineno+1, len(source)+1):
+            trysource = source[start:end]
+            if trysource.isparseable():
+                return start, end
+    raise SyntaxError("no valid source range around line %d " % (lineno,))
+
+
diff --git a/python/pytest/_pytest/_pluggy.py b/python/pytest/_pytest/_pluggy.py
new file mode 100644
index 000000000..87d32cf8d
--- /dev/null
+++ b/python/pytest/_pytest/_pluggy.py
@@ -0,0 +1,11 @@
+"""
+imports symbols from vendored "pluggy" if available, otherwise
+falls back to importing "pluggy" from the default namespace.
+"""
+
+try:
+    from _pytest.vendored_packages.pluggy import *  # noqa
+    from _pytest.vendored_packages.pluggy import __version__  # noqa
+except ImportError:
+    from pluggy import *  # noqa
+    from pluggy import __version__  # noqa
diff --git a/python/pytest/_pytest/assertion/__init__.py b/python/pytest/_pytest/assertion/__init__.py
new file mode 100644
index 000000000..6921deb2a
--- /dev/null
+++ b/python/pytest/_pytest/assertion/__init__.py
@@ -0,0 +1,176 @@
+"""
+support for presenting detailed information in failing assertions.
+"""
+import py
+import os
+import sys
+from _pytest.monkeypatch import monkeypatch
+from _pytest.assertion import util
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("debugconfig")
+    group.addoption('--assert',
+                    action="store",
+                    dest="assertmode",
+                    choices=("rewrite", "reinterp", "plain",),
+                    default="rewrite",
+                    metavar="MODE",
+                    help="""control assertion debugging tools.  'plain'
+                            performs no assertion debugging.  'reinterp'
+                            reinterprets assert statements after they failed
+                            to provide assertion expression information.
+                            'rewrite' (the default) rewrites assert
+                            statements in test modules on import to
+                            provide assert expression information. """)
+    group.addoption('--no-assert',
+                    action="store_true",
+                    default=False,
+                    dest="noassert",
+                    help="DEPRECATED equivalent to --assert=plain")
+    group.addoption('--nomagic', '--no-magic',
+                    action="store_true",
+                    default=False,
+                    help="DEPRECATED equivalent to --assert=plain")
+
+
+class AssertionState:
+    """State for the assertion plugin."""
+
+    def __init__(self, config, mode):
+        self.mode = mode
+        self.trace = config.trace.root.get("assertion")
+
+
+def pytest_configure(config):
+    mode = config.getvalue("assertmode")
+    if config.getvalue("noassert") or config.getvalue("nomagic"):
+        mode = "plain"
+    if mode == "rewrite":
+        try:
+            import ast  # noqa
+        except ImportError:
+            mode = "reinterp"
+        else:
+            # Both Jython and CPython 2.6.0 have AST bugs that make the
+            # assertion rewriting hook malfunction.
+            if (sys.platform.startswith('java') or
+                    sys.version_info[:3] == (2, 6, 0)):
+                mode = "reinterp"
+    if mode != "plain":
+        _load_modules(mode)
+        m = monkeypatch()
+        config._cleanup.append(m.undo)
+        m.setattr(py.builtin.builtins, 'AssertionError',
+                  reinterpret.AssertionError)  # noqa
+    hook = None
+    if mode == "rewrite":
+        hook = rewrite.AssertionRewritingHook()  # noqa
+        sys.meta_path.insert(0, hook)
+    warn_about_missing_assertion(mode)
+    config._assertstate = AssertionState(config, mode)
+    config._assertstate.hook = hook
+    config._assertstate.trace("configured with mode set to %r" % (mode,))
+    def undo():
+        hook = config._assertstate.hook
+        if hook is not None and hook in sys.meta_path:
+            sys.meta_path.remove(hook)
+    config.add_cleanup(undo)
+
+
+def pytest_collection(session):
+    # this hook is only called when test modules are collected
+    # so for example not in the master process of pytest-xdist
+    # (which does not collect test modules)
+    hook = session.config._assertstate.hook
+    if hook is not None:
+        hook.set_session(session)
+
+
+def _running_on_ci():
+    """Check if we're currently running on a CI system."""
+    env_vars = ['CI', 'BUILD_NUMBER']
+    return any(var in os.environ for var in env_vars)
+
+
+def pytest_runtest_setup(item):
+    """Setup the pytest_assertrepr_compare hook
+
+    The newinterpret and rewrite modules will use util._reprcompare if
+    it exists to use custom reporting via the
+    pytest_assertrepr_compare hook.  This sets up this custom
+    comparison for the test.
+    """
+    def callbinrepr(op, left, right):
+        """Call the pytest_assertrepr_compare hook and prepare the result
+
+        This uses the first result from the hook and then ensures the
+        following:
+        * Overly verbose explanations are dropped unless -vv was used or
+          running on a CI.
+        * Embedded newlines are escaped to help util.format_explanation()
+          later.
+        * If the rewrite mode is used embedded %-characters are replaced
+          to protect later % formatting.
+
+        The result can be formatted by util.format_explanation() for
+        pretty printing.
+        """
+        hook_result = item.ihook.pytest_assertrepr_compare(
+            config=item.config, op=op, left=left, right=right)
+        for new_expl in hook_result:
+            if new_expl:
+                if (sum(len(p) for p in new_expl[1:]) > 80*8 and
+                        item.config.option.verbose < 2 and
+                        not _running_on_ci()):
+                    show_max = 10
+                    truncated_lines = len(new_expl) - show_max
+                    new_expl[show_max:] = [py.builtin._totext(
+                        'Detailed information truncated (%d more lines)'
+                        ', use "-vv" to show' % truncated_lines)]
+                new_expl = [line.replace("\n", "\\n") for line in new_expl]
+                res = py.builtin._totext("\n~").join(new_expl)
+                if item.config.getvalue("assertmode") == "rewrite":
+                    res = res.replace("%", "%%")
+                return res
+    util._reprcompare = callbinrepr
+
+
+def pytest_runtest_teardown(item):
+    util._reprcompare = None
+
+
+def pytest_sessionfinish(session):
+    hook = session.config._assertstate.hook
+    if hook is not None:
+        hook.session = None
+
+
+def _load_modules(mode):
+    """Lazily import assertion related code."""
+    global rewrite, reinterpret
+    from _pytest.assertion import reinterpret  # noqa
+    if mode == "rewrite":
+        from _pytest.assertion import rewrite  # noqa
+
+
+def warn_about_missing_assertion(mode):
+    try:
+        assert False
+    except AssertionError:
+        pass
+    else:
+        if mode == "rewrite":
+            specifically = ("assertions which are not in test modules "
+                            "will be ignored")
+        else:
+            specifically = "failing tests may report as passing"
+
+        sys.stderr.write("WARNING: " + specifically +
+                         " because assert statements are not executed "
+                         "by the underlying Python interpreter "
+                         "(are you using python -O?)\n")
+
+
+# Expose this plugin's implementation for the pytest_assertrepr_compare hook
+pytest_assertrepr_compare = util.assertrepr_compare
diff --git a/python/pytest/_pytest/assertion/reinterpret.py b/python/pytest/_pytest/assertion/reinterpret.py
new file mode 100644
index 000000000..f4262c3ac
--- /dev/null
+++ b/python/pytest/_pytest/assertion/reinterpret.py
@@ -0,0 +1,407 @@
+"""
+Find intermediate evalutation results in assert statements through builtin AST.
+"""
+import ast
+import sys
+
+import _pytest._code
+import py
+from _pytest.assertion import util
+u = py.builtin._totext
+
+
+class AssertionError(util.BuiltinAssertionError):
+    def __init__(self, *args):
+        util.BuiltinAssertionError.__init__(self, *args)
+        if args:
+            # on Python2.6 we get len(args)==2 for: assert 0, (x,y)
+            # on Python2.7 and above we always get len(args) == 1
+            # with args[0] being the (x,y) tuple.
+            if len(args) > 1:
+                toprint = args
+            else:
+                toprint = args[0]
+            try:
+                self.msg = u(toprint)
+            except Exception:
+                self.msg = u(
+                    "<[broken __repr__] %s at %0xd>"
+                    % (toprint.__class__, id(toprint)))
+        else:
+            f = _pytest._code.Frame(sys._getframe(1))
+            try:
+                source = f.code.fullsource
+                if source is not None:
+                    try:
+                        source = source.getstatement(f.lineno, assertion=True)
+                    except IndexError:
+                        source = None
+                    else:
+                        source = str(source.deindent()).strip()
+            except py.error.ENOENT:
+                source = None
+                # this can also occur during reinterpretation, when the
+                # co_filename is set to "<run>".
+            if source:
+                self.msg = reinterpret(source, f, should_fail=True)
+            else:
+                self.msg = "<could not determine information>"
+            if not self.args:
+                self.args = (self.msg,)
+
+if sys.version_info > (3, 0):
+    AssertionError.__module__ = "builtins"
+
+if sys.platform.startswith("java"):
+    # See http://bugs.jython.org/issue1497
+    _exprs = ("BoolOp", "BinOp", "UnaryOp", "Lambda", "IfExp", "Dict",
+              "ListComp", "GeneratorExp", "Yield", "Compare", "Call",
+              "Repr", "Num", "Str", "Attribute", "Subscript", "Name",
+              "List", "Tuple")
+    _stmts = ("FunctionDef", "ClassDef", "Return", "Delete", "Assign",
+              "AugAssign", "Print", "For", "While", "If", "With", "Raise",
+              "TryExcept", "TryFinally", "Assert", "Import", "ImportFrom",
+              "Exec", "Global", "Expr", "Pass", "Break", "Continue")
+    _expr_nodes = set(getattr(ast, name) for name in _exprs)
+    _stmt_nodes = set(getattr(ast, name) for name in _stmts)
+    def _is_ast_expr(node):
+        return node.__class__ in _expr_nodes
+    def _is_ast_stmt(node):
+        return node.__class__ in _stmt_nodes
+else:
+    def _is_ast_expr(node):
+        return isinstance(node, ast.expr)
+    def _is_ast_stmt(node):
+        return isinstance(node, ast.stmt)
+
+try:
+    _Starred = ast.Starred
+except AttributeError:
+    # Python 2. Define a dummy class so isinstance() will always be False.
+    class _Starred(object): pass
+
+
+class Failure(Exception):
+    """Error found while interpreting AST."""
+
+    def __init__(self, explanation=""):
+        self.cause = sys.exc_info()
+        self.explanation = explanation
+
+
+def reinterpret(source, frame, should_fail=False):
+    mod = ast.parse(source)
+    visitor = DebugInterpreter(frame)
+    try:
+        visitor.visit(mod)
+    except Failure:
+        failure = sys.exc_info()[1]
+        return getfailure(failure)
+    if should_fail:
+        return ("(assertion failed, but when it was re-run for "
+                "printing intermediate values, it did not fail.  Suggestions: "
+                "compute assert expression before the assert or use --assert=plain)")
+
+def run(offending_line, frame=None):
+    if frame is None:
+        frame = _pytest._code.Frame(sys._getframe(1))
+    return reinterpret(offending_line, frame)
+
+def getfailure(e):
+    explanation = util.format_explanation(e.explanation)
+    value = e.cause[1]
+    if str(value):
+        lines = explanation.split('\n')
+        lines[0] += "  << %s" % (value,)
+        explanation = '\n'.join(lines)
+    text = "%s: %s" % (e.cause[0].__name__, explanation)
+    if text.startswith('AssertionError: assert '):
+        text = text[16:]
+    return text
+
+operator_map = {
+    ast.BitOr : "|",
+    ast.BitXor : "^",
+    ast.BitAnd : "&",
+    ast.LShift : "<<",
+    ast.RShift : ">>",
+    ast.Add : "+",
+    ast.Sub : "-",
+    ast.Mult : "*",
+    ast.Div : "/",
+    ast.FloorDiv : "//",
+    ast.Mod : "%",
+    ast.Eq : "==",
+    ast.NotEq : "!=",
+    ast.Lt : "<",
+    ast.LtE : "<=",
+    ast.Gt : ">",
+    ast.GtE : ">=",
+    ast.Pow : "**",
+    ast.Is : "is",
+    ast.IsNot : "is not",
+    ast.In : "in",
+    ast.NotIn : "not in"
+}
+
+unary_map = {
+    ast.Not : "not %s",
+    ast.Invert : "~%s",
+    ast.USub : "-%s",
+    ast.UAdd : "+%s"
+}
+
+
+class DebugInterpreter(ast.NodeVisitor):
+    """Interpret AST nodes to gleam useful debugging information. """
+
+    def __init__(self, frame):
+        self.frame = frame
+
+    def generic_visit(self, node):
+        # Fallback when we don't have a special implementation.
+        if _is_ast_expr(node):
+            mod = ast.Expression(node)
+            co = self._compile(mod)
+            try:
+                result = self.frame.eval(co)
+            except Exception:
+                raise Failure()
+            explanation = self.frame.repr(result)
+            return explanation, result
+        elif _is_ast_stmt(node):
+            mod = ast.Module([node])
+            co = self._compile(mod, "exec")
+            try:
+                self.frame.exec_(co)
+            except Exception:
+                raise Failure()
+            return None, None
+        else:
+            raise AssertionError("can't handle %s" %(node,))
+
+    def _compile(self, source, mode="eval"):
+        return compile(source, "<assertion interpretation>", mode)
+
+    def visit_Expr(self, expr):
+        return self.visit(expr.value)
+
+    def visit_Module(self, mod):
+        for stmt in mod.body:
+            self.visit(stmt)
+
+    def visit_Name(self, name):
+        explanation, result = self.generic_visit(name)
+        # See if the name is local.
+        source = "%r in locals() is not globals()" % (name.id,)
+        co = self._compile(source)
+        try:
+            local = self.frame.eval(co)
+        except Exception:
+            # have to assume it isn't
+            local = None
+        if local is None or not self.frame.is_true(local):
+            return name.id, result
+        return explanation, result
+
+    def visit_Compare(self, comp):
+        left = comp.left
+        left_explanation, left_result = self.visit(left)
+        for op, next_op in zip(comp.ops, comp.comparators):
+            next_explanation, next_result = self.visit(next_op)
+            op_symbol = operator_map[op.__class__]
+            explanation = "%s %s %s" % (left_explanation, op_symbol,
+                                        next_explanation)
+            source = "__exprinfo_left %s __exprinfo_right" % (op_symbol,)
+            co = self._compile(source)
+            try:
+                result = self.frame.eval(co, __exprinfo_left=left_result,
+                                         __exprinfo_right=next_result)
+            except Exception:
+                raise Failure(explanation)
+            try:
+                if not self.frame.is_true(result):
+                    break
+            except KeyboardInterrupt:
+                raise
+            except:
+                break
+            left_explanation, left_result = next_explanation, next_result
+
+        if util._reprcompare is not None:
+            res = util._reprcompare(op_symbol, left_result, next_result)
+            if res:
+                explanation = res
+        return explanation, result
+
+    def visit_BoolOp(self, boolop):
+        is_or = isinstance(boolop.op, ast.Or)
+        explanations = []
+        for operand in boolop.values:
+            explanation, result = self.visit(operand)
+            explanations.append(explanation)
+            if result == is_or:
+                break
+        name = is_or and " or " or " and "
+        explanation = "(" + name.join(explanations) + ")"
+        return explanation, result
+
+    def visit_UnaryOp(self, unary):
+        pattern = unary_map[unary.op.__class__]
+        operand_explanation, operand_result = self.visit(unary.operand)
+        explanation = pattern % (operand_explanation,)
+        co = self._compile(pattern % ("__exprinfo_expr",))
+        try:
+            result = self.frame.eval(co, __exprinfo_expr=operand_result)
+        except Exception:
+            raise Failure(explanation)
+        return explanation, result
+
+    def visit_BinOp(self, binop):
+        left_explanation, left_result = self.visit(binop.left)
+        right_explanation, right_result = self.visit(binop.right)
+        symbol = operator_map[binop.op.__class__]
+        explanation = "(%s %s %s)" % (left_explanation, symbol,
+                                      right_explanation)
+        source = "__exprinfo_left %s __exprinfo_right" % (symbol,)
+        co = self._compile(source)
+        try:
+            result = self.frame.eval(co, __exprinfo_left=left_result,
+                                     __exprinfo_right=right_result)
+        except Exception:
+            raise Failure(explanation)
+        return explanation, result
+
+    def visit_Call(self, call):
+        func_explanation, func = self.visit(call.func)
+        arg_explanations = []
+        ns = {"__exprinfo_func" : func}
+        arguments = []
+        for arg in call.args:
+            arg_explanation, arg_result = self.visit(arg)
+            if isinstance(arg, _Starred):
+                arg_name = "__exprinfo_star"
+                ns[arg_name] = arg_result
+                arguments.append("*%s" % (arg_name,))
+                arg_explanations.append("*%s" % (arg_explanation,))
+            else:
+                arg_name = "__exprinfo_%s" % (len(ns),)
+                ns[arg_name] = arg_result
+                arguments.append(arg_name)
+                arg_explanations.append(arg_explanation)
+        for keyword in call.keywords:
+            arg_explanation, arg_result = self.visit(keyword.value)
+            if keyword.arg:
+                arg_name = "__exprinfo_%s" % (len(ns),)
+                keyword_source = "%s=%%s" % (keyword.arg)
+                arguments.append(keyword_source % (arg_name,))
+                arg_explanations.append(keyword_source % (arg_explanation,))
+            else:
+                arg_name = "__exprinfo_kwds"
+                arguments.append("**%s" % (arg_name,))
+                arg_explanations.append("**%s" % (arg_explanation,))
+
+            ns[arg_name] = arg_result
+
+        if getattr(call, 'starargs', None):
+            arg_explanation, arg_result = self.visit(call.starargs)
+            arg_name = "__exprinfo_star"
+            ns[arg_name] = arg_result
+            arguments.append("*%s" % (arg_name,))
+            arg_explanations.append("*%s" % (arg_explanation,))
+
+        if getattr(call, 'kwargs', None):
+            arg_explanation, arg_result = self.visit(call.kwargs)
+            arg_name = "__exprinfo_kwds"
+            ns[arg_name] = arg_result
+            arguments.append("**%s" % (arg_name,))
+            arg_explanations.append("**%s" % (arg_explanation,))
+        args_explained = ", ".join(arg_explanations)
+        explanation = "%s(%s)" % (func_explanation, args_explained)
+        args = ", ".join(arguments)
+        source = "__exprinfo_func(%s)" % (args,)
+        co = self._compile(source)
+        try:
+            result = self.frame.eval(co, **ns)
+        except Exception:
+            raise Failure(explanation)
+        pattern = "%s\n{%s = %s\n}"
+        rep = self.frame.repr(result)
+        explanation = pattern % (rep, rep, explanation)
+        return explanation, result
+
+    def _is_builtin_name(self, name):
+        pattern = "%r not in globals() and %r not in locals()"
+        source = pattern % (name.id, name.id)
+        co = self._compile(source)
+        try:
+            return self.frame.eval(co)
+        except Exception:
+            return False
+
+    def visit_Attribute(self, attr):
+        if not isinstance(attr.ctx, ast.Load):
+            return self.generic_visit(attr)
+        source_explanation, source_result = self.visit(attr.value)
+        explanation = "%s.%s" % (source_explanation, attr.attr)
+        source = "__exprinfo_expr.%s" % (attr.attr,)
+        co = self._compile(source)
+        try:
+            try:
+                result = self.frame.eval(co, __exprinfo_expr=source_result)
+            except AttributeError:
+                # Maybe the attribute name needs to be mangled?
+                if not attr.attr.startswith("__") or attr.attr.endswith("__"):
+                    raise
+                source = "getattr(__exprinfo_expr.__class__, '__name__', '')"
+                co = self._compile(source)
+                class_name = self.frame.eval(co, __exprinfo_expr=source_result)
+                mangled_attr = "_" + class_name +  attr.attr
+                source = "__exprinfo_expr.%s" % (mangled_attr,)
+                co = self._compile(source)
+                result = self.frame.eval(co, __exprinfo_expr=source_result)
+        except Exception:
+            raise Failure(explanation)
+        explanation = "%s\n{%s = %s.%s\n}" % (self.frame.repr(result),
+                                              self.frame.repr(result),
+                                              source_explanation, attr.attr)
+        # Check if the attr is from an instance.
+        source = "%r in getattr(__exprinfo_expr, '__dict__', {})"
+        source = source % (attr.attr,)
+        co = self._compile(source)
+        try:
+            from_instance = self.frame.eval(co, __exprinfo_expr=source_result)
+        except Exception:
+            from_instance = None
+        if from_instance is None or self.frame.is_true(from_instance):
+            rep = self.frame.repr(result)
+            pattern = "%s\n{%s = %s\n}"
+            explanation = pattern % (rep, rep, explanation)
+        return explanation, result
+
+    def visit_Assert(self, assrt):
+        test_explanation, test_result = self.visit(assrt.test)
+        explanation = "assert %s" % (test_explanation,)
+        if not self.frame.is_true(test_result):
+            try:
+                raise util.BuiltinAssertionError
+            except Exception:
+                raise Failure(explanation)
+        return explanation, test_result
+
+    def visit_Assign(self, assign):
+        value_explanation, value_result = self.visit(assign.value)
+        explanation = "... = %s" % (value_explanation,)
+        name = ast.Name("__exprinfo_expr", ast.Load(),
+                        lineno=assign.value.lineno,
+                        col_offset=assign.value.col_offset)
+        new_assign = ast.Assign(assign.targets, name, lineno=assign.lineno,
+                                col_offset=assign.col_offset)
+        mod = ast.Module([new_assign])
+        co = self._compile(mod, "exec")
+        try:
+            self.frame.exec_(co, __exprinfo_expr=value_result)
+        except Exception:
+            raise Failure(explanation)
+        return explanation, value_result
+
diff --git a/python/pytest/_pytest/assertion/rewrite.py b/python/pytest/_pytest/assertion/rewrite.py
new file mode 100644
index 000000000..14b8e49db
--- /dev/null
+++ b/python/pytest/_pytest/assertion/rewrite.py
@@ -0,0 +1,885 @@
+"""Rewrite assertion AST to produce nice error messages"""
+
+import ast
+import errno
+import itertools
+import imp
+import marshal
+import os
+import re
+import struct
+import sys
+import types
+
+import py
+from _pytest.assertion import util
+
+
+# pytest caches rewritten pycs in __pycache__.
+if hasattr(imp, "get_tag"):
+    PYTEST_TAG = imp.get_tag() + "-PYTEST"
+else:
+    if hasattr(sys, "pypy_version_info"):
+        impl = "pypy"
+    elif sys.platform == "java":
+        impl = "jython"
+    else:
+        impl = "cpython"
+    ver = sys.version_info
+    PYTEST_TAG = "%s-%s%s-PYTEST" % (impl, ver[0], ver[1])
+    del ver, impl
+
+PYC_EXT = ".py" + (__debug__ and "c" or "o")
+PYC_TAIL = "." + PYTEST_TAG + PYC_EXT
+
+REWRITE_NEWLINES = sys.version_info[:2] != (2, 7) and sys.version_info < (3, 2)
+ASCII_IS_DEFAULT_ENCODING = sys.version_info[0] < 3
+
+if sys.version_info >= (3,5):
+    ast_Call = ast.Call
+else:
+    ast_Call = lambda a,b,c: ast.Call(a, b, c, None, None)
+
+
+class AssertionRewritingHook(object):
+    """PEP302 Import hook which rewrites asserts."""
+
+    def __init__(self):
+        self.session = None
+        self.modules = {}
+        self._register_with_pkg_resources()
+
+    def set_session(self, session):
+        self.fnpats = session.config.getini("python_files")
+        self.session = session
+
+    def find_module(self, name, path=None):
+        if self.session is None:
+            return None
+        sess = self.session
+        state = sess.config._assertstate
+        state.trace("find_module called for: %s" % name)
+        names = name.rsplit(".", 1)
+        lastname = names[-1]
+        pth = None
+        if path is not None:
+            # Starting with Python 3.3, path is a _NamespacePath(), which
+            # causes problems if not converted to list.
+            path = list(path)
+            if len(path) == 1:
+                pth = path[0]
+        if pth is None:
+            try:
+                fd, fn, desc = imp.find_module(lastname, path)
+            except ImportError:
+                return None
+            if fd is not None:
+                fd.close()
+            tp = desc[2]
+            if tp == imp.PY_COMPILED:
+                if hasattr(imp, "source_from_cache"):
+                    fn = imp.source_from_cache(fn)
+                else:
+                    fn = fn[:-1]
+            elif tp != imp.PY_SOURCE:
+                # Don't know what this is.
+                return None
+        else:
+            fn = os.path.join(pth, name.rpartition(".")[2] + ".py")
+        fn_pypath = py.path.local(fn)
+        # Is this a test file?
+        if not sess.isinitpath(fn):
+            # We have to be very careful here because imports in this code can
+            # trigger a cycle.
+            self.session = None
+            try:
+                for pat in self.fnpats:
+                    if fn_pypath.fnmatch(pat):
+                        state.trace("matched test file %r" % (fn,))
+                        break
+                else:
+                    return None
+            finally:
+                self.session = sess
+        else:
+            state.trace("matched test file (was specified on cmdline): %r" %
+                        (fn,))
+        # The requested module looks like a test file, so rewrite it. This is
+        # the most magical part of the process: load the source, rewrite the
+        # asserts, and load the rewritten source. We also cache the rewritten
+        # module code in a special pyc. We must be aware of the possibility of
+        # concurrent pytest processes rewriting and loading pycs. To avoid
+        # tricky race conditions, we maintain the following invariant: The
+        # cached pyc is always a complete, valid pyc. Operations on it must be
+        # atomic. POSIX's atomic rename comes in handy.
+        write = not sys.dont_write_bytecode
+        cache_dir = os.path.join(fn_pypath.dirname, "__pycache__")
+        if write:
+            try:
+                os.mkdir(cache_dir)
+            except OSError:
+                e = sys.exc_info()[1].errno
+                if e == errno.EEXIST:
+                    # Either the __pycache__ directory already exists (the
+                    # common case) or it's blocked by a non-dir node. In the
+                    # latter case, we'll ignore it in _write_pyc.
+                    pass
+                elif e in [errno.ENOENT, errno.ENOTDIR]:
+                    # One of the path components was not a directory, likely
+                    # because we're in a zip file.
+                    write = False
+                elif e in [errno.EACCES, errno.EROFS, errno.EPERM]:
+                    state.trace("read only directory: %r" % fn_pypath.dirname)
+                    write = False
+                else:
+                    raise
+        cache_name = fn_pypath.basename[:-3] + PYC_TAIL
+        pyc = os.path.join(cache_dir, cache_name)
+        # Notice that even if we're in a read-only directory, I'm going
+        # to check for a cached pyc. This may not be optimal...
+        co = _read_pyc(fn_pypath, pyc, state.trace)
+        if co is None:
+            state.trace("rewriting %r" % (fn,))
+            source_stat, co = _rewrite_test(state, fn_pypath)
+            if co is None:
+                # Probably a SyntaxError in the test.
+                return None
+            if write:
+                _make_rewritten_pyc(state, source_stat, pyc, co)
+        else:
+            state.trace("found cached rewritten pyc for %r" % (fn,))
+        self.modules[name] = co, pyc
+        return self
+
+    def load_module(self, name):
+        # If there is an existing module object named 'fullname' in
+        # sys.modules, the loader must use that existing module. (Otherwise,
+        # the reload() builtin will not work correctly.)
+        if name in sys.modules:
+            return sys.modules[name]
+
+        co, pyc = self.modules.pop(name)
+        # I wish I could just call imp.load_compiled here, but __file__ has to
+        # be set properly. In Python 3.2+, this all would be handled correctly
+        # by load_compiled.
+        mod = sys.modules[name] = imp.new_module(name)
+        try:
+            mod.__file__ = co.co_filename
+            # Normally, this attribute is 3.2+.
+            mod.__cached__ = pyc
+            mod.__loader__ = self
+            py.builtin.exec_(co, mod.__dict__)
+        except:
+            del sys.modules[name]
+            raise
+        return sys.modules[name]
+
+
+
+    def is_package(self, name):
+        try:
+            fd, fn, desc = imp.find_module(name)
+        except ImportError:
+            return False
+        if fd is not None:
+            fd.close()
+        tp = desc[2]
+        return tp == imp.PKG_DIRECTORY
+
+    @classmethod
+    def _register_with_pkg_resources(cls):
+        """
+        Ensure package resources can be loaded from this loader. May be called
+        multiple times, as the operation is idempotent.
+        """
+        try:
+            import pkg_resources
+            # access an attribute in case a deferred importer is present
+            pkg_resources.__name__
+        except ImportError:
+            return
+
+        # Since pytest tests are always located in the file system, the
+        #  DefaultProvider is appropriate.
+        pkg_resources.register_loader_type(cls, pkg_resources.DefaultProvider)
+
+    def get_data(self, pathname):
+        """Optional PEP302 get_data API.
+        """
+        with open(pathname, 'rb') as f:
+            return f.read()
+
+
+def _write_pyc(state, co, source_stat, pyc):
+    # Technically, we don't have to have the same pyc format as
+    # (C)Python, since these "pycs" should never be seen by builtin
+    # import. However, there's little reason deviate, and I hope
+    # sometime to be able to use imp.load_compiled to load them. (See
+    # the comment in load_module above.)
+    try:
+        fp = open(pyc, "wb")
+    except IOError:
+        err = sys.exc_info()[1].errno
+        state.trace("error writing pyc file at %s: errno=%s" %(pyc, err))
+        # we ignore any failure to write the cache file
+        # there are many reasons, permission-denied, __pycache__ being a
+        # file etc.
+        return False
+    try:
+        fp.write(imp.get_magic())
+        mtime = int(source_stat.mtime)
+        size = source_stat.size & 0xFFFFFFFF
+        fp.write(struct.pack("<ll", mtime, size))
+        marshal.dump(co, fp)
+    finally:
+        fp.close()
+    return True
+
+RN = "\r\n".encode("utf-8")
+N = "\n".encode("utf-8")
+
+cookie_re = re.compile(r"^[ \t\f]*#.*coding[:=][ \t]*[-\w.]+")
+BOM_UTF8 = '\xef\xbb\xbf'
+
+def _rewrite_test(state, fn):
+    """Try to read and rewrite *fn* and return the code object."""
+    try:
+        stat = fn.stat()
+        source = fn.read("rb")
+    except EnvironmentError:
+        return None, None
+    if ASCII_IS_DEFAULT_ENCODING:
+        # ASCII is the default encoding in Python 2. Without a coding
+        # declaration, Python 2 will complain about any bytes in the file
+        # outside the ASCII range. Sadly, this behavior does not extend to
+        # compile() or ast.parse(), which prefer to interpret the bytes as
+        # latin-1. (At least they properly handle explicit coding cookies.) To
+        # preserve this error behavior, we could force ast.parse() to use ASCII
+        # as the encoding by inserting a coding cookie. Unfortunately, that
+        # messes up line numbers. Thus, we have to check ourselves if anything
+        # is outside the ASCII range in the case no encoding is explicitly
+        # declared. For more context, see issue #269. Yay for Python 3 which
+        # gets this right.
+        end1 = source.find("\n")
+        end2 = source.find("\n", end1 + 1)
+        if (not source.startswith(BOM_UTF8) and
+            cookie_re.match(source[0:end1]) is None and
+            cookie_re.match(source[end1 + 1:end2]) is None):
+            if hasattr(state, "_indecode"):
+                # encodings imported us again, so don't rewrite.
+                return None, None
+            state._indecode = True
+            try:
+                try:
+                    source.decode("ascii")
+                except UnicodeDecodeError:
+                    # Let it fail in real import.
+                    return None, None
+            finally:
+                del state._indecode
+    # On Python versions which are not 2.7 and less than or equal to 3.1, the
+    # parser expects *nix newlines.
+    if REWRITE_NEWLINES:
+        source = source.replace(RN, N) + N
+    try:
+        tree = ast.parse(source)
+    except SyntaxError:
+        # Let this pop up again in the real import.
+        state.trace("failed to parse: %r" % (fn,))
+        return None, None
+    rewrite_asserts(tree)
+    try:
+        co = compile(tree, fn.strpath, "exec")
+    except SyntaxError:
+        # It's possible that this error is from some bug in the
+        # assertion rewriting, but I don't know of a fast way to tell.
+        state.trace("failed to compile: %r" % (fn,))
+        return None, None
+    return stat, co
+
+def _make_rewritten_pyc(state, source_stat, pyc, co):
+    """Try to dump rewritten code to *pyc*."""
+    if sys.platform.startswith("win"):
+        # Windows grants exclusive access to open files and doesn't have atomic
+        # rename, so just write into the final file.
+        _write_pyc(state, co, source_stat, pyc)
+    else:
+        # When not on windows, assume rename is atomic. Dump the code object
+        # into a file specific to this process and atomically replace it.
+        proc_pyc = pyc + "." + str(os.getpid())
+        if _write_pyc(state, co, source_stat, proc_pyc):
+            os.rename(proc_pyc, pyc)
+
+def _read_pyc(source, pyc, trace=lambda x: None):
+    """Possibly read a pytest pyc containing rewritten code.
+
+    Return rewritten code if successful or None if not.
+    """
+    try:
+        fp = open(pyc, "rb")
+    except IOError:
+        return None
+    with fp:
+        try:
+            mtime = int(source.mtime())
+            size = source.size()
+            data = fp.read(12)
+        except EnvironmentError as e:
+            trace('_read_pyc(%s): EnvironmentError %s' % (source, e))
+            return None
+        # Check for invalid or out of date pyc file.
+        if (len(data) != 12 or data[:4] != imp.get_magic() or
+                struct.unpack("<ll", data[4:]) != (mtime, size)):
+            trace('_read_pyc(%s): invalid or out of date pyc' % source)
+            return None
+        try:
+            co = marshal.load(fp)
+        except Exception as e:
+            trace('_read_pyc(%s): marshal.load error %s' % (source, e))
+            return None
+        if not isinstance(co, types.CodeType):
+            trace('_read_pyc(%s): not a code object' % source)
+            return None
+        return co
+
+
+def rewrite_asserts(mod):
+    """Rewrite the assert statements in mod."""
+    AssertionRewriter().run(mod)
+
+
+def _saferepr(obj):
+    """Get a safe repr of an object for assertion error messages.
+
+    The assertion formatting (util.format_explanation()) requires
+    newlines to be escaped since they are a special character for it.
+    Normally assertion.util.format_explanation() does this but for a
+    custom repr it is possible to contain one of the special escape
+    sequences, especially '\n{' and '\n}' are likely to be present in
+    JSON reprs.
+
+    """
+    repr = py.io.saferepr(obj)
+    if py.builtin._istext(repr):
+        t = py.builtin.text
+    else:
+        t = py.builtin.bytes
+    return repr.replace(t("\n"), t("\\n"))
+
+
+from _pytest.assertion.util import format_explanation as _format_explanation # noqa
+
+def _format_assertmsg(obj):
+    """Format the custom assertion message given.
+
+    For strings this simply replaces newlines with '\n~' so that
+    util.format_explanation() will preserve them instead of escaping
+    newlines.  For other objects py.io.saferepr() is used first.
+
+    """
+    # reprlib appears to have a bug which means that if a string
+    # contains a newline it gets escaped, however if an object has a
+    # .__repr__() which contains newlines it does not get escaped.
+    # However in either case we want to preserve the newline.
+    if py.builtin._istext(obj) or py.builtin._isbytes(obj):
+        s = obj
+        is_repr = False
+    else:
+        s = py.io.saferepr(obj)
+        is_repr = True
+    if py.builtin._istext(s):
+        t = py.builtin.text
+    else:
+        t = py.builtin.bytes
+    s = s.replace(t("\n"), t("\n~")).replace(t("%"), t("%%"))
+    if is_repr:
+        s = s.replace(t("\\n"), t("\n~"))
+    return s
+
+def _should_repr_global_name(obj):
+    return not hasattr(obj, "__name__") and not py.builtin.callable(obj)
+
+def _format_boolop(explanations, is_or):
+    explanation = "(" + (is_or and " or " or " and ").join(explanations) + ")"
+    if py.builtin._istext(explanation):
+        t = py.builtin.text
+    else:
+        t = py.builtin.bytes
+    return explanation.replace(t('%'), t('%%'))
+
+def _call_reprcompare(ops, results, expls, each_obj):
+    for i, res, expl in zip(range(len(ops)), results, expls):
+        try:
+            done = not res
+        except Exception:
+            done = True
+        if done:
+            break
+    if util._reprcompare is not None:
+        custom = util._reprcompare(ops[i], each_obj[i], each_obj[i + 1])
+        if custom is not None:
+            return custom
+    return expl
+
+
+unary_map = {
+    ast.Not: "not %s",
+    ast.Invert: "~%s",
+    ast.USub: "-%s",
+    ast.UAdd: "+%s"
+}
+
+binop_map = {
+    ast.BitOr: "|",
+    ast.BitXor: "^",
+    ast.BitAnd: "&",
+    ast.LShift: "<<",
+    ast.RShift: ">>",
+    ast.Add: "+",
+    ast.Sub: "-",
+    ast.Mult: "*",
+    ast.Div: "/",
+    ast.FloorDiv: "//",
+    ast.Mod: "%%", # escaped for string formatting
+    ast.Eq: "==",
+    ast.NotEq: "!=",
+    ast.Lt: "<",
+    ast.LtE: "<=",
+    ast.Gt: ">",
+    ast.GtE: ">=",
+    ast.Pow: "**",
+    ast.Is: "is",
+    ast.IsNot: "is not",
+    ast.In: "in",
+    ast.NotIn: "not in"
+}
+# Python 3.5+ compatibility
+try:
+    binop_map[ast.MatMult] = "@"
+except AttributeError:
+    pass
+
+# Python 3.4+ compatibility
+if hasattr(ast, "NameConstant"):
+    _NameConstant = ast.NameConstant
+else:
+    def _NameConstant(c):
+        return ast.Name(str(c), ast.Load())
+
+
+def set_location(node, lineno, col_offset):
+    """Set node location information recursively."""
+    def _fix(node, lineno, col_offset):
+        if "lineno" in node._attributes:
+            node.lineno = lineno
+        if "col_offset" in node._attributes:
+            node.col_offset = col_offset
+        for child in ast.iter_child_nodes(node):
+            _fix(child, lineno, col_offset)
+    _fix(node, lineno, col_offset)
+    return node
+
+
+class AssertionRewriter(ast.NodeVisitor):
+    """Assertion rewriting implementation.
+
+    The main entrypoint is to call .run() with an ast.Module instance,
+    this will then find all the assert statements and re-write them to
+    provide intermediate values and a detailed assertion error.  See
+    http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html
+    for an overview of how this works.
+
+    The entry point here is .run() which will iterate over all the
+    statements in an ast.Module and for each ast.Assert statement it
+    finds call .visit() with it.  Then .visit_Assert() takes over and
+    is responsible for creating new ast statements to replace the
+    original assert statement: it re-writes the test of an assertion
+    to provide intermediate values and replace it with an if statement
+    which raises an assertion error with a detailed explanation in
+    case the expression is false.
+
+    For this .visit_Assert() uses the visitor pattern to visit all the
+    AST nodes of the ast.Assert.test field, each visit call returning
+    an AST node and the corresponding explanation string.  During this
+    state is kept in several instance attributes:
+
+    :statements: All the AST statements which will replace the assert
+       statement.
+
+    :variables: This is populated by .variable() with each variable
+       used by the statements so that they can all be set to None at
+       the end of the statements.
+
+    :variable_counter: Counter to create new unique variables needed
+       by statements.  Variables are created using .variable() and
+       have the form of "@py_assert0".
+
+    :on_failure: The AST statements which will be executed if the
+       assertion test fails.  This is the code which will construct
+       the failure message and raises the AssertionError.
+
+    :explanation_specifiers: A dict filled by .explanation_param()
+       with %-formatting placeholders and their corresponding
+       expressions to use in the building of an assertion message.
+       This is used by .pop_format_context() to build a message.
+
+    :stack: A stack of the explanation_specifiers dicts maintained by
+       .push_format_context() and .pop_format_context() which allows
+       to build another %-formatted string while already building one.
+
+    This state is reset on every new assert statement visited and used
+    by the other visitors.
+
+    """
+
+    def run(self, mod):
+        """Find all assert statements in *mod* and rewrite them."""
+        if not mod.body:
+            # Nothing to do.
+            return
+        # Insert some special imports at the top of the module but after any
+        # docstrings and __future__ imports.
+        aliases = [ast.alias(py.builtin.builtins.__name__, "@py_builtins"),
+                   ast.alias("_pytest.assertion.rewrite", "@pytest_ar")]
+        expect_docstring = True
+        pos = 0
+        lineno = 0
+        for item in mod.body:
+            if (expect_docstring and isinstance(item, ast.Expr) and
+                    isinstance(item.value, ast.Str)):
+                doc = item.value.s
+                if "PYTEST_DONT_REWRITE" in doc:
+                    # The module has disabled assertion rewriting.
+                    return
+                lineno += len(doc) - 1
+                expect_docstring = False
+            elif (not isinstance(item, ast.ImportFrom) or item.level > 0 or
+                  item.module != "__future__"):
+                lineno = item.lineno
+                break
+            pos += 1
+        imports = [ast.Import([alias], lineno=lineno, col_offset=0)
+                   for alias in aliases]
+        mod.body[pos:pos] = imports
+        # Collect asserts.
+        nodes = [mod]
+        while nodes:
+            node = nodes.pop()
+            for name, field in ast.iter_fields(node):
+                if isinstance(field, list):
+                    new = []
+                    for i, child in enumerate(field):
+                        if isinstance(child, ast.Assert):
+                            # Transform assert.
+                            new.extend(self.visit(child))
+                        else:
+                            new.append(child)
+                            if isinstance(child, ast.AST):
+                                nodes.append(child)
+                    setattr(node, name, new)
+                elif (isinstance(field, ast.AST) and
+                      # Don't recurse into expressions as they can't contain
+                      # asserts.
+                      not isinstance(field, ast.expr)):
+                    nodes.append(field)
+
+    def variable(self):
+        """Get a new variable."""
+        # Use a character invalid in python identifiers to avoid clashing.
+        name = "@py_assert" + str(next(self.variable_counter))
+        self.variables.append(name)
+        return name
+
+    def assign(self, expr):
+        """Give *expr* a name."""
+        name = self.variable()
+        self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr))
+        return ast.Name(name, ast.Load())
+
+    def display(self, expr):
+        """Call py.io.saferepr on the expression."""
+        return self.helper("saferepr", expr)
+
+    def helper(self, name, *args):
+        """Call a helper in this module."""
+        py_name = ast.Name("@pytest_ar", ast.Load())
+        attr = ast.Attribute(py_name, "_" + name, ast.Load())
+        return ast_Call(attr, list(args), [])
+
+    def builtin(self, name):
+        """Return the builtin called *name*."""
+        builtin_name = ast.Name("@py_builtins", ast.Load())
+        return ast.Attribute(builtin_name, name, ast.Load())
+
+    def explanation_param(self, expr):
+        """Return a new named %-formatting placeholder for expr.
+
+        This creates a %-formatting placeholder for expr in the
+        current formatting context, e.g. ``%(py0)s``.  The placeholder
+        and expr are placed in the current format context so that it
+        can be used on the next call to .pop_format_context().
+
+        """
+        specifier = "py" + str(next(self.variable_counter))
+        self.explanation_specifiers[specifier] = expr
+        return "%(" + specifier + ")s"
+
+    def push_format_context(self):
+        """Create a new formatting context.
+
+        The format context is used for when an explanation wants to
+        have a variable value formatted in the assertion message.  In
+        this case the value required can be added using
+        .explanation_param().  Finally .pop_format_context() is used
+        to format a string of %-formatted values as added by
+        .explanation_param().
+
+        """
+        self.explanation_specifiers = {}
+        self.stack.append(self.explanation_specifiers)
+
+    def pop_format_context(self, expl_expr):
+        """Format the %-formatted string with current format context.
+
+        The expl_expr should be an ast.Str instance constructed from
+        the %-placeholders created by .explanation_param().  This will
+        add the required code to format said string to .on_failure and
+        return the ast.Name instance of the formatted string.
+
+        """
+        current = self.stack.pop()
+        if self.stack:
+            self.explanation_specifiers = self.stack[-1]
+        keys = [ast.Str(key) for key in current.keys()]
+        format_dict = ast.Dict(keys, list(current.values()))
+        form = ast.BinOp(expl_expr, ast.Mod(), format_dict)
+        name = "@py_format" + str(next(self.variable_counter))
+        self.on_failure.append(ast.Assign([ast.Name(name, ast.Store())], form))
+        return ast.Name(name, ast.Load())
+
+    def generic_visit(self, node):
+        """Handle expressions we don't have custom code for."""
+        assert isinstance(node, ast.expr)
+        res = self.assign(node)
+        return res, self.explanation_param(self.display(res))
+
+    def visit_Assert(self, assert_):
+        """Return the AST statements to replace the ast.Assert instance.
+
+        This re-writes the test of an assertion to provide
+        intermediate values and replace it with an if statement which
+        raises an assertion error with a detailed explanation in case
+        the expression is false.
+
+        """
+        self.statements = []
+        self.variables = []
+        self.variable_counter = itertools.count()
+        self.stack = []
+        self.on_failure = []
+        self.push_format_context()
+        # Rewrite assert into a bunch of statements.
+        top_condition, explanation = self.visit(assert_.test)
+        # Create failure message.
+        body = self.on_failure
+        negation = ast.UnaryOp(ast.Not(), top_condition)
+        self.statements.append(ast.If(negation, body, []))
+        if assert_.msg:
+            assertmsg = self.helper('format_assertmsg', assert_.msg)
+            explanation = "\n>assert " + explanation
+        else:
+            assertmsg = ast.Str("")
+            explanation = "assert " + explanation
+        template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation))
+        msg = self.pop_format_context(template)
+        fmt = self.helper("format_explanation", msg)
+        err_name = ast.Name("AssertionError", ast.Load())
+        exc = ast_Call(err_name, [fmt], [])
+        if sys.version_info[0] >= 3:
+            raise_ = ast.Raise(exc, None)
+        else:
+            raise_ = ast.Raise(exc, None, None)
+        body.append(raise_)
+        # Clear temporary variables by setting them to None.
+        if self.variables:
+            variables = [ast.Name(name, ast.Store())
+                         for name in self.variables]
+            clear = ast.Assign(variables, _NameConstant(None))
+            self.statements.append(clear)
+        # Fix line numbers.
+        for stmt in self.statements:
+            set_location(stmt, assert_.lineno, assert_.col_offset)
+        return self.statements
+
+    def visit_Name(self, name):
+        # Display the repr of the name if it's a local variable or
+        # _should_repr_global_name() thinks it's acceptable.
+        locs = ast_Call(self.builtin("locals"), [], [])
+        inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs])
+        dorepr = self.helper("should_repr_global_name", name)
+        test = ast.BoolOp(ast.Or(), [inlocs, dorepr])
+        expr = ast.IfExp(test, self.display(name), ast.Str(name.id))
+        return name, self.explanation_param(expr)
+
+    def visit_BoolOp(self, boolop):
+        res_var = self.variable()
+        expl_list = self.assign(ast.List([], ast.Load()))
+        app = ast.Attribute(expl_list, "append", ast.Load())
+        is_or = int(isinstance(boolop.op, ast.Or))
+        body = save = self.statements
+        fail_save = self.on_failure
+        levels = len(boolop.values) - 1
+        self.push_format_context()
+        # Process each operand, short-circuting if needed.
+        for i, v in enumerate(boolop.values):
+            if i:
+                fail_inner = []
+                # cond is set in a prior loop iteration below
+                self.on_failure.append(ast.If(cond, fail_inner, [])) # noqa
+                self.on_failure = fail_inner
+            self.push_format_context()
+            res, expl = self.visit(v)
+            body.append(ast.Assign([ast.Name(res_var, ast.Store())], res))
+            expl_format = self.pop_format_context(ast.Str(expl))
+            call = ast_Call(app, [expl_format], [])
+            self.on_failure.append(ast.Expr(call))
+            if i < levels:
+                cond = res
+                if is_or:
+                    cond = ast.UnaryOp(ast.Not(), cond)
+                inner = []
+                self.statements.append(ast.If(cond, inner, []))
+                self.statements = body = inner
+        self.statements = save
+        self.on_failure = fail_save
+        expl_template = self.helper("format_boolop", expl_list, ast.Num(is_or))
+        expl = self.pop_format_context(expl_template)
+        return ast.Name(res_var, ast.Load()), self.explanation_param(expl)
+
+    def visit_UnaryOp(self, unary):
+        pattern = unary_map[unary.op.__class__]
+        operand_res, operand_expl = self.visit(unary.operand)
+        res = self.assign(ast.UnaryOp(unary.op, operand_res))
+        return res, pattern % (operand_expl,)
+
+    def visit_BinOp(self, binop):
+        symbol = binop_map[binop.op.__class__]
+        left_expr, left_expl = self.visit(binop.left)
+        right_expr, right_expl = self.visit(binop.right)
+        explanation = "(%s %s %s)" % (left_expl, symbol, right_expl)
+        res = self.assign(ast.BinOp(left_expr, binop.op, right_expr))
+        return res, explanation
+
+    def visit_Call_35(self, call):
+        """
+        visit `ast.Call` nodes on Python3.5 and after
+        """
+        new_func, func_expl = self.visit(call.func)
+        arg_expls = []
+        new_args = []
+        new_kwargs = []
+        for arg in call.args:
+            res, expl = self.visit(arg)
+            arg_expls.append(expl)
+            new_args.append(res)
+        for keyword in call.keywords:
+            res, expl = self.visit(keyword.value)
+            new_kwargs.append(ast.keyword(keyword.arg, res))
+            if keyword.arg:
+                arg_expls.append(keyword.arg + "=" + expl)
+            else: ## **args have `arg` keywords with an .arg of None
+                arg_expls.append("**" + expl)
+
+        expl = "%s(%s)" % (func_expl, ', '.join(arg_expls))
+        new_call = ast.Call(new_func, new_args, new_kwargs)
+        res = self.assign(new_call)
+        res_expl = self.explanation_param(self.display(res))
+        outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl)
+        return res, outer_expl
+
+    def visit_Starred(self, starred):
+        # From Python 3.5, a Starred node can appear in a function call
+        res, expl = self.visit(starred.value)
+        return starred, '*' + expl
+
+    def visit_Call_legacy(self, call):
+        """
+        visit `ast.Call nodes on 3.4 and below`
+        """
+        new_func, func_expl = self.visit(call.func)
+        arg_expls = []
+        new_args = []
+        new_kwargs = []
+        new_star = new_kwarg = None
+        for arg in call.args:
+            res, expl = self.visit(arg)
+            new_args.append(res)
+            arg_expls.append(expl)
+        for keyword in call.keywords:
+            res, expl = self.visit(keyword.value)
+            new_kwargs.append(ast.keyword(keyword.arg, res))
+            arg_expls.append(keyword.arg + "=" + expl)
+        if call.starargs:
+            new_star, expl = self.visit(call.starargs)
+            arg_expls.append("*" + expl)
+        if call.kwargs:
+            new_kwarg, expl = self.visit(call.kwargs)
+            arg_expls.append("**" + expl)
+        expl = "%s(%s)" % (func_expl, ', '.join(arg_expls))
+        new_call = ast.Call(new_func, new_args, new_kwargs,
+                            new_star, new_kwarg)
+        res = self.assign(new_call)
+        res_expl = self.explanation_param(self.display(res))
+        outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl)
+        return res, outer_expl
+
+    # ast.Call signature changed on 3.5,
+    # conditionally change  which methods is named
+    # visit_Call depending on Python version
+    if sys.version_info >= (3, 5):
+        visit_Call = visit_Call_35
+    else:
+        visit_Call = visit_Call_legacy
+
+
+    def visit_Attribute(self, attr):
+        if not isinstance(attr.ctx, ast.Load):
+            return self.generic_visit(attr)
+        value, value_expl = self.visit(attr.value)
+        res = self.assign(ast.Attribute(value, attr.attr, ast.Load()))
+        res_expl = self.explanation_param(self.display(res))
+        pat = "%s\n{%s = %s.%s\n}"
+        expl = pat % (res_expl, res_expl, value_expl, attr.attr)
+        return res, expl
+
+    def visit_Compare(self, comp):
+        self.push_format_context()
+        left_res, left_expl = self.visit(comp.left)
+        res_variables = [self.variable() for i in range(len(comp.ops))]
+        load_names = [ast.Name(v, ast.Load()) for v in res_variables]
+        store_names = [ast.Name(v, ast.Store()) for v in res_variables]
+        it = zip(range(len(comp.ops)), comp.ops, comp.comparators)
+        expls = []
+        syms = []
+        results = [left_res]
+        for i, op, next_operand in it:
+            next_res, next_expl = self.visit(next_operand)
+            results.append(next_res)
+            sym = binop_map[op.__class__]
+            syms.append(ast.Str(sym))
+            expl = "%s %s %s" % (left_expl, sym, next_expl)
+            expls.append(ast.Str(expl))
+            res_expr = ast.Compare(left_res, [op], [next_res])
+            self.statements.append(ast.Assign([store_names[i]], res_expr))
+            left_res, left_expl = next_res, next_expl
+        # Use pytest.assertion.util._reprcompare if that's available.
+        expl_call = self.helper("call_reprcompare",
+                                ast.Tuple(syms, ast.Load()),
+                                ast.Tuple(load_names, ast.Load()),
+                                ast.Tuple(expls, ast.Load()),
+                                ast.Tuple(results, ast.Load()))
+        if len(comp.ops) > 1:
+            res = ast.BoolOp(ast.And(), load_names)
+        else:
+            res = load_names[0]
+        return res, self.explanation_param(self.pop_format_context(expl_call))
diff --git a/python/pytest/_pytest/assertion/util.py b/python/pytest/_pytest/assertion/util.py
new file mode 100644
index 000000000..f2f23efea
--- /dev/null
+++ b/python/pytest/_pytest/assertion/util.py
@@ -0,0 +1,332 @@
+"""Utilities for assertion debugging"""
+import pprint
+
+import _pytest._code
+import py
+try:
+    from collections import Sequence
+except ImportError:
+    Sequence = list
+
+BuiltinAssertionError = py.builtin.builtins.AssertionError
+u = py.builtin._totext
+
+# The _reprcompare attribute on the util module is used by the new assertion
+# interpretation code and assertion rewriter to detect this plugin was
+# loaded and in turn call the hooks defined here as part of the
+# DebugInterpreter.
+_reprcompare = None
+
+
+# the re-encoding is needed for python2 repr
+# with non-ascii characters (see issue 877 and 1379)
+def ecu(s):
+    try:
+        return u(s, 'utf-8', 'replace')
+    except TypeError:
+        return s
+
+
+def format_explanation(explanation):
+    """This formats an explanation
+
+    Normally all embedded newlines are escaped, however there are
+    three exceptions: \n{, \n} and \n~.  The first two are intended
+    cover nested explanations, see function and attribute explanations
+    for examples (.visit_Call(), visit_Attribute()).  The last one is
+    for when one explanation needs to span multiple lines, e.g. when
+    displaying diffs.
+    """
+    explanation = ecu(explanation)
+    explanation = _collapse_false(explanation)
+    lines = _split_explanation(explanation)
+    result = _format_lines(lines)
+    return u('\n').join(result)
+
+
+def _collapse_false(explanation):
+    """Collapse expansions of False
+
+    So this strips out any "assert False\n{where False = ...\n}"
+    blocks.
+    """
+    where = 0
+    while True:
+        start = where = explanation.find("False\n{False = ", where)
+        if where == -1:
+            break
+        level = 0
+        prev_c = explanation[start]
+        for i, c in enumerate(explanation[start:]):
+            if prev_c + c == "\n{":
+                level += 1
+            elif prev_c + c == "\n}":
+                level -= 1
+                if not level:
+                    break
+            prev_c = c
+        else:
+            raise AssertionError("unbalanced braces: %r" % (explanation,))
+        end = start + i
+        where = end
+        if explanation[end - 1] == '\n':
+            explanation = (explanation[:start] + explanation[start+15:end-1] +
+                           explanation[end+1:])
+            where -= 17
+    return explanation
+
+
+def _split_explanation(explanation):
+    """Return a list of individual lines in the explanation
+
+    This will return a list of lines split on '\n{', '\n}' and '\n~'.
+    Any other newlines will be escaped and appear in the line as the
+    literal '\n' characters.
+    """
+    raw_lines = (explanation or u('')).split('\n')
+    lines = [raw_lines[0]]
+    for l in raw_lines[1:]:
+        if l and l[0] in ['{', '}', '~', '>']:
+            lines.append(l)
+        else:
+            lines[-1] += '\\n' + l
+    return lines
+
+
+def _format_lines(lines):
+    """Format the individual lines
+
+    This will replace the '{', '}' and '~' characters of our mini
+    formatting language with the proper 'where ...', 'and ...' and ' +
+    ...' text, taking care of indentation along the way.
+
+    Return a list of formatted lines.
+    """
+    result = lines[:1]
+    stack = [0]
+    stackcnt = [0]
+    for line in lines[1:]:
+        if line.startswith('{'):
+            if stackcnt[-1]:
+                s = u('and   ')
+            else:
+                s = u('where ')
+            stack.append(len(result))
+            stackcnt[-1] += 1
+            stackcnt.append(0)
+            result.append(u(' +') + u('  ')*(len(stack)-1) + s + line[1:])
+        elif line.startswith('}'):
+            stack.pop()
+            stackcnt.pop()
+            result[stack[-1]] += line[1:]
+        else:
+            assert line[0] in ['~', '>']
+            stack[-1] += 1
+            indent = len(stack) if line.startswith('~') else len(stack) - 1
+            result.append(u('  ')*indent + line[1:])
+    assert len(stack) == 1
+    return result
+
+
+# Provide basestring in python3
+try:
+    basestring = basestring
+except NameError:
+    basestring = str
+
+
+def assertrepr_compare(config, op, left, right):
+    """Return specialised explanations for some operators/operands"""
+    width = 80 - 15 - len(op) - 2  # 15 chars indentation, 1 space around op
+    left_repr = py.io.saferepr(left, maxsize=int(width/2))
+    right_repr = py.io.saferepr(right, maxsize=width-len(left_repr))
+
+    summary = u('%s %s %s') % (ecu(left_repr), op, ecu(right_repr))
+
+    issequence = lambda x: (isinstance(x, (list, tuple, Sequence)) and
+                            not isinstance(x, basestring))
+    istext = lambda x: isinstance(x, basestring)
+    isdict = lambda x: isinstance(x, dict)
+    isset = lambda x: isinstance(x, (set, frozenset))
+
+    def isiterable(obj):
+        try:
+            iter(obj)
+            return not istext(obj)
+        except TypeError:
+            return False
+
+    verbose = config.getoption('verbose')
+    explanation = None
+    try:
+        if op == '==':
+            if istext(left) and istext(right):
+                explanation = _diff_text(left, right, verbose)
+            else:
+                if issequence(left) and issequence(right):
+                    explanation = _compare_eq_sequence(left, right, verbose)
+                elif isset(left) and isset(right):
+                    explanation = _compare_eq_set(left, right, verbose)
+                elif isdict(left) and isdict(right):
+                    explanation = _compare_eq_dict(left, right, verbose)
+                if isiterable(left) and isiterable(right):
+                    expl = _compare_eq_iterable(left, right, verbose)
+                    if explanation is not None:
+                        explanation.extend(expl)
+                    else:
+                        explanation = expl
+        elif op == 'not in':
+            if istext(left) and istext(right):
+                explanation = _notin_text(left, right, verbose)
+    except Exception:
+        explanation = [
+            u('(pytest_assertion plugin: representation of details failed.  '
+              'Probably an object has a faulty __repr__.)'),
+            u(_pytest._code.ExceptionInfo())]
+
+    if not explanation:
+        return None
+
+    return [summary] + explanation
+
+
+def _diff_text(left, right, verbose=False):
+    """Return the explanation for the diff between text or bytes
+
+    Unless --verbose is used this will skip leading and trailing
+    characters which are identical to keep the diff minimal.
+
+    If the input are bytes they will be safely converted to text.
+    """
+    from difflib import ndiff
+    explanation = []
+    if isinstance(left, py.builtin.bytes):
+        left = u(repr(left)[1:-1]).replace(r'\n', '\n')
+    if isinstance(right, py.builtin.bytes):
+        right = u(repr(right)[1:-1]).replace(r'\n', '\n')
+    if not verbose:
+        i = 0  # just in case left or right has zero length
+        for i in range(min(len(left), len(right))):
+            if left[i] != right[i]:
+                break
+        if i > 42:
+            i -= 10                 # Provide some context
+            explanation = [u('Skipping %s identical leading '
+                             'characters in diff, use -v to show') % i]
+            left = left[i:]
+            right = right[i:]
+        if len(left) == len(right):
+            for i in range(len(left)):
+                if left[-i] != right[-i]:
+                    break
+            if i > 42:
+                i -= 10     # Provide some context
+                explanation += [u('Skipping %s identical trailing '
+                                  'characters in diff, use -v to show') % i]
+                left = left[:-i]
+                right = right[:-i]
+    explanation += [line.strip('\n')
+                    for line in ndiff(left.splitlines(),
+                                      right.splitlines())]
+    return explanation
+
+
+def _compare_eq_iterable(left, right, verbose=False):
+    if not verbose:
+        return [u('Use -v to get the full diff')]
+    # dynamic import to speedup pytest
+    import difflib
+
+    try:
+        left_formatting = pprint.pformat(left).splitlines()
+        right_formatting = pprint.pformat(right).splitlines()
+        explanation = [u('Full diff:')]
+    except Exception:
+        # hack: PrettyPrinter.pformat() in python 2 fails when formatting items that can't be sorted(), ie, calling
+        # sorted() on a list would raise. See issue #718.
+        # As a workaround, the full diff is generated by using the repr() string of each item of each container.
+        left_formatting = sorted(repr(x) for x in left)
+        right_formatting = sorted(repr(x) for x in right)
+        explanation = [u('Full diff (fallback to calling repr on each item):')]
+    explanation.extend(line.strip() for line in difflib.ndiff(left_formatting, right_formatting))
+    return explanation
+
+
+def _compare_eq_sequence(left, right, verbose=False):
+    explanation = []
+    for i in range(min(len(left), len(right))):
+        if left[i] != right[i]:
+            explanation += [u('At index %s diff: %r != %r')
+                            % (i, left[i], right[i])]
+            break
+    if len(left) > len(right):
+        explanation += [u('Left contains more items, first extra item: %s')
+                        % py.io.saferepr(left[len(right)],)]
+    elif len(left) < len(right):
+        explanation += [
+            u('Right contains more items, first extra item: %s') %
+            py.io.saferepr(right[len(left)],)]
+    return explanation
+
+
+def _compare_eq_set(left, right, verbose=False):
+    explanation = []
+    diff_left = left - right
+    diff_right = right - left
+    if diff_left:
+        explanation.append(u('Extra items in the left set:'))
+        for item in diff_left:
+            explanation.append(py.io.saferepr(item))
+    if diff_right:
+        explanation.append(u('Extra items in the right set:'))
+        for item in diff_right:
+            explanation.append(py.io.saferepr(item))
+    return explanation
+
+
+def _compare_eq_dict(left, right, verbose=False):
+    explanation = []
+    common = set(left).intersection(set(right))
+    same = dict((k, left[k]) for k in common if left[k] == right[k])
+    if same and not verbose:
+        explanation += [u('Omitting %s identical items, use -v to show') %
+                        len(same)]
+    elif same:
+        explanation += [u('Common items:')]
+        explanation += pprint.pformat(same).splitlines()
+    diff = set(k for k in common if left[k] != right[k])
+    if diff:
+        explanation += [u('Differing items:')]
+        for k in diff:
+            explanation += [py.io.saferepr({k: left[k]}) + ' != ' +
+                            py.io.saferepr({k: right[k]})]
+    extra_left = set(left) - set(right)
+    if extra_left:
+        explanation.append(u('Left contains more items:'))
+        explanation.extend(pprint.pformat(
+            dict((k, left[k]) for k in extra_left)).splitlines())
+    extra_right = set(right) - set(left)
+    if extra_right:
+        explanation.append(u('Right contains more items:'))
+        explanation.extend(pprint.pformat(
+            dict((k, right[k]) for k in extra_right)).splitlines())
+    return explanation
+
+
+def _notin_text(term, text, verbose=False):
+    index = text.find(term)
+    head = text[:index]
+    tail = text[index+len(term):]
+    correct_text = head + tail
+    diff = _diff_text(correct_text, text, verbose)
+    newdiff = [u('%s is contained here:') % py.io.saferepr(term, maxsize=42)]
+    for line in diff:
+        if line.startswith(u('Skipping')):
+            continue
+        if line.startswith(u('- ')):
+            continue
+        if line.startswith(u('+ ')):
+            newdiff.append(u('  ') + line[2:])
+        else:
+            newdiff.append(line)
+    return newdiff
diff --git a/python/pytest/_pytest/cacheprovider.py b/python/pytest/_pytest/cacheprovider.py
new file mode 100755
index 000000000..0657001f2
--- /dev/null
+++ b/python/pytest/_pytest/cacheprovider.py
@@ -0,0 +1,245 @@
+"""
+merged implementation of the cache provider
+
+the name cache was not choosen to ensure pluggy automatically
+ignores the external pytest-cache
+"""
+
+import py
+import pytest
+import json
+from os.path import sep as _sep, altsep as _altsep
+
+
+class Cache(object):
+    def __init__(self, config):
+        self.config = config
+        self._cachedir = config.rootdir.join(".cache")
+        self.trace = config.trace.root.get("cache")
+        if config.getvalue("cacheclear"):
+            self.trace("clearing cachedir")
+            if self._cachedir.check():
+                self._cachedir.remove()
+            self._cachedir.mkdir()
+
+    def makedir(self, name):
+        """ return a directory path object with the given name.  If the
+        directory does not yet exist, it will be created.  You can use it
+        to manage files likes e. g. store/retrieve database
+        dumps across test sessions.
+
+        :param name: must be a string not containing a ``/`` separator.
+             Make sure the name contains your plugin or application
+             identifiers to prevent clashes with other cache users.
+        """
+        if _sep in name or _altsep is not None and _altsep in name:
+            raise ValueError("name is not allowed to contain path separators")
+        return self._cachedir.ensure_dir("d", name)
+
+    def _getvaluepath(self, key):
+        return self._cachedir.join('v', *key.split('/'))
+
+    def get(self, key, default):
+        """ return cached value for the given key.  If no value
+        was yet cached or the value cannot be read, the specified
+        default is returned.
+
+        :param key: must be a ``/`` separated value. Usually the first
+             name is the name of your plugin or your application.
+        :param default: must be provided in case of a cache-miss or
+             invalid cache values.
+
+        """
+        path = self._getvaluepath(key)
+        if path.check():
+            try:
+                with path.open("r") as f:
+                    return json.load(f)
+            except ValueError:
+                self.trace("cache-invalid at %s" % (path,))
+        return default
+
+    def set(self, key, value):
+        """ save value for the given key.
+
+        :param key: must be a ``/`` separated value. Usually the first
+             name is the name of your plugin or your application.
+        :param value: must be of any combination of basic
+               python types, including nested types
+               like e. g. lists of dictionaries.
+        """
+        path = self._getvaluepath(key)
+        try:
+            path.dirpath().ensure_dir()
+        except (py.error.EEXIST, py.error.EACCES):
+            self.config.warn(
+                code='I9', message='could not create cache path %s' % (path,)
+            )
+            return
+        try:
+            f = path.open('w')
+        except py.error.ENOTDIR:
+            self.config.warn(
+                code='I9', message='cache could not write path %s' % (path,))
+        else:
+            with f:
+                self.trace("cache-write %s: %r" % (key, value,))
+                json.dump(value, f, indent=2, sort_keys=True)
+
+
+class LFPlugin:
+    """ Plugin which implements the --lf (run last-failing) option """
+    def __init__(self, config):
+        self.config = config
+        active_keys = 'lf', 'failedfirst'
+        self.active = any(config.getvalue(key) for key in active_keys)
+        if self.active:
+            self.lastfailed = config.cache.get("cache/lastfailed", {})
+        else:
+            self.lastfailed = {}
+
+    def pytest_report_header(self):
+        if self.active:
+            if not self.lastfailed:
+                mode = "run all (no recorded failures)"
+            else:
+                mode = "rerun last %d failures%s" % (
+                    len(self.lastfailed),
+                    " first" if self.config.getvalue("failedfirst") else "")
+            return "run-last-failure: %s" % mode
+
+    def pytest_runtest_logreport(self, report):
+        if report.failed and "xfail" not in report.keywords:
+            self.lastfailed[report.nodeid] = True
+        elif not report.failed:
+            if report.when == "call":
+                self.lastfailed.pop(report.nodeid, None)
+
+    def pytest_collectreport(self, report):
+        passed = report.outcome in ('passed', 'skipped')
+        if passed:
+            if report.nodeid in self.lastfailed:
+                self.lastfailed.pop(report.nodeid)
+                self.lastfailed.update(
+                    (item.nodeid, True)
+                    for item in report.result)
+        else:
+            self.lastfailed[report.nodeid] = True
+
+    def pytest_collection_modifyitems(self, session, config, items):
+        if self.active and self.lastfailed:
+            previously_failed = []
+            previously_passed = []
+            for item in items:
+                if item.nodeid in self.lastfailed:
+                    previously_failed.append(item)
+                else:
+                    previously_passed.append(item)
+            if not previously_failed and previously_passed:
+                # running a subset of all tests with recorded failures outside
+                # of the set of tests currently executing
+                pass
+            elif self.config.getvalue("failedfirst"):
+                items[:] = previously_failed + previously_passed
+            else:
+                items[:] = previously_failed
+                config.hook.pytest_deselected(items=previously_passed)
+
+    def pytest_sessionfinish(self, session):
+        config = self.config
+        if config.getvalue("cacheshow") or hasattr(config, "slaveinput"):
+            return
+        prev_failed = config.cache.get("cache/lastfailed", None) is not None
+        if (session.testscollected and prev_failed) or self.lastfailed:
+            config.cache.set("cache/lastfailed", self.lastfailed)
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group.addoption(
+        '--lf', '--last-failed', action='store_true', dest="lf",
+        help="rerun only the tests that failed "
+             "at the last run (or all if none failed)")
+    group.addoption(
+        '--ff', '--failed-first', action='store_true', dest="failedfirst",
+        help="run all tests but run the last failures first.  "
+             "This may re-order tests and thus lead to "
+             "repeated fixture setup/teardown")
+    group.addoption(
+        '--cache-show', action='store_true', dest="cacheshow",
+        help="show cache contents, don't perform collection or tests")
+    group.addoption(
+        '--cache-clear', action='store_true', dest="cacheclear",
+        help="remove all cache contents at start of test run.")
+
+
+def pytest_cmdline_main(config):
+    if config.option.cacheshow:
+        from _pytest.main import wrap_session
+        return wrap_session(config, cacheshow)
+
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_configure(config):
+    config.cache = Cache(config)
+    config.pluginmanager.register(LFPlugin(config), "lfplugin")
+
+
+@pytest.fixture
+def cache(request):
+    """
+    Return a cache object that can persist state between testing sessions.
+
+    cache.get(key, default)
+    cache.set(key, value)
+
+    Keys must be a ``/`` separated value, where the first part is usually the
+    name of your plugin or application to avoid clashes with other cache users.
+
+    Values can be any object handled by the json stdlib module.
+    """
+    return request.config.cache
+
+
+def pytest_report_header(config):
+    if config.option.verbose:
+        relpath = py.path.local().bestrelpath(config.cache._cachedir)
+        return "cachedir: %s" % relpath
+
+
+def cacheshow(config, session):
+    from pprint import pprint
+    tw = py.io.TerminalWriter()
+    tw.line("cachedir: " + str(config.cache._cachedir))
+    if not config.cache._cachedir.check():
+        tw.line("cache is empty")
+        return 0
+    dummy = object()
+    basedir = config.cache._cachedir
+    vdir = basedir.join("v")
+    tw.sep("-", "cache values")
+    for valpath in vdir.visit(lambda x: x.isfile()):
+        key = valpath.relto(vdir).replace(valpath.sep, "/")
+        val = config.cache.get(key, dummy)
+        if val is dummy:
+            tw.line("%s contains unreadable content, "
+                  "will be ignored" % key)
+        else:
+            tw.line("%s contains:" % key)
+            stream = py.io.TextIO()
+            pprint(val, stream=stream)
+            for line in stream.getvalue().splitlines():
+                tw.line("  " + line)
+
+    ddir = basedir.join("d")
+    if ddir.isdir() and ddir.listdir():
+        tw.sep("-", "cache directories")
+        for p in basedir.join("d").visit():
+            #if p.check(dir=1):
+            #    print("%s/" % p.relto(basedir))
+            if p.isfile():
+                key = p.relto(basedir)
+                tw.line("%s is a file of length %d" % (
+                        key, p.size()))
+    return 0
diff --git a/python/pytest/_pytest/capture.py b/python/pytest/_pytest/capture.py
new file mode 100644
index 000000000..3895a714a
--- /dev/null
+++ b/python/pytest/_pytest/capture.py
@@ -0,0 +1,472 @@
+"""
+per-test stdout/stderr capturing mechanism.
+
+"""
+from __future__ import with_statement
+
+import sys
+import os
+from tempfile import TemporaryFile
+
+import py
+import pytest
+
+from py.io import TextIO
+unicode = py.builtin.text
+
+patchsysdict = {0: 'stdin', 1: 'stdout', 2: 'stderr'}
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group._addoption(
+        '--capture', action="store",
+        default="fd" if hasattr(os, "dup") else "sys",
+        metavar="method", choices=['fd', 'sys', 'no'],
+        help="per-test capturing method: one of fd|sys|no.")
+    group._addoption(
+        '-s', action="store_const", const="no", dest="capture",
+        help="shortcut for --capture=no.")
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_load_initial_conftests(early_config, parser, args):
+    _readline_workaround()
+    ns = early_config.known_args_namespace
+    pluginmanager = early_config.pluginmanager
+    capman = CaptureManager(ns.capture)
+    pluginmanager.register(capman, "capturemanager")
+
+    # make sure that capturemanager is properly reset at final shutdown
+    early_config.add_cleanup(capman.reset_capturings)
+
+    # make sure logging does not raise exceptions at the end
+    def silence_logging_at_shutdown():
+        if "logging" in sys.modules:
+            sys.modules["logging"].raiseExceptions = False
+    early_config.add_cleanup(silence_logging_at_shutdown)
+
+    # finally trigger conftest loading but while capturing (issue93)
+    capman.init_capturings()
+    outcome = yield
+    out, err = capman.suspendcapture()
+    if outcome.excinfo is not None:
+        sys.stdout.write(out)
+        sys.stderr.write(err)
+
+
+class CaptureManager:
+    def __init__(self, method):
+        self._method = method
+
+    def _getcapture(self, method):
+        if method == "fd":
+            return MultiCapture(out=True, err=True, Capture=FDCapture)
+        elif method == "sys":
+            return MultiCapture(out=True, err=True, Capture=SysCapture)
+        elif method == "no":
+            return MultiCapture(out=False, err=False, in_=False)
+        else:
+            raise ValueError("unknown capturing method: %r" % method)
+
+    def init_capturings(self):
+        assert not hasattr(self, "_capturing")
+        self._capturing = self._getcapture(self._method)
+        self._capturing.start_capturing()
+
+    def reset_capturings(self):
+        cap = self.__dict__.pop("_capturing", None)
+        if cap is not None:
+            cap.pop_outerr_to_orig()
+            cap.stop_capturing()
+
+    def resumecapture(self):
+        self._capturing.resume_capturing()
+
+    def suspendcapture(self, in_=False):
+        self.deactivate_funcargs()
+        cap = getattr(self, "_capturing", None)
+        if cap is not None:
+            try:
+                outerr = cap.readouterr()
+            finally:
+                cap.suspend_capturing(in_=in_)
+            return outerr
+
+    def activate_funcargs(self, pyfuncitem):
+        capfuncarg = pyfuncitem.__dict__.pop("_capfuncarg", None)
+        if capfuncarg is not None:
+            capfuncarg._start()
+            self._capfuncarg = capfuncarg
+
+    def deactivate_funcargs(self):
+        capfuncarg = self.__dict__.pop("_capfuncarg", None)
+        if capfuncarg is not None:
+            capfuncarg.close()
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_make_collect_report(self, collector):
+        if isinstance(collector, pytest.File):
+            self.resumecapture()
+            outcome = yield
+            out, err = self.suspendcapture()
+            rep = outcome.get_result()
+            if out:
+                rep.sections.append(("Captured stdout", out))
+            if err:
+                rep.sections.append(("Captured stderr", err))
+        else:
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_setup(self, item):
+        self.resumecapture()
+        yield
+        self.suspendcapture_item(item, "setup")
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_call(self, item):
+        self.resumecapture()
+        self.activate_funcargs(item)
+        yield
+        #self.deactivate_funcargs() called from suspendcapture()
+        self.suspendcapture_item(item, "call")
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_teardown(self, item):
+        self.resumecapture()
+        yield
+        self.suspendcapture_item(item, "teardown")
+
+    @pytest.hookimpl(tryfirst=True)
+    def pytest_keyboard_interrupt(self, excinfo):
+        self.reset_capturings()
+
+    @pytest.hookimpl(tryfirst=True)
+    def pytest_internalerror(self, excinfo):
+        self.reset_capturings()
+
+    def suspendcapture_item(self, item, when):
+        out, err = self.suspendcapture()
+        item.add_report_section(when, "stdout", out)
+        item.add_report_section(when, "stderr", err)
+
+error_capsysfderror = "cannot use capsys and capfd at the same time"
+
+
+@pytest.fixture
+def capsys(request):
+    """enables capturing of writes to sys.stdout/sys.stderr and makes
+    captured output available via ``capsys.readouterr()`` method calls
+    which return a ``(out, err)`` tuple.
+    """
+    if "capfd" in request._funcargs:
+        raise request.raiseerror(error_capsysfderror)
+    request.node._capfuncarg = c = CaptureFixture(SysCapture)
+    return c
+
+@pytest.fixture
+def capfd(request):
+    """enables capturing of writes to file descriptors 1 and 2 and makes
+    captured output available via ``capfd.readouterr()`` method calls
+    which return a ``(out, err)`` tuple.
+    """
+    if "capsys" in request._funcargs:
+        request.raiseerror(error_capsysfderror)
+    if not hasattr(os, 'dup'):
+        pytest.skip("capfd funcarg needs os.dup")
+    request.node._capfuncarg = c = CaptureFixture(FDCapture)
+    return c
+
+
+class CaptureFixture:
+    def __init__(self, captureclass):
+        self.captureclass = captureclass
+
+    def _start(self):
+        self._capture = MultiCapture(out=True, err=True, in_=False,
+                                       Capture=self.captureclass)
+        self._capture.start_capturing()
+
+    def close(self):
+        cap = self.__dict__.pop("_capture", None)
+        if cap is not None:
+            self._outerr = cap.pop_outerr_to_orig()
+            cap.stop_capturing()
+
+    def readouterr(self):
+        try:
+            return self._capture.readouterr()
+        except AttributeError:
+            return self._outerr
+
+
+def safe_text_dupfile(f, mode, default_encoding="UTF8"):
+    """ return a open text file object that's a duplicate of f on the
+        FD-level if possible.
+    """
+    encoding = getattr(f, "encoding", None)
+    try:
+        fd = f.fileno()
+    except Exception:
+        if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"):
+            # we seem to have a text stream, let's just use it
+            return f
+    else:
+        newfd = os.dup(fd)
+        if "b" not in mode:
+            mode += "b"
+        f = os.fdopen(newfd, mode, 0)  # no buffering
+    return EncodedFile(f, encoding or default_encoding)
+
+
+class EncodedFile(object):
+    errors = "strict"  # possibly needed by py3 code (issue555)
+    def __init__(self, buffer, encoding):
+        self.buffer = buffer
+        self.encoding = encoding
+
+    def write(self, obj):
+        if isinstance(obj, unicode):
+            obj = obj.encode(self.encoding, "replace")
+        self.buffer.write(obj)
+
+    def writelines(self, linelist):
+        data = ''.join(linelist)
+        self.write(data)
+
+    def __getattr__(self, name):
+        return getattr(object.__getattribute__(self, "buffer"), name)
+
+
+class MultiCapture(object):
+    out = err = in_ = None
+
+    def __init__(self, out=True, err=True, in_=True, Capture=None):
+        if in_:
+            self.in_ = Capture(0)
+        if out:
+            self.out = Capture(1)
+        if err:
+            self.err = Capture(2)
+
+    def start_capturing(self):
+        if self.in_:
+            self.in_.start()
+        if self.out:
+            self.out.start()
+        if self.err:
+            self.err.start()
+
+    def pop_outerr_to_orig(self):
+        """ pop current snapshot out/err capture and flush to orig streams. """
+        out, err = self.readouterr()
+        if out:
+            self.out.writeorg(out)
+        if err:
+            self.err.writeorg(err)
+        return out, err
+
+    def suspend_capturing(self, in_=False):
+        if self.out:
+            self.out.suspend()
+        if self.err:
+            self.err.suspend()
+        if in_ and self.in_:
+            self.in_.suspend()
+            self._in_suspended = True
+
+    def resume_capturing(self):
+        if self.out:
+            self.out.resume()
+        if self.err:
+            self.err.resume()
+        if hasattr(self, "_in_suspended"):
+            self.in_.resume()
+            del self._in_suspended
+
+    def stop_capturing(self):
+        """ stop capturing and reset capturing streams """
+        if hasattr(self, '_reset'):
+            raise ValueError("was already stopped")
+        self._reset = True
+        if self.out:
+            self.out.done()
+        if self.err:
+            self.err.done()
+        if self.in_:
+            self.in_.done()
+
+    def readouterr(self):
+        """ return snapshot unicode value of stdout/stderr capturings. """
+        return (self.out.snap() if self.out is not None else "",
+                self.err.snap() if self.err is not None else "")
+
+class NoCapture:
+    __init__ = start = done = suspend = resume = lambda *args: None
+
+class FDCapture:
+    """ Capture IO to/from a given os-level filedescriptor. """
+
+    def __init__(self, targetfd, tmpfile=None):
+        self.targetfd = targetfd
+        try:
+            self.targetfd_save = os.dup(self.targetfd)
+        except OSError:
+            self.start = lambda: None
+            self.done = lambda: None
+        else:
+            if targetfd == 0:
+                assert not tmpfile, "cannot set tmpfile with stdin"
+                tmpfile = open(os.devnull, "r")
+                self.syscapture = SysCapture(targetfd)
+            else:
+                if tmpfile is None:
+                    f = TemporaryFile()
+                    with f:
+                        tmpfile = safe_text_dupfile(f, mode="wb+")
+                if targetfd in patchsysdict:
+                    self.syscapture = SysCapture(targetfd, tmpfile)
+                else:
+                    self.syscapture = NoCapture()
+            self.tmpfile = tmpfile
+            self.tmpfile_fd = tmpfile.fileno()
+
+    def __repr__(self):
+        return "<FDCapture %s oldfd=%s>" % (self.targetfd, self.targetfd_save)
+
+    def start(self):
+        """ Start capturing on targetfd using memorized tmpfile. """
+        try:
+            os.fstat(self.targetfd_save)
+        except (AttributeError, OSError):
+            raise ValueError("saved filedescriptor not valid anymore")
+        os.dup2(self.tmpfile_fd, self.targetfd)
+        self.syscapture.start()
+
+    def snap(self):
+        f = self.tmpfile
+        f.seek(0)
+        res = f.read()
+        if res:
+            enc = getattr(f, "encoding", None)
+            if enc and isinstance(res, bytes):
+                res = py.builtin._totext(res, enc, "replace")
+            f.truncate(0)
+            f.seek(0)
+            return res
+        return ''
+
+    def done(self):
+        """ stop capturing, restore streams, return original capture file,
+        seeked to position zero. """
+        targetfd_save = self.__dict__.pop("targetfd_save")
+        os.dup2(targetfd_save, self.targetfd)
+        os.close(targetfd_save)
+        self.syscapture.done()
+        self.tmpfile.close()
+
+    def suspend(self):
+        self.syscapture.suspend()
+        os.dup2(self.targetfd_save, self.targetfd)
+
+    def resume(self):
+        self.syscapture.resume()
+        os.dup2(self.tmpfile_fd, self.targetfd)
+
+    def writeorg(self, data):
+        """ write to original file descriptor. """
+        if py.builtin._istext(data):
+            data = data.encode("utf8") # XXX use encoding of original stream
+        os.write(self.targetfd_save, data)
+
+
+class SysCapture:
+    def __init__(self, fd, tmpfile=None):
+        name = patchsysdict[fd]
+        self._old = getattr(sys, name)
+        self.name = name
+        if tmpfile is None:
+            if name == "stdin":
+                tmpfile = DontReadFromInput()
+            else:
+                tmpfile = TextIO()
+        self.tmpfile = tmpfile
+
+    def start(self):
+        setattr(sys, self.name, self.tmpfile)
+
+    def snap(self):
+        f = self.tmpfile
+        res = f.getvalue()
+        f.truncate(0)
+        f.seek(0)
+        return res
+
+    def done(self):
+        setattr(sys, self.name, self._old)
+        del self._old
+        self.tmpfile.close()
+
+    def suspend(self):
+        setattr(sys, self.name, self._old)
+
+    def resume(self):
+        setattr(sys, self.name, self.tmpfile)
+
+    def writeorg(self, data):
+        self._old.write(data)
+        self._old.flush()
+
+
+class DontReadFromInput:
+    """Temporary stub class.  Ideally when stdin is accessed, the
+    capturing should be turned off, with possibly all data captured
+    so far sent to the screen.  This should be configurable, though,
+    because in automated test runs it is better to crash than
+    hang indefinitely.
+    """
+
+    encoding = None
+
+    def read(self, *args):
+        raise IOError("reading from stdin while output is captured")
+    readline = read
+    readlines = read
+    __iter__ = read
+
+    def fileno(self):
+        raise ValueError("redirected Stdin is pseudofile, has no fileno()")
+
+    def isatty(self):
+        return False
+
+    def close(self):
+        pass
+
+
+def _readline_workaround():
+    """
+    Ensure readline is imported so that it attaches to the correct stdio
+    handles on Windows.
+
+    Pdb uses readline support where available--when not running from the Python
+    prompt, the readline module is not imported until running the pdb REPL.  If
+    running py.test with the --pdb option this means the readline module is not
+    imported until after I/O capture has been started.
+
+    This is a problem for pyreadline, which is often used to implement readline
+    support on Windows, as it does not attach to the correct handles for stdout
+    and/or stdin if they have been redirected by the FDCapture mechanism.  This
+    workaround ensures that readline is imported before I/O capture is setup so
+    that it can attach to the actual stdin/out for the console.
+
+    See https://github.com/pytest-dev/pytest/pull/1281
+    """
+
+    if not sys.platform.startswith('win32'):
+        return
+    try:
+        import readline  # noqa
+    except ImportError:
+        pass
diff --git a/python/pytest/_pytest/config.py b/python/pytest/_pytest/config.py
new file mode 100644
index 000000000..9a308df2b
--- /dev/null
+++ b/python/pytest/_pytest/config.py
@@ -0,0 +1,1192 @@
+""" command line options, ini-file and conftest.py processing. """
+import argparse
+import shlex
+import traceback
+import types
+import warnings
+
+import py
+# DON't import pytest here because it causes import cycle troubles
+import sys, os
+import _pytest._code
+import _pytest.hookspec  # the extension point definitions
+from _pytest._pluggy import PluginManager, HookimplMarker, HookspecMarker
+
+hookimpl = HookimplMarker("pytest")
+hookspec = HookspecMarker("pytest")
+
+# pytest startup
+#
+
+
+class ConftestImportFailure(Exception):
+    def __init__(self, path, excinfo):
+        Exception.__init__(self, path, excinfo)
+        self.path = path
+        self.excinfo = excinfo
+
+
+def main(args=None, plugins=None):
+    """ return exit code, after performing an in-process test run.
+
+    :arg args: list of command line arguments.
+
+    :arg plugins: list of plugin objects to be auto-registered during
+                  initialization.
+    """
+    try:
+        try:
+            config = _prepareconfig(args, plugins)
+        except ConftestImportFailure as e:
+            tw = py.io.TerminalWriter(sys.stderr)
+            for line in traceback.format_exception(*e.excinfo):
+                tw.line(line.rstrip(), red=True)
+            tw.line("ERROR: could not load %s\n" % (e.path), red=True)
+            return 4
+        else:
+            try:
+                config.pluginmanager.check_pending()
+                return config.hook.pytest_cmdline_main(config=config)
+            finally:
+                config._ensure_unconfigure()
+    except UsageError as e:
+        for msg in e.args:
+            sys.stderr.write("ERROR: %s\n" %(msg,))
+        return 4
+
+class cmdline:  # compatibility namespace
+    main = staticmethod(main)
+
+class UsageError(Exception):
+    """ error in pytest usage or invocation"""
+
+_preinit = []
+
+default_plugins = (
+     "mark main terminal runner python pdb unittest capture skipping "
+     "tmpdir monkeypatch recwarn pastebin helpconfig nose assertion genscript "
+     "junitxml resultlog doctest cacheprovider").split()
+
+builtin_plugins = set(default_plugins)
+builtin_plugins.add("pytester")
+
+
+def _preloadplugins():
+    assert not _preinit
+    _preinit.append(get_config())
+
+def get_config():
+    if _preinit:
+        return _preinit.pop(0)
+    # subsequent calls to main will create a fresh instance
+    pluginmanager = PytestPluginManager()
+    config = Config(pluginmanager)
+    for spec in default_plugins:
+        pluginmanager.import_plugin(spec)
+    return config
+
+def get_plugin_manager():
+    """
+    Obtain a new instance of the
+    :py:class:`_pytest.config.PytestPluginManager`, with default plugins
+    already loaded.
+
+    This function can be used by integration with other tools, like hooking
+    into pytest to run tests into an IDE.
+    """
+    return get_config().pluginmanager
+
+def _prepareconfig(args=None, plugins=None):
+    if args is None:
+        args = sys.argv[1:]
+    elif isinstance(args, py.path.local):
+        args = [str(args)]
+    elif not isinstance(args, (tuple, list)):
+        if not isinstance(args, str):
+            raise ValueError("not a string or argument list: %r" % (args,))
+        args = shlex.split(args, posix=sys.platform != "win32")
+    config = get_config()
+    pluginmanager = config.pluginmanager
+    try:
+        if plugins:
+            for plugin in plugins:
+                if isinstance(plugin, py.builtin._basestring):
+                    pluginmanager.consider_pluginarg(plugin)
+                else:
+                    pluginmanager.register(plugin)
+        return pluginmanager.hook.pytest_cmdline_parse(
+                pluginmanager=pluginmanager, args=args)
+    except BaseException:
+        config._ensure_unconfigure()
+        raise
+
+
+class PytestPluginManager(PluginManager):
+    """
+    Overwrites :py:class:`pluggy.PluginManager` to add pytest-specific
+    functionality:
+
+    * loading plugins from the command line, ``PYTEST_PLUGIN`` env variable and
+      ``pytest_plugins`` global variables found in plugins being loaded;
+    * ``conftest.py`` loading during start-up;
+    """
+    def __init__(self):
+        super(PytestPluginManager, self).__init__("pytest", implprefix="pytest_")
+        self._conftest_plugins = set()
+
+        # state related to local conftest plugins
+        self._path2confmods = {}
+        self._conftestpath2mod = {}
+        self._confcutdir = None
+        self._noconftest = False
+
+        self.add_hookspecs(_pytest.hookspec)
+        self.register(self)
+        if os.environ.get('PYTEST_DEBUG'):
+            err = sys.stderr
+            encoding = getattr(err, 'encoding', 'utf8')
+            try:
+                err = py.io.dupfile(err, encoding=encoding)
+            except Exception:
+                pass
+            self.trace.root.setwriter(err.write)
+            self.enable_tracing()
+
+    def addhooks(self, module_or_class):
+        """
+        .. deprecated:: 2.8
+
+        Use :py:meth:`pluggy.PluginManager.add_hookspecs` instead.
+        """
+        warning = dict(code="I2",
+                       fslocation=_pytest._code.getfslineno(sys._getframe(1)),
+                       nodeid=None,
+                       message="use pluginmanager.add_hookspecs instead of "
+                               "deprecated addhooks() method.")
+        self._warn(warning)
+        return self.add_hookspecs(module_or_class)
+
+    def parse_hookimpl_opts(self, plugin, name):
+        # pytest hooks are always prefixed with pytest_
+        # so we avoid accessing possibly non-readable attributes
+        # (see issue #1073)
+        if not name.startswith("pytest_"):
+            return
+        # ignore some historic special names which can not be hooks anyway
+        if name == "pytest_plugins" or name.startswith("pytest_funcarg__"):
+            return
+
+        method = getattr(plugin, name)
+        opts = super(PytestPluginManager, self).parse_hookimpl_opts(plugin, name)
+        if opts is not None:
+            for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"):
+                opts.setdefault(name, hasattr(method, name))
+        return opts
+
+    def parse_hookspec_opts(self, module_or_class, name):
+        opts = super(PytestPluginManager, self).parse_hookspec_opts(
+                                                module_or_class, name)
+        if opts is None:
+            method = getattr(module_or_class, name)
+            if name.startswith("pytest_"):
+                opts = {"firstresult": hasattr(method, "firstresult"),
+                        "historic": hasattr(method, "historic")}
+        return opts
+
+    def _verify_hook(self, hook, hookmethod):
+        super(PytestPluginManager, self)._verify_hook(hook, hookmethod)
+        if "__multicall__" in hookmethod.argnames:
+            fslineno = _pytest._code.getfslineno(hookmethod.function)
+            warning = dict(code="I1",
+                           fslocation=fslineno,
+                           nodeid=None,
+                           message="%r hook uses deprecated __multicall__ "
+                                   "argument" % (hook.name))
+            self._warn(warning)
+
+    def register(self, plugin, name=None):
+        ret = super(PytestPluginManager, self).register(plugin, name)
+        if ret:
+            self.hook.pytest_plugin_registered.call_historic(
+                      kwargs=dict(plugin=plugin, manager=self))
+        return ret
+
+    def getplugin(self, name):
+        # support deprecated naming because plugins (xdist e.g.) use it
+        return self.get_plugin(name)
+
+    def hasplugin(self, name):
+        """Return True if the plugin with the given name is registered."""
+        return bool(self.get_plugin(name))
+
+    def pytest_configure(self, config):
+        # XXX now that the pluginmanager exposes hookimpl(tryfirst...)
+        # we should remove tryfirst/trylast as markers
+        config.addinivalue_line("markers",
+            "tryfirst: mark a hook implementation function such that the "
+            "plugin machinery will try to call it first/as early as possible.")
+        config.addinivalue_line("markers",
+            "trylast: mark a hook implementation function such that the "
+            "plugin machinery will try to call it last/as late as possible.")
+
+    def _warn(self, message):
+        kwargs = message if isinstance(message, dict) else {
+            'code': 'I1',
+            'message': message,
+            'fslocation': None,
+            'nodeid': None,
+        }
+        self.hook.pytest_logwarning.call_historic(kwargs=kwargs)
+
+    #
+    # internal API for local conftest plugin handling
+    #
+    def _set_initial_conftests(self, namespace):
+        """ load initial conftest files given a preparsed "namespace".
+            As conftest files may add their own command line options
+            which have arguments ('--my-opt somepath') we might get some
+            false positives.  All builtin and 3rd party plugins will have
+            been loaded, however, so common options will not confuse our logic
+            here.
+        """
+        current = py.path.local()
+        self._confcutdir = current.join(namespace.confcutdir, abs=True) \
+                                if namespace.confcutdir else None
+        self._noconftest = namespace.noconftest
+        testpaths = namespace.file_or_dir
+        foundanchor = False
+        for path in testpaths:
+            path = str(path)
+            # remove node-id syntax
+            i = path.find("::")
+            if i != -1:
+                path = path[:i]
+            anchor = current.join(path, abs=1)
+            if exists(anchor): # we found some file object
+                self._try_load_conftest(anchor)
+                foundanchor = True
+        if not foundanchor:
+            self._try_load_conftest(current)
+
+    def _try_load_conftest(self, anchor):
+        self._getconftestmodules(anchor)
+        # let's also consider test* subdirs
+        if anchor.check(dir=1):
+            for x in anchor.listdir("test*"):
+                if x.check(dir=1):
+                    self._getconftestmodules(x)
+
+    def _getconftestmodules(self, path):
+        if self._noconftest:
+            return []
+        try:
+            return self._path2confmods[path]
+        except KeyError:
+            if path.isfile():
+                clist = self._getconftestmodules(path.dirpath())
+            else:
+                # XXX these days we may rather want to use config.rootdir
+                # and allow users to opt into looking into the rootdir parent
+                # directories instead of requiring to specify confcutdir
+                clist = []
+                for parent in path.parts():
+                    if self._confcutdir and self._confcutdir.relto(parent):
+                        continue
+                    conftestpath = parent.join("conftest.py")
+                    if conftestpath.isfile():
+                        mod = self._importconftest(conftestpath)
+                        clist.append(mod)
+
+            self._path2confmods[path] = clist
+            return clist
+
+    def _rget_with_confmod(self, name, path):
+        modules = self._getconftestmodules(path)
+        for mod in reversed(modules):
+            try:
+                return mod, getattr(mod, name)
+            except AttributeError:
+                continue
+        raise KeyError(name)
+
+    def _importconftest(self, conftestpath):
+        try:
+            return self._conftestpath2mod[conftestpath]
+        except KeyError:
+            pkgpath = conftestpath.pypkgpath()
+            if pkgpath is None:
+                _ensure_removed_sysmodule(conftestpath.purebasename)
+            try:
+                mod = conftestpath.pyimport()
+            except Exception:
+                raise ConftestImportFailure(conftestpath, sys.exc_info())
+
+            self._conftest_plugins.add(mod)
+            self._conftestpath2mod[conftestpath] = mod
+            dirpath = conftestpath.dirpath()
+            if dirpath in self._path2confmods:
+                for path, mods in self._path2confmods.items():
+                    if path and path.relto(dirpath) or path == dirpath:
+                        assert mod not in mods
+                        mods.append(mod)
+            self.trace("loaded conftestmodule %r" %(mod))
+            self.consider_conftest(mod)
+            return mod
+
+    #
+    # API for bootstrapping plugin loading
+    #
+    #
+
+    def consider_preparse(self, args):
+        for opt1,opt2 in zip(args, args[1:]):
+            if opt1 == "-p":
+                self.consider_pluginarg(opt2)
+
+    def consider_pluginarg(self, arg):
+        if arg.startswith("no:"):
+            name = arg[3:]
+            self.set_blocked(name)
+            if not name.startswith("pytest_"):
+                self.set_blocked("pytest_" + name)
+        else:
+            self.import_plugin(arg)
+
+    def consider_conftest(self, conftestmodule):
+        if self.register(conftestmodule, name=conftestmodule.__file__):
+            self.consider_module(conftestmodule)
+
+    def consider_env(self):
+        self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS"))
+
+    def consider_module(self, mod):
+        self._import_plugin_specs(getattr(mod, "pytest_plugins", None))
+
+    def _import_plugin_specs(self, spec):
+        if spec:
+            if isinstance(spec, str):
+                spec = spec.split(",")
+            for import_spec in spec:
+                self.import_plugin(import_spec)
+
+    def import_plugin(self, modname):
+        # most often modname refers to builtin modules, e.g. "pytester",
+        # "terminal" or "capture".  Those plugins are registered under their
+        # basename for historic purposes but must be imported with the
+        # _pytest prefix.
+        assert isinstance(modname, str)
+        if self.get_plugin(modname) is not None:
+            return
+        if modname in builtin_plugins:
+            importspec = "_pytest." + modname
+        else:
+            importspec = modname
+        try:
+            __import__(importspec)
+        except ImportError as e:
+            new_exc = ImportError('Error importing plugin "%s": %s' % (modname, e))
+            # copy over name and path attributes
+            for attr in ('name', 'path'):
+                if hasattr(e, attr):
+                    setattr(new_exc, attr, getattr(e, attr))
+            raise new_exc
+        except Exception as e:
+            import pytest
+            if not hasattr(pytest, 'skip') or not isinstance(e, pytest.skip.Exception):
+                raise
+            self._warn("skipped plugin %r: %s" %((modname, e.msg)))
+        else:
+            mod = sys.modules[importspec]
+            self.register(mod, modname)
+            self.consider_module(mod)
+
+
+class Parser:
+    """ Parser for command line arguments and ini-file values.
+
+    :ivar extra_info: dict of generic param -> value to display in case
+        there's an error processing the command line arguments.
+    """
+
+    def __init__(self, usage=None, processopt=None):
+        self._anonymous = OptionGroup("custom options", parser=self)
+        self._groups = []
+        self._processopt = processopt
+        self._usage = usage
+        self._inidict = {}
+        self._ininames = []
+        self.extra_info = {}
+
+    def processoption(self, option):
+        if self._processopt:
+            if option.dest:
+                self._processopt(option)
+
+    def getgroup(self, name, description="", after=None):
+        """ get (or create) a named option Group.
+
+        :name: name of the option group.
+        :description: long description for --help output.
+        :after: name of other group, used for ordering --help output.
+
+        The returned group object has an ``addoption`` method with the same
+        signature as :py:func:`parser.addoption
+        <_pytest.config.Parser.addoption>` but will be shown in the
+        respective group in the output of ``pytest. --help``.
+        """
+        for group in self._groups:
+            if group.name == name:
+                return group
+        group = OptionGroup(name, description, parser=self)
+        i = 0
+        for i, grp in enumerate(self._groups):
+            if grp.name == after:
+                break
+        self._groups.insert(i+1, group)
+        return group
+
+    def addoption(self, *opts, **attrs):
+        """ register a command line option.
+
+        :opts: option names, can be short or long options.
+        :attrs: same attributes which the ``add_option()`` function of the
+           `argparse library
+           <http://docs.python.org/2/library/argparse.html>`_
+           accepts.
+
+        After command line parsing options are available on the pytest config
+        object via ``config.option.NAME`` where ``NAME`` is usually set
+        by passing a ``dest`` attribute, for example
+        ``addoption("--long", dest="NAME", ...)``.
+        """
+        self._anonymous.addoption(*opts, **attrs)
+
+    def parse(self, args, namespace=None):
+        from _pytest._argcomplete import try_argcomplete
+        self.optparser = self._getparser()
+        try_argcomplete(self.optparser)
+        return self.optparser.parse_args([str(x) for x in args], namespace=namespace)
+
+    def _getparser(self):
+        from _pytest._argcomplete import filescompleter
+        optparser = MyOptionParser(self, self.extra_info)
+        groups = self._groups + [self._anonymous]
+        for group in groups:
+            if group.options:
+                desc = group.description or group.name
+                arggroup = optparser.add_argument_group(desc)
+                for option in group.options:
+                    n = option.names()
+                    a = option.attrs()
+                    arggroup.add_argument(*n, **a)
+        # bash like autocompletion for dirs (appending '/')
+        optparser.add_argument(FILE_OR_DIR, nargs='*').completer=filescompleter
+        return optparser
+
+    def parse_setoption(self, args, option, namespace=None):
+        parsedoption = self.parse(args, namespace=namespace)
+        for name, value in parsedoption.__dict__.items():
+            setattr(option, name, value)
+        return getattr(parsedoption, FILE_OR_DIR)
+
+    def parse_known_args(self, args, namespace=None):
+        """parses and returns a namespace object with known arguments at this
+        point.
+        """
+        return self.parse_known_and_unknown_args(args, namespace=namespace)[0]
+
+    def parse_known_and_unknown_args(self, args, namespace=None):
+        """parses and returns a namespace object with known arguments, and
+        the remaining arguments unknown at this point.
+        """
+        optparser = self._getparser()
+        args = [str(x) for x in args]
+        return optparser.parse_known_args(args, namespace=namespace)
+
+    def addini(self, name, help, type=None, default=None):
+        """ register an ini-file option.
+
+        :name: name of the ini-variable
+        :type: type of the variable, can be ``pathlist``, ``args``, ``linelist``
+               or ``bool``.
+        :default: default value if no ini-file option exists but is queried.
+
+        The value of ini-variables can be retrieved via a call to
+        :py:func:`config.getini(name) <_pytest.config.Config.getini>`.
+        """
+        assert type in (None, "pathlist", "args", "linelist", "bool")
+        self._inidict[name] = (help, type, default)
+        self._ininames.append(name)
+
+
+class ArgumentError(Exception):
+    """
+    Raised if an Argument instance is created with invalid or
+    inconsistent arguments.
+    """
+
+    def __init__(self, msg, option):
+        self.msg = msg
+        self.option_id = str(option)
+
+    def __str__(self):
+        if self.option_id:
+            return "option %s: %s" % (self.option_id, self.msg)
+        else:
+            return self.msg
+
+
+class Argument:
+    """class that mimics the necessary behaviour of optparse.Option """
+    _typ_map = {
+        'int': int,
+        'string': str,
+        }
+    # enable after some grace period for plugin writers
+    TYPE_WARN = False
+
+    def __init__(self, *names, **attrs):
+        """store parms in private vars for use in add_argument"""
+        self._attrs = attrs
+        self._short_opts = []
+        self._long_opts = []
+        self.dest = attrs.get('dest')
+        if self.TYPE_WARN:
+            try:
+                help = attrs['help']
+                if '%default' in help:
+                    warnings.warn(
+                        'pytest now uses argparse. "%default" should be'
+                        ' changed to "%(default)s" ',
+                        FutureWarning,
+                        stacklevel=3)
+            except KeyError:
+                pass
+        try:
+            typ = attrs['type']
+        except KeyError:
+            pass
+        else:
+            # this might raise a keyerror as well, don't want to catch that
+            if isinstance(typ, py.builtin._basestring):
+                if typ == 'choice':
+                    if self.TYPE_WARN:
+                        warnings.warn(
+                            'type argument to addoption() is a string %r.'
+                            ' For parsearg this is optional and when supplied '
+                            ' should be a type.'
+                            ' (options: %s)' % (typ, names),
+                            FutureWarning,
+                            stacklevel=3)
+                    # argparse expects a type here take it from
+                    # the type of the first element
+                    attrs['type'] = type(attrs['choices'][0])
+                else:
+                    if self.TYPE_WARN:
+                        warnings.warn(
+                            'type argument to addoption() is a string %r.'
+                            ' For parsearg this should be a type.'
+                            ' (options: %s)' % (typ, names),
+                            FutureWarning,
+                            stacklevel=3)
+                    attrs['type'] = Argument._typ_map[typ]
+                # used in test_parseopt -> test_parse_defaultgetter
+                self.type = attrs['type']
+            else:
+                self.type = typ
+        try:
+            # attribute existence is tested in Config._processopt
+            self.default = attrs['default']
+        except KeyError:
+            pass
+        self._set_opt_strings(names)
+        if not self.dest:
+            if self._long_opts:
+                self.dest = self._long_opts[0][2:].replace('-', '_')
+            else:
+                try:
+                    self.dest = self._short_opts[0][1:]
+                except IndexError:
+                    raise ArgumentError(
+                        'need a long or short option', self)
+
+    def names(self):
+        return self._short_opts + self._long_opts
+
+    def attrs(self):
+        # update any attributes set by processopt
+        attrs = 'default dest help'.split()
+        if self.dest:
+            attrs.append(self.dest)
+        for attr in attrs:
+            try:
+                self._attrs[attr] = getattr(self, attr)
+            except AttributeError:
+                pass
+        if self._attrs.get('help'):
+            a = self._attrs['help']
+            a = a.replace('%default', '%(default)s')
+            #a = a.replace('%prog', '%(prog)s')
+            self._attrs['help'] = a
+        return self._attrs
+
+    def _set_opt_strings(self, opts):
+        """directly from optparse
+
+        might not be necessary as this is passed to argparse later on"""
+        for opt in opts:
+            if len(opt) < 2:
+                raise ArgumentError(
+                    "invalid option string %r: "
+                    "must be at least two characters long" % opt, self)
+            elif len(opt) == 2:
+                if not (opt[0] == "-" and opt[1] != "-"):
+                    raise ArgumentError(
+                        "invalid short option string %r: "
+                        "must be of the form -x, (x any non-dash char)" % opt,
+                        self)
+                self._short_opts.append(opt)
+            else:
+                if not (opt[0:2] == "--" and opt[2] != "-"):
+                    raise ArgumentError(
+                        "invalid long option string %r: "
+                        "must start with --, followed by non-dash" % opt,
+                        self)
+                self._long_opts.append(opt)
+
+    def __repr__(self):
+        retval = 'Argument('
+        if self._short_opts:
+            retval += '_short_opts: ' + repr(self._short_opts) + ', '
+        if self._long_opts:
+            retval += '_long_opts: ' + repr(self._long_opts) + ', '
+        retval += 'dest: ' + repr(self.dest) + ', '
+        if hasattr(self, 'type'):
+            retval += 'type: ' + repr(self.type) + ', '
+        if hasattr(self, 'default'):
+            retval += 'default: ' + repr(self.default) + ', '
+        if retval[-2:] == ', ':  # always long enough to test ("Argument(" )
+            retval = retval[:-2]
+        retval += ')'
+        return retval
+
+
+class OptionGroup:
+    def __init__(self, name, description="", parser=None):
+        self.name = name
+        self.description = description
+        self.options = []
+        self.parser = parser
+
+    def addoption(self, *optnames, **attrs):
+        """ add an option to this group.
+
+        if a shortened version of a long option is specified it will
+        be suppressed in the help. addoption('--twowords', '--two-words')
+        results in help showing '--two-words' only, but --twowords gets
+        accepted **and** the automatic destination is in args.twowords
+        """
+        option = Argument(*optnames, **attrs)
+        self._addoption_instance(option, shortupper=False)
+
+    def _addoption(self, *optnames, **attrs):
+        option = Argument(*optnames, **attrs)
+        self._addoption_instance(option, shortupper=True)
+
+    def _addoption_instance(self, option, shortupper=False):
+        if not shortupper:
+            for opt in option._short_opts:
+                if opt[0] == '-' and opt[1].islower():
+                    raise ValueError("lowercase shortoptions reserved")
+        if self.parser:
+            self.parser.processoption(option)
+        self.options.append(option)
+
+
+class MyOptionParser(argparse.ArgumentParser):
+    def __init__(self, parser, extra_info=None):
+        if not extra_info:
+            extra_info = {}
+        self._parser = parser
+        argparse.ArgumentParser.__init__(self, usage=parser._usage,
+            add_help=False, formatter_class=DropShorterLongHelpFormatter)
+        # extra_info is a dict of (param -> value) to display if there's
+        # an usage error to provide more contextual information to the user
+        self.extra_info = extra_info
+
+    def parse_args(self, args=None, namespace=None):
+        """allow splitting of positional arguments"""
+        args, argv = self.parse_known_args(args, namespace)
+        if argv:
+            for arg in argv:
+                if arg and arg[0] == '-':
+                    lines = ['unrecognized arguments: %s' % (' '.join(argv))]
+                    for k, v in sorted(self.extra_info.items()):
+                        lines.append('  %s: %s' % (k, v))
+                    self.error('\n'.join(lines))
+            getattr(args, FILE_OR_DIR).extend(argv)
+        return args
+
+
+class DropShorterLongHelpFormatter(argparse.HelpFormatter):
+    """shorten help for long options that differ only in extra hyphens
+
+    - collapse **long** options that are the same except for extra hyphens
+    - special action attribute map_long_option allows surpressing additional
+      long options
+    - shortcut if there are only two options and one of them is a short one
+    - cache result on action object as this is called at least 2 times
+    """
+    def _format_action_invocation(self, action):
+        orgstr = argparse.HelpFormatter._format_action_invocation(self, action)
+        if orgstr and orgstr[0] != '-': # only optional arguments
+            return orgstr
+        res = getattr(action, '_formatted_action_invocation', None)
+        if res:
+            return res
+        options = orgstr.split(', ')
+        if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2):
+            # a shortcut for '-h, --help' or '--abc', '-a'
+            action._formatted_action_invocation = orgstr
+            return orgstr
+        return_list = []
+        option_map =  getattr(action, 'map_long_option', {})
+        if option_map is None:
+            option_map = {}
+        short_long = {}
+        for option in options:
+            if len(option) == 2 or option[2] == ' ':
+                continue
+            if not option.startswith('--'):
+                raise ArgumentError('long optional argument without "--": [%s]'
+                                    % (option), self)
+            xxoption = option[2:]
+            if xxoption.split()[0] not in option_map:
+                shortened = xxoption.replace('-', '')
+                if shortened not in short_long or \
+                   len(short_long[shortened]) < len(xxoption):
+                    short_long[shortened] = xxoption
+        # now short_long has been filled out to the longest with dashes
+        # **and** we keep the right option ordering from add_argument
+        for option in options: #
+            if len(option) == 2 or option[2] == ' ':
+                return_list.append(option)
+            if option[2:] == short_long.get(option.replace('-', '')):
+                return_list.append(option.replace(' ', '='))
+        action._formatted_action_invocation = ', '.join(return_list)
+        return action._formatted_action_invocation
+
+
+
+def _ensure_removed_sysmodule(modname):
+    try:
+        del sys.modules[modname]
+    except KeyError:
+        pass
+
+class CmdOptions(object):
+    """ holds cmdline options as attributes."""
+    def __init__(self, values=()):
+        self.__dict__.update(values)
+    def __repr__(self):
+        return "<CmdOptions %r>" %(self.__dict__,)
+    def copy(self):
+        return CmdOptions(self.__dict__)
+
+class Notset:
+    def __repr__(self):
+        return "<NOTSET>"
+
+notset = Notset()
+FILE_OR_DIR = 'file_or_dir'
+
+class Config(object):
+    """ access to configuration values, pluginmanager and plugin hooks.  """
+
+    def __init__(self, pluginmanager):
+        #: access to command line option as attributes.
+        #: (deprecated), use :py:func:`getoption() <_pytest.config.Config.getoption>` instead
+        self.option = CmdOptions()
+        _a = FILE_OR_DIR
+        self._parser = Parser(
+            usage="%%(prog)s [options] [%s] [%s] [...]" % (_a, _a),
+            processopt=self._processopt,
+        )
+        #: a pluginmanager instance
+        self.pluginmanager = pluginmanager
+        self.trace = self.pluginmanager.trace.root.get("config")
+        self.hook = self.pluginmanager.hook
+        self._inicache = {}
+        self._opt2dest = {}
+        self._cleanup = []
+        self._warn = self.pluginmanager._warn
+        self.pluginmanager.register(self, "pytestconfig")
+        self._configured = False
+        def do_setns(dic):
+            import pytest
+            setns(pytest, dic)
+        self.hook.pytest_namespace.call_historic(do_setns, {})
+        self.hook.pytest_addoption.call_historic(kwargs=dict(parser=self._parser))
+
+    def add_cleanup(self, func):
+        """ Add a function to be called when the config object gets out of
+        use (usually coninciding with pytest_unconfigure)."""
+        self._cleanup.append(func)
+
+    def _do_configure(self):
+        assert not self._configured
+        self._configured = True
+        self.hook.pytest_configure.call_historic(kwargs=dict(config=self))
+
+    def _ensure_unconfigure(self):
+        if self._configured:
+            self._configured = False
+            self.hook.pytest_unconfigure(config=self)
+            self.hook.pytest_configure._call_history = []
+        while self._cleanup:
+            fin = self._cleanup.pop()
+            fin()
+
+    def warn(self, code, message, fslocation=None):
+        """ generate a warning for this test session. """
+        self.hook.pytest_logwarning.call_historic(kwargs=dict(
+            code=code, message=message,
+            fslocation=fslocation, nodeid=None))
+
+    def get_terminal_writer(self):
+        return self.pluginmanager.get_plugin("terminalreporter")._tw
+
+    def pytest_cmdline_parse(self, pluginmanager, args):
+        # REF1 assert self == pluginmanager.config, (self, pluginmanager.config)
+        self.parse(args)
+        return self
+
+    def notify_exception(self, excinfo, option=None):
+        if option and option.fulltrace:
+            style = "long"
+        else:
+            style = "native"
+        excrepr = excinfo.getrepr(funcargs=True,
+            showlocals=getattr(option, 'showlocals', False),
+            style=style,
+        )
+        res = self.hook.pytest_internalerror(excrepr=excrepr,
+                                             excinfo=excinfo)
+        if not py.builtin.any(res):
+            for line in str(excrepr).split("\n"):
+                sys.stderr.write("INTERNALERROR> %s\n" %line)
+                sys.stderr.flush()
+
+    def cwd_relative_nodeid(self, nodeid):
+        # nodeid's are relative to the rootpath, compute relative to cwd
+        if self.invocation_dir != self.rootdir:
+            fullpath = self.rootdir.join(nodeid)
+            nodeid = self.invocation_dir.bestrelpath(fullpath)
+        return nodeid
+
+    @classmethod
+    def fromdictargs(cls, option_dict, args):
+        """ constructor useable for subprocesses. """
+        config = get_config()
+        config.option.__dict__.update(option_dict)
+        config.parse(args, addopts=False)
+        for x in config.option.plugins:
+            config.pluginmanager.consider_pluginarg(x)
+        return config
+
+    def _processopt(self, opt):
+        for name in opt._short_opts + opt._long_opts:
+            self._opt2dest[name] = opt.dest
+
+        if hasattr(opt, 'default') and opt.dest:
+            if not hasattr(self.option, opt.dest):
+                setattr(self.option, opt.dest, opt.default)
+
+    @hookimpl(trylast=True)
+    def pytest_load_initial_conftests(self, early_config):
+        self.pluginmanager._set_initial_conftests(early_config.known_args_namespace)
+
+    def _initini(self, args):
+        ns, unknown_args = self._parser.parse_known_and_unknown_args(args, namespace=self.option.copy())
+        r = determine_setup(ns.inifilename, ns.file_or_dir + unknown_args)
+        self.rootdir, self.inifile, self.inicfg = r
+        self._parser.extra_info['rootdir'] = self.rootdir
+        self._parser.extra_info['inifile'] = self.inifile
+        self.invocation_dir = py.path.local()
+        self._parser.addini('addopts', 'extra command line options', 'args')
+        self._parser.addini('minversion', 'minimally required pytest version')
+
+    def _preparse(self, args, addopts=True):
+        self._initini(args)
+        if addopts:
+            args[:] = shlex.split(os.environ.get('PYTEST_ADDOPTS', '')) + args
+            args[:] = self.getini("addopts") + args
+        self._checkversion()
+        self.pluginmanager.consider_preparse(args)
+        try:
+            self.pluginmanager.load_setuptools_entrypoints("pytest11")
+        except ImportError as e:
+            self.warn("I2", "could not load setuptools entry import: %s" % (e,))
+        self.pluginmanager.consider_env()
+        self.known_args_namespace = ns = self._parser.parse_known_args(args, namespace=self.option.copy())
+        if self.known_args_namespace.confcutdir is None and self.inifile:
+            confcutdir = py.path.local(self.inifile).dirname
+            self.known_args_namespace.confcutdir = confcutdir
+        try:
+            self.hook.pytest_load_initial_conftests(early_config=self,
+                    args=args, parser=self._parser)
+        except ConftestImportFailure:
+            e = sys.exc_info()[1]
+            if ns.help or ns.version:
+                # we don't want to prevent --help/--version to work
+                # so just let is pass and print a warning at the end
+                self._warn("could not load initial conftests (%s)\n" % e.path)
+            else:
+                raise
+
+    def _checkversion(self):
+        import pytest
+        minver = self.inicfg.get('minversion', None)
+        if minver:
+            ver = minver.split(".")
+            myver = pytest.__version__.split(".")
+            if myver < ver:
+                raise pytest.UsageError(
+                    "%s:%d: requires pytest-%s, actual pytest-%s'" %(
+                    self.inicfg.config.path, self.inicfg.lineof('minversion'),
+                    minver, pytest.__version__))
+
+    def parse(self, args, addopts=True):
+        # parse given cmdline arguments into this config object.
+        assert not hasattr(self, 'args'), (
+                "can only parse cmdline args at most once per Config object")
+        self._origargs = args
+        self.hook.pytest_addhooks.call_historic(
+                                  kwargs=dict(pluginmanager=self.pluginmanager))
+        self._preparse(args, addopts=addopts)
+        # XXX deprecated hook:
+        self.hook.pytest_cmdline_preparse(config=self, args=args)
+        args = self._parser.parse_setoption(args, self.option, namespace=self.option)
+        if not args:
+            cwd = os.getcwd()
+            if cwd == self.rootdir:
+                args = self.getini('testpaths')
+            if not args:
+                args = [cwd]
+        self.args = args
+
+    def addinivalue_line(self, name, line):
+        """ add a line to an ini-file option. The option must have been
+        declared but might not yet be set in which case the line becomes the
+        the first line in its value. """
+        x = self.getini(name)
+        assert isinstance(x, list)
+        x.append(line) # modifies the cached list inline
+
+    def getini(self, name):
+        """ return configuration value from an :ref:`ini file <inifiles>`. If the
+        specified name hasn't been registered through a prior
+        :py:func:`parser.addini <pytest.config.Parser.addini>`
+        call (usually from a plugin), a ValueError is raised. """
+        try:
+            return self._inicache[name]
+        except KeyError:
+            self._inicache[name] = val = self._getini(name)
+            return val
+
+    def _getini(self, name):
+        try:
+            description, type, default = self._parser._inidict[name]
+        except KeyError:
+            raise ValueError("unknown configuration value: %r" %(name,))
+        try:
+            value = self.inicfg[name]
+        except KeyError:
+            if default is not None:
+                return default
+            if type is None:
+                return ''
+            return []
+        if type == "pathlist":
+            dp = py.path.local(self.inicfg.config.path).dirpath()
+            l = []
+            for relpath in shlex.split(value):
+                l.append(dp.join(relpath, abs=True))
+            return l
+        elif type == "args":
+            return shlex.split(value)
+        elif type == "linelist":
+            return [t for t in map(lambda x: x.strip(), value.split("\n")) if t]
+        elif type == "bool":
+            return bool(_strtobool(value.strip()))
+        else:
+            assert type is None
+            return value
+
+    def _getconftest_pathlist(self, name, path):
+        try:
+            mod, relroots = self.pluginmanager._rget_with_confmod(name, path)
+        except KeyError:
+            return None
+        modpath = py.path.local(mod.__file__).dirpath()
+        l = []
+        for relroot in relroots:
+            if not isinstance(relroot, py.path.local):
+                relroot = relroot.replace("/", py.path.local.sep)
+                relroot = modpath.join(relroot, abs=True)
+            l.append(relroot)
+        return l
+
+    def getoption(self, name, default=notset, skip=False):
+        """ return command line option value.
+
+        :arg name: name of the option.  You may also specify
+            the literal ``--OPT`` option instead of the "dest" option name.
+        :arg default: default value if no option of that name exists.
+        :arg skip: if True raise pytest.skip if option does not exists
+            or has a None value.
+        """
+        name = self._opt2dest.get(name, name)
+        try:
+            val = getattr(self.option, name)
+            if val is None and skip:
+                raise AttributeError(name)
+            return val
+        except AttributeError:
+            if default is not notset:
+                return default
+            if skip:
+                import pytest
+                pytest.skip("no %r option found" %(name,))
+            raise ValueError("no option named %r" % (name,))
+
+    def getvalue(self, name, path=None):
+        """ (deprecated, use getoption()) """
+        return self.getoption(name)
+
+    def getvalueorskip(self, name, path=None):
+        """ (deprecated, use getoption(skip=True)) """
+        return self.getoption(name, skip=True)
+
+def exists(path, ignore=EnvironmentError):
+    try:
+        return path.check()
+    except ignore:
+        return False
+
+def getcfg(args, inibasenames):
+    args = [x for x in args if not str(x).startswith("-")]
+    if not args:
+        args = [py.path.local()]
+    for arg in args:
+        arg = py.path.local(arg)
+        for base in arg.parts(reverse=True):
+            for inibasename in inibasenames:
+                p = base.join(inibasename)
+                if exists(p):
+                    iniconfig = py.iniconfig.IniConfig(p)
+                    if 'pytest' in iniconfig.sections:
+                        return base, p, iniconfig['pytest']
+                    elif inibasename == "pytest.ini":
+                        # allowed to be empty
+                        return base, p, {}
+    return None, None, None
+
+
+def get_common_ancestor(args):
+    # args are what we get after early command line parsing (usually
+    # strings, but can be py.path.local objects as well)
+    common_ancestor = None
+    for arg in args:
+        if str(arg)[0] == "-":
+            continue
+        p = py.path.local(arg)
+        if common_ancestor is None:
+            common_ancestor = p
+        else:
+            if p.relto(common_ancestor) or p == common_ancestor:
+                continue
+            elif common_ancestor.relto(p):
+                common_ancestor = p
+            else:
+                shared = p.common(common_ancestor)
+                if shared is not None:
+                    common_ancestor = shared
+    if common_ancestor is None:
+        common_ancestor = py.path.local()
+    elif not common_ancestor.isdir():
+        common_ancestor = common_ancestor.dirpath()
+    return common_ancestor
+
+
+def determine_setup(inifile, args):
+    if inifile:
+        iniconfig = py.iniconfig.IniConfig(inifile)
+        try:
+            inicfg = iniconfig["pytest"]
+        except KeyError:
+            inicfg = None
+        rootdir = get_common_ancestor(args)
+    else:
+        ancestor = get_common_ancestor(args)
+        rootdir, inifile, inicfg = getcfg(
+            [ancestor], ["pytest.ini", "tox.ini", "setup.cfg"])
+        if rootdir is None:
+            for rootdir in ancestor.parts(reverse=True):
+                if rootdir.join("setup.py").exists():
+                    break
+            else:
+                rootdir = ancestor
+    return rootdir, inifile, inicfg or {}
+
+
+def setns(obj, dic):
+    import pytest
+    for name, value in dic.items():
+        if isinstance(value, dict):
+            mod = getattr(obj, name, None)
+            if mod is None:
+                modname = "pytest.%s" % name
+                mod = types.ModuleType(modname)
+                sys.modules[modname] = mod
+                mod.__all__ = []
+                setattr(obj, name, mod)
+            obj.__all__.append(name)
+            setns(mod, value)
+        else:
+            setattr(obj, name, value)
+            obj.__all__.append(name)
+            #if obj != pytest:
+            #    pytest.__all__.append(name)
+            setattr(pytest, name, value)
+
+
+def create_terminal_writer(config, *args, **kwargs):
+    """Create a TerminalWriter instance configured according to the options
+    in the config object. Every code which requires a TerminalWriter object
+    and has access to a config object should use this function.
+    """
+    tw = py.io.TerminalWriter(*args, **kwargs)
+    if config.option.color == 'yes':
+        tw.hasmarkup = True
+    if config.option.color == 'no':
+        tw.hasmarkup = False
+    return tw
+
+
+def _strtobool(val):
+    """Convert a string representation of truth to true (1) or false (0).
+
+    True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values
+    are 'n', 'no', 'f', 'false', 'off', and '0'.  Raises ValueError if
+    'val' is anything else.
+
+    .. note:: copied from distutils.util
+    """
+    val = val.lower()
+    if val in ('y', 'yes', 't', 'true', 'on', '1'):
+        return 1
+    elif val in ('n', 'no', 'f', 'false', 'off', '0'):
+        return 0
+    else:
+        raise ValueError("invalid truth value %r" % (val,))
diff --git a/python/pytest/_pytest/doctest.py b/python/pytest/_pytest/doctest.py
new file mode 100644
index 000000000..a57f7a494
--- /dev/null
+++ b/python/pytest/_pytest/doctest.py
@@ -0,0 +1,290 @@
+""" discover and run doctests in modules and test files."""
+from __future__ import absolute_import
+
+import traceback
+
+import pytest
+from _pytest._code.code import TerminalRepr, ReprFileLocation, ExceptionInfo
+from _pytest.python import FixtureRequest
+
+
+
+def pytest_addoption(parser):
+    parser.addini('doctest_optionflags', 'option flags for doctests',
+        type="args", default=["ELLIPSIS"])
+    group = parser.getgroup("collect")
+    group.addoption("--doctest-modules",
+        action="store_true", default=False,
+        help="run doctests in all .py modules",
+        dest="doctestmodules")
+    group.addoption("--doctest-glob",
+        action="append", default=[], metavar="pat",
+        help="doctests file matching pattern, default: test*.txt",
+        dest="doctestglob")
+    group.addoption("--doctest-ignore-import-errors",
+        action="store_true", default=False,
+        help="ignore doctest ImportErrors",
+        dest="doctest_ignore_import_errors")
+
+
+def pytest_collect_file(path, parent):
+    config = parent.config
+    if path.ext == ".py":
+        if config.option.doctestmodules:
+            return DoctestModule(path, parent)
+    elif _is_doctest(config, path, parent):
+        return DoctestTextfile(path, parent)
+
+
+def _is_doctest(config, path, parent):
+    if path.ext in ('.txt', '.rst') and parent.session.isinitpath(path):
+        return True
+    globs = config.getoption("doctestglob") or ['test*.txt']
+    for glob in globs:
+        if path.check(fnmatch=glob):
+            return True
+    return False
+
+
+class ReprFailDoctest(TerminalRepr):
+
+    def __init__(self, reprlocation, lines):
+        self.reprlocation = reprlocation
+        self.lines = lines
+
+    def toterminal(self, tw):
+        for line in self.lines:
+            tw.line(line)
+        self.reprlocation.toterminal(tw)
+
+
+class DoctestItem(pytest.Item):
+
+    def __init__(self, name, parent, runner=None, dtest=None):
+        super(DoctestItem, self).__init__(name, parent)
+        self.runner = runner
+        self.dtest = dtest
+        self.obj = None
+        self.fixture_request = None
+
+    def setup(self):
+        if self.dtest is not None:
+            self.fixture_request = _setup_fixtures(self)
+            globs = dict(getfixture=self.fixture_request.getfuncargvalue)
+            self.dtest.globs.update(globs)
+
+    def runtest(self):
+        _check_all_skipped(self.dtest)
+        self.runner.run(self.dtest)
+
+    def repr_failure(self, excinfo):
+        import doctest
+        if excinfo.errisinstance((doctest.DocTestFailure,
+                                  doctest.UnexpectedException)):
+            doctestfailure = excinfo.value
+            example = doctestfailure.example
+            test = doctestfailure.test
+            filename = test.filename
+            if test.lineno is None:
+                lineno = None
+            else:
+                lineno = test.lineno + example.lineno + 1
+            message = excinfo.type.__name__
+            reprlocation = ReprFileLocation(filename, lineno, message)
+            checker = _get_checker()
+            REPORT_UDIFF = doctest.REPORT_UDIFF
+            if lineno is not None:
+                lines = doctestfailure.test.docstring.splitlines(False)
+                # add line numbers to the left of the error message
+                lines = ["%03d %s" % (i + test.lineno + 1, x)
+                         for (i, x) in enumerate(lines)]
+                # trim docstring error lines to 10
+                lines = lines[example.lineno - 9:example.lineno + 1]
+            else:
+                lines = ['EXAMPLE LOCATION UNKNOWN, not showing all tests of that example']
+                indent = '>>>'
+                for line in example.source.splitlines():
+                    lines.append('??? %s %s' % (indent, line))
+                    indent = '...'
+            if excinfo.errisinstance(doctest.DocTestFailure):
+                lines += checker.output_difference(example,
+                        doctestfailure.got, REPORT_UDIFF).split("\n")
+            else:
+                inner_excinfo = ExceptionInfo(excinfo.value.exc_info)
+                lines += ["UNEXPECTED EXCEPTION: %s" %
+                            repr(inner_excinfo.value)]
+                lines += traceback.format_exception(*excinfo.value.exc_info)
+            return ReprFailDoctest(reprlocation, lines)
+        else:
+            return super(DoctestItem, self).repr_failure(excinfo)
+
+    def reportinfo(self):
+        return self.fspath, None, "[doctest] %s" % self.name
+
+
+def _get_flag_lookup():
+    import doctest
+    return dict(DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1,
+                DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE,
+                NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE,
+                ELLIPSIS=doctest.ELLIPSIS,
+                IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL,
+                COMPARISON_FLAGS=doctest.COMPARISON_FLAGS,
+                ALLOW_UNICODE=_get_allow_unicode_flag(),
+                ALLOW_BYTES=_get_allow_bytes_flag(),
+                )
+
+
+def get_optionflags(parent):
+    optionflags_str = parent.config.getini("doctest_optionflags")
+    flag_lookup_table = _get_flag_lookup()
+    flag_acc = 0
+    for flag in optionflags_str:
+        flag_acc |= flag_lookup_table[flag]
+    return flag_acc
+
+
+class DoctestTextfile(DoctestItem, pytest.Module):
+
+    def runtest(self):
+        import doctest
+        fixture_request = _setup_fixtures(self)
+
+        # inspired by doctest.testfile; ideally we would use it directly,
+        # but it doesn't support passing a custom checker
+        text = self.fspath.read()
+        filename = str(self.fspath)
+        name = self.fspath.basename
+        globs = dict(getfixture=fixture_request.getfuncargvalue)
+        if '__name__' not in globs:
+            globs['__name__'] = '__main__'
+
+        optionflags = get_optionflags(self)
+        runner = doctest.DebugRunner(verbose=0, optionflags=optionflags,
+                                     checker=_get_checker())
+
+        parser = doctest.DocTestParser()
+        test = parser.get_doctest(text, globs, name, filename, 0)
+        _check_all_skipped(test)
+        runner.run(test)
+
+
+def _check_all_skipped(test):
+    """raises pytest.skip() if all examples in the given DocTest have the SKIP
+    option set.
+    """
+    import doctest
+    all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples)
+    if all_skipped:
+        pytest.skip('all tests skipped by +SKIP option')
+
+
+class DoctestModule(pytest.Module):
+    def collect(self):
+        import doctest
+        if self.fspath.basename == "conftest.py":
+            module = self.config.pluginmanager._importconftest(self.fspath)
+        else:
+            try:
+                module = self.fspath.pyimport()
+            except ImportError:
+                if self.config.getvalue('doctest_ignore_import_errors'):
+                    pytest.skip('unable to import module %r' % self.fspath)
+                else:
+                    raise
+        # uses internal doctest module parsing mechanism
+        finder = doctest.DocTestFinder()
+        optionflags = get_optionflags(self)
+        runner = doctest.DebugRunner(verbose=0, optionflags=optionflags,
+                                     checker=_get_checker())
+        for test in finder.find(module, module.__name__):
+            if test.examples:  # skip empty doctests
+                yield DoctestItem(test.name, self, runner, test)
+
+
+def _setup_fixtures(doctest_item):
+    """
+    Used by DoctestTextfile and DoctestItem to setup fixture information.
+    """
+    def func():
+        pass
+
+    doctest_item.funcargs = {}
+    fm = doctest_item.session._fixturemanager
+    doctest_item._fixtureinfo = fm.getfixtureinfo(node=doctest_item, func=func,
+                                                  cls=None, funcargs=False)
+    fixture_request = FixtureRequest(doctest_item)
+    fixture_request._fillfixtures()
+    return fixture_request
+
+
+def _get_checker():
+    """
+    Returns a doctest.OutputChecker subclass that takes in account the
+    ALLOW_UNICODE option to ignore u'' prefixes in strings and ALLOW_BYTES
+    to strip b'' prefixes.
+    Useful when the same doctest should run in Python 2 and Python 3.
+
+    An inner class is used to avoid importing "doctest" at the module
+    level.
+    """
+    if hasattr(_get_checker, 'LiteralsOutputChecker'):
+        return _get_checker.LiteralsOutputChecker()
+
+    import doctest
+    import re
+
+    class LiteralsOutputChecker(doctest.OutputChecker):
+        """
+        Copied from doctest_nose_plugin.py from the nltk project:
+            https://github.com/nltk/nltk
+
+        Further extended to also support byte literals.
+        """
+
+        _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE)
+        _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE)
+
+        def check_output(self, want, got, optionflags):
+            res = doctest.OutputChecker.check_output(self, want, got,
+                                                     optionflags)
+            if res:
+                return True
+
+            allow_unicode = optionflags & _get_allow_unicode_flag()
+            allow_bytes = optionflags & _get_allow_bytes_flag()
+            if not allow_unicode and not allow_bytes:
+                return False
+
+            else:  # pragma: no cover
+                def remove_prefixes(regex, txt):
+                    return re.sub(regex, r'\1\2', txt)
+
+                if allow_unicode:
+                    want = remove_prefixes(self._unicode_literal_re, want)
+                    got = remove_prefixes(self._unicode_literal_re, got)
+                if allow_bytes:
+                    want = remove_prefixes(self._bytes_literal_re, want)
+                    got = remove_prefixes(self._bytes_literal_re, got)
+                res = doctest.OutputChecker.check_output(self, want, got,
+                                                         optionflags)
+                return res
+
+    _get_checker.LiteralsOutputChecker = LiteralsOutputChecker
+    return _get_checker.LiteralsOutputChecker()
+
+
+def _get_allow_unicode_flag():
+    """
+    Registers and returns the ALLOW_UNICODE flag.
+    """
+    import doctest
+    return doctest.register_optionflag('ALLOW_UNICODE')
+
+
+def _get_allow_bytes_flag():
+    """
+    Registers and returns the ALLOW_BYTES flag.
+    """
+    import doctest
+    return doctest.register_optionflag('ALLOW_BYTES')
diff --git a/python/pytest/_pytest/genscript.py b/python/pytest/_pytest/genscript.py
new file mode 100755
index 000000000..d2962d8fc
--- /dev/null
+++ b/python/pytest/_pytest/genscript.py
@@ -0,0 +1,132 @@
+""" (deprecated) generate a single-file self-contained version of pytest """
+import os
+import sys
+import pkgutil
+
+import py
+import _pytest
+
+
+
+def find_toplevel(name):
+    for syspath in sys.path:
+        base = py.path.local(syspath)
+        lib = base/name
+        if lib.check(dir=1):
+            return lib
+        mod = base.join("%s.py" % name)
+        if mod.check(file=1):
+            return mod
+    raise LookupError(name)
+
+def pkgname(toplevel, rootpath, path):
+    parts = path.parts()[len(rootpath.parts()):]
+    return '.'.join([toplevel] + [x.purebasename for x in parts])
+
+def pkg_to_mapping(name):
+    toplevel = find_toplevel(name)
+    name2src = {}
+    if toplevel.check(file=1): # module
+        name2src[toplevel.purebasename] = toplevel.read()
+    else: # package
+        for pyfile in toplevel.visit('*.py'):
+            pkg = pkgname(name, toplevel, pyfile)
+            name2src[pkg] = pyfile.read()
+        # with wheels py source code might be not be installed
+        # and the resulting genscript is useless, just bail out.
+        assert name2src, "no source code found for %r at %r" %(name, toplevel)
+    return name2src
+
+def compress_mapping(mapping):
+    import base64, pickle, zlib
+    data = pickle.dumps(mapping, 2)
+    data = zlib.compress(data, 9)
+    data = base64.encodestring(data)
+    data = data.decode('ascii')
+    return data
+
+
+def compress_packages(names):
+    mapping = {}
+    for name in names:
+        mapping.update(pkg_to_mapping(name))
+    return compress_mapping(mapping)
+
+def generate_script(entry, packages):
+    data = compress_packages(packages)
+    tmpl = py.path.local(__file__).dirpath().join('standalonetemplate.py')
+    exe = tmpl.read()
+    exe = exe.replace('@SOURCES@', data)
+    exe = exe.replace('@ENTRY@', entry)
+    return exe
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("debugconfig")
+    group.addoption("--genscript", action="store", default=None,
+        dest="genscript", metavar="path",
+        help="create standalone pytest script at given target path.")
+
+def pytest_cmdline_main(config):
+    import _pytest.config
+    genscript = config.getvalue("genscript")
+    if genscript:
+        tw = _pytest.config.create_terminal_writer(config)
+        tw.line("WARNING: usage of genscript is deprecated.",
+                red=True)
+        deps =  ['py', '_pytest', 'pytest']  # pluggy is vendored
+        if sys.version_info < (2,7):
+            deps.append("argparse")
+            tw.line("generated script will run on python2.6-python3.3++")
+        else:
+            tw.line("WARNING: generated script will not run on python2.6 "
+                    "due to 'argparse' dependency. Use python2.6 "
+                    "to generate a python2.6 compatible script", red=True)
+        script = generate_script(
+            'import pytest; raise SystemExit(pytest.cmdline.main())',
+            deps,
+        )
+        genscript = py.path.local(genscript)
+        genscript.write(script)
+        tw.line("generated pytest standalone script: %s" % genscript,
+                bold=True)
+        return 0
+
+
+def pytest_namespace():
+    return {'freeze_includes': freeze_includes}
+
+
+def freeze_includes():
+    """
+    Returns a list of module names used by py.test that should be
+    included by cx_freeze.
+    """
+    result = list(_iter_all_modules(py))
+    result += list(_iter_all_modules(_pytest))
+    return result
+
+
+def _iter_all_modules(package, prefix=''):
+    """
+    Iterates over the names of all modules that can be found in the given
+    package, recursively.
+
+    Example:
+        _iter_all_modules(_pytest) ->
+            ['_pytest.assertion.newinterpret',
+             '_pytest.capture',
+             '_pytest.core',
+             ...
+            ]
+    """
+    if type(package) is not str:
+        path, prefix = package.__path__[0], package.__name__ + '.'
+    else:
+        path = package
+    for _, name, is_package in pkgutil.iter_modules([path]):
+        if is_package:
+            for m in _iter_all_modules(os.path.join(path, name), prefix=name + '.'):
+                yield prefix + m
+        else:
+            yield prefix + name
diff --git a/python/pytest/_pytest/helpconfig.py b/python/pytest/_pytest/helpconfig.py
new file mode 100644
index 000000000..1df0c56ac
--- /dev/null
+++ b/python/pytest/_pytest/helpconfig.py
@@ -0,0 +1,139 @@
+""" version info, help messages, tracing configuration.  """
+import py
+import pytest
+import os, sys
+
+def pytest_addoption(parser):
+    group = parser.getgroup('debugconfig')
+    group.addoption('--version', action="store_true",
+            help="display pytest lib version and import information.")
+    group._addoption("-h", "--help", action="store_true", dest="help",
+            help="show help message and configuration info")
+    group._addoption('-p', action="append", dest="plugins", default = [],
+               metavar="name",
+               help="early-load given plugin (multi-allowed). "
+                    "To avoid loading of plugins, use the `no:` prefix, e.g. "
+                    "`no:doctest`.")
+    group.addoption('--traceconfig', '--trace-config',
+               action="store_true", default=False,
+               help="trace considerations of conftest.py files."),
+    group.addoption('--debug',
+               action="store_true", dest="debug", default=False,
+               help="store internal tracing debug information in 'pytestdebug.log'.")
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_cmdline_parse():
+    outcome = yield
+    config = outcome.get_result()
+    if config.option.debug:
+        path = os.path.abspath("pytestdebug.log")
+        debugfile = open(path, 'w')
+        debugfile.write("versions pytest-%s, py-%s, "
+                "python-%s\ncwd=%s\nargs=%s\n\n" %(
+            pytest.__version__, py.__version__,
+            ".".join(map(str, sys.version_info)),
+            os.getcwd(), config._origargs))
+        config.trace.root.setwriter(debugfile.write)
+        undo_tracing = config.pluginmanager.enable_tracing()
+        sys.stderr.write("writing pytestdebug information to %s\n" % path)
+        def unset_tracing():
+            debugfile.close()
+            sys.stderr.write("wrote pytestdebug information to %s\n" %
+                             debugfile.name)
+            config.trace.root.setwriter(None)
+            undo_tracing()
+        config.add_cleanup(unset_tracing)
+
+def pytest_cmdline_main(config):
+    if config.option.version:
+        p = py.path.local(pytest.__file__)
+        sys.stderr.write("This is pytest version %s, imported from %s\n" %
+            (pytest.__version__, p))
+        plugininfo = getpluginversioninfo(config)
+        if plugininfo:
+            for line in plugininfo:
+                sys.stderr.write(line + "\n")
+        return 0
+    elif config.option.help:
+        config._do_configure()
+        showhelp(config)
+        config._ensure_unconfigure()
+        return 0
+
+def showhelp(config):
+    reporter = config.pluginmanager.get_plugin('terminalreporter')
+    tw = reporter._tw
+    tw.write(config._parser.optparser.format_help())
+    tw.line()
+    tw.line()
+    #tw.sep( "=", "config file settings")
+    tw.line("[pytest] ini-options in the next "
+            "pytest.ini|tox.ini|setup.cfg file:")
+    tw.line()
+
+    for name in config._parser._ininames:
+        help, type, default = config._parser._inidict[name]
+        if type is None:
+            type = "string"
+        spec = "%s (%s)" % (name, type)
+        line = "  %-24s %s" %(spec, help)
+        tw.line(line[:tw.fullwidth])
+
+    tw.line()
+    tw.line("environment variables:")
+    vars = [
+        ("PYTEST_ADDOPTS", "extra command line options"),
+        ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"),
+        ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals")
+    ]
+    for name, help in vars:
+        tw.line("  %-24s %s" % (name, help))
+    tw.line()
+    tw.line()
+
+    tw.line("to see available markers type: py.test --markers")
+    tw.line("to see available fixtures type: py.test --fixtures")
+    tw.line("(shown according to specified file_or_dir or current dir "
+            "if not specified)")
+
+    for warningreport in reporter.stats.get('warnings', []):
+        tw.line("warning : " + warningreport.message, red=True)
+    return
+
+
+conftest_options = [
+    ('pytest_plugins', 'list of plugin names to load'),
+]
+
+def getpluginversioninfo(config):
+    lines = []
+    plugininfo = config.pluginmanager.list_plugin_distinfo()
+    if plugininfo:
+        lines.append("setuptools registered plugins:")
+        for plugin, dist in plugininfo:
+            loc = getattr(plugin, '__file__', repr(plugin))
+            content = "%s-%s at %s" % (dist.project_name, dist.version, loc)
+            lines.append("  " + content)
+    return lines
+
+def pytest_report_header(config):
+    lines = []
+    if config.option.debug or config.option.traceconfig:
+        lines.append("using: pytest-%s pylib-%s" %
+            (pytest.__version__,py.__version__))
+
+        verinfo = getpluginversioninfo(config)
+        if verinfo:
+            lines.extend(verinfo)
+
+    if config.option.traceconfig:
+        lines.append("active plugins:")
+        items = config.pluginmanager.list_name_plugin()
+        for name, plugin in items:
+            if hasattr(plugin, '__file__'):
+                r = plugin.__file__
+            else:
+                r = repr(plugin)
+            lines.append("    %-20s: %s" %(name, r))
+    return lines
diff --git a/python/pytest/_pytest/hookspec.py b/python/pytest/_pytest/hookspec.py
new file mode 100644
index 000000000..60e9b47d2
--- /dev/null
+++ b/python/pytest/_pytest/hookspec.py
@@ -0,0 +1,295 @@
+""" hook specifications for pytest plugins, invoked from main.py and builtin plugins.  """
+
+from _pytest._pluggy import HookspecMarker
+
+hookspec = HookspecMarker("pytest")
+
+# -------------------------------------------------------------------------
+# Initialization hooks called for every plugin
+# -------------------------------------------------------------------------
+
+@hookspec(historic=True)
+def pytest_addhooks(pluginmanager):
+    """called at plugin registration time to allow adding new hooks via a call to
+    pluginmanager.add_hookspecs(module_or_class, prefix)."""
+
+
+@hookspec(historic=True)
+def pytest_namespace():
+    """return dict of name->object to be made globally available in
+    the pytest namespace.  This hook is called at plugin registration
+    time.
+    """
+
+@hookspec(historic=True)
+def pytest_plugin_registered(plugin, manager):
+    """ a new pytest plugin got registered. """
+
+
+@hookspec(historic=True)
+def pytest_addoption(parser):
+    """register argparse-style options and ini-style config values,
+    called once at the beginning of a test run.
+
+    .. note::
+
+        This function should be implemented only in plugins or ``conftest.py``
+        files situated at the tests root directory due to how py.test
+        :ref:`discovers plugins during startup <pluginorder>`.
+
+    :arg parser: To add command line options, call
+        :py:func:`parser.addoption(...) <_pytest.config.Parser.addoption>`.
+        To add ini-file values call :py:func:`parser.addini(...)
+        <_pytest.config.Parser.addini>`.
+
+    Options can later be accessed through the
+    :py:class:`config <_pytest.config.Config>` object, respectively:
+
+    - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to
+      retrieve the value of a command line option.
+
+    - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve
+      a value read from an ini-style file.
+
+    The config object is passed around on many internal objects via the ``.config``
+    attribute or can be retrieved as the ``pytestconfig`` fixture or accessed
+    via (deprecated) ``pytest.config``.
+    """
+
+@hookspec(historic=True)
+def pytest_configure(config):
+    """ called after command line options have been parsed
+    and all plugins and initial conftest files been loaded.
+    This hook is called for every plugin.
+    """
+
+# -------------------------------------------------------------------------
+# Bootstrapping hooks called for plugins registered early enough:
+# internal and 3rd party plugins as well as directly
+# discoverable conftest.py local plugins.
+# -------------------------------------------------------------------------
+
+@hookspec(firstresult=True)
+def pytest_cmdline_parse(pluginmanager, args):
+    """return initialized config object, parsing the specified args. """
+
+def pytest_cmdline_preparse(config, args):
+    """(deprecated) modify command line arguments before option parsing. """
+
+@hookspec(firstresult=True)
+def pytest_cmdline_main(config):
+    """ called for performing the main command line action. The default
+    implementation will invoke the configure hooks and runtest_mainloop. """
+
+def pytest_load_initial_conftests(early_config, parser, args):
+    """ implements the loading of initial conftest files ahead
+    of command line option parsing. """
+
+
+# -------------------------------------------------------------------------
+# collection hooks
+# -------------------------------------------------------------------------
+
+@hookspec(firstresult=True)
+def pytest_collection(session):
+    """ perform the collection protocol for the given session. """
+
+def pytest_collection_modifyitems(session, config, items):
+    """ called after collection has been performed, may filter or re-order
+    the items in-place."""
+
+def pytest_collection_finish(session):
+    """ called after collection has been performed and modified. """
+
+@hookspec(firstresult=True)
+def pytest_ignore_collect(path, config):
+    """ return True to prevent considering this path for collection.
+    This hook is consulted for all files and directories prior to calling
+    more specific hooks.
+    """
+
+@hookspec(firstresult=True)
+def pytest_collect_directory(path, parent):
+    """ called before traversing a directory for collection files. """
+
+def pytest_collect_file(path, parent):
+    """ return collection Node or None for the given path. Any new node
+    needs to have the specified ``parent`` as a parent."""
+
+# logging hooks for collection
+def pytest_collectstart(collector):
+    """ collector starts collecting. """
+
+def pytest_itemcollected(item):
+    """ we just collected a test item. """
+
+def pytest_collectreport(report):
+    """ collector finished collecting. """
+
+def pytest_deselected(items):
+    """ called for test items deselected by keyword. """
+
+@hookspec(firstresult=True)
+def pytest_make_collect_report(collector):
+    """ perform ``collector.collect()`` and return a CollectReport. """
+
+# -------------------------------------------------------------------------
+# Python test function related hooks
+# -------------------------------------------------------------------------
+
+@hookspec(firstresult=True)
+def pytest_pycollect_makemodule(path, parent):
+    """ return a Module collector or None for the given path.
+    This hook will be called for each matching test module path.
+    The pytest_collect_file hook needs to be used if you want to
+    create test modules for files that do not match as a test module.
+    """
+
+@hookspec(firstresult=True)
+def pytest_pycollect_makeitem(collector, name, obj):
+    """ return custom item/collector for a python object in a module, or None.  """
+
+@hookspec(firstresult=True)
+def pytest_pyfunc_call(pyfuncitem):
+    """ call underlying test function. """
+
+def pytest_generate_tests(metafunc):
+    """ generate (multiple) parametrized calls to a test function."""
+
+# -------------------------------------------------------------------------
+# generic runtest related hooks
+# -------------------------------------------------------------------------
+
+@hookspec(firstresult=True)
+def pytest_runtestloop(session):
+    """ called for performing the main runtest loop
+    (after collection finished). """
+
+def pytest_itemstart(item, node):
+    """ (deprecated, use pytest_runtest_logstart). """
+
+@hookspec(firstresult=True)
+def pytest_runtest_protocol(item, nextitem):
+    """ implements the runtest_setup/call/teardown protocol for
+    the given test item, including capturing exceptions and calling
+    reporting hooks.
+
+    :arg item: test item for which the runtest protocol is performed.
+
+    :arg nextitem: the scheduled-to-be-next test item (or None if this
+                   is the end my friend).  This argument is passed on to
+                   :py:func:`pytest_runtest_teardown`.
+
+    :return boolean: True if no further hook implementations should be invoked.
+    """
+
+def pytest_runtest_logstart(nodeid, location):
+    """ signal the start of running a single test item. """
+
+def pytest_runtest_setup(item):
+    """ called before ``pytest_runtest_call(item)``. """
+
+def pytest_runtest_call(item):
+    """ called to execute the test ``item``. """
+
+def pytest_runtest_teardown(item, nextitem):
+    """ called after ``pytest_runtest_call``.
+
+    :arg nextitem: the scheduled-to-be-next test item (None if no further
+                   test item is scheduled).  This argument can be used to
+                   perform exact teardowns, i.e. calling just enough finalizers
+                   so that nextitem only needs to call setup-functions.
+    """
+
+@hookspec(firstresult=True)
+def pytest_runtest_makereport(item, call):
+    """ return a :py:class:`_pytest.runner.TestReport` object
+    for the given :py:class:`pytest.Item` and
+    :py:class:`_pytest.runner.CallInfo`.
+    """
+
+def pytest_runtest_logreport(report):
+    """ process a test setup/call/teardown report relating to
+    the respective phase of executing a test. """
+
+# -------------------------------------------------------------------------
+# test session related hooks
+# -------------------------------------------------------------------------
+
+def pytest_sessionstart(session):
+    """ before session.main() is called. """
+
+def pytest_sessionfinish(session, exitstatus):
+    """ whole test run finishes. """
+
+def pytest_unconfigure(config):
+    """ called before test process is exited.  """
+
+
+# -------------------------------------------------------------------------
+# hooks for customising the assert methods
+# -------------------------------------------------------------------------
+
+def pytest_assertrepr_compare(config, op, left, right):
+    """return explanation for comparisons in failing assert expressions.
+
+    Return None for no custom explanation, otherwise return a list
+    of strings.  The strings will be joined by newlines but any newlines
+    *in* a string will be escaped.  Note that all but the first line will
+    be indented sligthly, the intention is for the first line to be a summary.
+    """
+
+# -------------------------------------------------------------------------
+# hooks for influencing reporting (invoked from _pytest_terminal)
+# -------------------------------------------------------------------------
+
+def pytest_report_header(config, startdir):
+    """ return a string to be displayed as header info for terminal reporting."""
+
+@hookspec(firstresult=True)
+def pytest_report_teststatus(report):
+    """ return result-category, shortletter and verbose word for reporting."""
+
+def pytest_terminal_summary(terminalreporter):
+    """ add additional section in terminal summary reporting.  """
+
+
+@hookspec(historic=True)
+def pytest_logwarning(message, code, nodeid, fslocation):
+    """ process a warning specified by a message, a code string,
+    a nodeid and fslocation (both of which may be None
+    if the warning is not tied to a partilar node/location)."""
+
+# -------------------------------------------------------------------------
+# doctest hooks
+# -------------------------------------------------------------------------
+
+@hookspec(firstresult=True)
+def pytest_doctest_prepare_content(content):
+    """ return processed content for a given doctest"""
+
+# -------------------------------------------------------------------------
+# error handling and internal debugging hooks
+# -------------------------------------------------------------------------
+
+def pytest_internalerror(excrepr, excinfo):
+    """ called for internal errors. """
+
+def pytest_keyboard_interrupt(excinfo):
+    """ called for keyboard interrupt. """
+
+def pytest_exception_interact(node, call, report):
+    """called when an exception was raised which can potentially be
+    interactively handled.
+
+    This hook is only called if an exception was raised
+    that is not an internal exception like ``skip.Exception``.
+    """
+
+def pytest_enter_pdb(config):
+    """ called upon pdb.set_trace(), can be used by plugins to take special
+    action just before the python debugger enters in interactive mode.
+
+    :arg config: pytest config object
+    :type config: _pytest.config.Config
+    """
diff --git a/python/pytest/_pytest/junitxml.py b/python/pytest/_pytest/junitxml.py
new file mode 100644
index 000000000..f4de1343e
--- /dev/null
+++ b/python/pytest/_pytest/junitxml.py
@@ -0,0 +1,387 @@
+"""
+    report test results in JUnit-XML format,
+    for use with Jenkins and build integration servers.
+
+
+Based on initial code from Ross Lawley.
+"""
+# Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/
+# src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd
+
+import py
+import os
+import re
+import sys
+import time
+import pytest
+
+# Python 2.X and 3.X compatibility
+if sys.version_info[0] < 3:
+    from codecs import open
+else:
+    unichr = chr
+    unicode = str
+    long = int
+
+
+class Junit(py.xml.Namespace):
+    pass
+
+# We need to get the subset of the invalid unicode ranges according to
+# XML 1.0 which are valid in this python build.  Hence we calculate
+# this dynamically instead of hardcoding it.  The spec range of valid
+# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD]
+#                    | [#x10000-#x10FFFF]
+_legal_chars = (0x09, 0x0A, 0x0d)
+_legal_ranges = (
+    (0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF),
+)
+_legal_xml_re = [
+    unicode("%s-%s") % (unichr(low), unichr(high))
+    for (low, high) in _legal_ranges if low < sys.maxunicode
+]
+_legal_xml_re = [unichr(x) for x in _legal_chars] + _legal_xml_re
+illegal_xml_re = re.compile(unicode('[^%s]') % unicode('').join(_legal_xml_re))
+del _legal_chars
+del _legal_ranges
+del _legal_xml_re
+
+_py_ext_re = re.compile(r"\.py$")
+
+
+def bin_xml_escape(arg):
+    def repl(matchobj):
+        i = ord(matchobj.group())
+        if i <= 0xFF:
+            return unicode('#x%02X') % i
+        else:
+            return unicode('#x%04X') % i
+
+    return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg)))
+
+
+class _NodeReporter(object):
+    def __init__(self, nodeid, xml):
+
+        self.id = nodeid
+        self.xml = xml
+        self.add_stats = self.xml.add_stats
+        self.duration = 0
+        self.properties = []
+        self.nodes = []
+        self.testcase = None
+        self.attrs = {}
+
+    def append(self, node):
+        self.xml.add_stats(type(node).__name__)
+        self.nodes.append(node)
+
+    def add_property(self, name, value):
+        self.properties.append((str(name), bin_xml_escape(value)))
+
+    def make_properties_node(self):
+        """Return a Junit node containing custom properties, if any.
+        """
+        if self.properties:
+            return Junit.properties([
+                Junit.property(name=name, value=value)
+                for name, value in self.properties
+            ])
+        return ''
+
+    def record_testreport(self, testreport):
+        assert not self.testcase
+        names = mangle_test_address(testreport.nodeid)
+        classnames = names[:-1]
+        if self.xml.prefix:
+            classnames.insert(0, self.xml.prefix)
+        attrs = {
+            "classname": ".".join(classnames),
+            "name": bin_xml_escape(names[-1]),
+            "file": testreport.location[0],
+        }
+        if testreport.location[1] is not None:
+            attrs["line"] = testreport.location[1]
+        self.attrs = attrs
+
+    def to_xml(self):
+        testcase = Junit.testcase(time=self.duration, **self.attrs)
+        testcase.append(self.make_properties_node())
+        for node in self.nodes:
+            testcase.append(node)
+        return testcase
+
+    def _add_simple(self, kind, message, data=None):
+        data = bin_xml_escape(data)
+        node = kind(data, message=message)
+        self.append(node)
+
+    def _write_captured_output(self, report):
+        for capname in ('out', 'err'):
+            allcontent = ""
+            for name, content in report.get_sections("Captured std%s" %
+                                                     capname):
+                allcontent += content
+            if allcontent:
+                tag = getattr(Junit, 'system-' + capname)
+                self.append(tag(bin_xml_escape(allcontent)))
+
+    def append_pass(self, report):
+        self.add_stats('passed')
+        self._write_captured_output(report)
+
+    def append_failure(self, report):
+        # msg = str(report.longrepr.reprtraceback.extraline)
+        if hasattr(report, "wasxfail"):
+            self._add_simple(
+                Junit.skipped,
+                "xfail-marked test passes unexpectedly")
+        else:
+            if hasattr(report.longrepr, "reprcrash"):
+                message = report.longrepr.reprcrash.message
+            elif isinstance(report.longrepr, (unicode, str)):
+                message = report.longrepr
+            else:
+                message = str(report.longrepr)
+            message = bin_xml_escape(message)
+            fail = Junit.failure(message=message)
+            fail.append(bin_xml_escape(report.longrepr))
+            self.append(fail)
+        self._write_captured_output(report)
+
+    def append_collect_error(self, report):
+        # msg = str(report.longrepr.reprtraceback.extraline)
+        self.append(Junit.error(bin_xml_escape(report.longrepr),
+                                message="collection failure"))
+
+    def append_collect_skipped(self, report):
+        self._add_simple(
+            Junit.skipped, "collection skipped", report.longrepr)
+
+    def append_error(self, report):
+        self._add_simple(
+            Junit.error, "test setup failure", report.longrepr)
+        self._write_captured_output(report)
+
+    def append_skipped(self, report):
+        if hasattr(report, "wasxfail"):
+            self._add_simple(
+                Junit.skipped, "expected test failure", report.wasxfail
+            )
+        else:
+            filename, lineno, skipreason = report.longrepr
+            if skipreason.startswith("Skipped: "):
+                skipreason = bin_xml_escape(skipreason[9:])
+            self.append(
+                Junit.skipped("%s:%s: %s" % (filename, lineno, skipreason),
+                              type="pytest.skip",
+                              message=skipreason))
+        self._write_captured_output(report)
+
+    def finalize(self):
+        data = self.to_xml().unicode(indent=0)
+        self.__dict__.clear()
+        self.to_xml = lambda: py.xml.raw(data)
+
+
+@pytest.fixture
+def record_xml_property(request):
+    """Fixture that adds extra xml properties to the tag for the calling test.
+    The fixture is callable with (name, value), with value being automatically
+    xml-encoded.
+    """
+    request.node.warn(
+        code='C3',
+        message='record_xml_property is an experimental feature',
+    )
+    xml = getattr(request.config, "_xml", None)
+    if xml is not None:
+        node_reporter = xml.node_reporter(request.node.nodeid)
+        return node_reporter.add_property
+    else:
+        def add_property_noop(name, value):
+            pass
+
+        return add_property_noop
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting")
+    group.addoption(
+        '--junitxml', '--junit-xml',
+        action="store",
+        dest="xmlpath",
+        metavar="path",
+        default=None,
+        help="create junit-xml style report file at given path.")
+    group.addoption(
+        '--junitprefix', '--junit-prefix',
+        action="store",
+        metavar="str",
+        default=None,
+        help="prepend prefix to classnames in junit-xml output")
+
+
+def pytest_configure(config):
+    xmlpath = config.option.xmlpath
+    # prevent opening xmllog on slave nodes (xdist)
+    if xmlpath and not hasattr(config, 'slaveinput'):
+        config._xml = LogXML(xmlpath, config.option.junitprefix)
+        config.pluginmanager.register(config._xml)
+
+
+def pytest_unconfigure(config):
+    xml = getattr(config, '_xml', None)
+    if xml:
+        del config._xml
+        config.pluginmanager.unregister(xml)
+
+
+def mangle_test_address(address):
+    path, possible_open_bracket, params = address.partition('[')
+    names = path.split("::")
+    try:
+        names.remove('()')
+    except ValueError:
+        pass
+    # convert file path to dotted path
+    names[0] = names[0].replace("/", '.')
+    names[0] = _py_ext_re.sub("", names[0])
+    # put any params back
+    names[-1] += possible_open_bracket + params
+    return names
+
+
+class LogXML(object):
+    def __init__(self, logfile, prefix):
+        logfile = os.path.expanduser(os.path.expandvars(logfile))
+        self.logfile = os.path.normpath(os.path.abspath(logfile))
+        self.prefix = prefix
+        self.stats = dict.fromkeys([
+            'error',
+            'passed',
+            'failure',
+            'skipped',
+        ], 0)
+        self.node_reporters = {}  # nodeid -> _NodeReporter
+        self.node_reporters_ordered = []
+
+    def finalize(self, report):
+        nodeid = getattr(report, 'nodeid', report)
+        # local hack to handle xdist report order
+        slavenode = getattr(report, 'node', None)
+        reporter = self.node_reporters.pop((nodeid, slavenode))
+        if reporter is not None:
+            reporter.finalize()
+
+    def node_reporter(self, report):
+        nodeid = getattr(report, 'nodeid', report)
+        # local hack to handle xdist report order
+        slavenode = getattr(report, 'node', None)
+
+        key = nodeid, slavenode
+
+        if key in self.node_reporters:
+            # TODO: breasks for --dist=each
+            return self.node_reporters[key]
+        reporter = _NodeReporter(nodeid, self)
+        self.node_reporters[key] = reporter
+        self.node_reporters_ordered.append(reporter)
+        return reporter
+
+    def add_stats(self, key):
+        if key in self.stats:
+            self.stats[key] += 1
+
+    def _opentestcase(self, report):
+        reporter = self.node_reporter(report)
+        reporter.record_testreport(report)
+        return reporter
+
+    def pytest_runtest_logreport(self, report):
+        """handle a setup/call/teardown report, generating the appropriate
+        xml tags as necessary.
+
+        note: due to plugins like xdist, this hook may be called in interlaced
+        order with reports from other nodes. for example:
+
+        usual call order:
+            -> setup node1
+            -> call node1
+            -> teardown node1
+            -> setup node2
+            -> call node2
+            -> teardown node2
+
+        possible call order in xdist:
+            -> setup node1
+            -> call node1
+            -> setup node2
+            -> call node2
+            -> teardown node2
+            -> teardown node1
+        """
+        if report.passed:
+            if report.when == "call":  # ignore setup/teardown
+                reporter = self._opentestcase(report)
+                reporter.append_pass(report)
+        elif report.failed:
+            reporter = self._opentestcase(report)
+            if report.when == "call":
+                reporter.append_failure(report)
+            else:
+                reporter.append_error(report)
+        elif report.skipped:
+            reporter = self._opentestcase(report)
+            reporter.append_skipped(report)
+        self.update_testcase_duration(report)
+        if report.when == "teardown":
+            self.finalize(report)
+
+    def update_testcase_duration(self, report):
+        """accumulates total duration for nodeid from given report and updates
+        the Junit.testcase with the new total if already created.
+        """
+        reporter = self.node_reporter(report)
+        reporter.duration += getattr(report, 'duration', 0.0)
+
+    def pytest_collectreport(self, report):
+        if not report.passed:
+            reporter = self._opentestcase(report)
+            if report.failed:
+                reporter.append_collect_error(report)
+            else:
+                reporter.append_collect_skipped(report)
+
+    def pytest_internalerror(self, excrepr):
+        reporter = self.node_reporter('internal')
+        reporter.attrs.update(classname="pytest", name='internal')
+        reporter._add_simple(Junit.error, 'internal error', excrepr)
+
+    def pytest_sessionstart(self):
+        self.suite_start_time = time.time()
+
+    def pytest_sessionfinish(self):
+        dirname = os.path.dirname(os.path.abspath(self.logfile))
+        if not os.path.isdir(dirname):
+            os.makedirs(dirname)
+        logfile = open(self.logfile, 'w', encoding='utf-8')
+        suite_stop_time = time.time()
+        suite_time_delta = suite_stop_time - self.suite_start_time
+
+        numtests = self.stats['passed'] + self.stats['failure'] + self.stats['skipped']
+
+        logfile.write('<?xml version="1.0" encoding="utf-8"?>')
+        logfile.write(Junit.testsuite(
+            [x.to_xml() for x in self.node_reporters_ordered],
+            name="pytest",
+            errors=self.stats['error'],
+            failures=self.stats['failure'],
+            skips=self.stats['skipped'],
+            tests=numtests,
+            time="%.3f" % suite_time_delta, ).unicode(indent=0))
+        logfile.close()
+
+    def pytest_terminal_summary(self, terminalreporter):
+        terminalreporter.write_sep("-",
+                                   "generated xml file: %s" % (self.logfile))
diff --git a/python/pytest/_pytest/main.py b/python/pytest/_pytest/main.py
new file mode 100644
index 000000000..8654d7af6
--- /dev/null
+++ b/python/pytest/_pytest/main.py
@@ -0,0 +1,744 @@
+""" core implementation of testing process: init, session, runtest loop. """
+import imp
+import os
+import re
+import sys
+
+import _pytest
+import _pytest._code
+import py
+import pytest
+try:
+    from collections import MutableMapping as MappingMixin
+except ImportError:
+    from UserDict import DictMixin as MappingMixin
+
+from _pytest.runner import collect_one_node
+
+tracebackcutdir = py.path.local(_pytest.__file__).dirpath()
+
+# exitcodes for the command line
+EXIT_OK = 0
+EXIT_TESTSFAILED = 1
+EXIT_INTERRUPTED = 2
+EXIT_INTERNALERROR = 3
+EXIT_USAGEERROR = 4
+EXIT_NOTESTSCOLLECTED = 5
+
+name_re = re.compile("^[a-zA-Z_]\w*$")
+
+def pytest_addoption(parser):
+    parser.addini("norecursedirs", "directory patterns to avoid for recursion",
+        type="args", default=['.*', 'CVS', '_darcs', '{arch}', '*.egg'])
+    parser.addini("testpaths", "directories to search for tests when no files or directories are given in the command line.",
+        type="args", default=[])
+    #parser.addini("dirpatterns",
+    #    "patterns specifying possible locations of test files",
+    #    type="linelist", default=["**/test_*.txt",
+    #            "**/test_*.py", "**/*_test.py"]
+    #)
+    group = parser.getgroup("general", "running and selection options")
+    group._addoption('-x', '--exitfirst', action="store_true", default=False,
+               dest="exitfirst",
+               help="exit instantly on first error or failed test."),
+    group._addoption('--maxfail', metavar="num",
+               action="store", type=int, dest="maxfail", default=0,
+               help="exit after first num failures or errors.")
+    group._addoption('--strict', action="store_true",
+               help="run pytest in strict mode, warnings become errors.")
+    group._addoption("-c", metavar="file", type=str, dest="inifilename",
+               help="load configuration from `file` instead of trying to locate one of the implicit configuration files.")
+
+    group = parser.getgroup("collect", "collection")
+    group.addoption('--collectonly', '--collect-only', action="store_true",
+        help="only collect tests, don't execute them."),
+    group.addoption('--pyargs', action="store_true",
+        help="try to interpret all arguments as python packages.")
+    group.addoption("--ignore", action="append", metavar="path",
+        help="ignore path during collection (multi-allowed).")
+    # when changing this to --conf-cut-dir, config.py Conftest.setinitial
+    # needs upgrading as well
+    group.addoption('--confcutdir', dest="confcutdir", default=None,
+        metavar="dir",
+        help="only load conftest.py's relative to specified dir.")
+    group.addoption('--noconftest', action="store_true",
+        dest="noconftest", default=False,
+        help="Don't load any conftest.py files.")
+
+    group = parser.getgroup("debugconfig",
+        "test session debugging and configuration")
+    group.addoption('--basetemp', dest="basetemp", default=None, metavar="dir",
+               help="base temporary directory for this test run.")
+
+
+def pytest_namespace():
+    collect = dict(Item=Item, Collector=Collector, File=File, Session=Session)
+    return dict(collect=collect)
+
+def pytest_configure(config):
+    pytest.config = config # compatibiltiy
+    if config.option.exitfirst:
+        config.option.maxfail = 1
+
+def wrap_session(config, doit):
+    """Skeleton command line program"""
+    session = Session(config)
+    session.exitstatus = EXIT_OK
+    initstate = 0
+    try:
+        try:
+            config._do_configure()
+            initstate = 1
+            config.hook.pytest_sessionstart(session=session)
+            initstate = 2
+            session.exitstatus = doit(config, session) or 0
+        except pytest.UsageError:
+            raise
+        except KeyboardInterrupt:
+            excinfo = _pytest._code.ExceptionInfo()
+            config.hook.pytest_keyboard_interrupt(excinfo=excinfo)
+            session.exitstatus = EXIT_INTERRUPTED
+        except:
+            excinfo = _pytest._code.ExceptionInfo()
+            config.notify_exception(excinfo, config.option)
+            session.exitstatus = EXIT_INTERNALERROR
+            if excinfo.errisinstance(SystemExit):
+                sys.stderr.write("mainloop: caught Spurious SystemExit!\n")
+
+    finally:
+        excinfo = None  # Explicitly break reference cycle.
+        session.startdir.chdir()
+        if initstate >= 2:
+            config.hook.pytest_sessionfinish(
+                session=session,
+                exitstatus=session.exitstatus)
+        config._ensure_unconfigure()
+    return session.exitstatus
+
+def pytest_cmdline_main(config):
+    return wrap_session(config, _main)
+
+def _main(config, session):
+    """ default command line protocol for initialization, session,
+    running tests and reporting. """
+    config.hook.pytest_collection(session=session)
+    config.hook.pytest_runtestloop(session=session)
+
+    if session.testsfailed:
+        return EXIT_TESTSFAILED
+    elif session.testscollected == 0:
+        return EXIT_NOTESTSCOLLECTED
+
+def pytest_collection(session):
+    return session.perform_collect()
+
+def pytest_runtestloop(session):
+    if session.config.option.collectonly:
+        return True
+
+    def getnextitem(i):
+        # this is a function to avoid python2
+        # keeping sys.exc_info set when calling into a test
+        # python2 keeps sys.exc_info till the frame is left
+        try:
+            return session.items[i+1]
+        except IndexError:
+            return None
+
+    for i, item in enumerate(session.items):
+        nextitem = getnextitem(i)
+        item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem)
+        if session.shouldstop:
+            raise session.Interrupted(session.shouldstop)
+    return True
+
+def pytest_ignore_collect(path, config):
+    p = path.dirpath()
+    ignore_paths = config._getconftest_pathlist("collect_ignore", path=p)
+    ignore_paths = ignore_paths or []
+    excludeopt = config.getoption("ignore")
+    if excludeopt:
+        ignore_paths.extend([py.path.local(x) for x in excludeopt])
+    return path in ignore_paths
+
+class FSHookProxy:
+    def __init__(self, fspath, pm, remove_mods):
+        self.fspath = fspath
+        self.pm = pm
+        self.remove_mods = remove_mods
+
+    def __getattr__(self, name):
+        x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods)
+        self.__dict__[name] = x
+        return x
+
+def compatproperty(name):
+    def fget(self):
+        # deprecated - use pytest.name
+        return getattr(pytest, name)
+
+    return property(fget)
+
+class NodeKeywords(MappingMixin):
+    def __init__(self, node):
+        self.node = node
+        self.parent = node.parent
+        self._markers = {node.name: True}
+
+    def __getitem__(self, key):
+        try:
+            return self._markers[key]
+        except KeyError:
+            if self.parent is None:
+                raise
+            return self.parent.keywords[key]
+
+    def __setitem__(self, key, value):
+        self._markers[key] = value
+
+    def __delitem__(self, key):
+        raise ValueError("cannot delete key in keywords dict")
+
+    def __iter__(self):
+        seen = set(self._markers)
+        if self.parent is not None:
+            seen.update(self.parent.keywords)
+        return iter(seen)
+
+    def __len__(self):
+        return len(self.__iter__())
+
+    def keys(self):
+        return list(self)
+
+    def __repr__(self):
+        return "<NodeKeywords for node %s>" % (self.node, )
+
+
+class Node(object):
+    """ base class for Collector and Item the test collection tree.
+    Collector subclasses have children, Items are terminal nodes."""
+
+    def __init__(self, name, parent=None, config=None, session=None):
+        #: a unique name within the scope of the parent node
+        self.name = name
+
+        #: the parent collector node.
+        self.parent = parent
+
+        #: the pytest config object
+        self.config = config or parent.config
+
+        #: the session this node is part of
+        self.session = session or parent.session
+
+        #: filesystem path where this node was collected from (can be None)
+        self.fspath = getattr(parent, 'fspath', None)
+
+        #: keywords/markers collected from all scopes
+        self.keywords = NodeKeywords(self)
+
+        #: allow adding of extra keywords to use for matching
+        self.extra_keyword_matches = set()
+
+        # used for storing artificial fixturedefs for direct parametrization
+        self._name2pseudofixturedef = {}
+
+    @property
+    def ihook(self):
+        """ fspath sensitive hook proxy used to call pytest hooks"""
+        return self.session.gethookproxy(self.fspath)
+
+    Module = compatproperty("Module")
+    Class = compatproperty("Class")
+    Instance = compatproperty("Instance")
+    Function = compatproperty("Function")
+    File = compatproperty("File")
+    Item = compatproperty("Item")
+
+    def _getcustomclass(self, name):
+        cls = getattr(self, name)
+        if cls != getattr(pytest, name):
+            py.log._apiwarn("2.0", "use of node.%s is deprecated, "
+                "use pytest_pycollect_makeitem(...) to create custom "
+                "collection nodes" % name)
+        return cls
+
+    def __repr__(self):
+        return "<%s %r>" %(self.__class__.__name__,
+                           getattr(self, 'name', None))
+
+    def warn(self, code, message):
+        """ generate a warning with the given code and message for this
+        item. """
+        assert isinstance(code, str)
+        fslocation = getattr(self, "location", None)
+        if fslocation is None:
+            fslocation = getattr(self, "fspath", None)
+        else:
+            fslocation = "%s:%s" % fslocation[:2]
+
+        self.ihook.pytest_logwarning.call_historic(kwargs=dict(
+            code=code, message=message,
+            nodeid=self.nodeid, fslocation=fslocation))
+
+    # methods for ordering nodes
+    @property
+    def nodeid(self):
+        """ a ::-separated string denoting its collection tree address. """
+        try:
+            return self._nodeid
+        except AttributeError:
+            self._nodeid = x = self._makeid()
+            return x
+
+    def _makeid(self):
+        return self.parent.nodeid + "::" + self.name
+
+    def __hash__(self):
+        return hash(self.nodeid)
+
+    def setup(self):
+        pass
+
+    def teardown(self):
+        pass
+
+    def _memoizedcall(self, attrname, function):
+        exattrname = "_ex_" + attrname
+        failure = getattr(self, exattrname, None)
+        if failure is not None:
+            py.builtin._reraise(failure[0], failure[1], failure[2])
+        if hasattr(self, attrname):
+            return getattr(self, attrname)
+        try:
+            res = function()
+        except py.builtin._sysex:
+            raise
+        except:
+            failure = sys.exc_info()
+            setattr(self, exattrname, failure)
+            raise
+        setattr(self, attrname, res)
+        return res
+
+    def listchain(self):
+        """ return list of all parent collectors up to self,
+            starting from root of collection tree. """
+        chain = []
+        item = self
+        while item is not None:
+            chain.append(item)
+            item = item.parent
+        chain.reverse()
+        return chain
+
+    def add_marker(self, marker):
+        """ dynamically add a marker object to the node.
+
+        ``marker`` can be a string or pytest.mark.* instance.
+        """
+        from _pytest.mark import MarkDecorator
+        if isinstance(marker, py.builtin._basestring):
+            marker = MarkDecorator(marker)
+        elif not isinstance(marker, MarkDecorator):
+            raise ValueError("is not a string or pytest.mark.* Marker")
+        self.keywords[marker.name] = marker
+
+    def get_marker(self, name):
+        """ get a marker object from this node or None if
+        the node doesn't have a marker with that name. """
+        val = self.keywords.get(name, None)
+        if val is not None:
+            from _pytest.mark import MarkInfo, MarkDecorator
+            if isinstance(val, (MarkDecorator, MarkInfo)):
+                return val
+
+    def listextrakeywords(self):
+        """ Return a set of all extra keywords in self and any parents."""
+        extra_keywords = set()
+        item = self
+        for item in self.listchain():
+            extra_keywords.update(item.extra_keyword_matches)
+        return extra_keywords
+
+    def listnames(self):
+        return [x.name for x in self.listchain()]
+
+    def addfinalizer(self, fin):
+        """ register a function to be called when this node is finalized.
+
+        This method can only be called when this node is active
+        in a setup chain, for example during self.setup().
+        """
+        self.session._setupstate.addfinalizer(fin, self)
+
+    def getparent(self, cls):
+        """ get the next parent node (including ourself)
+        which is an instance of the given class"""
+        current = self
+        while current and not isinstance(current, cls):
+            current = current.parent
+        return current
+
+    def _prunetraceback(self, excinfo):
+        pass
+
+    def _repr_failure_py(self, excinfo, style=None):
+        fm = self.session._fixturemanager
+        if excinfo.errisinstance(fm.FixtureLookupError):
+            return excinfo.value.formatrepr()
+        tbfilter = True
+        if self.config.option.fulltrace:
+            style="long"
+        else:
+            self._prunetraceback(excinfo)
+            tbfilter = False  # prunetraceback already does it
+            if style == "auto":
+                style = "long"
+        # XXX should excinfo.getrepr record all data and toterminal() process it?
+        if style is None:
+            if self.config.option.tbstyle == "short":
+                style = "short"
+            else:
+                style = "long"
+
+        return excinfo.getrepr(funcargs=True,
+                               showlocals=self.config.option.showlocals,
+                               style=style, tbfilter=tbfilter)
+
+    repr_failure = _repr_failure_py
+
+class Collector(Node):
+    """ Collector instances create children through collect()
+        and thus iteratively build a tree.
+    """
+
+    class CollectError(Exception):
+        """ an error during collection, contains a custom message. """
+
+    def collect(self):
+        """ returns a list of children (items and collectors)
+            for this collection node.
+        """
+        raise NotImplementedError("abstract")
+
+    def repr_failure(self, excinfo):
+        """ represent a collection failure. """
+        if excinfo.errisinstance(self.CollectError):
+            exc = excinfo.value
+            return str(exc.args[0])
+        return self._repr_failure_py(excinfo, style="short")
+
+    def _memocollect(self):
+        """ internal helper method to cache results of calling collect(). """
+        return self._memoizedcall('_collected', lambda: list(self.collect()))
+
+    def _prunetraceback(self, excinfo):
+        if hasattr(self, 'fspath'):
+            traceback = excinfo.traceback
+            ntraceback = traceback.cut(path=self.fspath)
+            if ntraceback == traceback:
+                ntraceback = ntraceback.cut(excludepath=tracebackcutdir)
+            excinfo.traceback = ntraceback.filter()
+
+class FSCollector(Collector):
+    def __init__(self, fspath, parent=None, config=None, session=None):
+        fspath = py.path.local(fspath) # xxx only for test_resultlog.py?
+        name = fspath.basename
+        if parent is not None:
+            rel = fspath.relto(parent.fspath)
+            if rel:
+                name = rel
+            name = name.replace(os.sep, "/")
+        super(FSCollector, self).__init__(name, parent, config, session)
+        self.fspath = fspath
+
+    def _makeid(self):
+        relpath = self.fspath.relto(self.config.rootdir)
+        if os.sep != "/":
+            relpath = relpath.replace(os.sep, "/")
+        return relpath
+
+class File(FSCollector):
+    """ base class for collecting tests from a file. """
+
+class Item(Node):
+    """ a basic test invocation item. Note that for a single function
+    there might be multiple test invocation items.
+    """
+    nextitem = None
+
+    def __init__(self, name, parent=None, config=None, session=None):
+        super(Item, self).__init__(name, parent, config, session)
+        self._report_sections = []
+
+    def add_report_section(self, when, key, content):
+        if content:
+            self._report_sections.append((when, key, content))
+
+    def reportinfo(self):
+        return self.fspath, None, ""
+
+    @property
+    def location(self):
+        try:
+            return self._location
+        except AttributeError:
+            location = self.reportinfo()
+            # bestrelpath is a quite slow function
+            cache = self.config.__dict__.setdefault("_bestrelpathcache", {})
+            try:
+                fspath = cache[location[0]]
+            except KeyError:
+                fspath = self.session.fspath.bestrelpath(location[0])
+                cache[location[0]] = fspath
+            location = (fspath, location[1], str(location[2]))
+            self._location = location
+            return location
+
+class NoMatch(Exception):
+    """ raised if matching cannot locate a matching names. """
+
+class Interrupted(KeyboardInterrupt):
+    """ signals an interrupted test run. """
+    __module__ = 'builtins' # for py3
+
+class Session(FSCollector):
+    Interrupted = Interrupted
+
+    def __init__(self, config):
+        FSCollector.__init__(self, config.rootdir, parent=None,
+                             config=config, session=self)
+        self._fs2hookproxy = {}
+        self.testsfailed = 0
+        self.testscollected = 0
+        self.shouldstop = False
+        self.trace = config.trace.root.get("collection")
+        self._norecursepatterns = config.getini("norecursedirs")
+        self.startdir = py.path.local()
+        self.config.pluginmanager.register(self, name="session")
+
+    def _makeid(self):
+        return ""
+
+    @pytest.hookimpl(tryfirst=True)
+    def pytest_collectstart(self):
+        if self.shouldstop:
+            raise self.Interrupted(self.shouldstop)
+
+    @pytest.hookimpl(tryfirst=True)
+    def pytest_runtest_logreport(self, report):
+        if report.failed and not hasattr(report, 'wasxfail'):
+            self.testsfailed += 1
+            maxfail = self.config.getvalue("maxfail")
+            if maxfail and self.testsfailed >= maxfail:
+                self.shouldstop = "stopping after %d failures" % (
+                    self.testsfailed)
+    pytest_collectreport = pytest_runtest_logreport
+
+    def isinitpath(self, path):
+        return path in self._initialpaths
+
+    def gethookproxy(self, fspath):
+        try:
+            return self._fs2hookproxy[fspath]
+        except KeyError:
+            # check if we have the common case of running
+            # hooks with all conftest.py filesall conftest.py
+            pm = self.config.pluginmanager
+            my_conftestmodules = pm._getconftestmodules(fspath)
+            remove_mods = pm._conftest_plugins.difference(my_conftestmodules)
+            if remove_mods:
+                # one or more conftests are not in use at this fspath
+                proxy = FSHookProxy(fspath, pm, remove_mods)
+            else:
+                # all plugis are active for this fspath
+                proxy = self.config.hook
+
+            self._fs2hookproxy[fspath] = proxy
+            return proxy
+
+    def perform_collect(self, args=None, genitems=True):
+        hook = self.config.hook
+        try:
+            items = self._perform_collect(args, genitems)
+            hook.pytest_collection_modifyitems(session=self,
+                config=self.config, items=items)
+        finally:
+            hook.pytest_collection_finish(session=self)
+        self.testscollected = len(items)
+        return items
+
+    def _perform_collect(self, args, genitems):
+        if args is None:
+            args = self.config.args
+        self.trace("perform_collect", self, args)
+        self.trace.root.indent += 1
+        self._notfound = []
+        self._initialpaths = set()
+        self._initialparts = []
+        self.items = items = []
+        for arg in args:
+            parts = self._parsearg(arg)
+            self._initialparts.append(parts)
+            self._initialpaths.add(parts[0])
+        rep = collect_one_node(self)
+        self.ihook.pytest_collectreport(report=rep)
+        self.trace.root.indent -= 1
+        if self._notfound:
+            errors = []
+            for arg, exc in self._notfound:
+                line = "(no name %r in any of %r)" % (arg, exc.args[0])
+                errors.append("not found: %s\n%s" % (arg, line))
+                #XXX: test this
+            raise pytest.UsageError(*errors)
+        if not genitems:
+            return rep.result
+        else:
+            if rep.passed:
+                for node in rep.result:
+                    self.items.extend(self.genitems(node))
+            return items
+
+    def collect(self):
+        for parts in self._initialparts:
+            arg = "::".join(map(str, parts))
+            self.trace("processing argument", arg)
+            self.trace.root.indent += 1
+            try:
+                for x in self._collect(arg):
+                    yield x
+            except NoMatch:
+                # we are inside a make_report hook so
+                # we cannot directly pass through the exception
+                self._notfound.append((arg, sys.exc_info()[1]))
+
+            self.trace.root.indent -= 1
+
+    def _collect(self, arg):
+        names = self._parsearg(arg)
+        path = names.pop(0)
+        if path.check(dir=1):
+            assert not names, "invalid arg %r" %(arg,)
+            for path in path.visit(fil=lambda x: x.check(file=1),
+                                   rec=self._recurse, bf=True, sort=True):
+                for x in self._collectfile(path):
+                    yield x
+        else:
+            assert path.check(file=1)
+            for x in self.matchnodes(self._collectfile(path), names):
+                yield x
+
+    def _collectfile(self, path):
+        ihook = self.gethookproxy(path)
+        if not self.isinitpath(path):
+            if ihook.pytest_ignore_collect(path=path, config=self.config):
+                return ()
+        return ihook.pytest_collect_file(path=path, parent=self)
+
+    def _recurse(self, path):
+        ihook = self.gethookproxy(path.dirpath())
+        if ihook.pytest_ignore_collect(path=path, config=self.config):
+            return
+        for pat in self._norecursepatterns:
+            if path.check(fnmatch=pat):
+                return False
+        ihook = self.gethookproxy(path)
+        ihook.pytest_collect_directory(path=path, parent=self)
+        return True
+
+    def _tryconvertpyarg(self, x):
+        mod = None
+        path = [os.path.abspath('.')] + sys.path
+        for name in x.split('.'):
+            # ignore anything that's not a proper name here
+            # else something like --pyargs will mess up '.'
+            # since imp.find_module will actually sometimes work for it
+            # but it's supposed to be considered a filesystem path
+            # not a package
+            if name_re.match(name) is None:
+                return x
+            try:
+                fd, mod, type_ = imp.find_module(name, path)
+            except ImportError:
+                return x
+            else:
+                if fd is not None:
+                    fd.close()
+
+            if type_[2] != imp.PKG_DIRECTORY:
+                path = [os.path.dirname(mod)]
+            else:
+                path = [mod]
+        return mod
+
+    def _parsearg(self, arg):
+        """ return (fspath, names) tuple after checking the file exists. """
+        arg = str(arg)
+        if self.config.option.pyargs:
+            arg = self._tryconvertpyarg(arg)
+        parts = str(arg).split("::")
+        relpath = parts[0].replace("/", os.sep)
+        path = self.config.invocation_dir.join(relpath, abs=True)
+        if not path.check():
+            if self.config.option.pyargs:
+                msg = "file or package not found: "
+            else:
+                msg = "file not found: "
+            raise pytest.UsageError(msg + arg)
+        parts[0] = path
+        return parts
+
+    def matchnodes(self, matching, names):
+        self.trace("matchnodes", matching, names)
+        self.trace.root.indent += 1
+        nodes = self._matchnodes(matching, names)
+        num = len(nodes)
+        self.trace("matchnodes finished -> ", num, "nodes")
+        self.trace.root.indent -= 1
+        if num == 0:
+            raise NoMatch(matching, names[:1])
+        return nodes
+
+    def _matchnodes(self, matching, names):
+        if not matching or not names:
+            return matching
+        name = names[0]
+        assert name
+        nextnames = names[1:]
+        resultnodes = []
+        for node in matching:
+            if isinstance(node, pytest.Item):
+                if not names:
+                    resultnodes.append(node)
+                continue
+            assert isinstance(node, pytest.Collector)
+            rep = collect_one_node(node)
+            if rep.passed:
+                has_matched = False
+                for x in rep.result:
+                    # TODO: remove parametrized workaround once collection structure contains parametrization
+                    if x.name == name or x.name.split("[")[0] == name:
+                        resultnodes.extend(self.matchnodes([x], nextnames))
+                        has_matched = True
+                # XXX accept IDs that don't have "()" for class instances
+                if not has_matched and len(rep.result) == 1 and x.name == "()":
+                    nextnames.insert(0, name)
+                    resultnodes.extend(self.matchnodes([x], nextnames))
+            node.ihook.pytest_collectreport(report=rep)
+        return resultnodes
+
+    def genitems(self, node):
+        self.trace("genitems", node)
+        if isinstance(node, pytest.Item):
+            node.ihook.pytest_itemcollected(item=node)
+            yield node
+        else:
+            assert isinstance(node, pytest.Collector)
+            rep = collect_one_node(node)
+            if rep.passed:
+                for subnode in rep.result:
+                    for x in self.genitems(subnode):
+                        yield x
+            node.ihook.pytest_collectreport(report=rep)
diff --git a/python/pytest/_pytest/mark.py b/python/pytest/_pytest/mark.py
new file mode 100644
index 000000000..d8b60def3
--- /dev/null
+++ b/python/pytest/_pytest/mark.py
@@ -0,0 +1,311 @@
+""" generic mechanism for marking and selecting python functions. """
+import inspect
+
+
+class MarkerError(Exception):
+
+    """Error in use of a pytest marker/attribute."""
+
+
+def pytest_namespace():
+    return {'mark': MarkGenerator()}
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group._addoption(
+        '-k',
+        action="store", dest="keyword", default='', metavar="EXPRESSION",
+        help="only run tests which match the given substring expression. "
+             "An expression is a python evaluatable expression "
+             "where all names are substring-matched against test names "
+             "and their parent classes. Example: -k 'test_method or test "
+             "other' matches all test functions and classes whose name "
+             "contains 'test_method' or 'test_other'. "
+             "Additionally keywords are matched to classes and functions "
+             "containing extra names in their 'extra_keyword_matches' set, "
+             "as well as functions which have names assigned directly to them."
+    )
+
+    group._addoption(
+        "-m",
+        action="store", dest="markexpr", default="", metavar="MARKEXPR",
+        help="only run tests matching given mark expression.  "
+             "example: -m 'mark1 and not mark2'."
+    )
+
+    group.addoption(
+        "--markers", action="store_true",
+        help="show markers (builtin, plugin and per-project ones)."
+    )
+
+    parser.addini("markers", "markers for test functions", 'linelist')
+
+
+def pytest_cmdline_main(config):
+    import _pytest.config
+    if config.option.markers:
+        config._do_configure()
+        tw = _pytest.config.create_terminal_writer(config)
+        for line in config.getini("markers"):
+            name, rest = line.split(":", 1)
+            tw.write("@pytest.mark.%s:" % name, bold=True)
+            tw.line(rest)
+            tw.line()
+        config._ensure_unconfigure()
+        return 0
+pytest_cmdline_main.tryfirst = True
+
+
+def pytest_collection_modifyitems(items, config):
+    keywordexpr = config.option.keyword.lstrip()
+    matchexpr = config.option.markexpr
+    if not keywordexpr and not matchexpr:
+        return
+    # pytest used to allow "-" for negating
+    # but today we just allow "-" at the beginning, use "not" instead
+    # we probably remove "-" alltogether soon
+    if keywordexpr.startswith("-"):
+        keywordexpr = "not " + keywordexpr[1:]
+    selectuntil = False
+    if keywordexpr[-1:] == ":":
+        selectuntil = True
+        keywordexpr = keywordexpr[:-1]
+
+    remaining = []
+    deselected = []
+    for colitem in items:
+        if keywordexpr and not matchkeyword(colitem, keywordexpr):
+            deselected.append(colitem)
+        else:
+            if selectuntil:
+                keywordexpr = None
+            if matchexpr:
+                if not matchmark(colitem, matchexpr):
+                    deselected.append(colitem)
+                    continue
+            remaining.append(colitem)
+
+    if deselected:
+        config.hook.pytest_deselected(items=deselected)
+        items[:] = remaining
+
+
+class MarkMapping:
+    """Provides a local mapping for markers where item access
+    resolves to True if the marker is present. """
+    def __init__(self, keywords):
+        mymarks = set()
+        for key, value in keywords.items():
+            if isinstance(value, MarkInfo) or isinstance(value, MarkDecorator):
+                mymarks.add(key)
+        self._mymarks = mymarks
+
+    def __getitem__(self, name):
+        return name in self._mymarks
+
+
+class KeywordMapping:
+    """Provides a local mapping for keywords.
+    Given a list of names, map any substring of one of these names to True.
+    """
+    def __init__(self, names):
+        self._names = names
+
+    def __getitem__(self, subname):
+        for name in self._names:
+            if subname in name:
+                return True
+        return False
+
+
+def matchmark(colitem, markexpr):
+    """Tries to match on any marker names, attached to the given colitem."""
+    return eval(markexpr, {}, MarkMapping(colitem.keywords))
+
+
+def matchkeyword(colitem, keywordexpr):
+    """Tries to match given keyword expression to given collector item.
+
+    Will match on the name of colitem, including the names of its parents.
+    Only matches names of items which are either a :class:`Class` or a
+    :class:`Function`.
+    Additionally, matches on names in the 'extra_keyword_matches' set of
+    any item, as well as names directly assigned to test functions.
+    """
+    mapped_names = set()
+
+    # Add the names of the current item and any parent items
+    import pytest
+    for item in colitem.listchain():
+        if not isinstance(item, pytest.Instance):
+            mapped_names.add(item.name)
+
+    # Add the names added as extra keywords to current or parent items
+    for name in colitem.listextrakeywords():
+        mapped_names.add(name)
+
+    # Add the names attached to the current function through direct assignment
+    if hasattr(colitem, 'function'):
+        for name in colitem.function.__dict__:
+            mapped_names.add(name)
+
+    mapping = KeywordMapping(mapped_names)
+    if " " not in keywordexpr:
+        # special case to allow for simple "-k pass" and "-k 1.3"
+        return mapping[keywordexpr]
+    elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]:
+        return not mapping[keywordexpr[4:]]
+    return eval(keywordexpr, {}, mapping)
+
+
+def pytest_configure(config):
+    import pytest
+    if config.option.strict:
+        pytest.mark._config = config
+
+
+class MarkGenerator:
+    """ Factory for :class:`MarkDecorator` objects - exposed as
+    a ``pytest.mark`` singleton instance.  Example::
+
+         import pytest
+         @pytest.mark.slowtest
+         def test_function():
+            pass
+
+    will set a 'slowtest' :class:`MarkInfo` object
+    on the ``test_function`` object. """
+
+    def __getattr__(self, name):
+        if name[0] == "_":
+            raise AttributeError("Marker name must NOT start with underscore")
+        if hasattr(self, '_config'):
+            self._check(name)
+        return MarkDecorator(name)
+
+    def _check(self, name):
+        try:
+            if name in self._markers:
+                return
+        except AttributeError:
+            pass
+        self._markers = l = set()
+        for line in self._config.getini("markers"):
+            beginning = line.split(":", 1)
+            x = beginning[0].split("(", 1)[0]
+            l.add(x)
+        if name not in self._markers:
+            raise AttributeError("%r not a registered marker" % (name,))
+
+def istestfunc(func):
+    return hasattr(func, "__call__") and \
+        getattr(func, "__name__", "<lambda>") != "<lambda>"
+
+class MarkDecorator:
+    """ A decorator for test functions and test classes.  When applied
+    it will create :class:`MarkInfo` objects which may be
+    :ref:`retrieved by hooks as item keywords <excontrolskip>`.
+    MarkDecorator instances are often created like this::
+
+        mark1 = pytest.mark.NAME              # simple MarkDecorator
+        mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator
+
+    and can then be applied as decorators to test functions::
+
+        @mark2
+        def test_function():
+            pass
+
+    When a MarkDecorator instance is called it does the following:
+      1. If called with a single class as its only positional argument and no
+         additional keyword arguments, it attaches itself to the class so it
+         gets applied automatically to all test cases found in that class.
+      2. If called with a single function as its only positional argument and
+         no additional keyword arguments, it attaches a MarkInfo object to the
+         function, containing all the arguments already stored internally in
+         the MarkDecorator.
+      3. When called in any other case, it performs a 'fake construction' call,
+         i.e. it returns a new MarkDecorator instance with the original
+         MarkDecorator's content updated with the arguments passed to this
+         call.
+
+    Note: The rules above prevent MarkDecorator objects from storing only a
+    single function or class reference as their positional argument with no
+    additional keyword or positional arguments.
+
+    """
+    def __init__(self, name, args=None, kwargs=None):
+        self.name = name
+        self.args = args or ()
+        self.kwargs = kwargs or {}
+
+    @property
+    def markname(self):
+        return self.name # for backward-compat (2.4.1 had this attr)
+
+    def __repr__(self):
+        d = self.__dict__.copy()
+        name = d.pop('name')
+        return "<MarkDecorator %r %r>" % (name, d)
+
+    def __call__(self, *args, **kwargs):
+        """ if passed a single callable argument: decorate it with mark info.
+            otherwise add *args/**kwargs in-place to mark information. """
+        if args and not kwargs:
+            func = args[0]
+            is_class = inspect.isclass(func)
+            if len(args) == 1 and (istestfunc(func) or is_class):
+                if is_class:
+                    if hasattr(func, 'pytestmark'):
+                        mark_list = func.pytestmark
+                        if not isinstance(mark_list, list):
+                            mark_list = [mark_list]
+                        # always work on a copy to avoid updating pytestmark
+                        # from a superclass by accident
+                        mark_list = mark_list + [self]
+                        func.pytestmark = mark_list
+                    else:
+                        func.pytestmark = [self]
+                else:
+                    holder = getattr(func, self.name, None)
+                    if holder is None:
+                        holder = MarkInfo(
+                            self.name, self.args, self.kwargs
+                        )
+                        setattr(func, self.name, holder)
+                    else:
+                        holder.add(self.args, self.kwargs)
+                return func
+        kw = self.kwargs.copy()
+        kw.update(kwargs)
+        args = self.args + args
+        return self.__class__(self.name, args=args, kwargs=kw)
+
+
+class MarkInfo:
+    """ Marking object created by :class:`MarkDecorator` instances. """
+    def __init__(self, name, args, kwargs):
+        #: name of attribute
+        self.name = name
+        #: positional argument list, empty if none specified
+        self.args = args
+        #: keyword argument dictionary, empty if nothing specified
+        self.kwargs = kwargs.copy()
+        self._arglist = [(args, kwargs.copy())]
+
+    def __repr__(self):
+        return "<MarkInfo %r args=%r kwargs=%r>" % (
+            self.name, self.args, self.kwargs
+        )
+
+    def add(self, args, kwargs):
+        """ add a MarkInfo with the given args and kwargs. """
+        self._arglist.append((args, kwargs))
+        self.args += args
+        self.kwargs.update(kwargs)
+
+    def __iter__(self):
+        """ yield MarkInfo objects each relating to a marking-call. """
+        for args, kwargs in self._arglist:
+            yield MarkInfo(self.name, args, kwargs)
diff --git a/python/pytest/_pytest/monkeypatch.py b/python/pytest/_pytest/monkeypatch.py
new file mode 100644
index 000000000..d4c169d37
--- /dev/null
+++ b/python/pytest/_pytest/monkeypatch.py
@@ -0,0 +1,254 @@
+""" monkeypatching and mocking functionality.  """
+
+import os, sys
+import re
+
+from py.builtin import _basestring
+
+RE_IMPORT_ERROR_NAME = re.compile("^No module named (.*)$")
+
+
+def pytest_funcarg__monkeypatch(request):
+    """The returned ``monkeypatch`` funcarg provides these
+    helper methods to modify objects, dictionaries or os.environ::
+
+        monkeypatch.setattr(obj, name, value, raising=True)
+        monkeypatch.delattr(obj, name, raising=True)
+        monkeypatch.setitem(mapping, name, value)
+        monkeypatch.delitem(obj, name, raising=True)
+        monkeypatch.setenv(name, value, prepend=False)
+        monkeypatch.delenv(name, value, raising=True)
+        monkeypatch.syspath_prepend(path)
+        monkeypatch.chdir(path)
+
+    All modifications will be undone after the requesting
+    test function has finished. The ``raising``
+    parameter determines if a KeyError or AttributeError
+    will be raised if the set/deletion operation has no target.
+    """
+    mpatch = monkeypatch()
+    request.addfinalizer(mpatch.undo)
+    return mpatch
+
+
+def resolve(name):
+    # simplified from zope.dottedname
+    parts = name.split('.')
+
+    used = parts.pop(0)
+    found = __import__(used)
+    for part in parts:
+        used += '.' + part
+        try:
+            found = getattr(found, part)
+        except AttributeError:
+            pass
+        else:
+            continue
+        # we use explicit un-nesting of the handling block in order
+        # to avoid nested exceptions on python 3
+        try:
+            __import__(used)
+        except ImportError as ex:
+            # str is used for py2 vs py3
+            expected = str(ex).split()[-1]
+            if expected == used:
+                raise
+            else:
+                raise ImportError(
+                    'import error in %s: %s' % (used, ex)
+                )
+        found = annotated_getattr(found, part, used)
+    return found
+
+
+def annotated_getattr(obj, name, ann):
+    try:
+        obj = getattr(obj, name)
+    except AttributeError:
+        raise AttributeError(
+                '%r object at %s has no attribute %r' % (
+                    type(obj).__name__, ann, name
+                )
+        )
+    return obj
+
+
+def derive_importpath(import_path, raising):
+    if not isinstance(import_path, _basestring) or "." not in import_path:
+        raise TypeError("must be absolute import path string, not %r" %
+                        (import_path,))
+    module, attr = import_path.rsplit('.', 1)
+    target = resolve(module)
+    if raising:
+        annotated_getattr(target, attr, ann=module)
+    return attr, target
+
+
+class Notset:
+    def __repr__(self):
+        return "<notset>"
+
+
+notset = Notset()
+
+
+class monkeypatch:
+    """ Object keeping a record of setattr/item/env/syspath changes. """
+
+    def __init__(self):
+        self._setattr = []
+        self._setitem = []
+        self._cwd = None
+        self._savesyspath = None
+
+    def setattr(self, target, name, value=notset, raising=True):
+        """ Set attribute value on target, memorizing the old value.
+        By default raise AttributeError if the attribute did not exist.
+
+        For convenience you can specify a string as ``target`` which
+        will be interpreted as a dotted import path, with the last part
+        being the attribute name.  Example:
+        ``monkeypatch.setattr("os.getcwd", lambda x: "/")``
+        would set the ``getcwd`` function of the ``os`` module.
+
+        The ``raising`` value determines if the setattr should fail
+        if the attribute is not already present (defaults to True
+        which means it will raise).
+        """
+        __tracebackhide__ = True
+        import inspect
+
+        if value is notset:
+            if not isinstance(target, _basestring):
+                raise TypeError("use setattr(target, name, value) or "
+                                "setattr(target, value) with target being a dotted "
+                                "import string")
+            value = name
+            name, target = derive_importpath(target, raising)
+
+        oldval = getattr(target, name, notset)
+        if raising and oldval is notset:
+            raise AttributeError("%r has no attribute %r" % (target, name))
+
+        # avoid class descriptors like staticmethod/classmethod
+        if inspect.isclass(target):
+            oldval = target.__dict__.get(name, notset)
+        self._setattr.append((target, name, oldval))
+        setattr(target, name, value)
+
+    def delattr(self, target, name=notset, raising=True):
+        """ Delete attribute ``name`` from ``target``, by default raise
+        AttributeError it the attribute did not previously exist.
+
+        If no ``name`` is specified and ``target`` is a string
+        it will be interpreted as a dotted import path with the
+        last part being the attribute name.
+
+        If ``raising`` is set to False, no exception will be raised if the
+        attribute is missing.
+        """
+        __tracebackhide__ = True
+        if name is notset:
+            if not isinstance(target, _basestring):
+                raise TypeError("use delattr(target, name) or "
+                                "delattr(target) with target being a dotted "
+                                "import string")
+            name, target = derive_importpath(target, raising)
+
+        if not hasattr(target, name):
+            if raising:
+                raise AttributeError(name)
+        else:
+            self._setattr.append((target, name, getattr(target, name, notset)))
+            delattr(target, name)
+
+    def setitem(self, dic, name, value):
+        """ Set dictionary entry ``name`` to value. """
+        self._setitem.append((dic, name, dic.get(name, notset)))
+        dic[name] = value
+
+    def delitem(self, dic, name, raising=True):
+        """ Delete ``name`` from dict. Raise KeyError if it doesn't exist.
+
+        If ``raising`` is set to False, no exception will be raised if the
+        key is missing.
+        """
+        if name not in dic:
+            if raising:
+                raise KeyError(name)
+        else:
+            self._setitem.append((dic, name, dic.get(name, notset)))
+            del dic[name]
+
+    def setenv(self, name, value, prepend=None):
+        """ Set environment variable ``name`` to ``value``.  If ``prepend``
+        is a character, read the current environment variable value
+        and prepend the ``value`` adjoined with the ``prepend`` character."""
+        value = str(value)
+        if prepend and name in os.environ:
+            value = value + prepend + os.environ[name]
+        self.setitem(os.environ, name, value)
+
+    def delenv(self, name, raising=True):
+        """ Delete ``name`` from the environment. Raise KeyError it does not
+        exist.
+
+        If ``raising`` is set to False, no exception will be raised if the
+        environment variable is missing.
+        """
+        self.delitem(os.environ, name, raising=raising)
+
+    def syspath_prepend(self, path):
+        """ Prepend ``path`` to ``sys.path`` list of import locations. """
+        if self._savesyspath is None:
+            self._savesyspath = sys.path[:]
+        sys.path.insert(0, str(path))
+
+    def chdir(self, path):
+        """ Change the current working directory to the specified path.
+        Path can be a string or a py.path.local object.
+        """
+        if self._cwd is None:
+            self._cwd = os.getcwd()
+        if hasattr(path, "chdir"):
+            path.chdir()
+        else:
+            os.chdir(path)
+
+    def undo(self):
+        """ Undo previous changes.  This call consumes the
+        undo stack. Calling it a second time has no effect unless
+        you do more monkeypatching after the undo call.
+        
+        There is generally no need to call `undo()`, since it is
+        called automatically during tear-down.
+        
+        Note that the same `monkeypatch` fixture is used across a
+        single test function invocation. If `monkeypatch` is used both by
+        the test function itself and one of the test fixtures,
+        calling `undo()` will undo all of the changes made in
+        both functions.
+        """
+        for obj, name, value in reversed(self._setattr):
+            if value is not notset:
+                setattr(obj, name, value)
+            else:
+                delattr(obj, name)
+        self._setattr[:] = []
+        for dictionary, name, value in reversed(self._setitem):
+            if value is notset:
+                try:
+                    del dictionary[name]
+                except KeyError:
+                    pass  # was already deleted, so we have the desired state
+            else:
+                dictionary[name] = value
+        self._setitem[:] = []
+        if self._savesyspath is not None:
+            sys.path[:] = self._savesyspath
+            self._savesyspath = None
+
+        if self._cwd is not None:
+            os.chdir(self._cwd)
+            self._cwd = None
diff --git a/python/pytest/_pytest/nose.py b/python/pytest/_pytest/nose.py
new file mode 100644
index 000000000..038746868
--- /dev/null
+++ b/python/pytest/_pytest/nose.py
@@ -0,0 +1,71 @@
+""" run test suites written for nose. """
+
+import sys
+
+import py
+import pytest
+from _pytest import unittest
+
+
+def get_skip_exceptions():
+    skip_classes = set()
+    for module_name in ('unittest', 'unittest2', 'nose'):
+        mod = sys.modules.get(module_name)
+        if hasattr(mod, 'SkipTest'):
+            skip_classes.add(mod.SkipTest)
+    return tuple(skip_classes)
+
+
+def pytest_runtest_makereport(item, call):
+    if call.excinfo and call.excinfo.errisinstance(get_skip_exceptions()):
+        # let's substitute the excinfo with a pytest.skip one
+        call2 = call.__class__(lambda:
+                    pytest.skip(str(call.excinfo.value)), call.when)
+        call.excinfo = call2.excinfo
+
+
+@pytest.hookimpl(trylast=True)
+def pytest_runtest_setup(item):
+    if is_potential_nosetest(item):
+        if isinstance(item.parent, pytest.Generator):
+            gen = item.parent
+            if not hasattr(gen, '_nosegensetup'):
+                call_optional(gen.obj, 'setup')
+                if isinstance(gen.parent, pytest.Instance):
+                    call_optional(gen.parent.obj, 'setup')
+                gen._nosegensetup = True
+        if not call_optional(item.obj, 'setup'):
+            # call module level setup if there is no object level one
+            call_optional(item.parent.obj, 'setup')
+        #XXX this implies we only call teardown when setup worked
+        item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item)
+
+def teardown_nose(item):
+    if is_potential_nosetest(item):
+        if not call_optional(item.obj, 'teardown'):
+            call_optional(item.parent.obj, 'teardown')
+        #if hasattr(item.parent, '_nosegensetup'):
+        #    #call_optional(item._nosegensetup, 'teardown')
+        #    del item.parent._nosegensetup
+
+
+def pytest_make_collect_report(collector):
+    if isinstance(collector, pytest.Generator):
+        call_optional(collector.obj, 'setup')
+
+
+def is_potential_nosetest(item):
+    # extra check needed since we do not do nose style setup/teardown
+    # on direct unittest style classes
+    return isinstance(item, pytest.Function) and \
+        not isinstance(item, unittest.TestCaseFunction)
+
+
+def call_optional(obj, name):
+    method = getattr(obj, name, None)
+    isfixture = hasattr(method, "_pytestfixturefunction")
+    if method is not None and not isfixture and py.builtin.callable(method):
+        # If there's any problems allow the exception to raise rather than
+        # silently ignoring them
+        method()
+        return True
diff --git a/python/pytest/_pytest/pastebin.py b/python/pytest/_pytest/pastebin.py
new file mode 100644
index 000000000..4ec62d022
--- /dev/null
+++ b/python/pytest/_pytest/pastebin.py
@@ -0,0 +1,92 @@
+""" submit failure or test session information to a pastebin service. """
+import pytest
+import sys
+import tempfile
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting")
+    group._addoption('--pastebin', metavar="mode",
+        action='store', dest="pastebin", default=None,
+        choices=['failed', 'all'],
+        help="send failed|all info to bpaste.net pastebin service.")
+
+@pytest.hookimpl(trylast=True)
+def pytest_configure(config):
+    import py
+    if config.option.pastebin == "all":
+        tr = config.pluginmanager.getplugin('terminalreporter')
+        # if no terminal reporter plugin is present, nothing we can do here;
+        # this can happen when this function executes in a slave node
+        # when using pytest-xdist, for example
+        if tr is not None:
+            # pastebin file will be utf-8 encoded binary file
+            config._pastebinfile = tempfile.TemporaryFile('w+b')
+            oldwrite = tr._tw.write
+            def tee_write(s, **kwargs):
+                oldwrite(s, **kwargs)
+                if py.builtin._istext(s):
+                    s = s.encode('utf-8')
+                config._pastebinfile.write(s)
+            tr._tw.write = tee_write
+
+def pytest_unconfigure(config):
+    if hasattr(config, '_pastebinfile'):
+        # get terminal contents and delete file
+        config._pastebinfile.seek(0)
+        sessionlog = config._pastebinfile.read()
+        config._pastebinfile.close()
+        del config._pastebinfile
+        # undo our patching in the terminal reporter
+        tr = config.pluginmanager.getplugin('terminalreporter')
+        del tr._tw.__dict__['write']
+        # write summary
+        tr.write_sep("=", "Sending information to Paste Service")
+        pastebinurl = create_new_paste(sessionlog)
+        tr.write_line("pastebin session-log: %s\n" % pastebinurl)
+
+def create_new_paste(contents):
+    """
+    Creates a new paste using bpaste.net service.
+
+    :contents: paste contents as utf-8 encoded bytes
+    :returns: url to the pasted contents
+    """
+    import re
+    if sys.version_info < (3, 0):
+        from urllib import urlopen, urlencode
+    else:
+        from urllib.request import urlopen
+        from urllib.parse import urlencode
+
+    params = {
+        'code': contents,
+        'lexer': 'python3' if sys.version_info[0] == 3 else 'python',
+        'expiry': '1week',
+    }
+    url = 'https://bpaste.net'
+    response = urlopen(url, data=urlencode(params).encode('ascii')).read()
+    m = re.search(r'href="/raw/(\w+)"', response.decode('utf-8'))
+    if m:
+        return '%s/show/%s' % (url, m.group(1))
+    else:
+        return 'bad response: ' + response
+
+def pytest_terminal_summary(terminalreporter):
+    import _pytest.config
+    if terminalreporter.config.option.pastebin != "failed":
+        return
+    tr = terminalreporter
+    if 'failed' in tr.stats:
+        terminalreporter.write_sep("=", "Sending information to Paste Service")
+        for rep in terminalreporter.stats.get('failed'):
+            try:
+                msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc
+            except AttributeError:
+                msg = tr._getfailureheadline(rep)
+            tw = _pytest.config.create_terminal_writer(terminalreporter.config, stringio=True)
+            rep.toterminal(tw)
+            s = tw.stringio.getvalue()
+            assert len(s)
+            pastebinurl = create_new_paste(s)
+            tr.write_line("%s --> %s" %(msg, pastebinurl))
diff --git a/python/pytest/_pytest/pdb.py b/python/pytest/_pytest/pdb.py
new file mode 100644
index 000000000..84c920d17
--- /dev/null
+++ b/python/pytest/_pytest/pdb.py
@@ -0,0 +1,109 @@
+""" interactive debugging with PDB, the Python Debugger. """
+from __future__ import absolute_import
+import pdb
+import sys
+
+import pytest
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group._addoption('--pdb',
+               action="store_true", dest="usepdb", default=False,
+               help="start the interactive Python debugger on errors.")
+
+def pytest_namespace():
+    return {'set_trace': pytestPDB().set_trace}
+
+def pytest_configure(config):
+    if config.getvalue("usepdb"):
+        config.pluginmanager.register(PdbInvoke(), 'pdbinvoke')
+
+    old = (pdb.set_trace, pytestPDB._pluginmanager)
+    def fin():
+        pdb.set_trace, pytestPDB._pluginmanager = old
+        pytestPDB._config = None
+    pdb.set_trace = pytest.set_trace
+    pytestPDB._pluginmanager = config.pluginmanager
+    pytestPDB._config = config
+    config._cleanup.append(fin)
+
+class pytestPDB:
+    """ Pseudo PDB that defers to the real pdb. """
+    _pluginmanager = None
+    _config = None
+
+    def set_trace(self):
+        """ invoke PDB set_trace debugging, dropping any IO capturing. """
+        import _pytest.config
+        frame = sys._getframe().f_back
+        if self._pluginmanager is not None:
+            capman = self._pluginmanager.getplugin("capturemanager")
+            if capman:
+                capman.suspendcapture(in_=True)
+            tw = _pytest.config.create_terminal_writer(self._config)
+            tw.line()
+            tw.sep(">", "PDB set_trace (IO-capturing turned off)")
+            self._pluginmanager.hook.pytest_enter_pdb(config=self._config)
+        pdb.Pdb().set_trace(frame)
+
+
+class PdbInvoke:
+    def pytest_exception_interact(self, node, call, report):
+        capman = node.config.pluginmanager.getplugin("capturemanager")
+        if capman:
+            out, err = capman.suspendcapture(in_=True)
+            sys.stdout.write(out)
+            sys.stdout.write(err)
+        _enter_pdb(node, call.excinfo, report)
+
+    def pytest_internalerror(self, excrepr, excinfo):
+        for line in str(excrepr).split("\n"):
+            sys.stderr.write("INTERNALERROR> %s\n" %line)
+            sys.stderr.flush()
+        tb = _postmortem_traceback(excinfo)
+        post_mortem(tb)
+
+
+def _enter_pdb(node, excinfo, rep):
+    # XXX we re-use the TerminalReporter's terminalwriter
+    # because this seems to avoid some encoding related troubles
+    # for not completely clear reasons.
+    tw = node.config.pluginmanager.getplugin("terminalreporter")._tw
+    tw.line()
+    tw.sep(">", "traceback")
+    rep.toterminal(tw)
+    tw.sep(">", "entering PDB")
+    tb = _postmortem_traceback(excinfo)
+    post_mortem(tb)
+    rep._pdbshown = True
+    return rep
+
+
+def _postmortem_traceback(excinfo):
+    # A doctest.UnexpectedException is not useful for post_mortem.
+    # Use the underlying exception instead:
+    from doctest import UnexpectedException
+    if isinstance(excinfo.value, UnexpectedException):
+        return excinfo.value.exc_info[2]
+    else:
+        return excinfo._excinfo[2]
+
+
+def _find_last_non_hidden_frame(stack):
+    i = max(0, len(stack) - 1)
+    while i and stack[i][0].f_locals.get("__tracebackhide__", False):
+        i -= 1
+    return i
+
+
+def post_mortem(t):
+    class Pdb(pdb.Pdb):
+        def get_stack(self, f, t):
+            stack, i = pdb.Pdb.get_stack(self, f, t)
+            if f is None:
+                i = _find_last_non_hidden_frame(stack)
+            return stack, i
+    p = Pdb()
+    p.reset()
+    p.interaction(None, t)
diff --git a/python/pytest/_pytest/pytester.py b/python/pytest/_pytest/pytester.py
new file mode 100644
index 000000000..faed7f581
--- /dev/null
+++ b/python/pytest/_pytest/pytester.py
@@ -0,0 +1,1110 @@
+""" (disabled by default) support for testing pytest and pytest plugins. """
+import codecs
+import gc
+import os
+import platform
+import re
+import subprocess
+import sys
+import time
+import traceback
+from fnmatch import fnmatch
+
+from py.builtin import print_
+
+from _pytest._code import Source
+import py
+import pytest
+from _pytest.main import Session, EXIT_OK
+
+
+def pytest_addoption(parser):
+    # group = parser.getgroup("pytester", "pytester (self-tests) options")
+    parser.addoption('--lsof',
+           action="store_true", dest="lsof", default=False,
+           help=("run FD checks if lsof is available"))
+
+    parser.addoption('--runpytest', default="inprocess", dest="runpytest",
+           choices=("inprocess", "subprocess", ),
+           help=("run pytest sub runs in tests using an 'inprocess' "
+                 "or 'subprocess' (python -m main) method"))
+
+
+def pytest_configure(config):
+    # This might be called multiple times. Only take the first.
+    global _pytest_fullpath
+    try:
+        _pytest_fullpath
+    except NameError:
+        _pytest_fullpath = os.path.abspath(pytest.__file__.rstrip("oc"))
+        _pytest_fullpath = _pytest_fullpath.replace("$py.class", ".py")
+
+    if config.getvalue("lsof"):
+        checker = LsofFdLeakChecker()
+        if checker.matching_platform():
+            config.pluginmanager.register(checker)
+
+
+class LsofFdLeakChecker(object):
+    def get_open_files(self):
+        out = self._exec_lsof()
+        open_files = self._parse_lsof_output(out)
+        return open_files
+
+    def _exec_lsof(self):
+        pid = os.getpid()
+        return py.process.cmdexec("lsof -Ffn0 -p %d" % pid)
+
+    def _parse_lsof_output(self, out):
+        def isopen(line):
+            return line.startswith('f') and ("deleted" not in line and
+                'mem' not in line and "txt" not in line and 'cwd' not in line)
+
+        open_files = []
+
+        for line in out.split("\n"):
+            if isopen(line):
+                fields = line.split('\0')
+                fd = fields[0][1:]
+                filename = fields[1][1:]
+                if filename.startswith('/'):
+                    open_files.append((fd, filename))
+
+        return open_files
+
+    def matching_platform(self):
+        try:
+            py.process.cmdexec("lsof -v")
+        except (py.process.cmdexec.Error, UnicodeDecodeError):
+            # cmdexec may raise UnicodeDecodeError on Windows systems
+            # with locale other than english:
+            # https://bitbucket.org/pytest-dev/py/issues/66
+            return False
+        else:
+            return True
+
+    @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+    def pytest_runtest_item(self, item):
+        lines1 = self.get_open_files()
+        yield
+        if hasattr(sys, "pypy_version_info"):
+            gc.collect()
+        lines2 = self.get_open_files()
+
+        new_fds = set([t[0] for t in lines2]) - set([t[0] for t in lines1])
+        leaked_files = [t for t in lines2 if t[0] in new_fds]
+        if leaked_files:
+            error = []
+            error.append("***** %s FD leakage detected" % len(leaked_files))
+            error.extend([str(f) for f in leaked_files])
+            error.append("*** Before:")
+            error.extend([str(f) for f in lines1])
+            error.append("*** After:")
+            error.extend([str(f) for f in lines2])
+            error.append(error[0])
+            error.append("*** function %s:%s: %s " % item.location)
+            pytest.fail("\n".join(error), pytrace=False)
+
+
+# XXX copied from execnet's conftest.py - needs to be merged
+winpymap = {
+    'python2.7': r'C:\Python27\python.exe',
+    'python2.6': r'C:\Python26\python.exe',
+    'python3.1': r'C:\Python31\python.exe',
+    'python3.2': r'C:\Python32\python.exe',
+    'python3.3': r'C:\Python33\python.exe',
+    'python3.4': r'C:\Python34\python.exe',
+    'python3.5': r'C:\Python35\python.exe',
+}
+
+def getexecutable(name, cache={}):
+    try:
+        return cache[name]
+    except KeyError:
+        executable = py.path.local.sysfind(name)
+        if executable:
+            if name == "jython":
+                import subprocess
+                popen = subprocess.Popen([str(executable), "--version"],
+                    universal_newlines=True, stderr=subprocess.PIPE)
+                out, err = popen.communicate()
+                if not err or "2.5" not in err:
+                    executable = None
+                if "2.5.2" in err:
+                    executable = None # http://bugs.jython.org/issue1790
+        cache[name] = executable
+        return executable
+
+@pytest.fixture(params=['python2.6', 'python2.7', 'python3.3', "python3.4",
+                        'pypy', 'pypy3'])
+def anypython(request):
+    name = request.param
+    executable = getexecutable(name)
+    if executable is None:
+        if sys.platform == "win32":
+            executable = winpymap.get(name, None)
+            if executable:
+                executable = py.path.local(executable)
+                if executable.check():
+                    return executable
+        pytest.skip("no suitable %s found" % (name,))
+    return executable
+
+# used at least by pytest-xdist plugin
+@pytest.fixture
+def _pytest(request):
+    """ Return a helper which offers a gethookrecorder(hook)
+    method which returns a HookRecorder instance which helps
+    to make assertions about called hooks.
+    """
+    return PytestArg(request)
+
+class PytestArg:
+    def __init__(self, request):
+        self.request = request
+
+    def gethookrecorder(self, hook):
+        hookrecorder = HookRecorder(hook._pm)
+        self.request.addfinalizer(hookrecorder.finish_recording)
+        return hookrecorder
+
+
+def get_public_names(l):
+    """Only return names from iterator l without a leading underscore."""
+    return [x for x in l if x[0] != "_"]
+
+
+class ParsedCall:
+    def __init__(self, name, kwargs):
+        self.__dict__.update(kwargs)
+        self._name = name
+
+    def __repr__(self):
+        d = self.__dict__.copy()
+        del d['_name']
+        return "<ParsedCall %r(**%r)>" %(self._name, d)
+
+
+class HookRecorder:
+    """Record all hooks called in a plugin manager.
+
+    This wraps all the hook calls in the plugin manager, recording
+    each call before propagating the normal calls.
+
+    """
+
+    def __init__(self, pluginmanager):
+        self._pluginmanager = pluginmanager
+        self.calls = []
+
+        def before(hook_name, hook_impls, kwargs):
+            self.calls.append(ParsedCall(hook_name, kwargs))
+
+        def after(outcome, hook_name, hook_impls, kwargs):
+            pass
+
+        self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after)
+
+    def finish_recording(self):
+        self._undo_wrapping()
+
+    def getcalls(self, names):
+        if isinstance(names, str):
+            names = names.split()
+        return [call for call in self.calls if call._name in names]
+
+    def assert_contains(self, entries):
+        __tracebackhide__ = True
+        i = 0
+        entries = list(entries)
+        backlocals = sys._getframe(1).f_locals
+        while entries:
+            name, check = entries.pop(0)
+            for ind, call in enumerate(self.calls[i:]):
+                if call._name == name:
+                    print_("NAMEMATCH", name, call)
+                    if eval(check, backlocals, call.__dict__):
+                        print_("CHECKERMATCH", repr(check), "->", call)
+                    else:
+                        print_("NOCHECKERMATCH", repr(check), "-", call)
+                        continue
+                    i += ind + 1
+                    break
+                print_("NONAMEMATCH", name, "with", call)
+            else:
+                pytest.fail("could not find %r check %r" % (name, check))
+
+    def popcall(self, name):
+        __tracebackhide__ = True
+        for i, call in enumerate(self.calls):
+            if call._name == name:
+                del self.calls[i]
+                return call
+        lines = ["could not find call %r, in:" % (name,)]
+        lines.extend(["  %s" % str(x) for x in self.calls])
+        pytest.fail("\n".join(lines))
+
+    def getcall(self, name):
+        l = self.getcalls(name)
+        assert len(l) == 1, (name, l)
+        return l[0]
+
+    # functionality for test reports
+
+    def getreports(self,
+                   names="pytest_runtest_logreport pytest_collectreport"):
+        return [x.report for x in self.getcalls(names)]
+
+    def matchreport(self, inamepart="",
+        names="pytest_runtest_logreport pytest_collectreport", when=None):
+        """ return a testreport whose dotted import path matches """
+        l = []
+        for rep in self.getreports(names=names):
+            try:
+                if not when and rep.when != "call" and rep.passed:
+                    # setup/teardown passing reports - let's ignore those
+                    continue
+            except AttributeError:
+                pass
+            if when and getattr(rep, 'when', None) != when:
+                continue
+            if not inamepart or inamepart in rep.nodeid.split("::"):
+                l.append(rep)
+        if not l:
+            raise ValueError("could not find test report matching %r: "
+                             "no test reports at all!" % (inamepart,))
+        if len(l) > 1:
+            raise ValueError(
+                "found 2 or more testreports matching %r: %s" %(inamepart, l))
+        return l[0]
+
+    def getfailures(self,
+                    names='pytest_runtest_logreport pytest_collectreport'):
+        return [rep for rep in self.getreports(names) if rep.failed]
+
+    def getfailedcollections(self):
+        return self.getfailures('pytest_collectreport')
+
+    def listoutcomes(self):
+        passed = []
+        skipped = []
+        failed = []
+        for rep in self.getreports(
+            "pytest_collectreport pytest_runtest_logreport"):
+            if rep.passed:
+                if getattr(rep, "when", None) == "call":
+                    passed.append(rep)
+            elif rep.skipped:
+                skipped.append(rep)
+            elif rep.failed:
+                failed.append(rep)
+        return passed, skipped, failed
+
+    def countoutcomes(self):
+        return [len(x) for x in self.listoutcomes()]
+
+    def assertoutcome(self, passed=0, skipped=0, failed=0):
+        realpassed, realskipped, realfailed = self.listoutcomes()
+        assert passed == len(realpassed)
+        assert skipped == len(realskipped)
+        assert failed == len(realfailed)
+
+    def clear(self):
+        self.calls[:] = []
+
+
+@pytest.fixture
+def linecomp(request):
+    return LineComp()
+
+
+def pytest_funcarg__LineMatcher(request):
+    return LineMatcher
+
+
+@pytest.fixture
+def testdir(request, tmpdir_factory):
+    return Testdir(request, tmpdir_factory)
+
+
+rex_outcome = re.compile("(\d+) ([\w-]+)")
+class RunResult:
+    """The result of running a command.
+
+    Attributes:
+
+    :ret: The return value.
+    :outlines: List of lines captured from stdout.
+    :errlines: List of lines captures from stderr.
+    :stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to
+       reconstruct stdout or the commonly used
+       ``stdout.fnmatch_lines()`` method.
+    :stderrr: :py:class:`LineMatcher` of stderr.
+    :duration: Duration in seconds.
+
+    """
+    def __init__(self, ret, outlines, errlines, duration):
+        self.ret = ret
+        self.outlines = outlines
+        self.errlines = errlines
+        self.stdout = LineMatcher(outlines)
+        self.stderr = LineMatcher(errlines)
+        self.duration = duration
+
+    def parseoutcomes(self):
+        """ Return a dictionary of outcomestring->num from parsing
+        the terminal output that the test process produced."""
+        for line in reversed(self.outlines):
+            if 'seconds' in line:
+                outcomes = rex_outcome.findall(line)
+                if outcomes:
+                    d = {}
+                    for num, cat in outcomes:
+                        d[cat] = int(num)
+                    return d
+
+    def assert_outcomes(self, passed=0, skipped=0, failed=0):
+        """ assert that the specified outcomes appear with the respective
+        numbers (0 means it didn't occur) in the text output from a test run."""
+        d = self.parseoutcomes()
+        assert passed == d.get("passed", 0)
+        assert skipped == d.get("skipped", 0)
+        assert failed == d.get("failed", 0)
+
+
+
+class Testdir:
+    """Temporary test directory with tools to test/run py.test itself.
+
+    This is based on the ``tmpdir`` fixture but provides a number of
+    methods which aid with testing py.test itself.  Unless
+    :py:meth:`chdir` is used all methods will use :py:attr:`tmpdir` as
+    current working directory.
+
+    Attributes:
+
+    :tmpdir: The :py:class:`py.path.local` instance of the temporary
+       directory.
+
+    :plugins: A list of plugins to use with :py:meth:`parseconfig` and
+       :py:meth:`runpytest`.  Initially this is an empty list but
+       plugins can be added to the list.  The type of items to add to
+       the list depend on the method which uses them so refer to them
+       for details.
+
+    """
+
+    def __init__(self, request, tmpdir_factory):
+        self.request = request
+        # XXX remove duplication with tmpdir plugin
+        basetmp = tmpdir_factory.ensuretemp("testdir")
+        name = request.function.__name__
+        for i in range(100):
+            try:
+                tmpdir = basetmp.mkdir(name + str(i))
+            except py.error.EEXIST:
+                continue
+            break
+        self.tmpdir = tmpdir
+        self.plugins = []
+        self._savesyspath = (list(sys.path), list(sys.meta_path))
+        self._savemodulekeys = set(sys.modules)
+        self.chdir() # always chdir
+        self.request.addfinalizer(self.finalize)
+        method = self.request.config.getoption("--runpytest")
+        if method == "inprocess":
+            self._runpytest_method = self.runpytest_inprocess
+        elif method == "subprocess":
+            self._runpytest_method = self.runpytest_subprocess
+
+    def __repr__(self):
+        return "<Testdir %r>" % (self.tmpdir,)
+
+    def finalize(self):
+        """Clean up global state artifacts.
+
+        Some methods modify the global interpreter state and this
+        tries to clean this up.  It does not remove the temporary
+        directory however so it can be looked at after the test run
+        has finished.
+
+        """
+        sys.path[:], sys.meta_path[:] = self._savesyspath
+        if hasattr(self, '_olddir'):
+            self._olddir.chdir()
+        self.delete_loaded_modules()
+
+    def delete_loaded_modules(self):
+        """Delete modules that have been loaded during a test.
+
+        This allows the interpreter to catch module changes in case
+        the module is re-imported.
+        """
+        for name in set(sys.modules).difference(self._savemodulekeys):
+            # it seems zope.interfaces is keeping some state
+            # (used by twisted related tests)
+            if name != "zope.interface":
+                del sys.modules[name]
+
+    def make_hook_recorder(self, pluginmanager):
+        """Create a new :py:class:`HookRecorder` for a PluginManager."""
+        assert not hasattr(pluginmanager, "reprec")
+        pluginmanager.reprec = reprec = HookRecorder(pluginmanager)
+        self.request.addfinalizer(reprec.finish_recording)
+        return reprec
+
+    def chdir(self):
+        """Cd into the temporary directory.
+
+        This is done automatically upon instantiation.
+
+        """
+        old = self.tmpdir.chdir()
+        if not hasattr(self, '_olddir'):
+            self._olddir = old
+
+    def _makefile(self, ext, args, kwargs):
+        items = list(kwargs.items())
+        if args:
+            source = py.builtin._totext("\n").join(
+                map(py.builtin._totext, args)) + py.builtin._totext("\n")
+            basename = self.request.function.__name__
+            items.insert(0, (basename, source))
+        ret = None
+        for name, value in items:
+            p = self.tmpdir.join(name).new(ext=ext)
+            source = Source(value)
+            def my_totext(s, encoding="utf-8"):
+                if py.builtin._isbytes(s):
+                    s = py.builtin._totext(s, encoding=encoding)
+                return s
+            source_unicode = "\n".join([my_totext(line) for line in source.lines])
+            source = py.builtin._totext(source_unicode)
+            content = source.strip().encode("utf-8") # + "\n"
+            #content = content.rstrip() + "\n"
+            p.write(content, "wb")
+            if ret is None:
+                ret = p
+        return ret
+
+    def makefile(self, ext, *args, **kwargs):
+        """Create a new file in the testdir.
+
+        ext: The extension the file should use, including the dot.
+           E.g. ".py".
+
+        args: All args will be treated as strings and joined using
+           newlines.  The result will be written as contents to the
+           file.  The name of the file will be based on the test
+           function requesting this fixture.
+           E.g. "testdir.makefile('.txt', 'line1', 'line2')"
+
+        kwargs: Each keyword is the name of a file, while the value of
+           it will be written as contents of the file.
+           E.g. "testdir.makefile('.ini', pytest='[pytest]\naddopts=-rs\n')"
+
+        """
+        return self._makefile(ext, args, kwargs)
+
+    def makeconftest(self, source):
+        """Write a contest.py file with 'source' as contents."""
+        return self.makepyfile(conftest=source)
+
+    def makeini(self, source):
+        """Write a tox.ini file with 'source' as contents."""
+        return self.makefile('.ini', tox=source)
+
+    def getinicfg(self, source):
+        """Return the pytest section from the tox.ini config file."""
+        p = self.makeini(source)
+        return py.iniconfig.IniConfig(p)['pytest']
+
+    def makepyfile(self, *args, **kwargs):
+        """Shortcut for .makefile() with a .py extension."""
+        return self._makefile('.py', args, kwargs)
+
+    def maketxtfile(self, *args, **kwargs):
+        """Shortcut for .makefile() with a .txt extension."""
+        return self._makefile('.txt', args, kwargs)
+
+    def syspathinsert(self, path=None):
+        """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`.
+
+        This is undone automatically after the test.
+        """
+        if path is None:
+            path = self.tmpdir
+        sys.path.insert(0, str(path))
+        # a call to syspathinsert() usually means that the caller
+        # wants to import some dynamically created files.
+        # with python3 we thus invalidate import caches.
+        self._possibly_invalidate_import_caches()
+
+    def _possibly_invalidate_import_caches(self):
+        # invalidate caches if we can (py33 and above)
+        try:
+            import importlib
+        except ImportError:
+            pass
+        else:
+            if hasattr(importlib, "invalidate_caches"):
+                importlib.invalidate_caches()
+
+    def mkdir(self, name):
+        """Create a new (sub)directory."""
+        return self.tmpdir.mkdir(name)
+
+    def mkpydir(self, name):
+        """Create a new python package.
+
+        This creates a (sub)direcotry with an empty ``__init__.py``
+        file so that is recognised as a python package.
+
+        """
+        p = self.mkdir(name)
+        p.ensure("__init__.py")
+        return p
+
+    Session = Session
+    def getnode(self, config, arg):
+        """Return the collection node of a file.
+
+        :param config: :py:class:`_pytest.config.Config` instance, see
+           :py:meth:`parseconfig` and :py:meth:`parseconfigure` to
+           create the configuration.
+
+        :param arg: A :py:class:`py.path.local` instance of the file.
+
+        """
+        session = Session(config)
+        assert '::' not in str(arg)
+        p = py.path.local(arg)
+        config.hook.pytest_sessionstart(session=session)
+        res = session.perform_collect([str(p)], genitems=False)[0]
+        config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK)
+        return res
+
+    def getpathnode(self, path):
+        """Return the collection node of a file.
+
+        This is like :py:meth:`getnode` but uses
+        :py:meth:`parseconfigure` to create the (configured) py.test
+        Config instance.
+
+        :param path: A :py:class:`py.path.local` instance of the file.
+
+        """
+        config = self.parseconfigure(path)
+        session = Session(config)
+        x = session.fspath.bestrelpath(path)
+        config.hook.pytest_sessionstart(session=session)
+        res = session.perform_collect([x], genitems=False)[0]
+        config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK)
+        return res
+
+    def genitems(self, colitems):
+        """Generate all test items from a collection node.
+
+        This recurses into the collection node and returns a list of
+        all the test items contained within.
+
+        """
+        session = colitems[0].session
+        result = []
+        for colitem in colitems:
+            result.extend(session.genitems(colitem))
+        return result
+
+    def runitem(self, source):
+        """Run the "test_func" Item.
+
+        The calling test instance (the class which contains the test
+        method) must provide a ``.getrunner()`` method which should
+        return a runner which can run the test protocol for a single
+        item, like e.g. :py:func:`_pytest.runner.runtestprotocol`.
+
+        """
+        # used from runner functional tests
+        item = self.getitem(source)
+        # the test class where we are called from wants to provide the runner
+        testclassinstance = self.request.instance
+        runner = testclassinstance.getrunner()
+        return runner(item)
+
+    def inline_runsource(self, source, *cmdlineargs):
+        """Run a test module in process using ``pytest.main()``.
+
+        This run writes "source" into a temporary file and runs
+        ``pytest.main()`` on it, returning a :py:class:`HookRecorder`
+        instance for the result.
+
+        :param source: The source code of the test module.
+
+        :param cmdlineargs: Any extra command line arguments to use.
+
+        :return: :py:class:`HookRecorder` instance of the result.
+
+        """
+        p = self.makepyfile(source)
+        l = list(cmdlineargs) + [p]
+        return self.inline_run(*l)
+
+    def inline_genitems(self, *args):
+        """Run ``pytest.main(['--collectonly'])`` in-process.
+
+        Retuns a tuple of the collected items and a
+        :py:class:`HookRecorder` instance.
+
+        This runs the :py:func:`pytest.main` function to run all of
+        py.test inside the test process itself like
+        :py:meth:`inline_run`.  However the return value is a tuple of
+        the collection items and a :py:class:`HookRecorder` instance.
+
+        """
+        rec = self.inline_run("--collect-only", *args)
+        items = [x.item for x in rec.getcalls("pytest_itemcollected")]
+        return items, rec
+
+    def inline_run(self, *args, **kwargs):
+        """Run ``pytest.main()`` in-process, returning a HookRecorder.
+
+        This runs the :py:func:`pytest.main` function to run all of
+        py.test inside the test process itself.  This means it can
+        return a :py:class:`HookRecorder` instance which gives more
+        detailed results from then run then can be done by matching
+        stdout/stderr from :py:meth:`runpytest`.
+
+        :param args: Any command line arguments to pass to
+           :py:func:`pytest.main`.
+
+        :param plugin: (keyword-only) Extra plugin instances the
+           ``pytest.main()`` instance should use.
+
+        :return: A :py:class:`HookRecorder` instance.
+
+        """
+        rec = []
+        class Collect:
+            def pytest_configure(x, config):
+                rec.append(self.make_hook_recorder(config.pluginmanager))
+
+        plugins = kwargs.get("plugins") or []
+        plugins.append(Collect())
+        ret = pytest.main(list(args), plugins=plugins)
+        self.delete_loaded_modules()
+        if len(rec) == 1:
+            reprec = rec.pop()
+        else:
+            class reprec:
+                pass
+        reprec.ret = ret
+
+        # typically we reraise keyboard interrupts from the child run
+        # because it's our user requesting interruption of the testing
+        if ret == 2 and not kwargs.get("no_reraise_ctrlc"):
+            calls = reprec.getcalls("pytest_keyboard_interrupt")
+            if calls and calls[-1].excinfo.type == KeyboardInterrupt:
+                raise KeyboardInterrupt()
+        return reprec
+
+    def runpytest_inprocess(self, *args, **kwargs):
+        """ Return result of running pytest in-process, providing a similar
+        interface to what self.runpytest() provides. """
+        if kwargs.get("syspathinsert"):
+            self.syspathinsert()
+        now = time.time()
+        capture = py.io.StdCapture()
+        try:
+            try:
+                reprec = self.inline_run(*args, **kwargs)
+            except SystemExit as e:
+                class reprec:
+                    ret = e.args[0]
+            except Exception:
+                traceback.print_exc()
+                class reprec:
+                    ret = 3
+        finally:
+            out, err = capture.reset()
+            sys.stdout.write(out)
+            sys.stderr.write(err)
+
+        res = RunResult(reprec.ret,
+                        out.split("\n"), err.split("\n"),
+                        time.time()-now)
+        res.reprec = reprec
+        return res
+
+    def runpytest(self, *args, **kwargs):
+        """ Run pytest inline or in a subprocess, depending on the command line
+        option "--runpytest" and return a :py:class:`RunResult`.
+
+        """
+        args = self._ensure_basetemp(args)
+        return self._runpytest_method(*args, **kwargs)
+
+    def _ensure_basetemp(self, args):
+        args = [str(x) for x in args]
+        for x in args:
+            if str(x).startswith('--basetemp'):
+                #print ("basedtemp exists: %s" %(args,))
+                break
+        else:
+            args.append("--basetemp=%s" % self.tmpdir.dirpath('basetemp'))
+            #print ("added basetemp: %s" %(args,))
+        return args
+
+    def parseconfig(self, *args):
+        """Return a new py.test Config instance from given commandline args.
+
+        This invokes the py.test bootstrapping code in _pytest.config
+        to create a new :py:class:`_pytest.core.PluginManager` and
+        call the pytest_cmdline_parse hook to create new
+        :py:class:`_pytest.config.Config` instance.
+
+        If :py:attr:`plugins` has been populated they should be plugin
+        modules which will be registered with the PluginManager.
+
+        """
+        args = self._ensure_basetemp(args)
+
+        import _pytest.config
+        config = _pytest.config._prepareconfig(args, self.plugins)
+        # we don't know what the test will do with this half-setup config
+        # object and thus we make sure it gets unconfigured properly in any
+        # case (otherwise capturing could still be active, for example)
+        self.request.addfinalizer(config._ensure_unconfigure)
+        return config
+
+    def parseconfigure(self, *args):
+        """Return a new py.test configured Config instance.
+
+        This returns a new :py:class:`_pytest.config.Config` instance
+        like :py:meth:`parseconfig`, but also calls the
+        pytest_configure hook.
+
+        """
+        config = self.parseconfig(*args)
+        config._do_configure()
+        self.request.addfinalizer(config._ensure_unconfigure)
+        return config
+
+    def getitem(self,  source, funcname="test_func"):
+        """Return the test item for a test function.
+
+        This writes the source to a python file and runs py.test's
+        collection on the resulting module, returning the test item
+        for the requested function name.
+
+        :param source: The module source.
+
+        :param funcname: The name of the test function for which the
+           Item must be returned.
+
+        """
+        items = self.getitems(source)
+        for item in items:
+            if item.name == funcname:
+                return item
+        assert 0, "%r item not found in module:\n%s\nitems: %s" %(
+                  funcname, source, items)
+
+    def getitems(self,  source):
+        """Return all test items collected from the module.
+
+        This writes the source to a python file and runs py.test's
+        collection on the resulting module, returning all test items
+        contained within.
+
+        """
+        modcol = self.getmodulecol(source)
+        return self.genitems([modcol])
+
+    def getmodulecol(self,  source, configargs=(), withinit=False):
+        """Return the module collection node for ``source``.
+
+        This writes ``source`` to a file using :py:meth:`makepyfile`
+        and then runs the py.test collection on it, returning the
+        collection node for the test module.
+
+        :param source: The source code of the module to collect.
+
+        :param configargs: Any extra arguments to pass to
+           :py:meth:`parseconfigure`.
+
+        :param withinit: Whether to also write a ``__init__.py`` file
+           to the temporarly directory to ensure it is a package.
+
+        """
+        kw = {self.request.function.__name__: Source(source).strip()}
+        path = self.makepyfile(**kw)
+        if withinit:
+            self.makepyfile(__init__ = "#")
+        self.config = config = self.parseconfigure(path, *configargs)
+        node = self.getnode(config, path)
+        return node
+
+    def collect_by_name(self, modcol, name):
+        """Return the collection node for name from the module collection.
+
+        This will search a module collection node for a collection
+        node matching the given name.
+
+        :param modcol: A module collection node, see
+           :py:meth:`getmodulecol`.
+
+        :param name: The name of the node to return.
+
+        """
+        for colitem in modcol._memocollect():
+            if colitem.name == name:
+                return colitem
+
+    def popen(self, cmdargs, stdout, stderr, **kw):
+        """Invoke subprocess.Popen.
+
+        This calls subprocess.Popen making sure the current working
+        directory is the PYTHONPATH.
+
+        You probably want to use :py:meth:`run` instead.
+
+        """
+        env = os.environ.copy()
+        env['PYTHONPATH'] = os.pathsep.join(filter(None, [
+            str(os.getcwd()), env.get('PYTHONPATH', '')]))
+        kw['env'] = env
+        return subprocess.Popen(cmdargs,
+                                stdout=stdout, stderr=stderr, **kw)
+
+    def run(self, *cmdargs):
+        """Run a command with arguments.
+
+        Run a process using subprocess.Popen saving the stdout and
+        stderr.
+
+        Returns a :py:class:`RunResult`.
+
+        """
+        return self._run(*cmdargs)
+
+    def _run(self, *cmdargs):
+        cmdargs = [str(x) for x in cmdargs]
+        p1 = self.tmpdir.join("stdout")
+        p2 = self.tmpdir.join("stderr")
+        print_("running:", ' '.join(cmdargs))
+        print_("     in:", str(py.path.local()))
+        f1 = codecs.open(str(p1), "w", encoding="utf8")
+        f2 = codecs.open(str(p2), "w", encoding="utf8")
+        try:
+            now = time.time()
+            popen = self.popen(cmdargs, stdout=f1, stderr=f2,
+                close_fds=(sys.platform != "win32"))
+            ret = popen.wait()
+        finally:
+            f1.close()
+            f2.close()
+        f1 = codecs.open(str(p1), "r", encoding="utf8")
+        f2 = codecs.open(str(p2), "r", encoding="utf8")
+        try:
+            out = f1.read().splitlines()
+            err = f2.read().splitlines()
+        finally:
+            f1.close()
+            f2.close()
+        self._dump_lines(out, sys.stdout)
+        self._dump_lines(err, sys.stderr)
+        return RunResult(ret, out, err, time.time()-now)
+
+    def _dump_lines(self, lines, fp):
+        try:
+            for line in lines:
+                py.builtin.print_(line, file=fp)
+        except UnicodeEncodeError:
+            print("couldn't print to %s because of encoding" % (fp,))
+
+    def _getpytestargs(self):
+        # we cannot use "(sys.executable,script)"
+        # because on windows the script is e.g. a py.test.exe
+        return (sys.executable, _pytest_fullpath,) # noqa
+
+    def runpython(self, script):
+        """Run a python script using sys.executable as interpreter.
+
+        Returns a :py:class:`RunResult`.
+        """
+        return self.run(sys.executable, script)
+
+    def runpython_c(self, command):
+        """Run python -c "command", return a :py:class:`RunResult`."""
+        return self.run(sys.executable, "-c", command)
+
+    def runpytest_subprocess(self, *args, **kwargs):
+        """Run py.test as a subprocess with given arguments.
+
+        Any plugins added to the :py:attr:`plugins` list will added
+        using the ``-p`` command line option.  Addtionally
+        ``--basetemp`` is used put any temporary files and directories
+        in a numbered directory prefixed with "runpytest-" so they do
+        not conflict with the normal numberd pytest location for
+        temporary files and directories.
+
+        Returns a :py:class:`RunResult`.
+
+        """
+        p = py.path.local.make_numbered_dir(prefix="runpytest-",
+            keep=None, rootdir=self.tmpdir)
+        args = ('--basetemp=%s' % p, ) + args
+        #for x in args:
+        #    if '--confcutdir' in str(x):
+        #        break
+        #else:
+        #    pass
+        #    args = ('--confcutdir=.',) + args
+        plugins = [x for x in self.plugins if isinstance(x, str)]
+        if plugins:
+            args = ('-p', plugins[0]) + args
+        args = self._getpytestargs() + args
+        return self.run(*args)
+
+    def spawn_pytest(self, string, expect_timeout=10.0):
+        """Run py.test using pexpect.
+
+        This makes sure to use the right py.test and sets up the
+        temporary directory locations.
+
+        The pexpect child is returned.
+
+        """
+        basetemp = self.tmpdir.mkdir("pexpect")
+        invoke = " ".join(map(str, self._getpytestargs()))
+        cmd = "%s --basetemp=%s %s" % (invoke, basetemp, string)
+        return self.spawn(cmd, expect_timeout=expect_timeout)
+
+    def spawn(self, cmd, expect_timeout=10.0):
+        """Run a command using pexpect.
+
+        The pexpect child is returned.
+        """
+        pexpect = pytest.importorskip("pexpect", "3.0")
+        if hasattr(sys, 'pypy_version_info') and '64' in platform.machine():
+            pytest.skip("pypy-64 bit not supported")
+        if sys.platform == "darwin":
+            pytest.xfail("pexpect does not work reliably on darwin?!")
+        if sys.platform.startswith("freebsd"):
+            pytest.xfail("pexpect does not work reliably on freebsd")
+        logfile = self.tmpdir.join("spawn.out").open("wb")
+        child = pexpect.spawn(cmd, logfile=logfile)
+        self.request.addfinalizer(logfile.close)
+        child.timeout = expect_timeout
+        return child
+
+def getdecoded(out):
+        try:
+            return out.decode("utf-8")
+        except UnicodeDecodeError:
+            return "INTERNAL not-utf8-decodeable, truncated string:\n%s" % (
+                    py.io.saferepr(out),)
+
+
+class LineComp:
+    def __init__(self):
+        self.stringio = py.io.TextIO()
+
+    def assert_contains_lines(self, lines2):
+        """ assert that lines2 are contained (linearly) in lines1.
+            return a list of extralines found.
+        """
+        __tracebackhide__ = True
+        val = self.stringio.getvalue()
+        self.stringio.truncate(0)
+        self.stringio.seek(0)
+        lines1 = val.split("\n")
+        return LineMatcher(lines1).fnmatch_lines(lines2)
+
+
+class LineMatcher:
+    """Flexible matching of text.
+
+    This is a convenience class to test large texts like the output of
+    commands.
+
+    The constructor takes a list of lines without their trailing
+    newlines, i.e. ``text.splitlines()``.
+
+    """
+
+    def __init__(self,  lines):
+        self.lines = lines
+
+    def str(self):
+        """Return the entire original text."""
+        return "\n".join(self.lines)
+
+    def _getlines(self, lines2):
+        if isinstance(lines2, str):
+            lines2 = Source(lines2)
+        if isinstance(lines2, Source):
+            lines2 = lines2.strip().lines
+        return lines2
+
+    def fnmatch_lines_random(self, lines2):
+        """Check lines exist in the output.
+
+        The argument is a list of lines which have to occur in the
+        output, in any order.  Each line can contain glob whildcards.
+
+        """
+        lines2 = self._getlines(lines2)
+        for line in lines2:
+            for x in self.lines:
+                if line == x or fnmatch(x, line):
+                    print_("matched: ", repr(line))
+                    break
+            else:
+                raise ValueError("line %r not found in output" % line)
+
+    def get_lines_after(self, fnline):
+        """Return all lines following the given line in the text.
+
+        The given line can contain glob wildcards.
+        """
+        for i, line in enumerate(self.lines):
+            if fnline == line or fnmatch(line, fnline):
+                return self.lines[i+1:]
+        raise ValueError("line %r not found in output" % fnline)
+
+    def fnmatch_lines(self, lines2):
+        """Search the text for matching lines.
+
+        The argument is a list of lines which have to match and can
+        use glob wildcards.  If they do not match an pytest.fail() is
+        called.  The matches and non-matches are also printed on
+        stdout.
+
+        """
+        def show(arg1, arg2):
+            py.builtin.print_(arg1, arg2, file=sys.stderr)
+        lines2 = self._getlines(lines2)
+        lines1 = self.lines[:]
+        nextline = None
+        extralines = []
+        __tracebackhide__ = True
+        for line in lines2:
+            nomatchprinted = False
+            while lines1:
+                nextline = lines1.pop(0)
+                if line == nextline:
+                    show("exact match:", repr(line))
+                    break
+                elif fnmatch(nextline, line):
+                    show("fnmatch:", repr(line))
+                    show("   with:", repr(nextline))
+                    break
+                else:
+                    if not nomatchprinted:
+                        show("nomatch:", repr(line))
+                        nomatchprinted = True
+                    show("    and:", repr(nextline))
+                extralines.append(nextline)
+            else:
+                pytest.fail("remains unmatched: %r, see stderr" % (line,))
diff --git a/python/pytest/_pytest/python.py b/python/pytest/_pytest/python.py
new file mode 100644
index 000000000..21d78aea3
--- /dev/null
+++ b/python/pytest/_pytest/python.py
@@ -0,0 +1,2300 @@
+""" Python test discovery, setup and run of test functions. """
+import fnmatch
+import functools
+import inspect
+import re
+import types
+import sys
+
+import py
+import pytest
+from _pytest._code.code import TerminalRepr
+from _pytest.mark import MarkDecorator, MarkerError
+
+try:
+    import enum
+except ImportError:  # pragma: no cover
+    # Only available in Python 3.4+ or as a backport
+    enum = None
+
+import _pytest
+import _pytest._pluggy as pluggy
+
+cutdir2 = py.path.local(_pytest.__file__).dirpath()
+cutdir1 = py.path.local(pluggy.__file__.rstrip("oc"))
+
+
+NoneType = type(None)
+NOTSET = object()
+isfunction = inspect.isfunction
+isclass = inspect.isclass
+callable = py.builtin.callable
+# used to work around a python2 exception info leak
+exc_clear = getattr(sys, 'exc_clear', lambda: None)
+# The type of re.compile objects is not exposed in Python.
+REGEX_TYPE = type(re.compile(''))
+
+_PY3 = sys.version_info > (3, 0)
+_PY2 = not _PY3
+
+
+if hasattr(inspect, 'signature'):
+    def _format_args(func):
+        return str(inspect.signature(func))
+else:
+    def _format_args(func):
+        return inspect.formatargspec(*inspect.getargspec(func))
+
+if  sys.version_info[:2] == (2, 6):
+    def isclass(object):
+        """ Return true if the object is a class. Overrides inspect.isclass for
+        python 2.6 because it will return True for objects which always return
+        something on __getattr__ calls (see #1035).
+        Backport of https://hg.python.org/cpython/rev/35bf8f7a8edc
+        """
+        return isinstance(object, (type, types.ClassType))
+
+def _has_positional_arg(func):
+    return func.__code__.co_argcount
+
+
+def filter_traceback(entry):
+    # entry.path might sometimes return a str object when the entry
+    # points to dynamically generated code
+    # see https://bitbucket.org/pytest-dev/py/issues/71
+    raw_filename = entry.frame.code.raw.co_filename
+    is_generated = '<' in raw_filename and '>' in raw_filename
+    if is_generated:
+        return False
+    # entry.path might point to an inexisting file, in which case it will
+    # alsso return a str object. see #1133
+    p = py.path.local(entry.path)
+    return p != cutdir1 and not p.relto(cutdir2)
+
+
+def get_real_func(obj):
+    """ gets the real function object of the (possibly) wrapped object by
+    functools.wraps or functools.partial.
+    """
+    while hasattr(obj, "__wrapped__"):
+        obj = obj.__wrapped__
+    if isinstance(obj, functools.partial):
+        obj = obj.func
+    return obj
+
+def getfslineno(obj):
+    # xxx let decorators etc specify a sane ordering
+    obj = get_real_func(obj)
+    if hasattr(obj, 'place_as'):
+        obj = obj.place_as
+    fslineno = _pytest._code.getfslineno(obj)
+    assert isinstance(fslineno[1], int), obj
+    return fslineno
+
+def getimfunc(func):
+    try:
+        return func.__func__
+    except AttributeError:
+        try:
+            return func.im_func
+        except AttributeError:
+            return func
+
+def safe_getattr(object, name, default):
+    """ Like getattr but return default upon any Exception.
+
+    Attribute access can potentially fail for 'evil' Python objects.
+    See issue214
+    """
+    try:
+        return getattr(object, name, default)
+    except Exception:
+        return default
+
+
+class FixtureFunctionMarker:
+    def __init__(self, scope, params,
+                 autouse=False, yieldctx=False, ids=None):
+        self.scope = scope
+        self.params = params
+        self.autouse = autouse
+        self.yieldctx = yieldctx
+        self.ids = ids
+
+    def __call__(self, function):
+        if isclass(function):
+            raise ValueError(
+                    "class fixtures not supported (may be in the future)")
+        function._pytestfixturefunction = self
+        return function
+
+
+def fixture(scope="function", params=None, autouse=False, ids=None):
+    """ (return a) decorator to mark a fixture factory function.
+
+    This decorator can be used (with or or without parameters) to define
+    a fixture function.  The name of the fixture function can later be
+    referenced to cause its invocation ahead of running tests: test
+    modules or classes can use the pytest.mark.usefixtures(fixturename)
+    marker.  Test functions can directly use fixture names as input
+    arguments in which case the fixture instance returned from the fixture
+    function will be injected.
+
+    :arg scope: the scope for which this fixture is shared, one of
+                "function" (default), "class", "module", "session".
+
+    :arg params: an optional list of parameters which will cause multiple
+                invocations of the fixture function and all of the tests
+                using it.
+
+    :arg autouse: if True, the fixture func is activated for all tests that
+                can see it.  If False (the default) then an explicit
+                reference is needed to activate the fixture.
+
+    :arg ids: list of string ids each corresponding to the params
+       so that they are part of the test id. If no ids are provided
+       they will be generated automatically from the params.
+
+    """
+    if callable(scope) and params is None and autouse == False:
+        # direct decoration
+        return FixtureFunctionMarker(
+                "function", params, autouse)(scope)
+    if params is not None and not isinstance(params, (list, tuple)):
+        params = list(params)
+    return FixtureFunctionMarker(scope, params, autouse, ids=ids)
+
+def yield_fixture(scope="function", params=None, autouse=False, ids=None):
+    """ (return a) decorator to mark a yield-fixture factory function
+    (EXPERIMENTAL).
+
+    This takes the same arguments as :py:func:`pytest.fixture` but
+    expects a fixture function to use a ``yield`` instead of a ``return``
+    statement to provide a fixture.  See
+    http://pytest.org/en/latest/yieldfixture.html for more info.
+    """
+    if callable(scope) and params is None and autouse == False:
+        # direct decoration
+        return FixtureFunctionMarker(
+                "function", params, autouse, yieldctx=True)(scope)
+    else:
+        return FixtureFunctionMarker(scope, params, autouse,
+                                     yieldctx=True, ids=ids)
+
+defaultfuncargprefixmarker = fixture()
+
+def pyobj_property(name):
+    def get(self):
+        node = self.getparent(getattr(pytest, name))
+        if node is not None:
+            return node.obj
+    doc = "python %s object this node was collected from (can be None)." % (
+          name.lower(),)
+    return property(get, None, None, doc)
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group.addoption('--fixtures', '--funcargs',
+               action="store_true", dest="showfixtures", default=False,
+               help="show available fixtures, sorted by plugin appearance")
+    parser.addini("usefixtures", type="args", default=[],
+        help="list of default fixtures to be used with this project")
+    parser.addini("python_files", type="args",
+        default=['test_*.py', '*_test.py'],
+        help="glob-style file patterns for Python test module discovery")
+    parser.addini("python_classes", type="args", default=["Test",],
+        help="prefixes or glob names for Python test class discovery")
+    parser.addini("python_functions", type="args", default=["test",],
+        help="prefixes or glob names for Python test function and "
+             "method discovery")
+
+    group.addoption("--import-mode", default="prepend",
+        choices=["prepend", "append"], dest="importmode",
+        help="prepend/append to sys.path when importing test modules, "
+             "default is to prepend.")
+
+
+def pytest_cmdline_main(config):
+    if config.option.showfixtures:
+        showfixtures(config)
+        return 0
+
+
+def pytest_generate_tests(metafunc):
+    # those alternative spellings are common - raise a specific error to alert
+    # the user
+    alt_spellings = ['parameterize', 'parametrise', 'parameterise']
+    for attr in alt_spellings:
+        if hasattr(metafunc.function, attr):
+            msg = "{0} has '{1}', spelling should be 'parametrize'"
+            raise MarkerError(msg.format(metafunc.function.__name__, attr))
+    try:
+        markers = metafunc.function.parametrize
+    except AttributeError:
+        return
+    for marker in markers:
+        metafunc.parametrize(*marker.args, **marker.kwargs)
+
+def pytest_configure(config):
+    config.addinivalue_line("markers",
+        "parametrize(argnames, argvalues): call a test function multiple "
+        "times passing in different arguments in turn. argvalues generally "
+        "needs to be a list of values if argnames specifies only one name "
+        "or a list of tuples of values if argnames specifies multiple names. "
+        "Example: @parametrize('arg1', [1,2]) would lead to two calls of the "
+        "decorated test function, one with arg1=1 and another with arg1=2."
+        "see http://pytest.org/latest/parametrize.html for more info and "
+        "examples."
+    )
+    config.addinivalue_line("markers",
+        "usefixtures(fixturename1, fixturename2, ...): mark tests as needing "
+        "all of the specified fixtures. see http://pytest.org/latest/fixture.html#usefixtures "
+    )
+
+def pytest_sessionstart(session):
+    session._fixturemanager = FixtureManager(session)
+
+@pytest.hookimpl(trylast=True)
+def pytest_namespace():
+    raises.Exception = pytest.fail.Exception
+    return {
+        'fixture': fixture,
+        'yield_fixture': yield_fixture,
+        'raises' : raises,
+        'collect': {
+        'Module': Module, 'Class': Class, 'Instance': Instance,
+        'Function': Function, 'Generator': Generator,
+        '_fillfuncargs': fillfixtures}
+    }
+
+@fixture(scope="session")
+def pytestconfig(request):
+    """ the pytest config object with access to command line opts."""
+    return request.config
+
+
+@pytest.hookimpl(trylast=True)
+def pytest_pyfunc_call(pyfuncitem):
+    testfunction = pyfuncitem.obj
+    if pyfuncitem._isyieldedfunction():
+        testfunction(*pyfuncitem._args)
+    else:
+        funcargs = pyfuncitem.funcargs
+        testargs = {}
+        for arg in pyfuncitem._fixtureinfo.argnames:
+            testargs[arg] = funcargs[arg]
+        testfunction(**testargs)
+    return True
+
+def pytest_collect_file(path, parent):
+    ext = path.ext
+    if ext == ".py":
+        if not parent.session.isinitpath(path):
+            for pat in parent.config.getini('python_files'):
+                if path.fnmatch(pat):
+                    break
+            else:
+               return
+        ihook = parent.session.gethookproxy(path)
+        return ihook.pytest_pycollect_makemodule(path=path, parent=parent)
+
+def pytest_pycollect_makemodule(path, parent):
+    return Module(path, parent)
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_pycollect_makeitem(collector, name, obj):
+    outcome = yield
+    res = outcome.get_result()
+    if res is not None:
+        raise StopIteration
+    # nothing was collected elsewhere, let's do it here
+    if isclass(obj):
+        if collector.istestclass(obj, name):
+            Class = collector._getcustomclass("Class")
+            outcome.force_result(Class(name, parent=collector))
+    elif collector.istestfunction(obj, name):
+        # mock seems to store unbound methods (issue473), normalize it
+        obj = getattr(obj, "__func__", obj)
+        # We need to try and unwrap the function if it's a functools.partial
+        # or a funtools.wrapped.
+        # We musn't if it's been wrapped with mock.patch (python 2 only)
+        if not (isfunction(obj) or isfunction(get_real_func(obj))):
+            collector.warn(code="C2", message=
+                "cannot collect %r because it is not a function."
+                % name, )
+        elif getattr(obj, "__test__", True):
+            if is_generator(obj):
+                res = Generator(name, parent=collector)
+            else:
+                res = list(collector._genfunctions(name, obj))
+            outcome.force_result(res)
+
+def is_generator(func):
+    try:
+        return _pytest._code.getrawcode(func).co_flags & 32 # generator function
+    except AttributeError: # builtin functions have no bytecode
+        # assume them to not be generators
+        return False
+
+class PyobjContext(object):
+    module = pyobj_property("Module")
+    cls = pyobj_property("Class")
+    instance = pyobj_property("Instance")
+
+class PyobjMixin(PyobjContext):
+    def obj():
+        def fget(self):
+            try:
+                return self._obj
+            except AttributeError:
+                self._obj = obj = self._getobj()
+                return obj
+        def fset(self, value):
+            self._obj = value
+        return property(fget, fset, None, "underlying python object")
+    obj = obj()
+
+    def _getobj(self):
+        return getattr(self.parent.obj, self.name)
+
+    def getmodpath(self, stopatmodule=True, includemodule=False):
+        """ return python path relative to the containing module. """
+        chain = self.listchain()
+        chain.reverse()
+        parts = []
+        for node in chain:
+            if isinstance(node, Instance):
+                continue
+            name = node.name
+            if isinstance(node, Module):
+                assert name.endswith(".py")
+                name = name[:-3]
+                if stopatmodule:
+                    if includemodule:
+                        parts.append(name)
+                    break
+            parts.append(name)
+        parts.reverse()
+        s = ".".join(parts)
+        return s.replace(".[", "[")
+
+    def _getfslineno(self):
+        return getfslineno(self.obj)
+
+    def reportinfo(self):
+        # XXX caching?
+        obj = self.obj
+        compat_co_firstlineno = getattr(obj, 'compat_co_firstlineno', None)
+        if isinstance(compat_co_firstlineno, int):
+            # nose compatibility
+            fspath = sys.modules[obj.__module__].__file__
+            if fspath.endswith(".pyc"):
+                fspath = fspath[:-1]
+            lineno = compat_co_firstlineno
+        else:
+            fspath, lineno = getfslineno(obj)
+        modpath = self.getmodpath()
+        assert isinstance(lineno, int)
+        return fspath, lineno, modpath
+
+class PyCollector(PyobjMixin, pytest.Collector):
+
+    def funcnamefilter(self, name):
+        return self._matches_prefix_or_glob_option('python_functions', name)
+
+    def isnosetest(self, obj):
+        """ Look for the __test__ attribute, which is applied by the
+        @nose.tools.istest decorator
+        """
+        # We explicitly check for "is True" here to not mistakenly treat
+        # classes with a custom __getattr__ returning something truthy (like a
+        # function) as test classes.
+        return safe_getattr(obj, '__test__', False) is True
+
+    def classnamefilter(self, name):
+        return self._matches_prefix_or_glob_option('python_classes', name)
+
+    def istestfunction(self, obj, name):
+        return (
+            (self.funcnamefilter(name) or self.isnosetest(obj)) and
+            safe_getattr(obj, "__call__", False) and getfixturemarker(obj) is None
+        )
+
+    def istestclass(self, obj, name):
+        return self.classnamefilter(name) or self.isnosetest(obj)
+
+    def _matches_prefix_or_glob_option(self, option_name, name):
+        """
+        checks if the given name matches the prefix or glob-pattern defined
+        in ini configuration.
+        """
+        for option in self.config.getini(option_name):
+            if name.startswith(option):
+                return True
+            # check that name looks like a glob-string before calling fnmatch
+            # because this is called for every name in each collected module,
+            # and fnmatch is somewhat expensive to call
+            elif ('*' in option or '?' in option or '[' in option) and \
+                    fnmatch.fnmatch(name, option):
+                return True
+        return False
+
+    def collect(self):
+        if not getattr(self.obj, "__test__", True):
+            return []
+
+        # NB. we avoid random getattrs and peek in the __dict__ instead
+        # (XXX originally introduced from a PyPy need, still true?)
+        dicts = [getattr(self.obj, '__dict__', {})]
+        for basecls in inspect.getmro(self.obj.__class__):
+            dicts.append(basecls.__dict__)
+        seen = {}
+        l = []
+        for dic in dicts:
+            for name, obj in list(dic.items()):
+                if name in seen:
+                    continue
+                seen[name] = True
+                res = self.makeitem(name, obj)
+                if res is None:
+                    continue
+                if not isinstance(res, list):
+                    res = [res]
+                l.extend(res)
+        l.sort(key=lambda item: item.reportinfo()[:2])
+        return l
+
+    def makeitem(self, name, obj):
+        #assert self.ihook.fspath == self.fspath, self
+        return self.ihook.pytest_pycollect_makeitem(
+            collector=self, name=name, obj=obj)
+
+    def _genfunctions(self, name, funcobj):
+        module = self.getparent(Module).obj
+        clscol = self.getparent(Class)
+        cls = clscol and clscol.obj or None
+        transfer_markers(funcobj, cls, module)
+        fm = self.session._fixturemanager
+        fixtureinfo = fm.getfixtureinfo(self, funcobj, cls)
+        metafunc = Metafunc(funcobj, fixtureinfo, self.config,
+                            cls=cls, module=module)
+        methods = []
+        if hasattr(module, "pytest_generate_tests"):
+            methods.append(module.pytest_generate_tests)
+        if hasattr(cls, "pytest_generate_tests"):
+            methods.append(cls().pytest_generate_tests)
+        if methods:
+            self.ihook.pytest_generate_tests.call_extra(methods,
+                                                        dict(metafunc=metafunc))
+        else:
+            self.ihook.pytest_generate_tests(metafunc=metafunc)
+
+        Function = self._getcustomclass("Function")
+        if not metafunc._calls:
+            yield Function(name, parent=self, fixtureinfo=fixtureinfo)
+        else:
+            # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs
+            add_funcarg_pseudo_fixture_def(self, metafunc, fm)
+
+            for callspec in metafunc._calls:
+                subname = "%s[%s]" %(name, callspec.id)
+                yield Function(name=subname, parent=self,
+                               callspec=callspec, callobj=funcobj,
+                               fixtureinfo=fixtureinfo,
+                               keywords={callspec.id:True})
+
+def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager):
+    # this function will transform all collected calls to a functions
+    # if they use direct funcargs (i.e. direct parametrization)
+    # because we want later test execution to be able to rely on
+    # an existing FixtureDef structure for all arguments.
+    # XXX we can probably avoid this algorithm  if we modify CallSpec2
+    # to directly care for creating the fixturedefs within its methods.
+    if not metafunc._calls[0].funcargs:
+        return # this function call does not have direct parametrization
+    # collect funcargs of all callspecs into a list of values
+    arg2params = {}
+    arg2scope = {}
+    for callspec in metafunc._calls:
+        for argname, argvalue in callspec.funcargs.items():
+            assert argname not in callspec.params
+            callspec.params[argname] = argvalue
+            arg2params_list = arg2params.setdefault(argname, [])
+            callspec.indices[argname] = len(arg2params_list)
+            arg2params_list.append(argvalue)
+            if argname not in arg2scope:
+                scopenum = callspec._arg2scopenum.get(argname,
+                                                      scopenum_function)
+                arg2scope[argname] = scopes[scopenum]
+        callspec.funcargs.clear()
+
+    # register artificial FixtureDef's so that later at test execution
+    # time we can rely on a proper FixtureDef to exist for fixture setup.
+    arg2fixturedefs = metafunc._arg2fixturedefs
+    for argname, valuelist in arg2params.items():
+        # if we have a scope that is higher than function we need
+        # to make sure we only ever create an according fixturedef on
+        # a per-scope basis. We thus store and cache the fixturedef on the
+        # node related to the scope.
+        scope = arg2scope[argname]
+        node = None
+        if scope != "function":
+            node = get_scope_node(collector, scope)
+            if node is None:
+                assert scope == "class" and isinstance(collector, Module)
+                # use module-level collector for class-scope (for now)
+                node = collector
+        if node and argname in node._name2pseudofixturedef:
+            arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]]
+        else:
+            fixturedef =  FixtureDef(fixturemanager, '', argname,
+                           get_direct_param_fixture_func,
+                           arg2scope[argname],
+                           valuelist, False, False)
+            arg2fixturedefs[argname] = [fixturedef]
+            if node is not None:
+                node._name2pseudofixturedef[argname] = fixturedef
+
+
+def get_direct_param_fixture_func(request):
+    return request.param
+
+class FuncFixtureInfo:
+    def __init__(self, argnames, names_closure, name2fixturedefs):
+        self.argnames = argnames
+        self.names_closure = names_closure
+        self.name2fixturedefs = name2fixturedefs
+
+
+def _marked(func, mark):
+    """ Returns True if :func: is already marked with :mark:, False otherwise.
+    This can happen if marker is applied to class and the test file is
+    invoked more than once.
+    """
+    try:
+        func_mark = getattr(func, mark.name)
+    except AttributeError:
+        return False
+    return mark.args == func_mark.args and mark.kwargs == func_mark.kwargs
+
+
+def transfer_markers(funcobj, cls, mod):
+    # XXX this should rather be code in the mark plugin or the mark
+    # plugin should merge with the python plugin.
+    for holder in (cls, mod):
+        try:
+            pytestmark = holder.pytestmark
+        except AttributeError:
+            continue
+        if isinstance(pytestmark, list):
+            for mark in pytestmark:
+                if not _marked(funcobj, mark):
+                    mark(funcobj)
+        else:
+            if not _marked(funcobj, pytestmark):
+                pytestmark(funcobj)
+
+class Module(pytest.File, PyCollector):
+    """ Collector for test classes and functions. """
+    def _getobj(self):
+        return self._memoizedcall('_obj', self._importtestmodule)
+
+    def collect(self):
+        self.session._fixturemanager.parsefactories(self)
+        return super(Module, self).collect()
+
+    def _importtestmodule(self):
+        # we assume we are only called once per module
+        importmode = self.config.getoption("--import-mode")
+        try:
+            mod = self.fspath.pyimport(ensuresyspath=importmode)
+        except SyntaxError:
+            raise self.CollectError(
+                _pytest._code.ExceptionInfo().getrepr(style="short"))
+        except self.fspath.ImportMismatchError:
+            e = sys.exc_info()[1]
+            raise self.CollectError(
+                "import file mismatch:\n"
+                "imported module %r has this __file__ attribute:\n"
+                "  %s\n"
+                "which is not the same as the test file we want to collect:\n"
+                "  %s\n"
+                "HINT: remove __pycache__ / .pyc files and/or use a "
+                "unique basename for your test file modules"
+                 % e.args
+            )
+        #print "imported test module", mod
+        self.config.pluginmanager.consider_module(mod)
+        return mod
+
+    def setup(self):
+        setup_module = xunitsetup(self.obj, "setUpModule")
+        if setup_module is None:
+            setup_module = xunitsetup(self.obj, "setup_module")
+        if setup_module is not None:
+            #XXX: nose compat hack, move to nose plugin
+            # if it takes a positional arg, its probably a pytest style one
+            # so we pass the current module object
+            if _has_positional_arg(setup_module):
+                setup_module(self.obj)
+            else:
+                setup_module()
+        fin = getattr(self.obj, 'tearDownModule', None)
+        if fin is None:
+            fin = getattr(self.obj, 'teardown_module', None)
+        if fin is not None:
+            #XXX: nose compat hack, move to nose plugin
+            # if it takes a positional arg, it's probably a pytest style one
+            # so we pass the current module object
+            if _has_positional_arg(fin):
+                finalizer = lambda: fin(self.obj)
+            else:
+                finalizer = fin
+            self.addfinalizer(finalizer)
+
+
+class Class(PyCollector):
+    """ Collector for test methods. """
+    def collect(self):
+        if hasinit(self.obj):
+            self.warn("C1", "cannot collect test class %r because it has a "
+                "__init__ constructor" % self.obj.__name__)
+            return []
+        return [self._getcustomclass("Instance")(name="()", parent=self)]
+
+    def setup(self):
+        setup_class = xunitsetup(self.obj, 'setup_class')
+        if setup_class is not None:
+            setup_class = getattr(setup_class, 'im_func', setup_class)
+            setup_class = getattr(setup_class, '__func__', setup_class)
+            setup_class(self.obj)
+
+        fin_class = getattr(self.obj, 'teardown_class', None)
+        if fin_class is not None:
+            fin_class = getattr(fin_class, 'im_func', fin_class)
+            fin_class = getattr(fin_class, '__func__', fin_class)
+            self.addfinalizer(lambda: fin_class(self.obj))
+
+class Instance(PyCollector):
+    def _getobj(self):
+        obj = self.parent.obj()
+        return obj
+
+    def collect(self):
+        self.session._fixturemanager.parsefactories(self)
+        return super(Instance, self).collect()
+
+    def newinstance(self):
+        self.obj = self._getobj()
+        return self.obj
+
+class FunctionMixin(PyobjMixin):
+    """ mixin for the code common to Function and Generator.
+    """
+
+    def setup(self):
+        """ perform setup for this test function. """
+        if hasattr(self, '_preservedparent'):
+            obj = self._preservedparent
+        elif isinstance(self.parent, Instance):
+            obj = self.parent.newinstance()
+            self.obj = self._getobj()
+        else:
+            obj = self.parent.obj
+        if inspect.ismethod(self.obj):
+            setup_name = 'setup_method'
+            teardown_name = 'teardown_method'
+        else:
+            setup_name = 'setup_function'
+            teardown_name = 'teardown_function'
+        setup_func_or_method = xunitsetup(obj, setup_name)
+        if setup_func_or_method is not None:
+            setup_func_or_method(self.obj)
+        fin = getattr(obj, teardown_name, None)
+        if fin is not None:
+            self.addfinalizer(lambda: fin(self.obj))
+
+    def _prunetraceback(self, excinfo):
+        if hasattr(self, '_obj') and not self.config.option.fulltrace:
+            code = _pytest._code.Code(get_real_func(self.obj))
+            path, firstlineno = code.path, code.firstlineno
+            traceback = excinfo.traceback
+            ntraceback = traceback.cut(path=path, firstlineno=firstlineno)
+            if ntraceback == traceback:
+                ntraceback = ntraceback.cut(path=path)
+                if ntraceback == traceback:
+                    #ntraceback = ntraceback.cut(excludepath=cutdir2)
+                    ntraceback = ntraceback.filter(filter_traceback)
+                    if not ntraceback:
+                        ntraceback = traceback
+
+            excinfo.traceback = ntraceback.filter()
+            # issue364: mark all but first and last frames to
+            # only show a single-line message for each frame
+            if self.config.option.tbstyle == "auto":
+                if len(excinfo.traceback) > 2:
+                    for entry in excinfo.traceback[1:-1]:
+                        entry.set_repr_style('short')
+
+    def _repr_failure_py(self, excinfo, style="long"):
+        if excinfo.errisinstance(pytest.fail.Exception):
+            if not excinfo.value.pytrace:
+                return py._builtin._totext(excinfo.value)
+        return super(FunctionMixin, self)._repr_failure_py(excinfo,
+            style=style)
+
+    def repr_failure(self, excinfo, outerr=None):
+        assert outerr is None, "XXX outerr usage is deprecated"
+        style = self.config.option.tbstyle
+        if style == "auto":
+            style = "long"
+        return self._repr_failure_py(excinfo, style=style)
+
+
+class Generator(FunctionMixin, PyCollector):
+    def collect(self):
+        # test generators are seen as collectors but they also
+        # invoke setup/teardown on popular request
+        # (induced by the common "test_*" naming shared with normal tests)
+        self.session._setupstate.prepare(self)
+        # see FunctionMixin.setup and test_setupstate_is_preserved_134
+        self._preservedparent = self.parent.obj
+        l = []
+        seen = {}
+        for i, x in enumerate(self.obj()):
+            name, call, args = self.getcallargs(x)
+            if not callable(call):
+                raise TypeError("%r yielded non callable test %r" %(self.obj, call,))
+            if name is None:
+                name = "[%d]" % i
+            else:
+                name = "['%s']" % name
+            if name in seen:
+                raise ValueError("%r generated tests with non-unique name %r" %(self, name))
+            seen[name] = True
+            l.append(self.Function(name, self, args=args, callobj=call))
+        return l
+
+    def getcallargs(self, obj):
+        if not isinstance(obj, (tuple, list)):
+            obj = (obj,)
+        # explict naming
+        if isinstance(obj[0], py.builtin._basestring):
+            name = obj[0]
+            obj = obj[1:]
+        else:
+            name = None
+        call, args = obj[0], obj[1:]
+        return name, call, args
+
+
+def hasinit(obj):
+    init = getattr(obj, '__init__', None)
+    if init:
+        if init != object.__init__:
+            return True
+
+
+
+def fillfixtures(function):
+    """ fill missing funcargs for a test function. """
+    try:
+        request = function._request
+    except AttributeError:
+        # XXX this special code path is only expected to execute
+        # with the oejskit plugin.  It uses classes with funcargs
+        # and we thus have to work a bit to allow this.
+        fm = function.session._fixturemanager
+        fi = fm.getfixtureinfo(function.parent, function.obj, None)
+        function._fixtureinfo = fi
+        request = function._request = FixtureRequest(function)
+        request._fillfixtures()
+        # prune out funcargs for jstests
+        newfuncargs = {}
+        for name in fi.argnames:
+            newfuncargs[name] = function.funcargs[name]
+        function.funcargs = newfuncargs
+    else:
+        request._fillfixtures()
+
+
+_notexists = object()
+
+class CallSpec2(object):
+    def __init__(self, metafunc):
+        self.metafunc = metafunc
+        self.funcargs = {}
+        self._idlist = []
+        self.params = {}
+        self._globalid = _notexists
+        self._globalid_args = set()
+        self._globalparam = _notexists
+        self._arg2scopenum = {}  # used for sorting parametrized resources
+        self.keywords = {}
+        self.indices = {}
+
+    def copy(self, metafunc):
+        cs = CallSpec2(self.metafunc)
+        cs.funcargs.update(self.funcargs)
+        cs.params.update(self.params)
+        cs.keywords.update(self.keywords)
+        cs.indices.update(self.indices)
+        cs._arg2scopenum.update(self._arg2scopenum)
+        cs._idlist = list(self._idlist)
+        cs._globalid = self._globalid
+        cs._globalid_args = self._globalid_args
+        cs._globalparam = self._globalparam
+        return cs
+
+    def _checkargnotcontained(self, arg):
+        if arg in self.params or arg in self.funcargs:
+            raise ValueError("duplicate %r" %(arg,))
+
+    def getparam(self, name):
+        try:
+            return self.params[name]
+        except KeyError:
+            if self._globalparam is _notexists:
+                raise ValueError(name)
+            return self._globalparam
+
+    @property
+    def id(self):
+        return "-".join(map(str, filter(None, self._idlist)))
+
+    def setmulti(self, valtypes, argnames, valset, id, keywords, scopenum,
+                 param_index):
+        for arg,val in zip(argnames, valset):
+            self._checkargnotcontained(arg)
+            valtype_for_arg = valtypes[arg]
+            getattr(self, valtype_for_arg)[arg] = val
+            self.indices[arg] = param_index
+            self._arg2scopenum[arg] = scopenum
+        self._idlist.append(id)
+        self.keywords.update(keywords)
+
+    def setall(self, funcargs, id, param):
+        for x in funcargs:
+            self._checkargnotcontained(x)
+        self.funcargs.update(funcargs)
+        if id is not _notexists:
+            self._idlist.append(id)
+        if param is not _notexists:
+            assert self._globalparam is _notexists
+            self._globalparam = param
+        for arg in funcargs:
+            self._arg2scopenum[arg] = scopenum_function
+
+
+class FuncargnamesCompatAttr:
+    """ helper class so that Metafunc, Function and FixtureRequest
+    don't need to each define the "funcargnames" compatibility attribute.
+    """
+    @property
+    def funcargnames(self):
+        """ alias attribute for ``fixturenames`` for pre-2.3 compatibility"""
+        return self.fixturenames
+
+class Metafunc(FuncargnamesCompatAttr):
+    """
+    Metafunc objects are passed to the ``pytest_generate_tests`` hook.
+    They help to inspect a test function and to generate tests according to
+    test configuration or values specified in the class or module where a
+    test function is defined.
+
+    :ivar fixturenames: set of fixture names required by the test function
+
+    :ivar function: underlying python test function
+
+    :ivar cls: class object where the test function is defined in or ``None``.
+
+    :ivar module: the module object where the test function is defined in.
+
+    :ivar config: access to the :class:`_pytest.config.Config` object for the
+        test session.
+
+    :ivar funcargnames:
+        .. deprecated:: 2.3
+            Use ``fixturenames`` instead.
+    """
+    def __init__(self, function, fixtureinfo, config, cls=None, module=None):
+        self.config = config
+        self.module = module
+        self.function = function
+        self.fixturenames = fixtureinfo.names_closure
+        self._arg2fixturedefs = fixtureinfo.name2fixturedefs
+        self.cls = cls
+        self._calls = []
+        self._ids = py.builtin.set()
+
+    def parametrize(self, argnames, argvalues, indirect=False, ids=None,
+        scope=None):
+        """ Add new invocations to the underlying test function using the list
+        of argvalues for the given argnames.  Parametrization is performed
+        during the collection phase.  If you need to setup expensive resources
+        see about setting indirect to do it rather at test setup time.
+
+        :arg argnames: a comma-separated string denoting one or more argument
+                       names, or a list/tuple of argument strings.
+
+        :arg argvalues: The list of argvalues determines how often a
+            test is invoked with different argument values.  If only one
+            argname was specified argvalues is a list of values.  If N
+            argnames were specified, argvalues must be a list of N-tuples,
+            where each tuple-element specifies a value for its respective
+            argname.
+
+        :arg indirect: The list of argnames or boolean. A list of arguments'
+            names (subset of argnames). If True the list contains all names from
+            the argnames. Each argvalue corresponding to an argname in this list will
+            be passed as request.param to its respective argname fixture
+            function so that it can perform more expensive setups during the
+            setup phase of a test rather than at collection time.
+
+        :arg ids: list of string ids, or a callable.
+            If strings, each is corresponding to the argvalues so that they are
+            part of the test id.
+            If callable, it should take one argument (a single argvalue) and return
+            a string or return None. If None, the automatically generated id for that
+            argument will be used.
+            If no ids are provided they will be generated automatically from
+            the argvalues.
+
+        :arg scope: if specified it denotes the scope of the parameters.
+            The scope is used for grouping tests by parameter instances.
+            It will also override any fixture-function defined scope, allowing
+            to set a dynamic scope using test context or configuration.
+        """
+
+        # individual parametrized argument sets can be wrapped in a series
+        # of markers in which case we unwrap the values and apply the mark
+        # at Function init
+        newkeywords = {}
+        unwrapped_argvalues = []
+        for i, argval in enumerate(argvalues):
+            while isinstance(argval, MarkDecorator):
+                newmark = MarkDecorator(argval.markname,
+                                        argval.args[:-1], argval.kwargs)
+                newmarks = newkeywords.setdefault(i, {})
+                newmarks[newmark.markname] = newmark
+                argval = argval.args[-1]
+            unwrapped_argvalues.append(argval)
+        argvalues = unwrapped_argvalues
+
+        if not isinstance(argnames, (tuple, list)):
+            argnames = [x.strip() for x in argnames.split(",") if x.strip()]
+            if len(argnames) == 1:
+                argvalues = [(val,) for val in argvalues]
+        if not argvalues:
+            argvalues = [(_notexists,) * len(argnames)]
+            # we passed a empty list to parameterize, skip that test
+            #
+            fs, lineno = getfslineno(self.function)
+            newmark = pytest.mark.skip(
+                reason="got empty parameter set %r, function %s at %s:%d" % (
+                    argnames, self.function.__name__, fs, lineno))
+            newmarks = newkeywords.setdefault(0, {})
+            newmarks[newmark.markname] = newmark
+
+
+        if scope is None:
+            scope = "function"
+        scopenum = scopes.index(scope)
+        valtypes = {}
+        for arg in argnames:
+            if arg not in self.fixturenames:
+                raise ValueError("%r uses no fixture %r" %(self.function, arg))
+
+        if indirect is True:
+            valtypes = dict.fromkeys(argnames, "params")
+        elif indirect is False:
+            valtypes = dict.fromkeys(argnames, "funcargs")
+        elif isinstance(indirect, (tuple, list)):
+            valtypes = dict.fromkeys(argnames, "funcargs")
+            for arg in indirect:
+                if arg not in argnames:
+                    raise ValueError("indirect given to %r: fixture %r doesn't exist" %(
+                                     self.function, arg))
+                valtypes[arg] = "params"
+        idfn = None
+        if callable(ids):
+            idfn = ids
+            ids = None
+        if ids and len(ids) != len(argvalues):
+            raise ValueError('%d tests specified with %d ids' %(
+                             len(argvalues), len(ids)))
+        if not ids:
+            ids = idmaker(argnames, argvalues, idfn)
+        newcalls = []
+        for callspec in self._calls or [CallSpec2(self)]:
+            for param_index, valset in enumerate(argvalues):
+                assert len(valset) == len(argnames)
+                newcallspec = callspec.copy(self)
+                newcallspec.setmulti(valtypes, argnames, valset, ids[param_index],
+                                     newkeywords.get(param_index, {}), scopenum,
+                                     param_index)
+                newcalls.append(newcallspec)
+        self._calls = newcalls
+
+    def addcall(self, funcargs=None, id=_notexists, param=_notexists):
+        """ (deprecated, use parametrize) Add a new call to the underlying
+        test function during the collection phase of a test run.  Note that
+        request.addcall() is called during the test collection phase prior and
+        independently to actual test execution.  You should only use addcall()
+        if you need to specify multiple arguments of a test function.
+
+        :arg funcargs: argument keyword dictionary used when invoking
+            the test function.
+
+        :arg id: used for reporting and identification purposes.  If you
+            don't supply an `id` an automatic unique id will be generated.
+
+        :arg param: a parameter which will be exposed to a later fixture function
+            invocation through the ``request.param`` attribute.
+        """
+        assert funcargs is None or isinstance(funcargs, dict)
+        if funcargs is not None:
+            for name in funcargs:
+                if name not in self.fixturenames:
+                    pytest.fail("funcarg %r not used in this function." % name)
+        else:
+            funcargs = {}
+        if id is None:
+            raise ValueError("id=None not allowed")
+        if id is _notexists:
+            id = len(self._calls)
+        id = str(id)
+        if id in self._ids:
+            raise ValueError("duplicate id %r" % id)
+        self._ids.add(id)
+
+        cs = CallSpec2(self)
+        cs.setall(funcargs, id, param)
+        self._calls.append(cs)
+
+
+if _PY3:
+    import codecs
+
+    def _escape_bytes(val):
+        """
+        If val is pure ascii, returns it as a str(), otherwise escapes
+        into a sequence of escaped bytes:
+        b'\xc3\xb4\xc5\xd6' -> u'\\xc3\\xb4\\xc5\\xd6'
+
+        note:
+           the obvious "v.decode('unicode-escape')" will return
+           valid utf-8 unicode if it finds them in the string, but we
+           want to return escaped bytes for any byte, even if they match
+           a utf-8 string.
+        """
+        if val:
+            # source: http://goo.gl/bGsnwC
+            encoded_bytes, _ = codecs.escape_encode(val)
+            return encoded_bytes.decode('ascii')
+        else:
+            # empty bytes crashes codecs.escape_encode (#1087)
+            return ''
+else:
+    def _escape_bytes(val):
+        """
+        In py2 bytes and str are the same type, so return it unchanged if it
+        is a full ascii string, otherwise escape it into its binary form.
+        """
+        try:
+            return val.decode('ascii')
+        except UnicodeDecodeError:
+            return val.encode('string-escape')
+
+
+def _idval(val, argname, idx, idfn):
+    if idfn:
+        try:
+            s = idfn(val)
+            if s:
+                return s
+        except Exception:
+            pass
+
+    if isinstance(val, bytes):
+        return _escape_bytes(val)
+    elif isinstance(val, (float, int, str, bool, NoneType)):
+        return str(val)
+    elif isinstance(val, REGEX_TYPE):
+        return _escape_bytes(val.pattern) if isinstance(val.pattern, bytes) else val.pattern
+    elif enum is not None and isinstance(val, enum.Enum):
+        return str(val)
+    elif isclass(val) and hasattr(val, '__name__'):
+        return val.__name__
+    elif _PY2 and isinstance(val, unicode):
+        # special case for python 2: if a unicode string is
+        # convertible to ascii, return it as an str() object instead
+        try:
+            return str(val)
+        except UnicodeError:
+            # fallthrough
+            pass
+    return str(argname)+str(idx)
+
+def _idvalset(idx, valset, argnames, idfn):
+    this_id = [_idval(val, argname, idx, idfn)
+               for val, argname in zip(valset, argnames)]
+    return "-".join(this_id)
+
+def idmaker(argnames, argvalues, idfn=None):
+    ids = [_idvalset(valindex, valset, argnames, idfn)
+           for valindex, valset in enumerate(argvalues)]
+    if len(set(ids)) < len(ids):
+        # user may have provided a bad idfn which means the ids are not unique
+        ids = [str(i) + testid for i, testid in enumerate(ids)]
+    return ids
+
+def showfixtures(config):
+    from _pytest.main import wrap_session
+    return wrap_session(config, _showfixtures_main)
+
+def _showfixtures_main(config, session):
+    import _pytest.config
+    session.perform_collect()
+    curdir = py.path.local()
+    tw = _pytest.config.create_terminal_writer(config)
+    verbose = config.getvalue("verbose")
+
+    fm = session._fixturemanager
+
+    available = []
+    for argname, fixturedefs in fm._arg2fixturedefs.items():
+        assert fixturedefs is not None
+        if not fixturedefs:
+            continue
+        for fixturedef in fixturedefs:
+            loc = getlocation(fixturedef.func, curdir)
+            available.append((len(fixturedef.baseid),
+                              fixturedef.func.__module__,
+                              curdir.bestrelpath(loc),
+                              fixturedef.argname, fixturedef))
+
+    available.sort()
+    currentmodule = None
+    for baseid, module, bestrel, argname, fixturedef in available:
+        if currentmodule != module:
+            if not module.startswith("_pytest."):
+                tw.line()
+                tw.sep("-", "fixtures defined from %s" %(module,))
+                currentmodule = module
+        if verbose <= 0 and argname[0] == "_":
+            continue
+        if verbose > 0:
+            funcargspec = "%s -- %s" %(argname, bestrel,)
+        else:
+            funcargspec = argname
+        tw.line(funcargspec, green=True)
+        loc = getlocation(fixturedef.func, curdir)
+        doc = fixturedef.func.__doc__ or ""
+        if doc:
+            for line in doc.strip().split("\n"):
+                tw.line("    " + line.strip())
+        else:
+            tw.line("    %s: no docstring available" %(loc,),
+                red=True)
+
+def getlocation(function, curdir):
+    import inspect
+    fn = py.path.local(inspect.getfile(function))
+    lineno = py.builtin._getcode(function).co_firstlineno
+    if fn.relto(curdir):
+        fn = fn.relto(curdir)
+    return "%s:%d" %(fn, lineno+1)
+
+# builtin pytest.raises helper
+
+def raises(expected_exception, *args, **kwargs):
+    """ assert that a code block/function call raises ``expected_exception``
+    and raise a failure exception otherwise.
+
+    This helper produces a ``ExceptionInfo()`` object (see below).
+
+    If using Python 2.5 or above, you may use this function as a
+    context manager::
+
+        >>> with raises(ZeroDivisionError):
+        ...    1/0
+
+    .. note::
+
+       When using ``pytest.raises`` as a context manager, it's worthwhile to
+       note that normal context manager rules apply and that the exception
+       raised *must* be the final line in the scope of the context manager.
+       Lines of code after that, within the scope of the context manager will
+       not be executed. For example::
+
+           >>> with raises(OSError) as exc_info:
+                   assert 1 == 1  # this will execute as expected
+                   raise OSError(errno.EEXISTS, 'directory exists')
+                   assert exc_info.value.errno == errno.EEXISTS  # this will not execute
+
+       Instead, the following approach must be taken (note the difference in
+       scope)::
+
+           >>> with raises(OSError) as exc_info:
+                   assert 1 == 1  # this will execute as expected
+                   raise OSError(errno.EEXISTS, 'directory exists')
+
+               assert exc_info.value.errno == errno.EEXISTS  # this will now execute
+
+    Or you can specify a callable by passing a to-be-called lambda::
+
+        >>> raises(ZeroDivisionError, lambda: 1/0)
+        <ExceptionInfo ...>
+
+    or you can specify an arbitrary callable with arguments::
+
+        >>> def f(x): return 1/x
+        ...
+        >>> raises(ZeroDivisionError, f, 0)
+        <ExceptionInfo ...>
+        >>> raises(ZeroDivisionError, f, x=0)
+        <ExceptionInfo ...>
+
+    A third possibility is to use a string to be executed::
+
+        >>> raises(ZeroDivisionError, "f(0)")
+        <ExceptionInfo ...>
+
+    .. autoclass:: _pytest._code.ExceptionInfo
+        :members:
+
+    .. note::
+        Similar to caught exception objects in Python, explicitly clearing
+        local references to returned ``ExceptionInfo`` objects can
+        help the Python interpreter speed up its garbage collection.
+
+        Clearing those references breaks a reference cycle
+        (``ExceptionInfo`` --> caught exception --> frame stack raising
+        the exception --> current frame stack --> local variables -->
+        ``ExceptionInfo``) which makes Python keep all objects referenced
+        from that cycle (including all local variables in the current
+        frame) alive until the next cyclic garbage collection run. See the
+        official Python ``try`` statement documentation for more detailed
+        information.
+
+    """
+    __tracebackhide__ = True
+    if expected_exception is AssertionError:
+        # we want to catch a AssertionError
+        # replace our subclass with the builtin one
+        # see https://github.com/pytest-dev/pytest/issues/176
+        from _pytest.assertion.util import BuiltinAssertionError \
+            as expected_exception
+    msg = ("exceptions must be old-style classes or"
+           " derived from BaseException, not %s")
+    if isinstance(expected_exception, tuple):
+        for exc in expected_exception:
+            if not isclass(exc):
+                raise TypeError(msg % type(exc))
+    elif not isclass(expected_exception):
+        raise TypeError(msg % type(expected_exception))
+
+    if not args:
+        return RaisesContext(expected_exception)
+    elif isinstance(args[0], str):
+        code, = args
+        assert isinstance(code, str)
+        frame = sys._getframe(1)
+        loc = frame.f_locals.copy()
+        loc.update(kwargs)
+        #print "raises frame scope: %r" % frame.f_locals
+        try:
+            code = _pytest._code.Source(code).compile()
+            py.builtin.exec_(code, frame.f_globals, loc)
+            # XXX didn'T mean f_globals == f_locals something special?
+            #     this is destroyed here ...
+        except expected_exception:
+            return _pytest._code.ExceptionInfo()
+    else:
+        func = args[0]
+        try:
+            func(*args[1:], **kwargs)
+        except expected_exception:
+            return _pytest._code.ExceptionInfo()
+    pytest.fail("DID NOT RAISE {0}".format(expected_exception))
+
+class RaisesContext(object):
+    def __init__(self, expected_exception):
+        self.expected_exception = expected_exception
+        self.excinfo = None
+
+    def __enter__(self):
+        self.excinfo = object.__new__(_pytest._code.ExceptionInfo)
+        return self.excinfo
+
+    def __exit__(self, *tp):
+        __tracebackhide__ = True
+        if tp[0] is None:
+            pytest.fail("DID NOT RAISE")
+        if sys.version_info < (2, 7):
+            # py26: on __exit__() exc_value often does not contain the
+            # exception value.
+            # http://bugs.python.org/issue7853
+            if not isinstance(tp[1], BaseException):
+                exc_type, value, traceback = tp
+                tp = exc_type, exc_type(value), traceback
+        self.excinfo.__init__(tp)
+        return issubclass(self.excinfo.type, self.expected_exception)
+
+#
+#  the basic pytest Function item
+#
+
+class Function(FunctionMixin, pytest.Item, FuncargnamesCompatAttr):
+    """ a Function Item is responsible for setting up and executing a
+    Python test function.
+    """
+    _genid = None
+    def __init__(self, name, parent, args=None, config=None,
+                 callspec=None, callobj=NOTSET, keywords=None, session=None,
+                 fixtureinfo=None):
+        super(Function, self).__init__(name, parent, config=config,
+                                       session=session)
+        self._args = args
+        if callobj is not NOTSET:
+            self.obj = callobj
+
+        self.keywords.update(self.obj.__dict__)
+        if callspec:
+            self.callspec = callspec
+            self.keywords.update(callspec.keywords)
+        if keywords:
+            self.keywords.update(keywords)
+
+        if fixtureinfo is None:
+            fixtureinfo = self.session._fixturemanager.getfixtureinfo(
+                self.parent, self.obj, self.cls,
+                funcargs=not self._isyieldedfunction())
+        self._fixtureinfo = fixtureinfo
+        self.fixturenames = fixtureinfo.names_closure
+        self._initrequest()
+
+    def _initrequest(self):
+        self.funcargs = {}
+        if self._isyieldedfunction():
+            assert not hasattr(self, "callspec"), (
+                "yielded functions (deprecated) cannot have funcargs")
+        else:
+            if hasattr(self, "callspec"):
+                callspec = self.callspec
+                assert not callspec.funcargs
+                self._genid = callspec.id
+                if hasattr(callspec, "param"):
+                    self.param = callspec.param
+        self._request = FixtureRequest(self)
+
+    @property
+    def function(self):
+        "underlying python 'function' object"
+        return getattr(self.obj, 'im_func', self.obj)
+
+    def _getobj(self):
+        name = self.name
+        i = name.find("[") # parametrization
+        if i != -1:
+            name = name[:i]
+        return getattr(self.parent.obj, name)
+
+    @property
+    def _pyfuncitem(self):
+        "(compatonly) for code expecting pytest-2.2 style request objects"
+        return self
+
+    def _isyieldedfunction(self):
+        return getattr(self, "_args", None) is not None
+
+    def runtest(self):
+        """ execute the underlying test function. """
+        self.ihook.pytest_pyfunc_call(pyfuncitem=self)
+
+    def setup(self):
+        super(Function, self).setup()
+        fillfixtures(self)
+
+
+scope2props = dict(session=())
+scope2props["module"] = ("fspath", "module")
+scope2props["class"] = scope2props["module"] + ("cls",)
+scope2props["instance"] = scope2props["class"] + ("instance", )
+scope2props["function"] = scope2props["instance"] + ("function", "keywords")
+
+def scopeproperty(name=None, doc=None):
+    def decoratescope(func):
+        scopename = name or func.__name__
+        def provide(self):
+            if func.__name__ in scope2props[self.scope]:
+                return func(self)
+            raise AttributeError("%s not available in %s-scoped context" % (
+                scopename, self.scope))
+        return property(provide, None, None, func.__doc__)
+    return decoratescope
+
+
+class FixtureRequest(FuncargnamesCompatAttr):
+    """ A request for a fixture from a test or fixture function.
+
+    A request object gives access to the requesting test context
+    and has an optional ``param`` attribute in case
+    the fixture is parametrized indirectly.
+    """
+
+    def __init__(self, pyfuncitem):
+        self._pyfuncitem = pyfuncitem
+        #: fixture for which this request is being performed
+        self.fixturename = None
+        #: Scope string, one of "function", "class", "module", "session"
+        self.scope = "function"
+        self._funcargs  = {}
+        self._fixturedefs = {}
+        fixtureinfo = pyfuncitem._fixtureinfo
+        self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy()
+        self._arg2index = {}
+        self.fixturenames = fixtureinfo.names_closure
+        self._fixturemanager = pyfuncitem.session._fixturemanager
+
+    @property
+    def node(self):
+        """ underlying collection node (depends on current request scope)"""
+        return self._getscopeitem(self.scope)
+
+
+    def _getnextfixturedef(self, argname):
+        fixturedefs = self._arg2fixturedefs.get(argname, None)
+        if fixturedefs is None:
+            # we arrive here because of a  a dynamic call to
+            # getfuncargvalue(argname) usage which was naturally
+            # not known at parsing/collection time
+            fixturedefs = self._fixturemanager.getfixturedefs(
+                            argname, self._pyfuncitem.parent.nodeid)
+            self._arg2fixturedefs[argname] = fixturedefs
+        # fixturedefs list is immutable so we maintain a decreasing index
+        index = self._arg2index.get(argname, 0) - 1
+        if fixturedefs is None or (-index > len(fixturedefs)):
+            raise FixtureLookupError(argname, self)
+        self._arg2index[argname] = index
+        return fixturedefs[index]
+
+    @property
+    def config(self):
+        """ the pytest config object associated with this request. """
+        return self._pyfuncitem.config
+
+
+    @scopeproperty()
+    def function(self):
+        """ test function object if the request has a per-function scope. """
+        return self._pyfuncitem.obj
+
+    @scopeproperty("class")
+    def cls(self):
+        """ class (can be None) where the test function was collected. """
+        clscol = self._pyfuncitem.getparent(pytest.Class)
+        if clscol:
+            return clscol.obj
+
+    @property
+    def instance(self):
+        """ instance (can be None) on which test function was collected. """
+        # unittest support hack, see _pytest.unittest.TestCaseFunction
+        try:
+            return self._pyfuncitem._testcase
+        except AttributeError:
+            function = getattr(self, "function", None)
+            if function is not None:
+                return py.builtin._getimself(function)
+
+    @scopeproperty()
+    def module(self):
+        """ python module object where the test function was collected. """
+        return self._pyfuncitem.getparent(pytest.Module).obj
+
+    @scopeproperty()
+    def fspath(self):
+        """ the file system path of the test module which collected this test. """
+        return self._pyfuncitem.fspath
+
+    @property
+    def keywords(self):
+        """ keywords/markers dictionary for the underlying node. """
+        return self.node.keywords
+
+    @property
+    def session(self):
+        """ pytest session object. """
+        return self._pyfuncitem.session
+
+    def addfinalizer(self, finalizer):
+        """ add finalizer/teardown function to be called after the
+        last test within the requesting test context finished
+        execution. """
+        # XXX usually this method is shadowed by fixturedef specific ones
+        self._addfinalizer(finalizer, scope=self.scope)
+
+    def _addfinalizer(self, finalizer, scope):
+        colitem = self._getscopeitem(scope)
+        self._pyfuncitem.session._setupstate.addfinalizer(
+            finalizer=finalizer, colitem=colitem)
+
+    def applymarker(self, marker):
+        """ Apply a marker to a single test function invocation.
+        This method is useful if you don't want to have a keyword/marker
+        on all function invocations.
+
+        :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object
+            created by a call to ``pytest.mark.NAME(...)``.
+        """
+        try:
+            self.node.keywords[marker.markname] = marker
+        except AttributeError:
+            raise ValueError(marker)
+
+    def raiseerror(self, msg):
+        """ raise a FixtureLookupError with the given message. """
+        raise self._fixturemanager.FixtureLookupError(None, self, msg)
+
+    def _fillfixtures(self):
+        item = self._pyfuncitem
+        fixturenames = getattr(item, "fixturenames", self.fixturenames)
+        for argname in fixturenames:
+            if argname not in item.funcargs:
+                item.funcargs[argname] = self.getfuncargvalue(argname)
+
+    def cached_setup(self, setup, teardown=None, scope="module", extrakey=None):
+        """ (deprecated) Return a testing resource managed by ``setup`` &
+        ``teardown`` calls.  ``scope`` and ``extrakey`` determine when the
+        ``teardown`` function will be called so that subsequent calls to
+        ``setup`` would recreate the resource.  With pytest-2.3 you often
+        do not need ``cached_setup()`` as you can directly declare a scope
+        on a fixture function and register a finalizer through
+        ``request.addfinalizer()``.
+
+        :arg teardown: function receiving a previously setup resource.
+        :arg setup: a no-argument function creating a resource.
+        :arg scope: a string value out of ``function``, ``class``, ``module``
+            or ``session`` indicating the caching lifecycle of the resource.
+        :arg extrakey: added to internal caching key of (funcargname, scope).
+        """
+        if not hasattr(self.config, '_setupcache'):
+            self.config._setupcache = {} # XXX weakref?
+        cachekey = (self.fixturename, self._getscopeitem(scope), extrakey)
+        cache = self.config._setupcache
+        try:
+            val = cache[cachekey]
+        except KeyError:
+            self._check_scope(self.fixturename, self.scope, scope)
+            val = setup()
+            cache[cachekey] = val
+            if teardown is not None:
+                def finalizer():
+                    del cache[cachekey]
+                    teardown(val)
+                self._addfinalizer(finalizer, scope=scope)
+        return val
+
+    def getfuncargvalue(self, argname):
+        """ Dynamically retrieve a named fixture function argument.
+
+        As of pytest-2.3, it is easier and usually better to access other
+        fixture values by stating it as an input argument in the fixture
+        function.  If you only can decide about using another fixture at test
+        setup time, you may use this function to retrieve it inside a fixture
+        function body.
+        """
+        return self._get_active_fixturedef(argname).cached_result[0]
+
+    def _get_active_fixturedef(self, argname):
+        try:
+            return self._fixturedefs[argname]
+        except KeyError:
+            try:
+                fixturedef = self._getnextfixturedef(argname)
+            except FixtureLookupError:
+                if argname == "request":
+                    class PseudoFixtureDef:
+                        cached_result = (self, [0], None)
+                        scope = "function"
+                    return PseudoFixtureDef
+                raise
+        # remove indent to prevent the python3 exception
+        # from leaking into the call
+        result = self._getfuncargvalue(fixturedef)
+        self._funcargs[argname] = result
+        self._fixturedefs[argname] = fixturedef
+        return fixturedef
+
+    def _get_fixturestack(self):
+        current = self
+        l = []
+        while 1:
+            fixturedef = getattr(current, "_fixturedef", None)
+            if fixturedef is None:
+                l.reverse()
+                return l
+            l.append(fixturedef)
+            current = current._parent_request
+
+    def _getfuncargvalue(self, fixturedef):
+        # prepare a subrequest object before calling fixture function
+        # (latter managed by fixturedef)
+        argname = fixturedef.argname
+        funcitem = self._pyfuncitem
+        scope = fixturedef.scope
+        try:
+            param = funcitem.callspec.getparam(argname)
+        except (AttributeError, ValueError):
+            param = NOTSET
+            param_index = 0
+        else:
+            # indices might not be set if old-style metafunc.addcall() was used
+            param_index = funcitem.callspec.indices.get(argname, 0)
+            # if a parametrize invocation set a scope it will override
+            # the static scope defined with the fixture function
+            paramscopenum = funcitem.callspec._arg2scopenum.get(argname)
+            if paramscopenum is not None:
+                scope = scopes[paramscopenum]
+
+        subrequest = SubRequest(self, scope, param, param_index, fixturedef)
+
+        # check if a higher-level scoped fixture accesses a lower level one
+        subrequest._check_scope(argname, self.scope, scope)
+
+        # clear sys.exc_info before invoking the fixture (python bug?)
+        # if its not explicitly cleared it will leak into the call
+        exc_clear()
+        try:
+            # call the fixture function
+            val = fixturedef.execute(request=subrequest)
+        finally:
+            # if fixture function failed it might have registered finalizers
+            self.session._setupstate.addfinalizer(fixturedef.finish,
+                                                  subrequest.node)
+        return val
+
+    def _check_scope(self, argname, invoking_scope, requested_scope):
+        if argname == "request":
+            return
+        if scopemismatch(invoking_scope, requested_scope):
+            # try to report something helpful
+            lines = self._factorytraceback()
+            pytest.fail("ScopeMismatch: You tried to access the %r scoped "
+                "fixture %r with a %r scoped request object, "
+                "involved factories\n%s" %(
+                (requested_scope, argname, invoking_scope, "\n".join(lines))),
+                pytrace=False)
+
+    def _factorytraceback(self):
+        lines = []
+        for fixturedef in self._get_fixturestack():
+            factory = fixturedef.func
+            fs, lineno = getfslineno(factory)
+            p = self._pyfuncitem.session.fspath.bestrelpath(fs)
+            args = _format_args(factory)
+            lines.append("%s:%d:  def %s%s" %(
+                p, lineno, factory.__name__, args))
+        return lines
+
+    def _getscopeitem(self, scope):
+        if scope == "function":
+            # this might also be a non-function Item despite its attribute name
+            return self._pyfuncitem
+        node = get_scope_node(self._pyfuncitem, scope)
+        if node is None and scope == "class":
+            # fallback to function item itself
+            node = self._pyfuncitem
+        assert node
+        return node
+
+    def __repr__(self):
+        return "<FixtureRequest for %r>" %(self.node)
+
+
+class SubRequest(FixtureRequest):
+    """ a sub request for handling getting a fixture from a
+    test function/fixture. """
+    def __init__(self, request, scope, param, param_index, fixturedef):
+        self._parent_request = request
+        self.fixturename = fixturedef.argname
+        if param is not NOTSET:
+            self.param = param
+        self.param_index = param_index
+        self.scope = scope
+        self._fixturedef = fixturedef
+        self.addfinalizer = fixturedef.addfinalizer
+        self._pyfuncitem = request._pyfuncitem
+        self._funcargs  = request._funcargs
+        self._fixturedefs = request._fixturedefs
+        self._arg2fixturedefs = request._arg2fixturedefs
+        self._arg2index = request._arg2index
+        self.fixturenames = request.fixturenames
+        self._fixturemanager = request._fixturemanager
+
+    def __repr__(self):
+        return "<SubRequest %r for %r>" % (self.fixturename, self._pyfuncitem)
+
+
+class ScopeMismatchError(Exception):
+    """ A fixture function tries to use a different fixture function which
+    which has a lower scope (e.g. a Session one calls a function one)
+    """
+
+scopes = "session module class function".split()
+scopenum_function = scopes.index("function")
+def scopemismatch(currentscope, newscope):
+    return scopes.index(newscope) > scopes.index(currentscope)
+
+
+class FixtureLookupError(LookupError):
+    """ could not return a requested Fixture (missing or invalid). """
+    def __init__(self, argname, request, msg=None):
+        self.argname = argname
+        self.request = request
+        self.fixturestack = request._get_fixturestack()
+        self.msg = msg
+
+    def formatrepr(self):
+        tblines = []
+        addline = tblines.append
+        stack = [self.request._pyfuncitem.obj]
+        stack.extend(map(lambda x: x.func, self.fixturestack))
+        msg = self.msg
+        if msg is not None:
+            # the last fixture raise an error, let's present
+            # it at the requesting side
+            stack = stack[:-1]
+        for function in stack:
+            fspath, lineno = getfslineno(function)
+            try:
+                lines, _ = inspect.getsourcelines(get_real_func(function))
+            except (IOError, IndexError):
+                error_msg = "file %s, line %s: source code not available"
+                addline(error_msg % (fspath, lineno+1))
+            else:
+                addline("file %s, line %s" % (fspath, lineno+1))
+                for i, line in enumerate(lines):
+                    line = line.rstrip()
+                    addline("  " + line)
+                    if line.lstrip().startswith('def'):
+                        break
+
+        if msg is None:
+            fm = self.request._fixturemanager
+            available = []
+            for name, fixturedef in fm._arg2fixturedefs.items():
+                parentid = self.request._pyfuncitem.parent.nodeid
+                faclist = list(fm._matchfactories(fixturedef, parentid))
+                if faclist:
+                    available.append(name)
+            msg = "fixture %r not found" % (self.argname,)
+            msg += "\n available fixtures: %s" %(", ".join(available),)
+            msg += "\n use 'py.test --fixtures [testpath]' for help on them."
+
+        return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname)
+
+class FixtureLookupErrorRepr(TerminalRepr):
+    def __init__(self, filename, firstlineno, tblines, errorstring, argname):
+        self.tblines = tblines
+        self.errorstring = errorstring
+        self.filename = filename
+        self.firstlineno = firstlineno
+        self.argname = argname
+
+    def toterminal(self, tw):
+        #tw.line("FixtureLookupError: %s" %(self.argname), red=True)
+        for tbline in self.tblines:
+            tw.line(tbline.rstrip())
+        for line in self.errorstring.split("\n"):
+            tw.line("        " + line.strip(), red=True)
+        tw.line()
+        tw.line("%s:%d" % (self.filename, self.firstlineno+1))
+
+class FixtureManager:
+    """
+    pytest fixtures definitions and information is stored and managed
+    from this class.
+
+    During collection fm.parsefactories() is called multiple times to parse
+    fixture function definitions into FixtureDef objects and internal
+    data structures.
+
+    During collection of test functions, metafunc-mechanics instantiate
+    a FuncFixtureInfo object which is cached per node/func-name.
+    This FuncFixtureInfo object is later retrieved by Function nodes
+    which themselves offer a fixturenames attribute.
+
+    The FuncFixtureInfo object holds information about fixtures and FixtureDefs
+    relevant for a particular function.  An initial list of fixtures is
+    assembled like this:
+
+    - ini-defined usefixtures
+    - autouse-marked fixtures along the collection chain up from the function
+    - usefixtures markers at module/class/function level
+    - test function funcargs
+
+    Subsequently the funcfixtureinfo.fixturenames attribute is computed
+    as the closure of the fixtures needed to setup the initial fixtures,
+    i. e. fixtures needed by fixture functions themselves are appended
+    to the fixturenames list.
+
+    Upon the test-setup phases all fixturenames are instantiated, retrieved
+    by a lookup of their FuncFixtureInfo.
+    """
+
+    _argprefix = "pytest_funcarg__"
+    FixtureLookupError = FixtureLookupError
+    FixtureLookupErrorRepr = FixtureLookupErrorRepr
+
+    def __init__(self, session):
+        self.session = session
+        self.config = session.config
+        self._arg2fixturedefs = {}
+        self._holderobjseen = set()
+        self._arg2finish = {}
+        self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))]
+        session.config.pluginmanager.register(self, "funcmanage")
+
+
+    def getfixtureinfo(self, node, func, cls, funcargs=True):
+        if funcargs and not hasattr(node, "nofuncargs"):
+            if cls is not None:
+                startindex = 1
+            else:
+                startindex = None
+            argnames = getfuncargnames(func, startindex)
+        else:
+            argnames = ()
+        usefixtures = getattr(func, "usefixtures", None)
+        initialnames = argnames
+        if usefixtures is not None:
+            initialnames = usefixtures.args + initialnames
+        fm = node.session._fixturemanager
+        names_closure, arg2fixturedefs = fm.getfixtureclosure(initialnames,
+                                                              node)
+        return FuncFixtureInfo(argnames, names_closure, arg2fixturedefs)
+
+    def pytest_plugin_registered(self, plugin):
+        nodeid = None
+        try:
+            p = py.path.local(plugin.__file__)
+        except AttributeError:
+            pass
+        else:
+            # construct the base nodeid which is later used to check
+            # what fixtures are visible for particular tests (as denoted
+            # by their test id)
+            if p.basename.startswith("conftest.py"):
+                nodeid = p.dirpath().relto(self.config.rootdir)
+                if p.sep != "/":
+                    nodeid = nodeid.replace(p.sep, "/")
+        self.parsefactories(plugin, nodeid)
+
+    def _getautousenames(self, nodeid):
+        """ return a tuple of fixture names to be used. """
+        autousenames = []
+        for baseid, basenames in self._nodeid_and_autousenames:
+            if nodeid.startswith(baseid):
+                if baseid:
+                    i = len(baseid)
+                    nextchar = nodeid[i:i+1]
+                    if nextchar and nextchar not in ":/":
+                        continue
+                autousenames.extend(basenames)
+        # make sure autousenames are sorted by scope, scopenum 0 is session
+        autousenames.sort(
+            key=lambda x: self._arg2fixturedefs[x][-1].scopenum)
+        return autousenames
+
+    def getfixtureclosure(self, fixturenames, parentnode):
+        # collect the closure of all fixtures , starting with the given
+        # fixturenames as the initial set.  As we have to visit all
+        # factory definitions anyway, we also return a arg2fixturedefs
+        # mapping so that the caller can reuse it and does not have
+        # to re-discover fixturedefs again for each fixturename
+        # (discovering matching fixtures for a given name/node is expensive)
+
+        parentid = parentnode.nodeid
+        fixturenames_closure = self._getautousenames(parentid)
+        def merge(otherlist):
+            for arg in otherlist:
+                if arg not in fixturenames_closure:
+                    fixturenames_closure.append(arg)
+        merge(fixturenames)
+        arg2fixturedefs = {}
+        lastlen = -1
+        while lastlen != len(fixturenames_closure):
+            lastlen = len(fixturenames_closure)
+            for argname in fixturenames_closure:
+                if argname in arg2fixturedefs:
+                    continue
+                fixturedefs = self.getfixturedefs(argname, parentid)
+                if fixturedefs:
+                    arg2fixturedefs[argname] = fixturedefs
+                    merge(fixturedefs[-1].argnames)
+        return fixturenames_closure, arg2fixturedefs
+
+    def pytest_generate_tests(self, metafunc):
+        for argname in metafunc.fixturenames:
+            faclist = metafunc._arg2fixturedefs.get(argname)
+            if faclist:
+                fixturedef = faclist[-1]
+                if fixturedef.params is not None:
+                    func_params = getattr(getattr(metafunc.function, 'parametrize', None), 'args', [[None]])
+                    # skip directly parametrized arguments
+                    argnames = func_params[0]
+                    if not isinstance(argnames, (tuple, list)):
+                        argnames = [x.strip() for x in argnames.split(",") if x.strip()]
+                    if argname not in func_params and argname not in argnames:
+                        metafunc.parametrize(argname, fixturedef.params,
+                                             indirect=True, scope=fixturedef.scope,
+                                             ids=fixturedef.ids)
+            else:
+                continue # will raise FixtureLookupError at setup time
+
+    def pytest_collection_modifyitems(self, items):
+        # separate parametrized setups
+        items[:] = reorder_items(items)
+
+    def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False):
+        if nodeid is not NOTSET:
+            holderobj = node_or_obj
+        else:
+            holderobj = node_or_obj.obj
+            nodeid = node_or_obj.nodeid
+        if holderobj in self._holderobjseen:
+            return
+        self._holderobjseen.add(holderobj)
+        autousenames = []
+        for name in dir(holderobj):
+            obj = getattr(holderobj, name, None)
+            # fixture functions have a pytest_funcarg__ prefix (pre-2.3 style)
+            # or are "@pytest.fixture" marked
+            marker = getfixturemarker(obj)
+            if marker is None:
+                if not name.startswith(self._argprefix):
+                    continue
+                if not callable(obj):
+                    continue
+                marker = defaultfuncargprefixmarker
+                name = name[len(self._argprefix):]
+            elif not isinstance(marker, FixtureFunctionMarker):
+                # magic globals  with __getattr__ might have got us a wrong
+                # fixture attribute
+                continue
+            else:
+                assert not name.startswith(self._argprefix)
+            fixturedef = FixtureDef(self, nodeid, name, obj,
+                                    marker.scope, marker.params,
+                                    yieldctx=marker.yieldctx,
+                                    unittest=unittest, ids=marker.ids)
+            faclist = self._arg2fixturedefs.setdefault(name, [])
+            if fixturedef.has_location:
+                faclist.append(fixturedef)
+            else:
+                # fixturedefs with no location are at the front
+                # so this inserts the current fixturedef after the
+                # existing fixturedefs from external plugins but
+                # before the fixturedefs provided in conftests.
+                i = len([f for f in faclist if not f.has_location])
+                faclist.insert(i, fixturedef)
+            if marker.autouse:
+                autousenames.append(name)
+        if autousenames:
+            self._nodeid_and_autousenames.append((nodeid or '', autousenames))
+
+    def getfixturedefs(self, argname, nodeid):
+        try:
+            fixturedefs = self._arg2fixturedefs[argname]
+        except KeyError:
+            return None
+        else:
+            return tuple(self._matchfactories(fixturedefs, nodeid))
+
+    def _matchfactories(self, fixturedefs, nodeid):
+        for fixturedef in fixturedefs:
+            if nodeid.startswith(fixturedef.baseid):
+                yield fixturedef
+
+
+def fail_fixturefunc(fixturefunc, msg):
+    fs, lineno = getfslineno(fixturefunc)
+    location = "%s:%s" % (fs, lineno+1)
+    source = _pytest._code.Source(fixturefunc)
+    pytest.fail(msg + ":\n\n" + str(source.indent()) + "\n" + location,
+                pytrace=False)
+
+def call_fixture_func(fixturefunc, request, kwargs, yieldctx):
+    if yieldctx:
+        if not is_generator(fixturefunc):
+            fail_fixturefunc(fixturefunc,
+                msg="yield_fixture requires yield statement in function")
+        iter = fixturefunc(**kwargs)
+        next = getattr(iter, "__next__", None)
+        if next is None:
+            next = getattr(iter, "next")
+        res = next()
+        def teardown():
+            try:
+                next()
+            except StopIteration:
+                pass
+            else:
+                fail_fixturefunc(fixturefunc,
+                    "yield_fixture function has more than one 'yield'")
+        request.addfinalizer(teardown)
+    else:
+        if is_generator(fixturefunc):
+            fail_fixturefunc(fixturefunc,
+                msg="pytest.fixture functions cannot use ``yield``. "
+                    "Instead write and return an inner function/generator "
+                    "and let the consumer call and iterate over it.")
+        res = fixturefunc(**kwargs)
+    return res
+
+class FixtureDef:
+    """ A container for a factory definition. """
+    def __init__(self, fixturemanager, baseid, argname, func, scope, params,
+                 yieldctx, unittest=False, ids=None):
+        self._fixturemanager = fixturemanager
+        self.baseid = baseid or ''
+        self.has_location = baseid is not None
+        self.func = func
+        self.argname = argname
+        self.scope = scope
+        self.scopenum = scopes.index(scope or "function")
+        self.params = params
+        startindex = unittest and 1 or None
+        self.argnames = getfuncargnames(func, startindex=startindex)
+        self.yieldctx = yieldctx
+        self.unittest = unittest
+        self.ids = ids
+        self._finalizer = []
+
+    def addfinalizer(self, finalizer):
+        self._finalizer.append(finalizer)
+
+    def finish(self):
+        try:
+            while self._finalizer:
+                func = self._finalizer.pop()
+                func()
+        finally:
+            # even if finalization fails, we invalidate
+            # the cached fixture value
+            if hasattr(self, "cached_result"):
+                del self.cached_result
+
+    def execute(self, request):
+        # get required arguments and register our own finish()
+        # with their finalization
+        kwargs = {}
+        for argname in self.argnames:
+            fixturedef = request._get_active_fixturedef(argname)
+            result, arg_cache_key, exc = fixturedef.cached_result
+            request._check_scope(argname, request.scope, fixturedef.scope)
+            kwargs[argname] = result
+            if argname != "request":
+                fixturedef.addfinalizer(self.finish)
+
+        my_cache_key = request.param_index
+        cached_result = getattr(self, "cached_result", None)
+        if cached_result is not None:
+            result, cache_key, err = cached_result
+            if my_cache_key == cache_key:
+                if err is not None:
+                    py.builtin._reraise(*err)
+                else:
+                    return result
+            # we have a previous but differently parametrized fixture instance
+            # so we need to tear it down before creating a new one
+            self.finish()
+            assert not hasattr(self, "cached_result")
+
+        fixturefunc = self.func
+
+        if self.unittest:
+            if request.instance is not None:
+                # bind the unbound method to the TestCase instance
+                fixturefunc = self.func.__get__(request.instance)
+        else:
+            # the fixture function needs to be bound to the actual
+            # request.instance so that code working with "self" behaves
+            # as expected.
+            if request.instance is not None:
+                fixturefunc = getimfunc(self.func)
+                if fixturefunc != self.func:
+                    fixturefunc = fixturefunc.__get__(request.instance)
+
+        try:
+            result = call_fixture_func(fixturefunc, request, kwargs,
+                                       self.yieldctx)
+        except Exception:
+            self.cached_result = (None, my_cache_key, sys.exc_info())
+            raise
+        self.cached_result = (result, my_cache_key, None)
+        return result
+
+    def __repr__(self):
+        return ("<FixtureDef name=%r scope=%r baseid=%r >" %
+                (self.argname, self.scope, self.baseid))
+
+def num_mock_patch_args(function):
+    """ return number of arguments used up by mock arguments (if any) """
+    patchings = getattr(function, "patchings", None)
+    if not patchings:
+        return 0
+    mock = sys.modules.get("mock", sys.modules.get("unittest.mock", None))
+    if mock is not None:
+        return len([p for p in patchings
+                        if not p.attribute_name and p.new is mock.DEFAULT])
+    return len(patchings)
+
+
+def getfuncargnames(function, startindex=None):
+    # XXX merge with main.py's varnames
+    #assert not isclass(function)
+    realfunction = function
+    while hasattr(realfunction, "__wrapped__"):
+        realfunction = realfunction.__wrapped__
+    if startindex is None:
+        startindex = inspect.ismethod(function) and 1 or 0
+    if realfunction != function:
+        startindex += num_mock_patch_args(function)
+        function = realfunction
+    if isinstance(function, functools.partial):
+        argnames = inspect.getargs(_pytest._code.getrawcode(function.func))[0]
+        partial = function
+        argnames = argnames[len(partial.args):]
+        if partial.keywords:
+            for kw in partial.keywords:
+                argnames.remove(kw)
+    else:
+        argnames = inspect.getargs(_pytest._code.getrawcode(function))[0]
+    defaults = getattr(function, 'func_defaults',
+                       getattr(function, '__defaults__', None)) or ()
+    numdefaults = len(defaults)
+    if numdefaults:
+        return tuple(argnames[startindex:-numdefaults])
+    return tuple(argnames[startindex:])
+
+# algorithm for sorting on a per-parametrized resource setup basis
+# it is called for scopenum==0 (session) first and performs sorting
+# down to the lower scopes such as to minimize number of "high scope"
+# setups and teardowns
+
+def reorder_items(items):
+    argkeys_cache = {}
+    for scopenum in range(0, scopenum_function):
+        argkeys_cache[scopenum] = d = {}
+        for item in items:
+            keys = set(get_parametrized_fixture_keys(item, scopenum))
+            if keys:
+                d[item] = keys
+    return reorder_items_atscope(items, set(), argkeys_cache, 0)
+
+def reorder_items_atscope(items, ignore, argkeys_cache, scopenum):
+    if scopenum >= scopenum_function or len(items) < 3:
+        return items
+    items_done = []
+    while 1:
+        items_before, items_same, items_other, newignore = \
+                slice_items(items, ignore, argkeys_cache[scopenum])
+        items_before = reorder_items_atscope(
+                            items_before, ignore, argkeys_cache,scopenum+1)
+        if items_same is None:
+            # nothing to reorder in this scope
+            assert items_other is None
+            return items_done + items_before
+        items_done.extend(items_before)
+        items = items_same + items_other
+        ignore = newignore
+
+
+def slice_items(items, ignore, scoped_argkeys_cache):
+    # we pick the first item which uses a fixture instance in the
+    # requested scope and which we haven't seen yet.  We slice the input
+    # items list into a list of items_nomatch, items_same and
+    # items_other
+    if scoped_argkeys_cache:  # do we need to do work at all?
+        it = iter(items)
+        # first find a slicing key
+        for i, item in enumerate(it):
+            argkeys = scoped_argkeys_cache.get(item)
+            if argkeys is not None:
+                argkeys = argkeys.difference(ignore)
+                if argkeys:  # found a slicing key
+                    slicing_argkey = argkeys.pop()
+                    items_before = items[:i]
+                    items_same = [item]
+                    items_other = []
+                    # now slice the remainder of the list
+                    for item in it:
+                        argkeys = scoped_argkeys_cache.get(item)
+                        if argkeys and slicing_argkey in argkeys and \
+                            slicing_argkey not in ignore:
+                            items_same.append(item)
+                        else:
+                            items_other.append(item)
+                    newignore = ignore.copy()
+                    newignore.add(slicing_argkey)
+                    return (items_before, items_same, items_other, newignore)
+    return items, None, None, None
+
+def get_parametrized_fixture_keys(item, scopenum):
+    """ return list of keys for all parametrized arguments which match
+    the specified scope. """
+    assert scopenum < scopenum_function  # function
+    try:
+        cs = item.callspec
+    except AttributeError:
+        pass
+    else:
+        # cs.indictes.items() is random order of argnames but
+        # then again different functions (items) can change order of
+        # arguments so it doesn't matter much probably
+        for argname, param_index in cs.indices.items():
+            if cs._arg2scopenum[argname] != scopenum:
+                continue
+            if scopenum == 0:    # session
+                key = (argname, param_index)
+            elif scopenum == 1:  # module
+                key = (argname, param_index, item.fspath)
+            elif scopenum == 2:  # class
+                key = (argname, param_index, item.fspath, item.cls)
+            yield key
+
+
+def xunitsetup(obj, name):
+    meth = getattr(obj, name, None)
+    if getfixturemarker(meth) is None:
+        return meth
+
+def getfixturemarker(obj):
+    """ return fixturemarker or None if it doesn't exist or raised
+    exceptions."""
+    try:
+        return getattr(obj, "_pytestfixturefunction", None)
+    except KeyboardInterrupt:
+        raise
+    except Exception:
+        # some objects raise errors like request (from flask import request)
+        # we don't expect them to be fixture functions
+        return None
+
+scopename2class = {
+    'class': Class,
+    'module': Module,
+    'function': pytest.Item,
+}
+def get_scope_node(node, scope):
+    cls = scopename2class.get(scope)
+    if cls is None:
+        if scope == "session":
+            return node.session
+        raise ValueError("unknown scope")
+    return node.getparent(cls)
diff --git a/python/pytest/_pytest/recwarn.py b/python/pytest/_pytest/recwarn.py
new file mode 100644
index 000000000..a89474c03
--- /dev/null
+++ b/python/pytest/_pytest/recwarn.py
@@ -0,0 +1,221 @@
+""" recording warnings during test function execution. """
+
+import inspect
+
+import _pytest._code
+import py
+import sys
+import warnings
+import pytest
+
+
+@pytest.yield_fixture
+def recwarn(request):
+    """Return a WarningsRecorder instance that provides these methods:
+
+    * ``pop(category=None)``: return last warning matching the category.
+    * ``clear()``: clear list of warnings
+
+    See http://docs.python.org/library/warnings.html for information
+    on warning categories.
+    """
+    wrec = WarningsRecorder()
+    with wrec:
+        warnings.simplefilter('default')
+        yield wrec
+
+
+def pytest_namespace():
+    return {'deprecated_call': deprecated_call,
+            'warns': warns}
+
+
+def deprecated_call(func=None, *args, **kwargs):
+    """ assert that calling ``func(*args, **kwargs)`` triggers a
+    ``DeprecationWarning`` or ``PendingDeprecationWarning``.
+
+    This function can be used as a context manager::
+
+        >>> with deprecated_call():
+        ...    myobject.deprecated_method()
+
+    Note: we cannot use WarningsRecorder here because it is still subject
+    to the mechanism that prevents warnings of the same type from being
+    triggered twice for the same module. See #1190.
+    """
+    if not func:
+        return WarningsChecker(expected_warning=DeprecationWarning)
+
+    categories = []
+
+    def warn_explicit(message, category, *args, **kwargs):
+        categories.append(category)
+        old_warn_explicit(message, category, *args, **kwargs)
+
+    def warn(message, category=None, *args, **kwargs):
+        if isinstance(message, Warning):
+            categories.append(message.__class__)
+        else:
+            categories.append(category)
+        old_warn(message, category, *args, **kwargs)
+
+    old_warn = warnings.warn
+    old_warn_explicit = warnings.warn_explicit
+    warnings.warn_explicit = warn_explicit
+    warnings.warn = warn
+    try:
+        ret = func(*args, **kwargs)
+    finally:
+        warnings.warn_explicit = old_warn_explicit
+        warnings.warn = old_warn
+    deprecation_categories = (DeprecationWarning, PendingDeprecationWarning)
+    if not any(issubclass(c, deprecation_categories) for c in categories):
+        __tracebackhide__ = True
+        raise AssertionError("%r did not produce DeprecationWarning" % (func,))
+    return ret
+
+
+def warns(expected_warning, *args, **kwargs):
+    """Assert that code raises a particular class of warning.
+
+    Specifically, the input @expected_warning can be a warning class or
+    tuple of warning classes, and the code must return that warning
+    (if a single class) or one of those warnings (if a tuple).
+
+    This helper produces a list of ``warnings.WarningMessage`` objects,
+    one for each warning raised.
+
+    This function can be used as a context manager, or any of the other ways
+    ``pytest.raises`` can be used::
+
+        >>> with warns(RuntimeWarning):
+        ...    warnings.warn("my warning", RuntimeWarning)
+    """
+    wcheck = WarningsChecker(expected_warning)
+    if not args:
+        return wcheck
+    elif isinstance(args[0], str):
+        code, = args
+        assert isinstance(code, str)
+        frame = sys._getframe(1)
+        loc = frame.f_locals.copy()
+        loc.update(kwargs)
+
+        with wcheck:
+            code = _pytest._code.Source(code).compile()
+            py.builtin.exec_(code, frame.f_globals, loc)
+    else:
+        func = args[0]
+        with wcheck:
+            return func(*args[1:], **kwargs)
+
+
+class RecordedWarning(object):
+    def __init__(self, message, category, filename, lineno, file, line):
+        self.message = message
+        self.category = category
+        self.filename = filename
+        self.lineno = lineno
+        self.file = file
+        self.line = line
+
+
+class WarningsRecorder(object):
+    """A context manager to record raised warnings.
+
+    Adapted from `warnings.catch_warnings`.
+    """
+
+    def __init__(self, module=None):
+        self._module = sys.modules['warnings'] if module is None else module
+        self._entered = False
+        self._list = []
+
+    @property
+    def list(self):
+        """The list of recorded warnings."""
+        return self._list
+
+    def __getitem__(self, i):
+        """Get a recorded warning by index."""
+        return self._list[i]
+
+    def __iter__(self):
+        """Iterate through the recorded warnings."""
+        return iter(self._list)
+
+    def __len__(self):
+        """The number of recorded warnings."""
+        return len(self._list)
+
+    def pop(self, cls=Warning):
+        """Pop the first recorded warning, raise exception if not exists."""
+        for i, w in enumerate(self._list):
+            if issubclass(w.category, cls):
+                return self._list.pop(i)
+        __tracebackhide__ = True
+        raise AssertionError("%r not found in warning list" % cls)
+
+    def clear(self):
+        """Clear the list of recorded warnings."""
+        self._list[:] = []
+
+    def __enter__(self):
+        if self._entered:
+            __tracebackhide__ = True
+            raise RuntimeError("Cannot enter %r twice" % self)
+        self._entered = True
+        self._filters = self._module.filters
+        self._module.filters = self._filters[:]
+        self._showwarning = self._module.showwarning
+
+        def showwarning(message, category, filename, lineno,
+                        file=None, line=None):
+            self._list.append(RecordedWarning(
+                message, category, filename, lineno, file, line))
+
+            # still perform old showwarning functionality
+            self._showwarning(
+                message, category, filename, lineno, file=file, line=line)
+
+        self._module.showwarning = showwarning
+
+        # allow the same warning to be raised more than once
+
+        self._module.simplefilter('always')
+        return self
+
+    def __exit__(self, *exc_info):
+        if not self._entered:
+            __tracebackhide__ = True
+            raise RuntimeError("Cannot exit %r without entering first" % self)
+        self._module.filters = self._filters
+        self._module.showwarning = self._showwarning
+
+
+class WarningsChecker(WarningsRecorder):
+    def __init__(self, expected_warning=None, module=None):
+        super(WarningsChecker, self).__init__(module=module)
+
+        msg = ("exceptions must be old-style classes or "
+               "derived from Warning, not %s")
+        if isinstance(expected_warning, tuple):
+            for exc in expected_warning:
+                if not inspect.isclass(exc):
+                    raise TypeError(msg % type(exc))
+        elif inspect.isclass(expected_warning):
+            expected_warning = (expected_warning,)
+        elif expected_warning is not None:
+            raise TypeError(msg % type(expected_warning))
+
+        self.expected_warning = expected_warning
+
+    def __exit__(self, *exc_info):
+        super(WarningsChecker, self).__exit__(*exc_info)
+
+        # only check if we're not currently handling an exception
+        if all(a is None for a in exc_info):
+            if self.expected_warning is not None:
+                if not any(r.category in self.expected_warning for r in self):
+                    __tracebackhide__ = True
+                    pytest.fail("DID NOT WARN")
diff --git a/python/pytest/_pytest/resultlog.py b/python/pytest/_pytest/resultlog.py
new file mode 100644
index 000000000..3670f0214
--- /dev/null
+++ b/python/pytest/_pytest/resultlog.py
@@ -0,0 +1,104 @@
+""" log machine-parseable test session result information in a plain
+text file.
+"""
+
+import py
+import os
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting", "resultlog plugin options")
+    group.addoption('--resultlog', '--result-log', action="store",
+        metavar="path", default=None,
+        help="path for machine-readable result log.")
+
+def pytest_configure(config):
+    resultlog = config.option.resultlog
+    # prevent opening resultlog on slave nodes (xdist)
+    if resultlog and not hasattr(config, 'slaveinput'):
+        dirname = os.path.dirname(os.path.abspath(resultlog))
+        if not os.path.isdir(dirname):
+            os.makedirs(dirname)
+        logfile = open(resultlog, 'w', 1) # line buffered
+        config._resultlog = ResultLog(config, logfile)
+        config.pluginmanager.register(config._resultlog)
+
+def pytest_unconfigure(config):
+    resultlog = getattr(config, '_resultlog', None)
+    if resultlog:
+        resultlog.logfile.close()
+        del config._resultlog
+        config.pluginmanager.unregister(resultlog)
+
+def generic_path(item):
+    chain = item.listchain()
+    gpath = [chain[0].name]
+    fspath = chain[0].fspath
+    fspart = False
+    for node in chain[1:]:
+        newfspath = node.fspath
+        if newfspath == fspath:
+            if fspart:
+                gpath.append(':')
+                fspart = False
+            else:
+                gpath.append('.')
+        else:
+            gpath.append('/')
+            fspart = True
+        name = node.name
+        if name[0] in '([':
+            gpath.pop()
+        gpath.append(name)
+        fspath = newfspath
+    return ''.join(gpath)
+
+class ResultLog(object):
+    def __init__(self, config, logfile):
+        self.config = config
+        self.logfile = logfile # preferably line buffered
+
+    def write_log_entry(self, testpath, lettercode, longrepr):
+        py.builtin.print_("%s %s" % (lettercode, testpath), file=self.logfile)
+        for line in longrepr.splitlines():
+            py.builtin.print_(" %s" % line, file=self.logfile)
+
+    def log_outcome(self, report, lettercode, longrepr):
+        testpath = getattr(report, 'nodeid', None)
+        if testpath is None:
+            testpath = report.fspath
+        self.write_log_entry(testpath, lettercode, longrepr)
+
+    def pytest_runtest_logreport(self, report):
+        if report.when != "call" and report.passed:
+            return
+        res = self.config.hook.pytest_report_teststatus(report=report)
+        code = res[1]
+        if code == 'x':
+            longrepr = str(report.longrepr)
+        elif code == 'X':
+            longrepr = ''
+        elif report.passed:
+            longrepr = ""
+        elif report.failed:
+            longrepr = str(report.longrepr)
+        elif report.skipped:
+            longrepr = str(report.longrepr[2])
+        self.log_outcome(report, code, longrepr)
+
+    def pytest_collectreport(self, report):
+        if not report.passed:
+            if report.failed:
+                code = "F"
+                longrepr = str(report.longrepr)
+            else:
+                assert report.skipped
+                code = "S"
+                longrepr = "%s:%d: %s" % report.longrepr
+            self.log_outcome(report, code, longrepr)
+
+    def pytest_internalerror(self, excrepr):
+        reprcrash = getattr(excrepr, 'reprcrash', None)
+        path = getattr(reprcrash, "path", None)
+        if path is None:
+            path = "cwd:%s" % py.path.local()
+        self.write_log_entry(path, '!', str(excrepr))
diff --git a/python/pytest/_pytest/runner.py b/python/pytest/_pytest/runner.py
new file mode 100644
index 000000000..cde94c8c8
--- /dev/null
+++ b/python/pytest/_pytest/runner.py
@@ -0,0 +1,515 @@
+""" basic collect and runtest protocol implementations """
+import bdb
+import sys
+from time import time
+
+import py
+import pytest
+from _pytest._code.code import TerminalRepr, ExceptionInfo
+
+
+def pytest_namespace():
+    return {
+        'fail'         : fail,
+        'skip'         : skip,
+        'importorskip' : importorskip,
+        'exit'         : exit,
+    }
+
+#
+# pytest plugin hooks
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting", "reporting", after="general")
+    group.addoption('--durations',
+         action="store", type=int, default=None, metavar="N",
+         help="show N slowest setup/test durations (N=0 for all)."),
+
+def pytest_terminal_summary(terminalreporter):
+    durations = terminalreporter.config.option.durations
+    if durations is None:
+        return
+    tr = terminalreporter
+    dlist = []
+    for replist in tr.stats.values():
+        for rep in replist:
+            if hasattr(rep, 'duration'):
+                dlist.append(rep)
+    if not dlist:
+        return
+    dlist.sort(key=lambda x: x.duration)
+    dlist.reverse()
+    if not durations:
+        tr.write_sep("=", "slowest test durations")
+    else:
+        tr.write_sep("=", "slowest %s test durations" % durations)
+        dlist = dlist[:durations]
+
+    for rep in dlist:
+        nodeid = rep.nodeid.replace("::()::", "::")
+        tr.write_line("%02.2fs %-8s %s" %
+            (rep.duration, rep.when, nodeid))
+
+def pytest_sessionstart(session):
+    session._setupstate = SetupState()
+def pytest_sessionfinish(session):
+    session._setupstate.teardown_all()
+
+class NodeInfo:
+    def __init__(self, location):
+        self.location = location
+
+def pytest_runtest_protocol(item, nextitem):
+    item.ihook.pytest_runtest_logstart(
+        nodeid=item.nodeid, location=item.location,
+    )
+    runtestprotocol(item, nextitem=nextitem)
+    return True
+
+def runtestprotocol(item, log=True, nextitem=None):
+    hasrequest = hasattr(item, "_request")
+    if hasrequest and not item._request:
+        item._initrequest()
+    rep = call_and_report(item, "setup", log)
+    reports = [rep]
+    if rep.passed:
+        reports.append(call_and_report(item, "call", log))
+    reports.append(call_and_report(item, "teardown", log,
+        nextitem=nextitem))
+    # after all teardown hooks have been called
+    # want funcargs and request info to go away
+    if hasrequest:
+        item._request = False
+        item.funcargs = None
+    return reports
+
+def pytest_runtest_setup(item):
+    item.session._setupstate.prepare(item)
+
+def pytest_runtest_call(item):
+    try:
+        item.runtest()
+    except Exception:
+        # Store trace info to allow postmortem debugging
+        type, value, tb = sys.exc_info()
+        tb = tb.tb_next  # Skip *this* frame
+        sys.last_type = type
+        sys.last_value = value
+        sys.last_traceback = tb
+        del tb  # Get rid of it in this namespace
+        raise
+
+def pytest_runtest_teardown(item, nextitem):
+    item.session._setupstate.teardown_exact(item, nextitem)
+
+def pytest_report_teststatus(report):
+    if report.when in ("setup", "teardown"):
+        if report.failed:
+            #      category, shortletter, verbose-word
+            return "error", "E", "ERROR"
+        elif report.skipped:
+            return "skipped", "s", "SKIPPED"
+        else:
+            return "", "", ""
+
+
+#
+# Implementation
+
+def call_and_report(item, when, log=True, **kwds):
+    call = call_runtest_hook(item, when, **kwds)
+    hook = item.ihook
+    report = hook.pytest_runtest_makereport(item=item, call=call)
+    if log:
+        hook.pytest_runtest_logreport(report=report)
+    if check_interactive_exception(call, report):
+        hook.pytest_exception_interact(node=item, call=call, report=report)
+    return report
+
+def check_interactive_exception(call, report):
+    return call.excinfo and not (
+                hasattr(report, "wasxfail") or
+                call.excinfo.errisinstance(skip.Exception) or
+                call.excinfo.errisinstance(bdb.BdbQuit))
+
+def call_runtest_hook(item, when, **kwds):
+    hookname = "pytest_runtest_" + when
+    ihook = getattr(item.ihook, hookname)
+    return CallInfo(lambda: ihook(item=item, **kwds), when=when)
+
+class CallInfo:
+    """ Result/Exception info a function invocation. """
+    #: None or ExceptionInfo object.
+    excinfo = None
+    def __init__(self, func, when):
+        #: context of invocation: one of "setup", "call",
+        #: "teardown", "memocollect"
+        self.when = when
+        self.start = time()
+        try:
+            self.result = func()
+        except KeyboardInterrupt:
+            self.stop = time()
+            raise
+        except:
+            self.excinfo = ExceptionInfo()
+        self.stop = time()
+
+    def __repr__(self):
+        if self.excinfo:
+            status = "exception: %s" % str(self.excinfo.value)
+        else:
+            status = "result: %r" % (self.result,)
+        return "<CallInfo when=%r %s>" % (self.when, status)
+
+def getslaveinfoline(node):
+    try:
+        return node._slaveinfocache
+    except AttributeError:
+        d = node.slaveinfo
+        ver = "%s.%s.%s" % d['version_info'][:3]
+        node._slaveinfocache = s = "[%s] %s -- Python %s %s" % (
+            d['id'], d['sysplatform'], ver, d['executable'])
+        return s
+
+class BaseReport(object):
+
+    def __init__(self, **kw):
+        self.__dict__.update(kw)
+
+    def toterminal(self, out):
+        if hasattr(self, 'node'):
+            out.line(getslaveinfoline(self.node))
+
+        longrepr = self.longrepr
+        if longrepr is None:
+            return
+
+        if hasattr(longrepr, 'toterminal'):
+            longrepr.toterminal(out)
+        else:
+            try:
+                out.line(longrepr)
+            except UnicodeEncodeError:
+                out.line("<unprintable longrepr>")
+
+    def get_sections(self, prefix):
+        for name, content in self.sections:
+            if name.startswith(prefix):
+                yield prefix, content
+
+    passed = property(lambda x: x.outcome == "passed")
+    failed = property(lambda x: x.outcome == "failed")
+    skipped = property(lambda x: x.outcome == "skipped")
+
+    @property
+    def fspath(self):
+        return self.nodeid.split("::")[0]
+
+def pytest_runtest_makereport(item, call):
+    when = call.when
+    duration = call.stop-call.start
+    keywords = dict([(x,1) for x in item.keywords])
+    excinfo = call.excinfo
+    sections = []
+    if not call.excinfo:
+        outcome = "passed"
+        longrepr = None
+    else:
+        if not isinstance(excinfo, ExceptionInfo):
+            outcome = "failed"
+            longrepr = excinfo
+        elif excinfo.errisinstance(pytest.skip.Exception):
+            outcome = "skipped"
+            r = excinfo._getreprcrash()
+            longrepr = (str(r.path), r.lineno, r.message)
+        else:
+            outcome = "failed"
+            if call.when == "call":
+                longrepr = item.repr_failure(excinfo)
+            else: # exception in setup or teardown
+                longrepr = item._repr_failure_py(excinfo,
+                                            style=item.config.option.tbstyle)
+    for rwhen, key, content in item._report_sections:
+        sections.append(("Captured %s %s" %(key, rwhen), content))
+    return TestReport(item.nodeid, item.location,
+                      keywords, outcome, longrepr, when,
+                      sections, duration)
+
+class TestReport(BaseReport):
+    """ Basic test report object (also used for setup and teardown calls if
+    they fail).
+    """
+    def __init__(self, nodeid, location, keywords, outcome,
+                 longrepr, when, sections=(), duration=0, **extra):
+        #: normalized collection node id
+        self.nodeid = nodeid
+
+        #: a (filesystempath, lineno, domaininfo) tuple indicating the
+        #: actual location of a test item - it might be different from the
+        #: collected one e.g. if a method is inherited from a different module.
+        self.location = location
+
+        #: a name -> value dictionary containing all keywords and
+        #: markers associated with a test invocation.
+        self.keywords = keywords
+
+        #: test outcome, always one of "passed", "failed", "skipped".
+        self.outcome = outcome
+
+        #: None or a failure representation.
+        self.longrepr = longrepr
+
+        #: one of 'setup', 'call', 'teardown' to indicate runtest phase.
+        self.when = when
+
+        #: list of (secname, data) extra information which needs to
+        #: marshallable
+        self.sections = list(sections)
+
+        #: time it took to run just the test
+        self.duration = duration
+
+        self.__dict__.update(extra)
+
+    def __repr__(self):
+        return "<TestReport %r when=%r outcome=%r>" % (
+            self.nodeid, self.when, self.outcome)
+
+class TeardownErrorReport(BaseReport):
+    outcome = "failed"
+    when = "teardown"
+    def __init__(self, longrepr, **extra):
+        self.longrepr = longrepr
+        self.sections = []
+        self.__dict__.update(extra)
+
+def pytest_make_collect_report(collector):
+    call = CallInfo(collector._memocollect, "memocollect")
+    longrepr = None
+    if not call.excinfo:
+        outcome = "passed"
+    else:
+        from _pytest import nose
+        skip_exceptions = (Skipped,) + nose.get_skip_exceptions()
+        if call.excinfo.errisinstance(skip_exceptions):
+            outcome = "skipped"
+            r = collector._repr_failure_py(call.excinfo, "line").reprcrash
+            longrepr = (str(r.path), r.lineno, r.message)
+        else:
+            outcome = "failed"
+            errorinfo = collector.repr_failure(call.excinfo)
+            if not hasattr(errorinfo, "toterminal"):
+                errorinfo = CollectErrorRepr(errorinfo)
+            longrepr = errorinfo
+    rep = CollectReport(collector.nodeid, outcome, longrepr,
+        getattr(call, 'result', None))
+    rep.call = call  # see collect_one_node
+    return rep
+
+
+class CollectReport(BaseReport):
+    def __init__(self, nodeid, outcome, longrepr, result,
+                 sections=(), **extra):
+        self.nodeid = nodeid
+        self.outcome = outcome
+        self.longrepr = longrepr
+        self.result = result or []
+        self.sections = list(sections)
+        self.__dict__.update(extra)
+
+    @property
+    def location(self):
+        return (self.fspath, None, self.fspath)
+
+    def __repr__(self):
+        return "<CollectReport %r lenresult=%s outcome=%r>" % (
+                self.nodeid, len(self.result), self.outcome)
+
+class CollectErrorRepr(TerminalRepr):
+    def __init__(self, msg):
+        self.longrepr = msg
+    def toterminal(self, out):
+        out.line(self.longrepr, red=True)
+
+class SetupState(object):
+    """ shared state for setting up/tearing down test items or collectors. """
+    def __init__(self):
+        self.stack = []
+        self._finalizers = {}
+
+    def addfinalizer(self, finalizer, colitem):
+        """ attach a finalizer to the given colitem.
+        if colitem is None, this will add a finalizer that
+        is called at the end of teardown_all().
+        """
+        assert colitem and not isinstance(colitem, tuple)
+        assert py.builtin.callable(finalizer)
+        #assert colitem in self.stack  # some unit tests don't setup stack :/
+        self._finalizers.setdefault(colitem, []).append(finalizer)
+
+    def _pop_and_teardown(self):
+        colitem = self.stack.pop()
+        self._teardown_with_finalization(colitem)
+
+    def _callfinalizers(self, colitem):
+        finalizers = self._finalizers.pop(colitem, None)
+        exc = None
+        while finalizers:
+            fin = finalizers.pop()
+            try:
+                fin()
+            except Exception:
+                # XXX Only first exception will be seen by user,
+                #     ideally all should be reported.
+                if exc is None:
+                    exc = sys.exc_info()
+        if exc:
+            py.builtin._reraise(*exc)
+
+    def _teardown_with_finalization(self, colitem):
+        self._callfinalizers(colitem)
+        if hasattr(colitem, "teardown"):
+            colitem.teardown()
+        for colitem in self._finalizers:
+            assert colitem is None or colitem in self.stack \
+             or isinstance(colitem, tuple)
+
+    def teardown_all(self):
+        while self.stack:
+            self._pop_and_teardown()
+        for key in list(self._finalizers):
+            self._teardown_with_finalization(key)
+        assert not self._finalizers
+
+    def teardown_exact(self, item, nextitem):
+        needed_collectors = nextitem and nextitem.listchain() or []
+        self._teardown_towards(needed_collectors)
+
+    def _teardown_towards(self, needed_collectors):
+        while self.stack:
+            if self.stack == needed_collectors[:len(self.stack)]:
+                break
+            self._pop_and_teardown()
+
+    def prepare(self, colitem):
+        """ setup objects along the collector chain to the test-method
+            and teardown previously setup objects."""
+        needed_collectors = colitem.listchain()
+        self._teardown_towards(needed_collectors)
+
+        # check if the last collection node has raised an error
+        for col in self.stack:
+            if hasattr(col, '_prepare_exc'):
+                py.builtin._reraise(*col._prepare_exc)
+        for col in needed_collectors[len(self.stack):]:
+            self.stack.append(col)
+            try:
+                col.setup()
+            except Exception:
+                col._prepare_exc = sys.exc_info()
+                raise
+
+def collect_one_node(collector):
+    ihook = collector.ihook
+    ihook.pytest_collectstart(collector=collector)
+    rep = ihook.pytest_make_collect_report(collector=collector)
+    call = rep.__dict__.pop("call", None)
+    if call and check_interactive_exception(call, rep):
+        ihook.pytest_exception_interact(node=collector, call=call, report=rep)
+    return rep
+
+
+# =============================================================
+# Test OutcomeExceptions and helpers for creating them.
+
+
+class OutcomeException(Exception):
+    """ OutcomeException and its subclass instances indicate and
+        contain info about test and collection outcomes.
+    """
+    def __init__(self, msg=None, pytrace=True):
+        Exception.__init__(self, msg)
+        self.msg = msg
+        self.pytrace = pytrace
+
+    def __repr__(self):
+        if self.msg:
+            val = self.msg
+            if isinstance(val, bytes):
+                val = py._builtin._totext(val, errors='replace')
+            return val
+        return "<%s instance>" %(self.__class__.__name__,)
+    __str__ = __repr__
+
+class Skipped(OutcomeException):
+    # XXX hackish: on 3k we fake to live in the builtins
+    # in order to have Skipped exception printing shorter/nicer
+    __module__ = 'builtins'
+
+class Failed(OutcomeException):
+    """ raised from an explicit call to pytest.fail() """
+    __module__ = 'builtins'
+
+class Exit(KeyboardInterrupt):
+    """ raised for immediate program exits (no tracebacks/summaries)"""
+    def __init__(self, msg="unknown reason"):
+        self.msg = msg
+        KeyboardInterrupt.__init__(self, msg)
+
+# exposed helper methods
+
+def exit(msg):
+    """ exit testing process as if KeyboardInterrupt was triggered. """
+    __tracebackhide__ = True
+    raise Exit(msg)
+
+exit.Exception = Exit
+
+def skip(msg=""):
+    """ skip an executing test with the given message.  Note: it's usually
+    better to use the pytest.mark.skipif marker to declare a test to be
+    skipped under certain conditions like mismatching platforms or
+    dependencies.  See the pytest_skipping plugin for details.
+    """
+    __tracebackhide__ = True
+    raise Skipped(msg=msg)
+skip.Exception = Skipped
+
+def fail(msg="", pytrace=True):
+    """ explicitly fail an currently-executing test with the given Message.
+
+    :arg pytrace: if false the msg represents the full failure information
+                  and no python traceback will be reported.
+    """
+    __tracebackhide__ = True
+    raise Failed(msg=msg, pytrace=pytrace)
+fail.Exception = Failed
+
+
+def importorskip(modname, minversion=None):
+    """ return imported module if it has at least "minversion" as its
+    __version__ attribute.  If no minversion is specified the a skip
+    is only triggered if the module can not be imported.
+    """
+    __tracebackhide__ = True
+    compile(modname, '', 'eval') # to catch syntaxerrors
+    try:
+        __import__(modname)
+    except ImportError:
+        skip("could not import %r" %(modname,))
+    mod = sys.modules[modname]
+    if minversion is None:
+        return mod
+    verattr = getattr(mod, '__version__', None)
+    if minversion is not None:
+        try:
+            from pkg_resources import parse_version as pv
+        except ImportError:
+            skip("we have a required version for %r but can not import "
+                 "no pkg_resources to parse version strings." %(modname,))
+        if verattr is None or pv(verattr) < pv(minversion):
+            skip("module %r has __version__ %r, required is: %r" %(
+                 modname, verattr, minversion))
+    return mod
+
diff --git a/python/pytest/_pytest/skipping.py b/python/pytest/_pytest/skipping.py
new file mode 100644
index 000000000..18e038d2c
--- /dev/null
+++ b/python/pytest/_pytest/skipping.py
@@ -0,0 +1,361 @@
+""" support for skip/xfail functions and markers. """
+import os
+import sys
+import traceback
+
+import py
+import pytest
+from _pytest.mark import MarkInfo, MarkDecorator
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group.addoption('--runxfail',
+           action="store_true", dest="runxfail", default=False,
+           help="run tests even if they are marked xfail")
+
+    parser.addini("xfail_strict", "default for the strict parameter of xfail "
+                                  "markers when not given explicitly (default: "
+                                  "False)",
+                                  default=False,
+                                  type="bool")
+
+
+def pytest_configure(config):
+    if config.option.runxfail:
+        old = pytest.xfail
+        config._cleanup.append(lambda: setattr(pytest, "xfail", old))
+        def nop(*args, **kwargs):
+            pass
+        nop.Exception = XFailed
+        setattr(pytest, "xfail", nop)
+
+    config.addinivalue_line("markers",
+        "skip(reason=None): skip the given test function with an optional reason. "
+        "Example: skip(reason=\"no way of currently testing this\") skips the "
+        "test."
+    )
+    config.addinivalue_line("markers",
+        "skipif(condition): skip the given test function if eval(condition) "
+        "results in a True value.  Evaluation happens within the "
+        "module global context. Example: skipif('sys.platform == \"win32\"') "
+        "skips the test if we are on the win32 platform. see "
+        "http://pytest.org/latest/skipping.html"
+    )
+    config.addinivalue_line("markers",
+        "xfail(condition, reason=None, run=True, raises=None, strict=False): "
+        "mark the the test function as an expected failure if eval(condition) "
+        "has a True value. Optionally specify a reason for better reporting "
+        "and run=False if you don't even want to execute the test function. "
+        "If only specific exception(s) are expected, you can list them in "
+        "raises, and if the test fails in other ways, it will be reported as "
+        "a true failure. See http://pytest.org/latest/skipping.html"
+    )
+
+
+def pytest_namespace():
+    return dict(xfail=xfail)
+
+
+class XFailed(pytest.fail.Exception):
+    """ raised from an explicit call to pytest.xfail() """
+
+
+def xfail(reason=""):
+    """ xfail an executing test or setup functions with the given reason."""
+    __tracebackhide__ = True
+    raise XFailed(reason)
+xfail.Exception = XFailed
+
+
+class MarkEvaluator:
+    def __init__(self, item, name):
+        self.item = item
+        self.name = name
+
+    @property
+    def holder(self):
+        return self.item.keywords.get(self.name)
+
+    def __bool__(self):
+        return bool(self.holder)
+    __nonzero__ = __bool__
+
+    def wasvalid(self):
+        return not hasattr(self, 'exc')
+
+    def invalidraise(self, exc):
+        raises = self.get('raises')
+        if not raises:
+            return
+        return not isinstance(exc, raises)
+
+    def istrue(self):
+        try:
+            return self._istrue()
+        except Exception:
+            self.exc = sys.exc_info()
+            if isinstance(self.exc[1], SyntaxError):
+                msg = [" " * (self.exc[1].offset + 4) + "^",]
+                msg.append("SyntaxError: invalid syntax")
+            else:
+                msg = traceback.format_exception_only(*self.exc[:2])
+            pytest.fail("Error evaluating %r expression\n"
+                        "    %s\n"
+                        "%s"
+                        %(self.name, self.expr, "\n".join(msg)),
+                        pytrace=False)
+
+    def _getglobals(self):
+        d = {'os': os, 'sys': sys, 'config': self.item.config}
+        func = self.item.obj
+        try:
+            d.update(func.__globals__)
+        except AttributeError:
+            d.update(func.func_globals)
+        return d
+
+    def _istrue(self):
+        if hasattr(self, 'result'):
+            return self.result
+        if self.holder:
+            d = self._getglobals()
+            if self.holder.args or 'condition' in self.holder.kwargs:
+                self.result = False
+                # "holder" might be a MarkInfo or a MarkDecorator; only
+                # MarkInfo keeps track of all parameters it received in an
+                # _arglist attribute
+                if hasattr(self.holder, '_arglist'):
+                    arglist = self.holder._arglist
+                else:
+                    arglist = [(self.holder.args, self.holder.kwargs)]
+                for args, kwargs in arglist:
+                    if 'condition' in kwargs:
+                        args = (kwargs['condition'],)
+                    for expr in args:
+                        self.expr = expr
+                        if isinstance(expr, py.builtin._basestring):
+                            result = cached_eval(self.item.config, expr, d)
+                        else:
+                            if "reason" not in kwargs:
+                                # XXX better be checked at collection time
+                                msg = "you need to specify reason=STRING " \
+                                      "when using booleans as conditions."
+                                pytest.fail(msg)
+                            result = bool(expr)
+                        if result:
+                            self.result = True
+                            self.reason = kwargs.get('reason', None)
+                            self.expr = expr
+                            return self.result
+            else:
+                self.result = True
+        return getattr(self, 'result', False)
+
+    def get(self, attr, default=None):
+        return self.holder.kwargs.get(attr, default)
+
+    def getexplanation(self):
+        expl = getattr(self, 'reason', None) or self.get('reason', None)
+        if not expl:
+            if not hasattr(self, 'expr'):
+                return ""
+            else:
+                return "condition: " + str(self.expr)
+        return expl
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_runtest_setup(item):
+    # Check if skip or skipif are specified as pytest marks
+
+    skipif_info = item.keywords.get('skipif')
+    if isinstance(skipif_info, (MarkInfo, MarkDecorator)):
+        eval_skipif = MarkEvaluator(item, 'skipif')
+        if eval_skipif.istrue():
+            item._evalskip = eval_skipif
+            pytest.skip(eval_skipif.getexplanation())
+
+    skip_info = item.keywords.get('skip')
+    if isinstance(skip_info, (MarkInfo, MarkDecorator)):
+        item._evalskip = True
+        if 'reason' in skip_info.kwargs:
+            pytest.skip(skip_info.kwargs['reason'])
+        elif skip_info.args:
+            pytest.skip(skip_info.args[0])
+        else:
+            pytest.skip("unconditional skip")
+
+    item._evalxfail = MarkEvaluator(item, 'xfail')
+    check_xfail_no_run(item)
+
+
+@pytest.mark.hookwrapper
+def pytest_pyfunc_call(pyfuncitem):
+    check_xfail_no_run(pyfuncitem)
+    outcome = yield
+    passed = outcome.excinfo is None
+    if passed:
+        check_strict_xfail(pyfuncitem)
+
+
+def check_xfail_no_run(item):
+    """check xfail(run=False)"""
+    if not item.config.option.runxfail:
+        evalxfail = item._evalxfail
+        if evalxfail.istrue():
+            if not evalxfail.get('run', True):
+                pytest.xfail("[NOTRUN] " + evalxfail.getexplanation())
+
+
+def check_strict_xfail(pyfuncitem):
+    """check xfail(strict=True) for the given PASSING test"""
+    evalxfail = pyfuncitem._evalxfail
+    if evalxfail.istrue():
+        strict_default = pyfuncitem.config.getini('xfail_strict')
+        is_strict_xfail = evalxfail.get('strict', strict_default)
+        if is_strict_xfail:
+            del pyfuncitem._evalxfail
+            explanation = evalxfail.getexplanation()
+            pytest.fail('[XPASS(strict)] ' + explanation, pytrace=False)
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_runtest_makereport(item, call):
+    outcome = yield
+    rep = outcome.get_result()
+    evalxfail = getattr(item, '_evalxfail', None)
+    evalskip = getattr(item, '_evalskip', None)
+    # unitttest special case, see setting of _unexpectedsuccess
+    if hasattr(item, '_unexpectedsuccess') and rep.when == "call":
+        # we need to translate into how pytest encodes xpass
+        rep.wasxfail = "reason: " + repr(item._unexpectedsuccess)
+        rep.outcome = "failed"
+    elif item.config.option.runxfail:
+        pass   # don't interefere
+    elif call.excinfo and call.excinfo.errisinstance(pytest.xfail.Exception):
+        rep.wasxfail = "reason: " + call.excinfo.value.msg
+        rep.outcome = "skipped"
+    elif evalxfail and not rep.skipped and evalxfail.wasvalid() and \
+        evalxfail.istrue():
+        if call.excinfo:
+            if evalxfail.invalidraise(call.excinfo.value):
+                rep.outcome = "failed"
+            else:
+                rep.outcome = "skipped"
+                rep.wasxfail = evalxfail.getexplanation()
+        elif call.when == "call":
+            rep.outcome = "failed"  # xpass outcome
+            rep.wasxfail = evalxfail.getexplanation()
+    elif evalskip is not None and rep.skipped and type(rep.longrepr) is tuple:
+        # skipped by mark.skipif; change the location of the failure
+        # to point to the item definition, otherwise it will display
+        # the location of where the skip exception was raised within pytest
+        filename, line, reason = rep.longrepr
+        filename, line = item.location[:2]
+        rep.longrepr = filename, line, reason
+
+# called by terminalreporter progress reporting
+def pytest_report_teststatus(report):
+    if hasattr(report, "wasxfail"):
+        if report.skipped:
+            return "xfailed", "x", "xfail"
+        elif report.failed:
+            return "xpassed", "X", ("XPASS", {'yellow': True})
+
+# called by the terminalreporter instance/plugin
+def pytest_terminal_summary(terminalreporter):
+    tr = terminalreporter
+    if not tr.reportchars:
+        #for name in "xfailed skipped failed xpassed":
+        #    if not tr.stats.get(name, 0):
+        #        tr.write_line("HINT: use '-r' option to see extra "
+        #              "summary info about tests")
+        #        break
+        return
+
+    lines = []
+    for char in tr.reportchars:
+        if char == "x":
+            show_xfailed(terminalreporter, lines)
+        elif char == "X":
+            show_xpassed(terminalreporter, lines)
+        elif char in "fF":
+            show_simple(terminalreporter, lines, 'failed', "FAIL %s")
+        elif char in "sS":
+            show_skipped(terminalreporter, lines)
+        elif char == "E":
+            show_simple(terminalreporter, lines, 'error', "ERROR %s")
+        elif char == 'p':
+            show_simple(terminalreporter, lines, 'passed', "PASSED %s")
+
+    if lines:
+        tr._tw.sep("=", "short test summary info")
+        for line in lines:
+            tr._tw.line(line)
+
+def show_simple(terminalreporter, lines, stat, format):
+    failed = terminalreporter.stats.get(stat)
+    if failed:
+        for rep in failed:
+            pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid)
+            lines.append(format %(pos,))
+
+def show_xfailed(terminalreporter, lines):
+    xfailed = terminalreporter.stats.get("xfailed")
+    if xfailed:
+        for rep in xfailed:
+            pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid)
+            reason = rep.wasxfail
+            lines.append("XFAIL %s" % (pos,))
+            if reason:
+                lines.append("  " + str(reason))
+
+def show_xpassed(terminalreporter, lines):
+    xpassed = terminalreporter.stats.get("xpassed")
+    if xpassed:
+        for rep in xpassed:
+            pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid)
+            reason = rep.wasxfail
+            lines.append("XPASS %s %s" %(pos, reason))
+
+def cached_eval(config, expr, d):
+    if not hasattr(config, '_evalcache'):
+        config._evalcache = {}
+    try:
+        return config._evalcache[expr]
+    except KeyError:
+        import _pytest._code
+        exprcode = _pytest._code.compile(expr, mode="eval")
+        config._evalcache[expr] = x = eval(exprcode, d)
+        return x
+
+
+def folded_skips(skipped):
+    d = {}
+    for event in skipped:
+        key = event.longrepr
+        assert len(key) == 3, (event, key)
+        d.setdefault(key, []).append(event)
+    l = []
+    for key, events in d.items():
+        l.append((len(events),) + key)
+    return l
+
+def show_skipped(terminalreporter, lines):
+    tr = terminalreporter
+    skipped = tr.stats.get('skipped', [])
+    if skipped:
+        #if not tr.hasopt('skipped'):
+        #    tr.write_line(
+        #        "%d skipped tests, specify -rs for more info" %
+        #        len(skipped))
+        #    return
+        fskips = folded_skips(skipped)
+        if fskips:
+            #tr.write_sep("_", "skipped test summary")
+            for num, fspath, lineno, reason in fskips:
+                if reason.startswith("Skipped: "):
+                    reason = reason[9:]
+                lines.append("SKIP [%d] %s:%d: %s" %
+                    (num, fspath, lineno, reason))
diff --git a/python/pytest/_pytest/standalonetemplate.py b/python/pytest/_pytest/standalonetemplate.py
new file mode 100755
index 000000000..484d5d1b2
--- /dev/null
+++ b/python/pytest/_pytest/standalonetemplate.py
@@ -0,0 +1,89 @@
+#! /usr/bin/env python
+
+# Hi There!
+# You may be wondering what this giant blob of binary data here is, you might
+# even be worried that we're up to something nefarious (good for you for being
+# paranoid!). This is a base64 encoding of a zip file, this zip file contains
+# a fully functional basic pytest script.
+#
+# Pytest is a thing that tests packages, pytest itself is a package that some-
+# one might want to install, especially if they're looking to run tests inside
+# some package they want to install. Pytest has a lot of code to collect and
+# execute tests, and other such sort of "tribal knowledge" that has been en-
+# coded in its code base. Because of this we basically include a basic copy
+# of pytest inside this blob. We do this  because it let's you as a maintainer
+# or application developer who wants people who don't deal with python much to
+# easily run tests without installing the complete pytest package.
+#
+# If you're wondering how this is created: you can create it yourself if you
+# have a complete pytest installation by using this command on the command-
+# line: ``py.test --genscript=runtests.py``.
+
+sources = """
+@SOURCES@"""
+
+import sys
+import base64
+import zlib
+
+class DictImporter(object):
+    def __init__(self, sources):
+        self.sources = sources
+
+    def find_module(self, fullname, path=None):
+        if fullname == "argparse" and sys.version_info >= (2,7):
+            # we were generated with <python2.7 (which pulls in argparse)
+            # but we are running now on a stdlib which has it, so use that.
+            return None
+        if fullname in self.sources:
+            return self
+        if fullname + '.__init__' in self.sources:
+            return self
+        return None
+
+    def load_module(self, fullname):
+        # print "load_module:",  fullname
+        from types import ModuleType
+        try:
+            s = self.sources[fullname]
+            is_pkg = False
+        except KeyError:
+            s = self.sources[fullname + '.__init__']
+            is_pkg = True
+
+        co = compile(s, fullname, 'exec')
+        module = sys.modules.setdefault(fullname, ModuleType(fullname))
+        module.__file__ = "%s/%s" % (__file__, fullname)
+        module.__loader__ = self
+        if is_pkg:
+            module.__path__ = [fullname]
+
+        do_exec(co, module.__dict__) # noqa
+        return sys.modules[fullname]
+
+    def get_source(self, name):
+        res = self.sources.get(name)
+        if res is None:
+            res = self.sources.get(name + '.__init__')
+        return res
+
+if __name__ == "__main__":
+    try:
+        import pkg_resources  # noqa
+    except ImportError:
+        sys.stderr.write("ERROR: setuptools not installed\n")
+        sys.exit(2)
+    if sys.version_info >= (3, 0):
+        exec("def do_exec(co, loc): exec(co, loc)\n")
+        import pickle
+        sources = sources.encode("ascii") # ensure bytes
+        sources = pickle.loads(zlib.decompress(base64.decodebytes(sources)))
+    else:
+        import cPickle as pickle
+        exec("def do_exec(co, loc): exec co in loc\n")
+        sources = pickle.loads(zlib.decompress(base64.decodestring(sources)))
+
+    importer = DictImporter(sources)
+    sys.meta_path.insert(0, importer)
+    entry = "@ENTRY@"
+    do_exec(entry, locals()) # noqa
diff --git a/python/pytest/_pytest/terminal.py b/python/pytest/_pytest/terminal.py
new file mode 100644
index 000000000..825f553ef
--- /dev/null
+++ b/python/pytest/_pytest/terminal.py
@@ -0,0 +1,593 @@
+""" terminal reporting of the full testing process.
+
+This is a good source for looking at the various reporting hooks.
+"""
+from _pytest.main import EXIT_OK, EXIT_TESTSFAILED, EXIT_INTERRUPTED, \
+    EXIT_USAGEERROR, EXIT_NOTESTSCOLLECTED
+import pytest
+import py
+import sys
+import time
+import platform
+
+import _pytest._pluggy as pluggy
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting", "reporting", after="general")
+    group._addoption('-v', '--verbose', action="count",
+               dest="verbose", default=0, help="increase verbosity."),
+    group._addoption('-q', '--quiet', action="count",
+               dest="quiet", default=0, help="decrease verbosity."),
+    group._addoption('-r',
+         action="store", dest="reportchars", default=None, metavar="chars",
+         help="show extra test summary info as specified by chars (f)ailed, "
+              "(E)error, (s)skipped, (x)failed, (X)passed (w)pytest-warnings "
+              "(p)passed, (P)passed with output, (a)all except pP.")
+    group._addoption('-l', '--showlocals',
+         action="store_true", dest="showlocals", default=False,
+         help="show locals in tracebacks (disabled by default).")
+    group._addoption('--report',
+         action="store", dest="report", default=None, metavar="opts",
+         help="(deprecated, use -r)")
+    group._addoption('--tb', metavar="style",
+               action="store", dest="tbstyle", default='auto',
+               choices=['auto', 'long', 'short', 'no', 'line', 'native'],
+               help="traceback print mode (auto/long/short/line/native/no).")
+    group._addoption('--fulltrace', '--full-trace',
+               action="store_true", default=False,
+               help="don't cut any tracebacks (default is to cut).")
+    group._addoption('--color', metavar="color",
+               action="store", dest="color", default='auto',
+               choices=['yes', 'no', 'auto'],
+               help="color terminal output (yes/no/auto).")
+
+def pytest_configure(config):
+    config.option.verbose -= config.option.quiet
+    reporter = TerminalReporter(config, sys.stdout)
+    config.pluginmanager.register(reporter, 'terminalreporter')
+    if config.option.debug or config.option.traceconfig:
+        def mywriter(tags, args):
+            msg = " ".join(map(str, args))
+            reporter.write_line("[traceconfig] " + msg)
+        config.trace.root.setprocessor("pytest:config", mywriter)
+
+def getreportopt(config):
+    reportopts = ""
+    optvalue = config.option.report
+    if optvalue:
+        py.builtin.print_("DEPRECATED: use -r instead of --report option.",
+            file=sys.stderr)
+        if optvalue:
+            for setting in optvalue.split(","):
+                setting = setting.strip()
+                if setting == "skipped":
+                    reportopts += "s"
+                elif setting == "xfailed":
+                    reportopts += "x"
+    reportchars = config.option.reportchars
+    if reportchars:
+        for char in reportchars:
+            if char not in reportopts and char != 'a':
+                reportopts += char
+            elif char == 'a':
+                reportopts = 'fEsxXw'
+    return reportopts
+
+def pytest_report_teststatus(report):
+    if report.passed:
+        letter = "."
+    elif report.skipped:
+        letter = "s"
+    elif report.failed:
+        letter = "F"
+        if report.when != "call":
+            letter = "f"
+    return report.outcome, letter, report.outcome.upper()
+
+class WarningReport:
+    def __init__(self, code, message, nodeid=None, fslocation=None):
+        self.code = code
+        self.message = message
+        self.nodeid = nodeid
+        self.fslocation = fslocation
+
+
+class TerminalReporter:
+    def __init__(self, config, file=None):
+        import _pytest.config
+        self.config = config
+        self.verbosity = self.config.option.verbose
+        self.showheader = self.verbosity >= 0
+        self.showfspath = self.verbosity >= 0
+        self.showlongtestinfo = self.verbosity > 0
+        self._numcollected = 0
+
+        self.stats = {}
+        self.startdir = py.path.local()
+        if file is None:
+            file = sys.stdout
+        self._tw = self.writer = _pytest.config.create_terminal_writer(config,
+                                                                       file)
+        self.currentfspath = None
+        self.reportchars = getreportopt(config)
+        self.hasmarkup = self._tw.hasmarkup
+        self.isatty = file.isatty()
+
+    def hasopt(self, char):
+        char = {'xfailed': 'x', 'skipped': 's'}.get(char, char)
+        return char in self.reportchars
+
+    def write_fspath_result(self, nodeid, res):
+        fspath = self.config.rootdir.join(nodeid.split("::")[0])
+        if fspath != self.currentfspath:
+            self.currentfspath = fspath
+            fspath = self.startdir.bestrelpath(fspath)
+            self._tw.line()
+            self._tw.write(fspath + " ")
+        self._tw.write(res)
+
+    def write_ensure_prefix(self, prefix, extra="", **kwargs):
+        if self.currentfspath != prefix:
+            self._tw.line()
+            self.currentfspath = prefix
+            self._tw.write(prefix)
+        if extra:
+            self._tw.write(extra, **kwargs)
+            self.currentfspath = -2
+
+    def ensure_newline(self):
+        if self.currentfspath:
+            self._tw.line()
+            self.currentfspath = None
+
+    def write(self, content, **markup):
+        self._tw.write(content, **markup)
+
+    def write_line(self, line, **markup):
+        if not py.builtin._istext(line):
+            line = py.builtin.text(line, errors="replace")
+        self.ensure_newline()
+        self._tw.line(line, **markup)
+
+    def rewrite(self, line, **markup):
+        line = str(line)
+        self._tw.write("\r" + line, **markup)
+
+    def write_sep(self, sep, title=None, **markup):
+        self.ensure_newline()
+        self._tw.sep(sep, title, **markup)
+
+    def section(self, title, sep="=", **kw):
+        self._tw.sep(sep, title, **kw)
+
+    def line(self, msg, **kw):
+        self._tw.line(msg, **kw)
+
+    def pytest_internalerror(self, excrepr):
+        for line in py.builtin.text(excrepr).split("\n"):
+            self.write_line("INTERNALERROR> " + line)
+        return 1
+
+    def pytest_logwarning(self, code, fslocation, message, nodeid):
+        warnings = self.stats.setdefault("warnings", [])
+        if isinstance(fslocation, tuple):
+            fslocation = "%s:%d" % fslocation
+        warning = WarningReport(code=code, fslocation=fslocation,
+                                message=message, nodeid=nodeid)
+        warnings.append(warning)
+
+    def pytest_plugin_registered(self, plugin):
+        if self.config.option.traceconfig:
+            msg = "PLUGIN registered: %s" % (plugin,)
+            # XXX this event may happen during setup/teardown time
+            #     which unfortunately captures our output here
+            #     which garbles our output if we use self.write_line
+            self.write_line(msg)
+
+    def pytest_deselected(self, items):
+        self.stats.setdefault('deselected', []).extend(items)
+
+    def pytest_runtest_logstart(self, nodeid, location):
+        # ensure that the path is printed before the
+        # 1st test of a module starts running
+        if self.showlongtestinfo:
+            line = self._locationline(nodeid, *location)
+            self.write_ensure_prefix(line, "")
+        elif self.showfspath:
+            fsid = nodeid.split("::")[0]
+            self.write_fspath_result(fsid, "")
+
+    def pytest_runtest_logreport(self, report):
+        rep = report
+        res = self.config.hook.pytest_report_teststatus(report=rep)
+        cat, letter, word = res
+        self.stats.setdefault(cat, []).append(rep)
+        self._tests_ran = True
+        if not letter and not word:
+            # probably passed setup/teardown
+            return
+        if self.verbosity <= 0:
+            if not hasattr(rep, 'node') and self.showfspath:
+                self.write_fspath_result(rep.nodeid, letter)
+            else:
+                self._tw.write(letter)
+        else:
+            if isinstance(word, tuple):
+                word, markup = word
+            else:
+                if rep.passed:
+                    markup = {'green':True}
+                elif rep.failed:
+                    markup = {'red':True}
+                elif rep.skipped:
+                    markup = {'yellow':True}
+            line = self._locationline(rep.nodeid, *rep.location)
+            if not hasattr(rep, 'node'):
+                self.write_ensure_prefix(line, word, **markup)
+                #self._tw.write(word, **markup)
+            else:
+                self.ensure_newline()
+                if hasattr(rep, 'node'):
+                    self._tw.write("[%s] " % rep.node.gateway.id)
+                self._tw.write(word, **markup)
+                self._tw.write(" " + line)
+                self.currentfspath = -2
+
+    def pytest_collection(self):
+        if not self.isatty and self.config.option.verbose >= 1:
+            self.write("collecting ... ", bold=True)
+
+    def pytest_collectreport(self, report):
+        if report.failed:
+            self.stats.setdefault("error", []).append(report)
+        elif report.skipped:
+            self.stats.setdefault("skipped", []).append(report)
+        items = [x for x in report.result if isinstance(x, pytest.Item)]
+        self._numcollected += len(items)
+        if self.isatty:
+            #self.write_fspath_result(report.nodeid, 'E')
+            self.report_collect()
+
+    def report_collect(self, final=False):
+        if self.config.option.verbose < 0:
+            return
+
+        errors = len(self.stats.get('error', []))
+        skipped = len(self.stats.get('skipped', []))
+        if final:
+            line = "collected "
+        else:
+            line = "collecting "
+        line += str(self._numcollected) + " items"
+        if errors:
+            line += " / %d errors" % errors
+        if skipped:
+            line += " / %d skipped" % skipped
+        if self.isatty:
+            if final:
+                line += " \n"
+            self.rewrite(line, bold=True)
+        else:
+            self.write_line(line)
+
+    def pytest_collection_modifyitems(self):
+        self.report_collect(True)
+
+    @pytest.hookimpl(trylast=True)
+    def pytest_sessionstart(self, session):
+        self._sessionstarttime = time.time()
+        if not self.showheader:
+            return
+        self.write_sep("=", "test session starts", bold=True)
+        verinfo = platform.python_version()
+        msg = "platform %s -- Python %s" % (sys.platform, verinfo)
+        if hasattr(sys, 'pypy_version_info'):
+            verinfo = ".".join(map(str, sys.pypy_version_info[:3]))
+            msg += "[pypy-%s-%s]" % (verinfo, sys.pypy_version_info[3])
+        msg += ", pytest-%s, py-%s, pluggy-%s" % (
+               pytest.__version__, py.__version__, pluggy.__version__)
+        if self.verbosity > 0 or self.config.option.debug or \
+           getattr(self.config.option, 'pastebin', None):
+            msg += " -- " + str(sys.executable)
+        self.write_line(msg)
+        lines = self.config.hook.pytest_report_header(
+            config=self.config, startdir=self.startdir)
+        lines.reverse()
+        for line in flatten(lines):
+            self.write_line(line)
+
+    def pytest_report_header(self, config):
+        inifile = ""
+        if config.inifile:
+            inifile = config.rootdir.bestrelpath(config.inifile)
+        lines = ["rootdir: %s, inifile: %s" %(config.rootdir, inifile)]
+
+        plugininfo = config.pluginmanager.list_plugin_distinfo()
+        if plugininfo:
+
+            lines.append(
+                "plugins: %s" % ", ".join(_plugin_nameversions(plugininfo)))
+        return lines
+
+    def pytest_collection_finish(self, session):
+        if self.config.option.collectonly:
+            self._printcollecteditems(session.items)
+            if self.stats.get('failed'):
+                self._tw.sep("!", "collection failures")
+                for rep in self.stats.get('failed'):
+                    rep.toterminal(self._tw)
+                return 1
+            return 0
+        if not self.showheader:
+            return
+        #for i, testarg in enumerate(self.config.args):
+        #    self.write_line("test path %d: %s" %(i+1, testarg))
+
+    def _printcollecteditems(self, items):
+        # to print out items and their parent collectors
+        # we take care to leave out Instances aka ()
+        # because later versions are going to get rid of them anyway
+        if self.config.option.verbose < 0:
+            if self.config.option.verbose < -1:
+                counts = {}
+                for item in items:
+                    name = item.nodeid.split('::', 1)[0]
+                    counts[name] = counts.get(name, 0) + 1
+                for name, count in sorted(counts.items()):
+                    self._tw.line("%s: %d" % (name, count))
+            else:
+                for item in items:
+                    nodeid = item.nodeid
+                    nodeid = nodeid.replace("::()::", "::")
+                    self._tw.line(nodeid)
+            return
+        stack = []
+        indent = ""
+        for item in items:
+            needed_collectors = item.listchain()[1:] # strip root node
+            while stack:
+                if stack == needed_collectors[:len(stack)]:
+                    break
+                stack.pop()
+            for col in needed_collectors[len(stack):]:
+                stack.append(col)
+                #if col.name == "()":
+                #    continue
+                indent = (len(stack) - 1) * "  "
+                self._tw.line("%s%s" % (indent, col))
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_sessionfinish(self, exitstatus):
+        outcome = yield
+        outcome.get_result()
+        self._tw.line("")
+        summary_exit_codes = (
+            EXIT_OK, EXIT_TESTSFAILED, EXIT_INTERRUPTED, EXIT_USAGEERROR,
+            EXIT_NOTESTSCOLLECTED)
+        if exitstatus in summary_exit_codes:
+            self.config.hook.pytest_terminal_summary(terminalreporter=self)
+            self.summary_errors()
+            self.summary_failures()
+            self.summary_warnings()
+            self.summary_passes()
+        if exitstatus == EXIT_INTERRUPTED:
+            self._report_keyboardinterrupt()
+            del self._keyboardinterrupt_memo
+        self.summary_deselected()
+        self.summary_stats()
+
+    def pytest_keyboard_interrupt(self, excinfo):
+        self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True)
+
+    def pytest_unconfigure(self):
+        if hasattr(self, '_keyboardinterrupt_memo'):
+            self._report_keyboardinterrupt()
+
+    def _report_keyboardinterrupt(self):
+        excrepr = self._keyboardinterrupt_memo
+        msg = excrepr.reprcrash.message
+        self.write_sep("!", msg)
+        if "KeyboardInterrupt" in msg:
+            if self.config.option.fulltrace:
+                excrepr.toterminal(self._tw)
+            else:
+                self._tw.line("to show a full traceback on KeyboardInterrupt use --fulltrace", yellow=True)
+                excrepr.reprcrash.toterminal(self._tw)
+
+    def _locationline(self, nodeid, fspath, lineno, domain):
+        def mkrel(nodeid):
+            line = self.config.cwd_relative_nodeid(nodeid)
+            if domain and line.endswith(domain):
+                line = line[:-len(domain)]
+                l = domain.split("[")
+                l[0] = l[0].replace('.', '::')  # don't replace '.' in params
+                line += "[".join(l)
+            return line
+        # collect_fspath comes from testid which has a "/"-normalized path
+
+        if fspath:
+            res = mkrel(nodeid).replace("::()", "")  # parens-normalization
+            if nodeid.split("::")[0] != fspath.replace("\\", "/"):
+                res += " <- " + self.startdir.bestrelpath(fspath)
+        else:
+            res = "[location]"
+        return res + " "
+
+    def _getfailureheadline(self, rep):
+        if hasattr(rep, 'location'):
+            fspath, lineno, domain = rep.location
+            return domain
+        else:
+            return "test session" # XXX?
+
+    def _getcrashline(self, rep):
+        try:
+            return str(rep.longrepr.reprcrash)
+        except AttributeError:
+            try:
+                return str(rep.longrepr)[:50]
+            except AttributeError:
+                return ""
+
+    #
+    # summaries for sessionfinish
+    #
+    def getreports(self, name):
+        l = []
+        for x in self.stats.get(name, []):
+            if not hasattr(x, '_pdbshown'):
+                l.append(x)
+        return l
+
+    def summary_warnings(self):
+        if self.hasopt("w"):
+            warnings = self.stats.get("warnings")
+            if not warnings:
+                return
+            self.write_sep("=", "pytest-warning summary")
+            for w in warnings:
+                self._tw.line("W%s %s %s" % (w.code,
+                              w.fslocation, w.message))
+
+    def summary_passes(self):
+        if self.config.option.tbstyle != "no":
+            if self.hasopt("P"):
+                reports = self.getreports('passed')
+                if not reports:
+                    return
+                self.write_sep("=", "PASSES")
+                for rep in reports:
+                    msg = self._getfailureheadline(rep)
+                    self.write_sep("_", msg)
+                    self._outrep_summary(rep)
+
+    def summary_failures(self):
+        if self.config.option.tbstyle != "no":
+            reports = self.getreports('failed')
+            if not reports:
+                return
+            self.write_sep("=", "FAILURES")
+            for rep in reports:
+                if self.config.option.tbstyle == "line":
+                    line = self._getcrashline(rep)
+                    self.write_line(line)
+                else:
+                    msg = self._getfailureheadline(rep)
+                    markup = {'red': True, 'bold': True}
+                    self.write_sep("_", msg, **markup)
+                    self._outrep_summary(rep)
+
+    def summary_errors(self):
+        if self.config.option.tbstyle != "no":
+            reports = self.getreports('error')
+            if not reports:
+                return
+            self.write_sep("=", "ERRORS")
+            for rep in self.stats['error']:
+                msg = self._getfailureheadline(rep)
+                if not hasattr(rep, 'when'):
+                    # collect
+                    msg = "ERROR collecting " + msg
+                elif rep.when == "setup":
+                    msg = "ERROR at setup of " + msg
+                elif rep.when == "teardown":
+                    msg = "ERROR at teardown of " + msg
+                self.write_sep("_", msg)
+                self._outrep_summary(rep)
+
+    def _outrep_summary(self, rep):
+        rep.toterminal(self._tw)
+        for secname, content in rep.sections:
+            self._tw.sep("-", secname)
+            if content[-1:] == "\n":
+                content = content[:-1]
+            self._tw.line(content)
+
+    def summary_stats(self):
+        session_duration = time.time() - self._sessionstarttime
+        (line, color) = build_summary_stats_line(self.stats)
+        msg = "%s in %.2f seconds" % (line, session_duration)
+        markup = {color: True, 'bold': True}
+
+        if self.verbosity >= 0:
+            self.write_sep("=", msg, **markup)
+        if self.verbosity == -1:
+            self.write_line(msg, **markup)
+
+    def summary_deselected(self):
+        if 'deselected' in self.stats:
+            l = []
+            k = self.config.option.keyword
+            if k:
+                l.append("-k%s" % k)
+            m = self.config.option.markexpr
+            if m:
+                l.append("-m %r" % m)
+            if l:
+                self.write_sep("=", "%d tests deselected by %r" % (
+                    len(self.stats['deselected']), " ".join(l)), bold=True)
+
+def repr_pythonversion(v=None):
+    if v is None:
+        v = sys.version_info
+    try:
+        return "%s.%s.%s-%s-%s" % v
+    except (TypeError, ValueError):
+        return str(v)
+
+def flatten(l):
+    for x in l:
+        if isinstance(x, (list, tuple)):
+            for y in flatten(x):
+                yield y
+        else:
+            yield x
+
+def build_summary_stats_line(stats):
+    keys = ("failed passed skipped deselected "
+           "xfailed xpassed warnings error").split()
+    key_translation = {'warnings': 'pytest-warnings'}
+    unknown_key_seen = False
+    for key in stats.keys():
+        if key not in keys:
+            if key: # setup/teardown reports have an empty key, ignore them
+                keys.append(key)
+                unknown_key_seen = True
+    parts = []
+    for key in keys:
+        val = stats.get(key, None)
+        if val:
+            key_name = key_translation.get(key, key)
+            parts.append("%d %s" % (len(val), key_name))
+
+    if parts:
+        line = ", ".join(parts)
+    else:
+        line = "no tests ran"
+
+    if 'failed' in stats or 'error' in stats:
+        color = 'red'
+    elif 'warnings' in stats or unknown_key_seen:
+        color = 'yellow'
+    elif 'passed' in stats:
+        color = 'green'
+    else:
+        color = 'yellow'
+
+    return (line, color)
+
+
+def _plugin_nameversions(plugininfo):
+    l = []
+    for plugin, dist in plugininfo:
+        # gets us name and version!
+        name = '{dist.project_name}-{dist.version}'.format(dist=dist)
+        # questionable convenience, but it keeps things short
+        if name.startswith("pytest-"):
+            name = name[7:]
+        # we decided to print python package names
+        # they can have more than one plugin
+        if name not in l:
+            l.append(name)
+    return l
diff --git a/python/pytest/_pytest/tmpdir.py b/python/pytest/_pytest/tmpdir.py
new file mode 100644
index 000000000..ebc48dbe5
--- /dev/null
+++ b/python/pytest/_pytest/tmpdir.py
@@ -0,0 +1,123 @@
+""" support for providing temporary directories to test functions.  """
+import re
+
+import pytest
+import py
+from _pytest.monkeypatch import monkeypatch
+
+
+class TempdirFactory:
+    """Factory for temporary directories under the common base temp directory.
+
+    The base directory can be configured using the ``--basetemp`` option.
+    """
+
+    def __init__(self, config):
+        self.config = config
+        self.trace = config.trace.get("tmpdir")
+
+    def ensuretemp(self, string, dir=1):
+        """ (deprecated) return temporary directory path with
+            the given string as the trailing part.  It is usually
+            better to use the 'tmpdir' function argument which
+            provides an empty unique-per-test-invocation directory
+            and is guaranteed to be empty.
+        """
+        #py.log._apiwarn(">1.1", "use tmpdir function argument")
+        return self.getbasetemp().ensure(string, dir=dir)
+
+    def mktemp(self, basename, numbered=True):
+        """Create a subdirectory of the base temporary directory and return it.
+        If ``numbered``, ensure the directory is unique by adding a number
+        prefix greater than any existing one.
+        """
+        basetemp = self.getbasetemp()
+        if not numbered:
+            p = basetemp.mkdir(basename)
+        else:
+            p = py.path.local.make_numbered_dir(prefix=basename,
+                keep=0, rootdir=basetemp, lock_timeout=None)
+        self.trace("mktemp", p)
+        return p
+
+    def getbasetemp(self):
+        """ return base temporary directory. """
+        try:
+            return self._basetemp
+        except AttributeError:
+            basetemp = self.config.option.basetemp
+            if basetemp:
+                basetemp = py.path.local(basetemp)
+                if basetemp.check():
+                    basetemp.remove()
+                basetemp.mkdir()
+            else:
+                temproot = py.path.local.get_temproot()
+                user = get_user()
+                if user:
+                    # use a sub-directory in the temproot to speed-up
+                    # make_numbered_dir() call
+                    rootdir = temproot.join('pytest-of-%s' % user)
+                else:
+                    rootdir = temproot
+                rootdir.ensure(dir=1)
+                basetemp = py.path.local.make_numbered_dir(prefix='pytest-',
+                                                           rootdir=rootdir)
+            self._basetemp = t = basetemp.realpath()
+            self.trace("new basetemp", t)
+            return t
+
+    def finish(self):
+        self.trace("finish")
+
+
+def get_user():
+    """Return the current user name, or None if getuser() does not work
+    in the current environment (see #1010).
+    """
+    import getpass
+    try:
+        return getpass.getuser()
+    except (ImportError, KeyError):
+        return None
+
+# backward compatibility
+TempdirHandler = TempdirFactory
+
+
+def pytest_configure(config):
+    """Create a TempdirFactory and attach it to the config object.
+
+    This is to comply with existing plugins which expect the handler to be
+    available at pytest_configure time, but ideally should be moved entirely
+    to the tmpdir_factory session fixture.
+    """
+    mp = monkeypatch()
+    t = TempdirFactory(config)
+    config._cleanup.extend([mp.undo, t.finish])
+    mp.setattr(config, '_tmpdirhandler', t, raising=False)
+    mp.setattr(pytest, 'ensuretemp', t.ensuretemp, raising=False)
+
+
+@pytest.fixture(scope='session')
+def tmpdir_factory(request):
+    """Return a TempdirFactory instance for the test session.
+    """
+    return request.config._tmpdirhandler
+
+
+@pytest.fixture
+def tmpdir(request, tmpdir_factory):
+    """return a temporary directory path object
+    which is unique to each test function invocation,
+    created as a sub directory of the base temporary
+    directory.  The returned object is a `py.path.local`_
+    path object.
+    """
+    name = request.node.name
+    name = re.sub("[\W]", "_", name)
+    MAXVAL = 30
+    if len(name) > MAXVAL:
+        name = name[:MAXVAL]
+    x = tmpdir_factory.mktemp(name, numbered=True)
+    return x
diff --git a/python/pytest/_pytest/unittest.py b/python/pytest/_pytest/unittest.py
new file mode 100644
index 000000000..8120e94fb
--- /dev/null
+++ b/python/pytest/_pytest/unittest.py
@@ -0,0 +1,205 @@
+""" discovery and running of std-library "unittest" style tests. """
+from __future__ import absolute_import
+
+import sys
+import traceback
+
+import pytest
+# for transfering markers
+import _pytest._code
+from _pytest.python import transfer_markers
+from _pytest.skipping import MarkEvaluator
+
+
+def pytest_pycollect_makeitem(collector, name, obj):
+    # has unittest been imported and is obj a subclass of its TestCase?
+    try:
+        if not issubclass(obj, sys.modules["unittest"].TestCase):
+            return
+    except Exception:
+        return
+    # yes, so let's collect it
+    return UnitTestCase(name, parent=collector)
+
+
+class UnitTestCase(pytest.Class):
+    # marker for fixturemanger.getfixtureinfo()
+    # to declare that our children do not support funcargs
+    nofuncargs = True
+                                              
+    def setup(self):
+        cls = self.obj
+        if getattr(cls, '__unittest_skip__', False):
+            return  # skipped
+        setup = getattr(cls, 'setUpClass', None)
+        if setup is not None:
+            setup()
+        teardown = getattr(cls, 'tearDownClass', None)
+        if teardown is not None:
+            self.addfinalizer(teardown)
+        super(UnitTestCase, self).setup()
+
+    def collect(self):
+        from unittest import TestLoader
+        cls = self.obj
+        if not getattr(cls, "__test__", True):
+            return
+        self.session._fixturemanager.parsefactories(self, unittest=True)
+        loader = TestLoader()
+        module = self.getparent(pytest.Module).obj
+        foundsomething = False
+        for name in loader.getTestCaseNames(self.obj):
+            x = getattr(self.obj, name)
+            funcobj = getattr(x, 'im_func', x)
+            transfer_markers(funcobj, cls, module)
+            yield TestCaseFunction(name, parent=self)
+            foundsomething = True
+
+        if not foundsomething:
+            runtest = getattr(self.obj, 'runTest', None)
+            if runtest is not None:
+                ut = sys.modules.get("twisted.trial.unittest", None)
+                if ut is None or runtest != ut.TestCase.runTest:
+                    yield TestCaseFunction('runTest', parent=self)
+
+
+
+class TestCaseFunction(pytest.Function):
+    _excinfo = None
+
+    def setup(self):
+        self._testcase = self.parent.obj(self.name)
+        self._fix_unittest_skip_decorator()
+        self._obj = getattr(self._testcase, self.name)
+        if hasattr(self._testcase, 'setup_method'):
+            self._testcase.setup_method(self._obj)
+        if hasattr(self, "_request"):
+            self._request._fillfixtures()
+
+    def _fix_unittest_skip_decorator(self):
+        """
+        The @unittest.skip decorator calls functools.wraps(self._testcase)
+        The call to functools.wraps() fails unless self._testcase
+        has a __name__ attribute. This is usually automatically supplied
+        if the test is a function or method, but we need to add manually
+        here.
+
+        See issue #1169
+        """
+        if sys.version_info[0] == 2:
+            setattr(self._testcase, "__name__", self.name)
+
+    def teardown(self):
+        if hasattr(self._testcase, 'teardown_method'):
+            self._testcase.teardown_method(self._obj)
+
+    def startTest(self, testcase):
+        pass
+
+    def _addexcinfo(self, rawexcinfo):
+        # unwrap potential exception info (see twisted trial support below)
+        rawexcinfo = getattr(rawexcinfo, '_rawexcinfo', rawexcinfo)
+        try:
+            excinfo = _pytest._code.ExceptionInfo(rawexcinfo)
+        except TypeError:
+            try:
+                try:
+                    l = traceback.format_exception(*rawexcinfo)
+                    l.insert(0, "NOTE: Incompatible Exception Representation, "
+                        "displaying natively:\n\n")
+                    pytest.fail("".join(l), pytrace=False)
+                except (pytest.fail.Exception, KeyboardInterrupt):
+                    raise
+                except:
+                    pytest.fail("ERROR: Unknown Incompatible Exception "
+                        "representation:\n%r" %(rawexcinfo,), pytrace=False)
+            except KeyboardInterrupt:
+                raise
+            except pytest.fail.Exception:
+                excinfo = _pytest._code.ExceptionInfo()
+        self.__dict__.setdefault('_excinfo', []).append(excinfo)
+
+    def addError(self, testcase, rawexcinfo):
+        self._addexcinfo(rawexcinfo)
+    def addFailure(self, testcase, rawexcinfo):
+        self._addexcinfo(rawexcinfo)
+
+    def addSkip(self, testcase, reason):
+        try:
+            pytest.skip(reason)
+        except pytest.skip.Exception:
+            self._evalskip = MarkEvaluator(self, 'SkipTest')
+            self._evalskip.result = True
+            self._addexcinfo(sys.exc_info())
+
+    def addExpectedFailure(self, testcase, rawexcinfo, reason=""):
+        try:
+            pytest.xfail(str(reason))
+        except pytest.xfail.Exception:
+            self._addexcinfo(sys.exc_info())
+
+    def addUnexpectedSuccess(self, testcase, reason=""):
+        self._unexpectedsuccess = reason
+
+    def addSuccess(self, testcase):
+        pass
+
+    def stopTest(self, testcase):
+        pass
+
+    def runtest(self):
+        self._testcase(result=self)
+
+    def _prunetraceback(self, excinfo):
+        pytest.Function._prunetraceback(self, excinfo)
+        traceback = excinfo.traceback.filter(
+            lambda x:not x.frame.f_globals.get('__unittest'))
+        if traceback:
+            excinfo.traceback = traceback
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_runtest_makereport(item, call):
+    if isinstance(item, TestCaseFunction):
+        if item._excinfo:
+            call.excinfo = item._excinfo.pop(0)
+            try:
+                del call.result
+            except AttributeError:
+                pass
+
+# twisted trial support
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_runtest_protocol(item):
+    if isinstance(item, TestCaseFunction) and \
+       'twisted.trial.unittest' in sys.modules:
+        ut = sys.modules['twisted.python.failure']
+        Failure__init__ = ut.Failure.__init__
+        check_testcase_implements_trial_reporter()
+        def excstore(self, exc_value=None, exc_type=None, exc_tb=None,
+            captureVars=None):
+            if exc_value is None:
+                self._rawexcinfo = sys.exc_info()
+            else:
+                if exc_type is None:
+                    exc_type = type(exc_value)
+                self._rawexcinfo = (exc_type, exc_value, exc_tb)
+            try:
+                Failure__init__(self, exc_value, exc_type, exc_tb,
+                    captureVars=captureVars)
+            except TypeError:
+                Failure__init__(self, exc_value, exc_type, exc_tb)
+        ut.Failure.__init__ = excstore
+        yield
+        ut.Failure.__init__ = Failure__init__
+    else:
+        yield
+
+
+def check_testcase_implements_trial_reporter(done=[]):
+    if done:
+        return
+    from zope.interface import classImplements
+    from twisted.trial.itrial import IReporter
+    classImplements(TestCaseFunction, IReporter)
+    done.append(1)
diff --git a/python/pytest/_pytest/vendored_packages/README.md b/python/pytest/_pytest/vendored_packages/README.md
new file mode 100644
index 000000000..eab7c714f
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/README.md
@@ -0,0 +1,13 @@
+This directory vendors the `pluggy` module.
+
+For a more detailed discussion for the reasons to vendoring this 
+package, please see [this issue](https://github.com/pytest-dev/pytest/issues/944).
+
+To update the current version, execute:
+
+```
+$ pip install -U pluggy==<version> --no-compile --target=_pytest/vendored_packages
+```
+
+And commit the modified files. The `pluggy-<version>.dist-info` directory 
+created by `pip` should be ignored.
diff --git a/python/pytest/_pytest/vendored_packages/__init__.py b/python/pytest/_pytest/vendored_packages/__init__.py
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/__init__.py
diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/DESCRIPTION.rst b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/DESCRIPTION.rst
new file mode 100644
index 000000000..aa3bbf812
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/DESCRIPTION.rst
@@ -0,0 +1,10 @@
+Plugin registration and hook calling for Python
+===============================================
+
+This is the plugin manager as used by pytest but stripped
+of pytest specific details.
+
+During the 0.x series this plugin does not have much documentation
+except extensive docstrings in the pluggy.py module.
+
+
diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/METADATA b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/METADATA
new file mode 100644
index 000000000..ec81f0a6b
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/METADATA
@@ -0,0 +1,39 @@
+Metadata-Version: 2.0
+Name: pluggy
+Version: 0.3.1
+Summary: plugin and hook calling mechanisms for python
+Home-page: UNKNOWN
+Author: Holger Krekel
+Author-email: holger at merlinux.eu
+License: MIT license
+Platform: unix
+Platform: linux
+Platform: osx
+Platform: win32
+Classifier: Development Status :: 4 - Beta
+Classifier: Intended Audience :: Developers
+Classifier: License :: OSI Approved :: MIT License
+Classifier: Operating System :: POSIX
+Classifier: Operating System :: Microsoft :: Windows
+Classifier: Operating System :: MacOS :: MacOS X
+Classifier: Topic :: Software Development :: Testing
+Classifier: Topic :: Software Development :: Libraries
+Classifier: Topic :: Utilities
+Classifier: Programming Language :: Python :: 2
+Classifier: Programming Language :: Python :: 2.6
+Classifier: Programming Language :: Python :: 2.7
+Classifier: Programming Language :: Python :: 3
+Classifier: Programming Language :: Python :: 3.3
+Classifier: Programming Language :: Python :: 3.4
+Classifier: Programming Language :: Python :: 3.5
+
+Plugin registration and hook calling for Python
+===============================================
+
+This is the plugin manager as used by pytest but stripped
+of pytest specific details.
+
+During the 0.x series this plugin does not have much documentation
+except extensive docstrings in the pluggy.py module.
+
+
diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/RECORD b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/RECORD
new file mode 100644
index 000000000..9626673c4
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/RECORD
@@ -0,0 +1,8 @@
+pluggy.py,sha256=v_RfWzyW6DPU1cJu_EFoL_OHq3t13qloVdR6UaMCXQA,29862
+pluggy-0.3.1.dist-info/top_level.txt,sha256=xKSCRhai-v9MckvMuWqNz16c1tbsmOggoMSwTgcpYHE,7
+pluggy-0.3.1.dist-info/pbr.json,sha256=xX3s6__wOcAyF-AZJX1sdZyW6PUXT-FkfBlM69EEUCg,47
+pluggy-0.3.1.dist-info/RECORD,,
+pluggy-0.3.1.dist-info/metadata.json,sha256=nLKltOT78dMV-00uXD6Aeemp4xNsz2q59j6ORSDeLjw,1027
+pluggy-0.3.1.dist-info/METADATA,sha256=1b85Ho2u4iK30M099k7axMzcDDhLcIMb-A82JUJZnSo,1334
+pluggy-0.3.1.dist-info/WHEEL,sha256=AvR0WeTpDaxT645bl5FQxUK6NPsTls2ttpcGJg3j1Xg,110
+pluggy-0.3.1.dist-info/DESCRIPTION.rst,sha256=P5Akh1EdIBR6CeqtV2P8ZwpGSpZiTKPw0NyS7jEiD-g,306
diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/WHEEL b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/WHEEL
new file mode 100644
index 000000000..9dff69d86
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/WHEEL
@@ -0,0 +1,6 @@
+Wheel-Version: 1.0
+Generator: bdist_wheel (0.24.0)
+Root-Is-Purelib: true
+Tag: py2-none-any
+Tag: py3-none-any
+
diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/metadata.json b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/metadata.json
new file mode 100644
index 000000000..426a3a7ad
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/metadata.json
@@ -0,0 +1 @@
+{"license": "MIT license", "name": "pluggy", "metadata_version": "2.0", "generator": "bdist_wheel (0.24.0)", "summary": "plugin and hook calling mechanisms for python", "platform": "unix", "version": "0.3.1", "extensions": {"python.details": {"document_names": {"description": "DESCRIPTION.rst"}, "contacts": [{"role": "author", "email": "holger at merlinux.eu", "name": "Holger Krekel"}]}}, "classifiers": ["Development Status :: 4 - Beta", "Intended Audience :: Developers", "License :: OSI Approved :: MIT License", "Operating System :: POSIX", "Operating System :: Microsoft :: Windows", "Operating System :: MacOS :: MacOS X", "Topic :: Software Development :: Testing", "Topic :: Software Development :: Libraries", "Topic :: Utilities", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.6", "Programming Language :: Python :: 2.7", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.3", "Programming Language :: Python :: 3.4", "Programming Language :: Python :: 3.5"]}
\ No newline at end of file
diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/pbr.json b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/pbr.json
new file mode 100644
index 000000000..d6b798640
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/pbr.json
@@ -0,0 +1 @@
+{"is_release": false, "git_version": "7d4c9cd"}
\ No newline at end of file
diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/top_level.txt b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/top_level.txt
new file mode 100644
index 000000000..11bdb5c1f
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/top_level.txt
@@ -0,0 +1 @@
+pluggy
diff --git a/python/pytest/_pytest/vendored_packages/pluggy.py b/python/pytest/_pytest/vendored_packages/pluggy.py
new file mode 100644
index 000000000..2f848b23d
--- /dev/null
+++ b/python/pytest/_pytest/vendored_packages/pluggy.py
@@ -0,0 +1,777 @@
+"""
+PluginManager, basic initialization and tracing.
+
+pluggy is the cristallized core of plugin management as used
+by some 150 plugins for pytest.
+
+Pluggy uses semantic versioning. Breaking changes are only foreseen for
+Major releases (incremented X in "X.Y.Z").  If you want to use pluggy in
+your project you should thus use a dependency restriction like
+"pluggy>=0.1.0,<1.0" to avoid surprises.
+
+pluggy is concerned with hook specification, hook implementations and hook
+calling.  For any given hook specification a hook call invokes up to N implementations.
+A hook implementation can influence its position and type of execution:
+if attributed "tryfirst" or "trylast" it will be tried to execute
+first or last.  However, if attributed "hookwrapper" an implementation
+can wrap all calls to non-hookwrapper implementations.  A hookwrapper
+can thus execute some code ahead and after the execution of other hooks.
+
+Hook specification is done by way of a regular python function where
+both the function name and the names of all its arguments are significant.
+Each hook implementation function is verified against the original specification
+function, including the names of all its arguments.  To allow for hook specifications
+to evolve over the livetime of a project, hook implementations can
+accept less arguments.  One can thus add new arguments and semantics to
+a hook specification by adding another argument typically without breaking
+existing hook implementations.
+
+The chosen approach is meant to let a hook designer think carefuly about
+which objects are needed by an extension writer.  By contrast, subclass-based
+extension mechanisms often expose a lot more state and behaviour than needed,
+thus restricting future developments.
+
+Pluggy currently consists of functionality for:
+
+- a way to register new hook specifications.  Without a hook
+  specification no hook calling can be performed.
+
+- a registry of plugins which contain hook implementation functions.  It
+  is possible to register plugins for which a hook specification is not yet
+  known and validate all hooks when the system is in a more referentially
+  consistent state.  Setting an "optionalhook" attribution to a hook
+  implementation will avoid PluginValidationError's if a specification
+  is missing.  This allows to have optional integration between plugins.
+
+- a "hook" relay object from which you can launch 1:N calls to
+  registered hook implementation functions
+
+- a mechanism for ordering hook implementation functions
+
+- mechanisms for two different type of 1:N calls: "firstresult" for when
+  the call should stop when the first implementation returns a non-None result.
+  And the other (default) way of guaranteeing that all hook implementations
+  will be called and their non-None result collected.
+
+- mechanisms for "historic" extension points such that all newly
+  registered functions will receive all hook calls that happened
+  before their registration.
+
+- a mechanism for discovering plugin objects which are based on
+  setuptools based entry points.
+
+- a simple tracing mechanism, including tracing of plugin calls and
+  their arguments.
+
+"""
+import sys
+import inspect
+
+__version__ = '0.3.1'
+__all__ = ["PluginManager", "PluginValidationError",
+           "HookspecMarker", "HookimplMarker"]
+
+_py3 = sys.version_info > (3, 0)
+
+
+class HookspecMarker:
+    """ Decorator helper class for marking functions as hook specifications.
+
+    You can instantiate it with a project_name to get a decorator.
+    Calling PluginManager.add_hookspecs later will discover all marked functions
+    if the PluginManager uses the same project_name.
+    """
+
+    def __init__(self, project_name):
+        self.project_name = project_name
+
+    def __call__(self, function=None, firstresult=False, historic=False):
+        """ if passed a function, directly sets attributes on the function
+        which will make it discoverable to add_hookspecs().  If passed no
+        function, returns a decorator which can be applied to a function
+        later using the attributes supplied.
+
+        If firstresult is True the 1:N hook call (N being the number of registered
+        hook implementation functions) will stop at I<=N when the I'th function
+        returns a non-None result.
+
+        If historic is True calls to a hook will be memorized and replayed
+        on later registered plugins.
+
+        """
+        def setattr_hookspec_opts(func):
+            if historic and firstresult:
+                raise ValueError("cannot have a historic firstresult hook")
+            setattr(func, self.project_name + "_spec",
+                   dict(firstresult=firstresult, historic=historic))
+            return func
+
+        if function is not None:
+            return setattr_hookspec_opts(function)
+        else:
+            return setattr_hookspec_opts
+
+
+class HookimplMarker:
+    """ Decorator helper class for marking functions as hook implementations.
+
+    You can instantiate with a project_name to get a decorator.
+    Calling PluginManager.register later will discover all marked functions
+    if the PluginManager uses the same project_name.
+    """
+    def __init__(self, project_name):
+        self.project_name = project_name
+
+    def __call__(self, function=None, hookwrapper=False, optionalhook=False,
+                 tryfirst=False, trylast=False):
+
+        """ if passed a function, directly sets attributes on the function
+        which will make it discoverable to register().  If passed no function,
+        returns a decorator which can be applied to a function later using
+        the attributes supplied.
+
+        If optionalhook is True a missing matching hook specification will not result
+        in an error (by default it is an error if no matching spec is found).
+
+        If tryfirst is True this hook implementation will run as early as possible
+        in the chain of N hook implementations for a specfication.
+
+        If trylast is True this hook implementation will run as late as possible
+        in the chain of N hook implementations.
+
+        If hookwrapper is True the hook implementations needs to execute exactly
+        one "yield".  The code before the yield is run early before any non-hookwrapper
+        function is run.  The code after the yield is run after all non-hookwrapper
+        function have run.  The yield receives an ``_CallOutcome`` object representing
+        the exception or result outcome of the inner calls (including other hookwrapper
+        calls).
+
+        """
+        def setattr_hookimpl_opts(func):
+            setattr(func, self.project_name + "_impl",
+                   dict(hookwrapper=hookwrapper, optionalhook=optionalhook,
+                        tryfirst=tryfirst, trylast=trylast))
+            return func
+
+        if function is None:
+            return setattr_hookimpl_opts
+        else:
+            return setattr_hookimpl_opts(function)
+
+
+def normalize_hookimpl_opts(opts):
+    opts.setdefault("tryfirst", False)
+    opts.setdefault("trylast", False)
+    opts.setdefault("hookwrapper", False)
+    opts.setdefault("optionalhook", False)
+
+
+class _TagTracer:
+    def __init__(self):
+        self._tag2proc = {}
+        self.writer = None
+        self.indent = 0
+
+    def get(self, name):
+        return _TagTracerSub(self, (name,))
+
+    def format_message(self, tags, args):
+        if isinstance(args[-1], dict):
+            extra = args[-1]
+            args = args[:-1]
+        else:
+            extra = {}
+
+        content = " ".join(map(str, args))
+        indent = "  " * self.indent
+
+        lines = [
+            "%s%s [%s]\n" % (indent, content, ":".join(tags))
+        ]
+
+        for name, value in extra.items():
+            lines.append("%s    %s: %s\n" % (indent, name, value))
+        return lines
+
+    def processmessage(self, tags, args):
+        if self.writer is not None and args:
+            lines = self.format_message(tags, args)
+            self.writer(''.join(lines))
+        try:
+            self._tag2proc[tags](tags, args)
+        except KeyError:
+            pass
+
+    def setwriter(self, writer):
+        self.writer = writer
+
+    def setprocessor(self, tags, processor):
+        if isinstance(tags, str):
+            tags = tuple(tags.split(":"))
+        else:
+            assert isinstance(tags, tuple)
+        self._tag2proc[tags] = processor
+
+
+class _TagTracerSub:
+    def __init__(self, root, tags):
+        self.root = root
+        self.tags = tags
+
+    def __call__(self, *args):
+        self.root.processmessage(self.tags, args)
+
+    def setmyprocessor(self, processor):
+        self.root.setprocessor(self.tags, processor)
+
+    def get(self, name):
+        return self.__class__(self.root, self.tags + (name,))
+
+
+def _raise_wrapfail(wrap_controller, msg):
+    co = wrap_controller.gi_code
+    raise RuntimeError("wrap_controller at %r %s:%d %s" %
+                   (co.co_name, co.co_filename, co.co_firstlineno, msg))
+
+
+def _wrapped_call(wrap_controller, func):
+    """ Wrap calling to a function with a generator which needs to yield
+    exactly once.  The yield point will trigger calling the wrapped function
+    and return its _CallOutcome to the yield point.  The generator then needs
+    to finish (raise StopIteration) in order for the wrapped call to complete.
+    """
+    try:
+        next(wrap_controller)   # first yield
+    except StopIteration:
+        _raise_wrapfail(wrap_controller, "did not yield")
+    call_outcome = _CallOutcome(func)
+    try:
+        wrap_controller.send(call_outcome)
+        _raise_wrapfail(wrap_controller, "has second yield")
+    except StopIteration:
+        pass
+    return call_outcome.get_result()
+
+
+class _CallOutcome:
+    """ Outcome of a function call, either an exception or a proper result.
+    Calling the ``get_result`` method will return the result or reraise
+    the exception raised when the function was called. """
+    excinfo = None
+
+    def __init__(self, func):
+        try:
+            self.result = func()
+        except BaseException:
+            self.excinfo = sys.exc_info()
+
+    def force_result(self, result):
+        self.result = result
+        self.excinfo = None
+
+    def get_result(self):
+        if self.excinfo is None:
+            return self.result
+        else:
+            ex = self.excinfo
+            if _py3:
+                raise ex[1].with_traceback(ex[2])
+            _reraise(*ex)  # noqa
+
+if not _py3:
+    exec("""
+def _reraise(cls, val, tb):
+    raise cls, val, tb
+""")
+
+
+class _TracedHookExecution:
+    def __init__(self, pluginmanager, before, after):
+        self.pluginmanager = pluginmanager
+        self.before = before
+        self.after = after
+        self.oldcall = pluginmanager._inner_hookexec
+        assert not isinstance(self.oldcall, _TracedHookExecution)
+        self.pluginmanager._inner_hookexec = self
+
+    def __call__(self, hook, hook_impls, kwargs):
+        self.before(hook.name, hook_impls, kwargs)
+        outcome = _CallOutcome(lambda: self.oldcall(hook, hook_impls, kwargs))
+        self.after(outcome, hook.name, hook_impls, kwargs)
+        return outcome.get_result()
+
+    def undo(self):
+        self.pluginmanager._inner_hookexec = self.oldcall
+
+
+class PluginManager(object):
+    """ Core Pluginmanager class which manages registration
+    of plugin objects and 1:N hook calling.
+
+    You can register new hooks by calling ``addhooks(module_or_class)``.
+    You can register plugin objects (which contain hooks) by calling
+    ``register(plugin)``.  The Pluginmanager is initialized with a
+    prefix that is searched for in the names of the dict of registered
+    plugin objects.  An optional excludefunc allows to blacklist names which
+    are not considered as hooks despite a matching prefix.
+
+    For debugging purposes you can call ``enable_tracing()``
+    which will subsequently send debug information to the trace helper.
+    """
+
+    def __init__(self, project_name, implprefix=None):
+        """ if implprefix is given implementation functions
+        will be recognized if their name matches the implprefix. """
+        self.project_name = project_name
+        self._name2plugin = {}
+        self._plugin2hookcallers = {}
+        self._plugin_distinfo = []
+        self.trace = _TagTracer().get("pluginmanage")
+        self.hook = _HookRelay(self.trace.root.get("hook"))
+        self._implprefix = implprefix
+        self._inner_hookexec = lambda hook, methods, kwargs: \
+            _MultiCall(methods, kwargs, hook.spec_opts).execute()
+
+    def _hookexec(self, hook, methods, kwargs):
+        # called from all hookcaller instances.
+        # enable_tracing will set its own wrapping function at self._inner_hookexec
+        return self._inner_hookexec(hook, methods, kwargs)
+
+    def register(self, plugin, name=None):
+        """ Register a plugin and return its canonical name or None if the name
+        is blocked from registering.  Raise a ValueError if the plugin is already
+        registered. """
+        plugin_name = name or self.get_canonical_name(plugin)
+
+        if plugin_name in self._name2plugin or plugin in self._plugin2hookcallers:
+            if self._name2plugin.get(plugin_name, -1) is None:
+                return  # blocked plugin, return None to indicate no registration
+            raise ValueError("Plugin already registered: %s=%s\n%s" %
+                            (plugin_name, plugin, self._name2plugin))
+
+        # XXX if an error happens we should make sure no state has been
+        # changed at point of return
+        self._name2plugin[plugin_name] = plugin
+
+        # register matching hook implementations of the plugin
+        self._plugin2hookcallers[plugin] = hookcallers = []
+        for name in dir(plugin):
+            hookimpl_opts = self.parse_hookimpl_opts(plugin, name)
+            if hookimpl_opts is not None:
+                normalize_hookimpl_opts(hookimpl_opts)
+                method = getattr(plugin, name)
+                hookimpl = HookImpl(plugin, plugin_name, method, hookimpl_opts)
+                hook = getattr(self.hook, name, None)
+                if hook is None:
+                    hook = _HookCaller(name, self._hookexec)
+                    setattr(self.hook, name, hook)
+                elif hook.has_spec():
+                    self._verify_hook(hook, hookimpl)
+                    hook._maybe_apply_history(hookimpl)
+                hook._add_hookimpl(hookimpl)
+                hookcallers.append(hook)
+        return plugin_name
+
+    def parse_hookimpl_opts(self, plugin, name):
+        method = getattr(plugin, name)
+        res = getattr(method, self.project_name + "_impl", None)
+        if res is not None and not isinstance(res, dict):
+            # false positive
+            res = None
+        elif res is None and self._implprefix and name.startswith(self._implprefix):
+            res = {}
+        return res
+
+    def unregister(self, plugin=None, name=None):
+        """ unregister a plugin object and all its contained hook implementations
+        from internal data structures. """
+        if name is None:
+            assert plugin is not None, "one of name or plugin needs to be specified"
+            name = self.get_name(plugin)
+
+        if plugin is None:
+            plugin = self.get_plugin(name)
+
+        # if self._name2plugin[name] == None registration was blocked: ignore
+        if self._name2plugin.get(name):
+            del self._name2plugin[name]
+
+        for hookcaller in self._plugin2hookcallers.pop(plugin, []):
+            hookcaller._remove_plugin(plugin)
+
+        return plugin
+
+    def set_blocked(self, name):
+        """ block registrations of the given name, unregister if already registered. """
+        self.unregister(name=name)
+        self._name2plugin[name] = None
+
+    def is_blocked(self, name):
+        """ return True if the name blogs registering plugins of that name. """
+        return name in self._name2plugin and self._name2plugin[name] is None
+
+    def add_hookspecs(self, module_or_class):
+        """ add new hook specifications defined in the given module_or_class.
+        Functions are recognized if they have been decorated accordingly. """
+        names = []
+        for name in dir(module_or_class):
+            spec_opts = self.parse_hookspec_opts(module_or_class, name)
+            if spec_opts is not None:
+                hc = getattr(self.hook, name, None)
+                if hc is None:
+                    hc = _HookCaller(name, self._hookexec, module_or_class, spec_opts)
+                    setattr(self.hook, name, hc)
+                else:
+                    # plugins registered this hook without knowing the spec
+                    hc.set_specification(module_or_class, spec_opts)
+                    for hookfunction in (hc._wrappers + hc._nonwrappers):
+                        self._verify_hook(hc, hookfunction)
+                names.append(name)
+
+        if not names:
+            raise ValueError("did not find any %r hooks in %r" %
+                             (self.project_name, module_or_class))
+
+    def parse_hookspec_opts(self, module_or_class, name):
+        method = getattr(module_or_class, name)
+        return getattr(method, self.project_name + "_spec", None)
+
+    def get_plugins(self):
+        """ return the set of registered plugins. """
+        return set(self._plugin2hookcallers)
+
+    def is_registered(self, plugin):
+        """ Return True if the plugin is already registered. """
+        return plugin in self._plugin2hookcallers
+
+    def get_canonical_name(self, plugin):
+        """ Return canonical name for a plugin object. Note that a plugin
+        may be registered under a different name which was specified
+        by the caller of register(plugin, name). To obtain the name
+        of an registered plugin use ``get_name(plugin)`` instead."""
+        return getattr(plugin, "__name__", None) or str(id(plugin))
+
+    def get_plugin(self, name):
+        """ Return a plugin or None for the given name. """
+        return self._name2plugin.get(name)
+
+    def get_name(self, plugin):
+        """ Return name for registered plugin or None if not registered. """
+        for name, val in self._name2plugin.items():
+            if plugin == val:
+                return name
+
+    def _verify_hook(self, hook, hookimpl):
+        if hook.is_historic() and hookimpl.hookwrapper:
+            raise PluginValidationError(
+                "Plugin %r\nhook %r\nhistoric incompatible to hookwrapper" %
+                (hookimpl.plugin_name, hook.name))
+
+        for arg in hookimpl.argnames:
+            if arg not in hook.argnames:
+                raise PluginValidationError(
+                    "Plugin %r\nhook %r\nargument %r not available\n"
+                    "plugin definition: %s\n"
+                    "available hookargs: %s" %
+                    (hookimpl.plugin_name, hook.name, arg,
+                    _formatdef(hookimpl.function), ", ".join(hook.argnames)))
+
+    def check_pending(self):
+        """ Verify that all hooks which have not been verified against
+        a hook specification are optional, otherwise raise PluginValidationError"""
+        for name in self.hook.__dict__:
+            if name[0] != "_":
+                hook = getattr(self.hook, name)
+                if not hook.has_spec():
+                    for hookimpl in (hook._wrappers + hook._nonwrappers):
+                        if not hookimpl.optionalhook:
+                            raise PluginValidationError(
+                                "unknown hook %r in plugin %r" %
+                                (name, hookimpl.plugin))
+
+    def load_setuptools_entrypoints(self, entrypoint_name):
+        """ Load modules from querying the specified setuptools entrypoint name.
+        Return the number of loaded plugins. """
+        from pkg_resources import iter_entry_points, DistributionNotFound
+        for ep in iter_entry_points(entrypoint_name):
+            # is the plugin registered or blocked?
+            if self.get_plugin(ep.name) or self.is_blocked(ep.name):
+                continue
+            try:
+                plugin = ep.load()
+            except DistributionNotFound:
+                continue
+            self.register(plugin, name=ep.name)
+            self._plugin_distinfo.append((plugin, ep.dist))
+        return len(self._plugin_distinfo)
+
+    def list_plugin_distinfo(self):
+        """ return list of distinfo/plugin tuples for all setuptools registered
+        plugins. """
+        return list(self._plugin_distinfo)
+
+    def list_name_plugin(self):
+        """ return list of name/plugin pairs. """
+        return list(self._name2plugin.items())
+
+    def get_hookcallers(self, plugin):
+        """ get all hook callers for the specified plugin. """
+        return self._plugin2hookcallers.get(plugin)
+
+    def add_hookcall_monitoring(self, before, after):
+        """ add before/after tracing functions for all hooks
+        and return an undo function which, when called,
+        will remove the added tracers.
+
+        ``before(hook_name, hook_impls, kwargs)`` will be called ahead
+        of all hook calls and receive a hookcaller instance, a list
+        of HookImpl instances and the keyword arguments for the hook call.
+
+        ``after(outcome, hook_name, hook_impls, kwargs)`` receives the
+        same arguments as ``before`` but also a :py:class:`_CallOutcome`` object
+        which represents the result of the overall hook call.
+        """
+        return _TracedHookExecution(self, before, after).undo
+
+    def enable_tracing(self):
+        """ enable tracing of hook calls and return an undo function. """
+        hooktrace = self.hook._trace
+
+        def before(hook_name, methods, kwargs):
+            hooktrace.root.indent += 1
+            hooktrace(hook_name, kwargs)
+
+        def after(outcome, hook_name, methods, kwargs):
+            if outcome.excinfo is None:
+                hooktrace("finish", hook_name, "-->", outcome.result)
+            hooktrace.root.indent -= 1
+
+        return self.add_hookcall_monitoring(before, after)
+
+    def subset_hook_caller(self, name, remove_plugins):
+        """ Return a new _HookCaller instance for the named method
+        which manages calls to all registered plugins except the
+        ones from remove_plugins. """
+        orig = getattr(self.hook, name)
+        plugins_to_remove = [plug for plug in remove_plugins if hasattr(plug, name)]
+        if plugins_to_remove:
+            hc = _HookCaller(orig.name, orig._hookexec, orig._specmodule_or_class,
+                             orig.spec_opts)
+            for hookimpl in (orig._wrappers + orig._nonwrappers):
+                plugin = hookimpl.plugin
+                if plugin not in plugins_to_remove:
+                    hc._add_hookimpl(hookimpl)
+                    # we also keep track of this hook caller so it
+                    # gets properly removed on plugin unregistration
+                    self._plugin2hookcallers.setdefault(plugin, []).append(hc)
+            return hc
+        return orig
+
+
+class _MultiCall:
+    """ execute a call into multiple python functions/methods. """
+
+    # XXX note that the __multicall__ argument is supported only
+    # for pytest compatibility reasons.  It was never officially
+    # supported there and is explicitly deprecated since 2.8
+    # so we can remove it soon, allowing to avoid the below recursion
+    # in execute() and simplify/speed up the execute loop.
+
+    def __init__(self, hook_impls, kwargs, specopts={}):
+        self.hook_impls = hook_impls
+        self.kwargs = kwargs
+        self.kwargs["__multicall__"] = self
+        self.specopts = specopts
+
+    def execute(self):
+        all_kwargs = self.kwargs
+        self.results = results = []
+        firstresult = self.specopts.get("firstresult")
+
+        while self.hook_impls:
+            hook_impl = self.hook_impls.pop()
+            args = [all_kwargs[argname] for argname in hook_impl.argnames]
+            if hook_impl.hookwrapper:
+                return _wrapped_call(hook_impl.function(*args), self.execute)
+            res = hook_impl.function(*args)
+            if res is not None:
+                if firstresult:
+                    return res
+                results.append(res)
+
+        if not firstresult:
+            return results
+
+    def __repr__(self):
+        status = "%d meths" % (len(self.hook_impls),)
+        if hasattr(self, "results"):
+            status = ("%d results, " % len(self.results)) + status
+        return "<_MultiCall %s, kwargs=%r>" % (status, self.kwargs)
+
+
+def varnames(func, startindex=None):
+    """ return argument name tuple for a function, method, class or callable.
+
+    In case of a class, its "__init__" method is considered.
+    For methods the "self" parameter is not included unless you are passing
+    an unbound method with Python3 (which has no supports for unbound methods)
+    """
+    cache = getattr(func, "__dict__", {})
+    try:
+        return cache["_varnames"]
+    except KeyError:
+        pass
+    if inspect.isclass(func):
+        try:
+            func = func.__init__
+        except AttributeError:
+            return ()
+        startindex = 1
+    else:
+        if not inspect.isfunction(func) and not inspect.ismethod(func):
+            func = getattr(func, '__call__', func)
+        if startindex is None:
+            startindex = int(inspect.ismethod(func))
+
+    try:
+        rawcode = func.__code__
+    except AttributeError:
+        return ()
+    try:
+        x = rawcode.co_varnames[startindex:rawcode.co_argcount]
+    except AttributeError:
+        x = ()
+    else:
+        defaults = func.__defaults__
+        if defaults:
+            x = x[:-len(defaults)]
+    try:
+        cache["_varnames"] = x
+    except TypeError:
+        pass
+    return x
+
+
+class _HookRelay:
+    """ hook holder object for performing 1:N hook calls where N is the number
+    of registered plugins.
+
+    """
+
+    def __init__(self, trace):
+        self._trace = trace
+
+
+class _HookCaller(object):
+    def __init__(self, name, hook_execute, specmodule_or_class=None, spec_opts=None):
+        self.name = name
+        self._wrappers = []
+        self._nonwrappers = []
+        self._hookexec = hook_execute
+        if specmodule_or_class is not None:
+            assert spec_opts is not None
+            self.set_specification(specmodule_or_class, spec_opts)
+
+    def has_spec(self):
+        return hasattr(self, "_specmodule_or_class")
+
+    def set_specification(self, specmodule_or_class, spec_opts):
+        assert not self.has_spec()
+        self._specmodule_or_class = specmodule_or_class
+        specfunc = getattr(specmodule_or_class, self.name)
+        argnames = varnames(specfunc, startindex=inspect.isclass(specmodule_or_class))
+        assert "self" not in argnames  # sanity check
+        self.argnames = ["__multicall__"] + list(argnames)
+        self.spec_opts = spec_opts
+        if spec_opts.get("historic"):
+            self._call_history = []
+
+    def is_historic(self):
+        return hasattr(self, "_call_history")
+
+    def _remove_plugin(self, plugin):
+        def remove(wrappers):
+            for i, method in enumerate(wrappers):
+                if method.plugin == plugin:
+                    del wrappers[i]
+                    return True
+        if remove(self._wrappers) is None:
+            if remove(self._nonwrappers) is None:
+                raise ValueError("plugin %r not found" % (plugin,))
+
+    def _add_hookimpl(self, hookimpl):
+        if hookimpl.hookwrapper:
+            methods = self._wrappers
+        else:
+            methods = self._nonwrappers
+
+        if hookimpl.trylast:
+            methods.insert(0, hookimpl)
+        elif hookimpl.tryfirst:
+            methods.append(hookimpl)
+        else:
+            # find last non-tryfirst method
+            i = len(methods) - 1
+            while i >= 0 and methods[i].tryfirst:
+                i -= 1
+            methods.insert(i + 1, hookimpl)
+
+    def __repr__(self):
+        return "<_HookCaller %r>" % (self.name,)
+
+    def __call__(self, **kwargs):
+        assert not self.is_historic()
+        return self._hookexec(self, self._nonwrappers + self._wrappers, kwargs)
+
+    def call_historic(self, proc=None, kwargs=None):
+        self._call_history.append((kwargs or {}, proc))
+        # historizing hooks don't return results
+        self._hookexec(self, self._nonwrappers + self._wrappers, kwargs)
+
+    def call_extra(self, methods, kwargs):
+        """ Call the hook with some additional temporarily participating
+        methods using the specified kwargs as call parameters. """
+        old = list(self._nonwrappers), list(self._wrappers)
+        for method in methods:
+            opts = dict(hookwrapper=False, trylast=False, tryfirst=False)
+            hookimpl = HookImpl(None, "<temp>", method, opts)
+            self._add_hookimpl(hookimpl)
+        try:
+            return self(**kwargs)
+        finally:
+            self._nonwrappers, self._wrappers = old
+
+    def _maybe_apply_history(self, method):
+        if self.is_historic():
+            for kwargs, proc in self._call_history:
+                res = self._hookexec(self, [method], kwargs)
+                if res and proc is not None:
+                    proc(res[0])
+
+
+class HookImpl:
+    def __init__(self, plugin, plugin_name, function, hook_impl_opts):
+        self.function = function
+        self.argnames = varnames(self.function)
+        self.plugin = plugin
+        self.opts = hook_impl_opts
+        self.plugin_name = plugin_name
+        self.__dict__.update(hook_impl_opts)
+
+
+class PluginValidationError(Exception):
+    """ plugin failed validation. """
+
+
+if hasattr(inspect, 'signature'):
+    def _formatdef(func):
+        return "%s%s" % (
+            func.__name__,
+            str(inspect.signature(func))
+        )
+else:
+    def _formatdef(func):
+        return "%s%s" % (
+            func.__name__,
+            inspect.formatargspec(*inspect.getargspec(func))
+        )